From 151a2f902bbcda9052d95b51e1d7a8cbb5a84b65 Mon Sep 17 00:00:00 2001 From: "rui.zheng" Date: Sat, 29 Jul 2017 16:18:04 +0800 Subject: [PATCH] add QUIC support --- gost/client.go | 15 +- gost/examples/bench/cli.go | 19 +- gost/examples/bench/srv.go | 14 +- gost/examples/quic/quicc.go | 109 + gost/examples/quic/quics.go | 102 + gost/kcp.go | 25 +- gost/quic.go | 234 + gost/ssh.go | 3 +- vendor/github.com/davecgh/go-spew/LICENSE | 15 - .../github.com/davecgh/go-spew/spew/bypass.go | 152 - .../davecgh/go-spew/spew/bypasssafe.go | 38 - .../github.com/davecgh/go-spew/spew/common.go | 341 - .../github.com/davecgh/go-spew/spew/config.go | 306 - vendor/github.com/davecgh/go-spew/spew/doc.go | 202 - .../github.com/davecgh/go-spew/spew/dump.go | 509 -- .../github.com/davecgh/go-spew/spew/format.go | 419 - .../github.com/davecgh/go-spew/spew/spew.go | 148 - vendor/github.com/ginuerzh/pht/README.md | 2 +- vendor/github.com/golang/glog/README | 2 +- vendor/github.com/golang/glog/glog.go | 5 +- .../lucas-clemente/quic-go/Changelog.md | 17 + .../lucas-clemente/quic-go/README.md | 42 +- .../quic-go/ackhandler/interfaces.go | 13 +- .../quic-go/ackhandler/packet.go | 9 +- .../ackhandler/received_packet_handler.go | 45 +- .../ackhandler/received_packet_history.go | 2 +- .../quic-go/ackhandler/retransmittable.go | 38 + .../quic-go/ackhandler/sent_packet_handler.go | 367 +- .../lucas-clemente/quic-go/appveyor.yml | 8 +- .../lucas-clemente/quic-go/buffer_pool.go | 4 +- .../lucas-clemente/quic-go/client.go | 370 +- .../lucas-clemente/quic-go/codecov.yml | 4 +- .../quic-go/congestion/bandwidth.go | 4 - .../quic-go/congestion/congestion_vector.go | 12 - .../quic-go/congestion/cubic.go | 16 +- .../quic-go/congestion/cubic_sender.go | 21 +- .../quic-go/congestion/hybrid_slow_start.go | 2 +- .../quic-go/congestion/interface.go | 4 +- .../quic-go/congestion/prr_sender.go | 2 +- .../quic-go/congestion/rtt_stats.go | 2 +- .../github.com/lucas-clemente/quic-go/conn.go | 54 + .../quic-go/crypto/cert_chain.go | 71 +- .../quic-go/crypto/cert_compression.go | 6 +- .../quic-go/crypto/cert_manager.go | 7 +- .../quic-go/crypto/key_derivation.go | 2 +- .../quic-go/crypto/null_aead.go | 37 +- .../quic-go/crypto/source_address_token.go | 92 +- .../flowcontrol/flow_control_manager.go | 151 +- .../quic-go/flowcontrol/flow_controller.go | 124 +- .../quic-go/frames/ack_frame.go | 12 +- .../quic-go/frames/blocked_frame.go | 2 +- .../quic-go/frames/connection_close_frame.go | 2 +- .../quic-go/frames/goaway_frame.go | 2 +- .../lucas-clemente/quic-go/frames/log.go | 2 +- .../quic-go/frames/rst_stream_frame.go | 2 +- .../quic-go/frames/stop_waiting_frame.go | 5 +- .../quic-go/frames/stream_frame.go | 10 +- .../quic-go/frames/window_update_frame.go | 2 +- .../lucas-clemente/quic-go/h2quic/client.go | 193 +- .../quic-go/h2quic/request_body.go | 6 +- .../quic-go/h2quic/request_writer.go | 7 +- .../h2quic/response_setuncompressed.go | 9 - .../h2quic/response_setuncompressed_go16.go | 9 - .../quic-go/h2quic/response_writer.go | 15 +- .../quic-go/h2quic/roundtrip.go | 69 +- .../lucas-clemente/quic-go/h2quic/server.go | 111 +- .../connection_parameters_manager.go | 70 +- .../quic-go/handshake/crypto_setup_client.go | 218 +- .../handshake/crypto_setup_interface.go | 16 - .../quic-go/handshake/crypto_setup_server.go | 208 +- .../quic-go/handshake/ephermal_cache.go | 6 +- .../quic-go/handshake/handshake_message.go | 71 +- .../quic-go/handshake/interface.go | 24 + .../quic-go/handshake/server_config.go | 32 +- .../quic-go/handshake/server_config_client.go | 54 +- .../quic-go/handshake/stk_generator.go | 100 + .../lucas-clemente/quic-go/handshake/tags.go | 5 + .../lucas-clemente/quic-go/interface.go | 121 + .../quic-go/{ => internal}/utils/_gen.go | 0 .../{ => internal}/utils/atomic_bool.go | 0 .../utils/byteinterval_linkedlist.go | 0 .../{ => internal}/utils/connection_id.go | 2 +- .../quic-go/{ => internal}/utils/float16.go | 0 .../quic-go/{ => internal}/utils/host.go | 0 .../quic-go/internal/utils/log.go | 94 + .../quic-go/{ => internal}/utils/minmax.go | 0 .../{ => internal}/utils/packet_interval.go | 0 .../utils/packetinterval_linkedlist.go | 0 .../utils/streamframe_interval.go | 0 .../quic-go/internal/utils/timer.go | 43 + .../quic-go/{ => internal}/utils/utils.go | 0 .../lucas-clemente/quic-go/packet_packer.go | 318 +- .../lucas-clemente/quic-go/packet_unpacker.go | 28 +- .../quic-go/protocol/encryption_level.go | 18 +- .../quic-go/protocol/protocol.go | 27 +- .../quic-go/protocol/server_parameters.go | 46 +- .../quic-go/protocol/version.go | 72 +- .../lucas-clemente/quic-go/public_header.go | 45 +- .../lucas-clemente/quic-go/public_reset.go | 10 +- .../quic-go/qerr/error_codes.go | 3 + .../quic-go/qerr/errorcode_string.go | 6 +- .../lucas-clemente/quic-go/qerr/quic_error.go | 12 +- .../lucas-clemente/quic-go/server.go | 236 +- .../lucas-clemente/quic-go/session.go | 759 +- .../lucas-clemente/quic-go/stream.go | 178 +- .../quic-go/stream_frame_sorter.go | 140 +- .../lucas-clemente/quic-go/stream_framer.go | 36 +- .../lucas-clemente/quic-go/streams_map.go | 217 +- .../lucas-clemente/quic-go/udp_conn.go | 39 - .../lucas-clemente/quic-go/unpacked_packet.go | 27 - .../lucas-clemente/quic-go/utils/log.go | 70 - .../lucas-clemente/quic-go/utils/stream.go | 17 - vendor/github.com/pmezard/go-difflib/LICENSE | 27 - .../pmezard/go-difflib/difflib/difflib.go | 758 -- vendor/github.com/ryanuber/go-glob/glob.go | 25 +- vendor/github.com/stretchr/testify/LICENSE | 22 - .../testify/assert/assertion_format.go | 379 - .../testify/assert/assertion_format.go.tmpl | 4 - .../testify/assert/assertion_forward.go | 746 -- .../testify/assert/assertion_forward.go.tmpl | 4 - .../stretchr/testify/assert/assertions.go | 1208 --- .../github.com/stretchr/testify/assert/doc.go | 45 - .../stretchr/testify/assert/errors.go | 10 - .../testify/assert/forward_assertions.go | 16 - .../testify/assert/http_assertions.go | 127 - vendor/golang.org/x/crypto/blowfish/cipher.go | 2 +- vendor/golang.org/x/crypto/blowfish/const.go | 2 +- .../x/crypto/curve25519/const_amd64.h | 2 +- .../x/crypto/curve25519/const_amd64.s | 2 +- .../x/crypto/curve25519/cswap_amd64.s | 131 +- .../x/crypto/curve25519/curve25519.go | 23 +- vendor/golang.org/x/crypto/curve25519/doc.go | 2 +- .../x/crypto/curve25519/freeze_amd64.s | 2 +- .../x/crypto/curve25519/ladderstep_amd64.s | 2 +- .../x/crypto/curve25519/mul_amd64.s | 2 +- .../x/crypto/curve25519/square_amd64.s | 2 +- vendor/golang.org/x/crypto/ed25519/ed25519.go | 2 +- .../x/crypto/salsa20/salsa/salsa2020_amd64.s | 2 +- vendor/golang.org/x/crypto/salsa20/salsa20.go | 6 +- vendor/golang.org/x/crypto/ssh/certs.go | 36 +- vendor/golang.org/x/crypto/ssh/cipher.go | 4 +- vendor/golang.org/x/crypto/ssh/client.go | 56 +- vendor/golang.org/x/crypto/ssh/client_auth.go | 49 +- vendor/golang.org/x/crypto/ssh/common.go | 14 +- vendor/golang.org/x/crypto/ssh/connection.go | 2 +- vendor/golang.org/x/crypto/ssh/doc.go | 3 + vendor/golang.org/x/crypto/ssh/handshake.go | 53 +- vendor/golang.org/x/crypto/ssh/kex.go | 8 +- vendor/golang.org/x/crypto/ssh/keys.go | 143 +- vendor/golang.org/x/crypto/ssh/server.go | 104 +- vendor/golang.org/x/crypto/ssh/session.go | 20 + vendor/golang.org/x/crypto/ssh/streamlocal.go | 115 + vendor/golang.org/x/crypto/ssh/tcpip.go | 196 +- vendor/golang.org/x/crypto/twofish/twofish.go | 2 +- vendor/golang.org/x/net/bpf/constants.go | 3 + vendor/golang.org/x/net/bpf/instructions.go | 272 +- vendor/golang.org/x/net/http2/ciphers.go | 641 ++ .../x/net/http2/client_conn_pool.go | 2 +- vendor/golang.org/x/net/http2/databuffer.go | 146 + vendor/golang.org/x/net/http2/fixed_buffer.go | 60 - vendor/golang.org/x/net/http2/frame.go | 81 +- vendor/golang.org/x/net/http2/go16.go | 27 - vendor/golang.org/x/net/http2/go18.go | 6 +- vendor/golang.org/x/net/http2/hpack/encode.go | 29 +- vendor/golang.org/x/net/http2/hpack/hpack.go | 104 +- vendor/golang.org/x/net/http2/hpack/tables.go | 135 +- vendor/golang.org/x/net/http2/not_go16.go | 25 - vendor/golang.org/x/net/http2/pipe.go | 2 +- vendor/golang.org/x/net/http2/server.go | 245 +- vendor/golang.org/x/net/http2/transport.go | 9 +- vendor/golang.org/x/net/idna/idna.go | 672 +- vendor/golang.org/x/net/idna/punycode.go | 23 +- vendor/golang.org/x/net/idna/tables.go | 4477 ++++++++++ vendor/golang.org/x/net/idna/trie.go | 72 + vendor/golang.org/x/net/idna/trieval.go | 114 + vendor/golang.org/x/net/internal/iana/gen.go | 2 +- .../x/net/internal/netreflect/socket.go | 4 + .../x/net/internal/netreflect/socket_19.go | 37 + .../x/net/internal/netreflect/socket_posix.go | 1 + .../x/net/internal/netreflect/socket_stub.go | 1 + vendor/golang.org/x/net/ipv4/control.go | 2 +- vendor/golang.org/x/net/ipv4/control_bsd.go | 2 +- vendor/golang.org/x/net/ipv4/control_stub.go | 2 +- vendor/golang.org/x/net/ipv4/control_unix.go | 2 +- .../golang.org/x/net/ipv4/control_windows.go | 2 +- .../golang.org/x/net/ipv4/dgramopt_posix.go | 2 +- vendor/golang.org/x/net/ipv4/dgramopt_stub.go | 2 +- vendor/golang.org/x/net/ipv4/doc.go | 24 +- vendor/golang.org/x/net/ipv4/endpoint.go | 15 +- vendor/golang.org/x/net/ipv4/gen.go | 2 +- .../golang.org/x/net/ipv4/genericopt_posix.go | 2 +- .../golang.org/x/net/ipv4/genericopt_stub.go | 2 +- vendor/golang.org/x/net/ipv4/header.go | 2 +- vendor/golang.org/x/net/ipv4/helper.go | 2 +- vendor/golang.org/x/net/ipv4/icmp.go | 2 +- vendor/golang.org/x/net/ipv4/packet.go | 13 +- vendor/golang.org/x/net/ipv4/payload.go | 5 +- vendor/golang.org/x/net/ipv4/payload_cmsg.go | 10 +- .../golang.org/x/net/ipv4/payload_nocmsg.go | 10 +- .../golang.org/x/net/ipv4/sockopt_asmreq.go | 2 +- .../x/net/ipv4/sockopt_asmreq_posix.go | 2 +- .../x/net/ipv4/sockopt_asmreq_stub.go | 2 +- vendor/golang.org/x/net/ipv4/sockopt_posix.go | 2 +- vendor/golang.org/x/net/ipv4/sockopt_stub.go | 2 +- vendor/golang.org/x/net/ipv4/sys_darwin.go | 57 +- vendor/golang.org/x/net/ipv4/sys_windows.go | 1 + .../golang.org/x/net/ipv4/zsys_linux_mips.go | 146 + .../x/net/ipv4/zsys_linux_mipsle.go | 146 + vendor/golang.org/x/text/LICENSE | 27 + vendor/golang.org/x/text/PATENTS | 22 + .../x/text/secure/bidirule/bidirule.go | 342 + .../golang.org/x/text/transform/transform.go | 705 ++ vendor/golang.org/x/text/unicode/bidi/bidi.go | 198 + .../golang.org/x/text/unicode/bidi/bracket.go | 335 + vendor/golang.org/x/text/unicode/bidi/core.go | 1058 +++ vendor/golang.org/x/text/unicode/bidi/gen.go | 133 + .../x/text/unicode/bidi/gen_ranges.go | 57 + .../x/text/unicode/bidi/gen_trieval.go | 64 + vendor/golang.org/x/text/unicode/bidi/prop.go | 206 + .../golang.org/x/text/unicode/bidi/tables.go | 1779 ++++ .../golang.org/x/text/unicode/bidi/trieval.go | 60 + .../x/text/unicode/norm/composition.go | 508 ++ .../x/text/unicode/norm/forminfo.go | 259 + .../golang.org/x/text/unicode/norm/input.go | 109 + vendor/golang.org/x/text/unicode/norm/iter.go | 457 + .../x/text/unicode/norm/maketables.go | 976 +++ .../x/text/unicode/norm/normalize.go | 609 ++ .../x/text/unicode/norm/readwriter.go | 125 + .../golang.org/x/text/unicode/norm/tables.go | 7631 +++++++++++++++++ .../x/text/unicode/norm/transform.go | 88 + vendor/golang.org/x/text/unicode/norm/trie.go | 54 + .../golang.org/x/text/unicode/norm/triegen.go | 117 + vendor/vendor.json | 256 +- 233 files changed, 27733 insertions(+), 8465 deletions(-) create mode 100644 gost/examples/quic/quicc.go create mode 100644 gost/examples/quic/quics.go create mode 100644 gost/quic.go delete mode 100644 vendor/github.com/davecgh/go-spew/LICENSE delete mode 100644 vendor/github.com/davecgh/go-spew/spew/bypass.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/bypasssafe.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/common.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/config.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/doc.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/dump.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/format.go delete mode 100644 vendor/github.com/davecgh/go-spew/spew/spew.go create mode 100644 vendor/github.com/lucas-clemente/quic-go/Changelog.md create mode 100644 vendor/github.com/lucas-clemente/quic-go/ackhandler/retransmittable.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/congestion/congestion_vector.go create mode 100644 vendor/github.com/lucas-clemente/quic-go/conn.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed_go16.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_interface.go create mode 100644 vendor/github.com/lucas-clemente/quic-go/handshake/interface.go create mode 100644 vendor/github.com/lucas-clemente/quic-go/handshake/stk_generator.go create mode 100644 vendor/github.com/lucas-clemente/quic-go/interface.go rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/_gen.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/atomic_bool.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/byteinterval_linkedlist.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/connection_id.go (93%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/float16.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/host.go (100%) create mode 100644 vendor/github.com/lucas-clemente/quic-go/internal/utils/log.go rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/minmax.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/packet_interval.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/packetinterval_linkedlist.go (100%) rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/streamframe_interval.go (100%) create mode 100644 vendor/github.com/lucas-clemente/quic-go/internal/utils/timer.go rename vendor/github.com/lucas-clemente/quic-go/{ => internal}/utils/utils.go (100%) delete mode 100644 vendor/github.com/lucas-clemente/quic-go/udp_conn.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/unpacked_packet.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/utils/log.go delete mode 100644 vendor/github.com/lucas-clemente/quic-go/utils/stream.go delete mode 100644 vendor/github.com/pmezard/go-difflib/LICENSE delete mode 100644 vendor/github.com/pmezard/go-difflib/difflib/difflib.go delete mode 100644 vendor/github.com/stretchr/testify/LICENSE delete mode 100644 vendor/github.com/stretchr/testify/assert/assertion_format.go delete mode 100644 vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl delete mode 100644 vendor/github.com/stretchr/testify/assert/assertion_forward.go delete mode 100644 vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl delete mode 100644 vendor/github.com/stretchr/testify/assert/assertions.go delete mode 100644 vendor/github.com/stretchr/testify/assert/doc.go delete mode 100644 vendor/github.com/stretchr/testify/assert/errors.go delete mode 100644 vendor/github.com/stretchr/testify/assert/forward_assertions.go delete mode 100644 vendor/github.com/stretchr/testify/assert/http_assertions.go create mode 100644 vendor/golang.org/x/crypto/ssh/streamlocal.go create mode 100644 vendor/golang.org/x/net/http2/ciphers.go create mode 100644 vendor/golang.org/x/net/http2/databuffer.go delete mode 100644 vendor/golang.org/x/net/http2/fixed_buffer.go create mode 100644 vendor/golang.org/x/net/idna/tables.go create mode 100644 vendor/golang.org/x/net/idna/trie.go create mode 100644 vendor/golang.org/x/net/idna/trieval.go create mode 100644 vendor/golang.org/x/net/internal/netreflect/socket_19.go create mode 100644 vendor/golang.org/x/net/ipv4/zsys_linux_mips.go create mode 100644 vendor/golang.org/x/net/ipv4/zsys_linux_mipsle.go create mode 100644 vendor/golang.org/x/text/LICENSE create mode 100644 vendor/golang.org/x/text/PATENTS create mode 100644 vendor/golang.org/x/text/secure/bidirule/bidirule.go create mode 100644 vendor/golang.org/x/text/transform/transform.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/bidi.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/bracket.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/core.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/gen.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/gen_ranges.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/gen_trieval.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/prop.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/tables.go create mode 100644 vendor/golang.org/x/text/unicode/bidi/trieval.go create mode 100644 vendor/golang.org/x/text/unicode/norm/composition.go create mode 100644 vendor/golang.org/x/text/unicode/norm/forminfo.go create mode 100644 vendor/golang.org/x/text/unicode/norm/input.go create mode 100644 vendor/golang.org/x/text/unicode/norm/iter.go create mode 100644 vendor/golang.org/x/text/unicode/norm/maketables.go create mode 100644 vendor/golang.org/x/text/unicode/norm/normalize.go create mode 100644 vendor/golang.org/x/text/unicode/norm/readwriter.go create mode 100644 vendor/golang.org/x/text/unicode/norm/tables.go create mode 100644 vendor/golang.org/x/text/unicode/norm/transform.go create mode 100644 vendor/golang.org/x/text/unicode/norm/trie.go create mode 100644 vendor/golang.org/x/text/unicode/norm/triegen.go diff --git a/gost/client.go b/gost/client.go index 4d54a3e..ab85a25 100644 --- a/gost/client.go +++ b/gost/client.go @@ -120,13 +120,14 @@ func ChainDialOption(chain *Chain) DialOption { // HandshakeOptions describes the options for handshake. type HandshakeOptions struct { - Addr string - User *url.Userinfo - Timeout time.Duration - Interval time.Duration - TLSConfig *tls.Config - WSOptions *WSOptions - KCPConfig *KCPConfig + Addr string + User *url.Userinfo + Timeout time.Duration + Interval time.Duration + TLSConfig *tls.Config + WSOptions *WSOptions + KCPConfig *KCPConfig + QUICConfig *QUICConfig } // HandshakeOption allows a common way to set handshake options. diff --git a/gost/examples/bench/cli.go b/gost/examples/bench/cli.go index 0e6ef52..638b7fb 100644 --- a/gost/examples/bench/cli.go +++ b/gost/examples/bench/cli.go @@ -128,19 +128,30 @@ func main() { }, */ - // http+ssh + /* + // http+ssh + gost.Node{ + Addr: "127.0.0.1:12222", + Client: gost.NewClient( + gost.HTTPConnector(url.UserPassword("admin", "123456")), + gost.SSHTunnelTransporter(), + ), + }, + */ + + // http+quic gost.Node{ - Addr: "127.0.0.1:12222", + Addr: "localhost:6121", Client: gost.NewClient( gost.HTTPConnector(url.UserPassword("admin", "123456")), - gost.SSHTunnelTransporter(), + gost.QUICTransporter(nil), ), }, ) total := 0 for total < requests { - if total + concurrency > requests { + if total+concurrency > requests { concurrency = requests - total } startChan := make(chan struct{}) diff --git a/gost/examples/bench/srv.go b/gost/examples/bench/srv.go index bdba34d..c041363 100644 --- a/gost/examples/bench/srv.go +++ b/gost/examples/bench/srv.go @@ -40,7 +40,7 @@ func main() { // go sshForwardServer() go sshTunnelServer() // go http2Server() - + go quicServer() select {} } @@ -242,6 +242,18 @@ func http2Server() { log.Fatal(s.Serve(ln)) } +func quicServer() { + s := &gost.Server{} + s.Handle(gost.HTTPHandler( + gost.UsersHandlerOption(url.UserPassword("admin", "123456")), + )) + ln, err := gost.QUICListener("localhost:6121", &gost.QUICConfig{TLSConfig: tlsConfig()}) + if err != nil { + log.Fatal(err) + } + log.Fatal(s.Serve(ln)) +} + var ( rawCert = []byte(`-----BEGIN CERTIFICATE----- MIIC+jCCAeKgAwIBAgIRAMlREhz8Miu1FQozsxbeqyMwDQYJKoZIhvcNAQELBQAw diff --git a/gost/examples/quic/quicc.go b/gost/examples/quic/quicc.go new file mode 100644 index 0000000..145b97b --- /dev/null +++ b/gost/examples/quic/quicc.go @@ -0,0 +1,109 @@ +package main + +import ( + "crypto/tls" + "flag" + "log" + + "github.com/ginuerzh/gost/gost" +) + +var ( + laddr, faddr string + quiet bool +) + +func init() { + log.SetFlags(log.LstdFlags | log.Lshortfile) + + flag.StringVar(&laddr, "L", ":18080", "listen address") + flag.StringVar(&faddr, "F", ":6121", "forward address") + flag.BoolVar(&quiet, "q", false, "quiet mode") + flag.BoolVar(&gost.Debug, "d", false, "debug mode") + flag.Parse() + + if quiet { + gost.SetLogger(&gost.NopLogger{}) + } +} + +func main() { + chain := gost.NewChain( + gost.Node{ + Protocol: "socks5", + Transport: "quic", + Addr: faddr, + Client: gost.NewClient( + gost.SOCKS5Connector(nil), + gost.QUICTransporter(nil), + ), + }, + ) + + s := &gost.Server{} + s.Handle(gost.SOCKS5Handler( + gost.ChainHandlerOption(chain), + gost.TLSConfigHandlerOption(tlsConfig()), + )) + ln, err := gost.TCPListener(laddr) + if err != nil { + log.Fatal(err) + } + log.Fatal(s.Serve(ln)) +} + +var ( + rawCert = []byte(`-----BEGIN CERTIFICATE----- +MIIC+jCCAeKgAwIBAgIRAMlREhz8Miu1FQozsxbeqyMwDQYJKoZIhvcNAQELBQAw +EjEQMA4GA1UEChMHQWNtZSBDbzAeFw0xNzA1MTkwNTM5MDJaFw0xODA1MTkwNTM5 +MDJaMBIxEDAOBgNVBAoTB0FjbWUgQ28wggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw +ggEKAoIBAQCyfqvv0kDriciEAVIW6JaWYFCL9a19jj1wmAGmVGxV3kNsr01kpa6N +0EBqnrcy7WknhCt1d43CqhKtTcXgJ/J9phZVxlizb8sUB85hm+MvP0N3HCg3f0Jw +hLuMrPijS6xjyw0fKCK/p6OUYMIfo5cdqeZid2WV4Ozts5uRd6Dmy2kyBe8Zg1F4 +8YJGuTWZmL2L7uZUiPY4T3q9+1iucq3vUpxymVRi1BTXnTpx+C0GS8NNgeEmevHv +482vHM5DNflAQ+mvGZvBVduq/AfirCDnt2DIZm1DcZXLrY9F3EPrlRZexmAhCDGR +LIKnMmoGicBM11Aw1fDIfJAHynk43tjPAgMBAAGjSzBJMA4GA1UdDwEB/wQEAwIF +oDATBgNVHSUEDDAKBggrBgEFBQcDATAMBgNVHRMBAf8EAjAAMBQGA1UdEQQNMAuC +CWxvY2FsaG9zdDANBgkqhkiG9w0BAQsFAAOCAQEAAx8Lna8DcQv0bRB3L9i2+KRN +l/UhPCoFagxk1cZore4p0w+1m7OgigOoTpg5jh78DzVDhScZlgJ0bBVYp5rojeJS +cBDC9lCDcaXQfFmT5LykCAwIgw/gs+rw5Aq0y3D0m8CcqKosyZa9wnZ2cVy/+45w +emcSdboc65ueZScv38/W7aTUoVRcjyRUv0jv0zW0EPnnDlluVkeZo9spBhiTTwoj +b3zGODs6alTNIJwZIHNxxyOmfJPpVVp8BzGbMk7YBixSlZ/vbrrYV34TcSiy7J57 +lNNoVWM+OwiVk1+AEZfQDwaQfef5tsIkAZBUyITkkDKRhygtwM2110dejbEsgg== +-----END CERTIFICATE-----`) + rawKey = []byte(`-----BEGIN RSA PRIVATE KEY----- +MIIEpQIBAAKCAQEAsn6r79JA64nIhAFSFuiWlmBQi/WtfY49cJgBplRsVd5DbK9N +ZKWujdBAap63Mu1pJ4QrdXeNwqoSrU3F4CfyfaYWVcZYs2/LFAfOYZvjLz9Ddxwo +N39CcIS7jKz4o0usY8sNHygiv6ejlGDCH6OXHanmYndlleDs7bObkXeg5stpMgXv +GYNRePGCRrk1mZi9i+7mVIj2OE96vftYrnKt71KccplUYtQU1506cfgtBkvDTYHh +Jnrx7+PNrxzOQzX5QEPprxmbwVXbqvwH4qwg57dgyGZtQ3GVy62PRdxD65UWXsZg +IQgxkSyCpzJqBonATNdQMNXwyHyQB8p5ON7YzwIDAQABAoIBAQCG4doj3Apa8z+n +IShbT1+cOyQi34A+xOIA151Hh7xmFxN0afRd/iWt3JUQ/OcLgQRZbDM7DSD+3W5H +r+G7xfQkpwFxx/T3g58+f7ehYx+GcJQWyhxJ88zNIkBnyb4KCAE5WBOOW9IGajPe +yE9pgUGMlPsXpYoKfHIOHg+NGY1pWUGBfBNR2kGrbkpZMmyy5bGa8dyrwAFBFRru +kcmmKvate8UlbRspFtd4nR/GQLTBrcDJ1k1i1Su/4BpDuDeK6LPI8ZRePGqbdcxk +TS30lsdYozuGfjZ5Zu8lSIJ//+7RjfDg8r684dpWjpalq8Quen60ZrIs01CSbfyU +k8gOzTHhAoGBAOKhp41wXveegq+WylSXFyngm4bzF4dVdTRsSbJVk7NaOx1vCU6o +/xIHoGEQyLI6wF+EaHmY89/Qu6tSV97XyBbiKeskopv5iXS/BsWTHJ1VbCA1ZLmK +HgGllEkS0xfc9AdB7b6/K7LxAAQVKP3DtN6+6pSDZh9Sv2M1j0DbhkNbAoGBAMmg +HcMfExaaeskjHqyLudtKX+znwaIoumleOGuavohR4R+Fpk8Yv8Xhb5U7Yr4gk0vY +CFmhp1WAi6QMZ/8jePlKKXl3Ney827luoKiMczp2DoYE0t0u2Kw3LfkNKfjADZ7d +JI6xPJV9/X1erwjq+4UdKqrpOf05SY4nkBMcvr6dAoGAXzisvbDJNiFTp5Mj0Abr +pJzKvBjHegVeCXi2PkfWlzUCQYu1zWcURO8PY7k5mik1SuzHONAbJ578Oy+N3AOt +/m9oTXRHHmHqbzMUFU+KZlDN7XqBp7NwiCCZ/Vn7d7tOjP4Wdl68baL07sI1RupD +xJNS3LOY5PBPmc+XMRkLgKECgYEAgBNDlJSCrZMHeAjlDTncn53I/VXiPD2e3BvL +vx6W9UT9ueZN1GSmPO6M0MDeYmOS7VSXSUhUYQ28pkJzNTC1QbWITu4YxP7anBnX +1/kPoQ0pAJzDzVharlqGy3M/PBHTFRzogfO3xkY35ZFlokaR6uayGcr42Q+w16nt +7RYPXEkCgYEA3GQYirHnGZuQ952jMvduqnpgkJiSnr0fa+94Rwa1pAhxHLFMo5s4 +fqZOtqKPj2s5X1JR0VCey1ilCcaAhWeb3tXCpbYLZSbMtjtqwA6LUeGY+Xdupsjw +cfWIcOfHsIm2kP+RCxEnZf1XwiN9wyJeiUKlE0dqmx9j7F0Bm+7YDhI= +-----END RSA PRIVATE KEY-----`) +) + +func tlsConfig() *tls.Config { + cert, err := tls.X509KeyPair(rawCert, rawKey) + if err != nil { + panic(err) + } + return &tls.Config{Certificates: []tls.Certificate{cert}} +} diff --git a/gost/examples/quic/quics.go b/gost/examples/quic/quics.go new file mode 100644 index 0000000..d03f6f0 --- /dev/null +++ b/gost/examples/quic/quics.go @@ -0,0 +1,102 @@ +package main + +import ( + "crypto/tls" + "flag" + "log" + + "github.com/ginuerzh/gost/gost" +) + +var ( + laddr string + quiet bool +) + +func init() { + log.SetFlags(log.LstdFlags | log.Lshortfile) + + flag.StringVar(&laddr, "L", ":6121", "listen address") + flag.BoolVar(&quiet, "q", false, "quiet mode") + flag.BoolVar(&gost.Debug, "d", false, "debug mode") + + flag.Parse() + + if quiet { + gost.SetLogger(&gost.NopLogger{}) + } +} + +func main() { + quicServer() +} + +func quicServer() { + s := &gost.Server{} + s.Handle( + gost.SOCKS5Handler(gost.TLSConfigHandlerOption(tlsConfig())), + ) + + ln, err := gost.QUICListener(laddr, &gost.QUICConfig{TLSConfig: tlsConfig()}) + if err != nil { + log.Fatal(err) + } + log.Println("server listen on", laddr) + log.Fatal(s.Serve(ln)) +} + +var ( + rawCert = []byte(`-----BEGIN CERTIFICATE----- +MIIC+jCCAeKgAwIBAgIRAMlREhz8Miu1FQozsxbeqyMwDQYJKoZIhvcNAQELBQAw +EjEQMA4GA1UEChMHQWNtZSBDbzAeFw0xNzA1MTkwNTM5MDJaFw0xODA1MTkwNTM5 +MDJaMBIxEDAOBgNVBAoTB0FjbWUgQ28wggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAw +ggEKAoIBAQCyfqvv0kDriciEAVIW6JaWYFCL9a19jj1wmAGmVGxV3kNsr01kpa6N +0EBqnrcy7WknhCt1d43CqhKtTcXgJ/J9phZVxlizb8sUB85hm+MvP0N3HCg3f0Jw +hLuMrPijS6xjyw0fKCK/p6OUYMIfo5cdqeZid2WV4Ozts5uRd6Dmy2kyBe8Zg1F4 +8YJGuTWZmL2L7uZUiPY4T3q9+1iucq3vUpxymVRi1BTXnTpx+C0GS8NNgeEmevHv +482vHM5DNflAQ+mvGZvBVduq/AfirCDnt2DIZm1DcZXLrY9F3EPrlRZexmAhCDGR +LIKnMmoGicBM11Aw1fDIfJAHynk43tjPAgMBAAGjSzBJMA4GA1UdDwEB/wQEAwIF +oDATBgNVHSUEDDAKBggrBgEFBQcDATAMBgNVHRMBAf8EAjAAMBQGA1UdEQQNMAuC +CWxvY2FsaG9zdDANBgkqhkiG9w0BAQsFAAOCAQEAAx8Lna8DcQv0bRB3L9i2+KRN +l/UhPCoFagxk1cZore4p0w+1m7OgigOoTpg5jh78DzVDhScZlgJ0bBVYp5rojeJS +cBDC9lCDcaXQfFmT5LykCAwIgw/gs+rw5Aq0y3D0m8CcqKosyZa9wnZ2cVy/+45w +emcSdboc65ueZScv38/W7aTUoVRcjyRUv0jv0zW0EPnnDlluVkeZo9spBhiTTwoj +b3zGODs6alTNIJwZIHNxxyOmfJPpVVp8BzGbMk7YBixSlZ/vbrrYV34TcSiy7J57 +lNNoVWM+OwiVk1+AEZfQDwaQfef5tsIkAZBUyITkkDKRhygtwM2110dejbEsgg== +-----END CERTIFICATE-----`) + rawKey = []byte(`-----BEGIN RSA PRIVATE KEY----- +MIIEpQIBAAKCAQEAsn6r79JA64nIhAFSFuiWlmBQi/WtfY49cJgBplRsVd5DbK9N +ZKWujdBAap63Mu1pJ4QrdXeNwqoSrU3F4CfyfaYWVcZYs2/LFAfOYZvjLz9Ddxwo +N39CcIS7jKz4o0usY8sNHygiv6ejlGDCH6OXHanmYndlleDs7bObkXeg5stpMgXv +GYNRePGCRrk1mZi9i+7mVIj2OE96vftYrnKt71KccplUYtQU1506cfgtBkvDTYHh +Jnrx7+PNrxzOQzX5QEPprxmbwVXbqvwH4qwg57dgyGZtQ3GVy62PRdxD65UWXsZg +IQgxkSyCpzJqBonATNdQMNXwyHyQB8p5ON7YzwIDAQABAoIBAQCG4doj3Apa8z+n +IShbT1+cOyQi34A+xOIA151Hh7xmFxN0afRd/iWt3JUQ/OcLgQRZbDM7DSD+3W5H +r+G7xfQkpwFxx/T3g58+f7ehYx+GcJQWyhxJ88zNIkBnyb4KCAE5WBOOW9IGajPe +yE9pgUGMlPsXpYoKfHIOHg+NGY1pWUGBfBNR2kGrbkpZMmyy5bGa8dyrwAFBFRru +kcmmKvate8UlbRspFtd4nR/GQLTBrcDJ1k1i1Su/4BpDuDeK6LPI8ZRePGqbdcxk +TS30lsdYozuGfjZ5Zu8lSIJ//+7RjfDg8r684dpWjpalq8Quen60ZrIs01CSbfyU +k8gOzTHhAoGBAOKhp41wXveegq+WylSXFyngm4bzF4dVdTRsSbJVk7NaOx1vCU6o +/xIHoGEQyLI6wF+EaHmY89/Qu6tSV97XyBbiKeskopv5iXS/BsWTHJ1VbCA1ZLmK +HgGllEkS0xfc9AdB7b6/K7LxAAQVKP3DtN6+6pSDZh9Sv2M1j0DbhkNbAoGBAMmg +HcMfExaaeskjHqyLudtKX+znwaIoumleOGuavohR4R+Fpk8Yv8Xhb5U7Yr4gk0vY +CFmhp1WAi6QMZ/8jePlKKXl3Ney827luoKiMczp2DoYE0t0u2Kw3LfkNKfjADZ7d +JI6xPJV9/X1erwjq+4UdKqrpOf05SY4nkBMcvr6dAoGAXzisvbDJNiFTp5Mj0Abr +pJzKvBjHegVeCXi2PkfWlzUCQYu1zWcURO8PY7k5mik1SuzHONAbJ578Oy+N3AOt +/m9oTXRHHmHqbzMUFU+KZlDN7XqBp7NwiCCZ/Vn7d7tOjP4Wdl68baL07sI1RupD +xJNS3LOY5PBPmc+XMRkLgKECgYEAgBNDlJSCrZMHeAjlDTncn53I/VXiPD2e3BvL +vx6W9UT9ueZN1GSmPO6M0MDeYmOS7VSXSUhUYQ28pkJzNTC1QbWITu4YxP7anBnX +1/kPoQ0pAJzDzVharlqGy3M/PBHTFRzogfO3xkY35ZFlokaR6uayGcr42Q+w16nt +7RYPXEkCgYEA3GQYirHnGZuQ952jMvduqnpgkJiSnr0fa+94Rwa1pAhxHLFMo5s4 +fqZOtqKPj2s5X1JR0VCey1ilCcaAhWeb3tXCpbYLZSbMtjtqwA6LUeGY+Xdupsjw +cfWIcOfHsIm2kP+RCxEnZf1XwiN9wyJeiUKlE0dqmx9j7F0Bm+7YDhI= +-----END RSA PRIVATE KEY-----`) +) + +func tlsConfig() *tls.Config { + cert, err := tls.X509KeyPair(rawCert, rawKey) + if err != nil { + panic(err) + } + return &tls.Config{Certificates: []tls.Certificate{cert}} +} diff --git a/gost/kcp.go b/gost/kcp.go index ecda95e..ed6cf70 100644 --- a/gost/kcp.go +++ b/gost/kcp.go @@ -351,18 +351,6 @@ func (l *kcpListener) listenLoop() { } } -func (l *kcpListener) Accept() (conn net.Conn, err error) { - var ok bool - select { - case conn = <-l.connChan: - case err, ok = <-l.errChan: - if !ok { - err = errors.New("accpet on closed listener") - } - } - return -} - func (l *kcpListener) mux(conn net.Conn) { smuxConfig := smux.DefaultConfig() smuxConfig.MaxReceiveBuffer = l.config.SockBuf @@ -393,11 +381,22 @@ func (l *kcpListener) mux(conn net.Conn) { select { case l.connChan <- newKCPConn(conn, stream): default: - log.Logf("[kcp] %s - %s: connection queue is full", conn.RemoteAddr(), l.Addr()) + log.Logf("[kcp] %s - %s: connection queue is full", conn.RemoteAddr(), conn.LocalAddr()) } } } +func (l *kcpListener) Accept() (conn net.Conn, err error) { + var ok bool + select { + case conn = <-l.connChan: + case err, ok = <-l.errChan: + if !ok { + err = errors.New("accpet on closed listener") + } + } + return +} func (l *kcpListener) Addr() net.Addr { return l.ln.Addr() } diff --git a/gost/quic.go b/gost/quic.go new file mode 100644 index 0000000..a82d08a --- /dev/null +++ b/gost/quic.go @@ -0,0 +1,234 @@ +package gost + +import ( + "crypto/tls" + "errors" + "net" + "sync" + "time" + + "github.com/go-log/log" + quic "github.com/lucas-clemente/quic-go" +) + +type quicSession struct { + conn net.Conn + session quic.Session +} + +func (session *quicSession) GetConn() (*quicConn, error) { + stream, err := session.session.OpenStream() + if err != nil { + return nil, err + } + return &quicConn{ + Stream: stream, + laddr: session.session.LocalAddr(), + raddr: session.session.RemoteAddr(), + }, nil +} + +func (session *quicSession) Close() error { + return session.session.Close(nil) +} + +type quicTransporter struct { + config *QUICConfig + sessionMutex sync.Mutex + sessions map[string]*quicSession +} + +// QUICTransporter creates a Transporter that is used by QUIC proxy client. +func QUICTransporter(config *QUICConfig) Transporter { + if config == nil { + config = &QUICConfig{} + } + return &quicTransporter{ + config: config, + sessions: make(map[string]*quicSession), + } +} + +func (tr *quicTransporter) Dial(addr string, options ...DialOption) (conn net.Conn, err error) { + tr.sessionMutex.Lock() + defer tr.sessionMutex.Unlock() + + session, ok := tr.sessions[addr] + if !ok { + conn, err = net.ListenUDP("udp", &net.UDPAddr{IP: net.IPv4zero, Port: 0}) + if err != nil { + return + } + session = &quicSession{conn: conn} + tr.sessions[addr] = session + } + return session.conn, nil +} + +func (tr *quicTransporter) Handshake(conn net.Conn, options ...HandshakeOption) (net.Conn, error) { + opts := &HandshakeOptions{} + for _, option := range options { + option(opts) + } + config := tr.config + if opts.QUICConfig != nil { + config = opts.QUICConfig + } + if config.TLSConfig == nil { + config.TLSConfig = &tls.Config{InsecureSkipVerify: true} + } + + tr.sessionMutex.Lock() + defer tr.sessionMutex.Unlock() + + session, ok := tr.sessions[opts.Addr] + if session != nil && session.conn != conn { + conn.Close() + return nil, errors.New("quic: unrecognized connection") + } + if !ok || session.session == nil { + s, err := tr.initSession(opts.Addr, conn, config) + if err != nil { + conn.Close() + delete(tr.sessions, opts.Addr) + return nil, err + } + session = s + tr.sessions[opts.Addr] = session + } + cc, err := session.GetConn() + if err != nil { + session.Close() + delete(tr.sessions, opts.Addr) + return nil, err + } + + return cc, nil +} + +func (tr *quicTransporter) initSession(addr string, conn net.Conn, config *QUICConfig) (*quicSession, error) { + udpConn, ok := conn.(*net.UDPConn) + if !ok { + return nil, errors.New("quic: wrong connection type") + } + udpAddr, err := net.ResolveUDPAddr("udp", addr) + if err != nil { + return nil, err + } + quicConfig := &quic.Config{ + HandshakeTimeout: config.Timeout, + KeepAlive: config.KeepAlive, + } + session, err := quic.Dial(udpConn, udpAddr, addr, config.TLSConfig, quicConfig) + if err != nil { + log.Log("quic dial", err) + return nil, err + } + return &quicSession{conn: conn, session: session}, nil +} + +func (tr *quicTransporter) Multiplex() bool { + return true +} + +type QUICConfig struct { + TLSConfig *tls.Config + Timeout time.Duration + KeepAlive bool +} + +type quicListener struct { + ln quic.Listener + connChan chan net.Conn + errChan chan error +} + +// QUICListener creates a Listener for QUIC proxy server. +func QUICListener(addr string, config *QUICConfig) (Listener, error) { + if config == nil { + config = &QUICConfig{} + } + quicConfig := &quic.Config{ + HandshakeTimeout: config.Timeout, + KeepAlive: config.KeepAlive, + } + + ln, err := quic.ListenAddr(addr, config.TLSConfig, quicConfig) + if err != nil { + return nil, err + } + + l := &quicListener{ + ln: ln, + connChan: make(chan net.Conn, 1024), + errChan: make(chan error, 1), + } + go l.listenLoop() + + return l, nil +} + +func (l *quicListener) listenLoop() { + for { + session, err := l.ln.Accept() + if err != nil { + log.Log("[quic] accept:", err) + l.errChan <- err + close(l.errChan) + return + } + go l.sessionLoop(session) + } +} + +func (l *quicListener) sessionLoop(session quic.Session) { + log.Logf("[quic] %s <-> %s", session.RemoteAddr(), session.LocalAddr()) + defer log.Logf("[quic] %s >-< %s", session.RemoteAddr(), session.LocalAddr()) + + for { + stream, err := session.AcceptStream() + if err != nil { + log.Log("[quic] accept stream:", err) + return + } + select { + case l.connChan <- &quicConn{Stream: stream, laddr: session.LocalAddr(), raddr: session.RemoteAddr()}: + default: + log.Logf("[quic] %s - %s: connection queue is full", session.RemoteAddr(), session.LocalAddr()) + } + } +} + +func (l *quicListener) Accept() (conn net.Conn, err error) { + var ok bool + select { + case conn = <-l.connChan: + case err, ok = <-l.errChan: + if !ok { + err = errors.New("accpet on closed listener") + } + } + return +} + +func (l *quicListener) Addr() net.Addr { + return l.ln.Addr() +} + +func (l *quicListener) Close() error { + return l.ln.Close() +} + +type quicConn struct { + quic.Stream + laddr net.Addr + raddr net.Addr +} + +func (c *quicConn) LocalAddr() net.Addr { + return c.laddr +} + +func (c *quicConn) RemoteAddr() net.Addr { + return c.raddr +} diff --git a/gost/ssh.go b/gost/ssh.go index 27d60cd..68528d9 100644 --- a/gost/ssh.go +++ b/gost/ssh.go @@ -172,7 +172,8 @@ func (tr *sshTunnelTransporter) Handshake(conn net.Conn, options ...HandshakeOpt } config := ssh.ClientConfig{ - Timeout: opts.Timeout, + Timeout: opts.Timeout, + HostKeyCallback: ssh.InsecureIgnoreHostKey(), } if opts.User != nil { config.User = opts.User.Username() diff --git a/vendor/github.com/davecgh/go-spew/LICENSE b/vendor/github.com/davecgh/go-spew/LICENSE deleted file mode 100644 index bb67332..0000000 --- a/vendor/github.com/davecgh/go-spew/LICENSE +++ /dev/null @@ -1,15 +0,0 @@ -ISC License - -Copyright (c) 2012-2013 Dave Collins - -Permission to use, copy, modify, and distribute this software for any -purpose with or without fee is hereby granted, provided that the above -copyright notice and this permission notice appear in all copies. - -THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES -WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF -MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR -ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES -WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN -ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF -OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/vendor/github.com/davecgh/go-spew/spew/bypass.go b/vendor/github.com/davecgh/go-spew/spew/bypass.go deleted file mode 100644 index d42a0bc..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/bypass.go +++ /dev/null @@ -1,152 +0,0 @@ -// Copyright (c) 2015 Dave Collins -// -// Permission to use, copy, modify, and distribute this software for any -// purpose with or without fee is hereby granted, provided that the above -// copyright notice and this permission notice appear in all copies. -// -// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES -// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF -// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR -// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES -// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN -// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF -// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - -// NOTE: Due to the following build constraints, this file will only be compiled -// when the code is not running on Google App Engine, compiled by GopherJS, and -// "-tags safe" is not added to the go build command line. The "disableunsafe" -// tag is deprecated and thus should not be used. -// +build !js,!appengine,!safe,!disableunsafe - -package spew - -import ( - "reflect" - "unsafe" -) - -const ( - // UnsafeDisabled is a build-time constant which specifies whether or - // not access to the unsafe package is available. - UnsafeDisabled = false - - // ptrSize is the size of a pointer on the current arch. - ptrSize = unsafe.Sizeof((*byte)(nil)) -) - -var ( - // offsetPtr, offsetScalar, and offsetFlag are the offsets for the - // internal reflect.Value fields. These values are valid before golang - // commit ecccf07e7f9d which changed the format. The are also valid - // after commit 82f48826c6c7 which changed the format again to mirror - // the original format. Code in the init function updates these offsets - // as necessary. - offsetPtr = uintptr(ptrSize) - offsetScalar = uintptr(0) - offsetFlag = uintptr(ptrSize * 2) - - // flagKindWidth and flagKindShift indicate various bits that the - // reflect package uses internally to track kind information. - // - // flagRO indicates whether or not the value field of a reflect.Value is - // read-only. - // - // flagIndir indicates whether the value field of a reflect.Value is - // the actual data or a pointer to the data. - // - // These values are valid before golang commit 90a7c3c86944 which - // changed their positions. Code in the init function updates these - // flags as necessary. - flagKindWidth = uintptr(5) - flagKindShift = uintptr(flagKindWidth - 1) - flagRO = uintptr(1 << 0) - flagIndir = uintptr(1 << 1) -) - -func init() { - // Older versions of reflect.Value stored small integers directly in the - // ptr field (which is named val in the older versions). Versions - // between commits ecccf07e7f9d and 82f48826c6c7 added a new field named - // scalar for this purpose which unfortunately came before the flag - // field, so the offset of the flag field is different for those - // versions. - // - // This code constructs a new reflect.Value from a known small integer - // and checks if the size of the reflect.Value struct indicates it has - // the scalar field. When it does, the offsets are updated accordingly. - vv := reflect.ValueOf(0xf00) - if unsafe.Sizeof(vv) == (ptrSize * 4) { - offsetScalar = ptrSize * 2 - offsetFlag = ptrSize * 3 - } - - // Commit 90a7c3c86944 changed the flag positions such that the low - // order bits are the kind. This code extracts the kind from the flags - // field and ensures it's the correct type. When it's not, the flag - // order has been changed to the newer format, so the flags are updated - // accordingly. - upf := unsafe.Pointer(uintptr(unsafe.Pointer(&vv)) + offsetFlag) - upfv := *(*uintptr)(upf) - flagKindMask := uintptr((1<>flagKindShift != uintptr(reflect.Int) { - flagKindShift = 0 - flagRO = 1 << 5 - flagIndir = 1 << 6 - - // Commit adf9b30e5594 modified the flags to separate the - // flagRO flag into two bits which specifies whether or not the - // field is embedded. This causes flagIndir to move over a bit - // and means that flagRO is the combination of either of the - // original flagRO bit and the new bit. - // - // This code detects the change by extracting what used to be - // the indirect bit to ensure it's set. When it's not, the flag - // order has been changed to the newer format, so the flags are - // updated accordingly. - if upfv&flagIndir == 0 { - flagRO = 3 << 5 - flagIndir = 1 << 7 - } - } -} - -// unsafeReflectValue converts the passed reflect.Value into a one that bypasses -// the typical safety restrictions preventing access to unaddressable and -// unexported data. It works by digging the raw pointer to the underlying -// value out of the protected value and generating a new unprotected (unsafe) -// reflect.Value to it. -// -// This allows us to check for implementations of the Stringer and error -// interfaces to be used for pretty printing ordinarily unaddressable and -// inaccessible values such as unexported struct fields. -func unsafeReflectValue(v reflect.Value) (rv reflect.Value) { - indirects := 1 - vt := v.Type() - upv := unsafe.Pointer(uintptr(unsafe.Pointer(&v)) + offsetPtr) - rvf := *(*uintptr)(unsafe.Pointer(uintptr(unsafe.Pointer(&v)) + offsetFlag)) - if rvf&flagIndir != 0 { - vt = reflect.PtrTo(v.Type()) - indirects++ - } else if offsetScalar != 0 { - // The value is in the scalar field when it's not one of the - // reference types. - switch vt.Kind() { - case reflect.Uintptr: - case reflect.Chan: - case reflect.Func: - case reflect.Map: - case reflect.Ptr: - case reflect.UnsafePointer: - default: - upv = unsafe.Pointer(uintptr(unsafe.Pointer(&v)) + - offsetScalar) - } - } - - pv := reflect.NewAt(vt, upv) - rv = pv - for i := 0; i < indirects; i++ { - rv = rv.Elem() - } - return rv -} diff --git a/vendor/github.com/davecgh/go-spew/spew/bypasssafe.go b/vendor/github.com/davecgh/go-spew/spew/bypasssafe.go deleted file mode 100644 index e47a4e7..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/bypasssafe.go +++ /dev/null @@ -1,38 +0,0 @@ -// Copyright (c) 2015 Dave Collins -// -// Permission to use, copy, modify, and distribute this software for any -// purpose with or without fee is hereby granted, provided that the above -// copyright notice and this permission notice appear in all copies. -// -// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES -// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF -// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR -// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES -// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN -// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF -// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - -// NOTE: Due to the following build constraints, this file will only be compiled -// when the code is running on Google App Engine, compiled by GopherJS, or -// "-tags safe" is added to the go build command line. The "disableunsafe" -// tag is deprecated and thus should not be used. -// +build js appengine safe disableunsafe - -package spew - -import "reflect" - -const ( - // UnsafeDisabled is a build-time constant which specifies whether or - // not access to the unsafe package is available. - UnsafeDisabled = true -) - -// unsafeReflectValue typically converts the passed reflect.Value into a one -// that bypasses the typical safety restrictions preventing access to -// unaddressable and unexported data. However, doing this relies on access to -// the unsafe package. This is a stub version which simply returns the passed -// reflect.Value when the unsafe package is not available. -func unsafeReflectValue(v reflect.Value) reflect.Value { - return v -} diff --git a/vendor/github.com/davecgh/go-spew/spew/common.go b/vendor/github.com/davecgh/go-spew/spew/common.go deleted file mode 100644 index 14f02dc..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/common.go +++ /dev/null @@ -1,341 +0,0 @@ -/* - * Copyright (c) 2013 Dave Collins - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -package spew - -import ( - "bytes" - "fmt" - "io" - "reflect" - "sort" - "strconv" -) - -// Some constants in the form of bytes to avoid string overhead. This mirrors -// the technique used in the fmt package. -var ( - panicBytes = []byte("(PANIC=") - plusBytes = []byte("+") - iBytes = []byte("i") - trueBytes = []byte("true") - falseBytes = []byte("false") - interfaceBytes = []byte("(interface {})") - commaNewlineBytes = []byte(",\n") - newlineBytes = []byte("\n") - openBraceBytes = []byte("{") - openBraceNewlineBytes = []byte("{\n") - closeBraceBytes = []byte("}") - asteriskBytes = []byte("*") - colonBytes = []byte(":") - colonSpaceBytes = []byte(": ") - openParenBytes = []byte("(") - closeParenBytes = []byte(")") - spaceBytes = []byte(" ") - pointerChainBytes = []byte("->") - nilAngleBytes = []byte("") - maxNewlineBytes = []byte("\n") - maxShortBytes = []byte("") - circularBytes = []byte("") - circularShortBytes = []byte("") - invalidAngleBytes = []byte("") - openBracketBytes = []byte("[") - closeBracketBytes = []byte("]") - percentBytes = []byte("%") - precisionBytes = []byte(".") - openAngleBytes = []byte("<") - closeAngleBytes = []byte(">") - openMapBytes = []byte("map[") - closeMapBytes = []byte("]") - lenEqualsBytes = []byte("len=") - capEqualsBytes = []byte("cap=") -) - -// hexDigits is used to map a decimal value to a hex digit. -var hexDigits = "0123456789abcdef" - -// catchPanic handles any panics that might occur during the handleMethods -// calls. -func catchPanic(w io.Writer, v reflect.Value) { - if err := recover(); err != nil { - w.Write(panicBytes) - fmt.Fprintf(w, "%v", err) - w.Write(closeParenBytes) - } -} - -// handleMethods attempts to call the Error and String methods on the underlying -// type the passed reflect.Value represents and outputes the result to Writer w. -// -// It handles panics in any called methods by catching and displaying the error -// as the formatted value. -func handleMethods(cs *ConfigState, w io.Writer, v reflect.Value) (handled bool) { - // We need an interface to check if the type implements the error or - // Stringer interface. However, the reflect package won't give us an - // interface on certain things like unexported struct fields in order - // to enforce visibility rules. We use unsafe, when it's available, - // to bypass these restrictions since this package does not mutate the - // values. - if !v.CanInterface() { - if UnsafeDisabled { - return false - } - - v = unsafeReflectValue(v) - } - - // Choose whether or not to do error and Stringer interface lookups against - // the base type or a pointer to the base type depending on settings. - // Technically calling one of these methods with a pointer receiver can - // mutate the value, however, types which choose to satisify an error or - // Stringer interface with a pointer receiver should not be mutating their - // state inside these interface methods. - if !cs.DisablePointerMethods && !UnsafeDisabled && !v.CanAddr() { - v = unsafeReflectValue(v) - } - if v.CanAddr() { - v = v.Addr() - } - - // Is it an error or Stringer? - switch iface := v.Interface().(type) { - case error: - defer catchPanic(w, v) - if cs.ContinueOnMethod { - w.Write(openParenBytes) - w.Write([]byte(iface.Error())) - w.Write(closeParenBytes) - w.Write(spaceBytes) - return false - } - - w.Write([]byte(iface.Error())) - return true - - case fmt.Stringer: - defer catchPanic(w, v) - if cs.ContinueOnMethod { - w.Write(openParenBytes) - w.Write([]byte(iface.String())) - w.Write(closeParenBytes) - w.Write(spaceBytes) - return false - } - w.Write([]byte(iface.String())) - return true - } - return false -} - -// printBool outputs a boolean value as true or false to Writer w. -func printBool(w io.Writer, val bool) { - if val { - w.Write(trueBytes) - } else { - w.Write(falseBytes) - } -} - -// printInt outputs a signed integer value to Writer w. -func printInt(w io.Writer, val int64, base int) { - w.Write([]byte(strconv.FormatInt(val, base))) -} - -// printUint outputs an unsigned integer value to Writer w. -func printUint(w io.Writer, val uint64, base int) { - w.Write([]byte(strconv.FormatUint(val, base))) -} - -// printFloat outputs a floating point value using the specified precision, -// which is expected to be 32 or 64bit, to Writer w. -func printFloat(w io.Writer, val float64, precision int) { - w.Write([]byte(strconv.FormatFloat(val, 'g', -1, precision))) -} - -// printComplex outputs a complex value using the specified float precision -// for the real and imaginary parts to Writer w. -func printComplex(w io.Writer, c complex128, floatPrecision int) { - r := real(c) - w.Write(openParenBytes) - w.Write([]byte(strconv.FormatFloat(r, 'g', -1, floatPrecision))) - i := imag(c) - if i >= 0 { - w.Write(plusBytes) - } - w.Write([]byte(strconv.FormatFloat(i, 'g', -1, floatPrecision))) - w.Write(iBytes) - w.Write(closeParenBytes) -} - -// printHexPtr outputs a uintptr formatted as hexidecimal with a leading '0x' -// prefix to Writer w. -func printHexPtr(w io.Writer, p uintptr) { - // Null pointer. - num := uint64(p) - if num == 0 { - w.Write(nilAngleBytes) - return - } - - // Max uint64 is 16 bytes in hex + 2 bytes for '0x' prefix - buf := make([]byte, 18) - - // It's simpler to construct the hex string right to left. - base := uint64(16) - i := len(buf) - 1 - for num >= base { - buf[i] = hexDigits[num%base] - num /= base - i-- - } - buf[i] = hexDigits[num] - - // Add '0x' prefix. - i-- - buf[i] = 'x' - i-- - buf[i] = '0' - - // Strip unused leading bytes. - buf = buf[i:] - w.Write(buf) -} - -// valuesSorter implements sort.Interface to allow a slice of reflect.Value -// elements to be sorted. -type valuesSorter struct { - values []reflect.Value - strings []string // either nil or same len and values - cs *ConfigState -} - -// newValuesSorter initializes a valuesSorter instance, which holds a set of -// surrogate keys on which the data should be sorted. It uses flags in -// ConfigState to decide if and how to populate those surrogate keys. -func newValuesSorter(values []reflect.Value, cs *ConfigState) sort.Interface { - vs := &valuesSorter{values: values, cs: cs} - if canSortSimply(vs.values[0].Kind()) { - return vs - } - if !cs.DisableMethods { - vs.strings = make([]string, len(values)) - for i := range vs.values { - b := bytes.Buffer{} - if !handleMethods(cs, &b, vs.values[i]) { - vs.strings = nil - break - } - vs.strings[i] = b.String() - } - } - if vs.strings == nil && cs.SpewKeys { - vs.strings = make([]string, len(values)) - for i := range vs.values { - vs.strings[i] = Sprintf("%#v", vs.values[i].Interface()) - } - } - return vs -} - -// canSortSimply tests whether a reflect.Kind is a primitive that can be sorted -// directly, or whether it should be considered for sorting by surrogate keys -// (if the ConfigState allows it). -func canSortSimply(kind reflect.Kind) bool { - // This switch parallels valueSortLess, except for the default case. - switch kind { - case reflect.Bool: - return true - case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: - return true - case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: - return true - case reflect.Float32, reflect.Float64: - return true - case reflect.String: - return true - case reflect.Uintptr: - return true - case reflect.Array: - return true - } - return false -} - -// Len returns the number of values in the slice. It is part of the -// sort.Interface implementation. -func (s *valuesSorter) Len() int { - return len(s.values) -} - -// Swap swaps the values at the passed indices. It is part of the -// sort.Interface implementation. -func (s *valuesSorter) Swap(i, j int) { - s.values[i], s.values[j] = s.values[j], s.values[i] - if s.strings != nil { - s.strings[i], s.strings[j] = s.strings[j], s.strings[i] - } -} - -// valueSortLess returns whether the first value should sort before the second -// value. It is used by valueSorter.Less as part of the sort.Interface -// implementation. -func valueSortLess(a, b reflect.Value) bool { - switch a.Kind() { - case reflect.Bool: - return !a.Bool() && b.Bool() - case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: - return a.Int() < b.Int() - case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: - return a.Uint() < b.Uint() - case reflect.Float32, reflect.Float64: - return a.Float() < b.Float() - case reflect.String: - return a.String() < b.String() - case reflect.Uintptr: - return a.Uint() < b.Uint() - case reflect.Array: - // Compare the contents of both arrays. - l := a.Len() - for i := 0; i < l; i++ { - av := a.Index(i) - bv := b.Index(i) - if av.Interface() == bv.Interface() { - continue - } - return valueSortLess(av, bv) - } - } - return a.String() < b.String() -} - -// Less returns whether the value at index i should sort before the -// value at index j. It is part of the sort.Interface implementation. -func (s *valuesSorter) Less(i, j int) bool { - if s.strings == nil { - return valueSortLess(s.values[i], s.values[j]) - } - return s.strings[i] < s.strings[j] -} - -// sortValues is a sort function that handles both native types and any type that -// can be converted to error or Stringer. Other inputs are sorted according to -// their Value.String() value to ensure display stability. -func sortValues(values []reflect.Value, cs *ConfigState) { - if len(values) == 0 { - return - } - sort.Sort(newValuesSorter(values, cs)) -} diff --git a/vendor/github.com/davecgh/go-spew/spew/config.go b/vendor/github.com/davecgh/go-spew/spew/config.go deleted file mode 100644 index 9db83c6..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/config.go +++ /dev/null @@ -1,306 +0,0 @@ -/* - * Copyright (c) 2013 Dave Collins - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -package spew - -import ( - "bytes" - "fmt" - "io" - "os" -) - -// ConfigState houses the configuration options used by spew to format and -// display values. There is a global instance, Config, that is used to control -// all top-level Formatter and Dump functionality. Each ConfigState instance -// provides methods equivalent to the top-level functions. -// -// The zero value for ConfigState provides no indentation. You would typically -// want to set it to a space or a tab. -// -// Alternatively, you can use NewDefaultConfig to get a ConfigState instance -// with default settings. See the documentation of NewDefaultConfig for default -// values. -type ConfigState struct { - // Indent specifies the string to use for each indentation level. The - // global config instance that all top-level functions use set this to a - // single space by default. If you would like more indentation, you might - // set this to a tab with "\t" or perhaps two spaces with " ". - Indent string - - // MaxDepth controls the maximum number of levels to descend into nested - // data structures. The default, 0, means there is no limit. - // - // NOTE: Circular data structures are properly detected, so it is not - // necessary to set this value unless you specifically want to limit deeply - // nested data structures. - MaxDepth int - - // DisableMethods specifies whether or not error and Stringer interfaces are - // invoked for types that implement them. - DisableMethods bool - - // DisablePointerMethods specifies whether or not to check for and invoke - // error and Stringer interfaces on types which only accept a pointer - // receiver when the current type is not a pointer. - // - // NOTE: This might be an unsafe action since calling one of these methods - // with a pointer receiver could technically mutate the value, however, - // in practice, types which choose to satisify an error or Stringer - // interface with a pointer receiver should not be mutating their state - // inside these interface methods. As a result, this option relies on - // access to the unsafe package, so it will not have any effect when - // running in environments without access to the unsafe package such as - // Google App Engine or with the "safe" build tag specified. - DisablePointerMethods bool - - // DisablePointerAddresses specifies whether to disable the printing of - // pointer addresses. This is useful when diffing data structures in tests. - DisablePointerAddresses bool - - // DisableCapacities specifies whether to disable the printing of capacities - // for arrays, slices, maps and channels. This is useful when diffing - // data structures in tests. - DisableCapacities bool - - // ContinueOnMethod specifies whether or not recursion should continue once - // a custom error or Stringer interface is invoked. The default, false, - // means it will print the results of invoking the custom error or Stringer - // interface and return immediately instead of continuing to recurse into - // the internals of the data type. - // - // NOTE: This flag does not have any effect if method invocation is disabled - // via the DisableMethods or DisablePointerMethods options. - ContinueOnMethod bool - - // SortKeys specifies map keys should be sorted before being printed. Use - // this to have a more deterministic, diffable output. Note that only - // native types (bool, int, uint, floats, uintptr and string) and types - // that support the error or Stringer interfaces (if methods are - // enabled) are supported, with other types sorted according to the - // reflect.Value.String() output which guarantees display stability. - SortKeys bool - - // SpewKeys specifies that, as a last resort attempt, map keys should - // be spewed to strings and sorted by those strings. This is only - // considered if SortKeys is true. - SpewKeys bool -} - -// Config is the active configuration of the top-level functions. -// The configuration can be changed by modifying the contents of spew.Config. -var Config = ConfigState{Indent: " "} - -// Errorf is a wrapper for fmt.Errorf that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the formatted string as a value that satisfies error. See NewFormatter -// for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Errorf(format, c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Errorf(format string, a ...interface{}) (err error) { - return fmt.Errorf(format, c.convertArgs(a)...) -} - -// Fprint is a wrapper for fmt.Fprint that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Fprint(w, c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Fprint(w io.Writer, a ...interface{}) (n int, err error) { - return fmt.Fprint(w, c.convertArgs(a)...) -} - -// Fprintf is a wrapper for fmt.Fprintf that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Fprintf(w, format, c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Fprintf(w io.Writer, format string, a ...interface{}) (n int, err error) { - return fmt.Fprintf(w, format, c.convertArgs(a)...) -} - -// Fprintln is a wrapper for fmt.Fprintln that treats each argument as if it -// passed with a Formatter interface returned by c.NewFormatter. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Fprintln(w, c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Fprintln(w io.Writer, a ...interface{}) (n int, err error) { - return fmt.Fprintln(w, c.convertArgs(a)...) -} - -// Print is a wrapper for fmt.Print that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Print(c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Print(a ...interface{}) (n int, err error) { - return fmt.Print(c.convertArgs(a)...) -} - -// Printf is a wrapper for fmt.Printf that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Printf(format, c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Printf(format string, a ...interface{}) (n int, err error) { - return fmt.Printf(format, c.convertArgs(a)...) -} - -// Println is a wrapper for fmt.Println that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Println(c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Println(a ...interface{}) (n int, err error) { - return fmt.Println(c.convertArgs(a)...) -} - -// Sprint is a wrapper for fmt.Sprint that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the resulting string. See NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Sprint(c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Sprint(a ...interface{}) string { - return fmt.Sprint(c.convertArgs(a)...) -} - -// Sprintf is a wrapper for fmt.Sprintf that treats each argument as if it were -// passed with a Formatter interface returned by c.NewFormatter. It returns -// the resulting string. See NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Sprintf(format, c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Sprintf(format string, a ...interface{}) string { - return fmt.Sprintf(format, c.convertArgs(a)...) -} - -// Sprintln is a wrapper for fmt.Sprintln that treats each argument as if it -// were passed with a Formatter interface returned by c.NewFormatter. It -// returns the resulting string. See NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Sprintln(c.NewFormatter(a), c.NewFormatter(b)) -func (c *ConfigState) Sprintln(a ...interface{}) string { - return fmt.Sprintln(c.convertArgs(a)...) -} - -/* -NewFormatter returns a custom formatter that satisfies the fmt.Formatter -interface. As a result, it integrates cleanly with standard fmt package -printing functions. The formatter is useful for inline printing of smaller data -types similar to the standard %v format specifier. - -The custom formatter only responds to the %v (most compact), %+v (adds pointer -addresses), %#v (adds types), and %#+v (adds types and pointer addresses) verb -combinations. Any other verbs such as %x and %q will be sent to the the -standard fmt package for formatting. In addition, the custom formatter ignores -the width and precision arguments (however they will still work on the format -specifiers not handled by the custom formatter). - -Typically this function shouldn't be called directly. It is much easier to make -use of the custom formatter by calling one of the convenience functions such as -c.Printf, c.Println, or c.Printf. -*/ -func (c *ConfigState) NewFormatter(v interface{}) fmt.Formatter { - return newFormatter(c, v) -} - -// Fdump formats and displays the passed arguments to io.Writer w. It formats -// exactly the same as Dump. -func (c *ConfigState) Fdump(w io.Writer, a ...interface{}) { - fdump(c, w, a...) -} - -/* -Dump displays the passed parameters to standard out with newlines, customizable -indentation, and additional debug information such as complete types and all -pointer addresses used to indirect to the final value. It provides the -following features over the built-in printing facilities provided by the fmt -package: - - * Pointers are dereferenced and followed - * Circular data structures are detected and handled properly - * Custom Stringer/error interfaces are optionally invoked, including - on unexported types - * Custom types which only implement the Stringer/error interfaces via - a pointer receiver are optionally invoked when passing non-pointer - variables - * Byte arrays and slices are dumped like the hexdump -C command which - includes offsets, byte values in hex, and ASCII output - -The configuration options are controlled by modifying the public members -of c. See ConfigState for options documentation. - -See Fdump if you would prefer dumping to an arbitrary io.Writer or Sdump to -get the formatted result as a string. -*/ -func (c *ConfigState) Dump(a ...interface{}) { - fdump(c, os.Stdout, a...) -} - -// Sdump returns a string with the passed arguments formatted exactly the same -// as Dump. -func (c *ConfigState) Sdump(a ...interface{}) string { - var buf bytes.Buffer - fdump(c, &buf, a...) - return buf.String() -} - -// convertArgs accepts a slice of arguments and returns a slice of the same -// length with each argument converted to a spew Formatter interface using -// the ConfigState associated with s. -func (c *ConfigState) convertArgs(args []interface{}) (formatters []interface{}) { - formatters = make([]interface{}, len(args)) - for index, arg := range args { - formatters[index] = newFormatter(c, arg) - } - return formatters -} - -// NewDefaultConfig returns a ConfigState with the following default settings. -// -// Indent: " " -// MaxDepth: 0 -// DisableMethods: false -// DisablePointerMethods: false -// ContinueOnMethod: false -// SortKeys: false -func NewDefaultConfig() *ConfigState { - return &ConfigState{Indent: " "} -} diff --git a/vendor/github.com/davecgh/go-spew/spew/doc.go b/vendor/github.com/davecgh/go-spew/spew/doc.go deleted file mode 100644 index 5be0c40..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/doc.go +++ /dev/null @@ -1,202 +0,0 @@ -/* - * Copyright (c) 2013 Dave Collins - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* -Package spew implements a deep pretty printer for Go data structures to aid in -debugging. - -A quick overview of the additional features spew provides over the built-in -printing facilities for Go data types are as follows: - - * Pointers are dereferenced and followed - * Circular data structures are detected and handled properly - * Custom Stringer/error interfaces are optionally invoked, including - on unexported types - * Custom types which only implement the Stringer/error interfaces via - a pointer receiver are optionally invoked when passing non-pointer - variables - * Byte arrays and slices are dumped like the hexdump -C command which - includes offsets, byte values in hex, and ASCII output (only when using - Dump style) - -There are two different approaches spew allows for dumping Go data structures: - - * Dump style which prints with newlines, customizable indentation, - and additional debug information such as types and all pointer addresses - used to indirect to the final value - * A custom Formatter interface that integrates cleanly with the standard fmt - package and replaces %v, %+v, %#v, and %#+v to provide inline printing - similar to the default %v while providing the additional functionality - outlined above and passing unsupported format verbs such as %x and %q - along to fmt - -Quick Start - -This section demonstrates how to quickly get started with spew. See the -sections below for further details on formatting and configuration options. - -To dump a variable with full newlines, indentation, type, and pointer -information use Dump, Fdump, or Sdump: - spew.Dump(myVar1, myVar2, ...) - spew.Fdump(someWriter, myVar1, myVar2, ...) - str := spew.Sdump(myVar1, myVar2, ...) - -Alternatively, if you would prefer to use format strings with a compacted inline -printing style, use the convenience wrappers Printf, Fprintf, etc with -%v (most compact), %+v (adds pointer addresses), %#v (adds types), or -%#+v (adds types and pointer addresses): - spew.Printf("myVar1: %v -- myVar2: %+v", myVar1, myVar2) - spew.Printf("myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) - spew.Fprintf(someWriter, "myVar1: %v -- myVar2: %+v", myVar1, myVar2) - spew.Fprintf(someWriter, "myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) - -Configuration Options - -Configuration of spew is handled by fields in the ConfigState type. For -convenience, all of the top-level functions use a global state available -via the spew.Config global. - -It is also possible to create a ConfigState instance that provides methods -equivalent to the top-level functions. This allows concurrent configuration -options. See the ConfigState documentation for more details. - -The following configuration options are available: - * Indent - String to use for each indentation level for Dump functions. - It is a single space by default. A popular alternative is "\t". - - * MaxDepth - Maximum number of levels to descend into nested data structures. - There is no limit by default. - - * DisableMethods - Disables invocation of error and Stringer interface methods. - Method invocation is enabled by default. - - * DisablePointerMethods - Disables invocation of error and Stringer interface methods on types - which only accept pointer receivers from non-pointer variables. - Pointer method invocation is enabled by default. - - * ContinueOnMethod - Enables recursion into types after invoking error and Stringer interface - methods. Recursion after method invocation is disabled by default. - - * SortKeys - Specifies map keys should be sorted before being printed. Use - this to have a more deterministic, diffable output. Note that - only native types (bool, int, uint, floats, uintptr and string) - and types which implement error or Stringer interfaces are - supported with other types sorted according to the - reflect.Value.String() output which guarantees display - stability. Natural map order is used by default. - - * SpewKeys - Specifies that, as a last resort attempt, map keys should be - spewed to strings and sorted by those strings. This is only - considered if SortKeys is true. - -Dump Usage - -Simply call spew.Dump with a list of variables you want to dump: - - spew.Dump(myVar1, myVar2, ...) - -You may also call spew.Fdump if you would prefer to output to an arbitrary -io.Writer. For example, to dump to standard error: - - spew.Fdump(os.Stderr, myVar1, myVar2, ...) - -A third option is to call spew.Sdump to get the formatted output as a string: - - str := spew.Sdump(myVar1, myVar2, ...) - -Sample Dump Output - -See the Dump example for details on the setup of the types and variables being -shown here. - - (main.Foo) { - unexportedField: (*main.Bar)(0xf84002e210)({ - flag: (main.Flag) flagTwo, - data: (uintptr) - }), - ExportedField: (map[interface {}]interface {}) (len=1) { - (string) (len=3) "one": (bool) true - } - } - -Byte (and uint8) arrays and slices are displayed uniquely like the hexdump -C -command as shown. - ([]uint8) (len=32 cap=32) { - 00000000 11 12 13 14 15 16 17 18 19 1a 1b 1c 1d 1e 1f 20 |............... | - 00000010 21 22 23 24 25 26 27 28 29 2a 2b 2c 2d 2e 2f 30 |!"#$%&'()*+,-./0| - 00000020 31 32 |12| - } - -Custom Formatter - -Spew provides a custom formatter that implements the fmt.Formatter interface -so that it integrates cleanly with standard fmt package printing functions. The -formatter is useful for inline printing of smaller data types similar to the -standard %v format specifier. - -The custom formatter only responds to the %v (most compact), %+v (adds pointer -addresses), %#v (adds types), or %#+v (adds types and pointer addresses) verb -combinations. Any other verbs such as %x and %q will be sent to the the -standard fmt package for formatting. In addition, the custom formatter ignores -the width and precision arguments (however they will still work on the format -specifiers not handled by the custom formatter). - -Custom Formatter Usage - -The simplest way to make use of the spew custom formatter is to call one of the -convenience functions such as spew.Printf, spew.Println, or spew.Printf. The -functions have syntax you are most likely already familiar with: - - spew.Printf("myVar1: %v -- myVar2: %+v", myVar1, myVar2) - spew.Printf("myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) - spew.Println(myVar, myVar2) - spew.Fprintf(os.Stderr, "myVar1: %v -- myVar2: %+v", myVar1, myVar2) - spew.Fprintf(os.Stderr, "myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) - -See the Index for the full list convenience functions. - -Sample Formatter Output - -Double pointer to a uint8: - %v: <**>5 - %+v: <**>(0xf8400420d0->0xf8400420c8)5 - %#v: (**uint8)5 - %#+v: (**uint8)(0xf8400420d0->0xf8400420c8)5 - -Pointer to circular struct with a uint8 field and a pointer to itself: - %v: <*>{1 <*>} - %+v: <*>(0xf84003e260){ui8:1 c:<*>(0xf84003e260)} - %#v: (*main.circular){ui8:(uint8)1 c:(*main.circular)} - %#+v: (*main.circular)(0xf84003e260){ui8:(uint8)1 c:(*main.circular)(0xf84003e260)} - -See the Printf example for details on the setup of variables being shown -here. - -Errors - -Since it is possible for custom Stringer/error interfaces to panic, spew -detects them and handles them internally by printing the panic information -inline with the output. Since spew is intended to provide deep pretty printing -capabilities on structures, it intentionally does not return any errors. -*/ -package spew diff --git a/vendor/github.com/davecgh/go-spew/spew/dump.go b/vendor/github.com/davecgh/go-spew/spew/dump.go deleted file mode 100644 index 95f9dbf..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/dump.go +++ /dev/null @@ -1,509 +0,0 @@ -/* - * Copyright (c) 2013 Dave Collins - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -package spew - -import ( - "bytes" - "encoding/hex" - "fmt" - "io" - "os" - "reflect" - "regexp" - "strconv" - "strings" -) - -var ( - // uint8Type is a reflect.Type representing a uint8. It is used to - // convert cgo types to uint8 slices for hexdumping. - uint8Type = reflect.TypeOf(uint8(0)) - - // cCharRE is a regular expression that matches a cgo char. - // It is used to detect character arrays to hexdump them. - cCharRE = regexp.MustCompile("^.*\\._Ctype_char$") - - // cUnsignedCharRE is a regular expression that matches a cgo unsigned - // char. It is used to detect unsigned character arrays to hexdump - // them. - cUnsignedCharRE = regexp.MustCompile("^.*\\._Ctype_unsignedchar$") - - // cUint8tCharRE is a regular expression that matches a cgo uint8_t. - // It is used to detect uint8_t arrays to hexdump them. - cUint8tCharRE = regexp.MustCompile("^.*\\._Ctype_uint8_t$") -) - -// dumpState contains information about the state of a dump operation. -type dumpState struct { - w io.Writer - depth int - pointers map[uintptr]int - ignoreNextType bool - ignoreNextIndent bool - cs *ConfigState -} - -// indent performs indentation according to the depth level and cs.Indent -// option. -func (d *dumpState) indent() { - if d.ignoreNextIndent { - d.ignoreNextIndent = false - return - } - d.w.Write(bytes.Repeat([]byte(d.cs.Indent), d.depth)) -} - -// unpackValue returns values inside of non-nil interfaces when possible. -// This is useful for data types like structs, arrays, slices, and maps which -// can contain varying types packed inside an interface. -func (d *dumpState) unpackValue(v reflect.Value) reflect.Value { - if v.Kind() == reflect.Interface && !v.IsNil() { - v = v.Elem() - } - return v -} - -// dumpPtr handles formatting of pointers by indirecting them as necessary. -func (d *dumpState) dumpPtr(v reflect.Value) { - // Remove pointers at or below the current depth from map used to detect - // circular refs. - for k, depth := range d.pointers { - if depth >= d.depth { - delete(d.pointers, k) - } - } - - // Keep list of all dereferenced pointers to show later. - pointerChain := make([]uintptr, 0) - - // Figure out how many levels of indirection there are by dereferencing - // pointers and unpacking interfaces down the chain while detecting circular - // references. - nilFound := false - cycleFound := false - indirects := 0 - ve := v - for ve.Kind() == reflect.Ptr { - if ve.IsNil() { - nilFound = true - break - } - indirects++ - addr := ve.Pointer() - pointerChain = append(pointerChain, addr) - if pd, ok := d.pointers[addr]; ok && pd < d.depth { - cycleFound = true - indirects-- - break - } - d.pointers[addr] = d.depth - - ve = ve.Elem() - if ve.Kind() == reflect.Interface { - if ve.IsNil() { - nilFound = true - break - } - ve = ve.Elem() - } - } - - // Display type information. - d.w.Write(openParenBytes) - d.w.Write(bytes.Repeat(asteriskBytes, indirects)) - d.w.Write([]byte(ve.Type().String())) - d.w.Write(closeParenBytes) - - // Display pointer information. - if !d.cs.DisablePointerAddresses && len(pointerChain) > 0 { - d.w.Write(openParenBytes) - for i, addr := range pointerChain { - if i > 0 { - d.w.Write(pointerChainBytes) - } - printHexPtr(d.w, addr) - } - d.w.Write(closeParenBytes) - } - - // Display dereferenced value. - d.w.Write(openParenBytes) - switch { - case nilFound == true: - d.w.Write(nilAngleBytes) - - case cycleFound == true: - d.w.Write(circularBytes) - - default: - d.ignoreNextType = true - d.dump(ve) - } - d.w.Write(closeParenBytes) -} - -// dumpSlice handles formatting of arrays and slices. Byte (uint8 under -// reflection) arrays and slices are dumped in hexdump -C fashion. -func (d *dumpState) dumpSlice(v reflect.Value) { - // Determine whether this type should be hex dumped or not. Also, - // for types which should be hexdumped, try to use the underlying data - // first, then fall back to trying to convert them to a uint8 slice. - var buf []uint8 - doConvert := false - doHexDump := false - numEntries := v.Len() - if numEntries > 0 { - vt := v.Index(0).Type() - vts := vt.String() - switch { - // C types that need to be converted. - case cCharRE.MatchString(vts): - fallthrough - case cUnsignedCharRE.MatchString(vts): - fallthrough - case cUint8tCharRE.MatchString(vts): - doConvert = true - - // Try to use existing uint8 slices and fall back to converting - // and copying if that fails. - case vt.Kind() == reflect.Uint8: - // We need an addressable interface to convert the type - // to a byte slice. However, the reflect package won't - // give us an interface on certain things like - // unexported struct fields in order to enforce - // visibility rules. We use unsafe, when available, to - // bypass these restrictions since this package does not - // mutate the values. - vs := v - if !vs.CanInterface() || !vs.CanAddr() { - vs = unsafeReflectValue(vs) - } - if !UnsafeDisabled { - vs = vs.Slice(0, numEntries) - - // Use the existing uint8 slice if it can be - // type asserted. - iface := vs.Interface() - if slice, ok := iface.([]uint8); ok { - buf = slice - doHexDump = true - break - } - } - - // The underlying data needs to be converted if it can't - // be type asserted to a uint8 slice. - doConvert = true - } - - // Copy and convert the underlying type if needed. - if doConvert && vt.ConvertibleTo(uint8Type) { - // Convert and copy each element into a uint8 byte - // slice. - buf = make([]uint8, numEntries) - for i := 0; i < numEntries; i++ { - vv := v.Index(i) - buf[i] = uint8(vv.Convert(uint8Type).Uint()) - } - doHexDump = true - } - } - - // Hexdump the entire slice as needed. - if doHexDump { - indent := strings.Repeat(d.cs.Indent, d.depth) - str := indent + hex.Dump(buf) - str = strings.Replace(str, "\n", "\n"+indent, -1) - str = strings.TrimRight(str, d.cs.Indent) - d.w.Write([]byte(str)) - return - } - - // Recursively call dump for each item. - for i := 0; i < numEntries; i++ { - d.dump(d.unpackValue(v.Index(i))) - if i < (numEntries - 1) { - d.w.Write(commaNewlineBytes) - } else { - d.w.Write(newlineBytes) - } - } -} - -// dump is the main workhorse for dumping a value. It uses the passed reflect -// value to figure out what kind of object we are dealing with and formats it -// appropriately. It is a recursive function, however circular data structures -// are detected and handled properly. -func (d *dumpState) dump(v reflect.Value) { - // Handle invalid reflect values immediately. - kind := v.Kind() - if kind == reflect.Invalid { - d.w.Write(invalidAngleBytes) - return - } - - // Handle pointers specially. - if kind == reflect.Ptr { - d.indent() - d.dumpPtr(v) - return - } - - // Print type information unless already handled elsewhere. - if !d.ignoreNextType { - d.indent() - d.w.Write(openParenBytes) - d.w.Write([]byte(v.Type().String())) - d.w.Write(closeParenBytes) - d.w.Write(spaceBytes) - } - d.ignoreNextType = false - - // Display length and capacity if the built-in len and cap functions - // work with the value's kind and the len/cap itself is non-zero. - valueLen, valueCap := 0, 0 - switch v.Kind() { - case reflect.Array, reflect.Slice, reflect.Chan: - valueLen, valueCap = v.Len(), v.Cap() - case reflect.Map, reflect.String: - valueLen = v.Len() - } - if valueLen != 0 || !d.cs.DisableCapacities && valueCap != 0 { - d.w.Write(openParenBytes) - if valueLen != 0 { - d.w.Write(lenEqualsBytes) - printInt(d.w, int64(valueLen), 10) - } - if !d.cs.DisableCapacities && valueCap != 0 { - if valueLen != 0 { - d.w.Write(spaceBytes) - } - d.w.Write(capEqualsBytes) - printInt(d.w, int64(valueCap), 10) - } - d.w.Write(closeParenBytes) - d.w.Write(spaceBytes) - } - - // Call Stringer/error interfaces if they exist and the handle methods flag - // is enabled - if !d.cs.DisableMethods { - if (kind != reflect.Invalid) && (kind != reflect.Interface) { - if handled := handleMethods(d.cs, d.w, v); handled { - return - } - } - } - - switch kind { - case reflect.Invalid: - // Do nothing. We should never get here since invalid has already - // been handled above. - - case reflect.Bool: - printBool(d.w, v.Bool()) - - case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: - printInt(d.w, v.Int(), 10) - - case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: - printUint(d.w, v.Uint(), 10) - - case reflect.Float32: - printFloat(d.w, v.Float(), 32) - - case reflect.Float64: - printFloat(d.w, v.Float(), 64) - - case reflect.Complex64: - printComplex(d.w, v.Complex(), 32) - - case reflect.Complex128: - printComplex(d.w, v.Complex(), 64) - - case reflect.Slice: - if v.IsNil() { - d.w.Write(nilAngleBytes) - break - } - fallthrough - - case reflect.Array: - d.w.Write(openBraceNewlineBytes) - d.depth++ - if (d.cs.MaxDepth != 0) && (d.depth > d.cs.MaxDepth) { - d.indent() - d.w.Write(maxNewlineBytes) - } else { - d.dumpSlice(v) - } - d.depth-- - d.indent() - d.w.Write(closeBraceBytes) - - case reflect.String: - d.w.Write([]byte(strconv.Quote(v.String()))) - - case reflect.Interface: - // The only time we should get here is for nil interfaces due to - // unpackValue calls. - if v.IsNil() { - d.w.Write(nilAngleBytes) - } - - case reflect.Ptr: - // Do nothing. We should never get here since pointers have already - // been handled above. - - case reflect.Map: - // nil maps should be indicated as different than empty maps - if v.IsNil() { - d.w.Write(nilAngleBytes) - break - } - - d.w.Write(openBraceNewlineBytes) - d.depth++ - if (d.cs.MaxDepth != 0) && (d.depth > d.cs.MaxDepth) { - d.indent() - d.w.Write(maxNewlineBytes) - } else { - numEntries := v.Len() - keys := v.MapKeys() - if d.cs.SortKeys { - sortValues(keys, d.cs) - } - for i, key := range keys { - d.dump(d.unpackValue(key)) - d.w.Write(colonSpaceBytes) - d.ignoreNextIndent = true - d.dump(d.unpackValue(v.MapIndex(key))) - if i < (numEntries - 1) { - d.w.Write(commaNewlineBytes) - } else { - d.w.Write(newlineBytes) - } - } - } - d.depth-- - d.indent() - d.w.Write(closeBraceBytes) - - case reflect.Struct: - d.w.Write(openBraceNewlineBytes) - d.depth++ - if (d.cs.MaxDepth != 0) && (d.depth > d.cs.MaxDepth) { - d.indent() - d.w.Write(maxNewlineBytes) - } else { - vt := v.Type() - numFields := v.NumField() - for i := 0; i < numFields; i++ { - d.indent() - vtf := vt.Field(i) - d.w.Write([]byte(vtf.Name)) - d.w.Write(colonSpaceBytes) - d.ignoreNextIndent = true - d.dump(d.unpackValue(v.Field(i))) - if i < (numFields - 1) { - d.w.Write(commaNewlineBytes) - } else { - d.w.Write(newlineBytes) - } - } - } - d.depth-- - d.indent() - d.w.Write(closeBraceBytes) - - case reflect.Uintptr: - printHexPtr(d.w, uintptr(v.Uint())) - - case reflect.UnsafePointer, reflect.Chan, reflect.Func: - printHexPtr(d.w, v.Pointer()) - - // There were not any other types at the time this code was written, but - // fall back to letting the default fmt package handle it in case any new - // types are added. - default: - if v.CanInterface() { - fmt.Fprintf(d.w, "%v", v.Interface()) - } else { - fmt.Fprintf(d.w, "%v", v.String()) - } - } -} - -// fdump is a helper function to consolidate the logic from the various public -// methods which take varying writers and config states. -func fdump(cs *ConfigState, w io.Writer, a ...interface{}) { - for _, arg := range a { - if arg == nil { - w.Write(interfaceBytes) - w.Write(spaceBytes) - w.Write(nilAngleBytes) - w.Write(newlineBytes) - continue - } - - d := dumpState{w: w, cs: cs} - d.pointers = make(map[uintptr]int) - d.dump(reflect.ValueOf(arg)) - d.w.Write(newlineBytes) - } -} - -// Fdump formats and displays the passed arguments to io.Writer w. It formats -// exactly the same as Dump. -func Fdump(w io.Writer, a ...interface{}) { - fdump(&Config, w, a...) -} - -// Sdump returns a string with the passed arguments formatted exactly the same -// as Dump. -func Sdump(a ...interface{}) string { - var buf bytes.Buffer - fdump(&Config, &buf, a...) - return buf.String() -} - -/* -Dump displays the passed parameters to standard out with newlines, customizable -indentation, and additional debug information such as complete types and all -pointer addresses used to indirect to the final value. It provides the -following features over the built-in printing facilities provided by the fmt -package: - - * Pointers are dereferenced and followed - * Circular data structures are detected and handled properly - * Custom Stringer/error interfaces are optionally invoked, including - on unexported types - * Custom types which only implement the Stringer/error interfaces via - a pointer receiver are optionally invoked when passing non-pointer - variables - * Byte arrays and slices are dumped like the hexdump -C command which - includes offsets, byte values in hex, and ASCII output - -The configuration options are controlled by an exported package global, -spew.Config. See ConfigState for options documentation. - -See Fdump if you would prefer dumping to an arbitrary io.Writer or Sdump to -get the formatted result as a string. -*/ -func Dump(a ...interface{}) { - fdump(&Config, os.Stdout, a...) -} diff --git a/vendor/github.com/davecgh/go-spew/spew/format.go b/vendor/github.com/davecgh/go-spew/spew/format.go deleted file mode 100644 index ecf3b80..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/format.go +++ /dev/null @@ -1,419 +0,0 @@ -/* - * Copyright (c) 2013 Dave Collins - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -package spew - -import ( - "bytes" - "fmt" - "reflect" - "strconv" - "strings" -) - -// supportedFlags is a list of all the character flags supported by fmt package. -const supportedFlags = "0-+# " - -// formatState implements the fmt.Formatter interface and contains information -// about the state of a formatting operation. The NewFormatter function can -// be used to get a new Formatter which can be used directly as arguments -// in standard fmt package printing calls. -type formatState struct { - value interface{} - fs fmt.State - depth int - pointers map[uintptr]int - ignoreNextType bool - cs *ConfigState -} - -// buildDefaultFormat recreates the original format string without precision -// and width information to pass in to fmt.Sprintf in the case of an -// unrecognized type. Unless new types are added to the language, this -// function won't ever be called. -func (f *formatState) buildDefaultFormat() (format string) { - buf := bytes.NewBuffer(percentBytes) - - for _, flag := range supportedFlags { - if f.fs.Flag(int(flag)) { - buf.WriteRune(flag) - } - } - - buf.WriteRune('v') - - format = buf.String() - return format -} - -// constructOrigFormat recreates the original format string including precision -// and width information to pass along to the standard fmt package. This allows -// automatic deferral of all format strings this package doesn't support. -func (f *formatState) constructOrigFormat(verb rune) (format string) { - buf := bytes.NewBuffer(percentBytes) - - for _, flag := range supportedFlags { - if f.fs.Flag(int(flag)) { - buf.WriteRune(flag) - } - } - - if width, ok := f.fs.Width(); ok { - buf.WriteString(strconv.Itoa(width)) - } - - if precision, ok := f.fs.Precision(); ok { - buf.Write(precisionBytes) - buf.WriteString(strconv.Itoa(precision)) - } - - buf.WriteRune(verb) - - format = buf.String() - return format -} - -// unpackValue returns values inside of non-nil interfaces when possible and -// ensures that types for values which have been unpacked from an interface -// are displayed when the show types flag is also set. -// This is useful for data types like structs, arrays, slices, and maps which -// can contain varying types packed inside an interface. -func (f *formatState) unpackValue(v reflect.Value) reflect.Value { - if v.Kind() == reflect.Interface { - f.ignoreNextType = false - if !v.IsNil() { - v = v.Elem() - } - } - return v -} - -// formatPtr handles formatting of pointers by indirecting them as necessary. -func (f *formatState) formatPtr(v reflect.Value) { - // Display nil if top level pointer is nil. - showTypes := f.fs.Flag('#') - if v.IsNil() && (!showTypes || f.ignoreNextType) { - f.fs.Write(nilAngleBytes) - return - } - - // Remove pointers at or below the current depth from map used to detect - // circular refs. - for k, depth := range f.pointers { - if depth >= f.depth { - delete(f.pointers, k) - } - } - - // Keep list of all dereferenced pointers to possibly show later. - pointerChain := make([]uintptr, 0) - - // Figure out how many levels of indirection there are by derferencing - // pointers and unpacking interfaces down the chain while detecting circular - // references. - nilFound := false - cycleFound := false - indirects := 0 - ve := v - for ve.Kind() == reflect.Ptr { - if ve.IsNil() { - nilFound = true - break - } - indirects++ - addr := ve.Pointer() - pointerChain = append(pointerChain, addr) - if pd, ok := f.pointers[addr]; ok && pd < f.depth { - cycleFound = true - indirects-- - break - } - f.pointers[addr] = f.depth - - ve = ve.Elem() - if ve.Kind() == reflect.Interface { - if ve.IsNil() { - nilFound = true - break - } - ve = ve.Elem() - } - } - - // Display type or indirection level depending on flags. - if showTypes && !f.ignoreNextType { - f.fs.Write(openParenBytes) - f.fs.Write(bytes.Repeat(asteriskBytes, indirects)) - f.fs.Write([]byte(ve.Type().String())) - f.fs.Write(closeParenBytes) - } else { - if nilFound || cycleFound { - indirects += strings.Count(ve.Type().String(), "*") - } - f.fs.Write(openAngleBytes) - f.fs.Write([]byte(strings.Repeat("*", indirects))) - f.fs.Write(closeAngleBytes) - } - - // Display pointer information depending on flags. - if f.fs.Flag('+') && (len(pointerChain) > 0) { - f.fs.Write(openParenBytes) - for i, addr := range pointerChain { - if i > 0 { - f.fs.Write(pointerChainBytes) - } - printHexPtr(f.fs, addr) - } - f.fs.Write(closeParenBytes) - } - - // Display dereferenced value. - switch { - case nilFound == true: - f.fs.Write(nilAngleBytes) - - case cycleFound == true: - f.fs.Write(circularShortBytes) - - default: - f.ignoreNextType = true - f.format(ve) - } -} - -// format is the main workhorse for providing the Formatter interface. It -// uses the passed reflect value to figure out what kind of object we are -// dealing with and formats it appropriately. It is a recursive function, -// however circular data structures are detected and handled properly. -func (f *formatState) format(v reflect.Value) { - // Handle invalid reflect values immediately. - kind := v.Kind() - if kind == reflect.Invalid { - f.fs.Write(invalidAngleBytes) - return - } - - // Handle pointers specially. - if kind == reflect.Ptr { - f.formatPtr(v) - return - } - - // Print type information unless already handled elsewhere. - if !f.ignoreNextType && f.fs.Flag('#') { - f.fs.Write(openParenBytes) - f.fs.Write([]byte(v.Type().String())) - f.fs.Write(closeParenBytes) - } - f.ignoreNextType = false - - // Call Stringer/error interfaces if they exist and the handle methods - // flag is enabled. - if !f.cs.DisableMethods { - if (kind != reflect.Invalid) && (kind != reflect.Interface) { - if handled := handleMethods(f.cs, f.fs, v); handled { - return - } - } - } - - switch kind { - case reflect.Invalid: - // Do nothing. We should never get here since invalid has already - // been handled above. - - case reflect.Bool: - printBool(f.fs, v.Bool()) - - case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: - printInt(f.fs, v.Int(), 10) - - case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: - printUint(f.fs, v.Uint(), 10) - - case reflect.Float32: - printFloat(f.fs, v.Float(), 32) - - case reflect.Float64: - printFloat(f.fs, v.Float(), 64) - - case reflect.Complex64: - printComplex(f.fs, v.Complex(), 32) - - case reflect.Complex128: - printComplex(f.fs, v.Complex(), 64) - - case reflect.Slice: - if v.IsNil() { - f.fs.Write(nilAngleBytes) - break - } - fallthrough - - case reflect.Array: - f.fs.Write(openBracketBytes) - f.depth++ - if (f.cs.MaxDepth != 0) && (f.depth > f.cs.MaxDepth) { - f.fs.Write(maxShortBytes) - } else { - numEntries := v.Len() - for i := 0; i < numEntries; i++ { - if i > 0 { - f.fs.Write(spaceBytes) - } - f.ignoreNextType = true - f.format(f.unpackValue(v.Index(i))) - } - } - f.depth-- - f.fs.Write(closeBracketBytes) - - case reflect.String: - f.fs.Write([]byte(v.String())) - - case reflect.Interface: - // The only time we should get here is for nil interfaces due to - // unpackValue calls. - if v.IsNil() { - f.fs.Write(nilAngleBytes) - } - - case reflect.Ptr: - // Do nothing. We should never get here since pointers have already - // been handled above. - - case reflect.Map: - // nil maps should be indicated as different than empty maps - if v.IsNil() { - f.fs.Write(nilAngleBytes) - break - } - - f.fs.Write(openMapBytes) - f.depth++ - if (f.cs.MaxDepth != 0) && (f.depth > f.cs.MaxDepth) { - f.fs.Write(maxShortBytes) - } else { - keys := v.MapKeys() - if f.cs.SortKeys { - sortValues(keys, f.cs) - } - for i, key := range keys { - if i > 0 { - f.fs.Write(spaceBytes) - } - f.ignoreNextType = true - f.format(f.unpackValue(key)) - f.fs.Write(colonBytes) - f.ignoreNextType = true - f.format(f.unpackValue(v.MapIndex(key))) - } - } - f.depth-- - f.fs.Write(closeMapBytes) - - case reflect.Struct: - numFields := v.NumField() - f.fs.Write(openBraceBytes) - f.depth++ - if (f.cs.MaxDepth != 0) && (f.depth > f.cs.MaxDepth) { - f.fs.Write(maxShortBytes) - } else { - vt := v.Type() - for i := 0; i < numFields; i++ { - if i > 0 { - f.fs.Write(spaceBytes) - } - vtf := vt.Field(i) - if f.fs.Flag('+') || f.fs.Flag('#') { - f.fs.Write([]byte(vtf.Name)) - f.fs.Write(colonBytes) - } - f.format(f.unpackValue(v.Field(i))) - } - } - f.depth-- - f.fs.Write(closeBraceBytes) - - case reflect.Uintptr: - printHexPtr(f.fs, uintptr(v.Uint())) - - case reflect.UnsafePointer, reflect.Chan, reflect.Func: - printHexPtr(f.fs, v.Pointer()) - - // There were not any other types at the time this code was written, but - // fall back to letting the default fmt package handle it if any get added. - default: - format := f.buildDefaultFormat() - if v.CanInterface() { - fmt.Fprintf(f.fs, format, v.Interface()) - } else { - fmt.Fprintf(f.fs, format, v.String()) - } - } -} - -// Format satisfies the fmt.Formatter interface. See NewFormatter for usage -// details. -func (f *formatState) Format(fs fmt.State, verb rune) { - f.fs = fs - - // Use standard formatting for verbs that are not v. - if verb != 'v' { - format := f.constructOrigFormat(verb) - fmt.Fprintf(fs, format, f.value) - return - } - - if f.value == nil { - if fs.Flag('#') { - fs.Write(interfaceBytes) - } - fs.Write(nilAngleBytes) - return - } - - f.format(reflect.ValueOf(f.value)) -} - -// newFormatter is a helper function to consolidate the logic from the various -// public methods which take varying config states. -func newFormatter(cs *ConfigState, v interface{}) fmt.Formatter { - fs := &formatState{value: v, cs: cs} - fs.pointers = make(map[uintptr]int) - return fs -} - -/* -NewFormatter returns a custom formatter that satisfies the fmt.Formatter -interface. As a result, it integrates cleanly with standard fmt package -printing functions. The formatter is useful for inline printing of smaller data -types similar to the standard %v format specifier. - -The custom formatter only responds to the %v (most compact), %+v (adds pointer -addresses), %#v (adds types), or %#+v (adds types and pointer addresses) verb -combinations. Any other verbs such as %x and %q will be sent to the the -standard fmt package for formatting. In addition, the custom formatter ignores -the width and precision arguments (however they will still work on the format -specifiers not handled by the custom formatter). - -Typically this function shouldn't be called directly. It is much easier to make -use of the custom formatter by calling one of the convenience functions such as -Printf, Println, or Fprintf. -*/ -func NewFormatter(v interface{}) fmt.Formatter { - return newFormatter(&Config, v) -} diff --git a/vendor/github.com/davecgh/go-spew/spew/spew.go b/vendor/github.com/davecgh/go-spew/spew/spew.go deleted file mode 100644 index d8233f5..0000000 --- a/vendor/github.com/davecgh/go-spew/spew/spew.go +++ /dev/null @@ -1,148 +0,0 @@ -/* - * Copyright (c) 2013 Dave Collins - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -package spew - -import ( - "fmt" - "io" -) - -// Errorf is a wrapper for fmt.Errorf that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the formatted string as a value that satisfies error. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Errorf(format, spew.NewFormatter(a), spew.NewFormatter(b)) -func Errorf(format string, a ...interface{}) (err error) { - return fmt.Errorf(format, convertArgs(a)...) -} - -// Fprint is a wrapper for fmt.Fprint that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Fprint(w, spew.NewFormatter(a), spew.NewFormatter(b)) -func Fprint(w io.Writer, a ...interface{}) (n int, err error) { - return fmt.Fprint(w, convertArgs(a)...) -} - -// Fprintf is a wrapper for fmt.Fprintf that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Fprintf(w, format, spew.NewFormatter(a), spew.NewFormatter(b)) -func Fprintf(w io.Writer, format string, a ...interface{}) (n int, err error) { - return fmt.Fprintf(w, format, convertArgs(a)...) -} - -// Fprintln is a wrapper for fmt.Fprintln that treats each argument as if it -// passed with a default Formatter interface returned by NewFormatter. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Fprintln(w, spew.NewFormatter(a), spew.NewFormatter(b)) -func Fprintln(w io.Writer, a ...interface{}) (n int, err error) { - return fmt.Fprintln(w, convertArgs(a)...) -} - -// Print is a wrapper for fmt.Print that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Print(spew.NewFormatter(a), spew.NewFormatter(b)) -func Print(a ...interface{}) (n int, err error) { - return fmt.Print(convertArgs(a)...) -} - -// Printf is a wrapper for fmt.Printf that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Printf(format, spew.NewFormatter(a), spew.NewFormatter(b)) -func Printf(format string, a ...interface{}) (n int, err error) { - return fmt.Printf(format, convertArgs(a)...) -} - -// Println is a wrapper for fmt.Println that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the number of bytes written and any write error encountered. See -// NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Println(spew.NewFormatter(a), spew.NewFormatter(b)) -func Println(a ...interface{}) (n int, err error) { - return fmt.Println(convertArgs(a)...) -} - -// Sprint is a wrapper for fmt.Sprint that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the resulting string. See NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Sprint(spew.NewFormatter(a), spew.NewFormatter(b)) -func Sprint(a ...interface{}) string { - return fmt.Sprint(convertArgs(a)...) -} - -// Sprintf is a wrapper for fmt.Sprintf that treats each argument as if it were -// passed with a default Formatter interface returned by NewFormatter. It -// returns the resulting string. See NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Sprintf(format, spew.NewFormatter(a), spew.NewFormatter(b)) -func Sprintf(format string, a ...interface{}) string { - return fmt.Sprintf(format, convertArgs(a)...) -} - -// Sprintln is a wrapper for fmt.Sprintln that treats each argument as if it -// were passed with a default Formatter interface returned by NewFormatter. It -// returns the resulting string. See NewFormatter for formatting details. -// -// This function is shorthand for the following syntax: -// -// fmt.Sprintln(spew.NewFormatter(a), spew.NewFormatter(b)) -func Sprintln(a ...interface{}) string { - return fmt.Sprintln(convertArgs(a)...) -} - -// convertArgs accepts a slice of arguments and returns a slice of the same -// length with each argument converted to a default spew Formatter interface. -func convertArgs(args []interface{}) (formatters []interface{}) { - formatters = make([]interface{}, len(args)) - for index, arg := range args { - formatters[index] = NewFormatter(arg) - } - return formatters -} diff --git a/vendor/github.com/ginuerzh/pht/README.md b/vendor/github.com/ginuerzh/pht/README.md index c787647..35b25fa 100644 --- a/vendor/github.com/ginuerzh/pht/README.md +++ b/vendor/github.com/ginuerzh/pht/README.md @@ -1,2 +1,2 @@ # pht -Pure HTTP Tunnel - Tunnel over HTTP using only GET and POST requests. +Plain HTTP Tunnel - Tunnel over HTTP using only GET and POST requests, NO Websocket, NO CONNECT method. diff --git a/vendor/github.com/golang/glog/README b/vendor/github.com/golang/glog/README index 5f9c114..387b4eb 100644 --- a/vendor/github.com/golang/glog/README +++ b/vendor/github.com/golang/glog/README @@ -5,7 +5,7 @@ Leveled execution logs for Go. This is an efficient pure Go implementation of leveled logs in the manner of the open source C++ package - http://code.google.com/p/google-glog + https://github.com/google/glog By binding methods to booleans it is possible to use the log package without paying the expense of evaluating the arguments to the log. diff --git a/vendor/github.com/golang/glog/glog.go b/vendor/github.com/golang/glog/glog.go index 3e63fff..54bd7af 100644 --- a/vendor/github.com/golang/glog/glog.go +++ b/vendor/github.com/golang/glog/glog.go @@ -676,7 +676,10 @@ func (l *loggingT) output(s severity, buf *buffer, file string, line int, alsoTo } } data := buf.Bytes() - if l.toStderr { + if !flag.Parsed() { + os.Stderr.Write([]byte("ERROR: logging before flag.Parse: ")) + os.Stderr.Write(data) + } else if l.toStderr { os.Stderr.Write(data) } else { if alsoToStderr || l.alsoToStderr || s >= l.stderrThreshold.get() { diff --git a/vendor/github.com/lucas-clemente/quic-go/Changelog.md b/vendor/github.com/lucas-clemente/quic-go/Changelog.md new file mode 100644 index 0000000..0b357ab --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/Changelog.md @@ -0,0 +1,17 @@ +# Changelog + +## v0.6.0 (unreleased) + +- Added `quic.Config` options for maximal flow control windows +- Add a `quic.Config` option for QUIC versions +- Add a `quic.Config` option to request truncation of the connection ID from a server +- Add a `quic.Config` option to configure the source address validation +- Add a `quic.Config` option to configure the handshake timeout +- Add a `quic.Config` option to configure keep-alive +- Implement `net.Conn`-style deadlines for streams +- Remove the `tls.Config` from the `quic.Config`. The `tls.Config` must now be passed to the `Dial` and `Listen` functions as a separate parameter. See the [Godoc](https://godoc.org/github.com/lucas-clemente/quic-go) for details. +- Changed the log level environment variable to only accept strings ("DEBUG", "INFO", "ERROR"), see [the wiki](https://github.com/lucas-clemente/quic-go/wiki/Logging) for more details. +- Rename the `h2quic.QuicRoundTripper` to `h2quic.RoundTripper` +- Changed `h2quic.Server.Serve()` to accept a `net.PacketConn` +- Drop support for Go 1.7. +- Various bugfixes diff --git a/vendor/github.com/lucas-clemente/quic-go/README.md b/vendor/github.com/lucas-clemente/quic-go/README.md index 9d871f5..6f3a11e 100644 --- a/vendor/github.com/lucas-clemente/quic-go/README.md +++ b/vendor/github.com/lucas-clemente/quic-go/README.md @@ -1,4 +1,4 @@ -# A QUIC server implementation in pure Go +# A QUIC implementation in pure Go @@ -7,32 +7,20 @@ [![Windows Build Status](https://img.shields.io/appveyor/ci/lucas-clemente/quic-go/master.svg?style=flat-square&label=windows+build)](https://ci.appveyor.com/project/lucas-clemente/quic-go/branch/master) [![Code Coverage](https://img.shields.io/codecov/c/github/lucas-clemente/quic-go/master.svg?style=flat-square)](https://codecov.io/gh/lucas-clemente/quic-go/) -quic-go is an implementation of the [QUIC](https://en.wikipedia.org/wiki/QUIC) protocol in Go. While we're not far from being feature complete, there's still work to do regarding performance and security. At the moment, we do not recommend use in production systems. We appreciate any feedback :) +quic-go is an implementation of the [QUIC](https://en.wikipedia.org/wiki/QUIC) protocol in Go. ## Roadmap -Done: - -- Basic protocol with support for QUIC version 34-36 -- QUIC client -- HTTP/2 support -- Crypto (RSA / ECDSA certificates, Curve25519 for key exchange, AES-GCM or Chacha20-Poly1305 as stream cipher) -- Loss detection and retransmission (currently fast retransmission & RTO) -- Flow Control -- Congestion control using cubic - -Major TODOs: - -- Security, especially DoS protections -- Performance -- Better packet loss detection -- Connection migration +quic-go is compatible with the current version(s) of Google Chrome and QUIC as deployed on Google's servers. We're actively tracking the development of the Chrome code to ensure compatibility as the protocol evolves. In that process, we're dropping support for old QUIC versions. +As Google's QUIC versions are expected to converge towards the [IETF QUIC draft](https://github.com/quicwg/base-drafts), quic-go will eventually implement that draft. ## Guides -Installing deps: +We currently support Go 1.8+. - go get -t +Installing and updating dependencies: + + go get -t -u ./... Running tests: @@ -50,9 +38,13 @@ Using Chrome: /Applications/Google\ Chrome.app/Contents/MacOS/Google\ Chrome --user-data-dir=/tmp/chrome --no-proxy-server --enable-quic --origin-to-force-quic-on=quic.clemente.io:443 --host-resolver-rules='MAP quic.clemente.io:443 127.0.0.1:6121' https://quic.clemente.io +### QUIC without HTTP/2 + +Take a look at [this echo example](example/echo/echo.go). + ### Using the example client - go run example/client/main.go https://quic.clemente.io + go run example/client/main.go https://clemente.io ## Usage @@ -67,14 +59,14 @@ h2quic.ListenAndServeQUIC("localhost:4242", "/path/to/cert/chain.pem", "/path/to ### As a client -See the [example client](example/client/main.go). Use a `QuicRoundTripper` as a `Transport` in a `http.Client`. +See the [example client](example/client/main.go). Use a `h2quic.RoundTripper` as a `Transport` in a `http.Client`. ```go http.Client{ - Transport: &h2quic.QuicRoundTripper{}, + Transport: &h2quic.RoundTripper{}, } ``` -## Building on Windows +## Contributing -Due to the low Windows timer resolution (see [StackOverflow question](http://stackoverflow.com/questions/37706834/high-resolution-timers-millisecond-precision-in-go-on-windows)) available with Go 1.6.x, some optimizations might not work when compiled with this version of the compiler. Please use Go 1.7 on Windows. +We are always happy to welcome new contributors! We have a number of self-contained issues that are suitable for first-time contributors, they are tagged with [want-help](https://github.com/lucas-clemente/quic-go/issues?q=is%3Aopen+is%3Aissue+label%3Awant-help). If you have any questions, please feel free to reach out by opening an issue or leaving a comment. diff --git a/vendor/github.com/lucas-clemente/quic-go/ackhandler/interfaces.go b/vendor/github.com/lucas-clemente/quic-go/ackhandler/interfaces.go index 1d1b4be..e100264 100644 --- a/vendor/github.com/lucas-clemente/quic-go/ackhandler/interfaces.go +++ b/vendor/github.com/lucas-clemente/quic-go/ackhandler/interfaces.go @@ -9,21 +9,17 @@ import ( // SentPacketHandler handles ACKs received for outgoing packets type SentPacketHandler interface { + // SentPacket may modify the packet SentPacket(packet *Packet) error ReceivedAck(ackFrame *frames.AckFrame, withPacketNumber protocol.PacketNumber, recvTime time.Time) error + SendingAllowed() bool GetStopWaitingFrame(force bool) *frames.StopWaitingFrame - - MaybeQueueRTOs() DequeuePacketForRetransmission() (packet *Packet) - - BytesInFlight() protocol.ByteCount GetLeastUnacked() protocol.PacketNumber - SendingAllowed() bool - CheckForError() error - - TimeOfFirstRTO() time.Time + GetAlarmTimeout() time.Time + OnAlarm() } // ReceivedPacketHandler handles ACKs needed to send for incoming packets @@ -31,5 +27,6 @@ type ReceivedPacketHandler interface { ReceivedPacket(packetNumber protocol.PacketNumber, shouldInstigateAck bool) error ReceivedStopWaiting(*frames.StopWaitingFrame) error + GetAlarmTimeout() time.Time GetAckFrame() *frames.AckFrame } diff --git a/vendor/github.com/lucas-clemente/quic-go/ackhandler/packet.go b/vendor/github.com/lucas-clemente/quic-go/ackhandler/packet.go index d748547..e9dbf6a 100644 --- a/vendor/github.com/lucas-clemente/quic-go/ackhandler/packet.go +++ b/vendor/github.com/lucas-clemente/quic-go/ackhandler/packet.go @@ -10,11 +10,10 @@ import ( // A Packet is a packet // +gen linkedlist type Packet struct { - PacketNumber protocol.PacketNumber - Frames []frames.Frame - Length protocol.ByteCount - - MissingReports uint8 + PacketNumber protocol.PacketNumber + Frames []frames.Frame + Length protocol.ByteCount + EncryptionLevel protocol.EncryptionLevel SendTime time.Time } diff --git a/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_handler.go b/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_handler.go index daebbfb..c5e9dc2 100644 --- a/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_handler.go +++ b/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_handler.go @@ -8,13 +8,6 @@ import ( "github.com/lucas-clemente/quic-go/protocol" ) -var ( - // ErrDuplicatePacket occurres when a duplicate packet is received - ErrDuplicatePacket = errors.New("ReceivedPacketHandler: Duplicate Packet") - // ErrPacketSmallerThanLastStopWaiting occurs when a packet arrives with a packet number smaller than the largest LeastUnacked of a StopWaitingFrame. If this error occurs, the packet should be ignored - ErrPacketSmallerThanLastStopWaiting = errors.New("ReceivedPacketHandler: Packet number smaller than highest StopWaiting") -) - var errInvalidPacketNumber = errors.New("ReceivedPacketHandler: Invalid packet number") type receivedPacketHandler struct { @@ -30,20 +23,14 @@ type receivedPacketHandler struct { retransmittablePacketsReceivedSinceLastAck int ackQueued bool ackAlarm time.Time - ackAlarmResetCallback func(time.Time) lastAck *frames.AckFrame } // NewReceivedPacketHandler creates a new receivedPacketHandler -func NewReceivedPacketHandler(ackAlarmResetCallback func(time.Time)) ReceivedPacketHandler { - // create a stopped timer, see https://github.com/golang/go/issues/12721#issuecomment-143010182 - timer := time.NewTimer(0) - <-timer.C - +func NewReceivedPacketHandler() ReceivedPacketHandler { return &receivedPacketHandler{ - packetHistory: newReceivedPacketHistory(), - ackAlarmResetCallback: ackAlarmResetCallback, - ackSendDelay: protocol.AckSendDelay, + packetHistory: newReceivedPacketHistory(), + ackSendDelay: protocol.AckSendDelay, } } @@ -52,19 +39,10 @@ func (h *receivedPacketHandler) ReceivedPacket(packetNumber protocol.PacketNumbe return errInvalidPacketNumber } - // if the packet number is smaller than the largest LeastUnacked value of a StopWaiting we received, we cannot detect if this packet has a duplicate number - // the packet has to be ignored anyway - if packetNumber <= h.ignorePacketsBelow { - return ErrPacketSmallerThanLastStopWaiting - } - - if h.packetHistory.IsDuplicate(packetNumber) { - return ErrDuplicatePacket - } - - err := h.packetHistory.ReceivedPacket(packetNumber) - if err != nil { - return err + if packetNumber > h.ignorePacketsBelow { + if err := h.packetHistory.ReceivedPacket(packetNumber); err != nil { + return err + } } if packetNumber > h.largestObserved { @@ -89,7 +67,6 @@ func (h *receivedPacketHandler) ReceivedStopWaiting(f *frames.StopWaitingFrame) } func (h *receivedPacketHandler) maybeQueueAck(packetNumber protocol.PacketNumber, shouldInstigateAck bool) { - var ackAlarmSet bool h.packetsReceivedSinceLastAck++ if shouldInstigateAck { @@ -124,7 +101,6 @@ func (h *receivedPacketHandler) maybeQueueAck(packetNumber protocol.PacketNumber } else { if h.ackAlarm.IsZero() { h.ackAlarm = time.Now().Add(h.ackSendDelay) - ackAlarmSet = true } } } @@ -132,11 +108,6 @@ func (h *receivedPacketHandler) maybeQueueAck(packetNumber protocol.PacketNumber if h.ackQueued { // cancel the ack alarm h.ackAlarm = time.Time{} - ackAlarmSet = false - } - - if ackAlarmSet { - h.ackAlarmResetCallback(h.ackAlarm) } } @@ -164,3 +135,5 @@ func (h *receivedPacketHandler) GetAckFrame() *frames.AckFrame { return ack } + +func (h *receivedPacketHandler) GetAlarmTimeout() time.Time { return h.ackAlarm } diff --git a/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_history.go b/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_history.go index d45fe6f..791dec1 100644 --- a/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_history.go +++ b/vendor/github.com/lucas-clemente/quic-go/ackhandler/received_packet_history.go @@ -2,9 +2,9 @@ package ackhandler import ( "github.com/lucas-clemente/quic-go/frames" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) type receivedPacketHistory struct { diff --git a/vendor/github.com/lucas-clemente/quic-go/ackhandler/retransmittable.go b/vendor/github.com/lucas-clemente/quic-go/ackhandler/retransmittable.go new file mode 100644 index 0000000..17437b8 --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/ackhandler/retransmittable.go @@ -0,0 +1,38 @@ +package ackhandler + +import ( + "github.com/lucas-clemente/quic-go/frames" +) + +// Returns a new slice with all non-retransmittable frames deleted. +func stripNonRetransmittableFrames(fs []frames.Frame) []frames.Frame { + res := make([]frames.Frame, 0, len(fs)) + for _, f := range fs { + if IsFrameRetransmittable(f) { + res = append(res, f) + } + } + return res +} + +// IsFrameRetransmittable returns true if the frame should be retransmitted. +func IsFrameRetransmittable(f frames.Frame) bool { + switch f.(type) { + case *frames.StopWaitingFrame: + return false + case *frames.AckFrame: + return false + default: + return true + } +} + +// HasRetransmittableFrames returns true if at least one frame is retransmittable. +func HasRetransmittableFrames(fs []frames.Frame) bool { + for _, f := range fs { + if IsFrameRetransmittable(f) { + return true + } + } + return false +} diff --git a/vendor/github.com/lucas-clemente/quic-go/ackhandler/sent_packet_handler.go b/vendor/github.com/lucas-clemente/quic-go/ackhandler/sent_packet_handler.go index 686fd9d..300b665 100644 --- a/vendor/github.com/lucas-clemente/quic-go/ackhandler/sent_packet_handler.go +++ b/vendor/github.com/lucas-clemente/quic-go/ackhandler/sent_packet_handler.go @@ -7,9 +7,21 @@ import ( "github.com/lucas-clemente/quic-go/congestion" "github.com/lucas-clemente/quic-go/frames" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" +) + +const ( + // Maximum reordering in time space before time based loss detection considers a packet lost. + // In fraction of an RTT. + timeReorderingFraction = 1.0 / 8 + // defaultRTOTimeout is the RTO time on new connections + defaultRTOTimeout = 500 * time.Millisecond + // Minimum time in the future an RTO alarm may be set for. + minRTOTimeout = 200 * time.Millisecond + // maxRTOTimeout is the maximum RTO time + maxRTOTimeout = 60 * time.Second ) var ( @@ -22,11 +34,10 @@ var ( errAckForUnsentPacket = qerr.Error(qerr.InvalidAckData, "Received ACK for an unsent package") ) -var errPacketNumberNotIncreasing = errors.New("Already sent a packet with a higher packet number.") +var errPacketNumberNotIncreasing = errors.New("Already sent a packet with a higher packet number") type sentPacketHandler struct { lastSentPacketNumber protocol.PacketNumber - lastSentPacketTime time.Time skippedPackets []protocol.PacketNumber LargestAcked protocol.PacketNumber @@ -40,10 +51,17 @@ type sentPacketHandler struct { bytesInFlight protocol.ByteCount - rttStats *congestion.RTTStats congestion congestion.SendAlgorithm + rttStats *congestion.RTTStats - consecutiveRTOCount uint32 + // The number of times an RTO has been sent without receiving an ack. + rtoCount uint32 + + // The time at which the next packet will be considered lost based on early transmit or exceeding the reordering window in time. + lossTime time.Time + + // The alarm timeout + alarm time.Time } // NewSentPacketHandler creates a new sentPacketHandler @@ -64,40 +82,6 @@ func NewSentPacketHandler(rttStats *congestion.RTTStats) SentPacketHandler { } } -func (h *sentPacketHandler) ackPacket(packetElement *PacketElement) { - packet := &packetElement.Value - h.bytesInFlight -= packet.Length - h.packetHistory.Remove(packetElement) -} - -// nackPacket NACKs a packet -// it returns true if a FastRetransmissions was triggered -func (h *sentPacketHandler) nackPacket(packetElement *PacketElement) bool { - packet := &packetElement.Value - - packet.MissingReports++ - - if packet.MissingReports > protocol.RetransmissionThreshold { - utils.Debugf("\tQueueing packet 0x%x for retransmission (fast)", packet.PacketNumber) - h.queuePacketForRetransmission(packetElement) - return true - } - return false -} - -// does NOT set packet.Retransmitted. This variable is not needed anymore -func (h *sentPacketHandler) queuePacketForRetransmission(packetElement *PacketElement) { - packet := &packetElement.Value - h.bytesInFlight -= packet.Length - h.retransmissionQueue = append(h.retransmissionQueue, packet) - - h.packetHistory.Remove(packetElement) - - // strictly speaking, this is only necessary for RTO retransmissions - // this is because FastRetransmissions are triggered by missing ranges in ACKs, and then the LargestAcked will already be higher than the packet number of the retransmitted packet - h.stopWaitingManager.QueuedRetransmissionForPacketNumber(packet.PacketNumber) -} - func (h *sentPacketHandler) largestInOrderAcked() protocol.PacketNumber { if f := h.packetHistory.Front(); f != nil { return f.Value.PacketNumber - 1 @@ -110,6 +94,10 @@ func (h *sentPacketHandler) SentPacket(packet *Packet) error { return errPacketNumberNotIncreasing } + if protocol.PacketNumber(len(h.retransmissionQueue)+h.packetHistory.Len()+1) > protocol.MaxTrackedSentPackets { + return ErrTooManyTrackedSentPackets + } + for p := h.lastSentPacketNumber + 1; p < packet.PacketNumber; p++ { h.skippedPackets = append(h.skippedPackets, p) @@ -118,25 +106,27 @@ func (h *sentPacketHandler) SentPacket(packet *Packet) error { } } - now := time.Now() - h.lastSentPacketTime = now - packet.SendTime = now - if packet.Length == 0 { - return errors.New("SentPacketHandler: packet cannot be empty") - } - h.bytesInFlight += packet.Length - h.lastSentPacketNumber = packet.PacketNumber - h.packetHistory.PushBack(*packet) + now := time.Now() + + packet.Frames = stripNonRetransmittableFrames(packet.Frames) + isRetransmittable := len(packet.Frames) != 0 + + if isRetransmittable { + packet.SendTime = now + h.bytesInFlight += packet.Length + h.packetHistory.PushBack(*packet) + } h.congestion.OnPacketSent( now, - h.BytesInFlight(), + h.bytesInFlight, packet.PacketNumber, packet.Length, - true, /* TODO: is retransmittable */ + isRetransmittable, ) + h.updateLossDetectionAlarm() return nil } @@ -149,54 +139,57 @@ func (h *sentPacketHandler) ReceivedAck(ackFrame *frames.AckFrame, withPacketNum if withPacketNumber <= h.largestReceivedPacketWithAck { return ErrDuplicateOrOutOfOrderAck } - h.largestReceivedPacketWithAck = withPacketNumber // ignore repeated ACK (ACKs that don't have a higher LargestAcked than the last ACK) if ackFrame.LargestAcked <= h.largestInOrderAcked() { return nil } + h.LargestAcked = ackFrame.LargestAcked - // check if it acks any packets that were skipped - for _, p := range h.skippedPackets { - if ackFrame.AcksPacket(p) { - return ErrAckForSkippedPacket + if h.skippedPacketsAcked(ackFrame) { + return ErrAckForSkippedPacket + } + + rttUpdated := h.maybeUpdateRTT(ackFrame.LargestAcked, ackFrame.DelayTime, rcvTime) + + if rttUpdated { + h.congestion.MaybeExitSlowStart() + } + + ackedPackets, err := h.determineNewlyAckedPackets(ackFrame) + if err != nil { + return err + } + + if len(ackedPackets) > 0 { + for _, p := range ackedPackets { + h.onPacketAcked(p) + h.congestion.OnPacketAcked(p.Value.PacketNumber, p.Value.Length, h.bytesInFlight) } } - h.LargestAcked = ackFrame.LargestAcked + h.detectLostPackets() + h.updateLossDetectionAlarm() - var ackedPackets congestion.PacketVector - var lostPackets congestion.PacketVector + h.garbageCollectSkippedPackets() + h.stopWaitingManager.ReceivedAck(ackFrame) + + return nil +} + +func (h *sentPacketHandler) determineNewlyAckedPackets(ackFrame *frames.AckFrame) ([]*PacketElement, error) { + var ackedPackets []*PacketElement ackRangeIndex := 0 - rttUpdated := false - - var el, elNext *PacketElement - for el = h.packetHistory.Front(); el != nil; el = elNext { - // determine the next list element right at the beginning, because el.Next() is not avaible anymore, when the list element is deleted (i.e. when the packet is ACKed) - elNext = el.Next() + for el := h.packetHistory.Front(); el != nil; el = el.Next() { packet := el.Value packetNumber := packet.PacketNumber - // NACK packets below the LowestAcked + // Ignore packets below the LowestAcked if packetNumber < ackFrame.LowestAcked { - retransmitted := h.nackPacket(el) - if retransmitted { - lostPackets = append(lostPackets, congestion.PacketInfo{Number: packetNumber, Length: packet.Length}) - } continue } - - // Update the RTT - if packetNumber == h.LargestAcked { - rttUpdated = true - timeDelta := rcvTime.Sub(packet.SendTime) - h.rttStats.UpdateRTT(timeDelta, ackFrame.DelayTime, rcvTime) - if utils.Debug() { - utils.Debugf("\tEstimated RTT: %dms", h.rttStats.SmoothedRTT()/time.Millisecond) - } - } - + // Break after LargestAcked is reached if packetNumber > ackFrame.LargestAcked { break } @@ -211,59 +204,119 @@ func (h *sentPacketHandler) ReceivedAck(ackFrame *frames.AckFrame, withPacketNum if packetNumber >= ackRange.FirstPacketNumber { // packet i contained in ACK range if packetNumber > ackRange.LastPacketNumber { - return fmt.Errorf("BUG: ackhandler would have acked wrong packet 0x%x, while evaluating range 0x%x -> 0x%x", packetNumber, ackRange.FirstPacketNumber, ackRange.LastPacketNumber) - } - h.ackPacket(el) - ackedPackets = append(ackedPackets, congestion.PacketInfo{Number: packetNumber, Length: packet.Length}) - } else { - retransmitted := h.nackPacket(el) - if retransmitted { - lostPackets = append(lostPackets, congestion.PacketInfo{Number: packetNumber, Length: packet.Length}) + return nil, fmt.Errorf("BUG: ackhandler would have acked wrong packet 0x%x, while evaluating range 0x%x -> 0x%x", packetNumber, ackRange.FirstPacketNumber, ackRange.LastPacketNumber) } + ackedPackets = append(ackedPackets, el) } } else { - h.ackPacket(el) - ackedPackets = append(ackedPackets, congestion.PacketInfo{Number: packetNumber, Length: packet.Length}) + ackedPackets = append(ackedPackets, el) } } - if rttUpdated { - // Reset counter if a new packet was acked - h.consecutiveRTOCount = 0 + return ackedPackets, nil +} + +func (h *sentPacketHandler) maybeUpdateRTT(largestAcked protocol.PacketNumber, ackDelay time.Duration, rcvTime time.Time) bool { + for el := h.packetHistory.Front(); el != nil; el = el.Next() { + packet := el.Value + if packet.PacketNumber == largestAcked { + h.rttStats.UpdateRTT(rcvTime.Sub(packet.SendTime), ackDelay, time.Now()) + return true + } + // Packets are sorted by number, so we can stop searching + if packet.PacketNumber > largestAcked { + break + } + } + return false +} + +func (h *sentPacketHandler) updateLossDetectionAlarm() { + // Cancel the alarm if no packets are outstanding + if h.packetHistory.Len() == 0 { + h.alarm = time.Time{} + return } - h.garbageCollectSkippedPackets() + // TODO(#496): Handle handshake packets separately + // TODO(#497): TLP + if !h.lossTime.IsZero() { + // Early retransmit timer or time loss detection. + h.alarm = h.lossTime + } else { + // RTO + h.alarm = time.Now().Add(h.computeRTOTimeout()) + } +} - h.stopWaitingManager.ReceivedAck(ackFrame) +func (h *sentPacketHandler) detectLostPackets() { + h.lossTime = time.Time{} + now := time.Now() - h.congestion.OnCongestionEvent( - rttUpdated, - h.BytesInFlight(), - ackedPackets, - lostPackets, - ) + maxRTT := float64(utils.MaxDuration(h.rttStats.LatestRTT(), h.rttStats.SmoothedRTT())) + delayUntilLost := time.Duration((1.0 + timeReorderingFraction) * maxRTT) - return nil + var lostPackets []*PacketElement + for el := h.packetHistory.Front(); el != nil; el = el.Next() { + packet := el.Value + + if packet.PacketNumber > h.LargestAcked { + break + } + + timeSinceSent := now.Sub(packet.SendTime) + if timeSinceSent > delayUntilLost { + lostPackets = append(lostPackets, el) + } else if h.lossTime.IsZero() { + // Note: This conditional is only entered once per call + h.lossTime = now.Add(delayUntilLost - timeSinceSent) + } + } + + if len(lostPackets) > 0 { + for _, p := range lostPackets { + h.queuePacketForRetransmission(p) + h.congestion.OnPacketLost(p.Value.PacketNumber, p.Value.Length, h.bytesInFlight) + } + } +} + +func (h *sentPacketHandler) OnAlarm() { + // TODO(#496): Handle handshake packets separately + // TODO(#497): TLP + if !h.lossTime.IsZero() { + // Early retransmit or time loss detection + h.detectLostPackets() + } else { + // RTO + h.retransmitOldestTwoPackets() + h.rtoCount++ + } + + h.updateLossDetectionAlarm() +} + +func (h *sentPacketHandler) GetAlarmTimeout() time.Time { + return h.alarm +} + +func (h *sentPacketHandler) onPacketAcked(packetElement *PacketElement) { + h.bytesInFlight -= packetElement.Value.Length + h.rtoCount = 0 + // TODO(#497): h.tlpCount = 0 + h.packetHistory.Remove(packetElement) } func (h *sentPacketHandler) DequeuePacketForRetransmission() *Packet { if len(h.retransmissionQueue) == 0 { return nil } - - if len(h.retransmissionQueue) > 0 { - queueLen := len(h.retransmissionQueue) - // packets are usually NACKed in descending order. So use the slice as a stack - packet := h.retransmissionQueue[queueLen-1] - h.retransmissionQueue = h.retransmissionQueue[:queueLen-1] - return packet - } - - return nil -} - -func (h *sentPacketHandler) BytesInFlight() protocol.ByteCount { - return h.bytesInFlight + packet := h.retransmissionQueue[0] + // Shift the slice and don't retain anything that isn't needed. + copy(h.retransmissionQueue, h.retransmissionQueue[1:]) + h.retransmissionQueue[len(h.retransmissionQueue)-1] = nil + h.retransmissionQueue = h.retransmissionQueue[:len(h.retransmissionQueue)-1] + return packet } func (h *sentPacketHandler) GetLeastUnacked() protocol.PacketNumber { @@ -275,65 +328,67 @@ func (h *sentPacketHandler) GetStopWaitingFrame(force bool) *frames.StopWaitingF } func (h *sentPacketHandler) SendingAllowed() bool { - congestionLimited := h.BytesInFlight() > h.congestion.GetCongestionWindow() + congestionLimited := h.bytesInFlight > h.congestion.GetCongestionWindow() maxTrackedLimited := protocol.PacketNumber(len(h.retransmissionQueue)+h.packetHistory.Len()) >= protocol.MaxTrackedSentPackets - return !(congestionLimited || maxTrackedLimited) + if congestionLimited { + utils.Debugf("Congestion limited: bytes in flight %d, window %d", + h.bytesInFlight, + h.congestion.GetCongestionWindow()) + } + // Workaround for #555: + // Always allow sending of retransmissions. This should probably be limited + // to RTOs, but we currently don't have a nice way of distinguishing them. + haveRetransmissions := len(h.retransmissionQueue) > 0 + return !maxTrackedLimited && (!congestionLimited || haveRetransmissions) } -func (h *sentPacketHandler) CheckForError() error { - length := len(h.retransmissionQueue) + h.packetHistory.Len() - if protocol.PacketNumber(length) > protocol.MaxTrackedSentPackets { - return ErrTooManyTrackedSentPackets +func (h *sentPacketHandler) retransmitOldestTwoPackets() { + if p := h.packetHistory.Front(); p != nil { + h.queueRTO(p) } - return nil -} - -func (h *sentPacketHandler) MaybeQueueRTOs() { - if time.Now().Before(h.TimeOfFirstRTO()) { - return + if p := h.packetHistory.Front(); p != nil { + h.queueRTO(p) } - - // Always queue the two oldest packets - if h.packetHistory.Front() != nil { - h.queueRTO(h.packetHistory.Front()) - } - if h.packetHistory.Front() != nil { - h.queueRTO(h.packetHistory.Front()) - } - - // Reset the RTO timer here, since it's not clear that this packet contained any retransmittable frames - h.lastSentPacketTime = time.Now() - h.consecutiveRTOCount++ } func (h *sentPacketHandler) queueRTO(el *PacketElement) { packet := &el.Value - packetsLost := congestion.PacketVector{congestion.PacketInfo{ - Number: packet.PacketNumber, - Length: packet.Length, - }} - h.congestion.OnCongestionEvent(false, h.BytesInFlight(), nil, packetsLost) - h.congestion.OnRetransmissionTimeout(true) - utils.Debugf("\tQueueing packet 0x%x for retransmission (RTO)", packet.PacketNumber) + utils.Debugf( + "\tQueueing packet 0x%x for retransmission (RTO), %d outstanding", + packet.PacketNumber, + h.packetHistory.Len(), + ) h.queuePacketForRetransmission(el) + h.congestion.OnPacketLost(packet.PacketNumber, packet.Length, h.bytesInFlight) + h.congestion.OnRetransmissionTimeout(true) } -func (h *sentPacketHandler) getRTO() time.Duration { +func (h *sentPacketHandler) queuePacketForRetransmission(packetElement *PacketElement) { + packet := &packetElement.Value + h.bytesInFlight -= packet.Length + h.retransmissionQueue = append(h.retransmissionQueue, packet) + h.packetHistory.Remove(packetElement) + h.stopWaitingManager.QueuedRetransmissionForPacketNumber(packet.PacketNumber) +} + +func (h *sentPacketHandler) computeRTOTimeout() time.Duration { rto := h.congestion.RetransmissionDelay() if rto == 0 { - rto = protocol.DefaultRetransmissionTime + rto = defaultRTOTimeout } - rto = utils.MaxDuration(rto, protocol.MinRetransmissionTime) + rto = utils.MaxDuration(rto, minRTOTimeout) // Exponential backoff - rto *= 1 << h.consecutiveRTOCount - return utils.MinDuration(rto, protocol.MaxRetransmissionTime) + rto = rto << h.rtoCount + return utils.MinDuration(rto, maxRTOTimeout) } -func (h *sentPacketHandler) TimeOfFirstRTO() time.Time { - if h.lastSentPacketTime.IsZero() { - return time.Time{} +func (h *sentPacketHandler) skippedPacketsAcked(ackFrame *frames.AckFrame) bool { + for _, p := range h.skippedPackets { + if ackFrame.AcksPacket(p) { + return true + } } - return h.lastSentPacketTime.Add(h.getRTO()) + return false } func (h *sentPacketHandler) garbageCollectSkippedPackets() { diff --git a/vendor/github.com/lucas-clemente/quic-go/appveyor.yml b/vendor/github.com/lucas-clemente/quic-go/appveyor.yml index 4ed6cfa..8a3c907 100644 --- a/vendor/github.com/lucas-clemente/quic-go/appveyor.yml +++ b/vendor/github.com/lucas-clemente/quic-go/appveyor.yml @@ -5,6 +5,7 @@ os: Windows Server 2012 R2 environment: GOPATH: c:\gopath CGO_ENABLED: 0 + TIMESCALE_FACTOR: 20 matrix: - GOARCH: 386 - GOARCH: amd64 @@ -13,8 +14,8 @@ clone_folder: c:\gopath\src\github.com\lucas-clemente\quic-go install: - rmdir c:\go /s /q - - appveyor DownloadFile https://storage.googleapis.com/golang/go1.7.5.windows-amd64.zip - - 7z x go1.7.5.windows-amd64.zip -y -oC:\ > NUL + - appveyor DownloadFile https://storage.googleapis.com/golang/go1.8.3.windows-amd64.zip + - 7z x go1.8.3.windows-amd64.zip -y -oC:\ > NUL - set PATH=%PATH%;%GOPATH%\bin\windows_%GOARCH%;%GOPATH%\bin - echo %PATH% - echo %GOPATH% @@ -27,7 +28,8 @@ install: build_script: - rm -r integrationtests - - ginkgo -r --randomizeAllSpecs --randomizeSuites --trace --progress + - ginkgo -r --randomizeAllSpecs --randomizeSuites --trace --progress -skipPackage benchmark + - ginkgo --randomizeAllSpecs --randomizeSuites --trace --progress benchmark -- -samples=1 test: off diff --git a/vendor/github.com/lucas-clemente/quic-go/buffer_pool.go b/vendor/github.com/lucas-clemente/quic-go/buffer_pool.go index bb4feb3..f592d47 100644 --- a/vendor/github.com/lucas-clemente/quic-go/buffer_pool.go +++ b/vendor/github.com/lucas-clemente/quic-go/buffer_pool.go @@ -13,7 +13,7 @@ func getPacketBuffer() []byte { } func putPacketBuffer(buf []byte) { - if cap(buf) != int(protocol.MaxPacketSize) { + if cap(buf) != int(protocol.MaxReceivePacketSize) { panic("putPacketBuffer called with packet of wrong size!") } bufferPool.Put(buf[:0]) @@ -21,6 +21,6 @@ func putPacketBuffer(buf []byte) { func init() { bufferPool.New = func() interface{} { - return make([]byte, 0, protocol.MaxPacketSize) + return make([]byte, 0, protocol.MaxReceivePacketSize) } } diff --git a/vendor/github.com/lucas-clemente/quic-go/client.go b/vendor/github.com/lucas-clemente/quic-go/client.go index e5e6abe..2e18de8 100644 --- a/vendor/github.com/lucas-clemente/quic-go/client.go +++ b/vendor/github.com/lucas-clemente/quic-go/client.go @@ -4,216 +4,332 @@ import ( "bytes" "crypto/tls" "errors" + "fmt" "net" "strings" - "sync/atomic" + "sync" "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) -// A Client of QUIC -type Client struct { - addr *net.UDPAddr - conn *net.UDPConn +type client struct { + mutex sync.Mutex + listenErr error + + conn connection hostname string - connectionID protocol.ConnectionID - version protocol.VersionNumber - versionNegotiated bool - closed uint32 // atomic bool + errorChan chan struct{} + handshakeChan <-chan handshakeEvent - tlsConfig *tls.Config - cryptoChangeCallback CryptoChangeCallback - versionNegotiateCallback VersionNegotiateCallback + tlsConf *tls.Config + config *Config + versionNegotiated bool // has version negotiation completed yet + + connectionID protocol.ConnectionID + version protocol.VersionNumber session packetHandler } -// VersionNegotiateCallback is called once the client has a negotiated version -type VersionNegotiateCallback func() error - -var errHostname = errors.New("Invalid hostname") - var ( errCloseSessionForNewVersion = errors.New("closing session in order to recreate it with a new version") ) -// NewClient makes a new client -func NewClient(host string, tlsConfig *tls.Config, cryptoChangeCallback CryptoChangeCallback, versionNegotiateCallback VersionNegotiateCallback) (*Client, error) { - udpAddr, err := net.ResolveUDPAddr("udp", host) +// DialAddr establishes a new QUIC connection to a server. +// The hostname for SNI is taken from the given address. +func DialAddr(addr string, tlsConf *tls.Config, config *Config) (Session, error) { + udpAddr, err := net.ResolveUDPAddr("udp", addr) + if err != nil { + return nil, err + } + udpConn, err := net.ListenUDP("udp", &net.UDPAddr{IP: net.IPv4zero, Port: 0}) + if err != nil { + return nil, err + } + return Dial(udpConn, udpAddr, addr, tlsConf, config) +} + +// DialAddrNonFWSecure establishes a new QUIC connection to a server. +// The hostname for SNI is taken from the given address. +func DialAddrNonFWSecure( + addr string, + tlsConf *tls.Config, + config *Config, +) (NonFWSession, error) { + udpAddr, err := net.ResolveUDPAddr("udp", addr) + if err != nil { + return nil, err + } + udpConn, err := net.ListenUDP("udp", &net.UDPAddr{IP: net.IPv4zero, Port: 0}) + if err != nil { + return nil, err + } + return DialNonFWSecure(udpConn, udpAddr, addr, tlsConf, config) +} + +// DialNonFWSecure establishes a new non-forward-secure QUIC connection to a server using a net.PacketConn. +// The host parameter is used for SNI. +func DialNonFWSecure( + pconn net.PacketConn, + remoteAddr net.Addr, + host string, + tlsConf *tls.Config, + config *Config, +) (NonFWSession, error) { + connID, err := utils.GenerateConnectionID() if err != nil { return nil, err } - conn, err := net.ListenUDP("udp", &net.UDPAddr{IP: net.IPv4zero, Port: 0}) + var hostname string + if tlsConf != nil { + hostname = tlsConf.ServerName + } + + if hostname == "" { + hostname, _, err = net.SplitHostPort(host) + if err != nil { + return nil, err + } + } + + clientConfig := populateClientConfig(config) + c := &client{ + conn: &conn{pconn: pconn, currentAddr: remoteAddr}, + connectionID: connID, + hostname: hostname, + tlsConf: tlsConf, + config: clientConfig, + version: clientConfig.Versions[0], + errorChan: make(chan struct{}), + } + + err = c.createNewSession(nil) if err != nil { return nil, err } - connectionID, err := utils.GenerateConnectionID() + utils.Infof("Starting new connection to %s (%s -> %s), connectionID %x, version %d", hostname, c.conn.LocalAddr().String(), c.conn.RemoteAddr().String(), c.connectionID, c.version) + + return c.session.(NonFWSession), c.establishSecureConnection() +} + +// Dial establishes a new QUIC connection to a server using a net.PacketConn. +// The host parameter is used for SNI. +func Dial( + pconn net.PacketConn, + remoteAddr net.Addr, + host string, + tlsConf *tls.Config, + config *Config, +) (Session, error) { + sess, err := DialNonFWSecure(pconn, remoteAddr, host, tlsConf, config) if err != nil { return nil, err } - - hostname, _, err := net.SplitHostPort(host) + err = sess.WaitUntilHandshakeComplete() if err != nil { return nil, err } + return sess, nil +} - client := &Client{ - addr: udpAddr, - conn: conn, - hostname: hostname, - version: protocol.SupportedVersions[len(protocol.SupportedVersions)-1], // use the highest supported version by default - connectionID: connectionID, - tlsConfig: tlsConfig, - cryptoChangeCallback: cryptoChangeCallback, - versionNegotiateCallback: versionNegotiateCallback, +// populateClientConfig populates fields in the quic.Config with their default values, if none are set +// it may be called with nil +func populateClientConfig(config *Config) *Config { + if config == nil { + config = &Config{} + } + versions := config.Versions + if len(versions) == 0 { + versions = protocol.SupportedVersions } - utils.Infof("Starting new connection to %s (%s), connectionID %x, version %d", host, udpAddr.String(), connectionID, client.version) - - err = client.createNewSession(nil) - if err != nil { - return nil, err + handshakeTimeout := protocol.DefaultHandshakeTimeout + if config.HandshakeTimeout != 0 { + handshakeTimeout = config.HandshakeTimeout } - return client, nil + maxReceiveStreamFlowControlWindow := config.MaxReceiveStreamFlowControlWindow + if maxReceiveStreamFlowControlWindow == 0 { + maxReceiveStreamFlowControlWindow = protocol.DefaultMaxReceiveStreamFlowControlWindowClient + } + maxReceiveConnectionFlowControlWindow := config.MaxReceiveConnectionFlowControlWindow + if maxReceiveConnectionFlowControlWindow == 0 { + maxReceiveConnectionFlowControlWindow = protocol.DefaultMaxReceiveConnectionFlowControlWindowClient + } + + return &Config{ + Versions: versions, + HandshakeTimeout: handshakeTimeout, + RequestConnectionIDTruncation: config.RequestConnectionIDTruncation, + MaxReceiveStreamFlowControlWindow: maxReceiveStreamFlowControlWindow, + MaxReceiveConnectionFlowControlWindow: maxReceiveConnectionFlowControlWindow, + KeepAlive: config.KeepAlive, + } +} + +// establishSecureConnection returns as soon as the connection is secure (as opposed to forward-secure) +func (c *client) establishSecureConnection() error { + go c.listen() + + select { + case <-c.errorChan: + return c.listenErr + case ev := <-c.handshakeChan: + if ev.err != nil { + return ev.err + } + if ev.encLevel != protocol.EncryptionSecure { + return fmt.Errorf("Client BUG: Expected encryption level to be secure, was %s", ev.encLevel) + } + return nil + } } // Listen listens -func (c *Client) Listen() error { - for { - data := getPacketBuffer() - data = data[:protocol.MaxPacketSize] +func (c *client) listen() { + var err error - n, _, err := c.conn.ReadFromUDP(data) + for { + var n int + var addr net.Addr + data := getPacketBuffer() + data = data[:protocol.MaxReceivePacketSize] + // The packet size should not exceed protocol.MaxReceivePacketSize bytes + // If it does, we only read a truncated packet, which will then end up undecryptable + n, addr, err = c.conn.Read(data) if err != nil { - if strings.HasSuffix(err.Error(), "use of closed network connection") { - return nil + if !strings.HasSuffix(err.Error(), "use of closed network connection") { + c.session.Close(err) } - return err + break } data = data[:n] - err = c.handlePacket(data) - if err != nil { - utils.Errorf("error handling packet: %s", err.Error()) - c.session.Close(err) - return err - } + c.handlePacket(addr, data) } } -// OpenStream opens a stream, for client-side created streams (i.e. odd streamIDs) -func (c *Client) OpenStream(id protocol.StreamID) (utils.Stream, error) { - return c.session.OpenStream(id) -} - -// Close closes the connection -func (c *Client) Close(e error) error { - // Only close once - if !atomic.CompareAndSwapUint32(&c.closed, 0, 1) { - return nil - } - - _ = c.session.Close(e) - return c.conn.Close() -} - -func (c *Client) handlePacket(packet []byte) error { - if protocol.ByteCount(len(packet)) > protocol.MaxPacketSize { - return qerr.PacketTooLarge - } - +func (c *client) handlePacket(remoteAddr net.Addr, packet []byte) { rcvTime := time.Now() r := bytes.NewReader(packet) - hdr, err := ParsePublicHeader(r, protocol.PerspectiveServer) if err != nil { - return qerr.Error(qerr.InvalidPacketHeader, err.Error()) + utils.Errorf("error parsing packet from %s: %s", remoteAddr.String(), err.Error()) + // drop this packet if we can't parse the Public Header + return } hdr.Raw = packet[:len(packet)-r.Len()] + c.mutex.Lock() + defer c.mutex.Unlock() + + if hdr.ResetFlag { + cr := c.conn.RemoteAddr() + // check if the remote address and the connection ID match + // otherwise this might be an attacker trying to inject a PUBLIC_RESET to kill the connection + if cr.Network() != remoteAddr.Network() || cr.String() != remoteAddr.String() || hdr.ConnectionID != c.connectionID { + utils.Infof("Received a spoofed Public Reset. Ignoring.") + return + } + pr, err := parsePublicReset(r) + if err != nil { + utils.Infof("Received a Public Reset for connection %x. An error occurred parsing the packet.") + return + } + utils.Infof("Received Public Reset, rejected packet number: %#x.", pr.rejectedPacketNumber) + c.session.closeRemote(qerr.Error(qerr.PublicReset, fmt.Sprintf("Received a Public Reset for packet number %#x", pr.rejectedPacketNumber))) + return + } + // ignore delayed / duplicated version negotiation packets if c.versionNegotiated && hdr.VersionFlag { - return nil + return } // this is the first packet after the client sent a packet with the VersionFlag set // if the server doesn't send a version negotiation packet, it supports the suggested version if !hdr.VersionFlag && !c.versionNegotiated { c.versionNegotiated = true - err = c.versionNegotiateCallback() - if err != nil { - return err - } } if hdr.VersionFlag { - var hasCommonVersion bool // check if we're supporting any of the offered versions - for _, v := range hdr.SupportedVersions { - // check if the server sent the offered version in supported versions - if v == c.version { - return qerr.Error(qerr.InvalidVersionNegotiationPacket, "Server already supports client's version and should have accepted the connection.") - } - if v != protocol.VersionUnsupported { - hasCommonVersion = true - } + // version negotiation packets have no payload + if err := c.handlePacketWithVersionFlag(hdr); err != nil { + c.session.Close(err) } - if !hasCommonVersion { - utils.Infof("No common version found.") - return qerr.InvalidVersion - } - - ok, highestSupportedVersion := protocol.HighestSupportedVersion(hdr.SupportedVersions) - if !ok { - return qerr.VersionNegotiationMismatch - } - - utils.Infof("Switching to QUIC version %d", highestSupportedVersion) - c.version = highestSupportedVersion - c.versionNegotiated = true - - c.session.Close(errCloseSessionForNewVersion) - err = c.createNewSession(hdr.SupportedVersions) - if err != nil { - return err - } - err = c.versionNegotiateCallback() - if err != nil { - return err - } - - return nil // version negotiation packets have no payload + return } c.session.handlePacket(&receivedPacket{ - remoteAddr: c.addr, + remoteAddr: remoteAddr, publicHeader: hdr, data: packet[len(packet)-r.Len():], rcvTime: rcvTime, }) - return nil } -func (c *Client) createNewSession(negotiatedVersions []protocol.VersionNumber) error { +func (c *client) handlePacketWithVersionFlag(hdr *PublicHeader) error { + for _, v := range hdr.SupportedVersions { + if v == c.version { + // the version negotiation packet contains the version that we offered + // this might be a packet sent by an attacker (or by a terribly broken server implementation) + // ignore it + return nil + } + } + + newVersion := protocol.ChooseSupportedVersion(c.config.Versions, hdr.SupportedVersions) + if newVersion == protocol.VersionUnsupported { + return qerr.InvalidVersion + } + + // switch to negotiated version + c.version = newVersion + c.versionNegotiated = true var err error - c.session, err = newClientSession(c.conn, c.addr, c.hostname, c.version, c.connectionID, c.tlsConfig, c.streamCallback, c.closeCallback, c.cryptoChangeCallback, negotiatedVersions) + c.connectionID, err = utils.GenerateConnectionID() + if err != nil { + return err + } + utils.Infof("Switching to QUIC version %d. New connection ID: %x", newVersion, c.connectionID) + + c.session.Close(errCloseSessionForNewVersion) + return c.createNewSession(hdr.SupportedVersions) +} + +func (c *client) createNewSession(negotiatedVersions []protocol.VersionNumber) error { + var err error + c.session, c.handshakeChan, err = newClientSession( + c.conn, + c.hostname, + c.version, + c.connectionID, + c.tlsConf, + c.config, + negotiatedVersions, + ) if err != nil { return err } - go c.session.run() + go func() { + // session.run() returns as soon as the session is closed + err := c.session.run() + if err == errCloseSessionForNewVersion { + return + } + c.listenErr = err + close(c.errorChan) + + utils.Infof("Connection %x closed.", c.connectionID) + c.conn.Close() + }() return nil } - -func (c *Client) streamCallback(session *Session, stream utils.Stream) {} - -func (c *Client) closeCallback(id protocol.ConnectionID) { - utils.Infof("Connection %x closed.", id) -} diff --git a/vendor/github.com/lucas-clemente/quic-go/codecov.yml b/vendor/github.com/lucas-clemente/quic-go/codecov.yml index 8fa7519..d85e781 100644 --- a/vendor/github.com/lucas-clemente/quic-go/codecov.yml +++ b/vendor/github.com/lucas-clemente/quic-go/codecov.yml @@ -4,8 +4,8 @@ coverage: - ackhandler/packet_linkedlist.go - h2quic/gzipreader.go - h2quic/response.go - - utils/byteinterval_linkedlist.go - - utils/packetinterval_linkedlist.go + - internal/utils/byteinterval_linkedlist.go + - internal/utils/packetinterval_linkedlist.go status: project: default: diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/bandwidth.go b/vendor/github.com/lucas-clemente/quic-go/congestion/bandwidth.go index 2c7ff23..e76ea16 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/bandwidth.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/bandwidth.go @@ -12,12 +12,8 @@ type Bandwidth uint64 const ( // BitsPerSecond is 1 bit per second BitsPerSecond Bandwidth = 1 - // KBitsPerSecond is 1000 bits per second - KBitsPerSecond = 1000 * BitsPerSecond // BytesPerSecond is 1 byte per second BytesPerSecond = 8 * BitsPerSecond - // KBytesPerSecond is 1000 bytes per second - KBytesPerSecond = 1000 * BytesPerSecond ) // BandwidthFromDelta calculates the bandwidth from a number of bytes and a time delta diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/congestion_vector.go b/vendor/github.com/lucas-clemente/quic-go/congestion/congestion_vector.go deleted file mode 100644 index 9c6ebb4..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/congestion_vector.go +++ /dev/null @@ -1,12 +0,0 @@ -package congestion - -import "github.com/lucas-clemente/quic-go/protocol" - -// PacketInfo combines packet number and length of a packet for congestion calculation -type PacketInfo struct { - Number protocol.PacketNumber - Length protocol.ByteCount -} - -// PacketVector is passed to the congestion algorithm -type PacketVector []PacketInfo diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/cubic.go b/vendor/github.com/lucas-clemente/quic-go/congestion/cubic.go index e6e8bf6..62e7355 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/cubic.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/cubic.go @@ -4,8 +4,8 @@ import ( "math" "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // This cubic implementation is based on the one found in Chromiums's QUIC @@ -184,9 +184,19 @@ func (c *Cubic) CongestionWindowAfterAck(currentCongestionWindow protocol.Packet elapsedTime := int64((currentTime.Add(delayMin).Sub(c.epoch)/time.Microsecond)<<10) / 1000000 offset := int64(c.timeToOriginPoint) - elapsedTime + // Right-shifts of negative, signed numbers have + // implementation-dependent behavior. Force the offset to be + // positive, similar to the kernel implementation. + if offset < 0 { + offset = -offset + } deltaCongestionWindow := protocol.PacketNumber((cubeCongestionWindowScale * offset * offset * offset) >> cubeScale) - targetCongestionWindow := c.originPointCongestionWindow - deltaCongestionWindow - + var targetCongestionWindow protocol.PacketNumber + if elapsedTime > int64(c.timeToOriginPoint) { + targetCongestionWindow = c.originPointCongestionWindow + deltaCongestionWindow + } else { + targetCongestionWindow = c.originPointCongestionWindow - deltaCongestionWindow + } // With dynamic beta/alpha based on number of active streams, it is possible // for the required_ack_count to become much lower than acked_packets_count_ // suddenly, leading to more than one iteration through the following loop. diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/cubic_sender.go b/vendor/github.com/lucas-clemente/quic-go/congestion/cubic_sender.go index a34a69d..02e4206 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/cubic_sender.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/cubic_sender.go @@ -3,8 +3,8 @@ package congestion import ( "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) const ( @@ -125,24 +125,13 @@ func (c *cubicSender) SlowstartThreshold() protocol.PacketNumber { return c.slowstartThreshold } -// OnCongestionEvent indicates an update to the congestion state, caused either by an incoming -// ack or loss event timeout. |rttUpdated| indicates whether a new -// latest_rtt sample has been taken, |byte_in_flight| the bytes in flight -// prior to the congestion event. |ackedPackets| and |lostPackets| are -// any packets considered acked or lost as a result of the congestion event. -func (c *cubicSender) OnCongestionEvent(rttUpdated bool, bytesInFlight protocol.ByteCount, ackedPackets PacketVector, lostPackets PacketVector) { - if rttUpdated && c.InSlowStart() && c.hybridSlowStart.ShouldExitSlowStart(c.rttStats.LatestRTT(), c.rttStats.MinRTT(), c.GetCongestionWindow()/protocol.DefaultTCPMSS) { +func (c *cubicSender) MaybeExitSlowStart() { + if c.InSlowStart() && c.hybridSlowStart.ShouldExitSlowStart(c.rttStats.LatestRTT(), c.rttStats.MinRTT(), c.GetCongestionWindow()/protocol.DefaultTCPMSS) { c.ExitSlowstart() } - for _, i := range lostPackets { - c.onPacketLost(i.Number, i.Length, bytesInFlight) - } - for _, i := range ackedPackets { - c.onPacketAcked(i.Number, i.Length, bytesInFlight) - } } -func (c *cubicSender) onPacketAcked(ackedPacketNumber protocol.PacketNumber, ackedBytes protocol.ByteCount, bytesInFlight protocol.ByteCount) { +func (c *cubicSender) OnPacketAcked(ackedPacketNumber protocol.PacketNumber, ackedBytes protocol.ByteCount, bytesInFlight protocol.ByteCount) { c.largestAckedPacketNumber = utils.MaxPacketNumber(ackedPacketNumber, c.largestAckedPacketNumber) if c.InRecovery() { // PRR is used when in recovery. @@ -155,7 +144,7 @@ func (c *cubicSender) onPacketAcked(ackedPacketNumber protocol.PacketNumber, ack } } -func (c *cubicSender) onPacketLost(packetNumber protocol.PacketNumber, lostBytes protocol.ByteCount, bytesInFlight protocol.ByteCount) { +func (c *cubicSender) OnPacketLost(packetNumber protocol.PacketNumber, lostBytes protocol.ByteCount, bytesInFlight protocol.ByteCount) { // TCP NewReno (RFC6582) says that once a loss occurs, any losses in packets // already sent should be treated as a single loss event, since it's expected. if packetNumber <= c.largestSentAtLastCutback { diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/hybrid_slow_start.go b/vendor/github.com/lucas-clemente/quic-go/congestion/hybrid_slow_start.go index 29204ff..01a64f8 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/hybrid_slow_start.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/hybrid_slow_start.go @@ -3,8 +3,8 @@ package congestion import ( "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // Note(pwestin): the magic clamping numbers come from the original code in diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/interface.go b/vendor/github.com/lucas-clemente/quic-go/congestion/interface.go index 593c09e..bbce0a6 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/interface.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/interface.go @@ -11,7 +11,9 @@ type SendAlgorithm interface { TimeUntilSend(now time.Time, bytesInFlight protocol.ByteCount) time.Duration OnPacketSent(sentTime time.Time, bytesInFlight protocol.ByteCount, packetNumber protocol.PacketNumber, bytes protocol.ByteCount, isRetransmittable bool) bool GetCongestionWindow() protocol.ByteCount - OnCongestionEvent(rttUpdated bool, bytesInFlight protocol.ByteCount, ackedPackets PacketVector, lostPackets PacketVector) + MaybeExitSlowStart() + OnPacketAcked(number protocol.PacketNumber, ackedBytes protocol.ByteCount, bytesInFlight protocol.ByteCount) + OnPacketLost(number protocol.PacketNumber, lostBytes protocol.ByteCount, bytesInFlight protocol.ByteCount) SetNumEmulatedConnections(n int) OnRetransmissionTimeout(packetsRetransmitted bool) OnConnectionMigration() diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/prr_sender.go b/vendor/github.com/lucas-clemente/quic-go/congestion/prr_sender.go index f8e6d59..b8a0a10 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/prr_sender.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/prr_sender.go @@ -3,8 +3,8 @@ package congestion import ( "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // PrrSender implements the Proportional Rate Reduction (PRR) per RFC 6937 diff --git a/vendor/github.com/lucas-clemente/quic-go/congestion/rtt_stats.go b/vendor/github.com/lucas-clemente/quic-go/congestion/rtt_stats.go index 0bf7b05..546c1cb 100644 --- a/vendor/github.com/lucas-clemente/quic-go/congestion/rtt_stats.go +++ b/vendor/github.com/lucas-clemente/quic-go/congestion/rtt_stats.go @@ -3,7 +3,7 @@ package congestion import ( "time" - "github.com/lucas-clemente/quic-go/utils" + "github.com/lucas-clemente/quic-go/internal/utils" ) const ( diff --git a/vendor/github.com/lucas-clemente/quic-go/conn.go b/vendor/github.com/lucas-clemente/quic-go/conn.go new file mode 100644 index 0000000..700c147 --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/conn.go @@ -0,0 +1,54 @@ +package quic + +import ( + "net" + "sync" +) + +type connection interface { + Write([]byte) error + Read([]byte) (int, net.Addr, error) + Close() error + LocalAddr() net.Addr + RemoteAddr() net.Addr + SetCurrentRemoteAddr(net.Addr) +} + +type conn struct { + mutex sync.RWMutex + + pconn net.PacketConn + currentAddr net.Addr +} + +var _ connection = &conn{} + +func (c *conn) Write(p []byte) error { + _, err := c.pconn.WriteTo(p, c.currentAddr) + return err +} + +func (c *conn) Read(p []byte) (int, net.Addr, error) { + return c.pconn.ReadFrom(p) +} + +func (c *conn) SetCurrentRemoteAddr(addr net.Addr) { + c.mutex.Lock() + c.currentAddr = addr + c.mutex.Unlock() +} + +func (c *conn) LocalAddr() net.Addr { + return c.pconn.LocalAddr() +} + +func (c *conn) RemoteAddr() net.Addr { + c.mutex.RLock() + addr := c.currentAddr + c.mutex.RUnlock() + return addr +} + +func (c *conn) Close() error { + return c.pconn.Close() +} diff --git a/vendor/github.com/lucas-clemente/quic-go/crypto/cert_chain.go b/vendor/github.com/lucas-clemente/quic-go/crypto/cert_chain.go index 0fd905a..f3bc9fb 100644 --- a/vendor/github.com/lucas-clemente/quic-go/crypto/cert_chain.go +++ b/vendor/github.com/lucas-clemente/quic-go/crypto/cert_chain.go @@ -55,30 +55,59 @@ func (c *certChain) GetLeafCert(sni string) ([]byte, error) { return cert.Certificate[0], nil } -func (c *certChain) getCertForSNI(sni string) (*tls.Certificate, error) { - if c.config.GetCertificate != nil { - cert, err := c.config.GetCertificate(&tls.ClientHelloInfo{ServerName: sni}) - if err != nil { - return nil, err +func (cc *certChain) getCertForSNI(sni string) (*tls.Certificate, error) { + c := cc.config + c, err := maybeGetConfigForClient(c, sni) + if err != nil { + return nil, err + } + // The rest of this function is mostly copied from crypto/tls.getCertificate + + if c.GetCertificate != nil { + cert, err := c.GetCertificate(&tls.ClientHelloInfo{ServerName: sni}) + if cert != nil || err != nil { + return cert, err } - if cert != nil { + } + + if len(c.Certificates) == 0 { + return nil, errNoMatchingCertificate + } + + if len(c.Certificates) == 1 || c.NameToCertificate == nil { + // There's only one choice, so no point doing any work. + return &c.Certificates[0], nil + } + + name := strings.ToLower(sni) + for len(name) > 0 && name[len(name)-1] == '.' { + name = name[:len(name)-1] + } + + if cert, ok := c.NameToCertificate[name]; ok { + return cert, nil + } + + // try replacing labels in the name with wildcards until we get a + // match. + labels := strings.Split(name, ".") + for i := range labels { + labels[i] = "*" + candidate := strings.Join(labels, ".") + if cert, ok := c.NameToCertificate[candidate]; ok { return cert, nil } } - if len(c.config.NameToCertificate) != 0 { - if cert, ok := c.config.NameToCertificate[sni]; ok { - return cert, nil - } - wildcardSNI := "*" + strings.TrimLeftFunc(sni, func(r rune) bool { return r != '.' }) - if cert, ok := c.config.NameToCertificate[wildcardSNI]; ok { - return cert, nil - } - } - - if len(c.config.Certificates) != 0 { - return &c.config.Certificates[0], nil - } - - return nil, errNoMatchingCertificate + // If nothing matches, return the first certificate. + return &c.Certificates[0], nil +} + +func maybeGetConfigForClient(c *tls.Config, sni string) (*tls.Config, error) { + if c.GetConfigForClient == nil { + return c, nil + } + return c.GetConfigForClient(&tls.ClientHelloInfo{ + ServerName: sni, + }) } diff --git a/vendor/github.com/lucas-clemente/quic-go/crypto/cert_compression.go b/vendor/github.com/lucas-clemente/quic-go/crypto/cert_compression.go index f7676d5..ea5ecff 100644 --- a/vendor/github.com/lucas-clemente/quic-go/crypto/cert_compression.go +++ b/vendor/github.com/lucas-clemente/quic-go/crypto/cert_compression.go @@ -9,7 +9,7 @@ import ( "fmt" "hash/fnv" - "github.com/lucas-clemente/quic-go/utils" + "github.com/lucas-clemente/quic-go/internal/utils" ) type entryType uint8 @@ -142,7 +142,7 @@ func decompressChain(data []byte) ([][]byte, error) { } if numCerts == 0 { - return make([][]byte, 0, 0), nil + return make([][]byte, 0), nil } if hasCompressedCerts { @@ -255,7 +255,7 @@ func splitHashes(hashes []byte) ([]uint64, error) { } func getCommonCertificateHashes() []byte { - ccs := make([]byte, 8*len(certSets), 8*len(certSets)) + ccs := make([]byte, 8*len(certSets)) i := 0 for certSetHash := range certSets { binary.LittleEndian.PutUint64(ccs[i*8:(i+1)*8], certSetHash) diff --git a/vendor/github.com/lucas-clemente/quic-go/crypto/cert_manager.go b/vendor/github.com/lucas-clemente/quic-go/crypto/cert_manager.go index 5622784..5aaa187 100644 --- a/vendor/github.com/lucas-clemente/quic-go/crypto/cert_manager.go +++ b/vendor/github.com/lucas-clemente/quic-go/crypto/cert_manager.go @@ -41,7 +41,7 @@ func (c *certManager) SetData(data []byte) error { return qerr.Error(qerr.InvalidCryptoMessageParameter, "Certificate data invalid") } - chain := make([]*x509.Certificate, len(byteChain), len(byteChain)) + chain := make([]*x509.Certificate, len(byteChain)) for i, data := range byteChain { cert, err := x509.ParseCertificate(data) if err != nil { @@ -107,15 +107,14 @@ func (c *certManager) Verify(hostname string) error { var opts x509.VerifyOptions if c.config != nil { opts.Roots = c.config.RootCAs - opts.DNSName = c.config.ServerName if c.config.Time == nil { opts.CurrentTime = time.Now() } else { opts.CurrentTime = c.config.Time() } - } else { - opts.DNSName = hostname } + // we don't need to care about the tls.Config.ServerName here, since hostname has already been set to that value in the session setup + opts.DNSName = hostname // the first certificate is the leaf certificate, all others are intermediates if len(c.chain) > 1 { diff --git a/vendor/github.com/lucas-clemente/quic-go/crypto/key_derivation.go b/vendor/github.com/lucas-clemente/quic-go/crypto/key_derivation.go index 470137f..accdbea 100644 --- a/vendor/github.com/lucas-clemente/quic-go/crypto/key_derivation.go +++ b/vendor/github.com/lucas-clemente/quic-go/crypto/key_derivation.go @@ -5,8 +5,8 @@ import ( "crypto/sha256" "io" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" "golang.org/x/crypto/hkdf" ) diff --git a/vendor/github.com/lucas-clemente/quic-go/crypto/null_aead.go b/vendor/github.com/lucas-clemente/quic-go/crypto/null_aead.go index 5aa198c..ed85663 100644 --- a/vendor/github.com/lucas-clemente/quic-go/crypto/null_aead.go +++ b/vendor/github.com/lucas-clemente/quic-go/crypto/null_aead.go @@ -8,13 +8,24 @@ import ( "github.com/lucas-clemente/quic-go/protocol" ) -// NullAEAD handles not-yet encrypted packets -type NullAEAD struct{} +// nullAEAD handles not-yet encrypted packets +type nullAEAD struct { + perspective protocol.Perspective + version protocol.VersionNumber +} -var _ AEAD = &NullAEAD{} +var _ AEAD = &nullAEAD{} + +// NewNullAEAD creates a NullAEAD +func NewNullAEAD(p protocol.Perspective, v protocol.VersionNumber) AEAD { + return &nullAEAD{ + perspective: p, + version: v, + } +} // Open and verify the ciphertext -func (NullAEAD) Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, error) { +func (n *nullAEAD) Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, error) { if len(src) < 12 { return nil, errors.New("NullAEAD: ciphertext cannot be less than 12 bytes long") } @@ -22,6 +33,13 @@ func (NullAEAD) Open(dst, src []byte, packetNumber protocol.PacketNumber, associ hash := fnv128a.New() hash.Write(associatedData) hash.Write(src[12:]) + if n.version >= protocol.Version37 { + if n.perspective == protocol.PerspectiveServer { + hash.Write([]byte("Client")) + } else { + hash.Write([]byte("Server")) + } + } testHigh, testLow := hash.Sum128() low := binary.LittleEndian.Uint64(src) @@ -34,7 +52,7 @@ func (NullAEAD) Open(dst, src []byte, packetNumber protocol.PacketNumber, associ } // Seal writes hash and ciphertext to the buffer -func (NullAEAD) Seal(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { +func (n *nullAEAD) Seal(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { if cap(dst) < 12+len(src) { dst = make([]byte, 12+len(src)) } else { @@ -44,6 +62,15 @@ func (NullAEAD) Seal(dst, src []byte, packetNumber protocol.PacketNumber, associ hash := fnv128a.New() hash.Write(associatedData) hash.Write(src) + + if n.version >= protocol.Version37 { + if n.perspective == protocol.PerspectiveServer { + hash.Write([]byte("Server")) + } else { + hash.Write([]byte("Client")) + } + } + high, low := hash.Sum128() copy(dst[12:], src) diff --git a/vendor/github.com/lucas-clemente/quic-go/crypto/source_address_token.go b/vendor/github.com/lucas-clemente/quic-go/crypto/source_address_token.go index 6afdacd..3dcb26a 100644 --- a/vendor/github.com/lucas-clemente/quic-go/crypto/source_address_token.go +++ b/vendor/github.com/lucas-clemente/quic-go/crypto/source_address_token.go @@ -5,48 +5,18 @@ import ( "crypto/cipher" "crypto/rand" "crypto/sha256" - "crypto/subtle" - "encoding/binary" - "errors" "fmt" "io" - "net" - "time" - - "github.com/lucas-clemente/quic-go/protocol" "golang.org/x/crypto/hkdf" ) // StkSource is used to create and verify source address tokens type StkSource interface { - // NewToken creates a new token for a given IP address - NewToken(ip net.IP) ([]byte, error) - // VerifyToken verifies if a token matches a given IP address and is not outdated - VerifyToken(ip net.IP, data []byte) error -} - -type sourceAddressToken struct { - ip net.IP - // unix timestamp in seconds - timestamp uint64 -} - -func (t *sourceAddressToken) serialize() []byte { - res := make([]byte, 8+len(t.ip)) - binary.LittleEndian.PutUint64(res, t.timestamp) - copy(res[8:], t.ip) - return res -} - -func parseToken(data []byte) (*sourceAddressToken, error) { - if len(data) != 8+4 && len(data) != 8+16 { - return nil, fmt.Errorf("invalid STK length: %d", len(data)) - } - return &sourceAddressToken{ - ip: data[8:], - timestamp: binary.LittleEndian.Uint64(data), - }, nil + // NewToken creates a new token + NewToken([]byte) ([]byte, error) + // DecodeToken decodes a token + DecodeToken([]byte) ([]byte, error) } type stkSource struct { @@ -60,7 +30,11 @@ const stkKeySize = 16 const stkNonceSize = 16 // NewStkSource creates a source for source address tokens -func NewStkSource(secret []byte) (StkSource, error) { +func NewStkSource() (StkSource, error) { + secret := make([]byte, 32) + if _, err := rand.Read(secret); err != nil { + return nil, err + } key, err := deriveKey(secret) if err != nil { return nil, err @@ -76,38 +50,20 @@ func NewStkSource(secret []byte) (StkSource, error) { return &stkSource{aead: aead}, nil } -func (s *stkSource) NewToken(ip net.IP) ([]byte, error) { - return encryptToken(s.aead, &sourceAddressToken{ - ip: ip, - timestamp: uint64(time.Now().Unix()), - }) +func (s *stkSource) NewToken(data []byte) ([]byte, error) { + nonce := make([]byte, stkNonceSize) + if _, err := rand.Read(nonce); err != nil { + return nil, err + } + return s.aead.Seal(nonce, nonce, data, nil), nil } -func (s *stkSource) VerifyToken(ip net.IP, data []byte) error { - if len(data) < stkNonceSize { - return errors.New("STK too short") +func (s *stkSource) DecodeToken(p []byte) ([]byte, error) { + if len(p) < stkNonceSize { + return nil, fmt.Errorf("STK too short: %d", len(p)) } - nonce := data[:stkNonceSize] - - res, err := s.aead.Open(nil, nonce, data[stkNonceSize:], nil) - if err != nil { - return err - } - - token, err := parseToken(res) - if err != nil { - return err - } - - if subtle.ConstantTimeCompare(token.ip, ip) != 1 { - return errors.New("invalid ip in STK") - } - - if time.Now().Unix() > int64(token.timestamp)+protocol.STKExpiryTimeSec { - return errors.New("STK expired") - } - - return nil + nonce := p[:stkNonceSize] + return s.aead.Open(nil, nonce, p[stkNonceSize:], nil) } func deriveKey(secret []byte) ([]byte, error) { @@ -118,11 +74,3 @@ func deriveKey(secret []byte) ([]byte, error) { } return key, nil } - -func encryptToken(aead cipher.AEAD, token *sourceAddressToken) ([]byte, error) { - nonce := make([]byte, stkNonceSize) - if _, err := rand.Read(nonce); err != nil { - return nil, err - } - return aead.Seal(nonce, nonce, token.serialize(), nil), nil -} diff --git a/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_control_manager.go b/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_control_manager.go index a6cc577..9362d60 100644 --- a/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_control_manager.go +++ b/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_control_manager.go @@ -7,18 +7,18 @@ import ( "github.com/lucas-clemente/quic-go/congestion" "github.com/lucas-clemente/quic-go/handshake" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) type flowControlManager struct { connectionParameters handshake.ConnectionParametersManager rttStats *congestion.RTTStats - streamFlowController map[protocol.StreamID]*flowController - contributesToConnectionFlowControl map[protocol.StreamID]bool - mutex sync.RWMutex + streamFlowController map[protocol.StreamID]*flowController + connFlowController *flowController + mutex sync.RWMutex } var _ FlowControlManager = &flowControlManager{} @@ -27,20 +27,17 @@ var errMapAccess = errors.New("Error accessing the flowController map.") // NewFlowControlManager creates a new flow control manager func NewFlowControlManager(connectionParameters handshake.ConnectionParametersManager, rttStats *congestion.RTTStats) FlowControlManager { - fcm := flowControlManager{ - connectionParameters: connectionParameters, - rttStats: rttStats, - streamFlowController: make(map[protocol.StreamID]*flowController), - contributesToConnectionFlowControl: make(map[protocol.StreamID]bool), + return &flowControlManager{ + connectionParameters: connectionParameters, + rttStats: rttStats, + streamFlowController: make(map[protocol.StreamID]*flowController), + connFlowController: newFlowController(0, false, connectionParameters, rttStats), } - // initialize connection level flow controller - fcm.streamFlowController[0] = newFlowController(0, connectionParameters, rttStats) - fcm.contributesToConnectionFlowControl[0] = false - return &fcm } // NewStream creates new flow controllers for a stream -func (f *flowControlManager) NewStream(streamID protocol.StreamID, contributesToConnectionFlow bool) { +// it does nothing if the stream already exists +func (f *flowControlManager) NewStream(streamID protocol.StreamID, contributesToConnection bool) { f.mutex.Lock() defer f.mutex.Unlock() @@ -48,15 +45,13 @@ func (f *flowControlManager) NewStream(streamID protocol.StreamID, contributesTo return } - f.streamFlowController[streamID] = newFlowController(streamID, f.connectionParameters, f.rttStats) - f.contributesToConnectionFlowControl[streamID] = contributesToConnectionFlow + f.streamFlowController[streamID] = newFlowController(streamID, contributesToConnection, f.connectionParameters, f.rttStats) } // RemoveStream removes a closed stream from flow control func (f *flowControlManager) RemoveStream(streamID protocol.StreamID) { f.mutex.Lock() delete(f.streamFlowController, streamID) - delete(f.contributesToConnectionFlowControl, streamID) f.mutex.Unlock() } @@ -77,31 +72,19 @@ func (f *flowControlManager) ResetStream(streamID protocol.StreamID, byteOffset } if streamFlowController.CheckFlowControlViolation() { - return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes on stream %d, allowed %d bytes", byteOffset, streamID, streamFlowController.receiveFlowControlWindow)) + return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes on stream %d, allowed %d bytes", byteOffset, streamID, streamFlowController.receiveWindow)) } - if f.contributesToConnectionFlowControl[streamID] { - connectionFlowController := f.streamFlowController[0] - connectionFlowController.IncrementHighestReceived(increment) - if connectionFlowController.CheckFlowControlViolation() { - return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes for the connection, allowed %d bytes", byteOffset, connectionFlowController.receiveFlowControlWindow)) + if streamFlowController.ContributesToConnection() { + f.connFlowController.IncrementHighestReceived(increment) + if f.connFlowController.CheckFlowControlViolation() { + return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes for the connection, allowed %d bytes", f.connFlowController.highestReceived, f.connFlowController.receiveWindow)) } } return nil } -func (f *flowControlManager) GetBytesSent(streamID protocol.StreamID) (protocol.ByteCount, error) { - f.mutex.Lock() - defer f.mutex.Unlock() - - fc, err := f.getFlowController(streamID) - if err != nil { - return 0, err - } - return fc.GetBytesSent(), nil -} - // UpdateHighestReceived updates the highest received byte offset for a stream // it adds the number of additional bytes to connection level flow control // streamID must not be 0 here @@ -118,14 +101,13 @@ func (f *flowControlManager) UpdateHighestReceived(streamID protocol.StreamID, b increment, _ := streamFlowController.UpdateHighestReceived(byteOffset) if streamFlowController.CheckFlowControlViolation() { - return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes on stream %d, allowed %d bytes", byteOffset, streamID, streamFlowController.receiveFlowControlWindow)) + return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes on stream %d, allowed %d bytes", byteOffset, streamID, streamFlowController.receiveWindow)) } - if f.contributesToConnectionFlowControl[streamID] { - connectionFlowController := f.streamFlowController[0] - connectionFlowController.IncrementHighestReceived(increment) - if connectionFlowController.CheckFlowControlViolation() { - return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes for the connection, allowed %d bytes", byteOffset, connectionFlowController.receiveFlowControlWindow)) + if streamFlowController.ContributesToConnection() { + f.connFlowController.IncrementHighestReceived(increment) + if f.connFlowController.CheckFlowControlViolation() { + return qerr.Error(qerr.FlowControlReceivedTooMuchData, fmt.Sprintf("Received %d bytes for the connection, allowed %d bytes", f.connFlowController.highestReceived, f.connFlowController.receiveWindow)) } } @@ -137,15 +119,14 @@ func (f *flowControlManager) AddBytesRead(streamID protocol.StreamID, n protocol f.mutex.Lock() defer f.mutex.Unlock() - streamFlowController, err := f.getFlowController(streamID) + fc, err := f.getFlowController(streamID) if err != nil { return err } - streamFlowController.AddBytesRead(n) - - if f.contributesToConnectionFlowControl[streamID] { - f.streamFlowController[0].AddBytesRead(n) + fc.AddBytesRead(n) + if fc.ContributesToConnection() { + f.connFlowController.AddBytesRead(n) } return nil @@ -154,38 +135,53 @@ func (f *flowControlManager) AddBytesRead(streamID protocol.StreamID, n protocol func (f *flowControlManager) GetWindowUpdates() (res []WindowUpdate) { f.mutex.Lock() defer f.mutex.Unlock() + + // get WindowUpdates for streams for id, fc := range f.streamFlowController { - if necessary, offset := fc.MaybeTriggerWindowUpdate(); necessary { + if necessary, newIncrement, offset := fc.MaybeUpdateWindow(); necessary { res = append(res, WindowUpdate{StreamID: id, Offset: offset}) + if fc.ContributesToConnection() && newIncrement != 0 { + f.connFlowController.EnsureMinimumWindowIncrement(protocol.ByteCount(float64(newIncrement) * protocol.ConnectionFlowControlMultiplier)) + } } } - return res + // get a WindowUpdate for the connection + if necessary, _, offset := f.connFlowController.MaybeUpdateWindow(); necessary { + res = append(res, WindowUpdate{StreamID: 0, Offset: offset}) + } + + return } func (f *flowControlManager) GetReceiveWindow(streamID protocol.StreamID) (protocol.ByteCount, error) { - f.mutex.Lock() - defer f.mutex.Unlock() + f.mutex.RLock() + defer f.mutex.RUnlock() + + // StreamID can be 0 when retransmitting + if streamID == 0 { + return f.connFlowController.receiveWindow, nil + } + flowController, err := f.getFlowController(streamID) if err != nil { return 0, err } - return flowController.receiveFlowControlWindow, nil + return flowController.receiveWindow, nil } // streamID must not be 0 here func (f *flowControlManager) AddBytesSent(streamID protocol.StreamID, n protocol.ByteCount) error { - // Only lock the part reading from the map, since send-windows are only accessed from the session goroutine. f.mutex.Lock() - streamFlowController, err := f.getFlowController(streamID) - f.mutex.Unlock() + defer f.mutex.Unlock() + + fc, err := f.getFlowController(streamID) if err != nil { return err } - streamFlowController.AddBytesSent(n) - - if f.contributesToConnectionFlowControl[streamID] { - f.streamFlowController[0].AddBytesSent(n) + fc.AddBytesSent(n) + if fc.ContributesToConnection() { + f.connFlowController.AddBytesSent(n) } return nil @@ -193,45 +189,46 @@ func (f *flowControlManager) AddBytesSent(streamID protocol.StreamID, n protocol // must not be called with StreamID 0 func (f *flowControlManager) SendWindowSize(streamID protocol.StreamID) (protocol.ByteCount, error) { - // Only lock the part reading from the map, since send-windows are only accessed from the session goroutine. f.mutex.RLock() - streamFlowController, err := f.getFlowController(streamID) - f.mutex.RUnlock() + defer f.mutex.RUnlock() + + fc, err := f.getFlowController(streamID) if err != nil { return 0, err } - res := streamFlowController.SendWindowSize() + res := fc.SendWindowSize() - contributes, ok := f.contributesToConnectionFlowControl[streamID] - if !ok { - return 0, errMapAccess - } - if contributes { - res = utils.MinByteCount(res, f.streamFlowController[0].SendWindowSize()) + if fc.ContributesToConnection() { + res = utils.MinByteCount(res, f.connFlowController.SendWindowSize()) } return res, nil } func (f *flowControlManager) RemainingConnectionWindowSize() protocol.ByteCount { - // Only lock the part reading from the map, since send-windows are only accessed from the session goroutine. f.mutex.RLock() - res := f.streamFlowController[0].SendWindowSize() - f.mutex.RUnlock() - return res + defer f.mutex.RUnlock() + + return f.connFlowController.SendWindowSize() } // streamID may be 0 here func (f *flowControlManager) UpdateWindow(streamID protocol.StreamID, offset protocol.ByteCount) (bool, error) { - // Only lock the part reading from the map, since send-windows are only accessed from the session goroutine. f.mutex.Lock() - streamFlowController, err := f.getFlowController(streamID) - f.mutex.Unlock() - if err != nil { - return false, err + defer f.mutex.Unlock() + + var fc *flowController + if streamID == 0 { + fc = f.connFlowController + } else { + var err error + fc, err = f.getFlowController(streamID) + if err != nil { + return false, err + } } - return streamFlowController.UpdateSendWindow(offset), nil + return fc.UpdateSendWindow(offset), nil } func (f *flowControlManager) getFlowController(streamID protocol.StreamID) (*flowController, error) { diff --git a/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_controller.go b/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_controller.go index 4dadf7c..387ee05 100644 --- a/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_controller.go +++ b/vendor/github.com/lucas-clemente/quic-go/flowcontrol/flow_controller.go @@ -6,91 +6,93 @@ import ( "github.com/lucas-clemente/quic-go/congestion" "github.com/lucas-clemente/quic-go/handshake" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) type flowController struct { - streamID protocol.StreamID + streamID protocol.StreamID + contributesToConnection bool // does the stream contribute to connection level flow control connectionParameters handshake.ConnectionParametersManager rttStats *congestion.RTTStats - bytesSent protocol.ByteCount - sendFlowControlWindow protocol.ByteCount + bytesSent protocol.ByteCount + sendWindow protocol.ByteCount lastWindowUpdateTime time.Time - bytesRead protocol.ByteCount - highestReceived protocol.ByteCount - receiveFlowControlWindow protocol.ByteCount - receiveFlowControlWindowIncrement protocol.ByteCount - maxReceiveFlowControlWindowIncrement protocol.ByteCount + bytesRead protocol.ByteCount + highestReceived protocol.ByteCount + receiveWindow protocol.ByteCount + receiveWindowIncrement protocol.ByteCount + maxReceiveWindowIncrement protocol.ByteCount } // ErrReceivedSmallerByteOffset occurs if the ByteOffset received is smaller than a ByteOffset that was set previously var ErrReceivedSmallerByteOffset = errors.New("Received a smaller byte offset") // newFlowController gets a new flow controller -func newFlowController(streamID protocol.StreamID, connectionParameters handshake.ConnectionParametersManager, rttStats *congestion.RTTStats) *flowController { +func newFlowController(streamID protocol.StreamID, contributesToConnection bool, connectionParameters handshake.ConnectionParametersManager, rttStats *congestion.RTTStats) *flowController { fc := flowController{ - streamID: streamID, - connectionParameters: connectionParameters, - rttStats: rttStats, + streamID: streamID, + contributesToConnection: contributesToConnection, + connectionParameters: connectionParameters, + rttStats: rttStats, } if streamID == 0 { - fc.receiveFlowControlWindow = connectionParameters.GetReceiveConnectionFlowControlWindow() - fc.receiveFlowControlWindowIncrement = fc.receiveFlowControlWindow - fc.maxReceiveFlowControlWindowIncrement = connectionParameters.GetMaxReceiveConnectionFlowControlWindow() + fc.receiveWindow = connectionParameters.GetReceiveConnectionFlowControlWindow() + fc.receiveWindowIncrement = fc.receiveWindow + fc.maxReceiveWindowIncrement = connectionParameters.GetMaxReceiveConnectionFlowControlWindow() } else { - fc.receiveFlowControlWindow = connectionParameters.GetReceiveStreamFlowControlWindow() - fc.receiveFlowControlWindowIncrement = fc.receiveFlowControlWindow - fc.maxReceiveFlowControlWindowIncrement = connectionParameters.GetMaxReceiveStreamFlowControlWindow() + fc.receiveWindow = connectionParameters.GetReceiveStreamFlowControlWindow() + fc.receiveWindowIncrement = fc.receiveWindow + fc.maxReceiveWindowIncrement = connectionParameters.GetMaxReceiveStreamFlowControlWindow() } return &fc } -func (c *flowController) getSendFlowControlWindow() protocol.ByteCount { - if c.sendFlowControlWindow == 0 { +func (c *flowController) ContributesToConnection() bool { + return c.contributesToConnection +} + +func (c *flowController) getSendWindow() protocol.ByteCount { + if c.sendWindow == 0 { if c.streamID == 0 { return c.connectionParameters.GetSendConnectionFlowControlWindow() } return c.connectionParameters.GetSendStreamFlowControlWindow() } - return c.sendFlowControlWindow + return c.sendWindow } func (c *flowController) AddBytesSent(n protocol.ByteCount) { c.bytesSent += n } -func (c *flowController) GetBytesSent() protocol.ByteCount { - return c.bytesSent -} - // UpdateSendWindow should be called after receiving a WindowUpdateFrame // it returns true if the window was actually updated func (c *flowController) UpdateSendWindow(newOffset protocol.ByteCount) bool { - if newOffset > c.sendFlowControlWindow { - c.sendFlowControlWindow = newOffset + if newOffset > c.sendWindow { + c.sendWindow = newOffset return true } return false } func (c *flowController) SendWindowSize() protocol.ByteCount { - sendFlowControlWindow := c.getSendFlowControlWindow() + sendWindow := c.getSendWindow() - if c.bytesSent > sendFlowControlWindow { // should never happen, but make sure we don't do an underflow here + if c.bytesSent > sendWindow { // should never happen, but make sure we don't do an underflow here return 0 } - return sendFlowControlWindow - c.bytesSent + return sendWindow - c.bytesSent } func (c *flowController) SendWindowOffset() protocol.ByteCount { - return c.getSendFlowControlWindow() + return c.getSendWindow() } // UpdateHighestReceived updates the highestReceived value, if the byteOffset is higher @@ -117,28 +119,39 @@ func (c *flowController) IncrementHighestReceived(increment protocol.ByteCount) } func (c *flowController) AddBytesRead(n protocol.ByteCount) { + // pretend we sent a WindowUpdate when reading the first byte + // this way auto-tuning of the window increment already works for the first WindowUpdate + if c.bytesRead == 0 { + c.lastWindowUpdateTime = time.Now() + } c.bytesRead += n } -// MaybeTriggerWindowUpdate determines if it is necessary to send a WindowUpdate -// if so, it returns true and the offset of the window -func (c *flowController) MaybeTriggerWindowUpdate() (bool, protocol.ByteCount) { - diff := c.receiveFlowControlWindow - c.bytesRead +// MaybeUpdateWindow updates the receive window, if necessary +// if the receive window increment is changed, the new value is returned, otherwise a 0 +// the last return value is the new offset of the receive window +func (c *flowController) MaybeUpdateWindow() (bool, protocol.ByteCount /* new increment */, protocol.ByteCount /* new offset */) { + diff := c.receiveWindow - c.bytesRead // Chromium implements the same threshold - if diff < (c.receiveFlowControlWindowIncrement / 2) { + if diff < (c.receiveWindowIncrement / 2) { + var newWindowIncrement protocol.ByteCount + oldWindowIncrement := c.receiveWindowIncrement + c.maybeAdjustWindowIncrement() + if c.receiveWindowIncrement != oldWindowIncrement { + newWindowIncrement = c.receiveWindowIncrement + } + c.lastWindowUpdateTime = time.Now() - - c.receiveFlowControlWindow = c.bytesRead + c.receiveFlowControlWindowIncrement - - return true, c.receiveFlowControlWindow + c.receiveWindow = c.bytesRead + c.receiveWindowIncrement + return true, newWindowIncrement, c.receiveWindow } - return false, 0 + return false, 0, 0 } -// maybeAdjustWindowIncrement increases the receiveFlowControlWindowIncrement if we're sending WindowUpdates too often +// maybeAdjustWindowIncrement increases the receiveWindowIncrement if we're sending WindowUpdates too often func (c *flowController) maybeAdjustWindowIncrement() { if c.lastWindowUpdateTime.IsZero() { return @@ -149,19 +162,19 @@ func (c *flowController) maybeAdjustWindowIncrement() { return } - timeSinceLastWindowUpdate := time.Now().Sub(c.lastWindowUpdateTime) + timeSinceLastWindowUpdate := time.Since(c.lastWindowUpdateTime) // interval between the window updates is sufficiently large, no need to increase the increment if timeSinceLastWindowUpdate >= 2*rtt { return } - oldWindowSize := c.receiveFlowControlWindowIncrement - c.receiveFlowControlWindowIncrement = utils.MinByteCount(2*c.receiveFlowControlWindowIncrement, c.maxReceiveFlowControlWindowIncrement) + oldWindowSize := c.receiveWindowIncrement + c.receiveWindowIncrement = utils.MinByteCount(2*c.receiveWindowIncrement, c.maxReceiveWindowIncrement) // debug log, if the window size was actually increased - if oldWindowSize < c.receiveFlowControlWindowIncrement { - newWindowSize := c.receiveFlowControlWindowIncrement / (1 << 10) + if oldWindowSize < c.receiveWindowIncrement { + newWindowSize := c.receiveWindowIncrement / (1 << 10) if c.streamID == 0 { utils.Debugf("Increasing receive flow control window for the connection to %d kB", newWindowSize) } else { @@ -170,9 +183,16 @@ func (c *flowController) maybeAdjustWindowIncrement() { } } -func (c *flowController) CheckFlowControlViolation() bool { - if c.highestReceived > c.receiveFlowControlWindow { - return true +// EnsureMinimumWindowIncrement sets a minimum window increment +// it is intended be used for the connection-level flow controller +// it should make sure that the connection-level window is increased when a stream-level window grows +func (c *flowController) EnsureMinimumWindowIncrement(inc protocol.ByteCount) { + if inc > c.receiveWindowIncrement { + c.receiveWindowIncrement = utils.MinByteCount(inc, c.maxReceiveWindowIncrement) + c.lastWindowUpdateTime = time.Time{} // disables autotuning for the next window update } - return false +} + +func (c *flowController) CheckFlowControlViolation() bool { + return c.highestReceived > c.receiveWindow } diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/ack_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/ack_frame.go index 0380541..ceeba48 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/ack_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/ack_frame.go @@ -5,8 +5,8 @@ import ( "errors" "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) var ( @@ -222,7 +222,7 @@ func (f *AckFrame) Write(b *bytes.Buffer, version protocol.VersionNumber) error utils.WriteUint48(b, uint64(f.LargestAcked)) } - f.DelayTime = time.Now().Sub(f.PacketReceivedTime) + f.DelayTime = time.Since(f.PacketReceivedTime) utils.WriteUfloat16(b, uint64(f.DelayTime/time.Microsecond)) var numRanges uint64 @@ -332,8 +332,7 @@ func (f *AckFrame) Write(b *bytes.Buffer, version protocol.VersionNumber) error // MinLength of a written frame func (f *AckFrame) MinLength(version protocol.VersionNumber) (protocol.ByteCount, error) { - var length protocol.ByteCount - length = 1 + 2 + 1 // 1 TypeByte, 2 ACK delay time, 1 Num Timestamp + length := protocol.ByteCount(1 + 2 + 1) // 1 TypeByte, 2 ACK delay time, 1 Num Timestamp length += protocol.ByteCount(protocol.GetPacketNumberLength(f.LargestAcked)) missingSequenceNumberDeltaLen := protocol.ByteCount(f.getMissingSequenceNumberDeltaLen()) @@ -351,10 +350,7 @@ func (f *AckFrame) MinLength(version protocol.VersionNumber) (protocol.ByteCount // HasMissingRanges returns if this frame reports any missing packets func (f *AckFrame) HasMissingRanges() bool { - if len(f.AckRanges) > 0 { - return true - } - return false + return len(f.AckRanges) > 0 } func (f *AckFrame) validateAckRanges() bool { diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/blocked_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/blocked_frame.go index b7e640c..4464578 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/blocked_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/blocked_frame.go @@ -3,8 +3,8 @@ package frames import ( "bytes" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // A BlockedFrame in QUIC diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/connection_close_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/connection_close_frame.go index 5681414..5a7ed04 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/connection_close_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/connection_close_frame.go @@ -6,9 +6,9 @@ import ( "io" "math" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // A ConnectionCloseFrame in QUIC diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/goaway_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/goaway_frame.go index 7d452d5..e00a6cf 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/goaway_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/goaway_frame.go @@ -4,9 +4,9 @@ import ( "bytes" "io" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // A GoawayFrame is a GOAWAY frame diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/log.go b/vendor/github.com/lucas-clemente/quic-go/frames/log.go index 1918db1..6b7fdce 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/log.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/log.go @@ -1,6 +1,6 @@ package frames -import "github.com/lucas-clemente/quic-go/utils" +import "github.com/lucas-clemente/quic-go/internal/utils" // LogFrame logs a frame, either sent or received func LogFrame(frame Frame, sent bool) { diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/rst_stream_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/rst_stream_frame.go index 8777875..ea2531c 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/rst_stream_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/rst_stream_frame.go @@ -3,8 +3,8 @@ package frames import ( "bytes" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // A RstStreamFrame in QUIC diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/stop_waiting_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/stop_waiting_frame.go index 8267825..91f937a 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/stop_waiting_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/stop_waiting_frame.go @@ -4,9 +4,9 @@ import ( "bytes" "errors" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // A StopWaitingFrame in QUIC @@ -56,8 +56,7 @@ func (f *StopWaitingFrame) Write(b *bytes.Buffer, version protocol.VersionNumber // MinLength of a written frame func (f *StopWaitingFrame) MinLength(version protocol.VersionNumber) (protocol.ByteCount, error) { - var minLength protocol.ByteCount - minLength = 1 // typeByte + minLength := protocol.ByteCount(1) // typeByte if f.PacketNumberLen == protocol.PacketNumberLenInvalid { return 0, errPacketNumberLenNotSet diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/stream_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/stream_frame.go index fa833f8..7dd6223 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/stream_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/stream_frame.go @@ -4,9 +4,9 @@ import ( "bytes" "errors" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // A StreamFrame of QUIC @@ -64,7 +64,7 @@ func ParseStreamFrame(r *bytes.Reader) (*StreamFrame, error) { return nil, qerr.Error(qerr.InvalidStreamData, "data len too large") } - if dataLen == 0 { + if !frame.DataLenPresent { // The rest of the packet is data dataLen = uint16(r.Len()) } @@ -79,7 +79,11 @@ func ParseStreamFrame(r *bytes.Reader) (*StreamFrame, error) { } } - if !frame.FinBit && len(frame.Data) == 0 { + if frame.Offset+frame.DataLen() < frame.Offset { + return nil, qerr.Error(qerr.InvalidStreamData, "data overflows maximum offset") + } + + if !frame.FinBit && frame.DataLen() == 0 { return nil, qerr.EmptyStreamFrameNoFin } diff --git a/vendor/github.com/lucas-clemente/quic-go/frames/window_update_frame.go b/vendor/github.com/lucas-clemente/quic-go/frames/window_update_frame.go index 93e7f8c..9b8b459 100644 --- a/vendor/github.com/lucas-clemente/quic-go/frames/window_update_frame.go +++ b/vendor/github.com/lucas-clemente/quic-go/frames/window_update_frame.go @@ -3,8 +3,8 @@ package frames import ( "bytes" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // A WindowUpdateFrame in QUIC diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/client.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/client.go index ca18021..866b11a 100644 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/client.go +++ b/vendor/github.com/lucas-clemente/quic-go/h2quic/client.go @@ -15,89 +15,90 @@ import ( "golang.org/x/net/idna" quic "github.com/lucas-clemente/quic-go" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) -type quicClient interface { - OpenStream(protocol.StreamID) (utils.Stream, error) - Close(error) error - Listen() error +type roundTripperOpts struct { + DisableCompression bool } -// Client is a HTTP2 client doing QUIC requests -type Client struct { - mutex sync.RWMutex - cryptoChangedCond sync.Cond +var dialAddr = quic.DialAddr - t *QuicRoundTripper +// client is a HTTP2 client doing QUIC requests +type client struct { + mutex sync.RWMutex + + tlsConf *tls.Config + config *quic.Config + opts *roundTripperOpts hostname string encryptionLevel protocol.EncryptionLevel + handshakeErr error + dialOnce sync.Once - client quicClient - headerStream utils.Stream - headerErr *qerr.QuicError - highestOpenedStream protocol.StreamID - requestWriter *requestWriter + session quic.Session + headerStream quic.Stream + headerErr *qerr.QuicError + headerErrored chan struct{} // this channel is closed if an error occurs on the header stream + requestWriter *requestWriter responses map[protocol.StreamID]chan *http.Response } -var _ h2quicClient = &Client{} +var _ http.RoundTripper = &client{} -// NewClient creates a new client -func NewClient(t *QuicRoundTripper, tlsConfig *tls.Config, hostname string) (*Client, error) { - c := &Client{ - t: t, - hostname: authorityAddr("https", hostname), - highestOpenedStream: 3, - responses: make(map[protocol.StreamID]chan *http.Response), +var defaultQuicConfig = &quic.Config{ + RequestConnectionIDTruncation: true, + KeepAlive: true, +} + +// newClient creates a new client +func newClient( + hostname string, + tlsConfig *tls.Config, + opts *roundTripperOpts, + quicConfig *quic.Config, +) *client { + config := defaultQuicConfig + if quicConfig != nil { + config = quicConfig } - c.cryptoChangedCond = sync.Cond{L: &c.mutex} + return &client{ + hostname: authorityAddr("https", hostname), + responses: make(map[protocol.StreamID]chan *http.Response), + encryptionLevel: protocol.EncryptionUnencrypted, + tlsConf: tlsConfig, + config: config, + opts: opts, + headerErrored: make(chan struct{}), + } +} +// dial dials the connection +func (c *client) dial() error { var err error - c.client, err = quic.NewClient(c.hostname, tlsConfig, c.cryptoChangeCallback, c.versionNegotiateCallback) - if err != nil { - return nil, err - } - - go c.client.Listen() - return c, nil -} - -func (c *Client) handleStreamCb(session *quic.Session, stream utils.Stream) { - utils.Debugf("Handling stream %d", stream.StreamID()) -} - -func (c *Client) cryptoChangeCallback(isForwardSecure bool) { - c.cryptoChangedCond.L.Lock() - defer c.cryptoChangedCond.L.Unlock() - - if isForwardSecure { - c.encryptionLevel = protocol.EncryptionForwardSecure - utils.Debugf("is forward secure") - } else { - c.encryptionLevel = protocol.EncryptionSecure - utils.Debugf("is secure") - } - c.cryptoChangedCond.Broadcast() -} - -func (c *Client) versionNegotiateCallback() error { - var err error - // once the version has been negotiated, open the header stream - c.headerStream, err = c.client.OpenStream(3) + c.session, err = dialAddr(c.hostname, c.tlsConf, c.config) if err != nil { return err } + + // once the version has been negotiated, open the header stream + c.headerStream, err = c.session.OpenStream() + if err != nil { + return err + } + if c.headerStream.StreamID() != 3 { + return errors.New("h2quic Client BUG: StreamID of Header Stream is not 3") + } c.requestWriter = newRequestWriter(c.headerStream) go c.handleHeaderStream() return nil } -func (c *Client) handleHeaderStream() { +func (c *client) handleHeaderStream() { decoder := hpack.NewDecoder(4096, func(hf hpack.HeaderField) {}) h2framer := http2.NewFramer(nil, c.headerStream) @@ -106,7 +107,7 @@ func (c *Client) handleHeaderStream() { for { frame, err := h2framer.ReadFrame() if err != nil { - c.headerErr = qerr.Error(qerr.InvalidStreamData, "cannot read frame") + c.headerErr = qerr.Error(qerr.HeadersStreamDataDecompressFailure, "cannot read frame") break } lastStream = protocol.StreamID(frame.Header().StreamID) @@ -123,7 +124,7 @@ func (c *Client) handleHeaderStream() { } c.mutex.RLock() - headerChan, ok := c.responses[protocol.StreamID(hframe.StreamID)] + responseChan, ok := c.responses[protocol.StreamID(hframe.StreamID)] c.mutex.RUnlock() if !ok { c.headerErr = qerr.Error(qerr.InternalError, fmt.Sprintf("h2client BUG: response channel for stream %d not found", lastStream)) @@ -134,57 +135,53 @@ func (c *Client) handleHeaderStream() { if err != nil { c.headerErr = qerr.Error(qerr.InternalError, err.Error()) } - headerChan <- rsp + responseChan <- rsp } // stop all running request utils.Debugf("Error handling header stream %d: %s", lastStream, c.headerErr.Error()) - c.mutex.Lock() - for _, responseChan := range c.responses { - responseChan <- nil - } - c.mutex.Unlock() + close(c.headerErrored) } -// Do executes a request and returns a response -func (c *Client) Do(req *http.Request) (*http.Response, error) { +// Roundtrip executes a request and returns a response +func (c *client) RoundTrip(req *http.Request) (*http.Response, error) { // TODO: add port to address, if it doesn't have one if req.URL.Scheme != "https" { return nil, errors.New("quic http2: unsupported scheme") } if authorityAddr("https", hostnameFromRequest(req)) != c.hostname { - utils.Debugf("%s vs %s", req.Host, c.hostname) - return nil, errors.New("h2quic Client BUG: Do called for the wrong client") + return nil, fmt.Errorf("h2quic Client BUG: RoundTrip called for the wrong client (expected %s, got %s)", c.hostname, req.Host) + } + + c.dialOnce.Do(func() { + c.handshakeErr = c.dial() + }) + + if c.handshakeErr != nil { + return nil, c.handshakeErr } hasBody := (req.Body != nil) - c.mutex.Lock() - c.highestOpenedStream += 2 - dataStreamID := c.highestOpenedStream - for c.encryptionLevel != protocol.EncryptionForwardSecure { - c.cryptoChangedCond.Wait() - } - hdrChan := make(chan *http.Response) - c.responses[dataStreamID] = hdrChan - c.mutex.Unlock() - - // TODO: think about what to do with a TooManyOpenStreams error. Wait and retry? - dataStream, err := c.client.OpenStream(dataStreamID) + responseChan := make(chan *http.Response) + dataStream, err := c.session.OpenStreamSync() if err != nil { - c.Close(err) + _ = c.CloseWithError(err) return nil, err } + c.mutex.Lock() + c.responses[dataStream.StreamID()] = responseChan + c.mutex.Unlock() var requestedGzip bool - if !c.t.disableCompression() && req.Header.Get("Accept-Encoding") == "" && req.Header.Get("Range") == "" && req.Method != "HEAD" { + if !c.opts.DisableCompression && req.Header.Get("Accept-Encoding") == "" && req.Header.Get("Range") == "" && req.Method != "HEAD" { requestedGzip = true } // TODO: add support for trailers endStream := !hasBody - err = c.requestWriter.WriteRequest(req, dataStreamID, endStream, requestedGzip) + err = c.requestWriter.WriteRequest(req, dataStream.StreamID(), endStream, requestedGzip) if err != nil { - c.Close(err) + _ = c.CloseWithError(err) return nil, err } @@ -206,20 +203,20 @@ func (c *Client) Do(req *http.Request) (*http.Response, error) { for !(bodySent && receivedResponse) { select { - case res = <-hdrChan: + case res = <-responseChan: receivedResponse = true c.mutex.Lock() - delete(c.responses, dataStreamID) + delete(c.responses, dataStream.StreamID()) c.mutex.Unlock() - if res == nil { // an error occured on the header stream - c.Close(c.headerErr) - return nil, c.headerErr - } case err := <-resc: bodySent = true if err != nil { return nil, err } + case <-c.headerErrored: + // an error occured on the header stream + _ = c.CloseWithError(c.headerErr) + return nil, c.headerErr } } @@ -238,16 +235,15 @@ func (c *Client) Do(req *http.Request) (*http.Response, error) { res.Header.Del("Content-Length") res.ContentLength = -1 res.Body = &gzipReader{body: res.Body} - setUncompressed(res) + res.Uncompressed = true } } res.Request = req - return res, nil } -func (c *Client) writeRequestBody(dataStream utils.Stream, body io.ReadCloser) (err error) { +func (c *client) writeRequestBody(dataStream quic.Stream, body io.ReadCloser) (err error) { defer func() { cerr := body.Close() if err == nil { @@ -265,8 +261,15 @@ func (c *Client) writeRequestBody(dataStream utils.Stream, body io.ReadCloser) ( } // Close closes the client -func (c *Client) Close(e error) { - _ = c.client.Close(e) +func (c *client) CloseWithError(e error) error { + if c.session == nil { + return nil + } + return c.session.Close(e) +} + +func (c *client) Close() error { + return c.CloseWithError(nil) } // copied from net/transport.go diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/request_body.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/request_body.go index 41ff5c6..2d4d595 100644 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/request_body.go +++ b/vendor/github.com/lucas-clemente/quic-go/h2quic/request_body.go @@ -3,18 +3,18 @@ package h2quic import ( "io" - "github.com/lucas-clemente/quic-go/utils" + quic "github.com/lucas-clemente/quic-go" ) type requestBody struct { requestRead bool - dataStream utils.Stream + dataStream quic.Stream } // make sure the requestBody can be used as a http.Request.Body var _ io.ReadCloser = &requestBody{} -func newRequestBody(stream utils.Stream) *requestBody { +func newRequestBody(stream quic.Stream) *requestBody { return &requestBody{dataStream: stream} } diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/request_writer.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/request_writer.go index e837b0f..dad591c 100644 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/request_writer.go +++ b/vendor/github.com/lucas-clemente/quic-go/h2quic/request_writer.go @@ -12,13 +12,14 @@ import ( "golang.org/x/net/http2/hpack" "golang.org/x/net/lex/httplex" + quic "github.com/lucas-clemente/quic-go" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) type requestWriter struct { mutex sync.Mutex - headerStream utils.Stream + headerStream quic.Stream henc *hpack.Encoder hbuf bytes.Buffer // HPACK encoder writes into this @@ -26,7 +27,7 @@ type requestWriter struct { const defaultUserAgent = "quic-go" -func newRequestWriter(headerStream utils.Stream) *requestWriter { +func newRequestWriter(headerStream quic.Stream) *requestWriter { rw := &requestWriter{ headerStream: headerStream, } diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed.go deleted file mode 100644 index 191a248..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed.go +++ /dev/null @@ -1,9 +0,0 @@ -// +build go1.7 - -package h2quic - -import "net/http" - -func setUncompressed(res *http.Response) { - res.Uncompressed = true -} diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed_go16.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed_go16.go deleted file mode 100644 index 7359f04..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/response_setuncompressed_go16.go +++ /dev/null @@ -1,9 +0,0 @@ -// +build !go1.7 - -package h2quic - -import "net/http" - -func setUncompressed(res *http.Response) { - // http.Response.Uncompressed was introduced in go 1.7 -} diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/response_writer.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/response_writer.go index 7bd804f..2468934 100644 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/response_writer.go +++ b/vendor/github.com/lucas-clemente/quic-go/h2quic/response_writer.go @@ -7,17 +7,18 @@ import ( "strings" "sync" + quic "github.com/lucas-clemente/quic-go" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" "golang.org/x/net/http2" "golang.org/x/net/http2/hpack" ) type responseWriter struct { dataStreamID protocol.StreamID - dataStream utils.Stream + dataStream quic.Stream - headerStream utils.Stream + headerStream quic.Stream headerStreamMutex *sync.Mutex header http.Header @@ -25,7 +26,7 @@ type responseWriter struct { headerWritten bool } -func newResponseWriter(headerStream utils.Stream, headerStreamMutex *sync.Mutex, dataStream utils.Stream, dataStreamID protocol.StreamID) *responseWriter { +func newResponseWriter(headerStream quic.Stream, headerStreamMutex *sync.Mutex, dataStream quic.Stream, dataStreamID protocol.StreamID) *responseWriter { return &responseWriter{ header: http.Header{}, headerStream: headerStream, @@ -82,9 +83,15 @@ func (w *responseWriter) Write(p []byte) (int, error) { func (w *responseWriter) Flush() {} +// TODO: Implement a functional CloseNotify method. +func (w *responseWriter) CloseNotify() <-chan bool { return make(<-chan bool) } + // test that we implement http.Flusher var _ http.Flusher = &responseWriter{} +// test that we implement http.CloseNotifier +var _ http.CloseNotifier = &responseWriter{} + // copied from http2/http2.go // bodyAllowedForStatus reports whether a given response status code // permits a body. See RFC 2616, section 4.4. diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/roundtrip.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/roundtrip.go index 85faf8e..9ac5f19 100644 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/roundtrip.go +++ b/vendor/github.com/lucas-clemente/quic-go/h2quic/roundtrip.go @@ -4,19 +4,23 @@ import ( "crypto/tls" "errors" "fmt" + "io" "net/http" "strings" "sync" + quic "github.com/lucas-clemente/quic-go" + "golang.org/x/net/lex/httplex" ) -type h2quicClient interface { - Do(*http.Request) (*http.Response, error) +type roundTripCloser interface { + http.RoundTripper + io.Closer } -// QuicRoundTripper implements the http.RoundTripper interface -type QuicRoundTripper struct { +// RoundTripper implements the http.RoundTripper interface +type RoundTripper struct { mutex sync.Mutex // DisableCompression, if true, prevents the Transport from @@ -33,13 +37,29 @@ type QuicRoundTripper struct { // tls.Client. If nil, the default configuration is used. TLSClientConfig *tls.Config - clients map[string]h2quicClient + // QuicConfig is the quic.Config used for dialing new connections. + // If nil, reasonable default values will be used. + QuicConfig *quic.Config + + clients map[string]roundTripCloser } -var _ http.RoundTripper = &QuicRoundTripper{} +// RoundTripOpt are options for the Transport.RoundTripOpt method. +type RoundTripOpt struct { + // OnlyCachedConn controls whether the RoundTripper may + // create a new QUIC connection. If set true and + // no cached connection is available, RoundTrip + // will return ErrNoCachedConn. + OnlyCachedConn bool +} -// RoundTrip does a round trip -func (r *QuicRoundTripper) RoundTrip(req *http.Request) (*http.Response, error) { +var _ roundTripCloser = &RoundTripper{} + +// ErrNoCachedConn is returned when RoundTripper.OnlyCachedConn is set +var ErrNoCachedConn = errors.New("h2quic: no cached connection was available") + +// RoundTripOpt is like RoundTrip, but takes options. +func (r *RoundTripper) RoundTripOpt(req *http.Request, opt RoundTripOpt) (*http.Response, error) { if req.URL == nil { closeRequestBody(req) return nil, errors.New("quic: nil Request.URL") @@ -75,35 +95,48 @@ func (r *QuicRoundTripper) RoundTrip(req *http.Request) (*http.Response, error) } hostname := authorityAddr("https", hostnameFromRequest(req)) - client, err := r.getClient(hostname) + cl, err := r.getClient(hostname, opt.OnlyCachedConn) if err != nil { return nil, err } - return client.Do(req) + return cl.RoundTrip(req) } -func (r *QuicRoundTripper) getClient(hostname string) (h2quicClient, error) { +// RoundTrip does a round trip. +func (r *RoundTripper) RoundTrip(req *http.Request) (*http.Response, error) { + return r.RoundTripOpt(req, RoundTripOpt{}) +} + +func (r *RoundTripper) getClient(hostname string, onlyCached bool) (http.RoundTripper, error) { r.mutex.Lock() defer r.mutex.Unlock() if r.clients == nil { - r.clients = make(map[string]h2quicClient) + r.clients = make(map[string]roundTripCloser) } client, ok := r.clients[hostname] if !ok { - var err error - client, err = NewClient(r, r.TLSClientConfig, hostname) - if err != nil { - return nil, err + if onlyCached { + return nil, ErrNoCachedConn } + client = newClient(hostname, r.TLSClientConfig, &roundTripperOpts{DisableCompression: r.DisableCompression}, r.QuicConfig) r.clients[hostname] = client } return client, nil } -func (r *QuicRoundTripper) disableCompression() bool { - return r.DisableCompression +// Close closes the QUIC connections that this RoundTripper has used +func (r *RoundTripper) Close() error { + r.mutex.Lock() + defer r.mutex.Unlock() + for _, client := range r.clients { + if err := client.Close(); err != nil { + return err + } + } + r.clients = nil + return nil } func closeRequestBody(req *http.Request) { diff --git a/vendor/github.com/lucas-clemente/quic-go/h2quic/server.go b/vendor/github.com/lucas-clemente/quic-go/h2quic/server.go index 8b591ec..3647dc6 100644 --- a/vendor/github.com/lucas-clemente/quic-go/h2quic/server.go +++ b/vendor/github.com/lucas-clemente/quic-go/h2quic/server.go @@ -7,35 +7,51 @@ import ( "net" "net/http" "runtime" + "strconv" "sync" "sync/atomic" "time" - "github.com/lucas-clemente/quic-go" + quic "github.com/lucas-clemente/quic-go" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" "golang.org/x/net/http2" "golang.org/x/net/http2/hpack" ) type streamCreator interface { - GetOrOpenStream(protocol.StreamID) (utils.Stream, error) - Close(error) error - RemoteAddr() *net.UDPAddr + quic.Session + GetOrOpenStream(protocol.StreamID) (quic.Stream, error) } +type remoteCloser interface { + CloseRemote(protocol.ByteCount) +} + +// allows mocking of quic.Listen and quic.ListenAddr +var ( + quicListen = quic.Listen + quicListenAddr = quic.ListenAddr +) + // Server is a HTTP2 server listening for QUIC connections. type Server struct { *http.Server + // By providing a quic.Config, it is possible to set parameters of the QUIC connection. + // If nil, it uses reasonable default values. + QuicConfig *quic.Config + // Private flag for demo, do not use CloseAfterFirstRequest bool port uint32 // used atomically - server *quic.Server - serverMutex sync.Mutex + listenerMutex sync.Mutex + listener quic.Listener + + supportedVersionsAsString string } // ListenAndServe listens on the UDP address s.Addr and calls s.Handler to handle HTTP/2 requests on incoming connections. @@ -63,39 +79,51 @@ func (s *Server) ListenAndServeTLS(certFile, keyFile string) error { } // Serve an existing UDP connection. -func (s *Server) Serve(conn *net.UDPConn) error { +func (s *Server) Serve(conn net.PacketConn) error { return s.serveImpl(s.TLSConfig, conn) } -func (s *Server) serveImpl(tlsConfig *tls.Config, conn *net.UDPConn) error { +func (s *Server) serveImpl(tlsConfig *tls.Config, conn net.PacketConn) error { if s.Server == nil { return errors.New("use of h2quic.Server without http.Server") } - s.serverMutex.Lock() - if s.server != nil { - s.serverMutex.Unlock() + s.listenerMutex.Lock() + if s.listener != nil { + s.listenerMutex.Unlock() return errors.New("ListenAndServe may only be called once") } + + var ln quic.Listener var err error - server, err := quic.NewServer(s.Addr, tlsConfig, s.handleStreamCb) + if conn == nil { + ln, err = quicListenAddr(s.Addr, tlsConfig, s.QuicConfig) + } else { + ln, err = quicListen(conn, tlsConfig, s.QuicConfig) + } if err != nil { - s.serverMutex.Unlock() + s.listenerMutex.Unlock() return err } - s.server = server - s.serverMutex.Unlock() - if conn == nil { - return server.ListenAndServe() + s.listener = ln + s.listenerMutex.Unlock() + + for { + sess, err := ln.Accept() + if err != nil { + return err + } + go s.handleHeaderStream(sess.(streamCreator)) } - return server.Serve(conn) } -func (s *Server) handleStreamCb(session *quic.Session, stream utils.Stream) { - s.handleStream(session, stream) -} - -func (s *Server) handleStream(session streamCreator, stream utils.Stream) { +func (s *Server) handleHeaderStream(session streamCreator) { + stream, err := session.AcceptStream() + if err != nil { + session.Close(qerr.Error(qerr.InvalidHeadersStreamData, err.Error())) + return + } if stream.StreamID() != 3 { + session.Close(qerr.Error(qerr.InternalError, "h2quic server BUG: header stream does not have stream ID 3")) return } @@ -112,17 +140,17 @@ func (s *Server) handleStream(session streamCreator, stream utils.Stream) { if _, ok := err.(*qerr.QuicError); !ok { utils.Errorf("error handling h2 request: %s", err.Error()) } - session.Close(qerr.Error(qerr.InvalidHeadersStreamData, err.Error())) + session.Close(err) return } } }() } -func (s *Server) handleRequest(session streamCreator, headerStream utils.Stream, headerStreamMutex *sync.Mutex, hpackDecoder *hpack.Decoder, h2framer *http2.Framer) error { +func (s *Server) handleRequest(session streamCreator, headerStream quic.Stream, headerStreamMutex *sync.Mutex, hpackDecoder *hpack.Decoder, h2framer *http2.Framer) error { h2frame, err := h2framer.ReadFrame() if err != nil { - return err + return qerr.Error(qerr.HeadersStreamDataDecompressFailure, "cannot read frame") } h2headersFrame, ok := h2frame.(*http2.HeadersFrame) if !ok { @@ -154,10 +182,14 @@ func (s *Server) handleRequest(session streamCreator, headerStream utils.Stream, if err != nil { return err } + // this can happen if the client immediately closes the data stream after sending the request and the runtime processes the reset before the request + if dataStream == nil { + return nil + } var streamEnded bool if h2headersFrame.StreamEnded() { - dataStream.CloseRemote(0) + dataStream.(remoteCloser).CloseRemote(0) streamEnded = true _, _ = dataStream.Read([]byte{0}) // read the eof } @@ -209,11 +241,11 @@ func (s *Server) handleRequest(session streamCreator, headerStream utils.Stream, // Close the server immediately, aborting requests and sending CONNECTION_CLOSE frames to connected clients. // Close in combination with ListenAndServe() (instead of Serve()) may race if it is called before a UDP socket is established. func (s *Server) Close() error { - s.serverMutex.Lock() - defer s.serverMutex.Unlock() - if s.server != nil { - err := s.server.Close() - s.server = nil + s.listenerMutex.Lock() + defer s.listenerMutex.Unlock() + if s.listener != nil { + err := s.listener.Close() + s.listener = nil return err } return nil @@ -228,7 +260,6 @@ func (s *Server) CloseGracefully(timeout time.Duration) error { // SetQuicHeaders can be used to set the proper headers that announce that this server supports QUIC. // The values that are set depend on the port information from s.Server.Addr, and currently look like this (if Addr has port 443): -// Alternate-Protocol: 443:quic // Alt-Svc: quic=":443"; ma=2592000; v="33,32,31,30" func (s *Server) SetQuicHeaders(hdr http.Header) error { port := atomic.LoadUint32(&s.port) @@ -247,8 +278,16 @@ func (s *Server) SetQuicHeaders(hdr http.Header) error { atomic.StoreUint32(&s.port, port) } - hdr.Add("Alternate-Protocol", fmt.Sprintf("%d:quic", port)) - hdr.Add("Alt-Svc", fmt.Sprintf(`quic=":%d"; ma=2592000; v="%s"`, port, protocol.SupportedVersionsAsString)) + if s.supportedVersionsAsString == "" { + for i, v := range protocol.SupportedVersions { + s.supportedVersionsAsString += strconv.Itoa(int(v)) + if i != len(protocol.SupportedVersions)-1 { + s.supportedVersionsAsString += "," + } + } + } + + hdr.Add("Alt-Svc", fmt.Sprintf(`quic=":%d"; ma=2592000; v="%s"`, port, s.supportedVersionsAsString)) return nil } diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/connection_parameters_manager.go b/vendor/github.com/lucas-clemente/quic-go/handshake/connection_parameters_manager.go index 5b8c816..1ad9a3a 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/connection_parameters_manager.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/connection_parameters_manager.go @@ -2,13 +2,12 @@ package handshake import ( "bytes" - "errors" "sync" "time" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // ConnectionParametersManager negotiates and stores the connection parameters @@ -41,8 +40,7 @@ type connectionParametersManager struct { version protocol.VersionNumber perspective protocol.Perspective - flowControlNegotiated bool - hasReceivedMaxIncomingDynamicStreams bool + flowControlNegotiated bool truncateConnectionID bool maxStreamsPerConnection uint32 @@ -52,12 +50,12 @@ type connectionParametersManager struct { sendConnectionFlowControlWindow protocol.ByteCount receiveStreamFlowControlWindow protocol.ByteCount receiveConnectionFlowControlWindow protocol.ByteCount + maxReceiveStreamFlowControlWindow protocol.ByteCount + maxReceiveConnectionFlowControlWindow protocol.ByteCount } var _ ConnectionParametersManager = &connectionParametersManager{} -var errTagNotInConnectionParameterMap = errors.New("ConnectionParametersManager: Tag not found in ConnectionsParameter map") - // ErrMalformedTag is returned when the tag value cannot be read var ( ErrMalformedTag = qerr.Error(qerr.InvalidCryptoMessageParameter, "malformed Tag value") @@ -65,14 +63,19 @@ var ( ) // NewConnectionParamatersManager creates a new connection parameters manager -func NewConnectionParamatersManager(pers protocol.Perspective, v protocol.VersionNumber) ConnectionParametersManager { +func NewConnectionParamatersManager( + pers protocol.Perspective, v protocol.VersionNumber, + maxReceiveStreamFlowControlWindow protocol.ByteCount, maxReceiveConnectionFlowControlWindow protocol.ByteCount, +) ConnectionParametersManager { h := &connectionParametersManager{ - perspective: pers, - version: v, - sendStreamFlowControlWindow: protocol.InitialStreamFlowControlWindow, // can only be changed by the client - sendConnectionFlowControlWindow: protocol.InitialConnectionFlowControlWindow, // can only be changed by the client - receiveStreamFlowControlWindow: protocol.ReceiveStreamFlowControlWindow, - receiveConnectionFlowControlWindow: protocol.ReceiveConnectionFlowControlWindow, + perspective: pers, + version: v, + sendStreamFlowControlWindow: protocol.InitialStreamFlowControlWindow, // can only be changed by the client + sendConnectionFlowControlWindow: protocol.InitialConnectionFlowControlWindow, // can only be changed by the client + receiveStreamFlowControlWindow: protocol.ReceiveStreamFlowControlWindow, + receiveConnectionFlowControlWindow: protocol.ReceiveConnectionFlowControlWindow, + maxReceiveStreamFlowControlWindow: maxReceiveStreamFlowControlWindow, + maxReceiveConnectionFlowControlWindow: maxReceiveConnectionFlowControlWindow, } if h.perspective == protocol.PerspectiveServer { @@ -113,7 +116,6 @@ func (h *connectionParametersManager) SetFromMap(params map[Tag][]byte) error { return ErrMalformedTag } h.maxIncomingDynamicStreamsPerConnection = h.negotiateMaxIncomingDynamicStreamsPerConnection(clientValue) - h.hasReceivedMaxIncomingDynamicStreams = true } if value, ok := params[TagICSL]; ok { clientValue, err := utils.ReadUint32(bytes.NewBuffer(value)) @@ -175,23 +177,18 @@ func (h *connectionParametersManager) GetHelloMap() (map[Tag][]byte, error) { utils.WriteUint32(cfcw, uint32(h.GetReceiveConnectionFlowControlWindow())) mspc := bytes.NewBuffer([]byte{}) utils.WriteUint32(mspc, h.maxStreamsPerConnection) + mids := bytes.NewBuffer([]byte{}) + utils.WriteUint32(mids, protocol.MaxIncomingDynamicStreamsPerConnection) icsl := bytes.NewBuffer([]byte{}) utils.WriteUint32(icsl, uint32(h.GetIdleConnectionStateLifetime()/time.Second)) - tags := map[Tag][]byte{ + return map[Tag][]byte{ TagICSL: icsl.Bytes(), TagMSPC: mspc.Bytes(), + TagMIDS: mids.Bytes(), TagCFCW: cfcw.Bytes(), TagSFCW: sfcw.Bytes(), - } - - if h.version > protocol.Version34 { - mids := bytes.NewBuffer([]byte{}) - utils.WriteUint32(mids, protocol.MaxIncomingDynamicStreamsPerConnection) - tags[TagMIDS] = mids.Bytes() - } - - return tags, nil + }, nil } // GetSendStreamFlowControlWindow gets the size of the stream-level flow control window for sending data @@ -217,10 +214,7 @@ func (h *connectionParametersManager) GetReceiveStreamFlowControlWindow() protoc // GetMaxReceiveStreamFlowControlWindow gets the maximum size of the stream-level flow control window for sending data func (h *connectionParametersManager) GetMaxReceiveStreamFlowControlWindow() protocol.ByteCount { - if h.perspective == protocol.PerspectiveServer { - return protocol.MaxReceiveStreamFlowControlWindowServer - } - return protocol.MaxReceiveStreamFlowControlWindowClient + return h.maxReceiveStreamFlowControlWindow } // GetReceiveConnectionFlowControlWindow gets the size of the stream-level flow control window for receiving data @@ -232,10 +226,7 @@ func (h *connectionParametersManager) GetReceiveConnectionFlowControlWindow() pr // GetMaxReceiveConnectionFlowControlWindow gets the maximum size of the stream-level flow control window for sending data func (h *connectionParametersManager) GetMaxReceiveConnectionFlowControlWindow() protocol.ByteCount { - if h.perspective == protocol.PerspectiveServer { - return protocol.MaxReceiveConnectionFlowControlWindowServer - } - return protocol.MaxReceiveConnectionFlowControlWindowClient + return h.maxReceiveConnectionFlowControlWindow } // GetMaxOutgoingStreams gets the maximum number of outgoing streams per connection @@ -243,10 +234,7 @@ func (h *connectionParametersManager) GetMaxOutgoingStreams() uint32 { h.mutex.RLock() defer h.mutex.RUnlock() - if h.version > protocol.Version34 && h.hasReceivedMaxIncomingDynamicStreams { - return h.maxIncomingDynamicStreamsPerConnection - } - return h.maxStreamsPerConnection + return h.maxIncomingDynamicStreamsPerConnection } // GetMaxIncomingStreams get the maximum number of incoming streams per connection @@ -254,14 +242,8 @@ func (h *connectionParametersManager) GetMaxIncomingStreams() uint32 { h.mutex.RLock() defer h.mutex.RUnlock() - var val uint32 - if h.version <= protocol.Version34 { - val = h.maxStreamsPerConnection - } else { - val = protocol.MaxIncomingDynamicStreamsPerConnection - } - - return utils.MaxUint32(val+protocol.MaxStreamsMinimumIncrement, uint32(float64(val)*protocol.MaxStreamsMultiplier)) + maxStreams := protocol.MaxIncomingDynamicStreamsPerConnection + return utils.MaxUint32(uint32(maxStreams)+protocol.MaxStreamsMinimumIncrement, uint32(float64(maxStreams)*protocol.MaxStreamsMultiplier)) } // GetIdleConnectionStateLifetime gets the idle timeout diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_client.go b/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_client.go index 0fc46e5..a8d8812 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_client.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_client.go @@ -12,9 +12,9 @@ import ( "time" "github.com/lucas-clemente/quic-go/crypto" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) type cryptoSetupClient struct { @@ -25,32 +25,36 @@ type cryptoSetupClient struct { version protocol.VersionNumber negotiatedVersions []protocol.VersionNumber - cryptoStream utils.Stream + cryptoStream io.ReadWriter serverConfig *serverConfigClient - stk []byte - sno []byte - nonc []byte - proof []byte + stk []byte + sno []byte + nonc []byte + proof []byte + chloForSignature []byte + lastSentCHLO []byte + certManager crypto.CertManager + + divNonceChan chan []byte diversificationNonce []byte - chloForSignature []byte - lastSentCHLO []byte - certManager crypto.CertManager clientHelloCounter int serverVerified bool // has the certificate chain and the proof already been verified keyDerivation KeyDerivationFunction + keyExchange KeyExchangeFunction receivedSecurePacket bool + nullAEAD crypto.AEAD secureAEAD crypto.AEAD forwardSecureAEAD crypto.AEAD - aeadChanged chan struct{} + aeadChanged chan<- protocol.EncryptionLevel + params *TransportParameters connectionParameters ConnectionParametersManager } -var _ crypto.AEAD = &cryptoSetupClient{} var _ CryptoSetup = &cryptoSetupClient{} var ( @@ -64,10 +68,11 @@ func NewCryptoSetupClient( hostname string, connID protocol.ConnectionID, version protocol.VersionNumber, - cryptoStream utils.Stream, + cryptoStream io.ReadWriter, tlsConfig *tls.Config, connectionParameters ConnectionParametersManager, - aeadChanged chan struct{}, + aeadChanged chan<- protocol.EncryptionLevel, + params *TransportParameters, negotiatedVersions []protocol.VersionNumber, ) (CryptoSetup, error) { return &cryptoSetupClient{ @@ -78,57 +83,77 @@ func NewCryptoSetupClient( certManager: crypto.NewCertManager(tlsConfig), connectionParameters: connectionParameters, keyDerivation: crypto.DeriveKeysAESGCM, + keyExchange: getEphermalKEX, + nullAEAD: crypto.NewNullAEAD(protocol.PerspectiveClient, version), aeadChanged: aeadChanged, negotiatedVersions: negotiatedVersions, + divNonceChan: make(chan []byte), + params: params, }, nil } func (h *cryptoSetupClient) HandleCryptoStream() error { + messageChan := make(chan HandshakeMessage) + errorChan := make(chan error) + + go func() { + for { + message, err := ParseHandshakeMessage(h.cryptoStream) + if err != nil { + errorChan <- qerr.Error(qerr.HandshakeFailed, err.Error()) + return + } + messageChan <- message + } + }() + for { err := h.maybeUpgradeCrypto() if err != nil { return err } - // send CHLOs until the forward secure encryption is established - if h.forwardSecureAEAD == nil { + h.mutex.RLock() + sendCHLO := h.secureAEAD == nil + h.mutex.RUnlock() + + if sendCHLO { err = h.sendCHLO() if err != nil { return err } } - var shloData bytes.Buffer - - messageTag, cryptoData, err := ParseHandshakeMessage(io.TeeReader(h.cryptoStream, &shloData)) - if err != nil { - return qerr.HandshakeFailed + var message HandshakeMessage + select { + case divNonce := <-h.divNonceChan: + if len(h.diversificationNonce) != 0 && !bytes.Equal(h.diversificationNonce, divNonce) { + return errConflictingDiversificationNonces + } + h.diversificationNonce = divNonce + // there's no message to process, but we should try upgrading the crypto again + continue + case message = <-messageChan: + case err = <-errorChan: + return err } - if messageTag != TagSHLO && messageTag != TagREJ { + utils.Debugf("Got %s", message) + switch message.Tag { + case TagREJ: + err = h.handleREJMessage(message.Data) + case TagSHLO: + err = h.handleSHLOMessage(message.Data) + default: return qerr.InvalidCryptoMessageType } - - if messageTag == TagSHLO { - utils.Debugf("Got SHLO:\n%s", printHandshakeMessage(cryptoData)) - err = h.handleSHLOMessage(cryptoData) - if err != nil { - return err - } - } - - if messageTag == TagREJ { - err = h.handleREJMessage(cryptoData) - if err != nil { - return err - } + if err != nil { + return err } } } func (h *cryptoSetupClient) handleREJMessage(cryptoData map[Tag][]byte) error { - utils.Debugf("Got REJ:\n%s", printHandshakeMessage(cryptoData)) - var err error if stk, ok := cryptoData[TagSTK]; ok { @@ -244,7 +269,8 @@ func (h *cryptoSetupClient) handleSHLOMessage(cryptoData map[Tag][]byte) error { return qerr.InvalidCryptoMessageParameter } - h.aeadChanged <- struct{}{} + h.aeadChanged <- protocol.EncryptionForwardSecure + close(h.aeadChanged) return nil } @@ -264,7 +290,7 @@ func (h *cryptoSetupClient) validateVersionList(verTags []byte) bool { return false } ver := protocol.VersionTagToNumber(verTag) - if !protocol.IsSupportedVersion(ver) { + if !protocol.IsSupportedVersion(protocol.SupportedVersions, ver) { ver = protocol.VersionUnsupported } if ver != negotiatedVersion { @@ -274,67 +300,90 @@ func (h *cryptoSetupClient) validateVersionList(verTags []byte) bool { return true } -func (h *cryptoSetupClient) Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, error) { +func (h *cryptoSetupClient) Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, protocol.EncryptionLevel, error) { + h.mutex.RLock() + defer h.mutex.RUnlock() + if h.forwardSecureAEAD != nil { data, err := h.forwardSecureAEAD.Open(dst, src, packetNumber, associatedData) if err == nil { - return data, nil + return data, protocol.EncryptionForwardSecure, nil } - return nil, err + return nil, protocol.EncryptionUnspecified, err } if h.secureAEAD != nil { data, err := h.secureAEAD.Open(dst, src, packetNumber, associatedData) if err == nil { h.receivedSecurePacket = true - return data, nil + return data, protocol.EncryptionSecure, nil } if h.receivedSecurePacket { - return nil, err + return nil, protocol.EncryptionUnspecified, err } } - - return (&crypto.NullAEAD{}).Open(dst, src, packetNumber, associatedData) + res, err := h.nullAEAD.Open(dst, src, packetNumber, associatedData) + if err != nil { + return nil, protocol.EncryptionUnspecified, err + } + return res, protocol.EncryptionUnencrypted, nil } -func (h *cryptoSetupClient) Seal(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { +func (h *cryptoSetupClient) GetSealer() (protocol.EncryptionLevel, Sealer) { + h.mutex.RLock() + defer h.mutex.RUnlock() if h.forwardSecureAEAD != nil { - return h.forwardSecureAEAD.Seal(dst, src, packetNumber, associatedData) + return protocol.EncryptionForwardSecure, h.sealForwardSecure + } else if h.secureAEAD != nil { + return protocol.EncryptionSecure, h.sealSecure + } else { + return protocol.EncryptionUnencrypted, h.sealUnencrypted } - if h.secureAEAD != nil { - return h.secureAEAD.Seal(dst, src, packetNumber, associatedData) +} + +func (h *cryptoSetupClient) GetSealerForCryptoStream() (protocol.EncryptionLevel, Sealer) { + return protocol.EncryptionUnencrypted, h.sealUnencrypted +} + +func (h *cryptoSetupClient) GetSealerWithEncryptionLevel(encLevel protocol.EncryptionLevel) (Sealer, error) { + h.mutex.RLock() + defer h.mutex.RUnlock() + + switch encLevel { + case protocol.EncryptionUnencrypted: + return h.sealUnencrypted, nil + case protocol.EncryptionSecure: + if h.secureAEAD == nil { + return nil, errors.New("CryptoSetupClient: no secureAEAD") + } + return h.sealSecure, nil + case protocol.EncryptionForwardSecure: + if h.forwardSecureAEAD == nil { + return nil, errors.New("CryptoSetupClient: no forwardSecureAEAD") + } + return h.sealForwardSecure, nil } - return (&crypto.NullAEAD{}).Seal(dst, src, packetNumber, associatedData) + return nil, errors.New("CryptoSetupClient: no encryption level specified") +} + +func (h *cryptoSetupClient) sealUnencrypted(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { + return h.nullAEAD.Seal(dst, src, packetNumber, associatedData) +} + +func (h *cryptoSetupClient) sealSecure(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { + return h.secureAEAD.Seal(dst, src, packetNumber, associatedData) +} + +func (h *cryptoSetupClient) sealForwardSecure(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { + return h.forwardSecureAEAD.Seal(dst, src, packetNumber, associatedData) } func (h *cryptoSetupClient) DiversificationNonce() []byte { panic("not needed for cryptoSetupClient") } -func (h *cryptoSetupClient) SetDiversificationNonce(data []byte) error { - if len(h.diversificationNonce) == 0 { - h.diversificationNonce = data - return h.maybeUpgradeCrypto() - } - if !bytes.Equal(h.diversificationNonce, data) { - return errConflictingDiversificationNonces - } - return nil -} - -func (h *cryptoSetupClient) LockForSealing() { - -} - -func (h *cryptoSetupClient) UnlockForSealing() { - -} - -func (h *cryptoSetupClient) HandshakeComplete() bool { - h.mutex.RLock() - complete := h.forwardSecureAEAD != nil - h.mutex.RUnlock() - return complete +func (h *cryptoSetupClient) SetDiversificationNonce(data []byte) { + h.divNonceChan <- data } func (h *cryptoSetupClient) sendCHLO() error { @@ -350,9 +399,13 @@ func (h *cryptoSetupClient) sendCHLO() error { return err } h.addPadding(tags) + message := HandshakeMessage{ + Tag: TagCHLO, + Data: tags, + } - utils.Debugf("Sending CHLO:\n%s", printHandshakeMessage(tags)) - WriteHandshakeMessage(b, TagCHLO, tags) + utils.Debugf("Sending %s", message) + message.Write(b) _, err = h.cryptoStream.Write(b.Bytes()) if err != nil { @@ -377,14 +430,16 @@ func (h *cryptoSetupClient) getTags() (map[Tag][]byte, error) { tags[TagCCS] = ccs } - versionTag := make([]byte, 4, 4) + versionTag := make([]byte, 4) binary.LittleEndian.PutUint32(versionTag, protocol.VersionNumberToTag(h.version)) tags[TagVER] = versionTag + if h.params.RequestConnectionIDTruncation { + tags[TagTCID] = []byte{0, 0, 0, 0} + } if len(h.stk) > 0 { tags[TagSTK] = h.stk } - if len(h.sno) > 0 { tags[TagSNO] = h.sno } @@ -395,7 +450,7 @@ func (h *cryptoSetupClient) getTags() (map[Tag][]byte, error) { leafCert := h.certManager.GetLeafCert() if leafCert != nil { certHash, _ := h.certManager.GetLeafCertHash() - xlct := make([]byte, 8, 8) + xlct := make([]byte, 8) binary.LittleEndian.PutUint64(xlct, certHash) tags[TagNONC] = h.nonc @@ -430,7 +485,6 @@ func (h *cryptoSetupClient) maybeUpgradeCrypto() error { defer h.mutex.Unlock() leafCert := h.certManager.GetLeafCert() - if h.secureAEAD == nil && (h.serverConfig != nil && len(h.serverConfig.sharedSecret) > 0 && len(h.nonc) > 0 && len(leafCert) > 0 && len(h.diversificationNonce) > 0 && len(h.lastSentCHLO) > 0) { var err error var nonce []byte @@ -455,7 +509,7 @@ func (h *cryptoSetupClient) maybeUpgradeCrypto() error { return err } - h.aeadChanged <- struct{}{} + h.aeadChanged <- protocol.EncryptionSecure } return nil diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_interface.go b/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_interface.go deleted file mode 100644 index 4822cfb..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_interface.go +++ /dev/null @@ -1,16 +0,0 @@ -package handshake - -import "github.com/lucas-clemente/quic-go/protocol" - -// CryptoSetup is a crypto setup -type CryptoSetup interface { - HandleCryptoStream() error - Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, error) - Seal(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte - LockForSealing() - UnlockForSealing() - HandshakeComplete() bool - // TODO: clean up this interface - DiversificationNonce() []byte // only needed for cryptoSetupServer - SetDiversificationNonce([]byte) error // only needed for cryptoSetupClient -} diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_server.go b/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_server.go index 213d1d2..f639f51 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_server.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/crypto_setup_server.go @@ -4,14 +4,15 @@ import ( "bytes" "crypto/rand" "encoding/binary" + "errors" "io" "net" "sync" "github.com/lucas-clemente/quic-go/crypto" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // KeyDerivationFunction is used for key derivation @@ -23,48 +24,71 @@ type KeyExchangeFunction func() crypto.KeyExchange // The CryptoSetupServer handles all things crypto for the Session type cryptoSetupServer struct { connID protocol.ConnectionID - ip net.IP - version protocol.VersionNumber + remoteAddr net.Addr scfg *ServerConfig + stkGenerator *STKGenerator diversificationNonce []byte + version protocol.VersionNumber + supportedVersions []protocol.VersionNumber + + acceptSTKCallback func(net.Addr, *STK) bool + + nullAEAD crypto.AEAD secureAEAD crypto.AEAD forwardSecureAEAD crypto.AEAD receivedForwardSecurePacket bool + sentSHLO bool receivedSecurePacket bool - aeadChanged chan struct{} + aeadChanged chan<- protocol.EncryptionLevel keyDerivation KeyDerivationFunction keyExchange KeyExchangeFunction - cryptoStream utils.Stream + cryptoStream io.ReadWriter connectionParameters ConnectionParametersManager mutex sync.RWMutex } -var _ crypto.AEAD = &cryptoSetupServer{} +var _ CryptoSetup = &cryptoSetupServer{} + +// ErrHOLExperiment is returned when the client sends the FHL2 tag in the CHLO +// this is an expiremnt implemented by Chrome in QUIC 36, which we don't support +// TODO: remove this when dropping support for QUIC 36 +var ErrHOLExperiment = qerr.Error(qerr.InvalidCryptoMessageParameter, "HOL experiment. Unsupported") // NewCryptoSetup creates a new CryptoSetup instance for a server func NewCryptoSetup( connID protocol.ConnectionID, - ip net.IP, + remoteAddr net.Addr, version protocol.VersionNumber, scfg *ServerConfig, - cryptoStream utils.Stream, + cryptoStream io.ReadWriter, connectionParametersManager ConnectionParametersManager, - aeadChanged chan struct{}, + supportedVersions []protocol.VersionNumber, + acceptSTK func(net.Addr, *STK) bool, + aeadChanged chan<- protocol.EncryptionLevel, ) (CryptoSetup, error) { + stkGenerator, err := NewSTKGenerator() + if err != nil { + return nil, err + } + return &cryptoSetupServer{ connID: connID, - ip: ip, + remoteAddr: remoteAddr, version: version, + supportedVersions: supportedVersions, scfg: scfg, + stkGenerator: stkGenerator, keyDerivation: crypto.DeriveKeysAESGCM, keyExchange: getEphermalKEX, + nullAEAD: crypto.NewNullAEAD(protocol.PerspectiveServer, version), cryptoStream: cryptoStream, connectionParameters: connectionParametersManager, + acceptSTKCallback: acceptSTK, aeadChanged: aeadChanged, }, nil } @@ -73,17 +97,16 @@ func NewCryptoSetup( func (h *cryptoSetupServer) HandleCryptoStream() error { for { var chloData bytes.Buffer - messageTag, cryptoData, err := ParseHandshakeMessage(io.TeeReader(h.cryptoStream, &chloData)) + message, err := ParseHandshakeMessage(io.TeeReader(h.cryptoStream, &chloData)) if err != nil { return qerr.HandshakeFailed } - if messageTag != TagCHLO { + if message.Tag != TagCHLO { return qerr.InvalidCryptoMessageType } - utils.Debugf("Got CHLO:\n%s", printHandshakeMessage(cryptoData)) - - done, err := h.handleMessage(chloData.Bytes(), cryptoData) + utils.Debugf("Got %s", message) + done, err := h.handleMessage(chloData.Bytes(), message.Data) if err != nil { return err } @@ -94,6 +117,10 @@ func (h *cryptoSetupServer) HandleCryptoStream() error { } func (h *cryptoSetupServer) handleMessage(chloData []byte, cryptoData map[Tag][]byte) (bool, error) { + if _, isHOLExperiment := cryptoData[TagFHL2]; isHOLExperiment { + return false, ErrHOLExperiment + } + sniSlice, ok := cryptoData[TagSNI] if !ok { return false, qerr.Error(qerr.CryptoMessageParameterNotFound, "SNI required") @@ -115,7 +142,7 @@ func (h *cryptoSetupServer) handleMessage(chloData []byte, cryptoData map[Tag][] verTag := binary.LittleEndian.Uint32(verSlice) ver := protocol.VersionTagToNumber(verTag) // If the client's preferred version is not the version we are currently speaking, then the client went through a version negotiation. In this case, we need to make sure that we actually do not support this version and that it wasn't a downgrade attack. - if ver != h.version && protocol.IsSupportedVersion(ver) { + if ver != h.version && protocol.IsSupportedVersion(h.supportedVersions, ver) { return false, qerr.Error(qerr.VersionNegotiationMismatch, "Downgrade attack detected") } @@ -146,49 +173,93 @@ func (h *cryptoSetupServer) handleMessage(chloData []byte, cryptoData map[Tag][] return false, err } _, err = h.cryptoStream.Write(reply) - if err != nil { - return false, err - } - return false, nil + return false, err } // Open a message -func (h *cryptoSetupServer) Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, error) { +func (h *cryptoSetupServer) Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, protocol.EncryptionLevel, error) { h.mutex.RLock() defer h.mutex.RUnlock() if h.forwardSecureAEAD != nil { res, err := h.forwardSecureAEAD.Open(dst, src, packetNumber, associatedData) if err == nil { - h.receivedForwardSecurePacket = true - return res, nil + if !h.receivedForwardSecurePacket { // this is the first forward secure packet we receive from the client + h.receivedForwardSecurePacket = true + close(h.aeadChanged) + } + return res, protocol.EncryptionForwardSecure, nil } if h.receivedForwardSecurePacket { - return nil, err + return nil, protocol.EncryptionUnspecified, err } } if h.secureAEAD != nil { res, err := h.secureAEAD.Open(dst, src, packetNumber, associatedData) if err == nil { h.receivedSecurePacket = true - return res, nil + return res, protocol.EncryptionSecure, nil } if h.receivedSecurePacket { - return nil, err + return nil, protocol.EncryptionUnspecified, err } } - return (&crypto.NullAEAD{}).Open(dst, src, packetNumber, associatedData) + res, err := h.nullAEAD.Open(dst, src, packetNumber, associatedData) + if err != nil { + return res, protocol.EncryptionUnspecified, err + } + return res, protocol.EncryptionUnencrypted, err } -// Seal a message, call LockForSealing() before! -func (h *cryptoSetupServer) Seal(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { - if h.receivedForwardSecurePacket { - return h.forwardSecureAEAD.Seal(dst, src, packetNumber, associatedData) - } else if h.secureAEAD != nil { - return h.secureAEAD.Seal(dst, src, packetNumber, associatedData) - } else { - return (&crypto.NullAEAD{}).Seal(dst, src, packetNumber, associatedData) +func (h *cryptoSetupServer) GetSealer() (protocol.EncryptionLevel, Sealer) { + h.mutex.RLock() + defer h.mutex.RUnlock() + if h.forwardSecureAEAD != nil { + return protocol.EncryptionForwardSecure, h.sealForwardSecure } + return protocol.EncryptionUnencrypted, h.sealUnencrypted +} + +func (h *cryptoSetupServer) GetSealerForCryptoStream() (protocol.EncryptionLevel, Sealer) { + h.mutex.RLock() + defer h.mutex.RUnlock() + if h.secureAEAD != nil { + return protocol.EncryptionSecure, h.sealSecure + } + return protocol.EncryptionUnencrypted, h.sealUnencrypted +} + +func (h *cryptoSetupServer) GetSealerWithEncryptionLevel(encLevel protocol.EncryptionLevel) (Sealer, error) { + h.mutex.RLock() + defer h.mutex.RUnlock() + + switch encLevel { + case protocol.EncryptionUnencrypted: + return h.sealUnencrypted, nil + case protocol.EncryptionSecure: + if h.secureAEAD == nil { + return nil, errors.New("CryptoSetupServer: no secureAEAD") + } + return h.sealSecure, nil + case protocol.EncryptionForwardSecure: + if h.forwardSecureAEAD == nil { + return nil, errors.New("CryptoSetupServer: no forwardSecureAEAD") + } + return h.sealForwardSecure, nil + } + return nil, errors.New("CryptoSetupServer: no encryption level specified") +} + +func (h *cryptoSetupServer) sealUnencrypted(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { + return h.nullAEAD.Seal(dst, src, packetNumber, associatedData) +} + +func (h *cryptoSetupServer) sealSecure(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { + return h.secureAEAD.Seal(dst, src, packetNumber, associatedData) +} + +func (h *cryptoSetupServer) sealForwardSecure(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte { + return h.forwardSecureAEAD.Seal(dst, src, packetNumber, associatedData) } func (h *cryptoSetupServer) isInchoateCHLO(cryptoData map[Tag][]byte, cert []byte) bool { @@ -207,11 +278,16 @@ func (h *cryptoSetupServer) isInchoateCHLO(cryptoData map[Tag][]byte, cert []byt if crypto.HashCert(cert) != xlct { return true } - if err := h.scfg.stkSource.VerifyToken(h.ip, cryptoData[TagSTK]); err != nil { - utils.Infof("STK invalid: %s", err.Error()) - return true + return !h.acceptSTK(cryptoData[TagSTK]) +} + +func (h *cryptoSetupServer) acceptSTK(token []byte) bool { + stk, err := h.stkGenerator.DecodeToken(token) + if err != nil { + utils.Debugf("STK invalid: %s", err.Error()) + return false } - return false + return h.acceptSTKCallback(h.remoteAddr, stk) } func (h *cryptoSetupServer) handleInchoateCHLO(sni string, chlo []byte, cryptoData map[Tag][]byte) ([]byte, error) { @@ -219,7 +295,7 @@ func (h *cryptoSetupServer) handleInchoateCHLO(sni string, chlo []byte, cryptoDa return nil, qerr.Error(qerr.CryptoInvalidValueLength, "CHLO too small") } - token, err := h.scfg.stkSource.NewToken(h.ip) + token, err := h.stkGenerator.NewToken(h.remoteAddr) if err != nil { return nil, err } @@ -230,7 +306,7 @@ func (h *cryptoSetupServer) handleInchoateCHLO(sni string, chlo []byte, cryptoDa TagSVID: []byte("quic-go"), } - if h.scfg.stkSource.VerifyToken(h.ip, cryptoData[TagSTK]) == nil { + if h.acceptSTK(cryptoData[TagSTK]) { proof, err := h.scfg.Sign(sni, chlo) if err != nil { return nil, err @@ -248,9 +324,14 @@ func (h *cryptoSetupServer) handleInchoateCHLO(sni string, chlo []byte, cryptoDa replyMap[TagCERT] = certCompressed } + message := HandshakeMessage{ + Tag: TagREJ, + Data: replyMap, + } + var serverReply bytes.Buffer - WriteHandshakeMessage(&serverReply, TagREJ, replyMap) - utils.Debugf("Sending REJ:\n%s", printHandshakeMessage(replyMap)) + message.Write(&serverReply) + utils.Debugf("Sending %s", message) return serverReply.Bytes(), nil } @@ -310,6 +391,8 @@ func (h *cryptoSetupServer) handleCHLO(sni string, data []byte, cryptoData map[T return nil, err } + h.aeadChanged <- protocol.EncryptionSecure + // Generate a new curve instance to derive the forward secure key var fsNonce bytes.Buffer fsNonce.Write(clientNonce) @@ -345,46 +428,37 @@ func (h *cryptoSetupServer) handleCHLO(sni string, data []byte, cryptoData map[T return nil, err } // add crypto parameters + verTag := &bytes.Buffer{} + for _, v := range h.supportedVersions { + utils.WriteUint32(verTag, protocol.VersionNumberToTag(v)) + } replyMap[TagPUBS] = ephermalKex.PublicKey() replyMap[TagSNO] = serverNonce - replyMap[TagVER] = protocol.SupportedVersionsAsTags + replyMap[TagVER] = verTag.Bytes() + // note that the SHLO *has* to fit into one packet + message := HandshakeMessage{ + Tag: TagSHLO, + Data: replyMap, + } var reply bytes.Buffer - WriteHandshakeMessage(&reply, TagSHLO, replyMap) - utils.Debugf("Sending SHLO:\n%s", printHandshakeMessage(replyMap)) + message.Write(&reply) + utils.Debugf("Sending %s", message) - h.aeadChanged <- struct{}{} + h.aeadChanged <- protocol.EncryptionForwardSecure return reply.Bytes(), nil } -// DiversificationNonce returns a diversification nonce if required in the next packet to be Seal'ed. See LockForSealing()! +// DiversificationNonce returns the diversification nonce func (h *cryptoSetupServer) DiversificationNonce() []byte { - if h.receivedForwardSecurePacket || h.secureAEAD == nil { - return nil - } return h.diversificationNonce } -func (h *cryptoSetupServer) SetDiversificationNonce(data []byte) error { +func (h *cryptoSetupServer) SetDiversificationNonce(data []byte) { panic("not needed for cryptoSetupServer") } -// LockForSealing should be called before Seal(). It is needed so that diversification nonces can be obtained before packets are sealed, and the AEADs are not changed in the meantime. -func (h *cryptoSetupServer) LockForSealing() { - h.mutex.RLock() -} - -// UnlockForSealing should be called after Seal() is complete, see LockForSealing(). -func (h *cryptoSetupServer) UnlockForSealing() { - h.mutex.RUnlock() -} - -// HandshakeComplete returns true after the first forward secure packet was received form the client. -func (h *cryptoSetupServer) HandshakeComplete() bool { - return h.receivedForwardSecurePacket -} - func (h *cryptoSetupServer) validateClientNonce(nonce []byte) error { if len(nonce) != 32 { return qerr.Error(qerr.InvalidCryptoMessageParameter, "invalid client nonce length") diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/ephermal_cache.go b/vendor/github.com/lucas-clemente/quic-go/handshake/ephermal_cache.go index 794bcbd..da6724f 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/ephermal_cache.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/ephermal_cache.go @@ -5,8 +5,8 @@ import ( "time" "github.com/lucas-clemente/quic-go/crypto" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) var ( @@ -29,14 +29,14 @@ func getEphermalKEX() (res crypto.KeyExchange) { res = kexCurrent t := kexCurrentTime kexMutex.RUnlock() - if res != nil && time.Now().Sub(t) < kexLifetime { + if res != nil && time.Since(t) < kexLifetime { return res } kexMutex.Lock() defer kexMutex.Unlock() // Check if still unfulfilled - if kexCurrent == nil || time.Now().Sub(kexCurrentTime) > kexLifetime { + if kexCurrent == nil || time.Since(kexCurrentTime) > kexLifetime { kex, err := crypto.NewCurve25519KEX() if err != nil { utils.Errorf("could not set KEX: %s", err.Error()) diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/handshake_message.go b/vendor/github.com/lucas-clemente/quic-go/handshake/handshake_message.go index 32f0265..0744cbd 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/handshake_message.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/handshake_message.go @@ -7,32 +7,40 @@ import ( "io" "sort" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) +// A HandshakeMessage is a handshake message +type HandshakeMessage struct { + Tag Tag + Data map[Tag][]byte +} + +var _ fmt.Stringer = &HandshakeMessage{} + // ParseHandshakeMessage reads a crypto message -func ParseHandshakeMessage(r io.Reader) (Tag, map[Tag][]byte, error) { +func ParseHandshakeMessage(r io.Reader) (HandshakeMessage, error) { slice4 := make([]byte, 4) if _, err := io.ReadFull(r, slice4); err != nil { - return 0, nil, err + return HandshakeMessage{}, err } messageTag := Tag(binary.LittleEndian.Uint32(slice4)) if _, err := io.ReadFull(r, slice4); err != nil { - return 0, nil, err + return HandshakeMessage{}, err } nPairs := binary.LittleEndian.Uint32(slice4) if nPairs > protocol.CryptoMaxParams { - return 0, nil, qerr.CryptoTooManyEntries + return HandshakeMessage{}, qerr.CryptoTooManyEntries } index := make([]byte, nPairs*8) if _, err := io.ReadFull(r, index); err != nil { - return 0, nil, err + return HandshakeMessage{}, err } resultMap := map[Tag][]byte{} @@ -44,24 +52,27 @@ func ParseHandshakeMessage(r io.Reader) (Tag, map[Tag][]byte, error) { dataLen := dataEnd - dataStart if dataLen > protocol.CryptoParameterMaxLength { - return 0, nil, qerr.Error(qerr.CryptoInvalidValueLength, "value too long") + return HandshakeMessage{}, qerr.Error(qerr.CryptoInvalidValueLength, "value too long") } data := make([]byte, dataLen) if _, err := io.ReadFull(r, data); err != nil { - return 0, nil, err + return HandshakeMessage{}, err } resultMap[tag] = data dataStart = dataEnd } - return messageTag, resultMap, nil + return HandshakeMessage{ + Tag: messageTag, + Data: resultMap}, nil } -// WriteHandshakeMessage writes a crypto message -func WriteHandshakeMessage(b *bytes.Buffer, messageTag Tag, data map[Tag][]byte) { - utils.WriteUint32(b, uint32(messageTag)) +// Write writes a crypto message +func (h HandshakeMessage) Write(b *bytes.Buffer) { + data := h.Data + utils.WriteUint32(b, uint32(h.Tag)) utils.WriteUint16(b, uint16(len(data))) utils.WriteUint16(b, 0) @@ -71,17 +82,8 @@ func WriteHandshakeMessage(b *bytes.Buffer, messageTag Tag, data map[Tag][]byte) indexData := make([]byte, 8*len(data)) b.Write(indexData) // Will be updated later - // Sort the tags - tags := make([]uint32, len(data)) - i := 0 - for t := range data { - tags[i] = uint32(t) - i++ - } - sort.Sort(utils.Uint32Slice(tags)) - offset := uint32(0) - for i, t := range tags { + for i, t := range h.getTagsSorted() { v := data[Tag(t)] b.Write(v) offset += uint32(len(v)) @@ -93,21 +95,32 @@ func WriteHandshakeMessage(b *bytes.Buffer, messageTag Tag, data map[Tag][]byte) copy(b.Bytes()[indexStart:], indexData) } -func printHandshakeMessage(data map[Tag][]byte) string { - var res string +func (h *HandshakeMessage) getTagsSorted() []uint32 { + tags := make([]uint32, len(h.Data)) + i := 0 + for t := range h.Data { + tags[i] = uint32(t) + i++ + } + sort.Sort(utils.Uint32Slice(tags)) + return tags +} + +func (h HandshakeMessage) String() string { var pad string - for k, v := range data { - if k == TagPAD { - pad = fmt.Sprintf("\t%s: (%d bytes)\n", tagToString(k), len(v)) + res := tagToString(h.Tag) + ":\n" + for _, t := range h.getTagsSorted() { + tag := Tag(t) + if tag == TagPAD { + pad = fmt.Sprintf("\t%s: (%d bytes)\n", tagToString(tag), len(h.Data[tag])) } else { - res += fmt.Sprintf("\t%s: %#v\n", tagToString(k), string(v)) + res += fmt.Sprintf("\t%s: %#v\n", tagToString(tag), string(h.Data[tag])) } } if len(pad) > 0 { res += pad } - return res } diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/interface.go b/vendor/github.com/lucas-clemente/quic-go/handshake/interface.go new file mode 100644 index 0000000..751aae1 --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/interface.go @@ -0,0 +1,24 @@ +package handshake + +import "github.com/lucas-clemente/quic-go/protocol" + +// Sealer seals a packet +type Sealer func(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) []byte + +// CryptoSetup is a crypto setup +type CryptoSetup interface { + Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, protocol.EncryptionLevel, error) + HandleCryptoStream() error + // TODO: clean up this interface + DiversificationNonce() []byte // only needed for cryptoSetupServer + SetDiversificationNonce([]byte) // only needed for cryptoSetupClient + + GetSealer() (protocol.EncryptionLevel, Sealer) + GetSealerWithEncryptionLevel(protocol.EncryptionLevel) (Sealer, error) + GetSealerForCryptoStream() (protocol.EncryptionLevel, Sealer) +} + +// TransportParameters are parameters sent to the peer during the handshake +type TransportParameters struct { + RequestConnectionIDTruncation bool +} diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/server_config.go b/vendor/github.com/lucas-clemente/quic-go/handshake/server_config.go index cd15b20..fce66ef 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/server_config.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/server_config.go @@ -13,7 +13,6 @@ type ServerConfig struct { certChain crypto.CertChain ID []byte obit []byte - stkSource crypto.StkSource } // NewServerConfig creates a new server config @@ -24,41 +23,34 @@ func NewServerConfig(kex crypto.KeyExchange, certChain crypto.CertChain) (*Serve return nil, err } - stkSecret := make([]byte, 32) - if _, err = rand.Read(stkSecret); err != nil { - return nil, err - } - obit := make([]byte, 8) if _, err = rand.Read(obit); err != nil { return nil, err } - stkSource, err := crypto.NewStkSource(stkSecret) - if err != nil { - return nil, err - } - return &ServerConfig{ kex: kex, certChain: certChain, ID: id, obit: obit, - stkSource: stkSource, }, nil } // Get the server config binary representation func (s *ServerConfig) Get() []byte { var serverConfig bytes.Buffer - WriteHandshakeMessage(&serverConfig, TagSCFG, map[Tag][]byte{ - TagSCID: s.ID, - TagKEXS: []byte("C255"), - TagAEAD: []byte("AESG"), - TagPUBS: append([]byte{0x20, 0x00, 0x00}, s.kex.PublicKey()...), - TagOBIT: s.obit, - TagEXPY: {0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}, - }) + msg := HandshakeMessage{ + Tag: TagSCFG, + Data: map[Tag][]byte{ + TagSCID: s.ID, + TagKEXS: []byte("C255"), + TagAEAD: []byte("AESG"), + TagPUBS: append([]byte{0x20, 0x00, 0x00}, s.kex.PublicKey()...), + TagOBIT: s.obit, + TagEXPY: {0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}, + }, + } + msg.Write(&serverConfig) return serverConfig.Bytes() } diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/server_config_client.go b/vendor/github.com/lucas-clemente/quic-go/handshake/server_config_client.go index 1da6551..4201419 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/server_config_client.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/server_config_client.go @@ -8,8 +8,8 @@ import ( "time" "github.com/lucas-clemente/quic-go/crypto" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) type serverConfigClient struct { @@ -28,16 +28,16 @@ var ( // parseServerConfig parses a server config func parseServerConfig(data []byte) (*serverConfigClient, error) { - tag, tagMap, err := ParseHandshakeMessage(bytes.NewReader(data)) + message, err := ParseHandshakeMessage(bytes.NewReader(data)) if err != nil { return nil, err } - if tag != TagSCFG { + if message.Tag != TagSCFG { return nil, errMessageNotServerConfig } scfg := &serverConfigClient{raw: data} - err = scfg.parseValues(tagMap) + err = scfg.parseValues(message.Data) if err != nil { return nil, err } @@ -57,7 +57,6 @@ func (s *serverConfigClient) parseValues(tagMap map[Tag][]byte) error { s.ID = scfgID // KEXS - // TODO: allow for P256 in the list // TODO: setup Key Exchange kexs, ok := tagMap[TagKEXS] if !ok { @@ -66,8 +65,16 @@ func (s *serverConfigClient) parseValues(tagMap map[Tag][]byte) error { if len(kexs)%4 != 0 { return qerr.Error(qerr.CryptoInvalidValueLength, "KEXS") } - if !bytes.Equal(kexs, []byte("C255")) { - return qerr.Error(qerr.CryptoNoSupport, "KEXS") + c255Foundat := -1 + + for i := 0; i < len(kexs)/4; i++ { + if bytes.Equal(kexs[4*i:4*i+4], []byte("C255")) { + c255Foundat = i + break + } + } + if c255Foundat < 0 { + return qerr.Error(qerr.CryptoNoSupport, "KEXS: Could not find C255, other key exchanges are not supported") } // AEAD @@ -90,12 +97,37 @@ func (s *serverConfigClient) parseValues(tagMap map[Tag][]byte) error { } // PUBS - // TODO: save this value pubs, ok := tagMap[TagPUBS] if !ok { return qerr.Error(qerr.CryptoMessageParameterNotFound, "PUBS") } - if len(pubs) != 35 { + + var pubs_kexs []struct{Length uint32; Value []byte} + var last_len uint32 + + for i := 0; i < len(pubs)-3; i += int(last_len)+3 { + // the PUBS value is always prepended by 3 byte little endian length field + + err := binary.Read(bytes.NewReader([]byte{pubs[i], pubs[i+1], pubs[i+2], 0x00}), binary.LittleEndian, &last_len); + if err != nil { + return qerr.Error(qerr.CryptoInvalidValueLength, "PUBS not decodable") + } + if last_len == 0 { + return qerr.Error(qerr.CryptoInvalidValueLength, "PUBS") + } + + if i+3+int(last_len) > len(pubs) { + return qerr.Error(qerr.CryptoInvalidValueLength, "PUBS") + } + + pubs_kexs = append(pubs_kexs, struct{Length uint32; Value []byte}{last_len, pubs[i+3:i+3+int(last_len)]}) + } + + if c255Foundat >= len(pubs_kexs) { + return qerr.Error(qerr.CryptoMessageParameterNotFound, "KEXS not in PUBS") + } + + if pubs_kexs[c255Foundat].Length != 32 { return qerr.Error(qerr.CryptoInvalidValueLength, "PUBS") } @@ -105,8 +137,8 @@ func (s *serverConfigClient) parseValues(tagMap map[Tag][]byte) error { return err } - // the PUBS value is always prepended by []byte{0x20, 0x00, 0x00} - s.sharedSecret, err = s.kex.CalculateSharedKey(pubs[3:]) + + s.sharedSecret, err = s.kex.CalculateSharedKey(pubs_kexs[c255Foundat].Value) if err != nil { return err } diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/stk_generator.go b/vendor/github.com/lucas-clemente/quic-go/handshake/stk_generator.go new file mode 100644 index 0000000..c3caea3 --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/stk_generator.go @@ -0,0 +1,100 @@ +package handshake + +import ( + "encoding/asn1" + "fmt" + "net" + "time" + + "github.com/lucas-clemente/quic-go/crypto" +) + +const ( + stkPrefixIP byte = iota + stkPrefixString +) + +// An STK is a source address token +type STK struct { + RemoteAddr string + SentTime time.Time +} + +// token is the struct that is used for ASN1 serialization and deserialization +type token struct { + Data []byte + Timestamp int64 +} + +// An STKGenerator generates STKs +type STKGenerator struct { + stkSource crypto.StkSource +} + +// NewSTKGenerator initializes a new STKGenerator +func NewSTKGenerator() (*STKGenerator, error) { + stkSource, err := crypto.NewStkSource() + if err != nil { + return nil, err + } + return &STKGenerator{ + stkSource: stkSource, + }, nil +} + +// NewToken generates a new STK token for a given source address +func (g *STKGenerator) NewToken(raddr net.Addr) ([]byte, error) { + data, err := asn1.Marshal(token{ + Data: encodeRemoteAddr(raddr), + Timestamp: time.Now().Unix(), + }) + if err != nil { + return nil, err + } + return g.stkSource.NewToken(data) +} + +// DecodeToken decodes an STK token +func (g *STKGenerator) DecodeToken(encrypted []byte) (*STK, error) { + // if the client didn't send any STK, DecodeToken will be called with a nil-slice + if len(encrypted) == 0 { + return nil, nil + } + + data, err := g.stkSource.DecodeToken(encrypted) + if err != nil { + return nil, err + } + t := &token{} + rest, err := asn1.Unmarshal(data, t) + if err != nil { + return nil, err + } + if len(rest) != 0 { + return nil, fmt.Errorf("rest when unpacking token: %d", len(rest)) + } + return &STK{ + RemoteAddr: decodeRemoteAddr(t.Data), + SentTime: time.Unix(t.Timestamp, 0), + }, nil +} + +// encodeRemoteAddr encodes a remote address such that it can be saved in the STK +func encodeRemoteAddr(remoteAddr net.Addr) []byte { + if udpAddr, ok := remoteAddr.(*net.UDPAddr); ok { + return append([]byte{stkPrefixIP}, udpAddr.IP...) + } + return append([]byte{stkPrefixString}, []byte(remoteAddr.String())...) +} + +// decodeRemoteAddr decodes the remote address saved in the STK +func decodeRemoteAddr(data []byte) string { + // data will never be empty for an STK that we generated. Check it to be on the safe side + if len(data) == 0 { + return "" + } + if data[0] == stkPrefixIP { + return net.IP(data[1:]).String() + } + return string(data[1:]) +} diff --git a/vendor/github.com/lucas-clemente/quic-go/handshake/tags.go b/vendor/github.com/lucas-clemente/quic-go/handshake/tags.go index 56a07f6..2b3783f 100644 --- a/vendor/github.com/lucas-clemente/quic-go/handshake/tags.go +++ b/vendor/github.com/lucas-clemente/quic-go/handshake/tags.go @@ -50,6 +50,11 @@ const ( // TagSFCW is the initial stream flow control receive window. TagSFCW Tag = 'S' + 'F'<<8 + 'C'<<16 + 'W'<<24 + // TagFHL2 forces head of line blocking. + // Chrome experiment (see https://codereview.chromium.org/2115033002) + // unsupported by quic-go + TagFHL2 Tag = 'F' + 'H'<<8 + 'L'<<16 + '2'<<24 + // TagSTK is the source-address token TagSTK Tag = 'S' + 'T'<<8 + 'K'<<16 // TagSNO is the server nonce diff --git a/vendor/github.com/lucas-clemente/quic-go/interface.go b/vendor/github.com/lucas-clemente/quic-go/interface.go new file mode 100644 index 0000000..c4b7ed3 --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/interface.go @@ -0,0 +1,121 @@ +package quic + +import ( + "io" + "net" + "time" + + "github.com/lucas-clemente/quic-go/protocol" +) + +// Stream is the interface implemented by QUIC streams +type Stream interface { + // Read reads data from the stream. + // Read can be made to time out and return a net.Error with Timeout() == true + // after a fixed time limit; see SetDeadline and SetReadDeadline. + io.Reader + // Write writes data to the stream. + // Write can be made to time out and return a net.Error with Timeout() == true + // after a fixed time limit; see SetDeadline and SetWriteDeadline. + io.Writer + io.Closer + StreamID() protocol.StreamID + // Reset closes the stream with an error. + Reset(error) + // SetReadDeadline sets the deadline for future Read calls and + // any currently-blocked Read call. + // A zero value for t means Read will not time out. + SetReadDeadline(t time.Time) error + // SetWriteDeadline sets the deadline for future Write calls + // and any currently-blocked Write call. + // Even if write times out, it may return n > 0, indicating that + // some of the data was successfully written. + // A zero value for t means Write will not time out. + SetWriteDeadline(t time.Time) error + // SetDeadline sets the read and write deadlines associated + // with the connection. It is equivalent to calling both + // SetReadDeadline and SetWriteDeadline. + SetDeadline(t time.Time) error +} + +// A Session is a QUIC connection between two peers. +type Session interface { + // AcceptStream returns the next stream opened by the peer, blocking until one is available. + // Since stream 1 is reserved for the crypto stream, the first stream is either 2 (for a client) or 3 (for a server). + AcceptStream() (Stream, error) + // OpenStream opens a new QUIC stream, returning a special error when the peeer's concurrent stream limit is reached. + // New streams always have the smallest possible stream ID. + // TODO: Enable testing for the special error + OpenStream() (Stream, error) + // OpenStreamSync opens a new QUIC stream, blocking until the peer's concurrent stream limit allows a new stream to be opened. + // It always picks the smallest possible stream ID. + OpenStreamSync() (Stream, error) + // LocalAddr returns the local address. + LocalAddr() net.Addr + // RemoteAddr returns the address of the peer. + RemoteAddr() net.Addr + // Close closes the connection. The error will be sent to the remote peer in a CONNECTION_CLOSE frame. An error value of nil is allowed and will cause a normal PeerGoingAway to be sent. + Close(error) error + // WaitUntilClosed() blocks until the session is closed. + // Warning: This API should not be considered stable and might change soon. + WaitUntilClosed() +} + +// A NonFWSession is a QUIC connection between two peers half-way through the handshake. +// The communication is encrypted, but not yet forward secure. +type NonFWSession interface { + Session + WaitUntilHandshakeComplete() error +} + +// An STK is a Source Address token. +// It is issued by the server and sent to the client. For the client, it is an opaque blob. +// The client can send the STK in subsequent handshakes to prove ownership of its IP address. +type STK struct { + // The remote address this token was issued for. + // If the server is run on a net.UDPConn, this is the string representation of the IP address (net.IP.String()) + // Otherwise, this is the string representation of the net.Addr (net.Addr.String()) + remoteAddr string + // The time that the STK was issued (resolution 1 second) + sentTime time.Time +} + +// Config contains all configuration data needed for a QUIC server or client. +// More config parameters (such as timeouts) will be added soon, see e.g. https://github.com/lucas-clemente/quic-go/issues/441. +type Config struct { + // The QUIC versions that can be negotiated. + // If not set, it uses all versions available. + // Warning: This API should not be considered stable and will change soon. + Versions []protocol.VersionNumber + // Ask the server to truncate the connection ID sent in the Public Header. + // This saves 8 bytes in the Public Header in every packet. However, if the IP address of the server changes, the connection cannot be migrated. + // Currently only valid for the client. + RequestConnectionIDTruncation bool + // HandshakeTimeout is the maximum duration that the cryptographic handshake may take. + // If the timeout is exceeded, the connection is closed. + // If this value is zero, the timeout is set to 10 seconds. + HandshakeTimeout time.Duration + // AcceptSTK determines if an STK is accepted. + // It is called with stk = nil if the client didn't send an STK. + // If not set, it verifies that the address matches, and that the STK was issued within the last 24 hours. + // This option is only valid for the server. + AcceptSTK func(clientAddr net.Addr, stk *STK) bool + // MaxReceiveStreamFlowControlWindow is the maximum stream-level flow control window for receiving data. + // If this value is zero, it will default to 1 MB for the server and 6 MB for the client. + MaxReceiveStreamFlowControlWindow protocol.ByteCount + // MaxReceiveConnectionFlowControlWindow is the connection-level flow control window for receiving data. + // If this value is zero, it will default to 1.5 MB for the server and 15 MB for the client. + MaxReceiveConnectionFlowControlWindow protocol.ByteCount + // KeepAlive defines whether this peer will periodically send PING frames to keep the connection alive. + KeepAlive bool +} + +// A Listener for incoming QUIC connections +type Listener interface { + // Close the server, sending CONNECTION_CLOSE frames to each peer. + Close() error + // Addr returns the local network addr that the server is listening on. + Addr() net.Addr + // Accept returns new sessions. It should be called in a loop. + Accept() (Session, error) +} diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/_gen.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/_gen.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/_gen.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/_gen.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/atomic_bool.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/atomic_bool.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/atomic_bool.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/atomic_bool.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/byteinterval_linkedlist.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/byteinterval_linkedlist.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/byteinterval_linkedlist.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/byteinterval_linkedlist.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/connection_id.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/connection_id.go similarity index 93% rename from vendor/github.com/lucas-clemente/quic-go/utils/connection_id.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/connection_id.go index e0227d0..c2252e6 100644 --- a/vendor/github.com/lucas-clemente/quic-go/utils/connection_id.go +++ b/vendor/github.com/lucas-clemente/quic-go/internal/utils/connection_id.go @@ -9,7 +9,7 @@ import ( // GenerateConnectionID generates a connection ID using cryptographic random func GenerateConnectionID() (protocol.ConnectionID, error) { - b := make([]byte, 8, 8) + b := make([]byte, 8) _, err := rand.Read(b) if err != nil { return 0, err diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/float16.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/float16.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/float16.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/float16.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/host.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/host.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/host.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/host.go diff --git a/vendor/github.com/lucas-clemente/quic-go/internal/utils/log.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/log.go new file mode 100644 index 0000000..9128510 --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/internal/utils/log.go @@ -0,0 +1,94 @@ +package utils + +import ( + "fmt" + "log" + "os" + "time" +) + +// LogLevel of quic-go +type LogLevel uint8 + +const logEnv = "QUIC_GO_LOG_LEVEL" + +const ( + // LogLevelNothing disables + LogLevelNothing LogLevel = iota + // LogLevelError enables err logs + LogLevelError + // LogLevelInfo enables info logs (e.g. packets) + LogLevelInfo + // LogLevelDebug enables debug logs (e.g. packet contents) + LogLevelDebug +) + +var ( + logLevel = LogLevelNothing + timeFormat = "" +) + +// SetLogLevel sets the log level +func SetLogLevel(level LogLevel) { + logLevel = level +} + +// SetLogTimeFormat sets the format of the timestamp +// an empty string disables the logging of timestamps +func SetLogTimeFormat(format string) { + log.SetFlags(0) // disable timestamp logging done by the log package + timeFormat = format +} + +// Debugf logs something +func Debugf(format string, args ...interface{}) { + if logLevel == LogLevelDebug { + logMessage(format, args...) + } +} + +// Infof logs something +func Infof(format string, args ...interface{}) { + if logLevel >= LogLevelInfo { + logMessage(format, args...) + } +} + +// Errorf logs something +func Errorf(format string, args ...interface{}) { + if logLevel >= LogLevelError { + logMessage(format, args...) + } +} + +func logMessage(format string, args ...interface{}) { + if len(timeFormat) > 0 { + log.Printf(time.Now().Format(timeFormat)+" "+format, args...) + } else { + log.Printf(format, args...) + } +} + +// Debug returns true if the log level is LogLevelDebug +func Debug() bool { + return logLevel == LogLevelDebug +} + +func init() { + readLoggingEnv() +} + +func readLoggingEnv() { + switch os.Getenv(logEnv) { + case "": + return + case "DEBUG": + logLevel = LogLevelDebug + case "INFO": + logLevel = LogLevelInfo + case "ERROR": + logLevel = LogLevelError + default: + fmt.Fprintln(os.Stderr, "invalid quic-go log level, see https://github.com/lucas-clemente/quic-go/wiki/Logging") + } +} diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/minmax.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/minmax.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/minmax.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/minmax.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/packet_interval.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/packet_interval.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/packet_interval.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/packet_interval.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/packetinterval_linkedlist.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/packetinterval_linkedlist.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/packetinterval_linkedlist.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/packetinterval_linkedlist.go diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/streamframe_interval.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/streamframe_interval.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/streamframe_interval.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/streamframe_interval.go diff --git a/vendor/github.com/lucas-clemente/quic-go/internal/utils/timer.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/timer.go new file mode 100644 index 0000000..695ad3e --- /dev/null +++ b/vendor/github.com/lucas-clemente/quic-go/internal/utils/timer.go @@ -0,0 +1,43 @@ +package utils + +import "time" + +// A Timer wrapper that behaves correctly when resetting +type Timer struct { + t *time.Timer + read bool + deadline time.Time +} + +// NewTimer creates a new timer that is not set +func NewTimer() *Timer { + return &Timer{t: time.NewTimer(0)} +} + +// Chan returns the channel of the wrapped timer +func (t *Timer) Chan() <-chan time.Time { + return t.t.C +} + +// Reset the timer, no matter whether the value was read or not +func (t *Timer) Reset(deadline time.Time) { + if deadline.Equal(t.deadline) { + // No need to reset the timer + return + } + + // We need to drain the timer if the value from its channel was not read yet. + // See https://groups.google.com/forum/#!topic/golang-dev/c9UUfASVPoU + if !t.t.Stop() && !t.read { + <-t.t.C + } + t.t.Reset(deadline.Sub(time.Now())) + + t.read = false + t.deadline = deadline +} + +// SetRead should be called after the value from the chan was read +func (t *Timer) SetRead() { + t.read = true +} diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/utils.go b/vendor/github.com/lucas-clemente/quic-go/internal/utils/utils.go similarity index 100% rename from vendor/github.com/lucas-clemente/quic-go/utils/utils.go rename to vendor/github.com/lucas-clemente/quic-go/internal/utils/utils.go diff --git a/vendor/github.com/lucas-clemente/quic-go/packet_packer.go b/vendor/github.com/lucas-clemente/quic-go/packet_packer.go index fdf307a..28c29ac 100644 --- a/vendor/github.com/lucas-clemente/quic-go/packet_packer.go +++ b/vendor/github.com/lucas-clemente/quic-go/packet_packer.go @@ -5,15 +5,17 @@ import ( "errors" "fmt" + "github.com/lucas-clemente/quic-go/ackhandler" "github.com/lucas-clemente/quic-go/frames" "github.com/lucas-clemente/quic-go/handshake" "github.com/lucas-clemente/quic-go/protocol" ) type packedPacket struct { - number protocol.PacketNumber - raw []byte - frames []frames.Frame + number protocol.PacketNumber + raw []byte + frames []frames.Frame + encryptionLevel protocol.EncryptionLevel } type packetPacker struct { @@ -23,14 +25,22 @@ type packetPacker struct { cryptoSetup handshake.CryptoSetup packetNumberGenerator *packetNumberGenerator + connectionParameters handshake.ConnectionParametersManager + streamFramer *streamFramer - connectionParameters handshake.ConnectionParametersManager - - streamFramer *streamFramer controlFrames []frames.Frame + stopWaiting *frames.StopWaitingFrame + ackFrame *frames.AckFrame + leastUnacked protocol.PacketNumber } -func newPacketPacker(connectionID protocol.ConnectionID, cryptoSetup handshake.CryptoSetup, connectionParameters handshake.ConnectionParametersManager, streamFramer *streamFramer, perspective protocol.Perspective, version protocol.VersionNumber) *packetPacker { +func newPacketPacker(connectionID protocol.ConnectionID, + cryptoSetup handshake.CryptoSetup, + connectionParameters handshake.ConnectionParametersManager, + streamFramer *streamFramer, + perspective protocol.Perspective, + version protocol.VersionNumber, +) *packetPacker { return &packetPacker{ cryptoSetup: cryptoSetup, connectionID: connectionID, @@ -43,70 +53,91 @@ func newPacketPacker(connectionID protocol.ConnectionID, cryptoSetup handshake.C } // PackConnectionClose packs a packet that ONLY contains a ConnectionCloseFrame -func (p *packetPacker) PackConnectionClose(ccf *frames.ConnectionCloseFrame, leastUnacked protocol.PacketNumber) (*packedPacket, error) { - // in case the connection is closed, all queued control frames aren't of any use anymore - // discard them and queue the ConnectionCloseFrame - p.controlFrames = []frames.Frame{ccf} - return p.packPacket(nil, leastUnacked) +func (p *packetPacker) PackConnectionClose(ccf *frames.ConnectionCloseFrame) (*packedPacket, error) { + frames := []frames.Frame{ccf} + encLevel, sealer := p.cryptoSetup.GetSealer() + ph := p.getPublicHeader(encLevel) + raw, err := p.writeAndSealPacket(ph, frames, sealer) + return &packedPacket{ + number: ph.PacketNumber, + raw: raw, + frames: frames, + encryptionLevel: encLevel, + }, err } -// PackPacket packs a new packet -// the stopWaitingFrame is *guaranteed* to be included in the next packet -// the other controlFrames are sent in the next packet, but might be queued and sent in the next packet if the packet would overflow MaxPacketSize otherwise -func (p *packetPacker) PackPacket(stopWaitingFrame *frames.StopWaitingFrame, controlFrames []frames.Frame, leastUnacked protocol.PacketNumber) (*packedPacket, error) { - p.controlFrames = append(p.controlFrames, controlFrames...) - return p.packPacket(stopWaitingFrame, leastUnacked) +func (p *packetPacker) PackAckPacket() (*packedPacket, error) { + if p.ackFrame == nil { + return nil, errors.New("packet packer BUG: no ack frame queued") + } + encLevel, sealer := p.cryptoSetup.GetSealer() + ph := p.getPublicHeader(encLevel) + frames := []frames.Frame{p.ackFrame} + if p.stopWaiting != nil { + p.stopWaiting.PacketNumber = ph.PacketNumber + p.stopWaiting.PacketNumberLen = ph.PacketNumberLen + frames = append(frames, p.stopWaiting) + p.stopWaiting = nil + } + p.ackFrame = nil + raw, err := p.writeAndSealPacket(ph, frames, sealer) + return &packedPacket{ + number: ph.PacketNumber, + raw: raw, + frames: frames, + encryptionLevel: encLevel, + }, err } -func (p *packetPacker) packPacket(stopWaitingFrame *frames.StopWaitingFrame, leastUnacked protocol.PacketNumber) (*packedPacket, error) { - // cryptoSetup needs to be locked here, so that the AEADs are not changed between - // calling DiversificationNonce() and Seal(). - p.cryptoSetup.LockForSealing() - defer p.cryptoSetup.UnlockForSealing() - - currentPacketNumber := p.packetNumberGenerator.Peek() - packetNumberLen := protocol.GetPacketNumberLengthForPublicHeader(currentPacketNumber, leastUnacked) - responsePublicHeader := &PublicHeader{ - ConnectionID: p.connectionID, - PacketNumber: currentPacketNumber, - PacketNumberLen: packetNumberLen, - TruncateConnectionID: p.connectionParameters.TruncateConnectionID(), +// PackHandshakeRetransmission retransmits a handshake packet, that was sent with less than forward-secure encryption +func (p *packetPacker) PackHandshakeRetransmission(packet *ackhandler.Packet) (*packedPacket, error) { + if packet.EncryptionLevel == protocol.EncryptionForwardSecure { + return nil, errors.New("PacketPacker BUG: forward-secure encrypted handshake packets don't need special treatment") } - - if p.perspective == protocol.PerspectiveServer { - responsePublicHeader.DiversificationNonce = p.cryptoSetup.DiversificationNonce() - } - - // TODO: stop sending version numbers once a version has been negotiated - if p.perspective == protocol.PerspectiveClient { - responsePublicHeader.VersionFlag = true - responsePublicHeader.VersionNumber = p.version - } - - publicHeaderLength, err := responsePublicHeader.GetLength(p.perspective) + sealer, err := p.cryptoSetup.GetSealerWithEncryptionLevel(packet.EncryptionLevel) if err != nil { return nil, err } + if p.stopWaiting == nil { + return nil, errors.New("PacketPacker BUG: Handshake retransmissions must contain a StopWaitingFrame") + } + ph := p.getPublicHeader(packet.EncryptionLevel) + p.stopWaiting.PacketNumber = ph.PacketNumber + p.stopWaiting.PacketNumberLen = ph.PacketNumberLen + frames := append([]frames.Frame{p.stopWaiting}, packet.Frames...) + p.stopWaiting = nil + raw, err := p.writeAndSealPacket(ph, frames, sealer) + return &packedPacket{ + number: ph.PacketNumber, + raw: raw, + frames: frames, + encryptionLevel: packet.EncryptionLevel, + }, err +} - if stopWaitingFrame != nil { - stopWaitingFrame.PacketNumber = currentPacketNumber - stopWaitingFrame.PacketNumberLen = packetNumberLen +// PackPacket packs a new packet +// the other controlFrames are sent in the next packet, but might be queued and sent in the next packet if the packet would overflow MaxPacketSize otherwise +func (p *packetPacker) PackPacket() (*packedPacket, error) { + if p.streamFramer.HasCryptoStreamFrame() { + return p.packCryptoPacket() } - // we're packing a ConnectionClose, don't add any StreamFrames - var isConnectionClose bool - if len(p.controlFrames) == 1 { - _, isConnectionClose = p.controlFrames[0].(*frames.ConnectionCloseFrame) + encLevel, sealer := p.cryptoSetup.GetSealer() + + publicHeader := p.getPublicHeader(encLevel) + publicHeaderLength, err := publicHeader.GetLength(p.perspective) + if err != nil { + return nil, err + } + if p.stopWaiting != nil { + p.stopWaiting.PacketNumber = publicHeader.PacketNumber + p.stopWaiting.PacketNumberLen = publicHeader.PacketNumberLen } - var payloadFrames []frames.Frame - if isConnectionClose { - payloadFrames = []frames.Frame{p.controlFrames[0]} - } else { - payloadFrames, err = p.composeNextPacket(stopWaitingFrame, publicHeaderLength) - if err != nil { - return nil, err - } + maxSize := protocol.MaxFrameAndPublicHeaderSize - publicHeaderLength + payloadFrames, err := p.composeNextPacket(maxSize, p.canSendData(encLevel)) + if err != nil { + return nil, err } // Check if we have enough frames to send @@ -114,64 +145,76 @@ func (p *packetPacker) packPacket(stopWaitingFrame *frames.StopWaitingFrame, lea return nil, nil } // Don't send out packets that only contain a StopWaitingFrame - if len(payloadFrames) == 1 && stopWaitingFrame != nil { + if len(payloadFrames) == 1 && p.stopWaiting != nil { return nil, nil } + p.stopWaiting = nil + p.ackFrame = nil - raw := getPacketBuffer() - buffer := bytes.NewBuffer(raw) - - if err = responsePublicHeader.Write(buffer, p.version, p.perspective); err != nil { + raw, err := p.writeAndSealPacket(publicHeader, payloadFrames, sealer) + if err != nil { return nil, err } - - payloadStartIndex := buffer.Len() - - for _, frame := range payloadFrames { - err := frame.Write(buffer, p.version) - if err != nil { - return nil, err - } - } - - if protocol.ByteCount(buffer.Len()+12) > protocol.MaxPacketSize { - return nil, errors.New("PacketPacker BUG: packet too large") - } - - raw = raw[0:buffer.Len()] - p.cryptoSetup.Seal(raw[payloadStartIndex:payloadStartIndex], raw[payloadStartIndex:], currentPacketNumber, raw[:payloadStartIndex]) - raw = raw[0 : buffer.Len()+12] - - num := p.packetNumberGenerator.Pop() - if num != currentPacketNumber { - return nil, errors.New("PacketPacker BUG: Peeked and Popped packet numbers do not match.") - } - return &packedPacket{ - number: currentPacketNumber, - raw: raw, - frames: payloadFrames, + number: publicHeader.PacketNumber, + raw: raw, + frames: payloadFrames, + encryptionLevel: encLevel, }, nil } -func (p *packetPacker) composeNextPacket(stopWaitingFrame *frames.StopWaitingFrame, publicHeaderLength protocol.ByteCount) ([]frames.Frame, error) { +func (p *packetPacker) packCryptoPacket() (*packedPacket, error) { + encLevel, sealer := p.cryptoSetup.GetSealerForCryptoStream() + publicHeader := p.getPublicHeader(encLevel) + publicHeaderLength, err := publicHeader.GetLength(p.perspective) + if err != nil { + return nil, err + } + maxLen := protocol.MaxFrameAndPublicHeaderSize - protocol.NonForwardSecurePacketSizeReduction - publicHeaderLength + frames := []frames.Frame{p.streamFramer.PopCryptoStreamFrame(maxLen)} + raw, err := p.writeAndSealPacket(publicHeader, frames, sealer) + if err != nil { + return nil, err + } + return &packedPacket{ + number: publicHeader.PacketNumber, + raw: raw, + frames: frames, + encryptionLevel: encLevel, + }, nil +} + +func (p *packetPacker) composeNextPacket( + maxFrameSize protocol.ByteCount, + canSendStreamFrames bool, +) ([]frames.Frame, error) { var payloadLength protocol.ByteCount var payloadFrames []frames.Frame - maxFrameSize := protocol.MaxFrameAndPublicHeaderSize - publicHeaderLength - - if stopWaitingFrame != nil { - payloadFrames = append(payloadFrames, stopWaitingFrame) - minLength, err := stopWaitingFrame.MinLength(p.version) + // STOP_WAITING and ACK will always fit + if p.stopWaiting != nil { + payloadFrames = append(payloadFrames, p.stopWaiting) + l, err := p.stopWaiting.MinLength(p.version) if err != nil { return nil, err } - payloadLength += minLength + payloadLength += l + } + if p.ackFrame != nil { + payloadFrames = append(payloadFrames, p.ackFrame) + l, err := p.ackFrame.MinLength(p.version) + if err != nil { + return nil, err + } + payloadLength += l } for len(p.controlFrames) > 0 { frame := p.controlFrames[len(p.controlFrames)-1] - minLength, _ := frame.MinLength(p.version) // controlFrames does not contain any StopWaitingFrames. So it will *never* return an error + minLength, err := frame.MinLength(p.version) + if err != nil { + return nil, err + } if payloadLength+minLength > maxFrameSize { break } @@ -184,6 +227,10 @@ func (p *packetPacker) composeNextPacket(stopWaitingFrame *frames.StopWaitingFra return nil, fmt.Errorf("Packet Packer BUG: packet payload (%d) too large (%d)", payloadLength, maxFrameSize) } + if !canSendStreamFrames { + return payloadFrames, nil + } + // temporarily increase the maxFrameSize by 2 bytes // this leads to a properly sized packet in all cases, since we do all the packet length calculations with StreamFrames that have the DataLen set // however, for the last StreamFrame in the packet, we can omit the DataLen, thus saving 2 bytes and yielding a packet of exactly the correct size @@ -206,6 +253,79 @@ func (p *packetPacker) composeNextPacket(stopWaitingFrame *frames.StopWaitingFra return payloadFrames, nil } -func (p *packetPacker) QueueControlFrameForNextPacket(f frames.Frame) { - p.controlFrames = append(p.controlFrames, f) +func (p *packetPacker) QueueControlFrame(frame frames.Frame) { + switch f := frame.(type) { + case *frames.StopWaitingFrame: + p.stopWaiting = f + case *frames.AckFrame: + p.ackFrame = f + default: + p.controlFrames = append(p.controlFrames, f) + } +} + +func (p *packetPacker) getPublicHeader(encLevel protocol.EncryptionLevel) *PublicHeader { + pnum := p.packetNumberGenerator.Peek() + packetNumberLen := protocol.GetPacketNumberLengthForPublicHeader(pnum, p.leastUnacked) + publicHeader := &PublicHeader{ + ConnectionID: p.connectionID, + PacketNumber: pnum, + PacketNumberLen: packetNumberLen, + TruncateConnectionID: p.connectionParameters.TruncateConnectionID(), + } + + if p.perspective == protocol.PerspectiveServer && encLevel == protocol.EncryptionSecure { + publicHeader.DiversificationNonce = p.cryptoSetup.DiversificationNonce() + } + if p.perspective == protocol.PerspectiveClient && encLevel != protocol.EncryptionForwardSecure { + publicHeader.VersionFlag = true + publicHeader.VersionNumber = p.version + } + + return publicHeader +} + +func (p *packetPacker) writeAndSealPacket( + publicHeader *PublicHeader, + payloadFrames []frames.Frame, + sealer handshake.Sealer, +) ([]byte, error) { + raw := getPacketBuffer() + buffer := bytes.NewBuffer(raw) + + if err := publicHeader.Write(buffer, p.version, p.perspective); err != nil { + return nil, err + } + payloadStartIndex := buffer.Len() + for _, frame := range payloadFrames { + err := frame.Write(buffer, p.version) + if err != nil { + return nil, err + } + } + if protocol.ByteCount(buffer.Len()+12) > protocol.MaxPacketSize { + return nil, errors.New("PacketPacker BUG: packet too large") + } + + raw = raw[0:buffer.Len()] + _ = sealer(raw[payloadStartIndex:payloadStartIndex], raw[payloadStartIndex:], publicHeader.PacketNumber, raw[:payloadStartIndex]) + raw = raw[0 : buffer.Len()+12] + + num := p.packetNumberGenerator.Pop() + if num != publicHeader.PacketNumber { + return nil, errors.New("packetPacker BUG: Peeked and Popped packet numbers do not match") + } + + return raw, nil +} + +func (p *packetPacker) canSendData(encLevel protocol.EncryptionLevel) bool { + if p.perspective == protocol.PerspectiveClient { + return encLevel >= protocol.EncryptionSecure + } + return encLevel == protocol.EncryptionForwardSecure +} + +func (p *packetPacker) SetLeastUnacked(leastUnacked protocol.PacketNumber) { + p.leastUnacked = leastUnacked } diff --git a/vendor/github.com/lucas-clemente/quic-go/packet_unpacker.go b/vendor/github.com/lucas-clemente/quic-go/packet_unpacker.go index cec85ed..c92e6a5 100644 --- a/vendor/github.com/lucas-clemente/quic-go/packet_unpacker.go +++ b/vendor/github.com/lucas-clemente/quic-go/packet_unpacker.go @@ -5,21 +5,29 @@ import ( "errors" "fmt" - "github.com/lucas-clemente/quic-go/crypto" "github.com/lucas-clemente/quic-go/frames" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" ) +type unpackedPacket struct { + encryptionLevel protocol.EncryptionLevel + frames []frames.Frame +} + +type quicAEAD interface { + Open(dst, src []byte, packetNumber protocol.PacketNumber, associatedData []byte) ([]byte, protocol.EncryptionLevel, error) +} + type packetUnpacker struct { version protocol.VersionNumber - aead crypto.AEAD + aead quicAEAD } func (u *packetUnpacker) Unpack(publicHeaderBinary []byte, hdr *PublicHeader, data []byte) (*unpackedPacket, error) { buf := getPacketBuffer() defer putPacketBuffer(buf) - decrypted, err := u.aead.Open(buf, data, hdr.PacketNumber, publicHeaderBinary) + decrypted, encryptionLevel, err := u.aead.Open(buf, data, hdr.PacketNumber, publicHeaderBinary) if err != nil { // Wrap err in quicError so that public reset is sent by session return nil, qerr.Error(qerr.DecryptionFailure, err.Error()) @@ -33,9 +41,11 @@ func (u *packetUnpacker) Unpack(publicHeaderBinary []byte, hdr *PublicHeader, da fs := make([]frames.Frame, 0, 2) // Read all frames in the packet -ReadLoop: for r.Len() > 0 { typeByte, _ := r.ReadByte() + if typeByte == 0x0 { // PADDING frame + continue + } r.UnreadByte() var frame frames.Frame @@ -43,6 +53,11 @@ ReadLoop: frame, err = frames.ParseStreamFrame(r) if err != nil { err = qerr.Error(qerr.InvalidStreamData, err.Error()) + } else { + streamID := frame.(*frames.StreamFrame).StreamID + if streamID != 1 && encryptionLevel <= protocol.EncryptionUnencrypted { + err = qerr.Error(qerr.UnencryptedStreamData, fmt.Sprintf("received unencrypted stream data on stream %d", streamID)) + } } } else if typeByte&0xc0 == 0x40 { frame, err = frames.ParseAckFrame(r, u.version) @@ -53,8 +68,6 @@ ReadLoop: err = errors.New("unimplemented: CONGESTION_FEEDBACK") } else { switch typeByte { - case 0x0: // PAD, end of frames - break ReadLoop case 0x01: frame, err = frames.ParseRstStreamFrame(r) if err != nil { @@ -100,6 +113,7 @@ ReadLoop: } return &unpackedPacket{ - frames: fs, + encryptionLevel: encryptionLevel, + frames: fs, }, nil } diff --git a/vendor/github.com/lucas-clemente/quic-go/protocol/encryption_level.go b/vendor/github.com/lucas-clemente/quic-go/protocol/encryption_level.go index 3622c9f..19480b1 100644 --- a/vendor/github.com/lucas-clemente/quic-go/protocol/encryption_level.go +++ b/vendor/github.com/lucas-clemente/quic-go/protocol/encryption_level.go @@ -5,10 +5,24 @@ package protocol type EncryptionLevel int const ( - // Unencrypted is not encrypted - Unencrypted EncryptionLevel = iota + // EncryptionUnspecified is a not specified encryption level + EncryptionUnspecified EncryptionLevel = iota + // EncryptionUnencrypted is not encrypted + EncryptionUnencrypted // EncryptionSecure is encrypted, but not forward secure EncryptionSecure // EncryptionForwardSecure is forward secure EncryptionForwardSecure ) + +func (e EncryptionLevel) String() string { + switch e { + case EncryptionUnencrypted: + return "unencrypted" + case EncryptionSecure: + return "encrypted (not forward-secure)" + case EncryptionForwardSecure: + return "forward-secure" + } + return "unknown" +} diff --git a/vendor/github.com/lucas-clemente/quic-go/protocol/protocol.go b/vendor/github.com/lucas-clemente/quic-go/protocol/protocol.go index bb36e3b..cf9cf05 100644 --- a/vendor/github.com/lucas-clemente/quic-go/protocol/protocol.go +++ b/vendor/github.com/lucas-clemente/quic-go/protocol/protocol.go @@ -1,9 +1,6 @@ package protocol -import ( - "math" - "time" -) +import "math" // A PacketNumber in QUIC type PacketNumber uint64 @@ -34,14 +31,13 @@ type StreamID uint32 type ByteCount uint64 // MaxByteCount is the maximum value of a ByteCount -const MaxByteCount = math.MaxUint64 +const MaxByteCount = ByteCount(math.MaxUint64) -// MaxPacketSize is the maximum packet size, including the public header -// This is the value used by Chromium for a QUIC packet sent using IPv6 (for IPv4 it would be 1370) -const MaxPacketSize ByteCount = 1350 - -// MaxFrameAndPublicHeaderSize is the maximum size of a QUIC frame plus PublicHeader -const MaxFrameAndPublicHeaderSize = MaxPacketSize - 12 /*crypto signature*/ +// MaxReceivePacketSize maximum packet size of any QUIC packet, based on +// ethernet's max size, minus the IP and UDP headers. IPv6 has a 40 byte header, +// UDP adds an additional 8 bytes. This is a total overhead of 48 bytes. +// Ethernet's max packet size is 1500 bytes, 1500 - 48 = 1452. +const MaxReceivePacketSize ByteCount = 1452 // DefaultTCPMSS is the default maximum packet size used in the Linux TCP implementation. // Used in QUIC for congestion window computations in bytes. @@ -53,15 +49,6 @@ const InitialStreamFlowControlWindow ByteCount = (1 << 14) // 16 kB // InitialConnectionFlowControlWindow is the initial connection-level flow control window for sending const InitialConnectionFlowControlWindow ByteCount = (1 << 14) // 16 kB -// DefaultRetransmissionTime is the RTO time on new connections -const DefaultRetransmissionTime = 500 * time.Millisecond - -// MinRetransmissionTime is the minimum RTO time -const MinRetransmissionTime = 200 * time.Millisecond - -// MaxRetransmissionTime is the maximum RTO time -const MaxRetransmissionTime = 60 * time.Second - // ClientHelloMinimumSize is the minimum size the server expects an inchoate CHLO to have. const ClientHelloMinimumSize = 1024 diff --git a/vendor/github.com/lucas-clemente/quic-go/protocol/server_parameters.go b/vendor/github.com/lucas-clemente/quic-go/protocol/server_parameters.go index 1198182..8e632cc 100644 --- a/vendor/github.com/lucas-clemente/quic-go/protocol/server_parameters.go +++ b/vendor/github.com/lucas-clemente/quic-go/protocol/server_parameters.go @@ -2,6 +2,17 @@ package protocol import "time" +// MaxPacketSize is the maximum packet size, including the public header, that we use for sending packets +// This is the value used by Chromium for a QUIC packet sent using IPv6 (for IPv4 it would be 1370) +const MaxPacketSize ByteCount = 1350 + +// MaxFrameAndPublicHeaderSize is the maximum size of a QUIC frame plus PublicHeader +const MaxFrameAndPublicHeaderSize = MaxPacketSize - 12 /*crypto signature*/ + +// NonForwardSecurePacketSizeReduction is the number of bytes a non forward-secure packet has to be smaller than a forward-secure packet +// This makes sure that those packets can always be retransmitted without splitting the contained StreamFrames +const NonForwardSecurePacketSizeReduction = 50 + // DefaultMaxCongestionWindow is the default for the max congestion window const DefaultMaxCongestionWindow = 1000 @@ -12,6 +23,10 @@ const InitialCongestionWindow = 32 // session queues for later until it sends a public reset. const MaxUndecryptablePackets = 10 +// PublicResetTimeout is the time to wait before sending a Public Reset when receiving too many undecryptable packets during the handshake +// This timeout allows the Go scheduler to switch to the Go rountine that reads the crypto stream and to escalate the crypto +const PublicResetTimeout = 500 * time.Millisecond + // AckSendDelay is the maximum delay that can be applied to an ACK for a retransmittable packet // This is the value Chromium is using const AckSendDelay = 25 * time.Millisecond @@ -24,21 +39,25 @@ const ReceiveStreamFlowControlWindow ByteCount = (1 << 10) * 32 // 32 kB // This is the value that Google servers are using const ReceiveConnectionFlowControlWindow ByteCount = (1 << 10) * 48 // 48 kB -// MaxReceiveStreamFlowControlWindowServer is the maximum stream-level flow control window for receiving data +// DefaultMaxReceiveStreamFlowControlWindowServer is the default maximum stream-level flow control window for receiving data, for the server // This is the value that Google servers are using -const MaxReceiveStreamFlowControlWindowServer ByteCount = 1 * (1 << 20) // 1 MB +const DefaultMaxReceiveStreamFlowControlWindowServer ByteCount = 1 * (1 << 20) // 1 MB -// MaxReceiveConnectionFlowControlWindowServer is the connection-level flow control window for receiving data +// DefaultMaxReceiveConnectionFlowControlWindowServer is the default connection-level flow control window for receiving data, for the server // This is the value that Google servers are using -const MaxReceiveConnectionFlowControlWindowServer ByteCount = 1.5 * (1 << 20) // 1.5 MB +const DefaultMaxReceiveConnectionFlowControlWindowServer ByteCount = 1.5 * (1 << 20) // 1.5 MB -// MaxReceiveStreamFlowControlWindowClient is the maximum stream-level flow control window for receiving data, for the client +// DefaultMaxReceiveStreamFlowControlWindowClient is the default maximum stream-level flow control window for receiving data, for the client // This is the value that Chromium is using -const MaxReceiveStreamFlowControlWindowClient ByteCount = 6 * (1 << 20) // 6 MB +const DefaultMaxReceiveStreamFlowControlWindowClient ByteCount = 6 * (1 << 20) // 6 MB -// MaxReceiveConnectionFlowControlWindowClient is the connection-level flow control window for receiving data, for the server +// DefaultMaxReceiveConnectionFlowControlWindowClient is the default connection-level flow control window for receiving data, for the client // This is the value that Google servers are using -const MaxReceiveConnectionFlowControlWindowClient ByteCount = 15 * (1 << 20) // 15 MB +const DefaultMaxReceiveConnectionFlowControlWindowClient ByteCount = 15 * (1 << 20) // 15 MB + +// ConnectionFlowControlMultiplier determines how much larger the connection flow control windows needs to be relative to any stream's flow control window +// This is the value that Chromium is using +const ConnectionFlowControlMultiplier = 1.5 // MaxStreamsPerConnection is the maximum value accepted for the number of streams per connection const MaxStreamsPerConnection = 100 @@ -59,17 +78,14 @@ const MaxNewStreamIDDelta = 4 * MaxStreamsPerConnection // MaxSessionUnprocessedPackets is the max number of packets stored in each session that are not yet processed. const MaxSessionUnprocessedPackets = DefaultMaxCongestionWindow -// RetransmissionThreshold + 1 is the number of times a packet has to be NACKed so that it gets retransmitted -const RetransmissionThreshold = 3 - // SkipPacketAveragePeriodLength is the average period length in which one packet number is skipped to prevent an Optimistic ACK attack const SkipPacketAveragePeriodLength PacketNumber = 500 // MaxTrackedSkippedPackets is the maximum number of skipped packet numbers the SentPacketHandler keep track of for Optimistic ACK attack mitigation const MaxTrackedSkippedPackets = 10 -// STKExpiryTimeSec is the valid time of a source address token in seconds -const STKExpiryTimeSec = 24 * 60 * 60 +// STKExpiryTime is the valid time of a source address token +const STKExpiryTime = 24 * time.Hour // MaxTrackedSentPackets is maximum number of sent packets saved for either later retransmission or entropy calculation const MaxTrackedSentPackets = 2 * DefaultMaxCongestionWindow @@ -112,8 +128,8 @@ const MaxIdleTimeoutServer = 1 * time.Minute // MaxIdleTimeoutClient is the idle timeout that the client suggests to the server const MaxIdleTimeoutClient = 2 * time.Minute -// MaxTimeForCryptoHandshake is the default timeout for a connection until the crypto handshake succeeds. -const MaxTimeForCryptoHandshake = 10 * time.Second +// DefaultHandshakeTimeout is the default timeout for a connection until the crypto handshake succeeds. +const DefaultHandshakeTimeout = 10 * time.Second // ClosedSessionDeleteTimeout the server ignores packets arriving on a connection that is already closed // after this time all information about the old connection will be deleted diff --git a/vendor/github.com/lucas-clemente/quic-go/protocol/version.go b/vendor/github.com/lucas-clemente/quic-go/protocol/version.go index 3c1a70b..388162e 100644 --- a/vendor/github.com/lucas-clemente/quic-go/protocol/version.go +++ b/vendor/github.com/lucas-clemente/quic-go/protocol/version.go @@ -1,35 +1,23 @@ package protocol -import ( - "bytes" - "encoding/binary" - "strconv" -) - // VersionNumber is a version number as int type VersionNumber int // The version numbers, making grepping easier const ( - Version34 VersionNumber = 34 + iota - Version35 + Version35 VersionNumber = 35 + iota Version36 - VersionWhatever = 0 // for when the version doesn't matter - VersionUnsupported = -1 + Version37 + VersionWhatever VersionNumber = 0 // for when the version doesn't matter + VersionUnsupported VersionNumber = -1 ) // SupportedVersions lists the versions that the server supports -// must be in sorted order +// must be in sorted descending order var SupportedVersions = []VersionNumber{ - Version34, Version35, Version36, + Version37, Version36, Version35, } -// SupportedVersionsAsTags is needed for the SHLO crypto message -var SupportedVersionsAsTags []byte - -// SupportedVersionsAsString is needed for the Alt-Scv HTTP header -var SupportedVersionsAsString string - // VersionNumberToTag maps version numbers ('32') to tags ('Q032') func VersionNumberToTag(vn VersionNumber) uint32 { v := uint32(vn) @@ -42,8 +30,8 @@ func VersionTagToNumber(v uint32) VersionNumber { } // IsSupportedVersion returns true if the server supports this version -func IsSupportedVersion(v VersionNumber) bool { - for _, t := range SupportedVersions { +func IsSupportedVersion(supported []VersionNumber, v VersionNumber) bool { + for _, t := range supported { if t == v { return true } @@ -51,41 +39,17 @@ func IsSupportedVersion(v VersionNumber) bool { return false } -// HighestSupportedVersion finds the highest version number that is both present in other and in SupportedVersions -// the versions in other do not need to be ordered -// it returns true and the version number, if there is one, otherwise false -func HighestSupportedVersion(other []VersionNumber) (bool, VersionNumber) { - var otherSupported []VersionNumber - for _, ver := range other { - if ver != VersionUnsupported { - otherSupported = append(otherSupported, ver) - } - } - - for i := len(SupportedVersions) - 1; i >= 0; i-- { - for _, ver := range otherSupported { - if ver == SupportedVersions[i] { - return true, ver +// ChooseSupportedVersion finds the best version in the overlap of ours and theirs +// ours is a slice of versions that we support, sorted by our preference (descending) +// theirs is a slice of versions offered by the peer. The order does not matter +// if no suitable version is found, it returns VersionUnsupported +func ChooseSupportedVersion(ours, theirs []VersionNumber) VersionNumber { + for _, ourVer := range ours { + for _, theirVer := range theirs { + if ourVer == theirVer { + return ourVer } } } - - return false, 0 -} - -func init() { - var b bytes.Buffer - for _, v := range SupportedVersions { - s := make([]byte, 4) - binary.LittleEndian.PutUint32(s, VersionNumberToTag(v)) - b.Write(s) - } - SupportedVersionsAsTags = b.Bytes() - - for i := len(SupportedVersions) - 1; i >= 0; i-- { - SupportedVersionsAsString += strconv.Itoa(int(SupportedVersions[i])) - if i != 0 { - SupportedVersionsAsString += "," - } - } + return VersionUnsupported } diff --git a/vendor/github.com/lucas-clemente/quic-go/public_header.go b/vendor/github.com/lucas-clemente/quic-go/public_header.go index 9613ea2..59ddc6c 100644 --- a/vendor/github.com/lucas-clemente/quic-go/public_header.go +++ b/vendor/github.com/lucas-clemente/quic-go/public_header.go @@ -4,9 +4,9 @@ import ( "bytes" "errors" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) var ( @@ -17,7 +17,7 @@ var ( errGetLengthNotForVersionNegotiation = errors.New("PublicHeader: GetLength cannot be called for VersionNegotiation packets") ) -// The PublicHeader of a QUIC packet +// The PublicHeader of a QUIC packet. Warning: This struct should not be considered stable and will change soon. type PublicHeader struct { Raw []byte ConnectionID protocol.ConnectionID @@ -31,7 +31,7 @@ type PublicHeader struct { DiversificationNonce []byte } -// Write writes a public header +// Write writes a public header. Warning: This API should not be considered stable and will change soon. func (h *PublicHeader) Write(b *bytes.Buffer, version protocol.VersionNumber, pers protocol.Perspective) error { publicFlagByte := uint8(0x00) @@ -109,8 +109,9 @@ func (h *PublicHeader) Write(b *bytes.Buffer, version protocol.VersionNumber, pe return nil } -// ParsePublicHeader parses a QUIC packet's public header -// the packetSentBy is the perspective of the peer that sent this PublicHeader, i.e. if we're the server, packetSentBy should be PerspectiveClient +// ParsePublicHeader parses a QUIC packet's public header. +// The packetSentBy is the perspective of the peer that sent this PublicHeader, i.e. if we're the server, packetSentBy should be PerspectiveClient. +// Warning: This API should not be considered stable and will change soon. func ParsePublicHeader(b *bytes.Reader, packetSentBy protocol.Perspective) (*PublicHeader, error) { header := &PublicHeader{} @@ -128,7 +129,8 @@ func ParsePublicHeader(b *bytes.Reader, packetSentBy protocol.Perspective) (*Pub // return nil, errors.New("diversification nonces should only be sent by servers") // } - if publicFlagByte&0x08 == 0 { + header.TruncateConnectionID = publicFlagByte&0x08 == 0 + if header.TruncateConnectionID && packetSentBy == protocol.PerspectiveClient { return nil, errReceivedTruncatedConnectionID } @@ -146,14 +148,16 @@ func ParsePublicHeader(b *bytes.Reader, packetSentBy protocol.Perspective) (*Pub } // Connection ID - connID, err := utils.ReadUint64(b) - if err != nil { - return nil, err - } - - header.ConnectionID = protocol.ConnectionID(connID) - if header.ConnectionID == 0 { - return nil, errInvalidConnectionID + if !header.TruncateConnectionID { + var connID uint64 + connID, err = utils.ReadUint64(b) + if err != nil { + return nil, err + } + header.ConnectionID = protocol.ConnectionID(connID) + if header.ConnectionID == 0 { + return nil, errInvalidConnectionID + } } if packetSentBy == protocol.PerspectiveServer && publicFlagByte&0x04 > 0 { @@ -181,9 +185,9 @@ func ParsePublicHeader(b *bytes.Reader, packetSentBy protocol.Perspective) (*Pub } header.VersionNumber = protocol.VersionTagToNumber(versionTag) } else { // parse the version negotiaton packet - if b.Len()%4 != 0 { - return nil, qerr.InvalidVersionNegotiationPacket - } + if b.Len()%4 != 0 { + return nil, qerr.InvalidVersionNegotiationPacket + } header.SupportedVersions = make([]protocol.VersionNumber, 0) for { var versionTag uint32 @@ -192,9 +196,6 @@ func ParsePublicHeader(b *bytes.Reader, packetSentBy protocol.Perspective) (*Pub break } v := protocol.VersionTagToNumber(versionTag) - if !protocol.IsSupportedVersion(v) { - v = protocol.VersionUnsupported - } header.SupportedVersions = append(header.SupportedVersions, v) } } @@ -213,8 +214,8 @@ func ParsePublicHeader(b *bytes.Reader, packetSentBy protocol.Perspective) (*Pub return header, nil } -// GetLength gets the length of the publicHeader in bytes -// can only be called for regular packets +// GetLength gets the length of the publicHeader in bytes. +// It can only be called for regular packets. func (h *PublicHeader) GetLength(pers protocol.Perspective) (protocol.ByteCount, error) { if h.VersionFlag && h.ResetFlag { return 0, errResetAndVersionFlagSet diff --git a/vendor/github.com/lucas-clemente/quic-go/public_reset.go b/vendor/github.com/lucas-clemente/quic-go/public_reset.go index b1f60d4..958db9c 100644 --- a/vendor/github.com/lucas-clemente/quic-go/public_reset.go +++ b/vendor/github.com/lucas-clemente/quic-go/public_reset.go @@ -6,8 +6,8 @@ import ( "errors" "github.com/lucas-clemente/quic-go/handshake" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) type publicReset struct { @@ -32,15 +32,15 @@ func writePublicReset(connectionID protocol.ConnectionID, rejectedPacketNumber p func parsePublicReset(r *bytes.Reader) (*publicReset, error) { pr := publicReset{} - tag, tagMap, err := handshake.ParseHandshakeMessage(r) + msg, err := handshake.ParseHandshakeMessage(r) if err != nil { return nil, err } - if tag != handshake.TagPRST { + if msg.Tag != handshake.TagPRST { return nil, errors.New("wrong public reset tag") } - rseq, ok := tagMap[handshake.TagRSEQ] + rseq, ok := msg.Data[handshake.TagRSEQ] if !ok { return nil, errors.New("RSEQ missing") } @@ -49,7 +49,7 @@ func parsePublicReset(r *bytes.Reader) (*publicReset, error) { } pr.rejectedPacketNumber = protocol.PacketNumber(binary.LittleEndian.Uint64(rseq)) - rnon, ok := tagMap[handshake.TagRNON] + rnon, ok := msg.Data[handshake.TagRNON] if !ok { return nil, errors.New("RNON missing") } diff --git a/vendor/github.com/lucas-clemente/quic-go/qerr/error_codes.go b/vendor/github.com/lucas-clemente/quic-go/qerr/error_codes.go index 4797530..f3e6dd9 100644 --- a/vendor/github.com/lucas-clemente/quic-go/qerr/error_codes.go +++ b/vendor/github.com/lucas-clemente/quic-go/qerr/error_codes.go @@ -89,6 +89,9 @@ const ( EmptyStreamFrameNoFin ErrorCode = 50 // We received invalid data on the headers stream. InvalidHeadersStreamData ErrorCode = 56 + // Invalid data on the headers stream received because of decompression + // failure. + HeadersStreamDataDecompressFailure ErrorCode = 97 // The peer received too much data, violating flow control. FlowControlReceivedTooMuchData ErrorCode = 59 // The peer sent too much data, violating flow control. diff --git a/vendor/github.com/lucas-clemente/quic-go/qerr/errorcode_string.go b/vendor/github.com/lucas-clemente/quic-go/qerr/errorcode_string.go index aadd657..5a8e024 100644 --- a/vendor/github.com/lucas-clemente/quic-go/qerr/errorcode_string.go +++ b/vendor/github.com/lucas-clemente/quic-go/qerr/errorcode_string.go @@ -10,6 +10,7 @@ const ( _ErrorCode_name_2 = "InvalidHeaderIDInvalidNegotiatedValueDecompressionFailureNetworkIdleTimeoutErrorMigratingAddressPacketWriteErrorHandshakeFailedCryptoTagsOutOfOrderCryptoTooManyEntriesCryptoInvalidValueLengthCryptoMessageAfterHandshakeCompleteInvalidCryptoMessageTypeInvalidCryptoMessageParameterCryptoMessageParameterNotFoundCryptoMessageParameterNoOverlapCryptoMessageIndexNotFoundCryptoInternalErrorCryptoVersionNotSupportedCryptoNoSupportCryptoTooManyRejectsProofInvalidCryptoDuplicateTagCryptoEncryptionLevelIncorrectCryptoServerConfigExpiredInvalidStreamData" _ErrorCode_name_3 = "MissingPayloadInvalidPriorityEmptyStreamFrameNoFinPacketReadErrorInvalidChannelIDSignatureCryptoSymmetricKeySetupFailedCryptoMessageWhileValidatingClientHelloVersionNegotiationMismatchInvalidHeadersStreamDataInvalidWindowUpdateDataInvalidBlockedDataFlowControlReceivedTooMuchDataInvalidStopWaitingDataUnencryptedStreamDataConnectionIPPooledFlowControlSentTooMuchDataFlowControlInvalidWindowCryptoUpdateBeforeHandshakeComplete" _ErrorCode_name_4 = "HandshakeTimeoutTooManyOutstandingSentPacketsTooManyOutstandingReceivedPacketsConnectionCancelledBadPacketLossRateCryptoHandshakeStatelessRejectPublicResetsPostHandshakeTimeoutsWithOpenStreamsFailedToSerializePacketTooManyAvailableStreamsUnencryptedFecDataInvalidPathCloseDataBadMultipathFlagIPAddressChangedConnectionMigrationNoMigratableStreamsConnectionMigrationTooManyChangesConnectionMigrationNoNewNetworkConnectionMigrationNonMigratableStreamTooManyRtosErrorMigratingPortOverlappingStreamDataAttemptToSendUnencryptedStreamData" + _ErrorCode_name_5 = "HeadersStreamDataDecompressFailure" ) var ( @@ -18,12 +19,13 @@ var ( _ErrorCode_index_2 = [...]uint16{0, 15, 37, 57, 75, 96, 112, 127, 147, 167, 191, 226, 250, 279, 309, 340, 366, 385, 410, 425, 445, 457, 475, 505, 530, 547} _ErrorCode_index_3 = [...]uint16{0, 14, 29, 50, 65, 90, 119, 158, 184, 208, 231, 249, 279, 301, 322, 340, 366, 390, 425} _ErrorCode_index_4 = [...]uint16{0, 16, 45, 78, 97, 114, 144, 169, 192, 215, 238, 256, 276, 292, 308, 346, 379, 410, 448, 459, 477, 498, 532} + _ErrorCode_index_5 = [...]uint8{0, 34} ) func (i ErrorCode) String() string { switch { case 1 <= i && i <= 14: - i-- + i -= 1 return _ErrorCode_name_0[_ErrorCode_index_0[i]:_ErrorCode_index_0[i+1]] case 16 <= i && i <= 20: i -= 16 @@ -37,6 +39,8 @@ func (i ErrorCode) String() string { case 67 <= i && i <= 88: i -= 67 return _ErrorCode_name_4[_ErrorCode_index_4[i]:_ErrorCode_index_4[i+1]] + case i == 97: + return _ErrorCode_name_5 default: return fmt.Sprintf("ErrorCode(%d)", i) } diff --git a/vendor/github.com/lucas-clemente/quic-go/qerr/quic_error.go b/vendor/github.com/lucas-clemente/quic-go/qerr/quic_error.go index 6259476..9e1956f 100644 --- a/vendor/github.com/lucas-clemente/quic-go/qerr/quic_error.go +++ b/vendor/github.com/lucas-clemente/quic-go/qerr/quic_error.go @@ -3,7 +3,7 @@ package qerr import ( "fmt" - "github.com/lucas-clemente/quic-go/utils" + "github.com/lucas-clemente/quic-go/internal/utils" ) // ErrorCode can be used as a normal error without reason. @@ -31,6 +31,16 @@ func (e *QuicError) Error() string { return fmt.Sprintf("%s: %s", e.ErrorCode.String(), e.ErrorMessage) } +func (e *QuicError) Timeout() bool { + switch e.ErrorCode { + case NetworkIdleTimeout, + HandshakeTimeout, + TimeoutsWithOpenStreams: + return true + } + return false +} + // ToQuicError converts an arbitrary error to a QuicError. It leaves QuicErrors // unchanged, and properly handles `ErrorCode`s. func ToQuicError(err error) *QuicError { diff --git a/vendor/github.com/lucas-clemente/quic-go/server.go b/vendor/github.com/lucas-clemente/quic-go/server.go index 40b3e44..76f07ba 100644 --- a/vendor/github.com/lucas-clemente/quic-go/server.go +++ b/vendor/github.com/lucas-clemente/quic-go/server.go @@ -5,31 +5,30 @@ import ( "crypto/tls" "errors" "net" - "strings" "sync" "time" "github.com/lucas-clemente/quic-go/crypto" "github.com/lucas-clemente/quic-go/handshake" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) // packetHandler handles packets type packetHandler interface { + Session handlePacket(*receivedPacket) - OpenStream(protocol.StreamID) (utils.Stream, error) - run() - Close(error) error + run() error + closeRemote(error) } -// A Server of QUIC -type Server struct { - addr *net.UDPAddr +// A Listener of QUIC +type server struct { + tlsConf *tls.Config + config *Config - conn *net.UDPConn - connMutex sync.Mutex + conn net.PacketConn certChain crypto.CertChain scfg *handshake.ServerConfig @@ -38,15 +37,35 @@ type Server struct { sessionsMutex sync.RWMutex deleteClosedSessionsAfter time.Duration - streamCallback StreamCallback + serverError error + sessionQueue chan Session + errorChan chan struct{} - newSession func(conn connection, v protocol.VersionNumber, connectionID protocol.ConnectionID, sCfg *handshake.ServerConfig, streamCallback StreamCallback, closeCallback closeCallback) (packetHandler, error) + newSession func(conn connection, v protocol.VersionNumber, connectionID protocol.ConnectionID, sCfg *handshake.ServerConfig, tlsConf *tls.Config, config *Config) (packetHandler, <-chan handshakeEvent, error) } -// NewServer makes a new server -func NewServer(addr string, tlsConfig *tls.Config, cb StreamCallback) (*Server, error) { - certChain := crypto.NewCertChain(tlsConfig) +var _ Listener = &server{} +// ListenAddr creates a QUIC server listening on a given address. +// The listener is not active until Serve() is called. +// The tls.Config must not be nil, the quic.Config may be nil. +func ListenAddr(addr string, tlsConf *tls.Config, config *Config) (Listener, error) { + udpAddr, err := net.ResolveUDPAddr("udp", addr) + if err != nil { + return nil, err + } + conn, err := net.ListenUDP("udp", udpAddr) + if err != nil { + return nil, err + } + return Listen(conn, tlsConf, config) +} + +// Listen listens for QUIC connections on a given net.PacketConn. +// The listener is not active until Serve() is called. +// The tls.Config must not be nil, the quic.Config may be nil. +func Listen(conn net.PacketConn, tlsConf *tls.Config, config *Config) (Listener, error) { + certChain := crypto.NewCertChain(tlsConf) kex, err := crypto.NewCurve25519KEX() if err != nil { return nil, err @@ -56,56 +75,111 @@ func NewServer(addr string, tlsConfig *tls.Config, cb StreamCallback) (*Server, return nil, err } - udpAddr, err := net.ResolveUDPAddr("udp", addr) - if err != nil { - return nil, err - } - - return &Server{ - addr: udpAddr, + s := &server{ + conn: conn, + tlsConf: tlsConf, + config: populateServerConfig(config), certChain: certChain, scfg: scfg, - streamCallback: cb, sessions: map[protocol.ConnectionID]packetHandler{}, newSession: newSession, deleteClosedSessionsAfter: protocol.ClosedSessionDeleteTimeout, - }, nil -} - -// ListenAndServe listens and serves a connection -func (s *Server) ListenAndServe() error { - conn, err := net.ListenUDP("udp", s.addr) - if err != nil { - return err + sessionQueue: make(chan Session, 5), + errorChan: make(chan struct{}), } - return s.Serve(conn) + go s.serve() + return s, nil } -// Serve on an existing UDP connection. -func (s *Server) Serve(conn *net.UDPConn) error { - s.connMutex.Lock() - s.conn = conn - s.connMutex.Unlock() +var defaultAcceptSTK = func(clientAddr net.Addr, stk *STK) bool { + if stk == nil { + return false + } + if time.Now().After(stk.sentTime.Add(protocol.STKExpiryTime)) { + return false + } + var sourceAddr string + if udpAddr, ok := clientAddr.(*net.UDPAddr); ok { + sourceAddr = udpAddr.IP.String() + } else { + sourceAddr = clientAddr.String() + } + return sourceAddr == stk.remoteAddr +} +// populateServerConfig populates fields in the quic.Config with their default values, if none are set +// it may be called with nil +func populateServerConfig(config *Config) *Config { + if config == nil { + config = &Config{} + } + versions := config.Versions + if len(versions) == 0 { + versions = protocol.SupportedVersions + } + + vsa := defaultAcceptSTK + if config.AcceptSTK != nil { + vsa = config.AcceptSTK + } + + handshakeTimeout := protocol.DefaultHandshakeTimeout + if config.HandshakeTimeout != 0 { + handshakeTimeout = config.HandshakeTimeout + } + + maxReceiveStreamFlowControlWindow := config.MaxReceiveStreamFlowControlWindow + if maxReceiveStreamFlowControlWindow == 0 { + maxReceiveStreamFlowControlWindow = protocol.DefaultMaxReceiveStreamFlowControlWindowServer + } + maxReceiveConnectionFlowControlWindow := config.MaxReceiveConnectionFlowControlWindow + if maxReceiveConnectionFlowControlWindow == 0 { + maxReceiveConnectionFlowControlWindow = protocol.DefaultMaxReceiveConnectionFlowControlWindowServer + } + + return &Config{ + Versions: versions, + HandshakeTimeout: handshakeTimeout, + AcceptSTK: vsa, + MaxReceiveStreamFlowControlWindow: maxReceiveStreamFlowControlWindow, + MaxReceiveConnectionFlowControlWindow: maxReceiveConnectionFlowControlWindow, + } +} + +// serve listens on an existing PacketConn +func (s *server) serve() { for { data := getPacketBuffer() - data = data[:protocol.MaxPacketSize] - n, remoteAddr, err := conn.ReadFromUDP(data) + data = data[:protocol.MaxReceivePacketSize] + // The packet size should not exceed protocol.MaxReceivePacketSize bytes + // If it does, we only read a truncated packet, which will then end up undecryptable + n, remoteAddr, err := s.conn.ReadFrom(data) if err != nil { - if strings.HasSuffix(err.Error(), "use of closed network connection") { - return nil - } - return err + s.serverError = err + close(s.errorChan) + _ = s.Close() + return } data = data[:n] - if err := s.handlePacket(conn, remoteAddr, data); err != nil { + if err := s.handlePacket(s.conn, remoteAddr, data); err != nil { utils.Errorf("error handling packet: %s", err.Error()) } } } +// Accept returns newly openend sessions +func (s *server) Accept() (Session, error) { + var sess Session + select { + case sess = <-s.sessionQueue: + return sess, nil + case <-s.errorChan: + return nil, s.serverError + } +} + // Close the server -func (s *Server) Close() error { +func (s *server) Close() error { s.sessionsMutex.Lock() for _, session := range s.sessions { if session != nil { @@ -116,26 +190,21 @@ func (s *Server) Close() error { } s.sessionsMutex.Unlock() - s.connMutex.Lock() - conn := s.conn - s.conn = nil - s.connMutex.Unlock() - - if conn == nil { + if s.conn == nil { return nil } - return conn.Close() + return s.conn.Close() } -func (s *Server) handlePacket(conn *net.UDPConn, remoteAddr *net.UDPAddr, packet []byte) error { - if protocol.ByteCount(len(packet)) > protocol.MaxPacketSize { - return qerr.PacketTooLarge - } +// Addr returns the server's network address +func (s *server) Addr() net.Addr { + return s.conn.LocalAddr() +} +func (s *server) handlePacket(pconn net.PacketConn, remoteAddr net.Addr, packet []byte) error { rcvTime := time.Now() r := bytes.NewReader(packet) - hdr, err := ParsePublicHeader(r, protocol.PerspectiveClient) if err != nil { return qerr.Error(qerr.InvalidPacketHeader, err.Error()) @@ -165,43 +234,66 @@ func (s *Server) handlePacket(conn *net.UDPConn, remoteAddr *net.UDPAddr, packet // a session is only created once the client sent a supported version // if we receive a packet for a connection that already has session, it's probably an old packet that was sent by the client before the version was negotiated // it is safe to drop it - if ok && hdr.VersionFlag && !protocol.IsSupportedVersion(hdr.VersionNumber) { + if ok && hdr.VersionFlag && !protocol.IsSupportedVersion(s.config.Versions, hdr.VersionNumber) { return nil } // Send Version Negotiation Packet if the client is speaking a different protocol version - if hdr.VersionFlag && !protocol.IsSupportedVersion(hdr.VersionNumber) { + if hdr.VersionFlag && !protocol.IsSupportedVersion(s.config.Versions, hdr.VersionNumber) { + // drop packets that are too small to be valid first packets + if len(packet) < protocol.ClientHelloMinimumSize+len(hdr.Raw) { + return errors.New("dropping small packet with unknown version") + } utils.Infof("Client offered version %d, sending VersionNegotiationPacket", hdr.VersionNumber) - _, err = conn.WriteToUDP(composeVersionNegotiation(hdr.ConnectionID), remoteAddr) + _, err = pconn.WriteTo(composeVersionNegotiation(hdr.ConnectionID, s.config.Versions), remoteAddr) return err } if !ok { if !hdr.VersionFlag { - _, err = conn.WriteToUDP(writePublicReset(hdr.ConnectionID, hdr.PacketNumber, 0), remoteAddr) + _, err = pconn.WriteTo(writePublicReset(hdr.ConnectionID, hdr.PacketNumber, 0), remoteAddr) return err } version := hdr.VersionNumber - if !protocol.IsSupportedVersion(version) { + if !protocol.IsSupportedVersion(s.config.Versions, version) { return errors.New("Server BUG: negotiated version not supported") } utils.Infof("Serving new connection: %x, version %d from %v", hdr.ConnectionID, version, remoteAddr) - session, err = s.newSession( - &udpConn{conn: conn, currentAddr: remoteAddr}, + var handshakeChan <-chan handshakeEvent + session, handshakeChan, err = s.newSession( + &conn{pconn: pconn, currentAddr: remoteAddr}, version, hdr.ConnectionID, s.scfg, - s.streamCallback, - s.closeCallback, + s.tlsConf, + s.config, ) if err != nil { return err } - go session.run() s.sessionsMutex.Lock() s.sessions[hdr.ConnectionID] = session s.sessionsMutex.Unlock() + + go func() { + // session.run() returns as soon as the session is closed + _ = session.run() + s.removeConnection(hdr.ConnectionID) + }() + + go func() { + for { + ev := <-handshakeChan + if ev.err != nil { + return + } + if ev.encLevel == protocol.EncryptionForwardSecure { + break + } + } + s.sessionQueue <- session + }() } if session == nil { // Late packet for closed session @@ -216,7 +308,7 @@ func (s *Server) handlePacket(conn *net.UDPConn, remoteAddr *net.UDPAddr, packet return nil } -func (s *Server) closeCallback(id protocol.ConnectionID) { +func (s *server) removeConnection(id protocol.ConnectionID) { s.sessionsMutex.Lock() s.sessions[id] = nil s.sessionsMutex.Unlock() @@ -228,17 +320,19 @@ func (s *Server) closeCallback(id protocol.ConnectionID) { }) } -func composeVersionNegotiation(connectionID protocol.ConnectionID) []byte { +func composeVersionNegotiation(connectionID protocol.ConnectionID, versions []protocol.VersionNumber) []byte { fullReply := &bytes.Buffer{} responsePublicHeader := PublicHeader{ ConnectionID: connectionID, PacketNumber: 1, VersionFlag: true, } - err := responsePublicHeader.Write(fullReply, protocol.Version35, protocol.PerspectiveServer) + err := responsePublicHeader.Write(fullReply, protocol.VersionWhatever, protocol.PerspectiveServer) if err != nil { utils.Errorf("error composing version negotiation packet: %s", err.Error()) } - fullReply.Write(protocol.SupportedVersionsAsTags) + for _, v := range versions { + utils.WriteUint32(fullReply, protocol.VersionNumberToTag(v)) + } return fullReply.Bytes() } diff --git a/vendor/github.com/lucas-clemente/quic-go/session.go b/vendor/github.com/lucas-clemente/quic-go/session.go index ee67fe8..376aa7f 100644 --- a/vendor/github.com/lucas-clemente/quic-go/session.go +++ b/vendor/github.com/lucas-clemente/quic-go/session.go @@ -5,7 +5,7 @@ import ( "errors" "fmt" "net" - "sync/atomic" + "sync" "time" "github.com/lucas-clemente/quic-go/ackhandler" @@ -13,9 +13,9 @@ import ( "github.com/lucas-clemente/quic-go/flowcontrol" "github.com/lucas-clemente/quic-go/frames" "github.com/lucas-clemente/quic-go/handshake" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) type unpacker interface { @@ -23,7 +23,7 @@ type unpacker interface { } type receivedPacket struct { - remoteAddr interface{} + remoteAddr net.Addr publicHeader *PublicHeader data []byte rcvTime time.Time @@ -32,28 +32,30 @@ type receivedPacket struct { var ( errRstStreamOnInvalidStream = errors.New("RST_STREAM received for unknown stream") errWindowUpdateOnClosedStream = errors.New("WINDOW_UPDATE received for an already closed stream") - errSessionAlreadyClosed = errors.New("Cannot close Session. It was already closed before.") ) -// StreamCallback gets a stream frame and returns a reply frame -type StreamCallback func(*Session, utils.Stream) +var ( + newCryptoSetup = handshake.NewCryptoSetup + newCryptoSetupClient = handshake.NewCryptoSetupClient +) -// CryptoChangeCallback is called every time the encryption level changes -// Once the callback has been called with isForwardSecure = true, it is guarantueed to not be called with isForwardSecure = false after that -type CryptoChangeCallback func(isForwardSecure bool) +type handshakeEvent struct { + encLevel protocol.EncryptionLevel + err error +} -// closeCallback is called when a session is closed -type closeCallback func(id protocol.ConnectionID) +type closeError struct { + err error + remote bool +} // A Session is a QUIC session -type Session struct { +type session struct { connectionID protocol.ConnectionID perspective protocol.Perspective version protocol.VersionNumber - - streamCallback StreamCallback - closeCallback closeCallback - cryptoChangeCallback CryptoChangeCallback + tlsConf *tls.Config + config *Config conn connection @@ -75,15 +77,28 @@ type Session struct { receivedPackets chan *receivedPacket sendingScheduled chan struct{} // closeChan is used to notify the run loop that it should terminate. - // If the value is not nil, the error is sent as a CONNECTION_CLOSE. - closeChan chan *qerr.QuicError + closeChan chan closeError + // runClosed is closed once the run loop exits + // it is used to block Close() and WaitUntilClosed() runClosed chan struct{} - closed uint32 // atomic bool + closeOnce sync.Once - undecryptablePackets []*receivedPacket - aeadChanged chan struct{} + // when we receive too many undecryptable packets during the handshake, we send a Public reset + // but only after a time of protocol.PublicResetTimeout has passed + undecryptablePackets []*receivedPacket + receivedTooManyUndecrytablePacketsTime time.Time - nextAckScheduledTime time.Time + // this channel is passed to the CryptoSetup and receives the current encryption level + // it is closed as soon as the handshake is complete + aeadChanged <-chan protocol.EncryptionLevel + handshakeComplete bool + // will be closed as soon as the handshake completes, and receive any error that might occur until then + // it is used to block WaitUntilHandshakeComplete() + handshakeCompleteChan chan error + // handshakeChan receives handshake events and is closed as soon the handshake completes + // the receiving end of this channel is passed to the creator of the session + // it receives at most 3 handshake events: 2 when the encryption level changes, and one error + handshakeChan chan<- handshakeEvent connectionParameters handshake.ConnectionParametersManager @@ -95,99 +110,138 @@ type Session struct { sessionCreationTime time.Time lastNetworkActivityTime time.Time - timer *time.Timer - currentDeadline time.Time - timerRead bool + timer *utils.Timer + // keepAlivePingSent stores whether a Ping frame was sent to the peer or not + // it is reset as soon as we receive a packet from the peer + keepAlivePingSent bool } +var _ Session = &session{} + // newSession makes a new session -func newSession(conn connection, v protocol.VersionNumber, connectionID protocol.ConnectionID, sCfg *handshake.ServerConfig, streamCallback StreamCallback, closeCallback closeCallback) (packetHandler, error) { - session := &Session{ +func newSession( + conn connection, + v protocol.VersionNumber, + connectionID protocol.ConnectionID, + sCfg *handshake.ServerConfig, + tlsConf *tls.Config, + config *Config, +) (packetHandler, <-chan handshakeEvent, error) { + s := &session{ conn: conn, connectionID: connectionID, perspective: protocol.PerspectiveServer, version: v, - - streamCallback: streamCallback, - closeCallback: closeCallback, - cryptoChangeCallback: func(bool) {}, - connectionParameters: handshake.NewConnectionParamatersManager(protocol.PerspectiveServer, v), + config: config, } - - session.setup() - cryptoStream, _ := session.GetOrOpenStream(1) - var err error - session.cryptoSetup, err = handshake.NewCryptoSetup(connectionID, conn.RemoteAddr().IP, v, sCfg, cryptoStream, session.connectionParameters, session.aeadChanged) - if err != nil { - return nil, err - } - - session.packer = newPacketPacker(connectionID, session.cryptoSetup, session.connectionParameters, session.streamFramer, session.perspective, session.version) - session.unpacker = &packetUnpacker{aead: session.cryptoSetup, version: session.version} - - return session, err + return s.setup(sCfg, "", nil) } -func newClientSession(conn *net.UDPConn, addr *net.UDPAddr, hostname string, v protocol.VersionNumber, connectionID protocol.ConnectionID, tlsConfig *tls.Config, streamCallback StreamCallback, closeCallback closeCallback, cryptoChangeCallback CryptoChangeCallback, negotiatedVersions []protocol.VersionNumber) (*Session, error) { - session := &Session{ - conn: &udpConn{conn: conn, currentAddr: addr}, +// declare this as a variable, such that we can it mock it in the tests +var newClientSession = func( + conn connection, + hostname string, + v protocol.VersionNumber, + connectionID protocol.ConnectionID, + tlsConf *tls.Config, + config *Config, + negotiatedVersions []protocol.VersionNumber, +) (packetHandler, <-chan handshakeEvent, error) { + s := &session{ + conn: conn, connectionID: connectionID, perspective: protocol.PerspectiveClient, version: v, - - streamCallback: streamCallback, - closeCallback: closeCallback, - cryptoChangeCallback: cryptoChangeCallback, - connectionParameters: handshake.NewConnectionParamatersManager(protocol.PerspectiveClient, v), + tlsConf: tlsConf, + config: config, } - - session.receivedPacketHandler = ackhandler.NewReceivedPacketHandler(session.ackAlarmChanged) - session.setup() - - cryptoStream, _ := session.OpenStream(1) - var err error - session.cryptoSetup, err = handshake.NewCryptoSetupClient(hostname, connectionID, v, cryptoStream, tlsConfig, session.connectionParameters, session.aeadChanged, negotiatedVersions) - if err != nil { - return nil, err - } - - session.packer = newPacketPacker(connectionID, session.cryptoSetup, session.connectionParameters, session.streamFramer, session.perspective, session.version) - session.unpacker = &packetUnpacker{aead: session.cryptoSetup, version: session.version} - - return session, err + return s.setup(nil, hostname, negotiatedVersions) } -// setup is called from newSession and newClientSession and initializes values that are independent of the perspective -func (s *Session) setup() { - s.rttStats = &congestion.RTTStats{} - flowControlManager := flowcontrol.NewFlowControlManager(s.connectionParameters, s.rttStats) - - var sentPacketHandler ackhandler.SentPacketHandler - sentPacketHandler = ackhandler.NewSentPacketHandler(s.rttStats) - - now := time.Now() - - s.sentPacketHandler = sentPacketHandler - s.flowControlManager = flowControlManager - s.receivedPacketHandler = ackhandler.NewReceivedPacketHandler(s.ackAlarmChanged) - +func (s *session) setup( + scfg *handshake.ServerConfig, + hostname string, + negotiatedVersions []protocol.VersionNumber, +) (packetHandler, <-chan handshakeEvent, error) { + aeadChanged := make(chan protocol.EncryptionLevel, 2) + s.aeadChanged = aeadChanged + handshakeChan := make(chan handshakeEvent, 3) + s.handshakeChan = handshakeChan + s.runClosed = make(chan struct{}) + s.handshakeCompleteChan = make(chan error, 1) s.receivedPackets = make(chan *receivedPacket, protocol.MaxSessionUnprocessedPackets) - s.closeChan = make(chan *qerr.QuicError, 1) + s.closeChan = make(chan closeError, 1) s.sendingScheduled = make(chan struct{}, 1) s.undecryptablePackets = make([]*receivedPacket, 0, protocol.MaxUndecryptablePackets) - s.aeadChanged = make(chan struct{}, 1) - s.runClosed = make(chan struct{}, 1) - s.timer = time.NewTimer(0) + s.timer = utils.NewTimer() + now := time.Now() s.lastNetworkActivityTime = now s.sessionCreationTime = now + s.rttStats = &congestion.RTTStats{} + s.connectionParameters = handshake.NewConnectionParamatersManager(s.perspective, s.version, + s.config.MaxReceiveStreamFlowControlWindow, s.config.MaxReceiveConnectionFlowControlWindow) + s.sentPacketHandler = ackhandler.NewSentPacketHandler(s.rttStats) + s.flowControlManager = flowcontrol.NewFlowControlManager(s.connectionParameters, s.rttStats) + s.receivedPacketHandler = ackhandler.NewReceivedPacketHandler() s.streamsMap = newStreamsMap(s.newStream, s.perspective, s.connectionParameters) s.streamFramer = newStreamFramer(s.streamsMap, s.flowControlManager) + + var err error + if s.perspective == protocol.PerspectiveServer { + cryptoStream, _ := s.GetOrOpenStream(1) + _, _ = s.AcceptStream() // don't expose the crypto stream + verifySourceAddr := func(clientAddr net.Addr, hstk *handshake.STK) bool { + var stk *STK + if hstk != nil { + stk = &STK{remoteAddr: hstk.RemoteAddr, sentTime: hstk.SentTime} + } + return s.config.AcceptSTK(clientAddr, stk) + } + s.cryptoSetup, err = newCryptoSetup( + s.connectionID, + s.conn.RemoteAddr(), + s.version, + scfg, + cryptoStream, + s.connectionParameters, + s.config.Versions, + verifySourceAddr, + aeadChanged, + ) + } else { + cryptoStream, _ := s.OpenStream() + s.cryptoSetup, err = newCryptoSetupClient( + hostname, + s.connectionID, + s.version, + cryptoStream, + s.tlsConf, + s.connectionParameters, + aeadChanged, + &handshake.TransportParameters{RequestConnectionIDTruncation: s.config.RequestConnectionIDTruncation}, + negotiatedVersions, + ) + } + if err != nil { + return nil, nil, err + } + + s.packer = newPacketPacker(s.connectionID, + s.cryptoSetup, + s.connectionParameters, + s.streamFramer, + s.perspective, + s.version, + ) + s.unpacker = &packetUnpacker{aead: s.cryptoSetup, version: s.version} + + return s, handshakeChan, nil } // run the session main loop -func (s *Session) run() { +func (s *session) run() error { // Start the crypto stream handler go func() { if err := s.cryptoSetup.HandleCryptoStream(); err != nil { @@ -195,106 +249,131 @@ func (s *Session) run() { } }() + var closeErr closeError + aeadChanged := s.aeadChanged + runLoop: for { // Close immediately if requested select { - case errForConnClose := <-s.closeChan: - if errForConnClose != nil { - s.sendConnectionClose(errForConnClose) - } + case closeErr = <-s.closeChan: break runLoop default: } s.maybeResetTimer() - var err error select { - case errForConnClose := <-s.closeChan: - if errForConnClose != nil { - s.sendConnectionClose(errForConnClose) - } + case closeErr = <-s.closeChan: break runLoop - case <-s.timer.C: - s.timerRead = true + case <-s.timer.Chan(): + s.timer.SetRead() // We do all the interesting stuff after the switch statement, so // nothing to see here. case <-s.sendingScheduled: // We do all the interesting stuff after the switch statement, so // nothing to see here. case p := <-s.receivedPackets: - err = s.handlePacketImpl(p) - if qErr, ok := err.(*qerr.QuicError); ok && qErr.ErrorCode == qerr.DecryptionFailure { - s.tryQueueingUndecryptablePacket(p) + err := s.handlePacketImpl(p) + if err != nil { + if qErr, ok := err.(*qerr.QuicError); ok && qErr.ErrorCode == qerr.DecryptionFailure { + s.tryQueueingUndecryptablePacket(p) + continue + } + s.closeLocal(err) continue } // This is a bit unclean, but works properly, since the packet always // begins with the public header and we never copy it. putPacketBuffer(p.publicHeader.Raw) - case <-s.aeadChanged: - s.tryDecryptingQueuedPackets() - s.cryptoChangeCallback(s.cryptoSetup.HandshakeComplete()) + case l, ok := <-aeadChanged: + if !ok { // the aeadChanged chan was closed. This means that the handshake is completed. + s.handshakeComplete = true + aeadChanged = nil // prevent this case from ever being selected again + close(s.handshakeChan) + close(s.handshakeCompleteChan) + } else { + s.tryDecryptingQueuedPackets() + s.handshakeChan <- handshakeEvent{encLevel: l} + } } - if err != nil { - s.close(err) + now := time.Now() + if timeout := s.sentPacketHandler.GetAlarmTimeout(); !timeout.IsZero() && timeout.Before(now) { + // This could cause packets to be retransmitted, so check it before trying + // to send packets. + s.sentPacketHandler.OnAlarm() + } + + if s.config.KeepAlive && s.handshakeComplete && time.Since(s.lastNetworkActivityTime) >= s.idleTimeout()/2 { + // send the PING frame since there is no activity in the session + s.packer.QueueControlFrame(&frames.PingFrame{}) + s.keepAlivePingSent = true } if err := s.sendPacket(); err != nil { - s.close(err) + s.closeLocal(err) } - if time.Now().Sub(s.lastNetworkActivityTime) >= s.idleTimeout() { - s.close(qerr.Error(qerr.NetworkIdleTimeout, "No recent network activity.")) + if !s.receivedTooManyUndecrytablePacketsTime.IsZero() && s.receivedTooManyUndecrytablePacketsTime.Add(protocol.PublicResetTimeout).Before(now) && len(s.undecryptablePackets) != 0 { + s.closeLocal(qerr.Error(qerr.DecryptionFailure, "too many undecryptable packets received")) } - if !s.cryptoSetup.HandshakeComplete() && time.Now().Sub(s.sessionCreationTime) >= protocol.MaxTimeForCryptoHandshake { - s.close(qerr.Error(qerr.NetworkIdleTimeout, "Crypto handshake did not complete in time.")) + if now.Sub(s.lastNetworkActivityTime) >= s.idleTimeout() { + s.closeLocal(qerr.Error(qerr.NetworkIdleTimeout, "No recent network activity.")) + } + if !s.handshakeComplete && now.Sub(s.sessionCreationTime) >= s.config.HandshakeTimeout { + s.closeLocal(qerr.Error(qerr.HandshakeTimeout, "Crypto handshake did not complete in time.")) } s.garbageCollectStreams() } - s.closeCallback(s.connectionID) - s.runClosed <- struct{}{} + // only send the error the handshakeChan when the handshake is not completed yet + // otherwise this chan will already be closed + if !s.handshakeComplete { + s.handshakeCompleteChan <- closeErr.err + s.handshakeChan <- handshakeEvent{err: closeErr.err} + } + s.handleCloseError(closeErr) + close(s.runClosed) + return closeErr.err } -func (s *Session) maybeResetTimer() { - nextDeadline := s.lastNetworkActivityTime.Add(s.idleTimeout()) - - if !s.nextAckScheduledTime.IsZero() { - nextDeadline = utils.MinTime(nextDeadline, s.nextAckScheduledTime) - } - if rtoTime := s.sentPacketHandler.TimeOfFirstRTO(); !rtoTime.IsZero() { - nextDeadline = utils.MinTime(nextDeadline, rtoTime) - } - if !s.cryptoSetup.HandshakeComplete() { - handshakeDeadline := s.sessionCreationTime.Add(protocol.MaxTimeForCryptoHandshake) - nextDeadline = utils.MinTime(nextDeadline, handshakeDeadline) - } - - if nextDeadline.Equal(s.currentDeadline) { - // No need to reset the timer - return - } - - // We need to drain the timer if the value from its channel was not read yet. - // See https://groups.google.com/forum/#!topic/golang-dev/c9UUfASVPoU - if !s.timer.Stop() && !s.timerRead { - <-s.timer.C - } - s.timer.Reset(nextDeadline.Sub(time.Now())) - - s.timerRead = false - s.currentDeadline = nextDeadline +func (s *session) WaitUntilClosed() { + <-s.runClosed } -func (s *Session) idleTimeout() time.Duration { - if s.cryptoSetup.HandshakeComplete() { +func (s *session) maybeResetTimer() { + var deadline time.Time + if s.config.KeepAlive && s.handshakeComplete && !s.keepAlivePingSent { + deadline = s.lastNetworkActivityTime.Add(s.idleTimeout() / 2) + } else { + deadline = s.lastNetworkActivityTime.Add(s.idleTimeout()) + } + + if ackAlarm := s.receivedPacketHandler.GetAlarmTimeout(); !ackAlarm.IsZero() { + deadline = utils.MinTime(deadline, ackAlarm) + } + if lossTime := s.sentPacketHandler.GetAlarmTimeout(); !lossTime.IsZero() { + deadline = utils.MinTime(deadline, lossTime) + } + if !s.handshakeComplete { + handshakeDeadline := s.sessionCreationTime.Add(s.config.HandshakeTimeout) + deadline = utils.MinTime(deadline, handshakeDeadline) + } + if !s.receivedTooManyUndecrytablePacketsTime.IsZero() { + deadline = utils.MinTime(deadline, s.receivedTooManyUndecrytablePacketsTime.Add(protocol.PublicResetTimeout)) + } + + s.timer.Reset(deadline) +} + +func (s *session) idleTimeout() time.Duration { + if s.handshakeComplete { return s.connectionParameters.GetIdleConnectionStateLifetime() } return protocol.InitialIdleTimeout } -func (s *Session) handlePacketImpl(p *receivedPacket) error { +func (s *session) handlePacketImpl(p *receivedPacket) error { if s.perspective == protocol.PerspectiveClient { diversificationNonce := p.publicHeader.DiversificationNonce if len(diversificationNonce) > 0 { @@ -308,6 +387,7 @@ func (s *Session) handlePacketImpl(p *receivedPacket) error { } s.lastNetworkActivityTime = p.rcvTime + s.keepAlivePingSent = false hdr := p.publicHeader data := p.data @@ -317,11 +397,15 @@ func (s *Session) handlePacketImpl(p *receivedPacket) error { s.largestRcvdPacketNumber, hdr.PacketNumber, ) - if utils.Debug() { - utils.Debugf("<- Reading packet 0x%x (%d bytes) for connection %x @ %s", hdr.PacketNumber, len(data)+len(hdr.Raw), hdr.ConnectionID, time.Now().Format("15:04:05.000")) - } packet, err := s.unpacker.Unpack(hdr.Raw, hdr, data) + if utils.Debug() { + if err != nil { + utils.Debugf("<- Reading packet 0x%x (%d bytes) for connection %x", hdr.PacketNumber, len(data)+len(hdr.Raw), hdr.ConnectionID) + } else { + utils.Debugf("<- Reading packet 0x%x (%d bytes) for connection %x, %s", hdr.PacketNumber, len(data)+len(hdr.Raw), hdr.ConnectionID, packet.encryptionLevel) + } + } // if the decryption failed, this might be a packet sent by an attacker // don't update the remote address if quicErr, ok := err.(*qerr.QuicError); ok && quicErr.ErrorCode == qerr.DecryptionFailure { @@ -329,7 +413,7 @@ func (s *Session) handlePacketImpl(p *receivedPacket) error { } if s.perspective == protocol.PerspectiveServer { // update the remote address, even if unpacking failed for any other reason than a decryption error - s.conn.setCurrentRemoteAddr(p.remoteAddr) + s.conn.SetCurrentRemoteAddr(p.remoteAddr) } if err != nil { return err @@ -339,26 +423,15 @@ func (s *Session) handlePacketImpl(p *receivedPacket) error { // Only do this after decrypting, so we are sure the packet is not attacker-controlled s.largestRcvdPacketNumber = utils.MaxPacketNumber(s.largestRcvdPacketNumber, hdr.PacketNumber) - err = s.receivedPacketHandler.ReceivedPacket(hdr.PacketNumber, packet.IsRetransmittable()) - // ignore duplicate packets - if err == ackhandler.ErrDuplicatePacket { - utils.Infof("Ignoring packet 0x%x due to ErrDuplicatePacket", hdr.PacketNumber) - return nil - } - // ignore packets with packet numbers smaller than the LeastUnacked of a StopWaiting - if err == ackhandler.ErrPacketSmallerThanLastStopWaiting { - utils.Infof("Ignoring packet 0x%x due to ErrPacketSmallerThanLastStopWaiting", hdr.PacketNumber) - return nil - } - - if err != nil { + isRetransmittable := ackhandler.HasRetransmittableFrames(packet.frames) + if err = s.receivedPacketHandler.ReceivedPacket(hdr.PacketNumber, isRetransmittable); err != nil { return err } return s.handleFrames(packet.frames) } -func (s *Session) handleFrames(fs []frames.Frame) error { +func (s *session) handleFrames(fs []frames.Frame) error { for _, ff := range fs { var err error frames.LogFrame(ff, false) @@ -368,7 +441,7 @@ func (s *Session) handleFrames(fs []frames.Frame) error { case *frames.AckFrame: err = s.handleAckFrame(frame) case *frames.ConnectionCloseFrame: - s.closeImpl(qerr.Error(frame.ErrorCode, frame.ReasonPhrase), true) + s.closeRemote(qerr.Error(frame.ErrorCode, frame.ReasonPhrase)) case *frames.GoawayFrame: err = errors.New("unimplemented: handling GOAWAY frames") case *frames.StopWaitingFrame: @@ -401,7 +474,7 @@ func (s *Session) handleFrames(fs []frames.Frame) error { } // handlePacket is called by the server with a new packet -func (s *Session) handlePacket(p *receivedPacket) { +func (s *session) handlePacket(p *receivedPacket) { // Discard packets once the amount of queued packets is larger than // the channel size, protocol.MaxSessionUnprocessedPackets select { @@ -410,7 +483,7 @@ func (s *Session) handlePacket(p *receivedPacket) { } } -func (s *Session) handleStreamFrame(frame *frames.StreamFrame) error { +func (s *session) handleStreamFrame(frame *frames.StreamFrame) error { str, err := s.streamsMap.GetOrOpenStream(frame.StreamID) if err != nil { return err @@ -420,14 +493,10 @@ func (s *Session) handleStreamFrame(frame *frames.StreamFrame) error { // ignore this StreamFrame return nil } - err = str.AddStreamFrame(frame) - if err != nil { - return err - } - return nil + return str.AddStreamFrame(frame) } -func (s *Session) handleWindowUpdateFrame(frame *frames.WindowUpdateFrame) error { +func (s *session) handleWindowUpdateFrame(frame *frames.WindowUpdateFrame) error { if frame.StreamID != 0 { str, err := s.streamsMap.GetOrOpenStream(frame.StreamID) if err != nil { @@ -441,7 +510,7 @@ func (s *Session) handleWindowUpdateFrame(frame *frames.WindowUpdateFrame) error return err } -func (s *Session) handleRstStreamFrame(frame *frames.RstStreamFrame) error { +func (s *session) handleRstStreamFrame(frame *frames.RstStreamFrame) error { str, err := s.streamsMap.GetOrOpenStream(frame.StreamID) if err != nil { return err @@ -454,112 +523,95 @@ func (s *Session) handleRstStreamFrame(frame *frames.RstStreamFrame) error { return s.flowControlManager.ResetStream(frame.StreamID, frame.ByteOffset) } -func (s *Session) handleAckFrame(frame *frames.AckFrame) error { - if err := s.sentPacketHandler.ReceivedAck(frame, s.lastRcvdPacketNumber, s.lastNetworkActivityTime); err != nil { - return err - } - return nil +func (s *session) handleAckFrame(frame *frames.AckFrame) error { + return s.sentPacketHandler.ReceivedAck(frame, s.lastRcvdPacketNumber, s.lastNetworkActivityTime) +} + +func (s *session) closeLocal(e error) { + s.closeOnce.Do(func() { + s.closeChan <- closeError{err: e, remote: false} + }) +} + +func (s *session) closeRemote(e error) { + s.closeOnce.Do(func() { + s.closeChan <- closeError{err: e, remote: true} + }) } // Close the connection. If err is nil it will be set to qerr.PeerGoingAway. // It waits until the run loop has stopped before returning -func (s *Session) Close(e error) error { - err := s.closeImpl(e, false) - if err == errSessionAlreadyClosed { - return nil - } - - // wait for the run loop to finish +func (s *session) Close(e error) error { + s.closeLocal(e) <-s.runClosed - return err + return nil } -// close the connection. Use this when called from the run loop -func (s *Session) close(e error) error { - err := s.closeImpl(e, false) - if err == errSessionAlreadyClosed { - return nil - } - return err -} - -func (s *Session) closeImpl(e error, remoteClose bool) error { - // Only close once - if !atomic.CompareAndSwapUint32(&s.closed, 0, 1) { - return errSessionAlreadyClosed +func (s *session) handleCloseError(closeErr closeError) error { + if closeErr.err == nil { + closeErr.err = qerr.PeerGoingAway } - if e == errCloseSessionForNewVersion { - s.closeStreamsWithError(e) - // when the run loop exits, it will call the closeCallback - // replace it with an noop function to make sure this doesn't have any effect - s.closeCallback = func(protocol.ConnectionID) {} - s.closeChan <- nil - return nil + var quicErr *qerr.QuicError + var ok bool + if quicErr, ok = closeErr.err.(*qerr.QuicError); !ok { + quicErr = qerr.ToQuicError(closeErr.err) } - - if e == nil { - e = qerr.PeerGoingAway - } - - quicErr := qerr.ToQuicError(e) - // Don't log 'normal' reasons if quicErr.ErrorCode == qerr.PeerGoingAway || quicErr.ErrorCode == qerr.NetworkIdleTimeout { utils.Infof("Closing connection %x", s.connectionID) } else { - utils.Errorf("Closing session with error: %s", e.Error()) + utils.Errorf("Closing session with error: %s", closeErr.err.Error()) } - s.closeStreamsWithError(quicErr) + s.streamsMap.CloseWithError(quicErr) - if remoteClose { - // If this is a remote close we don't need to send a CONNECTION_CLOSE - s.closeChan <- nil + if closeErr.err == errCloseSessionForNewVersion { return nil } - if quicErr.ErrorCode == qerr.DecryptionFailure { - // If we send a public reset, don't send a CONNECTION_CLOSE - s.closeChan <- nil + // If this is a remote close we're done here + if closeErr.remote { + return nil + } + + if quicErr.ErrorCode == qerr.DecryptionFailure || quicErr == handshake.ErrHOLExperiment { return s.sendPublicReset(s.lastRcvdPacketNumber) } - s.closeChan <- quicErr - return nil + return s.sendConnectionClose(quicErr) } -func (s *Session) closeStreamsWithError(err error) { - s.streamsMap.Iterate(func(str *stream) (bool, error) { - str.Cancel(err) - return true, nil - }) -} +func (s *session) sendPacket() error { + s.packer.SetLeastUnacked(s.sentPacketHandler.GetLeastUnacked()) + + // Get WindowUpdate frames + // this call triggers the flow controller to increase the flow control windows, if necessary + windowUpdateFrames := s.getWindowUpdateFrames() + for _, wuf := range windowUpdateFrames { + s.packer.QueueControlFrame(wuf) + } + + ack := s.receivedPacketHandler.GetAckFrame() + if ack != nil { + s.packer.QueueControlFrame(ack) + } -func (s *Session) sendPacket() error { // Repeatedly try sending until we don't have any more data, or run out of the congestion window for { - err := s.sentPacketHandler.CheckForError() - if err != nil { - return err - } - - // Do this before checking the congestion, since we might de-congestionize here :) - s.sentPacketHandler.MaybeQueueRTOs() - if !s.sentPacketHandler.SendingAllowed() { - return nil - } - - var controlFrames []frames.Frame - - // get WindowUpdate frames - // this call triggers the flow controller to increase the flow control windows, if necessary - windowUpdateFrames, err := s.getWindowUpdateFrames() - if err != nil { - return err - } - for _, wuf := range windowUpdateFrames { - controlFrames = append(controlFrames, wuf) + if ack == nil { + return nil + } + // If we aren't allowed to send, at least try sending an ACK frame + swf := s.sentPacketHandler.GetStopWaitingFrame(false) + if swf != nil { + s.packer.QueueControlFrame(swf) + } + packet, err := s.packer.PackAckPacket() + if err != nil { + return err + } + return s.sendPackedPacket(packet) } // check for retransmissions first @@ -568,133 +620,154 @@ func (s *Session) sendPacket() error { if retransmitPacket == nil { break } - utils.Debugf("\tDequeueing retransmission for packet 0x%x", retransmitPacket.PacketNumber) - // resend the frames that were in the packet - for _, frame := range retransmitPacket.GetFramesForRetransmission() { - switch frame.(type) { - case *frames.StreamFrame: - s.streamFramer.AddFrameForRetransmission(frame.(*frames.StreamFrame)) - case *frames.WindowUpdateFrame: - // only retransmit WindowUpdates if the stream is not yet closed and the we haven't sent another WindowUpdate with a higher ByteOffset for the stream - var currentOffset protocol.ByteCount - f := frame.(*frames.WindowUpdateFrame) - currentOffset, err = s.flowControlManager.GetReceiveWindow(f.StreamID) - if err == nil && f.ByteOffset >= currentOffset { - controlFrames = append(controlFrames, frame) + if retransmitPacket.EncryptionLevel != protocol.EncryptionForwardSecure { + if s.handshakeComplete { + // Don't retransmit handshake packets when the handshake is complete + continue + } + utils.Debugf("\tDequeueing handshake retransmission for packet 0x%x", retransmitPacket.PacketNumber) + s.packer.QueueControlFrame(s.sentPacketHandler.GetStopWaitingFrame(true)) + packet, err := s.packer.PackHandshakeRetransmission(retransmitPacket) + if err != nil { + return err + } + if err = s.sendPackedPacket(packet); err != nil { + return err + } + } else { + utils.Debugf("\tDequeueing retransmission for packet 0x%x", retransmitPacket.PacketNumber) + // resend the frames that were in the packet + for _, frame := range retransmitPacket.GetFramesForRetransmission() { + switch f := frame.(type) { + case *frames.StreamFrame: + s.streamFramer.AddFrameForRetransmission(f) + case *frames.WindowUpdateFrame: + // only retransmit WindowUpdates if the stream is not yet closed and the we haven't sent another WindowUpdate with a higher ByteOffset for the stream + currentOffset, err := s.flowControlManager.GetReceiveWindow(f.StreamID) + if err == nil && f.ByteOffset >= currentOffset { + s.packer.QueueControlFrame(f) + } + default: + s.packer.QueueControlFrame(frame) } - default: - controlFrames = append(controlFrames, frame) } } } - ack := s.receivedPacketHandler.GetAckFrame() - if ack != nil { - controlFrames = append(controlFrames, ack) - } hasRetransmission := s.streamFramer.HasFramesForRetransmission() - var stopWaitingFrame *frames.StopWaitingFrame if ack != nil || hasRetransmission { - stopWaitingFrame = s.sentPacketHandler.GetStopWaitingFrame(hasRetransmission) + swf := s.sentPacketHandler.GetStopWaitingFrame(hasRetransmission) + if swf != nil { + s.packer.QueueControlFrame(swf) + } } - packet, err := s.packer.PackPacket(stopWaitingFrame, controlFrames, s.sentPacketHandler.GetLeastUnacked()) - if err != nil { + packet, err := s.packer.PackPacket() + if err != nil || packet == nil { return err } - if packet == nil { - return nil + if err = s.sendPackedPacket(packet); err != nil { + return err } + // send every window update twice for _, f := range windowUpdateFrames { - s.packer.QueueControlFrameForNextPacket(f) + s.packer.QueueControlFrame(f) } - - err = s.sentPacketHandler.SentPacket(&ackhandler.Packet{ - PacketNumber: packet.number, - Frames: packet.frames, - Length: protocol.ByteCount(len(packet.raw)), - }) - if err != nil { - return err - } - - s.logPacket(packet) - - err = s.conn.write(packet.raw) - putPacketBuffer(packet.raw) - if err != nil { - return err - } - s.nextAckScheduledTime = time.Time{} + windowUpdateFrames = nil + ack = nil } } -func (s *Session) sendConnectionClose(quicErr *qerr.QuicError) error { - packet, err := s.packer.PackConnectionClose(&frames.ConnectionCloseFrame{ErrorCode: quicErr.ErrorCode, ReasonPhrase: quicErr.ErrorMessage}, s.sentPacketHandler.GetLeastUnacked()) +func (s *session) sendPackedPacket(packet *packedPacket) error { + defer putPacketBuffer(packet.raw) + err := s.sentPacketHandler.SentPacket(&ackhandler.Packet{ + PacketNumber: packet.number, + Frames: packet.frames, + Length: protocol.ByteCount(len(packet.raw)), + EncryptionLevel: packet.encryptionLevel, + }) if err != nil { return err } - if packet == nil { - return errors.New("Session BUG: expected packet not to be nil") - } s.logPacket(packet) - return s.conn.write(packet.raw) + return s.conn.Write(packet.raw) } -func (s *Session) logPacket(packet *packedPacket) { +func (s *session) sendConnectionClose(quicErr *qerr.QuicError) error { + s.packer.SetLeastUnacked(s.sentPacketHandler.GetLeastUnacked()) + packet, err := s.packer.PackConnectionClose(&frames.ConnectionCloseFrame{ + ErrorCode: quicErr.ErrorCode, + ReasonPhrase: quicErr.ErrorMessage, + }) + if err != nil { + return err + } + s.logPacket(packet) + return s.conn.Write(packet.raw) +} + +func (s *session) logPacket(packet *packedPacket) { if !utils.Debug() { // We don't need to allocate the slices for calling the format functions return } - if utils.Debug() { - utils.Debugf("-> Sending packet 0x%x (%d bytes) @ %s", packet.number, len(packet.raw), time.Now().Format("15:04:05.000")) - for _, frame := range packet.frames { - frames.LogFrame(frame, true) - } + utils.Debugf("-> Sending packet 0x%x (%d bytes) for connection %x, %s", packet.number, len(packet.raw), s.connectionID, packet.encryptionLevel) + for _, frame := range packet.frames { + frames.LogFrame(frame, true) } } // GetOrOpenStream either returns an existing stream, a newly opened stream, or nil if a stream with the provided ID is already closed. // Newly opened streams should only originate from the client. To open a stream from the server, OpenStream should be used. -func (s *Session) GetOrOpenStream(id protocol.StreamID) (utils.Stream, error) { - return s.streamsMap.GetOrOpenStream(id) +func (s *session) GetOrOpenStream(id protocol.StreamID) (Stream, error) { + str, err := s.streamsMap.GetOrOpenStream(id) + if str != nil { + return str, err + } + // make sure to return an actual nil value here, not an Stream with value nil + return nil, err } -// OpenStream opens a stream from the server's side -func (s *Session) OpenStream(id protocol.StreamID) (utils.Stream, error) { - return s.streamsMap.OpenStream(id) +// AcceptStream returns the next stream openend by the peer +func (s *session) AcceptStream() (Stream, error) { + return s.streamsMap.AcceptStream() } -func (s *Session) queueResetStreamFrame(id protocol.StreamID, offset protocol.ByteCount) { - s.packer.QueueControlFrameForNextPacket(&frames.RstStreamFrame{ +// OpenStream opens a stream +func (s *session) OpenStream() (Stream, error) { + return s.streamsMap.OpenStream() +} + +func (s *session) OpenStreamSync() (Stream, error) { + return s.streamsMap.OpenStreamSync() +} + +func (s *session) WaitUntilHandshakeComplete() error { + return <-s.handshakeCompleteChan +} + +func (s *session) queueResetStreamFrame(id protocol.StreamID, offset protocol.ByteCount) { + s.packer.QueueControlFrame(&frames.RstStreamFrame{ StreamID: id, ByteOffset: offset, }) s.scheduleSending() } -func (s *Session) newStream(id protocol.StreamID) (*stream, error) { - stream, err := newStream(id, s.scheduleSending, s.queueResetStreamFrame, s.flowControlManager) - if err != nil { - return nil, err - } - +func (s *session) newStream(id protocol.StreamID) *stream { // TODO: find a better solution for determining which streams contribute to connection level flow control if id == 1 || id == 3 { s.flowControlManager.NewStream(id, false) } else { s.flowControlManager.NewStream(id, true) } - - s.streamCallback(s, stream) - - return stream, nil + return newStream(id, s.scheduleSending, s.queueResetStreamFrame, s.flowControlManager) } // garbageCollectStreams goes through all streams and removes EOF'ed streams // from the streams map. -func (s *Session) garbageCollectStreams() { +func (s *session) garbageCollectStreams() { s.streamsMap.Iterate(func(str *stream) (bool, error) { id := str.StreamID() if str.finished() { @@ -708,52 +781,58 @@ func (s *Session) garbageCollectStreams() { }) } -func (s *Session) sendPublicReset(rejectedPacketNumber protocol.PacketNumber) error { +func (s *session) sendPublicReset(rejectedPacketNumber protocol.PacketNumber) error { utils.Infof("Sending public reset for connection %x, packet number %d", s.connectionID, rejectedPacketNumber) - return s.conn.write(writePublicReset(s.connectionID, rejectedPacketNumber, 0)) + return s.conn.Write(writePublicReset(s.connectionID, rejectedPacketNumber, 0)) } // scheduleSending signals that we have data for sending -func (s *Session) scheduleSending() { +func (s *session) scheduleSending() { select { case s.sendingScheduled <- struct{}{}: default: } } -func (s *Session) tryQueueingUndecryptablePacket(p *receivedPacket) { - if s.cryptoSetup.HandshakeComplete() { +func (s *session) tryQueueingUndecryptablePacket(p *receivedPacket) { + if s.handshakeComplete { + utils.Debugf("Received undecryptable packet from %s after the handshake: %#v, %d bytes data", p.remoteAddr.String(), p.publicHeader, len(p.data)) + return + } + if len(s.undecryptablePackets)+1 > protocol.MaxUndecryptablePackets { + // if this is the first time the undecryptablePackets runs full, start the timer to send a Public Reset + if s.receivedTooManyUndecrytablePacketsTime.IsZero() { + s.receivedTooManyUndecrytablePacketsTime = time.Now() + s.maybeResetTimer() + } + utils.Infof("Dropping undecrytable packet 0x%x (undecryptable packet queue full)", p.publicHeader.PacketNumber) return } utils.Infof("Queueing packet 0x%x for later decryption", p.publicHeader.PacketNumber) - if len(s.undecryptablePackets)+1 >= protocol.MaxUndecryptablePackets { - s.close(qerr.Error(qerr.DecryptionFailure, "too many undecryptable packets received")) - } s.undecryptablePackets = append(s.undecryptablePackets, p) } -func (s *Session) tryDecryptingQueuedPackets() { +func (s *session) tryDecryptingQueuedPackets() { for _, p := range s.undecryptablePackets { s.handlePacket(p) } s.undecryptablePackets = s.undecryptablePackets[:0] } -func (s *Session) getWindowUpdateFrames() ([]*frames.WindowUpdateFrame, error) { +func (s *session) getWindowUpdateFrames() []*frames.WindowUpdateFrame { updates := s.flowControlManager.GetWindowUpdates() res := make([]*frames.WindowUpdateFrame, len(updates)) for i, u := range updates { res[i] = &frames.WindowUpdateFrame{StreamID: u.StreamID, ByteOffset: u.Offset} } - return res, nil + return res } -func (s *Session) ackAlarmChanged(t time.Time) { - s.nextAckScheduledTime = t - s.maybeResetTimer() +func (s *session) LocalAddr() net.Addr { + return s.conn.LocalAddr() } -// RemoteAddr returns the net.UDPAddr of the client -func (s *Session) RemoteAddr() *net.UDPAddr { +// RemoteAddr returns the net.Addr of the client +func (s *session) RemoteAddr() net.Addr { return s.conn.RemoteAddr() } diff --git a/vendor/github.com/lucas-clemente/quic-go/stream.go b/vendor/github.com/lucas-clemente/quic-go/stream.go index 72d3ec8..45cf01a 100644 --- a/vendor/github.com/lucas-clemente/quic-go/stream.go +++ b/vendor/github.com/lucas-clemente/quic-go/stream.go @@ -3,12 +3,14 @@ package quic import ( "fmt" "io" + "net" "sync" + "time" "github.com/lucas-clemente/quic-go/flowcontrol" "github.com/lucas-clemente/quic-go/frames" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) // A Stream assembles the data from StreamFrames and provides a super-convenient Read-Interface @@ -40,37 +42,50 @@ type stream struct { // resetRemotely is set if RegisterRemoteError() is called resetRemotely utils.AtomicBool - frameQueue *streamFrameSorter - newFrameOrErrCond sync.Cond + frameQueue *streamFrameSorter + readChan chan struct{} + readDeadline time.Time - dataForWriting []byte - finSent utils.AtomicBool - rstSent utils.AtomicBool - doneWritingOrErrCond sync.Cond + dataForWriting []byte + finSent utils.AtomicBool + rstSent utils.AtomicBool + writeChan chan struct{} + writeDeadline time.Time flowControlManager flowcontrol.FlowControlManager } +type deadlineError struct{} + +func (deadlineError) Error() string { return "deadline exceeded" } +func (deadlineError) Temporary() bool { return true } +func (deadlineError) Timeout() bool { return true } + +var errDeadline net.Error = &deadlineError{} + // newStream creates a new Stream -func newStream(StreamID protocol.StreamID, onData func(), onReset func(protocol.StreamID, protocol.ByteCount), flowControlManager flowcontrol.FlowControlManager) (*stream, error) { - s := &stream{ +func newStream(StreamID protocol.StreamID, + onData func(), + onReset func(protocol.StreamID, protocol.ByteCount), + flowControlManager flowcontrol.FlowControlManager) *stream { + return &stream{ onData: onData, onReset: onReset, streamID: StreamID, flowControlManager: flowControlManager, frameQueue: newStreamFrameSorter(), + readChan: make(chan struct{}, 1), + writeChan: make(chan struct{}, 1), } - - s.newFrameOrErrCond.L = &s.mutex - s.doneWritingOrErrCond.L = &s.mutex - - return s, nil } // Read implements io.Reader. It is not thread safe! func (s *stream) Read(p []byte) (int, error) { + s.mutex.Lock() + err := s.err + s.mutex.Unlock() if s.cancelled.Get() || s.resetLocally.Get() { - return 0, s.err + return 0, err } if s.finishedReading.Get() { return 0, io.EOF @@ -80,10 +95,10 @@ func (s *stream) Read(p []byte) (int, error) { for bytesRead < len(p) { s.mutex.Lock() frame := s.frameQueue.Head() - if frame == nil && bytesRead > 0 { + err = s.err s.mutex.Unlock() - return bytesRead, s.err + return bytesRead, err } var err error @@ -93,11 +108,28 @@ func (s *stream) Read(p []byte) (int, error) { err = s.err break } + + deadline := s.readDeadline + if !deadline.IsZero() && !time.Now().Before(deadline) { + err = errDeadline + break + } + if frame != nil { s.readPosInFrame = int(s.readOffset - frame.Offset) break } - s.newFrameOrErrCond.Wait() + + s.mutex.Unlock() + if deadline.IsZero() { + <-s.readChan + } else { + select { + case <-s.readChan: + case <-time.After(deadline.Sub(time.Now())): + } + } + s.mutex.Lock() frame = s.frameQueue.Head() } s.mutex.Unlock() @@ -142,34 +174,52 @@ func (s *stream) Read(p []byte) (int, error) { } func (s *stream) Write(p []byte) (int, error) { - if s.resetLocally.Get() { - return 0, s.err - } - s.mutex.Lock() defer s.mutex.Unlock() - if s.err != nil { + if s.resetLocally.Get() || s.err != nil { return 0, s.err } - + if s.finishedWriting.Get() { + return 0, fmt.Errorf("write on closed stream %d", s.streamID) + } if len(p) == 0 { return 0, nil } s.dataForWriting = make([]byte, len(p)) copy(s.dataForWriting, p) - s.onData() - for s.dataForWriting != nil && s.err == nil { - s.doneWritingOrErrCond.Wait() + var err error + for { + deadline := s.writeDeadline + if !deadline.IsZero() && !time.Now().Before(deadline) { + err = errDeadline + break + } + if s.dataForWriting == nil || s.err != nil { + break + } + + s.mutex.Unlock() + if deadline.IsZero() { + <-s.writeChan + } else { + select { + case <-s.writeChan: + case <-time.After(deadline.Sub(time.Now())): + } + } + s.mutex.Lock() } + if err != nil { + return 0, err + } if s.err != nil { - return 0, s.err + return len(p) - len(s.dataForWriting), s.err } - return len(p), nil } @@ -185,14 +235,12 @@ func (s *stream) lenOfDataForWriting() protocol.ByteCount { func (s *stream) getDataForWriting(maxBytes protocol.ByteCount) []byte { s.mutex.Lock() - if s.err != nil { - s.mutex.Unlock() - return nil - } - if s.dataForWriting == nil { - s.mutex.Unlock() + defer s.mutex.Unlock() + + if s.err != nil || s.dataForWriting == nil { return nil } + var ret []byte if protocol.ByteCount(len(s.dataForWriting)) > maxBytes { ret = s.dataForWriting[:maxBytes] @@ -200,10 +248,9 @@ func (s *stream) getDataForWriting(maxBytes protocol.ByteCount) []byte { } else { ret = s.dataForWriting s.dataForWriting = nil - s.doneWritingOrErrCond.Signal() + s.signalWrite() } s.writeOffset += protocol.ByteCount(len(ret)) - s.mutex.Unlock() return ret } @@ -246,7 +293,52 @@ func (s *stream) AddStreamFrame(frame *frames.StreamFrame) error { if err != nil && err != errDuplicateStreamData { return err } - s.newFrameOrErrCond.Signal() + s.signalRead() + return nil +} + +// signalRead performs a non-blocking send on the readChan +func (s *stream) signalRead() { + select { + case s.readChan <- struct{}{}: + default: + } +} + +// signalRead performs a non-blocking send on the writeChan +func (s *stream) signalWrite() { + select { + case s.writeChan <- struct{}{}: + default: + } +} + +func (s *stream) SetReadDeadline(t time.Time) error { + s.mutex.Lock() + oldDeadline := s.readDeadline + s.readDeadline = t + s.mutex.Unlock() + // if the new deadline is before the currently set deadline, wake up Read() + if t.Before(oldDeadline) { + s.signalRead() + } + return nil +} + +func (s *stream) SetWriteDeadline(t time.Time) error { + s.mutex.Lock() + oldDeadline := s.writeDeadline + s.writeDeadline = t + s.mutex.Unlock() + if t.Before(oldDeadline) { + s.signalWrite() + } + return nil +} + +func (s *stream) SetDeadline(t time.Time) error { + _ = s.SetReadDeadline(t) // SetReadDeadline never errors + _ = s.SetWriteDeadline(t) // SetWriteDeadline never errors return nil } @@ -263,8 +355,8 @@ func (s *stream) Cancel(err error) { // errors must not be changed! if s.err == nil { s.err = err - s.newFrameOrErrCond.Signal() - s.doneWritingOrErrCond.Signal() + s.signalRead() + s.signalWrite() } s.mutex.Unlock() } @@ -279,8 +371,8 @@ func (s *stream) Reset(err error) { // errors must not be changed! if s.err == nil { s.err = err - s.newFrameOrErrCond.Signal() - s.doneWritingOrErrCond.Signal() + s.signalRead() + s.signalWrite() } if s.shouldSendReset() { s.onReset(s.streamID, s.writeOffset) @@ -299,7 +391,7 @@ func (s *stream) RegisterRemoteError(err error) { // errors must not be changed! if s.err == nil { s.err = err - s.doneWritingOrErrCond.Signal() + s.signalWrite() } if s.shouldSendReset() { s.onReset(s.streamID, s.writeOffset) diff --git a/vendor/github.com/lucas-clemente/quic-go/stream_frame_sorter.go b/vendor/github.com/lucas-clemente/quic-go/stream_frame_sorter.go index 7a95f1f..4a50150 100644 --- a/vendor/github.com/lucas-clemente/quic-go/stream_frame_sorter.go +++ b/vendor/github.com/lucas-clemente/quic-go/stream_frame_sorter.go @@ -4,9 +4,8 @@ import ( "errors" "github.com/lucas-clemente/quic-go/frames" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/qerr" - "github.com/lucas-clemente/quic-go/utils" ) type streamFrameSorter struct { @@ -17,7 +16,7 @@ type streamFrameSorter struct { var ( errTooManyGapsInReceivedStreamData = errors.New("Too many gaps in received StreamFrame data") - errDuplicateStreamData = errors.New("Overlapping Stream Data") + errDuplicateStreamData = errors.New("Duplicate Stream Data") errEmptyStreamData = errors.New("Stream Data empty") ) @@ -31,15 +30,7 @@ func newStreamFrameSorter() *streamFrameSorter { } func (s *streamFrameSorter) Push(frame *frames.StreamFrame) error { - _, ok := s.queuedFrames[frame.Offset] - if ok { - return errDuplicateStreamData - } - - start := frame.Offset - end := frame.Offset + frame.DataLen() - - if start == end { + if frame.DataLen() == 0 { if frame.FinBit { s.queuedFrames[frame.Offset] = frame return nil @@ -47,56 +38,107 @@ func (s *streamFrameSorter) Push(frame *frames.StreamFrame) error { return errEmptyStreamData } - var foundInGap bool - - for gap := s.gaps.Front(); gap != nil; gap = gap.Next() { - // the complete frame lies before or after the gap - if end <= gap.Value.Start || start > gap.Value.End { - continue + var wasCut bool + if oldFrame, ok := s.queuedFrames[frame.Offset]; ok { + if frame.DataLen() <= oldFrame.DataLen() { + return errDuplicateStreamData } + frame.Data = frame.Data[oldFrame.DataLen():] + frame.Offset += oldFrame.DataLen() + wasCut = true + } - if start < gap.Value.Start { - return qerr.Error(qerr.OverlappingStreamData, "start of gap in stream chunk") + start := frame.Offset + end := frame.Offset + frame.DataLen() + + // skip all gaps that are before this stream frame + var gap *utils.ByteIntervalElement + for gap = s.gaps.Front(); gap != nil; gap = gap.Next() { + // the frame is a duplicate. Ignore it + if end <= gap.Value.Start { + return errDuplicateStreamData } - - if start < gap.Value.End && end > gap.Value.End { - return qerr.Error(qerr.OverlappingStreamData, "end of gap in stream chunk") - } - - foundInGap = true - - if start == gap.Value.Start { - if end == gap.Value.End { - s.gaps.Remove(gap) - break - } - if end < gap.Value.End { - gap.Value.Start = end - break - } - } - - if end == gap.Value.End { - gap.Value.End = start - break - } - - if end < gap.Value.End { - intv := utils.ByteInterval{Start: end, End: gap.Value.End} - s.gaps.InsertAfter(intv, gap) - gap.Value.End = start + if end > gap.Value.Start && start <= gap.Value.End { break } } - if !foundInGap { - return errDuplicateStreamData + if gap == nil { + return errors.New("StreamFrameSorter BUG: no gap found") + } + + if start < gap.Value.Start { + add := gap.Value.Start - start + frame.Offset += add + start += add + frame.Data = frame.Data[add:] + wasCut = true + } + + // find the highest gaps whose Start lies before the end of the frame + endGap := gap + for end >= endGap.Value.End { + nextEndGap := endGap.Next() + if nextEndGap == nil { + return errors.New("StreamFrameSorter BUG: no end gap found") + } + if endGap != gap { + s.gaps.Remove(endGap) + } + if end <= nextEndGap.Value.Start { + break + } + // delete queued frames completely covered by the current frame + delete(s.queuedFrames, endGap.Value.End) + endGap = nextEndGap + } + + if end > endGap.Value.End { + cutLen := end - endGap.Value.End + len := frame.DataLen() - cutLen + end -= cutLen + frame.Data = frame.Data[:len] + wasCut = true + } + + if start == gap.Value.Start { + if end >= gap.Value.End { + // the frame completely fills this gap + // delete the gap + s.gaps.Remove(gap) + } + if end < endGap.Value.End { + // the frame covers the beginning of the gap + // adjust the Start value to shrink the gap + endGap.Value.Start = end + } + } else if end == endGap.Value.End { + // the frame covers the end of the gap + // adjust the End value to shrink the gap + gap.Value.End = start + } else { + if gap == endGap { + // the frame lies within the current gap, splitting it into two + // insert a new gap and adjust the current one + intv := utils.ByteInterval{Start: end, End: gap.Value.End} + s.gaps.InsertAfter(intv, gap) + gap.Value.End = start + } else { + gap.Value.End = start + endGap.Value.Start = end + } } if s.gaps.Len() > protocol.MaxStreamFrameSorterGaps { return errTooManyGapsInReceivedStreamData } + if wasCut { + data := make([]byte, frame.DataLen()) + copy(data, frame.Data) + frame.Data = data + } + s.queuedFrames[frame.Offset] = frame return nil } diff --git a/vendor/github.com/lucas-clemente/quic-go/stream_framer.go b/vendor/github.com/lucas-clemente/quic-go/stream_framer.go index 45c0722..20f82e3 100644 --- a/vendor/github.com/lucas-clemente/quic-go/stream_framer.go +++ b/vendor/github.com/lucas-clemente/quic-go/stream_framer.go @@ -3,8 +3,8 @@ package quic import ( "github.com/lucas-clemente/quic-go/flowcontrol" "github.com/lucas-clemente/quic-go/frames" + "github.com/lucas-clemente/quic-go/internal/utils" "github.com/lucas-clemente/quic-go/protocol" - "github.com/lucas-clemente/quic-go/utils" ) type streamFramer struct { @@ -45,6 +45,28 @@ func (f *streamFramer) HasFramesForRetransmission() bool { return len(f.retransmissionQueue) > 0 } +func (f *streamFramer) HasCryptoStreamFrame() bool { + // TODO(#657): Flow control + cs, _ := f.streamsMap.GetOrOpenStream(1) + return cs.lenOfDataForWriting() > 0 +} + +// TODO(lclemente): This is somewhat duplicate with the normal path for generating frames. +// TODO(#657): Flow control +func (f *streamFramer) PopCryptoStreamFrame(maxLen protocol.ByteCount) *frames.StreamFrame { + if !f.HasCryptoStreamFrame() { + return nil + } + cs, _ := f.streamsMap.GetOrOpenStream(1) + frame := &frames.StreamFrame{ + StreamID: 1, + Offset: cs.writeOffset, + } + frameHeaderBytes, _ := frame.MinLength(protocol.VersionWhatever) // can never error + frame.Data = cs.getDataForWriting(maxLen - frameHeaderBytes) + return frame +} + func (f *streamFramer) maybePopFramesForRetransmission(maxLen protocol.ByteCount) (res []*frames.StreamFrame, currentLen protocol.ByteCount) { for len(f.retransmissionQueue) > 0 { frame := f.retransmissionQueue[0] @@ -76,7 +98,7 @@ func (f *streamFramer) maybePopNormalFrames(maxBytes protocol.ByteCount) (res [] var currentLen protocol.ByteCount fn := func(s *stream) (bool, error) { - if s == nil { + if s == nil || s.streamID == 1 /* crypto stream is handled separately */ { return true, nil } @@ -90,7 +112,8 @@ func (f *streamFramer) maybePopNormalFrames(maxBytes protocol.ByteCount) (res [] maxLen := maxBytes - currentLen - frameHeaderBytes var sendWindowSize protocol.ByteCount - if s.lenOfDataForWriting() != 0 { + lenStreamData := s.lenOfDataForWriting() + if lenStreamData != 0 { sendWindowSize, _ = f.flowControlManager.SendWindowSize(s.streamID) maxLen = utils.MinByteCount(maxLen, sendWindowSize) } @@ -99,7 +122,12 @@ func (f *streamFramer) maybePopNormalFrames(maxBytes protocol.ByteCount) (res [] return true, nil } - data := s.getDataForWriting(maxLen) + var data []byte + if lenStreamData != 0 { + // Only getDataForWriting() if we didn't have data earlier, so that we + // don't send without FC approval (if a Write() raced). + data = s.getDataForWriting(maxLen) + } // This is unlikely, but check it nonetheless, the scheduler might have jumped in. Seems to happen in ~20% of cases in the tests. shouldSendFin := s.shouldSendFin() diff --git a/vendor/github.com/lucas-clemente/quic-go/streams_map.go b/vendor/github.com/lucas-clemente/quic-go/streams_map.go index 7666497..74be17e 100644 --- a/vendor/github.com/lucas-clemente/quic-go/streams_map.go +++ b/vendor/github.com/lucas-clemente/quic-go/streams_map.go @@ -16,37 +16,52 @@ type streamsMap struct { perspective protocol.Perspective connectionParameters handshake.ConnectionParametersManager - streams map[protocol.StreamID]*stream - openStreams []protocol.StreamID + streams map[protocol.StreamID]*stream + // needed for round-robin scheduling + openStreams []protocol.StreamID + roundRobinIndex uint32 - highestStreamOpenedByClient protocol.StreamID - streamsOpenedAfterLastGarbageCollect int + nextStream protocol.StreamID // StreamID of the next Stream that will be returned by OpenStream() + highestStreamOpenedByPeer protocol.StreamID + nextStreamOrErrCond sync.Cond + openStreamOrErrCond sync.Cond + + closeErr error + nextStreamToAccept protocol.StreamID newStream newStreamLambda - maxOutgoingStreams uint32 numOutgoingStreams uint32 - maxIncomingStreams uint32 numIncomingStreams uint32 - - roundRobinIndex uint32 } type streamLambda func(*stream) (bool, error) -type newStreamLambda func(protocol.StreamID) (*stream, error) +type newStreamLambda func(protocol.StreamID) *stream var ( errMapAccess = errors.New("streamsMap: Error accessing the streams map") ) func newStreamsMap(newStream newStreamLambda, pers protocol.Perspective, connectionParameters handshake.ConnectionParametersManager) *streamsMap { - return &streamsMap{ + sm := streamsMap{ perspective: pers, streams: map[protocol.StreamID]*stream{}, openStreams: make([]protocol.StreamID, 0), newStream: newStream, connectionParameters: connectionParameters, } + sm.nextStreamOrErrCond.L = &sm.mutex + sm.openStreamOrErrCond.L = &sm.mutex + + if pers == protocol.PerspectiveClient { + sm.nextStream = 1 + sm.nextStreamToAccept = 2 + } else { + sm.nextStream = 2 + sm.nextStreamToAccept = 1 + } + + return &sm } // GetOrOpenStream either returns an existing stream, a newly opened stream, or nil if a stream with the provided ID is already closed. @@ -59,7 +74,7 @@ func (m *streamsMap) GetOrOpenStream(id protocol.StreamID) (*stream, error) { return s, nil // s may be nil } - // ... we don't have an existing stream, try opening a new one + // ... we don't have an existing stream m.mutex.Lock() defer m.mutex.Unlock() // We need to check whether another invocation has already created a stream (between RUnlock() and Lock()). @@ -67,22 +82,54 @@ func (m *streamsMap) GetOrOpenStream(id protocol.StreamID) (*stream, error) { if ok { return s, nil } + + if m.perspective == protocol.PerspectiveServer { + if id%2 == 0 { + if id <= m.nextStream { // this is a server-side stream that we already opened. Must have been closed already + return nil, nil + } + return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d from client-side", id)) + } + if id <= m.highestStreamOpenedByPeer { // this is a client-side stream that doesn't exist anymore. Must have been closed already + return nil, nil + } + } + if m.perspective == protocol.PerspectiveClient { + if id%2 == 1 { + if id <= m.nextStream { // this is a client-side stream that we already opened. + return nil, nil + } + return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d from server-side", id)) + } + if id <= m.highestStreamOpenedByPeer { // this is a server-side stream that doesn't exist anymore. Must have been closed already + return nil, nil + } + } + + // sid is the next stream that will be opened + sid := m.highestStreamOpenedByPeer + 2 + // if there is no stream opened yet, and this is the server, stream 1 should be openend + if sid == 2 && m.perspective == protocol.PerspectiveServer { + sid = 1 + } + + for ; sid <= id; sid += 2 { + _, err := m.openRemoteStream(sid) + if err != nil { + return nil, err + } + } + + m.nextStreamOrErrCond.Broadcast() + return m.streams[id], nil +} + +func (m *streamsMap) openRemoteStream(id protocol.StreamID) (*stream, error) { if m.numIncomingStreams >= m.connectionParameters.GetMaxIncomingStreams() { return nil, qerr.TooManyOpenStreams } - if m.perspective == protocol.PerspectiveServer && id%2 == 0 { - return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d from client-side", id)) - } - if m.perspective == protocol.PerspectiveClient && id%2 == 1 { - return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d from server-side", id)) - } - if id+protocol.MaxNewStreamIDDelta < m.highestStreamOpenedByClient { - return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d, which is a lot smaller than the highest opened stream, %d", id, m.highestStreamOpenedByClient)) - } - - s, err := m.newStream(id) - if err != nil { - return nil, err + if id+protocol.MaxNewStreamIDDelta < m.highestStreamOpenedByPeer { + return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d, which is a lot smaller than the highest opened stream, %d", id, m.highestStreamOpenedByPeer)) } if m.perspective == protocol.PerspectiveServer { @@ -91,59 +138,91 @@ func (m *streamsMap) GetOrOpenStream(id protocol.StreamID) (*stream, error) { m.numOutgoingStreams++ } - if id > m.highestStreamOpenedByClient { - m.highestStreamOpenedByClient = id - } - - // maybe trigger garbage collection of streams map - m.streamsOpenedAfterLastGarbageCollect++ - if m.streamsOpenedAfterLastGarbageCollect%protocol.MaxNewStreamIDDelta == 0 { - m.garbageCollectClosedStreams() + if id > m.highestStreamOpenedByPeer { + m.highestStreamOpenedByPeer = id } + s := m.newStream(id) m.putStream(s) return s, nil } -// OpenStream opens a stream from the server's side -func (m *streamsMap) OpenStream(id protocol.StreamID) (*stream, error) { - if m.perspective == protocol.PerspectiveServer && id%2 == 1 { - return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d from server-side", id)) - } - if m.perspective == protocol.PerspectiveClient && id%2 == 0 { - return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d from client-side", id)) - } - - m.mutex.Lock() - defer m.mutex.Unlock() - _, ok := m.streams[id] - if ok { - return nil, qerr.Error(qerr.InvalidStreamID, fmt.Sprintf("attempted to open stream %d, which is already open", id)) - } +func (m *streamsMap) openStreamImpl() (*stream, error) { + id := m.nextStream if m.numOutgoingStreams >= m.connectionParameters.GetMaxOutgoingStreams() { return nil, qerr.TooManyOpenStreams } - s, err := m.newStream(id) - if err != nil { - return nil, err - } - if m.perspective == protocol.PerspectiveServer { m.numOutgoingStreams++ } else { m.numIncomingStreams++ } + m.nextStream += 2 + s := m.newStream(id) m.putStream(s) return s, nil } +// OpenStream opens the next available stream +func (m *streamsMap) OpenStream() (*stream, error) { + m.mutex.Lock() + defer m.mutex.Unlock() + + if m.closeErr != nil { + return nil, m.closeErr + } + return m.openStreamImpl() +} + +func (m *streamsMap) OpenStreamSync() (*stream, error) { + m.mutex.Lock() + defer m.mutex.Unlock() + + for { + if m.closeErr != nil { + return nil, m.closeErr + } + str, err := m.openStreamImpl() + if err == nil { + return str, err + } + if err != nil && err != qerr.TooManyOpenStreams { + return nil, err + } + m.openStreamOrErrCond.Wait() + } +} + +// AcceptStream returns the next stream opened by the peer +// it blocks until a new stream is opened +func (m *streamsMap) AcceptStream() (*stream, error) { + m.mutex.Lock() + defer m.mutex.Unlock() + var str *stream + for { + var ok bool + if m.closeErr != nil { + return nil, m.closeErr + } + str, ok = m.streams[m.nextStreamToAccept] + if ok { + break + } + m.nextStreamOrErrCond.Wait() + } + m.nextStreamToAccept += 2 + return str, nil +} + func (m *streamsMap) Iterate(fn streamLambda) error { m.mutex.Lock() defer m.mutex.Unlock() - for _, streamID := range m.openStreams { + openStreams := append([]protocol.StreamID{}, m.openStreams...) + + for _, streamID := range openStreams { cont, err := m.iterateFunc(streamID, fn) if err != nil { return err @@ -162,7 +241,7 @@ func (m *streamsMap) RoundRobinIterate(fn streamLambda) error { m.mutex.Lock() defer m.mutex.Unlock() - numStreams := uint32(len(m.openStreams)) + numStreams := uint32(len(m.streams)) startIndex := m.roundRobinIndex for _, i := range []protocol.StreamID{1, 3} { @@ -177,7 +256,6 @@ func (m *streamsMap) RoundRobinIterate(fn streamLambda) error { for i := uint32(0); i < numStreams; i++ { streamID := m.openStreams[(i+startIndex)%numStreams] - if streamID == 1 || streamID == 3 { continue } @@ -199,9 +277,6 @@ func (m *streamsMap) iterateFunc(streamID protocol.StreamID, fn streamLambda) (b if !ok { return true, errMapAccess } - if str == nil { - return false, fmt.Errorf("BUG: Stream %d is closed, but still in openStreams map", streamID) - } return fn(str) } @@ -213,7 +288,6 @@ func (m *streamsMap) putStream(s *stream) error { m.streams[id] = s m.openStreams = append(m.openStreams, id) - return nil } @@ -224,7 +298,6 @@ func (m *streamsMap) RemoveStream(id protocol.StreamID) error { return fmt.Errorf("attempted to remove non-existing stream: %d", id) } - m.streams[id] = nil if id%2 == 0 { m.numOutgoingStreams-- } else { @@ -243,22 +316,18 @@ func (m *streamsMap) RemoveStream(id protocol.StreamID) error { } } + delete(m.streams, id) + m.openStreamOrErrCond.Signal() return nil } -// garbageCollectClosedStreams deletes nil values in the streams if they are smaller than protocol.MaxNewStreamIDDelta than the highest stream opened by the client -// note that this garbage collection is relatively expensive, since it iterates over the whole streams map. It should not be called every time a stream is openend or closed -func (m *streamsMap) garbageCollectClosedStreams() { - for id, str := range m.streams { - if str != nil { - continue - } - - // server-side streams can be gargage collected immediately - // client-side streams need to be kept as nils in the streams map for a bit longer, in order to prevent a client from reopening closed streams - if id%2 == 0 || id+protocol.MaxNewStreamIDDelta <= m.highestStreamOpenedByClient { - delete(m.streams, id) - } +func (m *streamsMap) CloseWithError(err error) { + m.mutex.Lock() + defer m.mutex.Unlock() + m.closeErr = err + m.nextStreamOrErrCond.Broadcast() + m.openStreamOrErrCond.Broadcast() + for _, s := range m.openStreams { + m.streams[s].Cancel(err) } - m.streamsOpenedAfterLastGarbageCollect = 0 } diff --git a/vendor/github.com/lucas-clemente/quic-go/udp_conn.go b/vendor/github.com/lucas-clemente/quic-go/udp_conn.go deleted file mode 100644 index efc646d..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/udp_conn.go +++ /dev/null @@ -1,39 +0,0 @@ -package quic - -import ( - "net" - "sync" -) - -type connection interface { - write([]byte) error - setCurrentRemoteAddr(interface{}) - RemoteAddr() *net.UDPAddr -} - -type udpConn struct { - mutex sync.RWMutex - - conn *net.UDPConn - currentAddr *net.UDPAddr -} - -var _ connection = &udpConn{} - -func (c *udpConn) write(p []byte) error { - _, err := c.conn.WriteToUDP(p, c.currentAddr) - return err -} - -func (c *udpConn) setCurrentRemoteAddr(addr interface{}) { - c.mutex.Lock() - c.currentAddr = addr.(*net.UDPAddr) - c.mutex.Unlock() -} - -func (c *udpConn) RemoteAddr() *net.UDPAddr { - c.mutex.RLock() - addr := c.currentAddr - c.mutex.RUnlock() - return addr -} diff --git a/vendor/github.com/lucas-clemente/quic-go/unpacked_packet.go b/vendor/github.com/lucas-clemente/quic-go/unpacked_packet.go deleted file mode 100644 index 8079204..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/unpacked_packet.go +++ /dev/null @@ -1,27 +0,0 @@ -package quic - -import "github.com/lucas-clemente/quic-go/frames" - -type unpackedPacket struct { - frames []frames.Frame -} - -func (u *unpackedPacket) IsRetransmittable() bool { - for _, f := range u.frames { - switch f.(type) { - case *frames.StreamFrame: - return true - case *frames.RstStreamFrame: - return true - case *frames.WindowUpdateFrame: - return true - case *frames.BlockedFrame: - return true - case *frames.PingFrame: - return true - case *frames.GoawayFrame: - return true - } - } - return false -} diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/log.go b/vendor/github.com/lucas-clemente/quic-go/utils/log.go deleted file mode 100644 index bb0f255..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/utils/log.go +++ /dev/null @@ -1,70 +0,0 @@ -package utils - -import ( - "fmt" - "io" - "os" - "sync" -) - -var out io.Writer = os.Stdout - -// LogLevel of quic-go -type LogLevel uint8 - -const ( - // LogLevelDebug enables debug logs (e.g. packet contents) - LogLevelDebug LogLevel = iota - // LogLevelInfo enables info logs (e.g. packets) - LogLevelInfo - // LogLevelError enables err logs - LogLevelError - // LogLevelNothing disables - LogLevelNothing -) - -var logLevel = LogLevelNothing - -var mutex sync.Mutex - -// SetLogWriter sets the log writer. -func SetLogWriter(w io.Writer) { - out = w -} - -// SetLogLevel sets the log level -func SetLogLevel(level LogLevel) { - logLevel = level -} - -// Debugf logs something -func Debugf(format string, args ...interface{}) { - if logLevel == LogLevelDebug { - mutex.Lock() - fmt.Fprintf(out, format+"\n", args...) - mutex.Unlock() - } -} - -// Infof logs something -func Infof(format string, args ...interface{}) { - if logLevel <= LogLevelInfo { - mutex.Lock() - fmt.Fprintf(out, format+"\n", args...) - mutex.Unlock() - } -} - -// Errorf logs something -func Errorf(format string, args ...interface{}) { - if logLevel <= LogLevelError { - mutex.Lock() - fmt.Fprintf(out, format+"\n", args...) - mutex.Unlock() - } -} - -// Debug returns true if the log level is LogLevelDebug -func Debug() bool { - return logLevel == LogLevelDebug -} diff --git a/vendor/github.com/lucas-clemente/quic-go/utils/stream.go b/vendor/github.com/lucas-clemente/quic-go/utils/stream.go deleted file mode 100644 index b776a89..0000000 --- a/vendor/github.com/lucas-clemente/quic-go/utils/stream.go +++ /dev/null @@ -1,17 +0,0 @@ -package utils - -import ( - "io" - - "github.com/lucas-clemente/quic-go/protocol" -) - -// Stream is the interface for QUIC streams -type Stream interface { - io.Reader - io.Writer - io.Closer - StreamID() protocol.StreamID - CloseRemote(offset protocol.ByteCount) - Reset(error) -} diff --git a/vendor/github.com/pmezard/go-difflib/LICENSE b/vendor/github.com/pmezard/go-difflib/LICENSE deleted file mode 100644 index c67dad6..0000000 --- a/vendor/github.com/pmezard/go-difflib/LICENSE +++ /dev/null @@ -1,27 +0,0 @@ -Copyright (c) 2013, Patrick Mezard -All rights reserved. - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions are -met: - - Redistributions of source code must retain the above copyright -notice, this list of conditions and the following disclaimer. - Redistributions in binary form must reproduce the above copyright -notice, this list of conditions and the following disclaimer in the -documentation and/or other materials provided with the distribution. - The names of its contributors may not be used to endorse or promote -products derived from this software without specific prior written -permission. - -THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS -IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED -TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A -PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT -HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, -SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED -TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR -PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF -LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING -NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS -SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/pmezard/go-difflib/difflib/difflib.go b/vendor/github.com/pmezard/go-difflib/difflib/difflib.go deleted file mode 100644 index 64cc40f..0000000 --- a/vendor/github.com/pmezard/go-difflib/difflib/difflib.go +++ /dev/null @@ -1,758 +0,0 @@ -// Package difflib is a partial port of Python difflib module. -// -// It provides tools to compare sequences of strings and generate textual diffs. -// -// The following class and functions have been ported: -// -// - SequenceMatcher -// -// - unified_diff -// -// - context_diff -// -// Getting unified diffs was the main goal of the port. Keep in mind this code -// is mostly suitable to output text differences in a human friendly way, there -// are no guarantees generated diffs are consumable by patch(1). -package difflib - -import ( - "bufio" - "bytes" - "fmt" - "io" - "strings" -) - -func min(a, b int) int { - if a < b { - return a - } - return b -} - -func max(a, b int) int { - if a > b { - return a - } - return b -} - -func calculateRatio(matches, length int) float64 { - if length > 0 { - return 2.0 * float64(matches) / float64(length) - } - return 1.0 -} - -type Match struct { - A int - B int - Size int -} - -type OpCode struct { - Tag byte - I1 int - I2 int - J1 int - J2 int -} - -// SequenceMatcher compares sequence of strings. The basic -// algorithm predates, and is a little fancier than, an algorithm -// published in the late 1980's by Ratcliff and Obershelp under the -// hyperbolic name "gestalt pattern matching". The basic idea is to find -// the longest contiguous matching subsequence that contains no "junk" -// elements (R-O doesn't address junk). The same idea is then applied -// recursively to the pieces of the sequences to the left and to the right -// of the matching subsequence. This does not yield minimal edit -// sequences, but does tend to yield matches that "look right" to people. -// -// SequenceMatcher tries to compute a "human-friendly diff" between two -// sequences. Unlike e.g. UNIX(tm) diff, the fundamental notion is the -// longest *contiguous* & junk-free matching subsequence. That's what -// catches peoples' eyes. The Windows(tm) windiff has another interesting -// notion, pairing up elements that appear uniquely in each sequence. -// That, and the method here, appear to yield more intuitive difference -// reports than does diff. This method appears to be the least vulnerable -// to synching up on blocks of "junk lines", though (like blank lines in -// ordinary text files, or maybe "

" lines in HTML files). That may be -// because this is the only method of the 3 that has a *concept* of -// "junk" . -// -// Timing: Basic R-O is cubic time worst case and quadratic time expected -// case. SequenceMatcher is quadratic time for the worst case and has -// expected-case behavior dependent in a complicated way on how many -// elements the sequences have in common; best case time is linear. -type SequenceMatcher struct { - a []string - b []string - b2j map[string][]int - IsJunk func(string) bool - autoJunk bool - bJunk map[string]struct{} - matchingBlocks []Match - fullBCount map[string]int - bPopular map[string]struct{} - opCodes []OpCode -} - -func NewMatcher(a, b []string) *SequenceMatcher { - m := SequenceMatcher{autoJunk: true} - m.SetSeqs(a, b) - return &m -} - -func NewMatcherWithJunk(a, b []string, autoJunk bool, - isJunk func(string) bool) *SequenceMatcher { - - m := SequenceMatcher{IsJunk: isJunk, autoJunk: autoJunk} - m.SetSeqs(a, b) - return &m -} - -// Set two sequences to be compared. -func (m *SequenceMatcher) SetSeqs(a, b []string) { - m.SetSeq1(a) - m.SetSeq2(b) -} - -// Set the first sequence to be compared. The second sequence to be compared is -// not changed. -// -// SequenceMatcher computes and caches detailed information about the second -// sequence, so if you want to compare one sequence S against many sequences, -// use .SetSeq2(s) once and call .SetSeq1(x) repeatedly for each of the other -// sequences. -// -// See also SetSeqs() and SetSeq2(). -func (m *SequenceMatcher) SetSeq1(a []string) { - if &a == &m.a { - return - } - m.a = a - m.matchingBlocks = nil - m.opCodes = nil -} - -// Set the second sequence to be compared. The first sequence to be compared is -// not changed. -func (m *SequenceMatcher) SetSeq2(b []string) { - if &b == &m.b { - return - } - m.b = b - m.matchingBlocks = nil - m.opCodes = nil - m.fullBCount = nil - m.chainB() -} - -func (m *SequenceMatcher) chainB() { - // Populate line -> index mapping - b2j := map[string][]int{} - for i, s := range m.b { - indices := b2j[s] - indices = append(indices, i) - b2j[s] = indices - } - - // Purge junk elements - m.bJunk = map[string]struct{}{} - if m.IsJunk != nil { - junk := m.bJunk - for s, _ := range b2j { - if m.IsJunk(s) { - junk[s] = struct{}{} - } - } - for s, _ := range junk { - delete(b2j, s) - } - } - - // Purge remaining popular elements - popular := map[string]struct{}{} - n := len(m.b) - if m.autoJunk && n >= 200 { - ntest := n/100 + 1 - for s, indices := range b2j { - if len(indices) > ntest { - popular[s] = struct{}{} - } - } - for s, _ := range popular { - delete(b2j, s) - } - } - m.bPopular = popular - m.b2j = b2j -} - -func (m *SequenceMatcher) isBJunk(s string) bool { - _, ok := m.bJunk[s] - return ok -} - -// Find longest matching block in a[alo:ahi] and b[blo:bhi]. -// -// If IsJunk is not defined: -// -// Return (i,j,k) such that a[i:i+k] is equal to b[j:j+k], where -// alo <= i <= i+k <= ahi -// blo <= j <= j+k <= bhi -// and for all (i',j',k') meeting those conditions, -// k >= k' -// i <= i' -// and if i == i', j <= j' -// -// In other words, of all maximal matching blocks, return one that -// starts earliest in a, and of all those maximal matching blocks that -// start earliest in a, return the one that starts earliest in b. -// -// If IsJunk is defined, first the longest matching block is -// determined as above, but with the additional restriction that no -// junk element appears in the block. Then that block is extended as -// far as possible by matching (only) junk elements on both sides. So -// the resulting block never matches on junk except as identical junk -// happens to be adjacent to an "interesting" match. -// -// If no blocks match, return (alo, blo, 0). -func (m *SequenceMatcher) findLongestMatch(alo, ahi, blo, bhi int) Match { - // CAUTION: stripping common prefix or suffix would be incorrect. - // E.g., - // ab - // acab - // Longest matching block is "ab", but if common prefix is - // stripped, it's "a" (tied with "b"). UNIX(tm) diff does so - // strip, so ends up claiming that ab is changed to acab by - // inserting "ca" in the middle. That's minimal but unintuitive: - // "it's obvious" that someone inserted "ac" at the front. - // Windiff ends up at the same place as diff, but by pairing up - // the unique 'b's and then matching the first two 'a's. - besti, bestj, bestsize := alo, blo, 0 - - // find longest junk-free match - // during an iteration of the loop, j2len[j] = length of longest - // junk-free match ending with a[i-1] and b[j] - j2len := map[int]int{} - for i := alo; i != ahi; i++ { - // look at all instances of a[i] in b; note that because - // b2j has no junk keys, the loop is skipped if a[i] is junk - newj2len := map[int]int{} - for _, j := range m.b2j[m.a[i]] { - // a[i] matches b[j] - if j < blo { - continue - } - if j >= bhi { - break - } - k := j2len[j-1] + 1 - newj2len[j] = k - if k > bestsize { - besti, bestj, bestsize = i-k+1, j-k+1, k - } - } - j2len = newj2len - } - - // Extend the best by non-junk elements on each end. In particular, - // "popular" non-junk elements aren't in b2j, which greatly speeds - // the inner loop above, but also means "the best" match so far - // doesn't contain any junk *or* popular non-junk elements. - for besti > alo && bestj > blo && !m.isBJunk(m.b[bestj-1]) && - m.a[besti-1] == m.b[bestj-1] { - besti, bestj, bestsize = besti-1, bestj-1, bestsize+1 - } - for besti+bestsize < ahi && bestj+bestsize < bhi && - !m.isBJunk(m.b[bestj+bestsize]) && - m.a[besti+bestsize] == m.b[bestj+bestsize] { - bestsize += 1 - } - - // Now that we have a wholly interesting match (albeit possibly - // empty!), we may as well suck up the matching junk on each - // side of it too. Can't think of a good reason not to, and it - // saves post-processing the (possibly considerable) expense of - // figuring out what to do with it. In the case of an empty - // interesting match, this is clearly the right thing to do, - // because no other kind of match is possible in the regions. - for besti > alo && bestj > blo && m.isBJunk(m.b[bestj-1]) && - m.a[besti-1] == m.b[bestj-1] { - besti, bestj, bestsize = besti-1, bestj-1, bestsize+1 - } - for besti+bestsize < ahi && bestj+bestsize < bhi && - m.isBJunk(m.b[bestj+bestsize]) && - m.a[besti+bestsize] == m.b[bestj+bestsize] { - bestsize += 1 - } - - return Match{A: besti, B: bestj, Size: bestsize} -} - -// Return list of triples describing matching subsequences. -// -// Each triple is of the form (i, j, n), and means that -// a[i:i+n] == b[j:j+n]. The triples are monotonically increasing in -// i and in j. It's also guaranteed that if (i, j, n) and (i', j', n') are -// adjacent triples in the list, and the second is not the last triple in the -// list, then i+n != i' or j+n != j'. IOW, adjacent triples never describe -// adjacent equal blocks. -// -// The last triple is a dummy, (len(a), len(b), 0), and is the only -// triple with n==0. -func (m *SequenceMatcher) GetMatchingBlocks() []Match { - if m.matchingBlocks != nil { - return m.matchingBlocks - } - - var matchBlocks func(alo, ahi, blo, bhi int, matched []Match) []Match - matchBlocks = func(alo, ahi, blo, bhi int, matched []Match) []Match { - match := m.findLongestMatch(alo, ahi, blo, bhi) - i, j, k := match.A, match.B, match.Size - if match.Size > 0 { - if alo < i && blo < j { - matched = matchBlocks(alo, i, blo, j, matched) - } - matched = append(matched, match) - if i+k < ahi && j+k < bhi { - matched = matchBlocks(i+k, ahi, j+k, bhi, matched) - } - } - return matched - } - matched := matchBlocks(0, len(m.a), 0, len(m.b), nil) - - // It's possible that we have adjacent equal blocks in the - // matching_blocks list now. - nonAdjacent := []Match{} - i1, j1, k1 := 0, 0, 0 - for _, b := range matched { - // Is this block adjacent to i1, j1, k1? - i2, j2, k2 := b.A, b.B, b.Size - if i1+k1 == i2 && j1+k1 == j2 { - // Yes, so collapse them -- this just increases the length of - // the first block by the length of the second, and the first - // block so lengthened remains the block to compare against. - k1 += k2 - } else { - // Not adjacent. Remember the first block (k1==0 means it's - // the dummy we started with), and make the second block the - // new block to compare against. - if k1 > 0 { - nonAdjacent = append(nonAdjacent, Match{i1, j1, k1}) - } - i1, j1, k1 = i2, j2, k2 - } - } - if k1 > 0 { - nonAdjacent = append(nonAdjacent, Match{i1, j1, k1}) - } - - nonAdjacent = append(nonAdjacent, Match{len(m.a), len(m.b), 0}) - m.matchingBlocks = nonAdjacent - return m.matchingBlocks -} - -// Return list of 5-tuples describing how to turn a into b. -// -// Each tuple is of the form (tag, i1, i2, j1, j2). The first tuple -// has i1 == j1 == 0, and remaining tuples have i1 == the i2 from the -// tuple preceding it, and likewise for j1 == the previous j2. -// -// The tags are characters, with these meanings: -// -// 'r' (replace): a[i1:i2] should be replaced by b[j1:j2] -// -// 'd' (delete): a[i1:i2] should be deleted, j1==j2 in this case. -// -// 'i' (insert): b[j1:j2] should be inserted at a[i1:i1], i1==i2 in this case. -// -// 'e' (equal): a[i1:i2] == b[j1:j2] -func (m *SequenceMatcher) GetOpCodes() []OpCode { - if m.opCodes != nil { - return m.opCodes - } - i, j := 0, 0 - matching := m.GetMatchingBlocks() - opCodes := make([]OpCode, 0, len(matching)) - for _, m := range matching { - // invariant: we've pumped out correct diffs to change - // a[:i] into b[:j], and the next matching block is - // a[ai:ai+size] == b[bj:bj+size]. So we need to pump - // out a diff to change a[i:ai] into b[j:bj], pump out - // the matching block, and move (i,j) beyond the match - ai, bj, size := m.A, m.B, m.Size - tag := byte(0) - if i < ai && j < bj { - tag = 'r' - } else if i < ai { - tag = 'd' - } else if j < bj { - tag = 'i' - } - if tag > 0 { - opCodes = append(opCodes, OpCode{tag, i, ai, j, bj}) - } - i, j = ai+size, bj+size - // the list of matching blocks is terminated by a - // sentinel with size 0 - if size > 0 { - opCodes = append(opCodes, OpCode{'e', ai, i, bj, j}) - } - } - m.opCodes = opCodes - return m.opCodes -} - -// Isolate change clusters by eliminating ranges with no changes. -// -// Return a generator of groups with up to n lines of context. -// Each group is in the same format as returned by GetOpCodes(). -func (m *SequenceMatcher) GetGroupedOpCodes(n int) [][]OpCode { - if n < 0 { - n = 3 - } - codes := m.GetOpCodes() - if len(codes) == 0 { - codes = []OpCode{OpCode{'e', 0, 1, 0, 1}} - } - // Fixup leading and trailing groups if they show no changes. - if codes[0].Tag == 'e' { - c := codes[0] - i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 - codes[0] = OpCode{c.Tag, max(i1, i2-n), i2, max(j1, j2-n), j2} - } - if codes[len(codes)-1].Tag == 'e' { - c := codes[len(codes)-1] - i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 - codes[len(codes)-1] = OpCode{c.Tag, i1, min(i2, i1+n), j1, min(j2, j1+n)} - } - nn := n + n - groups := [][]OpCode{} - group := []OpCode{} - for _, c := range codes { - i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 - // End the current group and start a new one whenever - // there is a large range with no changes. - if c.Tag == 'e' && i2-i1 > nn { - group = append(group, OpCode{c.Tag, i1, min(i2, i1+n), - j1, min(j2, j1+n)}) - groups = append(groups, group) - group = []OpCode{} - i1, j1 = max(i1, i2-n), max(j1, j2-n) - } - group = append(group, OpCode{c.Tag, i1, i2, j1, j2}) - } - if len(group) > 0 && !(len(group) == 1 && group[0].Tag == 'e') { - groups = append(groups, group) - } - return groups -} - -// Return a measure of the sequences' similarity (float in [0,1]). -// -// Where T is the total number of elements in both sequences, and -// M is the number of matches, this is 2.0*M / T. -// Note that this is 1 if the sequences are identical, and 0 if -// they have nothing in common. -// -// .Ratio() is expensive to compute if you haven't already computed -// .GetMatchingBlocks() or .GetOpCodes(), in which case you may -// want to try .QuickRatio() or .RealQuickRation() first to get an -// upper bound. -func (m *SequenceMatcher) Ratio() float64 { - matches := 0 - for _, m := range m.GetMatchingBlocks() { - matches += m.Size - } - return calculateRatio(matches, len(m.a)+len(m.b)) -} - -// Return an upper bound on ratio() relatively quickly. -// -// This isn't defined beyond that it is an upper bound on .Ratio(), and -// is faster to compute. -func (m *SequenceMatcher) QuickRatio() float64 { - // viewing a and b as multisets, set matches to the cardinality - // of their intersection; this counts the number of matches - // without regard to order, so is clearly an upper bound - if m.fullBCount == nil { - m.fullBCount = map[string]int{} - for _, s := range m.b { - m.fullBCount[s] = m.fullBCount[s] + 1 - } - } - - // avail[x] is the number of times x appears in 'b' less the - // number of times we've seen it in 'a' so far ... kinda - avail := map[string]int{} - matches := 0 - for _, s := range m.a { - n, ok := avail[s] - if !ok { - n = m.fullBCount[s] - } - avail[s] = n - 1 - if n > 0 { - matches += 1 - } - } - return calculateRatio(matches, len(m.a)+len(m.b)) -} - -// Return an upper bound on ratio() very quickly. -// -// This isn't defined beyond that it is an upper bound on .Ratio(), and -// is faster to compute than either .Ratio() or .QuickRatio(). -func (m *SequenceMatcher) RealQuickRatio() float64 { - la, lb := len(m.a), len(m.b) - return calculateRatio(min(la, lb), la+lb) -} - -// Convert range to the "ed" format -func formatRangeUnified(start, stop int) string { - // Per the diff spec at http://www.unix.org/single_unix_specification/ - beginning := start + 1 // lines start numbering with one - length := stop - start - if length == 1 { - return fmt.Sprintf("%d", beginning) - } - if length == 0 { - beginning -= 1 // empty ranges begin at line just before the range - } - return fmt.Sprintf("%d,%d", beginning, length) -} - -// Unified diff parameters -type UnifiedDiff struct { - A []string // First sequence lines - FromFile string // First file name - FromDate string // First file time - B []string // Second sequence lines - ToFile string // Second file name - ToDate string // Second file time - Eol string // Headers end of line, defaults to LF - Context int // Number of context lines -} - -// Compare two sequences of lines; generate the delta as a unified diff. -// -// Unified diffs are a compact way of showing line changes and a few -// lines of context. The number of context lines is set by 'n' which -// defaults to three. -// -// By default, the diff control lines (those with ---, +++, or @@) are -// created with a trailing newline. This is helpful so that inputs -// created from file.readlines() result in diffs that are suitable for -// file.writelines() since both the inputs and outputs have trailing -// newlines. -// -// For inputs that do not have trailing newlines, set the lineterm -// argument to "" so that the output will be uniformly newline free. -// -// The unidiff format normally has a header for filenames and modification -// times. Any or all of these may be specified using strings for -// 'fromfile', 'tofile', 'fromfiledate', and 'tofiledate'. -// The modification times are normally expressed in the ISO 8601 format. -func WriteUnifiedDiff(writer io.Writer, diff UnifiedDiff) error { - buf := bufio.NewWriter(writer) - defer buf.Flush() - w := func(format string, args ...interface{}) error { - _, err := buf.WriteString(fmt.Sprintf(format, args...)) - return err - } - - if len(diff.Eol) == 0 { - diff.Eol = "\n" - } - - started := false - m := NewMatcher(diff.A, diff.B) - for _, g := range m.GetGroupedOpCodes(diff.Context) { - if !started { - started = true - fromDate := "" - if len(diff.FromDate) > 0 { - fromDate = "\t" + diff.FromDate - } - toDate := "" - if len(diff.ToDate) > 0 { - toDate = "\t" + diff.ToDate - } - err := w("--- %s%s%s", diff.FromFile, fromDate, diff.Eol) - if err != nil { - return err - } - err = w("+++ %s%s%s", diff.ToFile, toDate, diff.Eol) - if err != nil { - return err - } - } - first, last := g[0], g[len(g)-1] - range1 := formatRangeUnified(first.I1, last.I2) - range2 := formatRangeUnified(first.J1, last.J2) - if err := w("@@ -%s +%s @@%s", range1, range2, diff.Eol); err != nil { - return err - } - for _, c := range g { - i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 - if c.Tag == 'e' { - for _, line := range diff.A[i1:i2] { - if err := w(" " + line); err != nil { - return err - } - } - continue - } - if c.Tag == 'r' || c.Tag == 'd' { - for _, line := range diff.A[i1:i2] { - if err := w("-" + line); err != nil { - return err - } - } - } - if c.Tag == 'r' || c.Tag == 'i' { - for _, line := range diff.B[j1:j2] { - if err := w("+" + line); err != nil { - return err - } - } - } - } - } - return nil -} - -// Like WriteUnifiedDiff but returns the diff a string. -func GetUnifiedDiffString(diff UnifiedDiff) (string, error) { - w := &bytes.Buffer{} - err := WriteUnifiedDiff(w, diff) - return string(w.Bytes()), err -} - -// Convert range to the "ed" format. -func formatRangeContext(start, stop int) string { - // Per the diff spec at http://www.unix.org/single_unix_specification/ - beginning := start + 1 // lines start numbering with one - length := stop - start - if length == 0 { - beginning -= 1 // empty ranges begin at line just before the range - } - if length <= 1 { - return fmt.Sprintf("%d", beginning) - } - return fmt.Sprintf("%d,%d", beginning, beginning+length-1) -} - -type ContextDiff UnifiedDiff - -// Compare two sequences of lines; generate the delta as a context diff. -// -// Context diffs are a compact way of showing line changes and a few -// lines of context. The number of context lines is set by diff.Context -// which defaults to three. -// -// By default, the diff control lines (those with *** or ---) are -// created with a trailing newline. -// -// For inputs that do not have trailing newlines, set the diff.Eol -// argument to "" so that the output will be uniformly newline free. -// -// The context diff format normally has a header for filenames and -// modification times. Any or all of these may be specified using -// strings for diff.FromFile, diff.ToFile, diff.FromDate, diff.ToDate. -// The modification times are normally expressed in the ISO 8601 format. -// If not specified, the strings default to blanks. -func WriteContextDiff(writer io.Writer, diff ContextDiff) error { - buf := bufio.NewWriter(writer) - defer buf.Flush() - var diffErr error - w := func(format string, args ...interface{}) { - _, err := buf.WriteString(fmt.Sprintf(format, args...)) - if diffErr == nil && err != nil { - diffErr = err - } - } - - if len(diff.Eol) == 0 { - diff.Eol = "\n" - } - - prefix := map[byte]string{ - 'i': "+ ", - 'd': "- ", - 'r': "! ", - 'e': " ", - } - - started := false - m := NewMatcher(diff.A, diff.B) - for _, g := range m.GetGroupedOpCodes(diff.Context) { - if !started { - started = true - fromDate := "" - if len(diff.FromDate) > 0 { - fromDate = "\t" + diff.FromDate - } - toDate := "" - if len(diff.ToDate) > 0 { - toDate = "\t" + diff.ToDate - } - w("*** %s%s%s", diff.FromFile, fromDate, diff.Eol) - w("--- %s%s%s", diff.ToFile, toDate, diff.Eol) - } - - first, last := g[0], g[len(g)-1] - w("***************" + diff.Eol) - - range1 := formatRangeContext(first.I1, last.I2) - w("*** %s ****%s", range1, diff.Eol) - for _, c := range g { - if c.Tag == 'r' || c.Tag == 'd' { - for _, cc := range g { - if cc.Tag == 'i' { - continue - } - for _, line := range diff.A[cc.I1:cc.I2] { - w(prefix[cc.Tag] + line) - } - } - break - } - } - - range2 := formatRangeContext(first.J1, last.J2) - w("--- %s ----%s", range2, diff.Eol) - for _, c := range g { - if c.Tag == 'r' || c.Tag == 'i' { - for _, cc := range g { - if cc.Tag == 'd' { - continue - } - for _, line := range diff.B[cc.J1:cc.J2] { - w(prefix[cc.Tag] + line) - } - } - break - } - } - } - return diffErr -} - -// Like WriteContextDiff but returns the diff a string. -func GetContextDiffString(diff ContextDiff) (string, error) { - w := &bytes.Buffer{} - err := WriteContextDiff(w, diff) - return string(w.Bytes()), err -} - -// Split a string on "\n" while preserving them. The output can be used -// as input for UnifiedDiff and ContextDiff structures. -func SplitLines(s string) []string { - lines := strings.SplitAfter(s, "\n") - lines[len(lines)-1] += "\n" - return lines -} diff --git a/vendor/github.com/ryanuber/go-glob/glob.go b/vendor/github.com/ryanuber/go-glob/glob.go index 32e3390..e67db3b 100644 --- a/vendor/github.com/ryanuber/go-glob/glob.go +++ b/vendor/github.com/ryanuber/go-glob/glob.go @@ -30,30 +30,27 @@ func Glob(pattern, subj string) bool { trailingGlob := strings.HasSuffix(pattern, GLOB) end := len(parts) - 1 - for i, part := range parts { + // Go over the leading parts and ensure they match. + for i := 0; i < end; i++ { + idx := strings.Index(subj, parts[i]) + switch i { case 0: - if leadingGlob { - continue - } - if !strings.HasPrefix(subj, part) { + // Check the first section. Requires special handling. + if !leadingGlob && idx != 0 { return false } - case end: - if len(subj) > 0 { - return trailingGlob || strings.HasSuffix(subj, part) - } default: - if !strings.Contains(subj, part) { + // Check that the middle parts match. + if idx < 0 { return false } } // Trim evaluated text from subj as we loop over the pattern. - idx := strings.Index(subj, part) + len(part) - subj = subj[idx:] + subj = subj[idx+len(parts[i]):] } - // All parts of the pattern matched - return true + // Reached the last section. Requires special handling. + return trailingGlob || strings.HasSuffix(subj, parts[end]) } diff --git a/vendor/github.com/stretchr/testify/LICENSE b/vendor/github.com/stretchr/testify/LICENSE deleted file mode 100644 index 473b670..0000000 --- a/vendor/github.com/stretchr/testify/LICENSE +++ /dev/null @@ -1,22 +0,0 @@ -Copyright (c) 2012 - 2013 Mat Ryer and Tyler Bunnell - -Please consider promoting this project if you find it useful. - -Permission is hereby granted, free of charge, to any person -obtaining a copy of this software and associated documentation -files (the "Software"), to deal in the Software without restriction, -including without limitation the rights to use, copy, modify, merge, -publish, distribute, sublicense, and/or sell copies of the Software, -and to permit persons to whom the Software is furnished to do so, -subject to the following conditions: - -The above copyright notice and this permission notice shall be included -in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES -OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. -IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, -DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT -OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE -OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/vendor/github.com/stretchr/testify/assert/assertion_format.go b/vendor/github.com/stretchr/testify/assert/assertion_format.go deleted file mode 100644 index 23838c4..0000000 --- a/vendor/github.com/stretchr/testify/assert/assertion_format.go +++ /dev/null @@ -1,379 +0,0 @@ -/* -* CODE GENERATED AUTOMATICALLY WITH github.com/stretchr/testify/_codegen -* THIS FILE MUST NOT BE EDITED BY HAND - */ - -package assert - -import ( - http "net/http" - url "net/url" - time "time" -) - -// Conditionf uses a Comparison to assert a complex condition. -func Conditionf(t TestingT, comp Comparison, msg string, args ...interface{}) bool { - return Condition(t, comp, append([]interface{}{msg}, args...)...) -} - -// Containsf asserts that the specified string, list(array, slice...) or map contains the -// specified substring or element. -// -// assert.Containsf(t, "Hello World", "World", "error message %s", "formatted") -// assert.Containsf(t, ["Hello", "World"], "World", "error message %s", "formatted") -// assert.Containsf(t, {"Hello": "World"}, "Hello", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Containsf(t TestingT, s interface{}, contains interface{}, msg string, args ...interface{}) bool { - return Contains(t, s, contains, append([]interface{}{msg}, args...)...) -} - -// Emptyf asserts that the specified object is empty. I.e. nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// assert.Emptyf(t, obj, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Emptyf(t TestingT, object interface{}, msg string, args ...interface{}) bool { - return Empty(t, object, append([]interface{}{msg}, args...)...) -} - -// Equalf asserts that two objects are equal. -// -// assert.Equalf(t, 123, 123, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). Function equality -// cannot be determined and will always fail. -func Equalf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return Equal(t, expected, actual, append([]interface{}{msg}, args...)...) -} - -// EqualErrorf asserts that a function returned an error (i.e. not `nil`) -// and that it is equal to the provided error. -// -// actualObj, err := SomeFunction() -// assert.EqualErrorf(t, err, expectedErrorString, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func EqualErrorf(t TestingT, theError error, errString string, msg string, args ...interface{}) bool { - return EqualError(t, theError, errString, append([]interface{}{msg}, args...)...) -} - -// EqualValuesf asserts that two objects are equal or convertable to the same types -// and equal. -// -// assert.EqualValuesf(t, uint32(123, "error message %s", "formatted"), int32(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func EqualValuesf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return EqualValues(t, expected, actual, append([]interface{}{msg}, args...)...) -} - -// Errorf asserts that a function returned an error (i.e. not `nil`). -// -// actualObj, err := SomeFunction() -// if assert.Errorf(t, err, "error message %s", "formatted") { -// assert.Equal(t, expectedErrorf, err) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func Errorf(t TestingT, err error, msg string, args ...interface{}) bool { - return Error(t, err, append([]interface{}{msg}, args...)...) -} - -// Exactlyf asserts that two objects are equal is value and type. -// -// assert.Exactlyf(t, int32(123, "error message %s", "formatted"), int64(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func Exactlyf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return Exactly(t, expected, actual, append([]interface{}{msg}, args...)...) -} - -// Failf reports a failure through -func Failf(t TestingT, failureMessage string, msg string, args ...interface{}) bool { - return Fail(t, failureMessage, append([]interface{}{msg}, args...)...) -} - -// FailNowf fails test -func FailNowf(t TestingT, failureMessage string, msg string, args ...interface{}) bool { - return FailNow(t, failureMessage, append([]interface{}{msg}, args...)...) -} - -// Falsef asserts that the specified value is false. -// -// assert.Falsef(t, myBool, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Falsef(t TestingT, value bool, msg string, args ...interface{}) bool { - return False(t, value, append([]interface{}{msg}, args...)...) -} - -// HTTPBodyContainsf asserts that a specified handler returns a -// body that contains a string. -// -// assert.HTTPBodyContainsf(t, myHandler, "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPBodyContainsf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, str interface{}) bool { - return HTTPBodyContains(t, handler, method, url, values, str) -} - -// HTTPBodyNotContainsf asserts that a specified handler returns a -// body that does not contain a string. -// -// assert.HTTPBodyNotContainsf(t, myHandler, "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPBodyNotContainsf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, str interface{}) bool { - return HTTPBodyNotContains(t, handler, method, url, values, str) -} - -// HTTPErrorf asserts that a specified handler returns an error status code. -// -// assert.HTTPErrorf(t, myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). -func HTTPErrorf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPError(t, handler, method, url, values) -} - -// HTTPRedirectf asserts that a specified handler returns a redirect status code. -// -// assert.HTTPRedirectf(t, myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). -func HTTPRedirectf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPRedirect(t, handler, method, url, values) -} - -// HTTPSuccessf asserts that a specified handler returns a success status code. -// -// assert.HTTPSuccessf(t, myHandler, "POST", "http://www.google.com", nil, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPSuccessf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPSuccess(t, handler, method, url, values) -} - -// Implementsf asserts that an object is implemented by the specified interface. -// -// assert.Implementsf(t, (*MyInterface, "error message %s", "formatted")(nil), new(MyObject)) -func Implementsf(t TestingT, interfaceObject interface{}, object interface{}, msg string, args ...interface{}) bool { - return Implements(t, interfaceObject, object, append([]interface{}{msg}, args...)...) -} - -// InDeltaf asserts that the two numerals are within delta of each other. -// -// assert.InDeltaf(t, math.Pi, (22 / 7.0, "error message %s", "formatted"), 0.01) -// -// Returns whether the assertion was successful (true) or not (false). -func InDeltaf(t TestingT, expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { - return InDelta(t, expected, actual, delta, append([]interface{}{msg}, args...)...) -} - -// InDeltaSlicef is the same as InDelta, except it compares two slices. -func InDeltaSlicef(t TestingT, expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { - return InDeltaSlice(t, expected, actual, delta, append([]interface{}{msg}, args...)...) -} - -// InEpsilonf asserts that expected and actual have a relative error less than epsilon -// -// Returns whether the assertion was successful (true) or not (false). -func InEpsilonf(t TestingT, expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { - return InEpsilon(t, expected, actual, epsilon, append([]interface{}{msg}, args...)...) -} - -// InEpsilonSlicef is the same as InEpsilon, except it compares each value from two slices. -func InEpsilonSlicef(t TestingT, expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { - return InEpsilonSlice(t, expected, actual, epsilon, append([]interface{}{msg}, args...)...) -} - -// IsTypef asserts that the specified objects are of the same type. -func IsTypef(t TestingT, expectedType interface{}, object interface{}, msg string, args ...interface{}) bool { - return IsType(t, expectedType, object, append([]interface{}{msg}, args...)...) -} - -// JSONEqf asserts that two JSON strings are equivalent. -// -// assert.JSONEqf(t, `{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func JSONEqf(t TestingT, expected string, actual string, msg string, args ...interface{}) bool { - return JSONEq(t, expected, actual, append([]interface{}{msg}, args...)...) -} - -// Lenf asserts that the specified object has specific length. -// Lenf also fails if the object has a type that len() not accept. -// -// assert.Lenf(t, mySlice, 3, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Lenf(t TestingT, object interface{}, length int, msg string, args ...interface{}) bool { - return Len(t, object, length, append([]interface{}{msg}, args...)...) -} - -// Nilf asserts that the specified object is nil. -// -// assert.Nilf(t, err, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Nilf(t TestingT, object interface{}, msg string, args ...interface{}) bool { - return Nil(t, object, append([]interface{}{msg}, args...)...) -} - -// NoErrorf asserts that a function returned no error (i.e. `nil`). -// -// actualObj, err := SomeFunction() -// if assert.NoErrorf(t, err, "error message %s", "formatted") { -// assert.Equal(t, expectedObj, actualObj) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func NoErrorf(t TestingT, err error, msg string, args ...interface{}) bool { - return NoError(t, err, append([]interface{}{msg}, args...)...) -} - -// NotContainsf asserts that the specified string, list(array, slice...) or map does NOT contain the -// specified substring or element. -// -// assert.NotContainsf(t, "Hello World", "Earth", "error message %s", "formatted") -// assert.NotContainsf(t, ["Hello", "World"], "Earth", "error message %s", "formatted") -// assert.NotContainsf(t, {"Hello": "World"}, "Earth", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func NotContainsf(t TestingT, s interface{}, contains interface{}, msg string, args ...interface{}) bool { - return NotContains(t, s, contains, append([]interface{}{msg}, args...)...) -} - -// NotEmptyf asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// if assert.NotEmptyf(t, obj, "error message %s", "formatted") { -// assert.Equal(t, "two", obj[1]) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func NotEmptyf(t TestingT, object interface{}, msg string, args ...interface{}) bool { - return NotEmpty(t, object, append([]interface{}{msg}, args...)...) -} - -// NotEqualf asserts that the specified values are NOT equal. -// -// assert.NotEqualf(t, obj1, obj2, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). -func NotEqualf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return NotEqual(t, expected, actual, append([]interface{}{msg}, args...)...) -} - -// NotNilf asserts that the specified object is not nil. -// -// assert.NotNilf(t, err, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func NotNilf(t TestingT, object interface{}, msg string, args ...interface{}) bool { - return NotNil(t, object, append([]interface{}{msg}, args...)...) -} - -// NotPanicsf asserts that the code inside the specified PanicTestFunc does NOT panic. -// -// assert.NotPanicsf(t, func(){ RemainCalm() }, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func NotPanicsf(t TestingT, f PanicTestFunc, msg string, args ...interface{}) bool { - return NotPanics(t, f, append([]interface{}{msg}, args...)...) -} - -// NotRegexpf asserts that a specified regexp does not match a string. -// -// assert.NotRegexpf(t, regexp.MustCompile("starts", "error message %s", "formatted"), "it's starting") -// assert.NotRegexpf(t, "^start", "it's not starting", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func NotRegexpf(t TestingT, rx interface{}, str interface{}, msg string, args ...interface{}) bool { - return NotRegexp(t, rx, str, append([]interface{}{msg}, args...)...) -} - -// NotSubsetf asserts that the specified list(array, slice...) contains not all -// elements given in the specified subset(array, slice...). -// -// assert.NotSubsetf(t, [1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func NotSubsetf(t TestingT, list interface{}, subset interface{}, msg string, args ...interface{}) bool { - return NotSubset(t, list, subset, append([]interface{}{msg}, args...)...) -} - -// NotZerof asserts that i is not the zero value for its type and returns the truth. -func NotZerof(t TestingT, i interface{}, msg string, args ...interface{}) bool { - return NotZero(t, i, append([]interface{}{msg}, args...)...) -} - -// Panicsf asserts that the code inside the specified PanicTestFunc panics. -// -// assert.Panicsf(t, func(){ GoCrazy() }, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Panicsf(t TestingT, f PanicTestFunc, msg string, args ...interface{}) bool { - return Panics(t, f, append([]interface{}{msg}, args...)...) -} - -// PanicsWithValuef asserts that the code inside the specified PanicTestFunc panics, and that -// the recovered panic value equals the expected panic value. -// -// assert.PanicsWithValuef(t, "crazy error", func(){ GoCrazy() }, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func PanicsWithValuef(t TestingT, expected interface{}, f PanicTestFunc, msg string, args ...interface{}) bool { - return PanicsWithValue(t, expected, f, append([]interface{}{msg}, args...)...) -} - -// Regexpf asserts that a specified regexp matches a string. -// -// assert.Regexpf(t, regexp.MustCompile("start", "error message %s", "formatted"), "it's starting") -// assert.Regexpf(t, "start...$", "it's not starting", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Regexpf(t TestingT, rx interface{}, str interface{}, msg string, args ...interface{}) bool { - return Regexp(t, rx, str, append([]interface{}{msg}, args...)...) -} - -// Subsetf asserts that the specified list(array, slice...) contains all -// elements given in the specified subset(array, slice...). -// -// assert.Subsetf(t, [1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Subsetf(t TestingT, list interface{}, subset interface{}, msg string, args ...interface{}) bool { - return Subset(t, list, subset, append([]interface{}{msg}, args...)...) -} - -// Truef asserts that the specified value is true. -// -// assert.Truef(t, myBool, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func Truef(t TestingT, value bool, msg string, args ...interface{}) bool { - return True(t, value, append([]interface{}{msg}, args...)...) -} - -// WithinDurationf asserts that the two times are within duration delta of each other. -// -// assert.WithinDurationf(t, time.Now(), time.Now(), 10*time.Second, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func WithinDurationf(t TestingT, expected time.Time, actual time.Time, delta time.Duration, msg string, args ...interface{}) bool { - return WithinDuration(t, expected, actual, delta, append([]interface{}{msg}, args...)...) -} - -// Zerof asserts that i is the zero value for its type and returns the truth. -func Zerof(t TestingT, i interface{}, msg string, args ...interface{}) bool { - return Zero(t, i, append([]interface{}{msg}, args...)...) -} diff --git a/vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl b/vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl deleted file mode 100644 index c5cc66f..0000000 --- a/vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl +++ /dev/null @@ -1,4 +0,0 @@ -{{.CommentFormat}} -func {{.DocInfo.Name}}f(t TestingT, {{.ParamsFormat}}) bool { - return {{.DocInfo.Name}}(t, {{.ForwardedParamsFormat}}) -} diff --git a/vendor/github.com/stretchr/testify/assert/assertion_forward.go b/vendor/github.com/stretchr/testify/assert/assertion_forward.go deleted file mode 100644 index fcccbd0..0000000 --- a/vendor/github.com/stretchr/testify/assert/assertion_forward.go +++ /dev/null @@ -1,746 +0,0 @@ -/* -* CODE GENERATED AUTOMATICALLY WITH github.com/stretchr/testify/_codegen -* THIS FILE MUST NOT BE EDITED BY HAND - */ - -package assert - -import ( - http "net/http" - url "net/url" - time "time" -) - -// Condition uses a Comparison to assert a complex condition. -func (a *Assertions) Condition(comp Comparison, msgAndArgs ...interface{}) bool { - return Condition(a.t, comp, msgAndArgs...) -} - -// Conditionf uses a Comparison to assert a complex condition. -func (a *Assertions) Conditionf(comp Comparison, msg string, args ...interface{}) bool { - return Conditionf(a.t, comp, msg, args...) -} - -// Contains asserts that the specified string, list(array, slice...) or map contains the -// specified substring or element. -// -// a.Contains("Hello World", "World") -// a.Contains(["Hello", "World"], "World") -// a.Contains({"Hello": "World"}, "Hello") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Contains(s interface{}, contains interface{}, msgAndArgs ...interface{}) bool { - return Contains(a.t, s, contains, msgAndArgs...) -} - -// Containsf asserts that the specified string, list(array, slice...) or map contains the -// specified substring or element. -// -// a.Containsf("Hello World", "World", "error message %s", "formatted") -// a.Containsf(["Hello", "World"], "World", "error message %s", "formatted") -// a.Containsf({"Hello": "World"}, "Hello", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Containsf(s interface{}, contains interface{}, msg string, args ...interface{}) bool { - return Containsf(a.t, s, contains, msg, args...) -} - -// Empty asserts that the specified object is empty. I.e. nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// a.Empty(obj) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Empty(object interface{}, msgAndArgs ...interface{}) bool { - return Empty(a.t, object, msgAndArgs...) -} - -// Emptyf asserts that the specified object is empty. I.e. nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// a.Emptyf(obj, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Emptyf(object interface{}, msg string, args ...interface{}) bool { - return Emptyf(a.t, object, msg, args...) -} - -// Equal asserts that two objects are equal. -// -// a.Equal(123, 123) -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). Function equality -// cannot be determined and will always fail. -func (a *Assertions) Equal(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { - return Equal(a.t, expected, actual, msgAndArgs...) -} - -// EqualError asserts that a function returned an error (i.e. not `nil`) -// and that it is equal to the provided error. -// -// actualObj, err := SomeFunction() -// a.EqualError(err, expectedErrorString) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) EqualError(theError error, errString string, msgAndArgs ...interface{}) bool { - return EqualError(a.t, theError, errString, msgAndArgs...) -} - -// EqualErrorf asserts that a function returned an error (i.e. not `nil`) -// and that it is equal to the provided error. -// -// actualObj, err := SomeFunction() -// a.EqualErrorf(err, expectedErrorString, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) EqualErrorf(theError error, errString string, msg string, args ...interface{}) bool { - return EqualErrorf(a.t, theError, errString, msg, args...) -} - -// EqualValues asserts that two objects are equal or convertable to the same types -// and equal. -// -// a.EqualValues(uint32(123), int32(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) EqualValues(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { - return EqualValues(a.t, expected, actual, msgAndArgs...) -} - -// EqualValuesf asserts that two objects are equal or convertable to the same types -// and equal. -// -// a.EqualValuesf(uint32(123, "error message %s", "formatted"), int32(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) EqualValuesf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return EqualValuesf(a.t, expected, actual, msg, args...) -} - -// Equalf asserts that two objects are equal. -// -// a.Equalf(123, 123, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). Function equality -// cannot be determined and will always fail. -func (a *Assertions) Equalf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return Equalf(a.t, expected, actual, msg, args...) -} - -// Error asserts that a function returned an error (i.e. not `nil`). -// -// actualObj, err := SomeFunction() -// if a.Error(err) { -// assert.Equal(t, expectedError, err) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Error(err error, msgAndArgs ...interface{}) bool { - return Error(a.t, err, msgAndArgs...) -} - -// Errorf asserts that a function returned an error (i.e. not `nil`). -// -// actualObj, err := SomeFunction() -// if a.Errorf(err, "error message %s", "formatted") { -// assert.Equal(t, expectedErrorf, err) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Errorf(err error, msg string, args ...interface{}) bool { - return Errorf(a.t, err, msg, args...) -} - -// Exactly asserts that two objects are equal is value and type. -// -// a.Exactly(int32(123), int64(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Exactly(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { - return Exactly(a.t, expected, actual, msgAndArgs...) -} - -// Exactlyf asserts that two objects are equal is value and type. -// -// a.Exactlyf(int32(123, "error message %s", "formatted"), int64(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Exactlyf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return Exactlyf(a.t, expected, actual, msg, args...) -} - -// Fail reports a failure through -func (a *Assertions) Fail(failureMessage string, msgAndArgs ...interface{}) bool { - return Fail(a.t, failureMessage, msgAndArgs...) -} - -// FailNow fails test -func (a *Assertions) FailNow(failureMessage string, msgAndArgs ...interface{}) bool { - return FailNow(a.t, failureMessage, msgAndArgs...) -} - -// FailNowf fails test -func (a *Assertions) FailNowf(failureMessage string, msg string, args ...interface{}) bool { - return FailNowf(a.t, failureMessage, msg, args...) -} - -// Failf reports a failure through -func (a *Assertions) Failf(failureMessage string, msg string, args ...interface{}) bool { - return Failf(a.t, failureMessage, msg, args...) -} - -// False asserts that the specified value is false. -// -// a.False(myBool) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) False(value bool, msgAndArgs ...interface{}) bool { - return False(a.t, value, msgAndArgs...) -} - -// Falsef asserts that the specified value is false. -// -// a.Falsef(myBool, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Falsef(value bool, msg string, args ...interface{}) bool { - return Falsef(a.t, value, msg, args...) -} - -// HTTPBodyContains asserts that a specified handler returns a -// body that contains a string. -// -// a.HTTPBodyContains(myHandler, "www.google.com", nil, "I'm Feeling Lucky") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPBodyContains(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}) bool { - return HTTPBodyContains(a.t, handler, method, url, values, str) -} - -// HTTPBodyContainsf asserts that a specified handler returns a -// body that contains a string. -// -// a.HTTPBodyContainsf(myHandler, "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPBodyContainsf(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}) bool { - return HTTPBodyContainsf(a.t, handler, method, url, values, str) -} - -// HTTPBodyNotContains asserts that a specified handler returns a -// body that does not contain a string. -// -// a.HTTPBodyNotContains(myHandler, "www.google.com", nil, "I'm Feeling Lucky") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPBodyNotContains(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}) bool { - return HTTPBodyNotContains(a.t, handler, method, url, values, str) -} - -// HTTPBodyNotContainsf asserts that a specified handler returns a -// body that does not contain a string. -// -// a.HTTPBodyNotContainsf(myHandler, "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPBodyNotContainsf(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}) bool { - return HTTPBodyNotContainsf(a.t, handler, method, url, values, str) -} - -// HTTPError asserts that a specified handler returns an error status code. -// -// a.HTTPError(myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPError(handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPError(a.t, handler, method, url, values) -} - -// HTTPErrorf asserts that a specified handler returns an error status code. -// -// a.HTTPErrorf(myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). -func (a *Assertions) HTTPErrorf(handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPErrorf(a.t, handler, method, url, values) -} - -// HTTPRedirect asserts that a specified handler returns a redirect status code. -// -// a.HTTPRedirect(myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPRedirect(handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPRedirect(a.t, handler, method, url, values) -} - -// HTTPRedirectf asserts that a specified handler returns a redirect status code. -// -// a.HTTPRedirectf(myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). -func (a *Assertions) HTTPRedirectf(handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPRedirectf(a.t, handler, method, url, values) -} - -// HTTPSuccess asserts that a specified handler returns a success status code. -// -// a.HTTPSuccess(myHandler, "POST", "http://www.google.com", nil) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPSuccess(handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPSuccess(a.t, handler, method, url, values) -} - -// HTTPSuccessf asserts that a specified handler returns a success status code. -// -// a.HTTPSuccessf(myHandler, "POST", "http://www.google.com", nil, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) HTTPSuccessf(handler http.HandlerFunc, method string, url string, values url.Values) bool { - return HTTPSuccessf(a.t, handler, method, url, values) -} - -// Implements asserts that an object is implemented by the specified interface. -// -// a.Implements((*MyInterface)(nil), new(MyObject)) -func (a *Assertions) Implements(interfaceObject interface{}, object interface{}, msgAndArgs ...interface{}) bool { - return Implements(a.t, interfaceObject, object, msgAndArgs...) -} - -// Implementsf asserts that an object is implemented by the specified interface. -// -// a.Implementsf((*MyInterface, "error message %s", "formatted")(nil), new(MyObject)) -func (a *Assertions) Implementsf(interfaceObject interface{}, object interface{}, msg string, args ...interface{}) bool { - return Implementsf(a.t, interfaceObject, object, msg, args...) -} - -// InDelta asserts that the two numerals are within delta of each other. -// -// a.InDelta(math.Pi, (22 / 7.0), 0.01) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) InDelta(expected interface{}, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { - return InDelta(a.t, expected, actual, delta, msgAndArgs...) -} - -// InDeltaSlice is the same as InDelta, except it compares two slices. -func (a *Assertions) InDeltaSlice(expected interface{}, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { - return InDeltaSlice(a.t, expected, actual, delta, msgAndArgs...) -} - -// InDeltaSlicef is the same as InDelta, except it compares two slices. -func (a *Assertions) InDeltaSlicef(expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { - return InDeltaSlicef(a.t, expected, actual, delta, msg, args...) -} - -// InDeltaf asserts that the two numerals are within delta of each other. -// -// a.InDeltaf(math.Pi, (22 / 7.0, "error message %s", "formatted"), 0.01) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) InDeltaf(expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { - return InDeltaf(a.t, expected, actual, delta, msg, args...) -} - -// InEpsilon asserts that expected and actual have a relative error less than epsilon -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) InEpsilon(expected interface{}, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { - return InEpsilon(a.t, expected, actual, epsilon, msgAndArgs...) -} - -// InEpsilonSlice is the same as InEpsilon, except it compares each value from two slices. -func (a *Assertions) InEpsilonSlice(expected interface{}, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { - return InEpsilonSlice(a.t, expected, actual, epsilon, msgAndArgs...) -} - -// InEpsilonSlicef is the same as InEpsilon, except it compares each value from two slices. -func (a *Assertions) InEpsilonSlicef(expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { - return InEpsilonSlicef(a.t, expected, actual, epsilon, msg, args...) -} - -// InEpsilonf asserts that expected and actual have a relative error less than epsilon -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) InEpsilonf(expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { - return InEpsilonf(a.t, expected, actual, epsilon, msg, args...) -} - -// IsType asserts that the specified objects are of the same type. -func (a *Assertions) IsType(expectedType interface{}, object interface{}, msgAndArgs ...interface{}) bool { - return IsType(a.t, expectedType, object, msgAndArgs...) -} - -// IsTypef asserts that the specified objects are of the same type. -func (a *Assertions) IsTypef(expectedType interface{}, object interface{}, msg string, args ...interface{}) bool { - return IsTypef(a.t, expectedType, object, msg, args...) -} - -// JSONEq asserts that two JSON strings are equivalent. -// -// a.JSONEq(`{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) JSONEq(expected string, actual string, msgAndArgs ...interface{}) bool { - return JSONEq(a.t, expected, actual, msgAndArgs...) -} - -// JSONEqf asserts that two JSON strings are equivalent. -// -// a.JSONEqf(`{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) JSONEqf(expected string, actual string, msg string, args ...interface{}) bool { - return JSONEqf(a.t, expected, actual, msg, args...) -} - -// Len asserts that the specified object has specific length. -// Len also fails if the object has a type that len() not accept. -// -// a.Len(mySlice, 3) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Len(object interface{}, length int, msgAndArgs ...interface{}) bool { - return Len(a.t, object, length, msgAndArgs...) -} - -// Lenf asserts that the specified object has specific length. -// Lenf also fails if the object has a type that len() not accept. -// -// a.Lenf(mySlice, 3, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Lenf(object interface{}, length int, msg string, args ...interface{}) bool { - return Lenf(a.t, object, length, msg, args...) -} - -// Nil asserts that the specified object is nil. -// -// a.Nil(err) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Nil(object interface{}, msgAndArgs ...interface{}) bool { - return Nil(a.t, object, msgAndArgs...) -} - -// Nilf asserts that the specified object is nil. -// -// a.Nilf(err, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Nilf(object interface{}, msg string, args ...interface{}) bool { - return Nilf(a.t, object, msg, args...) -} - -// NoError asserts that a function returned no error (i.e. `nil`). -// -// actualObj, err := SomeFunction() -// if a.NoError(err) { -// assert.Equal(t, expectedObj, actualObj) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NoError(err error, msgAndArgs ...interface{}) bool { - return NoError(a.t, err, msgAndArgs...) -} - -// NoErrorf asserts that a function returned no error (i.e. `nil`). -// -// actualObj, err := SomeFunction() -// if a.NoErrorf(err, "error message %s", "formatted") { -// assert.Equal(t, expectedObj, actualObj) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NoErrorf(err error, msg string, args ...interface{}) bool { - return NoErrorf(a.t, err, msg, args...) -} - -// NotContains asserts that the specified string, list(array, slice...) or map does NOT contain the -// specified substring or element. -// -// a.NotContains("Hello World", "Earth") -// a.NotContains(["Hello", "World"], "Earth") -// a.NotContains({"Hello": "World"}, "Earth") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotContains(s interface{}, contains interface{}, msgAndArgs ...interface{}) bool { - return NotContains(a.t, s, contains, msgAndArgs...) -} - -// NotContainsf asserts that the specified string, list(array, slice...) or map does NOT contain the -// specified substring or element. -// -// a.NotContainsf("Hello World", "Earth", "error message %s", "formatted") -// a.NotContainsf(["Hello", "World"], "Earth", "error message %s", "formatted") -// a.NotContainsf({"Hello": "World"}, "Earth", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotContainsf(s interface{}, contains interface{}, msg string, args ...interface{}) bool { - return NotContainsf(a.t, s, contains, msg, args...) -} - -// NotEmpty asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// if a.NotEmpty(obj) { -// assert.Equal(t, "two", obj[1]) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotEmpty(object interface{}, msgAndArgs ...interface{}) bool { - return NotEmpty(a.t, object, msgAndArgs...) -} - -// NotEmptyf asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// if a.NotEmptyf(obj, "error message %s", "formatted") { -// assert.Equal(t, "two", obj[1]) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotEmptyf(object interface{}, msg string, args ...interface{}) bool { - return NotEmptyf(a.t, object, msg, args...) -} - -// NotEqual asserts that the specified values are NOT equal. -// -// a.NotEqual(obj1, obj2) -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). -func (a *Assertions) NotEqual(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { - return NotEqual(a.t, expected, actual, msgAndArgs...) -} - -// NotEqualf asserts that the specified values are NOT equal. -// -// a.NotEqualf(obj1, obj2, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). -func (a *Assertions) NotEqualf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { - return NotEqualf(a.t, expected, actual, msg, args...) -} - -// NotNil asserts that the specified object is not nil. -// -// a.NotNil(err) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotNil(object interface{}, msgAndArgs ...interface{}) bool { - return NotNil(a.t, object, msgAndArgs...) -} - -// NotNilf asserts that the specified object is not nil. -// -// a.NotNilf(err, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotNilf(object interface{}, msg string, args ...interface{}) bool { - return NotNilf(a.t, object, msg, args...) -} - -// NotPanics asserts that the code inside the specified PanicTestFunc does NOT panic. -// -// a.NotPanics(func(){ RemainCalm() }) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotPanics(f PanicTestFunc, msgAndArgs ...interface{}) bool { - return NotPanics(a.t, f, msgAndArgs...) -} - -// NotPanicsf asserts that the code inside the specified PanicTestFunc does NOT panic. -// -// a.NotPanicsf(func(){ RemainCalm() }, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotPanicsf(f PanicTestFunc, msg string, args ...interface{}) bool { - return NotPanicsf(a.t, f, msg, args...) -} - -// NotRegexp asserts that a specified regexp does not match a string. -// -// a.NotRegexp(regexp.MustCompile("starts"), "it's starting") -// a.NotRegexp("^start", "it's not starting") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotRegexp(rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { - return NotRegexp(a.t, rx, str, msgAndArgs...) -} - -// NotRegexpf asserts that a specified regexp does not match a string. -// -// a.NotRegexpf(regexp.MustCompile("starts", "error message %s", "formatted"), "it's starting") -// a.NotRegexpf("^start", "it's not starting", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotRegexpf(rx interface{}, str interface{}, msg string, args ...interface{}) bool { - return NotRegexpf(a.t, rx, str, msg, args...) -} - -// NotSubset asserts that the specified list(array, slice...) contains not all -// elements given in the specified subset(array, slice...). -// -// a.NotSubset([1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotSubset(list interface{}, subset interface{}, msgAndArgs ...interface{}) bool { - return NotSubset(a.t, list, subset, msgAndArgs...) -} - -// NotSubsetf asserts that the specified list(array, slice...) contains not all -// elements given in the specified subset(array, slice...). -// -// a.NotSubsetf([1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) NotSubsetf(list interface{}, subset interface{}, msg string, args ...interface{}) bool { - return NotSubsetf(a.t, list, subset, msg, args...) -} - -// NotZero asserts that i is not the zero value for its type and returns the truth. -func (a *Assertions) NotZero(i interface{}, msgAndArgs ...interface{}) bool { - return NotZero(a.t, i, msgAndArgs...) -} - -// NotZerof asserts that i is not the zero value for its type and returns the truth. -func (a *Assertions) NotZerof(i interface{}, msg string, args ...interface{}) bool { - return NotZerof(a.t, i, msg, args...) -} - -// Panics asserts that the code inside the specified PanicTestFunc panics. -// -// a.Panics(func(){ GoCrazy() }) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Panics(f PanicTestFunc, msgAndArgs ...interface{}) bool { - return Panics(a.t, f, msgAndArgs...) -} - -// PanicsWithValue asserts that the code inside the specified PanicTestFunc panics, and that -// the recovered panic value equals the expected panic value. -// -// a.PanicsWithValue("crazy error", func(){ GoCrazy() }) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) PanicsWithValue(expected interface{}, f PanicTestFunc, msgAndArgs ...interface{}) bool { - return PanicsWithValue(a.t, expected, f, msgAndArgs...) -} - -// PanicsWithValuef asserts that the code inside the specified PanicTestFunc panics, and that -// the recovered panic value equals the expected panic value. -// -// a.PanicsWithValuef("crazy error", func(){ GoCrazy() }, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) PanicsWithValuef(expected interface{}, f PanicTestFunc, msg string, args ...interface{}) bool { - return PanicsWithValuef(a.t, expected, f, msg, args...) -} - -// Panicsf asserts that the code inside the specified PanicTestFunc panics. -// -// a.Panicsf(func(){ GoCrazy() }, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Panicsf(f PanicTestFunc, msg string, args ...interface{}) bool { - return Panicsf(a.t, f, msg, args...) -} - -// Regexp asserts that a specified regexp matches a string. -// -// a.Regexp(regexp.MustCompile("start"), "it's starting") -// a.Regexp("start...$", "it's not starting") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Regexp(rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { - return Regexp(a.t, rx, str, msgAndArgs...) -} - -// Regexpf asserts that a specified regexp matches a string. -// -// a.Regexpf(regexp.MustCompile("start", "error message %s", "formatted"), "it's starting") -// a.Regexpf("start...$", "it's not starting", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Regexpf(rx interface{}, str interface{}, msg string, args ...interface{}) bool { - return Regexpf(a.t, rx, str, msg, args...) -} - -// Subset asserts that the specified list(array, slice...) contains all -// elements given in the specified subset(array, slice...). -// -// a.Subset([1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Subset(list interface{}, subset interface{}, msgAndArgs ...interface{}) bool { - return Subset(a.t, list, subset, msgAndArgs...) -} - -// Subsetf asserts that the specified list(array, slice...) contains all -// elements given in the specified subset(array, slice...). -// -// a.Subsetf([1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]", "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Subsetf(list interface{}, subset interface{}, msg string, args ...interface{}) bool { - return Subsetf(a.t, list, subset, msg, args...) -} - -// True asserts that the specified value is true. -// -// a.True(myBool) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) True(value bool, msgAndArgs ...interface{}) bool { - return True(a.t, value, msgAndArgs...) -} - -// Truef asserts that the specified value is true. -// -// a.Truef(myBool, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) Truef(value bool, msg string, args ...interface{}) bool { - return Truef(a.t, value, msg, args...) -} - -// WithinDuration asserts that the two times are within duration delta of each other. -// -// a.WithinDuration(time.Now(), time.Now(), 10*time.Second) -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) WithinDuration(expected time.Time, actual time.Time, delta time.Duration, msgAndArgs ...interface{}) bool { - return WithinDuration(a.t, expected, actual, delta, msgAndArgs...) -} - -// WithinDurationf asserts that the two times are within duration delta of each other. -// -// a.WithinDurationf(time.Now(), time.Now(), 10*time.Second, "error message %s", "formatted") -// -// Returns whether the assertion was successful (true) or not (false). -func (a *Assertions) WithinDurationf(expected time.Time, actual time.Time, delta time.Duration, msg string, args ...interface{}) bool { - return WithinDurationf(a.t, expected, actual, delta, msg, args...) -} - -// Zero asserts that i is the zero value for its type and returns the truth. -func (a *Assertions) Zero(i interface{}, msgAndArgs ...interface{}) bool { - return Zero(a.t, i, msgAndArgs...) -} - -// Zerof asserts that i is the zero value for its type and returns the truth. -func (a *Assertions) Zerof(i interface{}, msg string, args ...interface{}) bool { - return Zerof(a.t, i, msg, args...) -} diff --git a/vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl b/vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl deleted file mode 100644 index 99f9acf..0000000 --- a/vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl +++ /dev/null @@ -1,4 +0,0 @@ -{{.CommentWithoutT "a"}} -func (a *Assertions) {{.DocInfo.Name}}({{.Params}}) bool { - return {{.DocInfo.Name}}(a.t, {{.ForwardedParams}}) -} diff --git a/vendor/github.com/stretchr/testify/assert/assertions.go b/vendor/github.com/stretchr/testify/assert/assertions.go deleted file mode 100644 index c8034f6..0000000 --- a/vendor/github.com/stretchr/testify/assert/assertions.go +++ /dev/null @@ -1,1208 +0,0 @@ -package assert - -import ( - "bufio" - "bytes" - "encoding/json" - "errors" - "fmt" - "math" - "reflect" - "regexp" - "runtime" - "strings" - "time" - "unicode" - "unicode/utf8" - - "github.com/davecgh/go-spew/spew" - "github.com/pmezard/go-difflib/difflib" -) - -//go:generate go run ../_codegen/main.go -output-package=assert -template=assertion_format.go.tmpl - -// TestingT is an interface wrapper around *testing.T -type TestingT interface { - Errorf(format string, args ...interface{}) -} - -// Comparison a custom function that returns true on success and false on failure -type Comparison func() (success bool) - -/* - Helper functions -*/ - -// ObjectsAreEqual determines if two objects are considered equal. -// -// This function does no assertion of any kind. -func ObjectsAreEqual(expected, actual interface{}) bool { - - if expected == nil || actual == nil { - return expected == actual - } - if exp, ok := expected.([]byte); ok { - act, ok := actual.([]byte) - if !ok { - return false - } else if exp == nil || act == nil { - return exp == nil && act == nil - } - return bytes.Equal(exp, act) - } - return reflect.DeepEqual(expected, actual) - -} - -// ObjectsAreEqualValues gets whether two objects are equal, or if their -// values are equal. -func ObjectsAreEqualValues(expected, actual interface{}) bool { - if ObjectsAreEqual(expected, actual) { - return true - } - - actualType := reflect.TypeOf(actual) - if actualType == nil { - return false - } - expectedValue := reflect.ValueOf(expected) - if expectedValue.IsValid() && expectedValue.Type().ConvertibleTo(actualType) { - // Attempt comparison after type conversion - return reflect.DeepEqual(expectedValue.Convert(actualType).Interface(), actual) - } - - return false -} - -/* CallerInfo is necessary because the assert functions use the testing object -internally, causing it to print the file:line of the assert method, rather than where -the problem actually occurred in calling code.*/ - -// CallerInfo returns an array of strings containing the file and line number -// of each stack frame leading from the current test to the assert call that -// failed. -func CallerInfo() []string { - - pc := uintptr(0) - file := "" - line := 0 - ok := false - name := "" - - callers := []string{} - for i := 0; ; i++ { - pc, file, line, ok = runtime.Caller(i) - if !ok { - // The breaks below failed to terminate the loop, and we ran off the - // end of the call stack. - break - } - - // This is a huge edge case, but it will panic if this is the case, see #180 - if file == "" { - break - } - - f := runtime.FuncForPC(pc) - if f == nil { - break - } - name = f.Name() - - // testing.tRunner is the standard library function that calls - // tests. Subtests are called directly by tRunner, without going through - // the Test/Benchmark/Example function that contains the t.Run calls, so - // with subtests we should break when we hit tRunner, without adding it - // to the list of callers. - if name == "testing.tRunner" { - break - } - - parts := strings.Split(file, "/") - file = parts[len(parts)-1] - if len(parts) > 1 { - dir := parts[len(parts)-2] - if (dir != "assert" && dir != "mock" && dir != "require") || file == "mock_test.go" { - callers = append(callers, fmt.Sprintf("%s:%d", file, line)) - } - } - - // Drop the package - segments := strings.Split(name, ".") - name = segments[len(segments)-1] - if isTest(name, "Test") || - isTest(name, "Benchmark") || - isTest(name, "Example") { - break - } - } - - return callers -} - -// Stolen from the `go test` tool. -// isTest tells whether name looks like a test (or benchmark, according to prefix). -// It is a Test (say) if there is a character after Test that is not a lower-case letter. -// We don't want TesticularCancer. -func isTest(name, prefix string) bool { - if !strings.HasPrefix(name, prefix) { - return false - } - if len(name) == len(prefix) { // "Test" is ok - return true - } - rune, _ := utf8.DecodeRuneInString(name[len(prefix):]) - return !unicode.IsLower(rune) -} - -// getWhitespaceString returns a string that is long enough to overwrite the default -// output from the go testing framework. -func getWhitespaceString() string { - - _, file, line, ok := runtime.Caller(1) - if !ok { - return "" - } - parts := strings.Split(file, "/") - file = parts[len(parts)-1] - - return strings.Repeat(" ", len(fmt.Sprintf("%s:%d: ", file, line))) - -} - -func messageFromMsgAndArgs(msgAndArgs ...interface{}) string { - if len(msgAndArgs) == 0 || msgAndArgs == nil { - return "" - } - if len(msgAndArgs) == 1 { - return msgAndArgs[0].(string) - } - if len(msgAndArgs) > 1 { - return fmt.Sprintf(msgAndArgs[0].(string), msgAndArgs[1:]...) - } - return "" -} - -// Aligns the provided message so that all lines after the first line start at the same location as the first line. -// Assumes that the first line starts at the correct location (after carriage return, tab, label, spacer and tab). -// The longestLabelLen parameter specifies the length of the longest label in the output (required becaues this is the -// basis on which the alignment occurs). -func indentMessageLines(message string, longestLabelLen int) string { - outBuf := new(bytes.Buffer) - - for i, scanner := 0, bufio.NewScanner(strings.NewReader(message)); scanner.Scan(); i++ { - // no need to align first line because it starts at the correct location (after the label) - if i != 0 { - // append alignLen+1 spaces to align with "{{longestLabel}}:" before adding tab - outBuf.WriteString("\n\r\t" + strings.Repeat(" ", longestLabelLen+1) + "\t") - } - outBuf.WriteString(scanner.Text()) - } - - return outBuf.String() -} - -type failNower interface { - FailNow() -} - -// FailNow fails test -func FailNow(t TestingT, failureMessage string, msgAndArgs ...interface{}) bool { - Fail(t, failureMessage, msgAndArgs...) - - // We cannot extend TestingT with FailNow() and - // maintain backwards compatibility, so we fallback - // to panicking when FailNow is not available in - // TestingT. - // See issue #263 - - if t, ok := t.(failNower); ok { - t.FailNow() - } else { - panic("test failed and t is missing `FailNow()`") - } - return false -} - -// Fail reports a failure through -func Fail(t TestingT, failureMessage string, msgAndArgs ...interface{}) bool { - content := []labeledContent{ - {"Error Trace", strings.Join(CallerInfo(), "\n\r\t\t\t")}, - {"Error", failureMessage}, - } - - message := messageFromMsgAndArgs(msgAndArgs...) - if len(message) > 0 { - content = append(content, labeledContent{"Messages", message}) - } - - t.Errorf("%s", "\r"+getWhitespaceString()+labeledOutput(content...)) - - return false -} - -type labeledContent struct { - label string - content string -} - -// labeledOutput returns a string consisting of the provided labeledContent. Each labeled output is appended in the following manner: -// -// \r\t{{label}}:{{align_spaces}}\t{{content}}\n -// -// The initial carriage return is required to undo/erase any padding added by testing.T.Errorf. The "\t{{label}}:" is for the label. -// If a label is shorter than the longest label provided, padding spaces are added to make all the labels match in length. Once this -// alignment is achieved, "\t{{content}}\n" is added for the output. -// -// If the content of the labeledOutput contains line breaks, the subsequent lines are aligned so that they start at the same location as the first line. -func labeledOutput(content ...labeledContent) string { - longestLabel := 0 - for _, v := range content { - if len(v.label) > longestLabel { - longestLabel = len(v.label) - } - } - var output string - for _, v := range content { - output += "\r\t" + v.label + ":" + strings.Repeat(" ", longestLabel-len(v.label)) + "\t" + indentMessageLines(v.content, longestLabel) + "\n" - } - return output -} - -// Implements asserts that an object is implemented by the specified interface. -// -// assert.Implements(t, (*MyInterface)(nil), new(MyObject)) -func Implements(t TestingT, interfaceObject interface{}, object interface{}, msgAndArgs ...interface{}) bool { - - interfaceType := reflect.TypeOf(interfaceObject).Elem() - - if !reflect.TypeOf(object).Implements(interfaceType) { - return Fail(t, fmt.Sprintf("%T must implement %v", object, interfaceType), msgAndArgs...) - } - - return true - -} - -// IsType asserts that the specified objects are of the same type. -func IsType(t TestingT, expectedType interface{}, object interface{}, msgAndArgs ...interface{}) bool { - - if !ObjectsAreEqual(reflect.TypeOf(object), reflect.TypeOf(expectedType)) { - return Fail(t, fmt.Sprintf("Object expected to be of type %v, but was %v", reflect.TypeOf(expectedType), reflect.TypeOf(object)), msgAndArgs...) - } - - return true -} - -// Equal asserts that two objects are equal. -// -// assert.Equal(t, 123, 123) -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). Function equality -// cannot be determined and will always fail. -func Equal(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { - if err := validateEqualArgs(expected, actual); err != nil { - return Fail(t, fmt.Sprintf("Invalid operation: %#v == %#v (%s)", - expected, actual, err), msgAndArgs...) - } - - if !ObjectsAreEqual(expected, actual) { - diff := diff(expected, actual) - expected, actual = formatUnequalValues(expected, actual) - return Fail(t, fmt.Sprintf("Not equal: \n"+ - "expected: %s\n"+ - "actual: %s%s", expected, actual, diff), msgAndArgs...) - } - - return true - -} - -// formatUnequalValues takes two values of arbitrary types and returns string -// representations appropriate to be presented to the user. -// -// If the values are not of like type, the returned strings will be prefixed -// with the type name, and the value will be enclosed in parenthesis similar -// to a type conversion in the Go grammar. -func formatUnequalValues(expected, actual interface{}) (e string, a string) { - if reflect.TypeOf(expected) != reflect.TypeOf(actual) { - return fmt.Sprintf("%T(%#v)", expected, expected), - fmt.Sprintf("%T(%#v)", actual, actual) - } - - return fmt.Sprintf("%#v", expected), - fmt.Sprintf("%#v", actual) -} - -// EqualValues asserts that two objects are equal or convertable to the same types -// and equal. -// -// assert.EqualValues(t, uint32(123), int32(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func EqualValues(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { - - if !ObjectsAreEqualValues(expected, actual) { - diff := diff(expected, actual) - expected, actual = formatUnequalValues(expected, actual) - return Fail(t, fmt.Sprintf("Not equal: \n"+ - "expected: %s\n"+ - "actual: %s%s", expected, actual, diff), msgAndArgs...) - } - - return true - -} - -// Exactly asserts that two objects are equal is value and type. -// -// assert.Exactly(t, int32(123), int64(123)) -// -// Returns whether the assertion was successful (true) or not (false). -func Exactly(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { - - aType := reflect.TypeOf(expected) - bType := reflect.TypeOf(actual) - - if aType != bType { - return Fail(t, fmt.Sprintf("Types expected to match exactly\n\r\t%v != %v", aType, bType), msgAndArgs...) - } - - return Equal(t, expected, actual, msgAndArgs...) - -} - -// NotNil asserts that the specified object is not nil. -// -// assert.NotNil(t, err) -// -// Returns whether the assertion was successful (true) or not (false). -func NotNil(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { - if !isNil(object) { - return true - } - return Fail(t, "Expected value not to be nil.", msgAndArgs...) -} - -// isNil checks if a specified object is nil or not, without Failing. -func isNil(object interface{}) bool { - if object == nil { - return true - } - - value := reflect.ValueOf(object) - kind := value.Kind() - if kind >= reflect.Chan && kind <= reflect.Slice && value.IsNil() { - return true - } - - return false -} - -// Nil asserts that the specified object is nil. -// -// assert.Nil(t, err) -// -// Returns whether the assertion was successful (true) or not (false). -func Nil(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { - if isNil(object) { - return true - } - return Fail(t, fmt.Sprintf("Expected nil, but got: %#v", object), msgAndArgs...) -} - -var numericZeros = []interface{}{ - int(0), - int8(0), - int16(0), - int32(0), - int64(0), - uint(0), - uint8(0), - uint16(0), - uint32(0), - uint64(0), - float32(0), - float64(0), -} - -// isEmpty gets whether the specified object is considered empty or not. -func isEmpty(object interface{}) bool { - - if object == nil { - return true - } else if object == "" { - return true - } else if object == false { - return true - } - - for _, v := range numericZeros { - if object == v { - return true - } - } - - objValue := reflect.ValueOf(object) - - switch objValue.Kind() { - case reflect.Map: - fallthrough - case reflect.Slice, reflect.Chan: - { - return (objValue.Len() == 0) - } - case reflect.Struct: - switch object.(type) { - case time.Time: - return object.(time.Time).IsZero() - } - case reflect.Ptr: - { - if objValue.IsNil() { - return true - } - switch object.(type) { - case *time.Time: - return object.(*time.Time).IsZero() - default: - return false - } - } - } - return false -} - -// Empty asserts that the specified object is empty. I.e. nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// assert.Empty(t, obj) -// -// Returns whether the assertion was successful (true) or not (false). -func Empty(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { - - pass := isEmpty(object) - if !pass { - Fail(t, fmt.Sprintf("Should be empty, but was %v", object), msgAndArgs...) - } - - return pass - -} - -// NotEmpty asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either -// a slice or a channel with len == 0. -// -// if assert.NotEmpty(t, obj) { -// assert.Equal(t, "two", obj[1]) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func NotEmpty(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { - - pass := !isEmpty(object) - if !pass { - Fail(t, fmt.Sprintf("Should NOT be empty, but was %v", object), msgAndArgs...) - } - - return pass - -} - -// getLen try to get length of object. -// return (false, 0) if impossible. -func getLen(x interface{}) (ok bool, length int) { - v := reflect.ValueOf(x) - defer func() { - if e := recover(); e != nil { - ok = false - } - }() - return true, v.Len() -} - -// Len asserts that the specified object has specific length. -// Len also fails if the object has a type that len() not accept. -// -// assert.Len(t, mySlice, 3) -// -// Returns whether the assertion was successful (true) or not (false). -func Len(t TestingT, object interface{}, length int, msgAndArgs ...interface{}) bool { - ok, l := getLen(object) - if !ok { - return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", object), msgAndArgs...) - } - - if l != length { - return Fail(t, fmt.Sprintf("\"%s\" should have %d item(s), but has %d", object, length, l), msgAndArgs...) - } - return true -} - -// True asserts that the specified value is true. -// -// assert.True(t, myBool) -// -// Returns whether the assertion was successful (true) or not (false). -func True(t TestingT, value bool, msgAndArgs ...interface{}) bool { - - if value != true { - return Fail(t, "Should be true", msgAndArgs...) - } - - return true - -} - -// False asserts that the specified value is false. -// -// assert.False(t, myBool) -// -// Returns whether the assertion was successful (true) or not (false). -func False(t TestingT, value bool, msgAndArgs ...interface{}) bool { - - if value != false { - return Fail(t, "Should be false", msgAndArgs...) - } - - return true - -} - -// NotEqual asserts that the specified values are NOT equal. -// -// assert.NotEqual(t, obj1, obj2) -// -// Returns whether the assertion was successful (true) or not (false). -// -// Pointer variable equality is determined based on the equality of the -// referenced values (as opposed to the memory addresses). -func NotEqual(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { - if err := validateEqualArgs(expected, actual); err != nil { - return Fail(t, fmt.Sprintf("Invalid operation: %#v != %#v (%s)", - expected, actual, err), msgAndArgs...) - } - - if ObjectsAreEqual(expected, actual) { - return Fail(t, fmt.Sprintf("Should not be: %#v\n", actual), msgAndArgs...) - } - - return true - -} - -// containsElement try loop over the list check if the list includes the element. -// return (false, false) if impossible. -// return (true, false) if element was not found. -// return (true, true) if element was found. -func includeElement(list interface{}, element interface{}) (ok, found bool) { - - listValue := reflect.ValueOf(list) - elementValue := reflect.ValueOf(element) - defer func() { - if e := recover(); e != nil { - ok = false - found = false - } - }() - - if reflect.TypeOf(list).Kind() == reflect.String { - return true, strings.Contains(listValue.String(), elementValue.String()) - } - - if reflect.TypeOf(list).Kind() == reflect.Map { - mapKeys := listValue.MapKeys() - for i := 0; i < len(mapKeys); i++ { - if ObjectsAreEqual(mapKeys[i].Interface(), element) { - return true, true - } - } - return true, false - } - - for i := 0; i < listValue.Len(); i++ { - if ObjectsAreEqual(listValue.Index(i).Interface(), element) { - return true, true - } - } - return true, false - -} - -// Contains asserts that the specified string, list(array, slice...) or map contains the -// specified substring or element. -// -// assert.Contains(t, "Hello World", "World") -// assert.Contains(t, ["Hello", "World"], "World") -// assert.Contains(t, {"Hello": "World"}, "Hello") -// -// Returns whether the assertion was successful (true) or not (false). -func Contains(t TestingT, s, contains interface{}, msgAndArgs ...interface{}) bool { - - ok, found := includeElement(s, contains) - if !ok { - return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", s), msgAndArgs...) - } - if !found { - return Fail(t, fmt.Sprintf("\"%s\" does not contain \"%s\"", s, contains), msgAndArgs...) - } - - return true - -} - -// NotContains asserts that the specified string, list(array, slice...) or map does NOT contain the -// specified substring or element. -// -// assert.NotContains(t, "Hello World", "Earth") -// assert.NotContains(t, ["Hello", "World"], "Earth") -// assert.NotContains(t, {"Hello": "World"}, "Earth") -// -// Returns whether the assertion was successful (true) or not (false). -func NotContains(t TestingT, s, contains interface{}, msgAndArgs ...interface{}) bool { - - ok, found := includeElement(s, contains) - if !ok { - return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", s), msgAndArgs...) - } - if found { - return Fail(t, fmt.Sprintf("\"%s\" should not contain \"%s\"", s, contains), msgAndArgs...) - } - - return true - -} - -// Subset asserts that the specified list(array, slice...) contains all -// elements given in the specified subset(array, slice...). -// -// assert.Subset(t, [1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]") -// -// Returns whether the assertion was successful (true) or not (false). -func Subset(t TestingT, list, subset interface{}, msgAndArgs ...interface{}) (ok bool) { - if subset == nil { - return true // we consider nil to be equal to the nil set - } - - subsetValue := reflect.ValueOf(subset) - defer func() { - if e := recover(); e != nil { - ok = false - } - }() - - listKind := reflect.TypeOf(list).Kind() - subsetKind := reflect.TypeOf(subset).Kind() - - if listKind != reflect.Array && listKind != reflect.Slice { - return Fail(t, fmt.Sprintf("%q has an unsupported type %s", list, listKind), msgAndArgs...) - } - - if subsetKind != reflect.Array && subsetKind != reflect.Slice { - return Fail(t, fmt.Sprintf("%q has an unsupported type %s", subset, subsetKind), msgAndArgs...) - } - - for i := 0; i < subsetValue.Len(); i++ { - element := subsetValue.Index(i).Interface() - ok, found := includeElement(list, element) - if !ok { - return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", list), msgAndArgs...) - } - if !found { - return Fail(t, fmt.Sprintf("\"%s\" does not contain \"%s\"", list, element), msgAndArgs...) - } - } - - return true -} - -// NotSubset asserts that the specified list(array, slice...) contains not all -// elements given in the specified subset(array, slice...). -// -// assert.NotSubset(t, [1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]") -// -// Returns whether the assertion was successful (true) or not (false). -func NotSubset(t TestingT, list, subset interface{}, msgAndArgs ...interface{}) (ok bool) { - if subset == nil { - return false // we consider nil to be equal to the nil set - } - - subsetValue := reflect.ValueOf(subset) - defer func() { - if e := recover(); e != nil { - ok = false - } - }() - - listKind := reflect.TypeOf(list).Kind() - subsetKind := reflect.TypeOf(subset).Kind() - - if listKind != reflect.Array && listKind != reflect.Slice { - return Fail(t, fmt.Sprintf("%q has an unsupported type %s", list, listKind), msgAndArgs...) - } - - if subsetKind != reflect.Array && subsetKind != reflect.Slice { - return Fail(t, fmt.Sprintf("%q has an unsupported type %s", subset, subsetKind), msgAndArgs...) - } - - for i := 0; i < subsetValue.Len(); i++ { - element := subsetValue.Index(i).Interface() - ok, found := includeElement(list, element) - if !ok { - return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", list), msgAndArgs...) - } - if !found { - return true - } - } - - return Fail(t, fmt.Sprintf("%q is a subset of %q", subset, list), msgAndArgs...) -} - -// Condition uses a Comparison to assert a complex condition. -func Condition(t TestingT, comp Comparison, msgAndArgs ...interface{}) bool { - result := comp() - if !result { - Fail(t, "Condition failed!", msgAndArgs...) - } - return result -} - -// PanicTestFunc defines a func that should be passed to the assert.Panics and assert.NotPanics -// methods, and represents a simple func that takes no arguments, and returns nothing. -type PanicTestFunc func() - -// didPanic returns true if the function passed to it panics. Otherwise, it returns false. -func didPanic(f PanicTestFunc) (bool, interface{}) { - - didPanic := false - var message interface{} - func() { - - defer func() { - if message = recover(); message != nil { - didPanic = true - } - }() - - // call the target function - f() - - }() - - return didPanic, message - -} - -// Panics asserts that the code inside the specified PanicTestFunc panics. -// -// assert.Panics(t, func(){ GoCrazy() }) -// -// Returns whether the assertion was successful (true) or not (false). -func Panics(t TestingT, f PanicTestFunc, msgAndArgs ...interface{}) bool { - - if funcDidPanic, panicValue := didPanic(f); !funcDidPanic { - return Fail(t, fmt.Sprintf("func %#v should panic\n\r\tPanic value:\t%v", f, panicValue), msgAndArgs...) - } - - return true -} - -// PanicsWithValue asserts that the code inside the specified PanicTestFunc panics, and that -// the recovered panic value equals the expected panic value. -// -// assert.PanicsWithValue(t, "crazy error", func(){ GoCrazy() }) -// -// Returns whether the assertion was successful (true) or not (false). -func PanicsWithValue(t TestingT, expected interface{}, f PanicTestFunc, msgAndArgs ...interface{}) bool { - - funcDidPanic, panicValue := didPanic(f) - if !funcDidPanic { - return Fail(t, fmt.Sprintf("func %#v should panic\n\r\tPanic value:\t%v", f, panicValue), msgAndArgs...) - } - if panicValue != expected { - return Fail(t, fmt.Sprintf("func %#v should panic with value:\t%v\n\r\tPanic value:\t%v", f, expected, panicValue), msgAndArgs...) - } - - return true -} - -// NotPanics asserts that the code inside the specified PanicTestFunc does NOT panic. -// -// assert.NotPanics(t, func(){ RemainCalm() }) -// -// Returns whether the assertion was successful (true) or not (false). -func NotPanics(t TestingT, f PanicTestFunc, msgAndArgs ...interface{}) bool { - - if funcDidPanic, panicValue := didPanic(f); funcDidPanic { - return Fail(t, fmt.Sprintf("func %#v should not panic\n\r\tPanic value:\t%v", f, panicValue), msgAndArgs...) - } - - return true -} - -// WithinDuration asserts that the two times are within duration delta of each other. -// -// assert.WithinDuration(t, time.Now(), time.Now(), 10*time.Second) -// -// Returns whether the assertion was successful (true) or not (false). -func WithinDuration(t TestingT, expected, actual time.Time, delta time.Duration, msgAndArgs ...interface{}) bool { - - dt := expected.Sub(actual) - if dt < -delta || dt > delta { - return Fail(t, fmt.Sprintf("Max difference between %v and %v allowed is %v, but difference was %v", expected, actual, delta, dt), msgAndArgs...) - } - - return true -} - -func toFloat(x interface{}) (float64, bool) { - var xf float64 - xok := true - - switch xn := x.(type) { - case uint8: - xf = float64(xn) - case uint16: - xf = float64(xn) - case uint32: - xf = float64(xn) - case uint64: - xf = float64(xn) - case int: - xf = float64(xn) - case int8: - xf = float64(xn) - case int16: - xf = float64(xn) - case int32: - xf = float64(xn) - case int64: - xf = float64(xn) - case float32: - xf = float64(xn) - case float64: - xf = float64(xn) - default: - xok = false - } - - return xf, xok -} - -// InDelta asserts that the two numerals are within delta of each other. -// -// assert.InDelta(t, math.Pi, (22 / 7.0), 0.01) -// -// Returns whether the assertion was successful (true) or not (false). -func InDelta(t TestingT, expected, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { - - af, aok := toFloat(expected) - bf, bok := toFloat(actual) - - if !aok || !bok { - return Fail(t, fmt.Sprintf("Parameters must be numerical"), msgAndArgs...) - } - - if math.IsNaN(af) { - return Fail(t, fmt.Sprintf("Actual must not be NaN"), msgAndArgs...) - } - - if math.IsNaN(bf) { - return Fail(t, fmt.Sprintf("Expected %v with delta %v, but was NaN", expected, delta), msgAndArgs...) - } - - dt := af - bf - if dt < -delta || dt > delta { - return Fail(t, fmt.Sprintf("Max difference between %v and %v allowed is %v, but difference was %v", expected, actual, delta, dt), msgAndArgs...) - } - - return true -} - -// InDeltaSlice is the same as InDelta, except it compares two slices. -func InDeltaSlice(t TestingT, expected, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { - if expected == nil || actual == nil || - reflect.TypeOf(actual).Kind() != reflect.Slice || - reflect.TypeOf(expected).Kind() != reflect.Slice { - return Fail(t, fmt.Sprintf("Parameters must be slice"), msgAndArgs...) - } - - actualSlice := reflect.ValueOf(actual) - expectedSlice := reflect.ValueOf(expected) - - for i := 0; i < actualSlice.Len(); i++ { - result := InDelta(t, actualSlice.Index(i).Interface(), expectedSlice.Index(i).Interface(), delta, msgAndArgs...) - if !result { - return result - } - } - - return true -} - -func calcRelativeError(expected, actual interface{}) (float64, error) { - af, aok := toFloat(expected) - if !aok { - return 0, fmt.Errorf("expected value %q cannot be converted to float", expected) - } - if af == 0 { - return 0, fmt.Errorf("expected value must have a value other than zero to calculate the relative error") - } - bf, bok := toFloat(actual) - if !bok { - return 0, fmt.Errorf("expected value %q cannot be converted to float", actual) - } - - return math.Abs(af-bf) / math.Abs(af), nil -} - -// InEpsilon asserts that expected and actual have a relative error less than epsilon -// -// Returns whether the assertion was successful (true) or not (false). -func InEpsilon(t TestingT, expected, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { - actualEpsilon, err := calcRelativeError(expected, actual) - if err != nil { - return Fail(t, err.Error(), msgAndArgs...) - } - if actualEpsilon > epsilon { - return Fail(t, fmt.Sprintf("Relative error is too high: %#v (expected)\n"+ - " < %#v (actual)", actualEpsilon, epsilon), msgAndArgs...) - } - - return true -} - -// InEpsilonSlice is the same as InEpsilon, except it compares each value from two slices. -func InEpsilonSlice(t TestingT, expected, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { - if expected == nil || actual == nil || - reflect.TypeOf(actual).Kind() != reflect.Slice || - reflect.TypeOf(expected).Kind() != reflect.Slice { - return Fail(t, fmt.Sprintf("Parameters must be slice"), msgAndArgs...) - } - - actualSlice := reflect.ValueOf(actual) - expectedSlice := reflect.ValueOf(expected) - - for i := 0; i < actualSlice.Len(); i++ { - result := InEpsilon(t, actualSlice.Index(i).Interface(), expectedSlice.Index(i).Interface(), epsilon) - if !result { - return result - } - } - - return true -} - -/* - Errors -*/ - -// NoError asserts that a function returned no error (i.e. `nil`). -// -// actualObj, err := SomeFunction() -// if assert.NoError(t, err) { -// assert.Equal(t, expectedObj, actualObj) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func NoError(t TestingT, err error, msgAndArgs ...interface{}) bool { - if err != nil { - return Fail(t, fmt.Sprintf("Received unexpected error:\n%+v", err), msgAndArgs...) - } - - return true -} - -// Error asserts that a function returned an error (i.e. not `nil`). -// -// actualObj, err := SomeFunction() -// if assert.Error(t, err) { -// assert.Equal(t, expectedError, err) -// } -// -// Returns whether the assertion was successful (true) or not (false). -func Error(t TestingT, err error, msgAndArgs ...interface{}) bool { - - if err == nil { - return Fail(t, "An error is expected but got nil.", msgAndArgs...) - } - - return true -} - -// EqualError asserts that a function returned an error (i.e. not `nil`) -// and that it is equal to the provided error. -// -// actualObj, err := SomeFunction() -// assert.EqualError(t, err, expectedErrorString) -// -// Returns whether the assertion was successful (true) or not (false). -func EqualError(t TestingT, theError error, errString string, msgAndArgs ...interface{}) bool { - if !Error(t, theError, msgAndArgs...) { - return false - } - expected := errString - actual := theError.Error() - // don't need to use deep equals here, we know they are both strings - if expected != actual { - return Fail(t, fmt.Sprintf("Error message not equal:\n"+ - "expected: %q\n"+ - "actual: %q", expected, actual), msgAndArgs...) - } - return true -} - -// matchRegexp return true if a specified regexp matches a string. -func matchRegexp(rx interface{}, str interface{}) bool { - - var r *regexp.Regexp - if rr, ok := rx.(*regexp.Regexp); ok { - r = rr - } else { - r = regexp.MustCompile(fmt.Sprint(rx)) - } - - return (r.FindStringIndex(fmt.Sprint(str)) != nil) - -} - -// Regexp asserts that a specified regexp matches a string. -// -// assert.Regexp(t, regexp.MustCompile("start"), "it's starting") -// assert.Regexp(t, "start...$", "it's not starting") -// -// Returns whether the assertion was successful (true) or not (false). -func Regexp(t TestingT, rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { - - match := matchRegexp(rx, str) - - if !match { - Fail(t, fmt.Sprintf("Expect \"%v\" to match \"%v\"", str, rx), msgAndArgs...) - } - - return match -} - -// NotRegexp asserts that a specified regexp does not match a string. -// -// assert.NotRegexp(t, regexp.MustCompile("starts"), "it's starting") -// assert.NotRegexp(t, "^start", "it's not starting") -// -// Returns whether the assertion was successful (true) or not (false). -func NotRegexp(t TestingT, rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { - match := matchRegexp(rx, str) - - if match { - Fail(t, fmt.Sprintf("Expect \"%v\" to NOT match \"%v\"", str, rx), msgAndArgs...) - } - - return !match - -} - -// Zero asserts that i is the zero value for its type and returns the truth. -func Zero(t TestingT, i interface{}, msgAndArgs ...interface{}) bool { - if i != nil && !reflect.DeepEqual(i, reflect.Zero(reflect.TypeOf(i)).Interface()) { - return Fail(t, fmt.Sprintf("Should be zero, but was %v", i), msgAndArgs...) - } - return true -} - -// NotZero asserts that i is not the zero value for its type and returns the truth. -func NotZero(t TestingT, i interface{}, msgAndArgs ...interface{}) bool { - if i == nil || reflect.DeepEqual(i, reflect.Zero(reflect.TypeOf(i)).Interface()) { - return Fail(t, fmt.Sprintf("Should not be zero, but was %v", i), msgAndArgs...) - } - return true -} - -// JSONEq asserts that two JSON strings are equivalent. -// -// assert.JSONEq(t, `{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`) -// -// Returns whether the assertion was successful (true) or not (false). -func JSONEq(t TestingT, expected string, actual string, msgAndArgs ...interface{}) bool { - var expectedJSONAsInterface, actualJSONAsInterface interface{} - - if err := json.Unmarshal([]byte(expected), &expectedJSONAsInterface); err != nil { - return Fail(t, fmt.Sprintf("Expected value ('%s') is not valid json.\nJSON parsing error: '%s'", expected, err.Error()), msgAndArgs...) - } - - if err := json.Unmarshal([]byte(actual), &actualJSONAsInterface); err != nil { - return Fail(t, fmt.Sprintf("Input ('%s') needs to be valid json.\nJSON parsing error: '%s'", actual, err.Error()), msgAndArgs...) - } - - return Equal(t, expectedJSONAsInterface, actualJSONAsInterface, msgAndArgs...) -} - -func typeAndKind(v interface{}) (reflect.Type, reflect.Kind) { - t := reflect.TypeOf(v) - k := t.Kind() - - if k == reflect.Ptr { - t = t.Elem() - k = t.Kind() - } - return t, k -} - -// diff returns a diff of both values as long as both are of the same type and -// are a struct, map, slice or array. Otherwise it returns an empty string. -func diff(expected interface{}, actual interface{}) string { - if expected == nil || actual == nil { - return "" - } - - et, ek := typeAndKind(expected) - at, _ := typeAndKind(actual) - - if et != at { - return "" - } - - if ek != reflect.Struct && ek != reflect.Map && ek != reflect.Slice && ek != reflect.Array { - return "" - } - - e := spewConfig.Sdump(expected) - a := spewConfig.Sdump(actual) - - diff, _ := difflib.GetUnifiedDiffString(difflib.UnifiedDiff{ - A: difflib.SplitLines(e), - B: difflib.SplitLines(a), - FromFile: "Expected", - FromDate: "", - ToFile: "Actual", - ToDate: "", - Context: 1, - }) - - return "\n\nDiff:\n" + diff -} - -// validateEqualArgs checks whether provided arguments can be safely used in the -// Equal/NotEqual functions. -func validateEqualArgs(expected, actual interface{}) error { - if isFunction(expected) || isFunction(actual) { - return errors.New("cannot take func type as argument") - } - return nil -} - -func isFunction(arg interface{}) bool { - if arg == nil { - return false - } - return reflect.TypeOf(arg).Kind() == reflect.Func -} - -var spewConfig = spew.ConfigState{ - Indent: " ", - DisablePointerAddresses: true, - DisableCapacities: true, - SortKeys: true, -} diff --git a/vendor/github.com/stretchr/testify/assert/doc.go b/vendor/github.com/stretchr/testify/assert/doc.go deleted file mode 100644 index c9dccc4..0000000 --- a/vendor/github.com/stretchr/testify/assert/doc.go +++ /dev/null @@ -1,45 +0,0 @@ -// Package assert provides a set of comprehensive testing tools for use with the normal Go testing system. -// -// Example Usage -// -// The following is a complete example using assert in a standard test function: -// import ( -// "testing" -// "github.com/stretchr/testify/assert" -// ) -// -// func TestSomething(t *testing.T) { -// -// var a string = "Hello" -// var b string = "Hello" -// -// assert.Equal(t, a, b, "The two words should be the same.") -// -// } -// -// if you assert many times, use the format below: -// -// import ( -// "testing" -// "github.com/stretchr/testify/assert" -// ) -// -// func TestSomething(t *testing.T) { -// assert := assert.New(t) -// -// var a string = "Hello" -// var b string = "Hello" -// -// assert.Equal(a, b, "The two words should be the same.") -// } -// -// Assertions -// -// Assertions allow you to easily write test code, and are global funcs in the `assert` package. -// All assertion functions take, as the first argument, the `*testing.T` object provided by the -// testing framework. This allows the assertion funcs to write the failings and other details to -// the correct place. -// -// Every assertion function also takes an optional string message as the final argument, -// allowing custom error messages to be appended to the message the assertion method outputs. -package assert diff --git a/vendor/github.com/stretchr/testify/assert/errors.go b/vendor/github.com/stretchr/testify/assert/errors.go deleted file mode 100644 index ac9dc9d..0000000 --- a/vendor/github.com/stretchr/testify/assert/errors.go +++ /dev/null @@ -1,10 +0,0 @@ -package assert - -import ( - "errors" -) - -// AnError is an error instance useful for testing. If the code does not care -// about error specifics, and only needs to return the error for example, this -// error should be used to make the test code more readable. -var AnError = errors.New("assert.AnError general error for testing") diff --git a/vendor/github.com/stretchr/testify/assert/forward_assertions.go b/vendor/github.com/stretchr/testify/assert/forward_assertions.go deleted file mode 100644 index 9ad5685..0000000 --- a/vendor/github.com/stretchr/testify/assert/forward_assertions.go +++ /dev/null @@ -1,16 +0,0 @@ -package assert - -// Assertions provides assertion methods around the -// TestingT interface. -type Assertions struct { - t TestingT -} - -// New makes a new Assertions object for the specified TestingT. -func New(t TestingT) *Assertions { - return &Assertions{ - t: t, - } -} - -//go:generate go run ../_codegen/main.go -output-package=assert -template=assertion_forward.go.tmpl -include-format-funcs diff --git a/vendor/github.com/stretchr/testify/assert/http_assertions.go b/vendor/github.com/stretchr/testify/assert/http_assertions.go deleted file mode 100644 index ba811c0..0000000 --- a/vendor/github.com/stretchr/testify/assert/http_assertions.go +++ /dev/null @@ -1,127 +0,0 @@ -package assert - -import ( - "fmt" - "net/http" - "net/http/httptest" - "net/url" - "strings" -) - -// httpCode is a helper that returns HTTP code of the response. It returns -1 and -// an error if building a new request fails. -func httpCode(handler http.HandlerFunc, method, url string, values url.Values) (int, error) { - w := httptest.NewRecorder() - req, err := http.NewRequest(method, url+"?"+values.Encode(), nil) - if err != nil { - return -1, err - } - handler(w, req) - return w.Code, nil -} - -// HTTPSuccess asserts that a specified handler returns a success status code. -// -// assert.HTTPSuccess(t, myHandler, "POST", "http://www.google.com", nil) -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPSuccess(t TestingT, handler http.HandlerFunc, method, url string, values url.Values) bool { - code, err := httpCode(handler, method, url, values) - if err != nil { - Fail(t, fmt.Sprintf("Failed to build test request, got error: %s", err)) - return false - } - - isSuccessCode := code >= http.StatusOK && code <= http.StatusPartialContent - if !isSuccessCode { - Fail(t, fmt.Sprintf("Expected HTTP success status code for %q but received %d", url+"?"+values.Encode(), code)) - } - - return isSuccessCode -} - -// HTTPRedirect asserts that a specified handler returns a redirect status code. -// -// assert.HTTPRedirect(t, myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPRedirect(t TestingT, handler http.HandlerFunc, method, url string, values url.Values) bool { - code, err := httpCode(handler, method, url, values) - if err != nil { - Fail(t, fmt.Sprintf("Failed to build test request, got error: %s", err)) - return false - } - - isRedirectCode := code >= http.StatusMultipleChoices && code <= http.StatusTemporaryRedirect - if !isRedirectCode { - Fail(t, fmt.Sprintf("Expected HTTP redirect status code for %q but received %d", url+"?"+values.Encode(), code)) - } - - return isRedirectCode -} - -// HTTPError asserts that a specified handler returns an error status code. -// -// assert.HTTPError(t, myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPError(t TestingT, handler http.HandlerFunc, method, url string, values url.Values) bool { - code, err := httpCode(handler, method, url, values) - if err != nil { - Fail(t, fmt.Sprintf("Failed to build test request, got error: %s", err)) - return false - } - - isErrorCode := code >= http.StatusBadRequest - if !isErrorCode { - Fail(t, fmt.Sprintf("Expected HTTP error status code for %q but received %d", url+"?"+values.Encode(), code)) - } - - return isErrorCode -} - -// HTTPBody is a helper that returns HTTP body of the response. It returns -// empty string if building a new request fails. -func HTTPBody(handler http.HandlerFunc, method, url string, values url.Values) string { - w := httptest.NewRecorder() - req, err := http.NewRequest(method, url+"?"+values.Encode(), nil) - if err != nil { - return "" - } - handler(w, req) - return w.Body.String() -} - -// HTTPBodyContains asserts that a specified handler returns a -// body that contains a string. -// -// assert.HTTPBodyContains(t, myHandler, "www.google.com", nil, "I'm Feeling Lucky") -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPBodyContains(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, str interface{}) bool { - body := HTTPBody(handler, method, url, values) - - contains := strings.Contains(body, fmt.Sprint(str)) - if !contains { - Fail(t, fmt.Sprintf("Expected response body for \"%s\" to contain \"%s\" but found \"%s\"", url+"?"+values.Encode(), str, body)) - } - - return contains -} - -// HTTPBodyNotContains asserts that a specified handler returns a -// body that does not contain a string. -// -// assert.HTTPBodyNotContains(t, myHandler, "www.google.com", nil, "I'm Feeling Lucky") -// -// Returns whether the assertion was successful (true) or not (false). -func HTTPBodyNotContains(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, str interface{}) bool { - body := HTTPBody(handler, method, url, values) - - contains := strings.Contains(body, fmt.Sprint(str)) - if contains { - Fail(t, fmt.Sprintf("Expected response body for \"%s\" to NOT contain \"%s\" but found \"%s\"", url+"?"+values.Encode(), str, body)) - } - - return !contains -} diff --git a/vendor/golang.org/x/crypto/blowfish/cipher.go b/vendor/golang.org/x/crypto/blowfish/cipher.go index a73954f..2641dad 100644 --- a/vendor/golang.org/x/crypto/blowfish/cipher.go +++ b/vendor/golang.org/x/crypto/blowfish/cipher.go @@ -6,7 +6,7 @@ package blowfish // import "golang.org/x/crypto/blowfish" // The code is a port of Bruce Schneier's C implementation. -// See http://www.schneier.com/blowfish.html. +// See https://www.schneier.com/blowfish.html. import "strconv" diff --git a/vendor/golang.org/x/crypto/blowfish/const.go b/vendor/golang.org/x/crypto/blowfish/const.go index 8c5ee4c..d040775 100644 --- a/vendor/golang.org/x/crypto/blowfish/const.go +++ b/vendor/golang.org/x/crypto/blowfish/const.go @@ -4,7 +4,7 @@ // The startup permutation array and substitution boxes. // They are the hexadecimal digits of PI; see: -// http://www.schneier.com/code/constants.txt. +// https://www.schneier.com/code/constants.txt. package blowfish diff --git a/vendor/golang.org/x/crypto/curve25519/const_amd64.h b/vendor/golang.org/x/crypto/curve25519/const_amd64.h index 80ad222..b3f7416 100644 --- a/vendor/golang.org/x/crypto/curve25519/const_amd64.h +++ b/vendor/golang.org/x/crypto/curve25519/const_amd64.h @@ -3,6 +3,6 @@ // license that can be found in the LICENSE file. // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html #define REDMASK51 0x0007FFFFFFFFFFFF diff --git a/vendor/golang.org/x/crypto/curve25519/const_amd64.s b/vendor/golang.org/x/crypto/curve25519/const_amd64.s index 0ad5398..ee7b4bd 100644 --- a/vendor/golang.org/x/crypto/curve25519/const_amd64.s +++ b/vendor/golang.org/x/crypto/curve25519/const_amd64.s @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html // +build amd64,!gccgo,!appengine diff --git a/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s b/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s index 45484d1..cd793a5 100644 --- a/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s +++ b/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s @@ -2,87 +2,64 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html - // +build amd64,!gccgo,!appengine -// func cswap(inout *[5]uint64, v uint64) +// func cswap(inout *[4][5]uint64, v uint64) TEXT ·cswap(SB),7,$0 MOVQ inout+0(FP),DI MOVQ v+8(FP),SI - CMPQ SI,$1 - MOVQ 0(DI),SI - MOVQ 80(DI),DX - MOVQ 8(DI),CX - MOVQ 88(DI),R8 - MOVQ SI,R9 - CMOVQEQ DX,SI - CMOVQEQ R9,DX - MOVQ CX,R9 - CMOVQEQ R8,CX - CMOVQEQ R9,R8 - MOVQ SI,0(DI) - MOVQ DX,80(DI) - MOVQ CX,8(DI) - MOVQ R8,88(DI) - MOVQ 16(DI),SI - MOVQ 96(DI),DX - MOVQ 24(DI),CX - MOVQ 104(DI),R8 - MOVQ SI,R9 - CMOVQEQ DX,SI - CMOVQEQ R9,DX - MOVQ CX,R9 - CMOVQEQ R8,CX - CMOVQEQ R9,R8 - MOVQ SI,16(DI) - MOVQ DX,96(DI) - MOVQ CX,24(DI) - MOVQ R8,104(DI) - MOVQ 32(DI),SI - MOVQ 112(DI),DX - MOVQ 40(DI),CX - MOVQ 120(DI),R8 - MOVQ SI,R9 - CMOVQEQ DX,SI - CMOVQEQ R9,DX - MOVQ CX,R9 - CMOVQEQ R8,CX - CMOVQEQ R9,R8 - MOVQ SI,32(DI) - MOVQ DX,112(DI) - MOVQ CX,40(DI) - MOVQ R8,120(DI) - MOVQ 48(DI),SI - MOVQ 128(DI),DX - MOVQ 56(DI),CX - MOVQ 136(DI),R8 - MOVQ SI,R9 - CMOVQEQ DX,SI - CMOVQEQ R9,DX - MOVQ CX,R9 - CMOVQEQ R8,CX - CMOVQEQ R9,R8 - MOVQ SI,48(DI) - MOVQ DX,128(DI) - MOVQ CX,56(DI) - MOVQ R8,136(DI) - MOVQ 64(DI),SI - MOVQ 144(DI),DX - MOVQ 72(DI),CX - MOVQ 152(DI),R8 - MOVQ SI,R9 - CMOVQEQ DX,SI - CMOVQEQ R9,DX - MOVQ CX,R9 - CMOVQEQ R8,CX - CMOVQEQ R9,R8 - MOVQ SI,64(DI) - MOVQ DX,144(DI) - MOVQ CX,72(DI) - MOVQ R8,152(DI) - MOVQ DI,AX - MOVQ SI,DX + SUBQ $1, SI + NOTQ SI + MOVQ SI, X15 + PSHUFD $0x44, X15, X15 + + MOVOU 0(DI), X0 + MOVOU 16(DI), X2 + MOVOU 32(DI), X4 + MOVOU 48(DI), X6 + MOVOU 64(DI), X8 + MOVOU 80(DI), X1 + MOVOU 96(DI), X3 + MOVOU 112(DI), X5 + MOVOU 128(DI), X7 + MOVOU 144(DI), X9 + + MOVO X1, X10 + MOVO X3, X11 + MOVO X5, X12 + MOVO X7, X13 + MOVO X9, X14 + + PXOR X0, X10 + PXOR X2, X11 + PXOR X4, X12 + PXOR X6, X13 + PXOR X8, X14 + PAND X15, X10 + PAND X15, X11 + PAND X15, X12 + PAND X15, X13 + PAND X15, X14 + PXOR X10, X0 + PXOR X10, X1 + PXOR X11, X2 + PXOR X11, X3 + PXOR X12, X4 + PXOR X12, X5 + PXOR X13, X6 + PXOR X13, X7 + PXOR X14, X8 + PXOR X14, X9 + + MOVOU X0, 0(DI) + MOVOU X2, 16(DI) + MOVOU X4, 32(DI) + MOVOU X6, 48(DI) + MOVOU X8, 64(DI) + MOVOU X1, 80(DI) + MOVOU X3, 96(DI) + MOVOU X5, 112(DI) + MOVOU X7, 128(DI) + MOVOU X9, 144(DI) RET diff --git a/vendor/golang.org/x/crypto/curve25519/curve25519.go b/vendor/golang.org/x/crypto/curve25519/curve25519.go index 6918c47..2d14c2a 100644 --- a/vendor/golang.org/x/crypto/curve25519/curve25519.go +++ b/vendor/golang.org/x/crypto/curve25519/curve25519.go @@ -8,6 +8,10 @@ package curve25519 +import ( + "encoding/binary" +) + // This code is a port of the public domain, "ref10" implementation of // curve25519 from SUPERCOP 20130419 by D. J. Bernstein. @@ -50,17 +54,11 @@ func feCopy(dst, src *fieldElement) { // // Preconditions: b in {0,1}. func feCSwap(f, g *fieldElement, b int32) { - var x fieldElement b = -b - for i := range x { - x[i] = b & (f[i] ^ g[i]) - } - for i := range f { - f[i] ^= x[i] - } - for i := range g { - g[i] ^= x[i] + t := b & (f[i] ^ g[i]) + f[i] ^= t + g[i] ^= t } } @@ -75,12 +73,7 @@ func load3(in []byte) int64 { // load4 reads a 32-bit, little-endian value from in. func load4(in []byte) int64 { - var r int64 - r = int64(in[0]) - r |= int64(in[1]) << 8 - r |= int64(in[2]) << 16 - r |= int64(in[3]) << 24 - return r + return int64(binary.LittleEndian.Uint32(in)) } func feFromBytes(dst *fieldElement, src *[32]byte) { diff --git a/vendor/golang.org/x/crypto/curve25519/doc.go b/vendor/golang.org/x/crypto/curve25519/doc.go index ebeea3c..da9b10d 100644 --- a/vendor/golang.org/x/crypto/curve25519/doc.go +++ b/vendor/golang.org/x/crypto/curve25519/doc.go @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // Package curve25519 provides an implementation of scalar multiplication on -// the elliptic curve known as curve25519. See http://cr.yp.to/ecdh.html +// the elliptic curve known as curve25519. See https://cr.yp.to/ecdh.html package curve25519 // import "golang.org/x/crypto/curve25519" // basePoint is the x coordinate of the generator of the curve. diff --git a/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s b/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s index 536479b..3908161 100644 --- a/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s +++ b/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html // +build amd64,!gccgo,!appengine diff --git a/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s b/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s index 7074e5c..9e9040b 100644 --- a/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s +++ b/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html // +build amd64,!gccgo,!appengine diff --git a/vendor/golang.org/x/crypto/curve25519/mul_amd64.s b/vendor/golang.org/x/crypto/curve25519/mul_amd64.s index b162e65..5ce80a2 100644 --- a/vendor/golang.org/x/crypto/curve25519/mul_amd64.s +++ b/vendor/golang.org/x/crypto/curve25519/mul_amd64.s @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html // +build amd64,!gccgo,!appengine diff --git a/vendor/golang.org/x/crypto/curve25519/square_amd64.s b/vendor/golang.org/x/crypto/curve25519/square_amd64.s index 4e864a8..12f7373 100644 --- a/vendor/golang.org/x/crypto/curve25519/square_amd64.s +++ b/vendor/golang.org/x/crypto/curve25519/square_amd64.s @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html // +build amd64,!gccgo,!appengine diff --git a/vendor/golang.org/x/crypto/ed25519/ed25519.go b/vendor/golang.org/x/crypto/ed25519/ed25519.go index f1d9567..9b07acc 100644 --- a/vendor/golang.org/x/crypto/ed25519/ed25519.go +++ b/vendor/golang.org/x/crypto/ed25519/ed25519.go @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // Package ed25519 implements the Ed25519 signature algorithm. See -// http://ed25519.cr.yp.to/. +// https://ed25519.cr.yp.to/. // // These functions are also compatible with the “Ed25519” function defined in // https://tools.ietf.org/html/draft-irtf-cfrg-eddsa-05. diff --git a/vendor/golang.org/x/crypto/salsa20/salsa/salsa2020_amd64.s b/vendor/golang.org/x/crypto/salsa20/salsa/salsa2020_amd64.s index 083fe38..22afbdc 100644 --- a/vendor/golang.org/x/crypto/salsa20/salsa/salsa2020_amd64.s +++ b/vendor/golang.org/x/crypto/salsa20/salsa/salsa2020_amd64.s @@ -5,7 +5,7 @@ // +build amd64,!appengine,!gccgo // This code was translated into a form compatible with 6a from the public -// domain sources in SUPERCOP: http://bench.cr.yp.to/supercop.html +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html // func salsa2020XORKeyStream(out, in *byte, n uint64, nonce, key *byte) // This needs up to 64 bytes at 360(SP); hence the non-obvious frame size. diff --git a/vendor/golang.org/x/crypto/salsa20/salsa20.go b/vendor/golang.org/x/crypto/salsa20/salsa20.go index fde9846..a8ddd76 100644 --- a/vendor/golang.org/x/crypto/salsa20/salsa20.go +++ b/vendor/golang.org/x/crypto/salsa20/salsa20.go @@ -3,20 +3,20 @@ // license that can be found in the LICENSE file. /* -Package salsa20 implements the Salsa20 stream cipher as specified in http://cr.yp.to/snuffle/spec.pdf. +Package salsa20 implements the Salsa20 stream cipher as specified in https://cr.yp.to/snuffle/spec.pdf. Salsa20 differs from many other stream ciphers in that it is message orientated rather than byte orientated. Keystream blocks are not preserved between calls, therefore each side must encrypt/decrypt data with the same segmentation. Another aspect of this difference is that part of the counter is exposed as -an nonce in each call. Encrypting two different messages with the same (key, +a nonce in each call. Encrypting two different messages with the same (key, nonce) pair leads to trivial plaintext recovery. This is analogous to encrypting two different messages with the same key with a traditional stream cipher. This package also implements XSalsa20: a version of Salsa20 with a 24-byte -nonce as specified in http://cr.yp.to/snuffle/xsalsa-20081128.pdf. Simply +nonce as specified in https://cr.yp.to/snuffle/xsalsa-20081128.pdf. Simply passing a 24-byte slice as the nonce triggers XSalsa20. */ package salsa20 // import "golang.org/x/crypto/salsa20" diff --git a/vendor/golang.org/x/crypto/ssh/certs.go b/vendor/golang.org/x/crypto/ssh/certs.go index 6331c94..b1f0220 100644 --- a/vendor/golang.org/x/crypto/ssh/certs.go +++ b/vendor/golang.org/x/crypto/ssh/certs.go @@ -251,10 +251,18 @@ type CertChecker struct { // for user certificates. SupportedCriticalOptions []string - // IsAuthority should return true if the key is recognized as - // an authority. This allows for certificates to be signed by other - // certificates. - IsAuthority func(auth PublicKey) bool + // IsUserAuthority should return true if the key is recognized as an + // authority for the given user certificate. This allows for + // certificates to be signed by other certificates. This must be set + // if this CertChecker will be checking user certificates. + IsUserAuthority func(auth PublicKey) bool + + // IsHostAuthority should report whether the key is recognized as + // an authority for this host. This allows for certificates to be + // signed by other keys, and for those other keys to only be valid + // signers for particular hostnames. This must be set if this + // CertChecker will be checking host certificates. + IsHostAuthority func(auth PublicKey, address string) bool // Clock is used for verifying time stamps. If nil, time.Now // is used. @@ -268,7 +276,7 @@ type CertChecker struct { // HostKeyFallback is called when CertChecker.CheckHostKey encounters a // public key that is not a certificate. It must implement host key // validation or else, if nil, all such keys are rejected. - HostKeyFallback func(addr string, remote net.Addr, key PublicKey) error + HostKeyFallback HostKeyCallback // IsRevoked is called for each certificate so that revocation checking // can be implemented. It should return true if the given certificate @@ -290,8 +298,17 @@ func (c *CertChecker) CheckHostKey(addr string, remote net.Addr, key PublicKey) if cert.CertType != HostCert { return fmt.Errorf("ssh: certificate presented as a host key has type %d", cert.CertType) } + if !c.IsHostAuthority(cert.SignatureKey, addr) { + return fmt.Errorf("ssh: no authorities for hostname: %v", addr) + } - return c.CheckCert(addr, cert) + hostname, _, err := net.SplitHostPort(addr) + if err != nil { + return err + } + + // Pass hostname only as principal for host certificates (consistent with OpenSSH) + return c.CheckCert(hostname, cert) } // Authenticate checks a user certificate. Authenticate can be used as @@ -308,6 +325,9 @@ func (c *CertChecker) Authenticate(conn ConnMetadata, pubKey PublicKey) (*Permis if cert.CertType != UserCert { return nil, fmt.Errorf("ssh: cert has type %d", cert.CertType) } + if !c.IsUserAuthority(cert.SignatureKey) { + return nil, fmt.Errorf("ssh: certificate signed by unrecognized authority") + } if err := c.CheckCert(conn.User(), cert); err != nil { return nil, err @@ -356,10 +376,6 @@ func (c *CertChecker) CheckCert(principal string, cert *Certificate) error { } } - if !c.IsAuthority(cert.SignatureKey) { - return fmt.Errorf("ssh: certificate signed by unrecognized authority") - } - clock := c.Clock if clock == nil { clock = time.Now diff --git a/vendor/golang.org/x/crypto/ssh/cipher.go b/vendor/golang.org/x/crypto/ssh/cipher.go index 13484ab..22bb30c 100644 --- a/vendor/golang.org/x/crypto/ssh/cipher.go +++ b/vendor/golang.org/x/crypto/ssh/cipher.go @@ -392,7 +392,9 @@ func (c *gcmCipher) readPacket(seqNum uint32, r io.Reader) ([]byte, error) { c.incIV() padding := plain[0] - if padding < 4 || padding >= 20 { + if padding < 4 { + // padding is a byte, so it automatically satisfies + // the maximum size, which is 255. return nil, fmt.Errorf("ssh: illegal padding %d", padding) } diff --git a/vendor/golang.org/x/crypto/ssh/client.go b/vendor/golang.org/x/crypto/ssh/client.go index c97f297..a7e3263 100644 --- a/vendor/golang.org/x/crypto/ssh/client.go +++ b/vendor/golang.org/x/crypto/ssh/client.go @@ -5,6 +5,7 @@ package ssh import ( + "bytes" "errors" "fmt" "net" @@ -13,7 +14,7 @@ import ( ) // Client implements a traditional SSH client that supports shells, -// subprocesses, port forwarding and tunneled dialing. +// subprocesses, TCP port/streamlocal forwarding and tunneled dialing. type Client struct { Conn @@ -59,6 +60,7 @@ func NewClient(c Conn, chans <-chan NewChannel, reqs <-chan *Request) *Client { conn.forwards.closeAll() }() go conn.forwards.handleChannels(conn.HandleChannelOpen("forwarded-tcpip")) + go conn.forwards.handleChannels(conn.HandleChannelOpen("forwarded-streamlocal@openssh.com")) return conn } @@ -68,6 +70,11 @@ func NewClient(c Conn, chans <-chan NewChannel, reqs <-chan *Request) *Client { func NewClientConn(c net.Conn, addr string, config *ClientConfig) (Conn, <-chan NewChannel, <-chan *Request, error) { fullConf := *config fullConf.SetDefaults() + if fullConf.HostKeyCallback == nil { + c.Close() + return nil, nil, nil, errors.New("ssh: must specify HostKeyCallback") + } + conn := &connection{ sshConn: sshConn{conn: c}, } @@ -173,6 +180,13 @@ func Dial(network, addr string, config *ClientConfig) (*Client, error) { return NewClient(c, chans, reqs), nil } +// HostKeyCallback is the function type used for verifying server +// keys. A HostKeyCallback must return nil if the host key is OK, or +// an error to reject it. It receives the hostname as passed to Dial +// or NewClientConn. The remote address is the RemoteAddr of the +// net.Conn underlying the the SSH connection. +type HostKeyCallback func(hostname string, remote net.Addr, key PublicKey) error + // A ClientConfig structure is used to configure a Client. It must not be // modified after having been passed to an SSH function. type ClientConfig struct { @@ -188,10 +202,12 @@ type ClientConfig struct { // be used during authentication. Auth []AuthMethod - // HostKeyCallback, if not nil, is called during the cryptographic - // handshake to validate the server's host key. A nil HostKeyCallback - // implies that all host keys are accepted. - HostKeyCallback func(hostname string, remote net.Addr, key PublicKey) error + // HostKeyCallback is called during the cryptographic + // handshake to validate the server's host key. The client + // configuration must supply this callback for the connection + // to succeed. The functions InsecureIgnoreHostKey or + // FixedHostKey can be used for simplistic host key checks. + HostKeyCallback HostKeyCallback // ClientVersion contains the version identification string that will // be used for the connection. If empty, a reasonable default is used. @@ -209,3 +225,33 @@ type ClientConfig struct { // A Timeout of zero means no timeout. Timeout time.Duration } + +// InsecureIgnoreHostKey returns a function that can be used for +// ClientConfig.HostKeyCallback to accept any host key. It should +// not be used for production code. +func InsecureIgnoreHostKey() HostKeyCallback { + return func(hostname string, remote net.Addr, key PublicKey) error { + return nil + } +} + +type fixedHostKey struct { + key PublicKey +} + +func (f *fixedHostKey) check(hostname string, remote net.Addr, key PublicKey) error { + if f.key == nil { + return fmt.Errorf("ssh: required host key was nil") + } + if !bytes.Equal(key.Marshal(), f.key.Marshal()) { + return fmt.Errorf("ssh: host key mismatch") + } + return nil +} + +// FixedHostKey returns a function for use in +// ClientConfig.HostKeyCallback to accept only a specific host key. +func FixedHostKey(key PublicKey) HostKeyCallback { + hk := &fixedHostKey{key} + return hk.check +} diff --git a/vendor/golang.org/x/crypto/ssh/client_auth.go b/vendor/golang.org/x/crypto/ssh/client_auth.go index fd1ec5d..b882da0 100644 --- a/vendor/golang.org/x/crypto/ssh/client_auth.go +++ b/vendor/golang.org/x/crypto/ssh/client_auth.go @@ -179,31 +179,26 @@ func (cb publicKeyCallback) method() string { } func (cb publicKeyCallback) auth(session []byte, user string, c packetConn, rand io.Reader) (bool, []string, error) { - // Authentication is performed in two stages. The first stage sends an - // enquiry to test if each key is acceptable to the remote. The second - // stage attempts to authenticate with the valid keys obtained in the - // first stage. + // Authentication is performed by sending an enquiry to test if a key is + // acceptable to the remote. If the key is acceptable, the client will + // attempt to authenticate with the valid key. If not the client will repeat + // the process with the remaining keys. signers, err := cb() if err != nil { return false, nil, err } - var validKeys []Signer - for _, signer := range signers { - if ok, err := validateKey(signer.PublicKey(), user, c); ok { - validKeys = append(validKeys, signer) - } else { - if err != nil { - return false, nil, err - } - } - } - - // methods that may continue if this auth is not successful. var methods []string - for _, signer := range validKeys { - pub := signer.PublicKey() + for _, signer := range signers { + ok, err := validateKey(signer.PublicKey(), user, c) + if err != nil { + return false, nil, err + } + if !ok { + continue + } + pub := signer.PublicKey() pubKey := pub.Marshal() sign, err := signer.Sign(rand, buildDataSignedForAuth(session, userAuthRequestMsg{ User: user, @@ -236,13 +231,29 @@ func (cb publicKeyCallback) auth(session []byte, user string, c packetConn, rand if err != nil { return false, nil, err } - if success { + + // If authentication succeeds or the list of available methods does not + // contain the "publickey" method, do not attempt to authenticate with any + // other keys. According to RFC 4252 Section 7, the latter can occur when + // additional authentication methods are required. + if success || !containsMethod(methods, cb.method()) { return success, methods, err } } + return false, methods, nil } +func containsMethod(methods []string, method string) bool { + for _, m := range methods { + if m == method { + return true + } + } + + return false +} + // validateKey validates the key provided is acceptable to the server. func validateKey(key PublicKey, user string, c packetConn) (bool, error) { pubKey := key.Marshal() diff --git a/vendor/golang.org/x/crypto/ssh/common.go b/vendor/golang.org/x/crypto/ssh/common.go index 8656d0f..dc39e4d 100644 --- a/vendor/golang.org/x/crypto/ssh/common.go +++ b/vendor/golang.org/x/crypto/ssh/common.go @@ -9,6 +9,7 @@ import ( "crypto/rand" "fmt" "io" + "math" "sync" _ "crypto/sha1" @@ -40,7 +41,7 @@ var supportedKexAlgos = []string{ kexAlgoDH14SHA1, kexAlgoDH1SHA1, } -// supportedKexAlgos specifies the supported host-key algorithms (i.e. methods +// supportedHostKeyAlgos specifies the supported host-key algorithms (i.e. methods // of authenticating servers) in preference order. var supportedHostKeyAlgos = []string{ CertAlgoRSAv01, CertAlgoDSAv01, CertAlgoECDSA256v01, @@ -186,7 +187,7 @@ type Config struct { // The maximum number of bytes sent or received after which a // new key is negotiated. It must be at least 256. If - // unspecified, 1 gigabyte is used. + // unspecified, a size suitable for the chosen cipher is used. RekeyThreshold uint64 // The allowed key exchanges algorithms. If unspecified then a @@ -230,11 +231,12 @@ func (c *Config) SetDefaults() { } if c.RekeyThreshold == 0 { - // RFC 4253, section 9 suggests rekeying after 1G. - c.RekeyThreshold = 1 << 30 - } - if c.RekeyThreshold < minRekeyThreshold { + // cipher specific default + } else if c.RekeyThreshold < minRekeyThreshold { c.RekeyThreshold = minRekeyThreshold + } else if c.RekeyThreshold >= math.MaxInt64 { + // Avoid weirdness if somebody uses -1 as a threshold. + c.RekeyThreshold = math.MaxInt64 } } diff --git a/vendor/golang.org/x/crypto/ssh/connection.go b/vendor/golang.org/x/crypto/ssh/connection.go index e786f2f..fd6b068 100644 --- a/vendor/golang.org/x/crypto/ssh/connection.go +++ b/vendor/golang.org/x/crypto/ssh/connection.go @@ -25,7 +25,7 @@ type ConnMetadata interface { // User returns the user ID for this connection. User() string - // SessionID returns the sesson hash, also denoted by H. + // SessionID returns the session hash, also denoted by H. SessionID() []byte // ClientVersion returns the client's version string as hashed diff --git a/vendor/golang.org/x/crypto/ssh/doc.go b/vendor/golang.org/x/crypto/ssh/doc.go index d6be894..67b7322 100644 --- a/vendor/golang.org/x/crypto/ssh/doc.go +++ b/vendor/golang.org/x/crypto/ssh/doc.go @@ -14,5 +14,8 @@ others. References: [PROTOCOL.certkeys]: http://cvsweb.openbsd.org/cgi-bin/cvsweb/src/usr.bin/ssh/PROTOCOL.certkeys?rev=HEAD [SSH-PARAMETERS]: http://www.iana.org/assignments/ssh-parameters/ssh-parameters.xml#ssh-parameters-1 + +This package does not fall under the stability promise of the Go language itself, +so its API may be changed when pressing needs arise. */ package ssh // import "golang.org/x/crypto/ssh" diff --git a/vendor/golang.org/x/crypto/ssh/handshake.go b/vendor/golang.org/x/crypto/ssh/handshake.go index 8de6506..932ce83 100644 --- a/vendor/golang.org/x/crypto/ssh/handshake.go +++ b/vendor/golang.org/x/crypto/ssh/handshake.go @@ -74,7 +74,7 @@ type handshakeTransport struct { startKex chan *pendingKex // data for host key checking - hostKeyCallback func(hostname string, remote net.Addr, key PublicKey) error + hostKeyCallback HostKeyCallback dialAddress string remoteAddr net.Addr @@ -107,6 +107,8 @@ func newHandshakeTransport(conn keyingTransport, config *Config, clientVersion, config: config, } + t.resetReadThresholds() + t.resetWriteThresholds() // We always start with a mandatory key exchange. t.requestKex <- struct{}{} @@ -237,6 +239,17 @@ func (t *handshakeTransport) requestKeyExchange() { } } +func (t *handshakeTransport) resetWriteThresholds() { + t.writePacketsLeft = packetRekeyThreshold + if t.config.RekeyThreshold > 0 { + t.writeBytesLeft = int64(t.config.RekeyThreshold) + } else if t.algorithms != nil { + t.writeBytesLeft = t.algorithms.w.rekeyBytes() + } else { + t.writeBytesLeft = 1 << 30 + } +} + func (t *handshakeTransport) kexLoop() { write: @@ -285,12 +298,8 @@ write: t.writeError = err t.sentInitPacket = nil t.sentInitMsg = nil - t.writePacketsLeft = packetRekeyThreshold - if t.config.RekeyThreshold > 0 { - t.writeBytesLeft = int64(t.config.RekeyThreshold) - } else if t.algorithms != nil { - t.writeBytesLeft = t.algorithms.w.rekeyBytes() - } + + t.resetWriteThresholds() // we have completed the key exchange. Since the // reader is still blocked, it is safe to clear out @@ -344,6 +353,17 @@ write: // key exchange itself. const packetRekeyThreshold = (1 << 31) +func (t *handshakeTransport) resetReadThresholds() { + t.readPacketsLeft = packetRekeyThreshold + if t.config.RekeyThreshold > 0 { + t.readBytesLeft = int64(t.config.RekeyThreshold) + } else if t.algorithms != nil { + t.readBytesLeft = t.algorithms.r.rekeyBytes() + } else { + t.readBytesLeft = 1 << 30 + } +} + func (t *handshakeTransport) readOnePacket(first bool) ([]byte, error) { p, err := t.conn.readPacket() if err != nil { @@ -391,12 +411,7 @@ func (t *handshakeTransport) readOnePacket(first bool) ([]byte, error) { return nil, err } - t.readPacketsLeft = packetRekeyThreshold - if t.config.RekeyThreshold > 0 { - t.readBytesLeft = int64(t.config.RekeyThreshold) - } else { - t.readBytesLeft = t.algorithms.r.rekeyBytes() - } + t.resetReadThresholds() // By default, a key exchange is hidden from higher layers by // translating it into msgIgnore. @@ -574,7 +589,9 @@ func (t *handshakeTransport) enterKeyExchange(otherInitPacket []byte) error { } result.SessionID = t.sessionID - t.conn.prepareKeyChange(t.algorithms, result) + if err := t.conn.prepareKeyChange(t.algorithms, result); err != nil { + return err + } if err = t.conn.writePacket([]byte{msgNewKeys}); err != nil { return err } @@ -614,11 +631,9 @@ func (t *handshakeTransport) client(kex kexAlgorithm, algs *algorithms, magics * return nil, err } - if t.hostKeyCallback != nil { - err = t.hostKeyCallback(t.dialAddress, t.remoteAddr, hostKey) - if err != nil { - return nil, err - } + err = t.hostKeyCallback(t.dialAddress, t.remoteAddr, hostKey) + if err != nil { + return nil, err } return result, nil diff --git a/vendor/golang.org/x/crypto/ssh/kex.go b/vendor/golang.org/x/crypto/ssh/kex.go index c87fbeb..f91c277 100644 --- a/vendor/golang.org/x/crypto/ssh/kex.go +++ b/vendor/golang.org/x/crypto/ssh/kex.go @@ -383,8 +383,8 @@ func init() { // 4253 and Oakley Group 2 in RFC 2409. p, _ := new(big.Int).SetString("FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD129024E088A67CC74020BBEA63B139B22514A08798E3404DDEF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7EDEE386BFB5A899FA5AE9F24117C4B1FE649286651ECE65381FFFFFFFFFFFFFFFF", 16) kexAlgoMap[kexAlgoDH1SHA1] = &dhGroup{ - g: new(big.Int).SetInt64(2), - p: p, + g: new(big.Int).SetInt64(2), + p: p, pMinus1: new(big.Int).Sub(p, bigOne), } @@ -393,8 +393,8 @@ func init() { p, _ = new(big.Int).SetString("FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD129024E088A67CC74020BBEA63B139B22514A08798E3404DDEF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7EDEE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3DC2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F83655D23DCA3AD961C62F356208552BB9ED529077096966D670C354E4ABC9804F1746C08CA18217C32905E462E36CE3BE39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9DE2BCBF6955817183995497CEA956AE515D2261898FA051015728E5A8AACAA68FFFFFFFFFFFFFFFF", 16) kexAlgoMap[kexAlgoDH14SHA1] = &dhGroup{ - g: new(big.Int).SetInt64(2), - p: p, + g: new(big.Int).SetInt64(2), + p: p, pMinus1: new(big.Int).Sub(p, bigOne), } diff --git a/vendor/golang.org/x/crypto/ssh/keys.go b/vendor/golang.org/x/crypto/ssh/keys.go index f38de98..7a8756a 100644 --- a/vendor/golang.org/x/crypto/ssh/keys.go +++ b/vendor/golang.org/x/crypto/ssh/keys.go @@ -756,6 +756,18 @@ func ParsePrivateKey(pemBytes []byte) (Signer, error) { return NewSignerFromKey(key) } +// ParsePrivateKeyWithPassphrase returns a Signer from a PEM encoded private +// key and passphrase. It supports the same keys as +// ParseRawPrivateKeyWithPassphrase. +func ParsePrivateKeyWithPassphrase(pemBytes, passPhrase []byte) (Signer, error) { + key, err := ParseRawPrivateKeyWithPassphrase(pemBytes, passPhrase) + if err != nil { + return nil, err + } + + return NewSignerFromKey(key) +} + // encryptedBlock tells whether a private key is // encrypted by examining its Proc-Type header // for a mention of ENCRYPTED @@ -790,6 +802,43 @@ func ParseRawPrivateKey(pemBytes []byte) (interface{}, error) { } } +// ParseRawPrivateKeyWithPassphrase returns a private key decrypted with +// passphrase from a PEM encoded private key. If wrong passphrase, return +// x509.IncorrectPasswordError. +func ParseRawPrivateKeyWithPassphrase(pemBytes, passPhrase []byte) (interface{}, error) { + block, _ := pem.Decode(pemBytes) + if block == nil { + return nil, errors.New("ssh: no key found") + } + buf := block.Bytes + + if encryptedBlock(block) { + if x509.IsEncryptedPEMBlock(block) { + var err error + buf, err = x509.DecryptPEMBlock(block, passPhrase) + if err != nil { + if err == x509.IncorrectPasswordError { + return nil, err + } + return nil, fmt.Errorf("ssh: cannot decode encrypted private keys: %v", err) + } + } + } + + switch block.Type { + case "RSA PRIVATE KEY": + return x509.ParsePKCS1PrivateKey(buf) + case "EC PRIVATE KEY": + return x509.ParseECPrivateKey(buf) + case "DSA PRIVATE KEY": + return ParseDSAPrivateKey(buf) + case "OPENSSH PRIVATE KEY": + return parseOpenSSHPrivateKey(buf) + default: + return nil, fmt.Errorf("ssh: unsupported key type %q", block.Type) + } +} + // ParseDSAPrivateKey returns a DSA private key from its ASN.1 DER encoding, as // specified by the OpenSSL DSA man page. func ParseDSAPrivateKey(der []byte) (*dsa.PrivateKey, error) { @@ -824,7 +873,7 @@ func ParseDSAPrivateKey(der []byte) (*dsa.PrivateKey, error) { // Implemented based on the documentation at // https://github.com/openssh/openssh-portable/blob/master/PROTOCOL.key -func parseOpenSSHPrivateKey(key []byte) (*ed25519.PrivateKey, error) { +func parseOpenSSHPrivateKey(key []byte) (crypto.PrivateKey, error) { magic := append([]byte("openssh-key-v1"), 0) if !bytes.Equal(magic, key[0:len(magic)]) { return nil, errors.New("ssh: invalid openssh private key format") @@ -844,14 +893,15 @@ func parseOpenSSHPrivateKey(key []byte) (*ed25519.PrivateKey, error) { return nil, err } + if w.KdfName != "none" || w.CipherName != "none" { + return nil, errors.New("ssh: cannot decode encrypted private keys") + } + pk1 := struct { Check1 uint32 Check2 uint32 Keytype string - Pub []byte - Priv []byte - Comment string - Pad []byte `ssh:"rest"` + Rest []byte `ssh:"rest"` }{} if err := Unmarshal(w.PrivKeyBlock, &pk1); err != nil { @@ -862,24 +912,75 @@ func parseOpenSSHPrivateKey(key []byte) (*ed25519.PrivateKey, error) { return nil, errors.New("ssh: checkint mismatch") } - // we only handle ed25519 keys currently - if pk1.Keytype != KeyAlgoED25519 { + // we only handle ed25519 and rsa keys currently + switch pk1.Keytype { + case KeyAlgoRSA: + // https://github.com/openssh/openssh-portable/blob/master/sshkey.c#L2760-L2773 + key := struct { + N *big.Int + E *big.Int + D *big.Int + Iqmp *big.Int + P *big.Int + Q *big.Int + Comment string + Pad []byte `ssh:"rest"` + }{} + + if err := Unmarshal(pk1.Rest, &key); err != nil { + return nil, err + } + + for i, b := range key.Pad { + if int(b) != i+1 { + return nil, errors.New("ssh: padding not as expected") + } + } + + pk := &rsa.PrivateKey{ + PublicKey: rsa.PublicKey{ + N: key.N, + E: int(key.E.Int64()), + }, + D: key.D, + Primes: []*big.Int{key.P, key.Q}, + } + + if err := pk.Validate(); err != nil { + return nil, err + } + + pk.Precompute() + + return pk, nil + case KeyAlgoED25519: + key := struct { + Pub []byte + Priv []byte + Comment string + Pad []byte `ssh:"rest"` + }{} + + if err := Unmarshal(pk1.Rest, &key); err != nil { + return nil, err + } + + if len(key.Priv) != ed25519.PrivateKeySize { + return nil, errors.New("ssh: private key unexpected length") + } + + for i, b := range key.Pad { + if int(b) != i+1 { + return nil, errors.New("ssh: padding not as expected") + } + } + + pk := ed25519.PrivateKey(make([]byte, ed25519.PrivateKeySize)) + copy(pk, key.Priv) + return &pk, nil + default: return nil, errors.New("ssh: unhandled key type") } - - for i, b := range pk1.Pad { - if int(b) != i+1 { - return nil, errors.New("ssh: padding not as expected") - } - } - - if len(pk1.Priv) != ed25519.PrivateKeySize { - return nil, errors.New("ssh: private key unexpected length") - } - - pk := ed25519.PrivateKey(make([]byte, ed25519.PrivateKeySize)) - copy(pk, pk1.Priv) - return &pk, nil } // FingerprintLegacyMD5 returns the user presentation of the key's diff --git a/vendor/golang.org/x/crypto/ssh/server.go b/vendor/golang.org/x/crypto/ssh/server.go index 77c84d1..b6f4cc8 100644 --- a/vendor/golang.org/x/crypto/ssh/server.go +++ b/vendor/golang.org/x/crypto/ssh/server.go @@ -14,23 +14,34 @@ import ( ) // The Permissions type holds fine-grained permissions that are -// specific to a user or a specific authentication method for a -// user. Permissions, except for "source-address", must be enforced in -// the server application layer, after successful authentication. The -// Permissions are passed on in ServerConn so a server implementation -// can honor them. +// specific to a user or a specific authentication method for a user. +// The Permissions value for a successful authentication attempt is +// available in ServerConn, so it can be used to pass information from +// the user-authentication phase to the application layer. type Permissions struct { - // Critical options restrict default permissions. Common - // restrictions are "source-address" and "force-command". If - // the server cannot enforce the restriction, or does not - // recognize it, the user should not authenticate. + // CriticalOptions indicate restrictions to the default + // permissions, and are typically used in conjunction with + // user certificates. The standard for SSH certificates + // defines "force-command" (only allow the given command to + // execute) and "source-address" (only allow connections from + // the given address). The SSH package currently only enforces + // the "source-address" critical option. It is up to server + // implementations to enforce other critical options, such as + // "force-command", by checking them after the SSH handshake + // is successful. In general, SSH servers should reject + // connections that specify critical options that are unknown + // or not supported. CriticalOptions map[string]string // Extensions are extra functionality that the server may - // offer on authenticated connections. Common extensions are - // "permit-agent-forwarding", "permit-X11-forwarding". Lack of - // support for an extension does not preclude authenticating a - // user. + // offer on authenticated connections. Lack of support for an + // extension does not preclude authenticating a user. Common + // extensions are "permit-agent-forwarding", + // "permit-X11-forwarding". The Go SSH library currently does + // not act on any extension, and it is up to server + // implementations to honor them. Extensions can be used to + // pass data from the authentication callbacks to the server + // application layer. Extensions map[string]string } @@ -45,13 +56,24 @@ type ServerConfig struct { // authenticating. NoClientAuth bool + // MaxAuthTries specifies the maximum number of authentication attempts + // permitted per connection. If set to a negative number, the number of + // attempts are unlimited. If set to zero, the number of attempts are limited + // to 6. + MaxAuthTries int + // PasswordCallback, if non-nil, is called when a user // attempts to authenticate using a password. PasswordCallback func(conn ConnMetadata, password []byte) (*Permissions, error) - // PublicKeyCallback, if non-nil, is called when a client attempts public - // key authentication. It must return true if the given public key is - // valid for the given user. For example, see CertChecker.Authenticate. + // PublicKeyCallback, if non-nil, is called when a client + // offers a public key for authentication. It must return true + // if the given public key can be used to authenticate the + // given user. For example, see CertChecker.Authenticate. A + // call to this function does not guarantee that the key + // offered is in fact used to authenticate. To record any data + // depending on the public key, store it inside a + // Permissions.Extensions entry. PublicKeyCallback func(conn ConnMetadata, key PublicKey) (*Permissions, error) // KeyboardInteractiveCallback, if non-nil, is called when @@ -143,6 +165,10 @@ type ServerConn struct { func NewServerConn(c net.Conn, config *ServerConfig) (*ServerConn, <-chan NewChannel, <-chan *Request, error) { fullConf := *config fullConf.SetDefaults() + if fullConf.MaxAuthTries == 0 { + fullConf.MaxAuthTries = 6 + } + s := &connection{ sshConn: sshConn{conn: c}, } @@ -262,15 +288,51 @@ func checkSourceAddress(addr net.Addr, sourceAddrs string) error { return fmt.Errorf("ssh: remote address %v is not allowed because of source-address restriction", addr) } +// ServerAuthError implements the error interface. It appends any authentication +// errors that may occur, and is returned if all of the authentication methods +// provided by the user failed to authenticate. +type ServerAuthError struct { + // Errors contains authentication errors returned by the authentication + // callback methods. + Errors []error +} + +func (l ServerAuthError) Error() string { + var errs []string + for _, err := range l.Errors { + errs = append(errs, err.Error()) + } + return "[" + strings.Join(errs, ", ") + "]" +} + func (s *connection) serverAuthenticate(config *ServerConfig) (*Permissions, error) { sessionID := s.transport.getSessionID() var cache pubKeyCache var perms *Permissions + authFailures := 0 + var authErrs []error + userAuthLoop: for { + if authFailures >= config.MaxAuthTries && config.MaxAuthTries > 0 { + discMsg := &disconnectMsg{ + Reason: 2, + Message: "too many authentication failures", + } + + if err := s.transport.writePacket(Marshal(discMsg)); err != nil { + return nil, err + } + + return nil, discMsg + } + var userAuthReq userAuthRequestMsg if packet, err := s.transport.readPacket(); err != nil { + if err == io.EOF { + return nil, &ServerAuthError{Errors: authErrs} + } return nil, err } else if err = Unmarshal(packet, &userAuthReq); err != nil { return nil, err @@ -289,6 +351,11 @@ userAuthLoop: if config.NoClientAuth { authErr = nil } + + // allow initial attempt of 'none' without penalty + if authFailures == 0 { + authFailures-- + } case "password": if config.PasswordCallback == nil { authErr = errors.New("ssh: password auth not configured") @@ -360,6 +427,7 @@ userAuthLoop: if isQuery { // The client can query if the given public key // would be okay. + if len(payload) > 0 { return nil, parseError(msgUserAuthRequest) } @@ -401,6 +469,8 @@ userAuthLoop: authErr = fmt.Errorf("ssh: unknown method %q", userAuthReq.Method) } + authErrs = append(authErrs, authErr) + if config.AuthLogCallback != nil { config.AuthLogCallback(s, userAuthReq.Method, authErr) } @@ -409,6 +479,8 @@ userAuthLoop: break userAuthLoop } + authFailures++ + var failureMsg userAuthFailureMsg if config.PasswordCallback != nil { failureMsg.Methods = append(failureMsg.Methods, "password") diff --git a/vendor/golang.org/x/crypto/ssh/session.go b/vendor/golang.org/x/crypto/ssh/session.go index 17e2aa8..cc06e03 100644 --- a/vendor/golang.org/x/crypto/ssh/session.go +++ b/vendor/golang.org/x/crypto/ssh/session.go @@ -231,6 +231,26 @@ func (s *Session) RequestSubsystem(subsystem string) error { return err } +// RFC 4254 Section 6.7. +type ptyWindowChangeMsg struct { + Columns uint32 + Rows uint32 + Width uint32 + Height uint32 +} + +// WindowChange informs the remote host about a terminal window dimension change to h rows and w columns. +func (s *Session) WindowChange(h, w int) error { + req := ptyWindowChangeMsg{ + Columns: uint32(w), + Rows: uint32(h), + Width: uint32(w * 8), + Height: uint32(h * 8), + } + _, err := s.ch.SendRequest("window-change", false, Marshal(&req)) + return err +} + // RFC 4254 Section 6.9. type signalMsg struct { Signal string diff --git a/vendor/golang.org/x/crypto/ssh/streamlocal.go b/vendor/golang.org/x/crypto/ssh/streamlocal.go new file mode 100644 index 0000000..a2dccc6 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/streamlocal.go @@ -0,0 +1,115 @@ +package ssh + +import ( + "errors" + "io" + "net" +) + +// streamLocalChannelOpenDirectMsg is a struct used for SSH_MSG_CHANNEL_OPEN message +// with "direct-streamlocal@openssh.com" string. +// +// See openssh-portable/PROTOCOL, section 2.4. connection: Unix domain socket forwarding +// https://github.com/openssh/openssh-portable/blob/master/PROTOCOL#L235 +type streamLocalChannelOpenDirectMsg struct { + socketPath string + reserved0 string + reserved1 uint32 +} + +// forwardedStreamLocalPayload is a struct used for SSH_MSG_CHANNEL_OPEN message +// with "forwarded-streamlocal@openssh.com" string. +type forwardedStreamLocalPayload struct { + SocketPath string + Reserved0 string +} + +// streamLocalChannelForwardMsg is a struct used for SSH2_MSG_GLOBAL_REQUEST message +// with "streamlocal-forward@openssh.com"/"cancel-streamlocal-forward@openssh.com" string. +type streamLocalChannelForwardMsg struct { + socketPath string +} + +// ListenUnix is similar to ListenTCP but uses a Unix domain socket. +func (c *Client) ListenUnix(socketPath string) (net.Listener, error) { + m := streamLocalChannelForwardMsg{ + socketPath, + } + // send message + ok, _, err := c.SendRequest("streamlocal-forward@openssh.com", true, Marshal(&m)) + if err != nil { + return nil, err + } + if !ok { + return nil, errors.New("ssh: streamlocal-forward@openssh.com request denied by peer") + } + ch := c.forwards.add(&net.UnixAddr{Name: socketPath, Net: "unix"}) + + return &unixListener{socketPath, c, ch}, nil +} + +func (c *Client) dialStreamLocal(socketPath string) (Channel, error) { + msg := streamLocalChannelOpenDirectMsg{ + socketPath: socketPath, + } + ch, in, err := c.OpenChannel("direct-streamlocal@openssh.com", Marshal(&msg)) + if err != nil { + return nil, err + } + go DiscardRequests(in) + return ch, err +} + +type unixListener struct { + socketPath string + + conn *Client + in <-chan forward +} + +// Accept waits for and returns the next connection to the listener. +func (l *unixListener) Accept() (net.Conn, error) { + s, ok := <-l.in + if !ok { + return nil, io.EOF + } + ch, incoming, err := s.newCh.Accept() + if err != nil { + return nil, err + } + go DiscardRequests(incoming) + + return &chanConn{ + Channel: ch, + laddr: &net.UnixAddr{ + Name: l.socketPath, + Net: "unix", + }, + raddr: &net.UnixAddr{ + Name: "@", + Net: "unix", + }, + }, nil +} + +// Close closes the listener. +func (l *unixListener) Close() error { + // this also closes the listener. + l.conn.forwards.remove(&net.UnixAddr{Name: l.socketPath, Net: "unix"}) + m := streamLocalChannelForwardMsg{ + l.socketPath, + } + ok, _, err := l.conn.SendRequest("cancel-streamlocal-forward@openssh.com", true, Marshal(&m)) + if err == nil && !ok { + err = errors.New("ssh: cancel-streamlocal-forward@openssh.com failed") + } + return err +} + +// Addr returns the listener's network address. +func (l *unixListener) Addr() net.Addr { + return &net.UnixAddr{ + Name: l.socketPath, + Net: "unix", + } +} diff --git a/vendor/golang.org/x/crypto/ssh/tcpip.go b/vendor/golang.org/x/crypto/ssh/tcpip.go index 6151241..acf1717 100644 --- a/vendor/golang.org/x/crypto/ssh/tcpip.go +++ b/vendor/golang.org/x/crypto/ssh/tcpip.go @@ -20,12 +20,20 @@ import ( // addr. Incoming connections will be available by calling Accept on // the returned net.Listener. The listener must be serviced, or the // SSH connection may hang. +// N must be "tcp", "tcp4", "tcp6", or "unix". func (c *Client) Listen(n, addr string) (net.Listener, error) { - laddr, err := net.ResolveTCPAddr(n, addr) - if err != nil { - return nil, err + switch n { + case "tcp", "tcp4", "tcp6": + laddr, err := net.ResolveTCPAddr(n, addr) + if err != nil { + return nil, err + } + return c.ListenTCP(laddr) + case "unix": + return c.ListenUnix(addr) + default: + return nil, fmt.Errorf("ssh: unsupported protocol: %s", n) } - return c.ListenTCP(laddr) } // Automatic port allocation is broken with OpenSSH before 6.0. See @@ -116,7 +124,7 @@ func (c *Client) ListenTCP(laddr *net.TCPAddr) (net.Listener, error) { } // Register this forward, using the port number we obtained. - ch := c.forwards.add(*laddr) + ch := c.forwards.add(laddr) return &tcpListener{laddr, c, ch}, nil } @@ -131,7 +139,7 @@ type forwardList struct { // forwardEntry represents an established mapping of a laddr on a // remote ssh server to a channel connected to a tcpListener. type forwardEntry struct { - laddr net.TCPAddr + laddr net.Addr c chan forward } @@ -139,16 +147,16 @@ type forwardEntry struct { // arguments to add/remove/lookup should be address as specified in // the original forward-request. type forward struct { - newCh NewChannel // the ssh client channel underlying this forward - raddr *net.TCPAddr // the raddr of the incoming connection + newCh NewChannel // the ssh client channel underlying this forward + raddr net.Addr // the raddr of the incoming connection } -func (l *forwardList) add(addr net.TCPAddr) chan forward { +func (l *forwardList) add(addr net.Addr) chan forward { l.Lock() defer l.Unlock() f := forwardEntry{ - addr, - make(chan forward, 1), + laddr: addr, + c: make(chan forward, 1), } l.entries = append(l.entries, f) return f.c @@ -176,44 +184,69 @@ func parseTCPAddr(addr string, port uint32) (*net.TCPAddr, error) { func (l *forwardList) handleChannels(in <-chan NewChannel) { for ch := range in { - var payload forwardedTCPPayload - if err := Unmarshal(ch.ExtraData(), &payload); err != nil { - ch.Reject(ConnectionFailed, "could not parse forwarded-tcpip payload: "+err.Error()) - continue - } + var ( + laddr net.Addr + raddr net.Addr + err error + ) + switch channelType := ch.ChannelType(); channelType { + case "forwarded-tcpip": + var payload forwardedTCPPayload + if err = Unmarshal(ch.ExtraData(), &payload); err != nil { + ch.Reject(ConnectionFailed, "could not parse forwarded-tcpip payload: "+err.Error()) + continue + } - // RFC 4254 section 7.2 specifies that incoming - // addresses should list the address, in string - // format. It is implied that this should be an IP - // address, as it would be impossible to connect to it - // otherwise. - laddr, err := parseTCPAddr(payload.Addr, payload.Port) - if err != nil { - ch.Reject(ConnectionFailed, err.Error()) - continue - } - raddr, err := parseTCPAddr(payload.OriginAddr, payload.OriginPort) - if err != nil { - ch.Reject(ConnectionFailed, err.Error()) - continue - } + // RFC 4254 section 7.2 specifies that incoming + // addresses should list the address, in string + // format. It is implied that this should be an IP + // address, as it would be impossible to connect to it + // otherwise. + laddr, err = parseTCPAddr(payload.Addr, payload.Port) + if err != nil { + ch.Reject(ConnectionFailed, err.Error()) + continue + } + raddr, err = parseTCPAddr(payload.OriginAddr, payload.OriginPort) + if err != nil { + ch.Reject(ConnectionFailed, err.Error()) + continue + } - if ok := l.forward(*laddr, *raddr, ch); !ok { + case "forwarded-streamlocal@openssh.com": + var payload forwardedStreamLocalPayload + if err = Unmarshal(ch.ExtraData(), &payload); err != nil { + ch.Reject(ConnectionFailed, "could not parse forwarded-streamlocal@openssh.com payload: "+err.Error()) + continue + } + laddr = &net.UnixAddr{ + Name: payload.SocketPath, + Net: "unix", + } + raddr = &net.UnixAddr{ + Name: "@", + Net: "unix", + } + default: + panic(fmt.Errorf("ssh: unknown channel type %s", channelType)) + } + if ok := l.forward(laddr, raddr, ch); !ok { // Section 7.2, implementations MUST reject spurious incoming // connections. ch.Reject(Prohibited, "no forward for address") continue } + } } // remove removes the forward entry, and the channel feeding its // listener. -func (l *forwardList) remove(addr net.TCPAddr) { +func (l *forwardList) remove(addr net.Addr) { l.Lock() defer l.Unlock() for i, f := range l.entries { - if addr.IP.Equal(f.laddr.IP) && addr.Port == f.laddr.Port { + if addr.Network() == f.laddr.Network() && addr.String() == f.laddr.String() { l.entries = append(l.entries[:i], l.entries[i+1:]...) close(f.c) return @@ -231,12 +264,12 @@ func (l *forwardList) closeAll() { l.entries = nil } -func (l *forwardList) forward(laddr, raddr net.TCPAddr, ch NewChannel) bool { +func (l *forwardList) forward(laddr, raddr net.Addr, ch NewChannel) bool { l.Lock() defer l.Unlock() for _, f := range l.entries { - if laddr.IP.Equal(f.laddr.IP) && laddr.Port == f.laddr.Port { - f.c <- forward{ch, &raddr} + if laddr.Network() == f.laddr.Network() && laddr.String() == f.laddr.String() { + f.c <- forward{newCh: ch, raddr: raddr} return true } } @@ -262,7 +295,7 @@ func (l *tcpListener) Accept() (net.Conn, error) { } go DiscardRequests(incoming) - return &tcpChanConn{ + return &chanConn{ Channel: ch, laddr: l.laddr, raddr: s.raddr, @@ -277,7 +310,7 @@ func (l *tcpListener) Close() error { } // this also closes the listener. - l.conn.forwards.remove(*l.laddr) + l.conn.forwards.remove(l.laddr) ok, _, err := l.conn.SendRequest("cancel-tcpip-forward", true, Marshal(&m)) if err == nil && !ok { err = errors.New("ssh: cancel-tcpip-forward failed") @@ -293,29 +326,52 @@ func (l *tcpListener) Addr() net.Addr { // Dial initiates a connection to the addr from the remote host. // The resulting connection has a zero LocalAddr() and RemoteAddr(). func (c *Client) Dial(n, addr string) (net.Conn, error) { - // Parse the address into host and numeric port. - host, portString, err := net.SplitHostPort(addr) - if err != nil { - return nil, err + var ch Channel + switch n { + case "tcp", "tcp4", "tcp6": + // Parse the address into host and numeric port. + host, portString, err := net.SplitHostPort(addr) + if err != nil { + return nil, err + } + port, err := strconv.ParseUint(portString, 10, 16) + if err != nil { + return nil, err + } + ch, err = c.dial(net.IPv4zero.String(), 0, host, int(port)) + if err != nil { + return nil, err + } + // Use a zero address for local and remote address. + zeroAddr := &net.TCPAddr{ + IP: net.IPv4zero, + Port: 0, + } + return &chanConn{ + Channel: ch, + laddr: zeroAddr, + raddr: zeroAddr, + }, nil + case "unix": + var err error + ch, err = c.dialStreamLocal(addr) + if err != nil { + return nil, err + } + return &chanConn{ + Channel: ch, + laddr: &net.UnixAddr{ + Name: "@", + Net: "unix", + }, + raddr: &net.UnixAddr{ + Name: addr, + Net: "unix", + }, + }, nil + default: + return nil, fmt.Errorf("ssh: unsupported protocol: %s", n) } - port, err := strconv.ParseUint(portString, 10, 16) - if err != nil { - return nil, err - } - // Use a zero address for local and remote address. - zeroAddr := &net.TCPAddr{ - IP: net.IPv4zero, - Port: 0, - } - ch, err := c.dial(net.IPv4zero.String(), 0, host, int(port)) - if err != nil { - return nil, err - } - return &tcpChanConn{ - Channel: ch, - laddr: zeroAddr, - raddr: zeroAddr, - }, nil } // DialTCP connects to the remote address raddr on the network net, @@ -332,7 +388,7 @@ func (c *Client) DialTCP(n string, laddr, raddr *net.TCPAddr) (net.Conn, error) if err != nil { return nil, err } - return &tcpChanConn{ + return &chanConn{ Channel: ch, laddr: laddr, raddr: raddr, @@ -366,26 +422,26 @@ type tcpChan struct { Channel // the backing channel } -// tcpChanConn fulfills the net.Conn interface without +// chanConn fulfills the net.Conn interface without // the tcpChan having to hold laddr or raddr directly. -type tcpChanConn struct { +type chanConn struct { Channel laddr, raddr net.Addr } // LocalAddr returns the local network address. -func (t *tcpChanConn) LocalAddr() net.Addr { +func (t *chanConn) LocalAddr() net.Addr { return t.laddr } // RemoteAddr returns the remote network address. -func (t *tcpChanConn) RemoteAddr() net.Addr { +func (t *chanConn) RemoteAddr() net.Addr { return t.raddr } // SetDeadline sets the read and write deadlines associated // with the connection. -func (t *tcpChanConn) SetDeadline(deadline time.Time) error { +func (t *chanConn) SetDeadline(deadline time.Time) error { if err := t.SetReadDeadline(deadline); err != nil { return err } @@ -396,12 +452,14 @@ func (t *tcpChanConn) SetDeadline(deadline time.Time) error { // A zero value for t means Read will not time out. // After the deadline, the error from Read will implement net.Error // with Timeout() == true. -func (t *tcpChanConn) SetReadDeadline(deadline time.Time) error { +func (t *chanConn) SetReadDeadline(deadline time.Time) error { + // for compatibility with previous version, + // the error message contains "tcpChan" return errors.New("ssh: tcpChan: deadline not supported") } // SetWriteDeadline exists to satisfy the net.Conn interface // but is not implemented by this type. It always returns an error. -func (t *tcpChanConn) SetWriteDeadline(deadline time.Time) error { +func (t *chanConn) SetWriteDeadline(deadline time.Time) error { return errors.New("ssh: tcpChan: deadline not supported") } diff --git a/vendor/golang.org/x/crypto/twofish/twofish.go b/vendor/golang.org/x/crypto/twofish/twofish.go index 376fa0e..6db01fc 100644 --- a/vendor/golang.org/x/crypto/twofish/twofish.go +++ b/vendor/golang.org/x/crypto/twofish/twofish.go @@ -5,7 +5,7 @@ // Package twofish implements Bruce Schneier's Twofish encryption algorithm. package twofish // import "golang.org/x/crypto/twofish" -// Twofish is defined in http://www.schneier.com/paper-twofish-paper.pdf [TWOFISH] +// Twofish is defined in https://www.schneier.com/paper-twofish-paper.pdf [TWOFISH] // This code is a port of the LibTom C implementation. // See http://libtom.org/?page=features&newsitems=5&whatfile=crypt. diff --git a/vendor/golang.org/x/net/bpf/constants.go b/vendor/golang.org/x/net/bpf/constants.go index 2c8bbab..ccf6ada 100644 --- a/vendor/golang.org/x/net/bpf/constants.go +++ b/vendor/golang.org/x/net/bpf/constants.go @@ -70,6 +70,9 @@ type Extension int // Extension functions available in the Linux kernel. const ( + // extOffset is the negative maximum number of instructions used + // to load instructions by overloading the K argument. + extOffset = -0x1000 // ExtLen returns the length of the packet. ExtLen Extension = 1 // ExtProto returns the packet's L3 protocol type. diff --git a/vendor/golang.org/x/net/bpf/instructions.go b/vendor/golang.org/x/net/bpf/instructions.go index 68ae6f5..3b4fd08 100644 --- a/vendor/golang.org/x/net/bpf/instructions.go +++ b/vendor/golang.org/x/net/bpf/instructions.go @@ -57,6 +57,9 @@ func (ri RawInstruction) Disassemble() Instruction { } return LoadScratch{Dst: reg, N: int(ri.K)} case opAddrModeAbsolute: + if ri.K > extOffset+0xffffffff { + return LoadExtension{Num: Extension(-extOffset + ri.K)} + } return LoadAbsolute{Size: sz, Off: ri.K} case opAddrModeIndirect: return LoadIndirect{Size: sz, Off: ri.K} @@ -104,6 +107,14 @@ func (ri RawInstruction) Disassemble() Instruction { case opJumpAlways: return Jump{Skip: ri.K} case opJumpEqual: + if ri.Jt == 0 { + return JumpIf{ + Cond: JumpNotEqual, + Val: ri.K, + SkipTrue: ri.Jf, + SkipFalse: 0, + } + } return JumpIf{ Cond: JumpEqual, Val: ri.K, @@ -111,6 +122,14 @@ func (ri RawInstruction) Disassemble() Instruction { SkipFalse: ri.Jf, } case opJumpGT: + if ri.Jt == 0 { + return JumpIf{ + Cond: JumpLessOrEqual, + Val: ri.K, + SkipTrue: ri.Jf, + SkipFalse: 0, + } + } return JumpIf{ Cond: JumpGreaterThan, Val: ri.K, @@ -118,6 +137,14 @@ func (ri RawInstruction) Disassemble() Instruction { SkipFalse: ri.Jf, } case opJumpGE: + if ri.Jt == 0 { + return JumpIf{ + Cond: JumpLessThan, + Val: ri.K, + SkipTrue: ri.Jf, + SkipFalse: 0, + } + } return JumpIf{ Cond: JumpGreaterOrEqual, Val: ri.K, @@ -171,6 +198,18 @@ func (a LoadConstant) Assemble() (RawInstruction, error) { return assembleLoad(a.Dst, 4, opAddrModeImmediate, a.Val) } +// String returns the the instruction in assembler notation. +func (a LoadConstant) String() string { + switch a.Dst { + case RegA: + return fmt.Sprintf("ld #%d", a.Val) + case RegX: + return fmt.Sprintf("ldx #%d", a.Val) + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // LoadScratch loads scratch[N] into register Dst. type LoadScratch struct { Dst Register @@ -185,6 +224,18 @@ func (a LoadScratch) Assemble() (RawInstruction, error) { return assembleLoad(a.Dst, 4, opAddrModeScratch, uint32(a.N)) } +// String returns the the instruction in assembler notation. +func (a LoadScratch) String() string { + switch a.Dst { + case RegA: + return fmt.Sprintf("ld M[%d]", a.N) + case RegX: + return fmt.Sprintf("ldx M[%d]", a.N) + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // LoadAbsolute loads packet[Off:Off+Size] as an integer value into // register A. type LoadAbsolute struct { @@ -197,6 +248,23 @@ func (a LoadAbsolute) Assemble() (RawInstruction, error) { return assembleLoad(RegA, a.Size, opAddrModeAbsolute, a.Off) } +// String returns the the instruction in assembler notation. +func (a LoadAbsolute) String() string { + switch a.Size { + case 1: // byte + return fmt.Sprintf("ldb [%d]", a.Off) + case 2: // half word + return fmt.Sprintf("ldh [%d]", a.Off) + case 4: // word + if a.Off > extOffset+0xffffffff { + return LoadExtension{Num: Extension(a.Off + 0x1000)}.String() + } + return fmt.Sprintf("ld [%d]", a.Off) + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // LoadIndirect loads packet[X+Off:X+Off+Size] as an integer value // into register A. type LoadIndirect struct { @@ -209,6 +277,20 @@ func (a LoadIndirect) Assemble() (RawInstruction, error) { return assembleLoad(RegA, a.Size, opAddrModeIndirect, a.Off) } +// String returns the the instruction in assembler notation. +func (a LoadIndirect) String() string { + switch a.Size { + case 1: // byte + return fmt.Sprintf("ldb [x + %d]", a.Off) + case 2: // half word + return fmt.Sprintf("ldh [x + %d]", a.Off) + case 4: // word + return fmt.Sprintf("ld [x + %d]", a.Off) + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // LoadMemShift multiplies the first 4 bits of the byte at packet[Off] // by 4 and stores the result in register X. // @@ -224,6 +306,11 @@ func (a LoadMemShift) Assemble() (RawInstruction, error) { return assembleLoad(RegX, 1, opAddrModeMemShift, a.Off) } +// String returns the the instruction in assembler notation. +func (a LoadMemShift) String() string { + return fmt.Sprintf("ldx 4*([%d]&0xf)", a.Off) +} + // LoadExtension invokes a linux-specific extension and stores the // result in register A. type LoadExtension struct { @@ -235,7 +322,47 @@ func (a LoadExtension) Assemble() (RawInstruction, error) { if a.Num == ExtLen { return assembleLoad(RegA, 4, opAddrModePacketLen, 0) } - return assembleLoad(RegA, 4, opAddrModeAbsolute, uint32(-0x1000+a.Num)) + return assembleLoad(RegA, 4, opAddrModeAbsolute, uint32(extOffset+a.Num)) +} + +// String returns the the instruction in assembler notation. +func (a LoadExtension) String() string { + switch a.Num { + case ExtLen: + return "ld #len" + case ExtProto: + return "ld #proto" + case ExtType: + return "ld #type" + case ExtPayloadOffset: + return "ld #poff" + case ExtInterfaceIndex: + return "ld #ifidx" + case ExtNetlinkAttr: + return "ld #nla" + case ExtNetlinkAttrNested: + return "ld #nlan" + case ExtMark: + return "ld #mark" + case ExtQueue: + return "ld #queue" + case ExtLinkLayerType: + return "ld #hatype" + case ExtRXHash: + return "ld #rxhash" + case ExtCPUID: + return "ld #cpu" + case ExtVLANTag: + return "ld #vlan_tci" + case ExtVLANTagPresent: + return "ld #vlan_avail" + case ExtVLANProto: + return "ld #vlan_tpid" + case ExtRand: + return "ld #rand" + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } } // StoreScratch stores register Src into scratch[N]. @@ -265,6 +392,18 @@ func (a StoreScratch) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a StoreScratch) String() string { + switch a.Src { + case RegA: + return fmt.Sprintf("st M[%d]", a.N) + case RegX: + return fmt.Sprintf("stx M[%d]", a.N) + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // ALUOpConstant executes A = A Val. type ALUOpConstant struct { Op ALUOp @@ -279,6 +418,34 @@ func (a ALUOpConstant) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a ALUOpConstant) String() string { + switch a.Op { + case ALUOpAdd: + return fmt.Sprintf("add #%d", a.Val) + case ALUOpSub: + return fmt.Sprintf("sub #%d", a.Val) + case ALUOpMul: + return fmt.Sprintf("mul #%d", a.Val) + case ALUOpDiv: + return fmt.Sprintf("div #%d", a.Val) + case ALUOpMod: + return fmt.Sprintf("mod #%d", a.Val) + case ALUOpAnd: + return fmt.Sprintf("and #%d", a.Val) + case ALUOpOr: + return fmt.Sprintf("or #%d", a.Val) + case ALUOpXor: + return fmt.Sprintf("xor #%d", a.Val) + case ALUOpShiftLeft: + return fmt.Sprintf("lsh #%d", a.Val) + case ALUOpShiftRight: + return fmt.Sprintf("rsh #%d", a.Val) + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // ALUOpX executes A = A X type ALUOpX struct { Op ALUOp @@ -291,6 +458,34 @@ func (a ALUOpX) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a ALUOpX) String() string { + switch a.Op { + case ALUOpAdd: + return "add x" + case ALUOpSub: + return "sub x" + case ALUOpMul: + return "mul x" + case ALUOpDiv: + return "div x" + case ALUOpMod: + return "mod x" + case ALUOpAnd: + return "and x" + case ALUOpOr: + return "or x" + case ALUOpXor: + return "xor x" + case ALUOpShiftLeft: + return "lsh x" + case ALUOpShiftRight: + return "rsh x" + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + // NegateA executes A = -A. type NegateA struct{} @@ -301,6 +496,11 @@ func (a NegateA) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a NegateA) String() string { + return fmt.Sprintf("neg") +} + // Jump skips the following Skip instructions in the program. type Jump struct { Skip uint32 @@ -314,6 +514,11 @@ func (a Jump) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a Jump) String() string { + return fmt.Sprintf("ja %d", a.Skip) +} + // JumpIf skips the following Skip instructions in the program if A // Val is true. type JumpIf struct { @@ -361,6 +566,51 @@ func (a JumpIf) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a JumpIf) String() string { + switch a.Cond { + // K == A + case JumpEqual: + return conditionalJump(a, "jeq", "jneq") + // K != A + case JumpNotEqual: + return fmt.Sprintf("jneq #%d,%d", a.Val, a.SkipTrue) + // K > A + case JumpGreaterThan: + return conditionalJump(a, "jgt", "jle") + // K < A + case JumpLessThan: + return fmt.Sprintf("jlt #%d,%d", a.Val, a.SkipTrue) + // K >= A + case JumpGreaterOrEqual: + return conditionalJump(a, "jge", "jlt") + // K <= A + case JumpLessOrEqual: + return fmt.Sprintf("jle #%d,%d", a.Val, a.SkipTrue) + // K & A != 0 + case JumpBitsSet: + if a.SkipFalse > 0 { + return fmt.Sprintf("jset #%d,%d,%d", a.Val, a.SkipTrue, a.SkipFalse) + } + return fmt.Sprintf("jset #%d,%d", a.Val, a.SkipTrue) + // K & A == 0, there is no assembler instruction for JumpBitNotSet, use JumpBitSet and invert skips + case JumpBitsNotSet: + return JumpIf{Cond: JumpBitsSet, SkipTrue: a.SkipFalse, SkipFalse: a.SkipTrue, Val: a.Val}.String() + default: + return fmt.Sprintf("unknown instruction: %#v", a) + } +} + +func conditionalJump(inst JumpIf, positiveJump, negativeJump string) string { + if inst.SkipTrue > 0 { + if inst.SkipFalse > 0 { + return fmt.Sprintf("%s #%d,%d,%d", positiveJump, inst.Val, inst.SkipTrue, inst.SkipFalse) + } + return fmt.Sprintf("%s #%d,%d", positiveJump, inst.Val, inst.SkipTrue) + } + return fmt.Sprintf("%s #%d,%d", negativeJump, inst.Val, inst.SkipFalse) +} + // RetA exits the BPF program, returning the value of register A. type RetA struct{} @@ -371,6 +621,11 @@ func (a RetA) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a RetA) String() string { + return fmt.Sprintf("ret a") +} + // RetConstant exits the BPF program, returning a constant value. type RetConstant struct { Val uint32 @@ -384,6 +639,11 @@ func (a RetConstant) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a RetConstant) String() string { + return fmt.Sprintf("ret #%d", a.Val) +} + // TXA copies the value of register X to register A. type TXA struct{} @@ -394,6 +654,11 @@ func (a TXA) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a TXA) String() string { + return fmt.Sprintf("txa") +} + // TAX copies the value of register A to register X. type TAX struct{} @@ -404,6 +669,11 @@ func (a TAX) Assemble() (RawInstruction, error) { }, nil } +// String returns the the instruction in assembler notation. +func (a TAX) String() string { + return fmt.Sprintf("tax") +} + func assembleLoad(dst Register, loadSize int, mode uint16, k uint32) (RawInstruction, error) { var ( cls uint16 diff --git a/vendor/golang.org/x/net/http2/ciphers.go b/vendor/golang.org/x/net/http2/ciphers.go new file mode 100644 index 0000000..698860b --- /dev/null +++ b/vendor/golang.org/x/net/http2/ciphers.go @@ -0,0 +1,641 @@ +// Copyright 2017 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package http2 + +// A list of the possible cipher suite ids. Taken from +// http://www.iana.org/assignments/tls-parameters/tls-parameters.txt + +const ( + cipher_TLS_NULL_WITH_NULL_NULL uint16 = 0x0000 + cipher_TLS_RSA_WITH_NULL_MD5 uint16 = 0x0001 + cipher_TLS_RSA_WITH_NULL_SHA uint16 = 0x0002 + cipher_TLS_RSA_EXPORT_WITH_RC4_40_MD5 uint16 = 0x0003 + cipher_TLS_RSA_WITH_RC4_128_MD5 uint16 = 0x0004 + cipher_TLS_RSA_WITH_RC4_128_SHA uint16 = 0x0005 + cipher_TLS_RSA_EXPORT_WITH_RC2_CBC_40_MD5 uint16 = 0x0006 + cipher_TLS_RSA_WITH_IDEA_CBC_SHA uint16 = 0x0007 + cipher_TLS_RSA_EXPORT_WITH_DES40_CBC_SHA uint16 = 0x0008 + cipher_TLS_RSA_WITH_DES_CBC_SHA uint16 = 0x0009 + cipher_TLS_RSA_WITH_3DES_EDE_CBC_SHA uint16 = 0x000A + cipher_TLS_DH_DSS_EXPORT_WITH_DES40_CBC_SHA uint16 = 0x000B + cipher_TLS_DH_DSS_WITH_DES_CBC_SHA uint16 = 0x000C + cipher_TLS_DH_DSS_WITH_3DES_EDE_CBC_SHA uint16 = 0x000D + cipher_TLS_DH_RSA_EXPORT_WITH_DES40_CBC_SHA uint16 = 0x000E + cipher_TLS_DH_RSA_WITH_DES_CBC_SHA uint16 = 0x000F + cipher_TLS_DH_RSA_WITH_3DES_EDE_CBC_SHA uint16 = 0x0010 + cipher_TLS_DHE_DSS_EXPORT_WITH_DES40_CBC_SHA uint16 = 0x0011 + cipher_TLS_DHE_DSS_WITH_DES_CBC_SHA uint16 = 0x0012 + cipher_TLS_DHE_DSS_WITH_3DES_EDE_CBC_SHA uint16 = 0x0013 + cipher_TLS_DHE_RSA_EXPORT_WITH_DES40_CBC_SHA uint16 = 0x0014 + cipher_TLS_DHE_RSA_WITH_DES_CBC_SHA uint16 = 0x0015 + cipher_TLS_DHE_RSA_WITH_3DES_EDE_CBC_SHA uint16 = 0x0016 + cipher_TLS_DH_anon_EXPORT_WITH_RC4_40_MD5 uint16 = 0x0017 + cipher_TLS_DH_anon_WITH_RC4_128_MD5 uint16 = 0x0018 + cipher_TLS_DH_anon_EXPORT_WITH_DES40_CBC_SHA uint16 = 0x0019 + cipher_TLS_DH_anon_WITH_DES_CBC_SHA uint16 = 0x001A + cipher_TLS_DH_anon_WITH_3DES_EDE_CBC_SHA uint16 = 0x001B + // Reserved uint16 = 0x001C-1D + cipher_TLS_KRB5_WITH_DES_CBC_SHA uint16 = 0x001E + cipher_TLS_KRB5_WITH_3DES_EDE_CBC_SHA uint16 = 0x001F + cipher_TLS_KRB5_WITH_RC4_128_SHA uint16 = 0x0020 + cipher_TLS_KRB5_WITH_IDEA_CBC_SHA uint16 = 0x0021 + cipher_TLS_KRB5_WITH_DES_CBC_MD5 uint16 = 0x0022 + cipher_TLS_KRB5_WITH_3DES_EDE_CBC_MD5 uint16 = 0x0023 + cipher_TLS_KRB5_WITH_RC4_128_MD5 uint16 = 0x0024 + cipher_TLS_KRB5_WITH_IDEA_CBC_MD5 uint16 = 0x0025 + cipher_TLS_KRB5_EXPORT_WITH_DES_CBC_40_SHA uint16 = 0x0026 + cipher_TLS_KRB5_EXPORT_WITH_RC2_CBC_40_SHA uint16 = 0x0027 + cipher_TLS_KRB5_EXPORT_WITH_RC4_40_SHA uint16 = 0x0028 + cipher_TLS_KRB5_EXPORT_WITH_DES_CBC_40_MD5 uint16 = 0x0029 + cipher_TLS_KRB5_EXPORT_WITH_RC2_CBC_40_MD5 uint16 = 0x002A + cipher_TLS_KRB5_EXPORT_WITH_RC4_40_MD5 uint16 = 0x002B + cipher_TLS_PSK_WITH_NULL_SHA uint16 = 0x002C + cipher_TLS_DHE_PSK_WITH_NULL_SHA uint16 = 0x002D + cipher_TLS_RSA_PSK_WITH_NULL_SHA uint16 = 0x002E + cipher_TLS_RSA_WITH_AES_128_CBC_SHA uint16 = 0x002F + cipher_TLS_DH_DSS_WITH_AES_128_CBC_SHA uint16 = 0x0030 + cipher_TLS_DH_RSA_WITH_AES_128_CBC_SHA uint16 = 0x0031 + cipher_TLS_DHE_DSS_WITH_AES_128_CBC_SHA uint16 = 0x0032 + cipher_TLS_DHE_RSA_WITH_AES_128_CBC_SHA uint16 = 0x0033 + cipher_TLS_DH_anon_WITH_AES_128_CBC_SHA uint16 = 0x0034 + cipher_TLS_RSA_WITH_AES_256_CBC_SHA uint16 = 0x0035 + cipher_TLS_DH_DSS_WITH_AES_256_CBC_SHA uint16 = 0x0036 + cipher_TLS_DH_RSA_WITH_AES_256_CBC_SHA uint16 = 0x0037 + cipher_TLS_DHE_DSS_WITH_AES_256_CBC_SHA uint16 = 0x0038 + cipher_TLS_DHE_RSA_WITH_AES_256_CBC_SHA uint16 = 0x0039 + cipher_TLS_DH_anon_WITH_AES_256_CBC_SHA uint16 = 0x003A + cipher_TLS_RSA_WITH_NULL_SHA256 uint16 = 0x003B + cipher_TLS_RSA_WITH_AES_128_CBC_SHA256 uint16 = 0x003C + cipher_TLS_RSA_WITH_AES_256_CBC_SHA256 uint16 = 0x003D + cipher_TLS_DH_DSS_WITH_AES_128_CBC_SHA256 uint16 = 0x003E + cipher_TLS_DH_RSA_WITH_AES_128_CBC_SHA256 uint16 = 0x003F + cipher_TLS_DHE_DSS_WITH_AES_128_CBC_SHA256 uint16 = 0x0040 + cipher_TLS_RSA_WITH_CAMELLIA_128_CBC_SHA uint16 = 0x0041 + cipher_TLS_DH_DSS_WITH_CAMELLIA_128_CBC_SHA uint16 = 0x0042 + cipher_TLS_DH_RSA_WITH_CAMELLIA_128_CBC_SHA uint16 = 0x0043 + cipher_TLS_DHE_DSS_WITH_CAMELLIA_128_CBC_SHA uint16 = 0x0044 + cipher_TLS_DHE_RSA_WITH_CAMELLIA_128_CBC_SHA uint16 = 0x0045 + cipher_TLS_DH_anon_WITH_CAMELLIA_128_CBC_SHA uint16 = 0x0046 + // Reserved uint16 = 0x0047-4F + // Reserved uint16 = 0x0050-58 + // Reserved uint16 = 0x0059-5C + // Unassigned uint16 = 0x005D-5F + // Reserved uint16 = 0x0060-66 + cipher_TLS_DHE_RSA_WITH_AES_128_CBC_SHA256 uint16 = 0x0067 + cipher_TLS_DH_DSS_WITH_AES_256_CBC_SHA256 uint16 = 0x0068 + cipher_TLS_DH_RSA_WITH_AES_256_CBC_SHA256 uint16 = 0x0069 + cipher_TLS_DHE_DSS_WITH_AES_256_CBC_SHA256 uint16 = 0x006A + cipher_TLS_DHE_RSA_WITH_AES_256_CBC_SHA256 uint16 = 0x006B + cipher_TLS_DH_anon_WITH_AES_128_CBC_SHA256 uint16 = 0x006C + cipher_TLS_DH_anon_WITH_AES_256_CBC_SHA256 uint16 = 0x006D + // Unassigned uint16 = 0x006E-83 + cipher_TLS_RSA_WITH_CAMELLIA_256_CBC_SHA uint16 = 0x0084 + cipher_TLS_DH_DSS_WITH_CAMELLIA_256_CBC_SHA uint16 = 0x0085 + cipher_TLS_DH_RSA_WITH_CAMELLIA_256_CBC_SHA uint16 = 0x0086 + cipher_TLS_DHE_DSS_WITH_CAMELLIA_256_CBC_SHA uint16 = 0x0087 + cipher_TLS_DHE_RSA_WITH_CAMELLIA_256_CBC_SHA uint16 = 0x0088 + cipher_TLS_DH_anon_WITH_CAMELLIA_256_CBC_SHA uint16 = 0x0089 + cipher_TLS_PSK_WITH_RC4_128_SHA uint16 = 0x008A + cipher_TLS_PSK_WITH_3DES_EDE_CBC_SHA uint16 = 0x008B + cipher_TLS_PSK_WITH_AES_128_CBC_SHA uint16 = 0x008C + cipher_TLS_PSK_WITH_AES_256_CBC_SHA uint16 = 0x008D + cipher_TLS_DHE_PSK_WITH_RC4_128_SHA uint16 = 0x008E + cipher_TLS_DHE_PSK_WITH_3DES_EDE_CBC_SHA uint16 = 0x008F + cipher_TLS_DHE_PSK_WITH_AES_128_CBC_SHA uint16 = 0x0090 + cipher_TLS_DHE_PSK_WITH_AES_256_CBC_SHA uint16 = 0x0091 + cipher_TLS_RSA_PSK_WITH_RC4_128_SHA uint16 = 0x0092 + cipher_TLS_RSA_PSK_WITH_3DES_EDE_CBC_SHA uint16 = 0x0093 + cipher_TLS_RSA_PSK_WITH_AES_128_CBC_SHA uint16 = 0x0094 + cipher_TLS_RSA_PSK_WITH_AES_256_CBC_SHA uint16 = 0x0095 + cipher_TLS_RSA_WITH_SEED_CBC_SHA uint16 = 0x0096 + cipher_TLS_DH_DSS_WITH_SEED_CBC_SHA uint16 = 0x0097 + cipher_TLS_DH_RSA_WITH_SEED_CBC_SHA uint16 = 0x0098 + cipher_TLS_DHE_DSS_WITH_SEED_CBC_SHA uint16 = 0x0099 + cipher_TLS_DHE_RSA_WITH_SEED_CBC_SHA uint16 = 0x009A + cipher_TLS_DH_anon_WITH_SEED_CBC_SHA uint16 = 0x009B + cipher_TLS_RSA_WITH_AES_128_GCM_SHA256 uint16 = 0x009C + cipher_TLS_RSA_WITH_AES_256_GCM_SHA384 uint16 = 0x009D + cipher_TLS_DHE_RSA_WITH_AES_128_GCM_SHA256 uint16 = 0x009E + cipher_TLS_DHE_RSA_WITH_AES_256_GCM_SHA384 uint16 = 0x009F + cipher_TLS_DH_RSA_WITH_AES_128_GCM_SHA256 uint16 = 0x00A0 + cipher_TLS_DH_RSA_WITH_AES_256_GCM_SHA384 uint16 = 0x00A1 + cipher_TLS_DHE_DSS_WITH_AES_128_GCM_SHA256 uint16 = 0x00A2 + cipher_TLS_DHE_DSS_WITH_AES_256_GCM_SHA384 uint16 = 0x00A3 + cipher_TLS_DH_DSS_WITH_AES_128_GCM_SHA256 uint16 = 0x00A4 + cipher_TLS_DH_DSS_WITH_AES_256_GCM_SHA384 uint16 = 0x00A5 + cipher_TLS_DH_anon_WITH_AES_128_GCM_SHA256 uint16 = 0x00A6 + cipher_TLS_DH_anon_WITH_AES_256_GCM_SHA384 uint16 = 0x00A7 + cipher_TLS_PSK_WITH_AES_128_GCM_SHA256 uint16 = 0x00A8 + cipher_TLS_PSK_WITH_AES_256_GCM_SHA384 uint16 = 0x00A9 + cipher_TLS_DHE_PSK_WITH_AES_128_GCM_SHA256 uint16 = 0x00AA + cipher_TLS_DHE_PSK_WITH_AES_256_GCM_SHA384 uint16 = 0x00AB + cipher_TLS_RSA_PSK_WITH_AES_128_GCM_SHA256 uint16 = 0x00AC + cipher_TLS_RSA_PSK_WITH_AES_256_GCM_SHA384 uint16 = 0x00AD + cipher_TLS_PSK_WITH_AES_128_CBC_SHA256 uint16 = 0x00AE + cipher_TLS_PSK_WITH_AES_256_CBC_SHA384 uint16 = 0x00AF + cipher_TLS_PSK_WITH_NULL_SHA256 uint16 = 0x00B0 + cipher_TLS_PSK_WITH_NULL_SHA384 uint16 = 0x00B1 + cipher_TLS_DHE_PSK_WITH_AES_128_CBC_SHA256 uint16 = 0x00B2 + cipher_TLS_DHE_PSK_WITH_AES_256_CBC_SHA384 uint16 = 0x00B3 + cipher_TLS_DHE_PSK_WITH_NULL_SHA256 uint16 = 0x00B4 + cipher_TLS_DHE_PSK_WITH_NULL_SHA384 uint16 = 0x00B5 + cipher_TLS_RSA_PSK_WITH_AES_128_CBC_SHA256 uint16 = 0x00B6 + cipher_TLS_RSA_PSK_WITH_AES_256_CBC_SHA384 uint16 = 0x00B7 + cipher_TLS_RSA_PSK_WITH_NULL_SHA256 uint16 = 0x00B8 + cipher_TLS_RSA_PSK_WITH_NULL_SHA384 uint16 = 0x00B9 + cipher_TLS_RSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0x00BA + cipher_TLS_DH_DSS_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0x00BB + cipher_TLS_DH_RSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0x00BC + cipher_TLS_DHE_DSS_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0x00BD + cipher_TLS_DHE_RSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0x00BE + cipher_TLS_DH_anon_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0x00BF + cipher_TLS_RSA_WITH_CAMELLIA_256_CBC_SHA256 uint16 = 0x00C0 + cipher_TLS_DH_DSS_WITH_CAMELLIA_256_CBC_SHA256 uint16 = 0x00C1 + cipher_TLS_DH_RSA_WITH_CAMELLIA_256_CBC_SHA256 uint16 = 0x00C2 + cipher_TLS_DHE_DSS_WITH_CAMELLIA_256_CBC_SHA256 uint16 = 0x00C3 + cipher_TLS_DHE_RSA_WITH_CAMELLIA_256_CBC_SHA256 uint16 = 0x00C4 + cipher_TLS_DH_anon_WITH_CAMELLIA_256_CBC_SHA256 uint16 = 0x00C5 + // Unassigned uint16 = 0x00C6-FE + cipher_TLS_EMPTY_RENEGOTIATION_INFO_SCSV uint16 = 0x00FF + // Unassigned uint16 = 0x01-55,* + cipher_TLS_FALLBACK_SCSV uint16 = 0x5600 + // Unassigned uint16 = 0x5601 - 0xC000 + cipher_TLS_ECDH_ECDSA_WITH_NULL_SHA uint16 = 0xC001 + cipher_TLS_ECDH_ECDSA_WITH_RC4_128_SHA uint16 = 0xC002 + cipher_TLS_ECDH_ECDSA_WITH_3DES_EDE_CBC_SHA uint16 = 0xC003 + cipher_TLS_ECDH_ECDSA_WITH_AES_128_CBC_SHA uint16 = 0xC004 + cipher_TLS_ECDH_ECDSA_WITH_AES_256_CBC_SHA uint16 = 0xC005 + cipher_TLS_ECDHE_ECDSA_WITH_NULL_SHA uint16 = 0xC006 + cipher_TLS_ECDHE_ECDSA_WITH_RC4_128_SHA uint16 = 0xC007 + cipher_TLS_ECDHE_ECDSA_WITH_3DES_EDE_CBC_SHA uint16 = 0xC008 + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA uint16 = 0xC009 + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA uint16 = 0xC00A + cipher_TLS_ECDH_RSA_WITH_NULL_SHA uint16 = 0xC00B + cipher_TLS_ECDH_RSA_WITH_RC4_128_SHA uint16 = 0xC00C + cipher_TLS_ECDH_RSA_WITH_3DES_EDE_CBC_SHA uint16 = 0xC00D + cipher_TLS_ECDH_RSA_WITH_AES_128_CBC_SHA uint16 = 0xC00E + cipher_TLS_ECDH_RSA_WITH_AES_256_CBC_SHA uint16 = 0xC00F + cipher_TLS_ECDHE_RSA_WITH_NULL_SHA uint16 = 0xC010 + cipher_TLS_ECDHE_RSA_WITH_RC4_128_SHA uint16 = 0xC011 + cipher_TLS_ECDHE_RSA_WITH_3DES_EDE_CBC_SHA uint16 = 0xC012 + cipher_TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA uint16 = 0xC013 + cipher_TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA uint16 = 0xC014 + cipher_TLS_ECDH_anon_WITH_NULL_SHA uint16 = 0xC015 + cipher_TLS_ECDH_anon_WITH_RC4_128_SHA uint16 = 0xC016 + cipher_TLS_ECDH_anon_WITH_3DES_EDE_CBC_SHA uint16 = 0xC017 + cipher_TLS_ECDH_anon_WITH_AES_128_CBC_SHA uint16 = 0xC018 + cipher_TLS_ECDH_anon_WITH_AES_256_CBC_SHA uint16 = 0xC019 + cipher_TLS_SRP_SHA_WITH_3DES_EDE_CBC_SHA uint16 = 0xC01A + cipher_TLS_SRP_SHA_RSA_WITH_3DES_EDE_CBC_SHA uint16 = 0xC01B + cipher_TLS_SRP_SHA_DSS_WITH_3DES_EDE_CBC_SHA uint16 = 0xC01C + cipher_TLS_SRP_SHA_WITH_AES_128_CBC_SHA uint16 = 0xC01D + cipher_TLS_SRP_SHA_RSA_WITH_AES_128_CBC_SHA uint16 = 0xC01E + cipher_TLS_SRP_SHA_DSS_WITH_AES_128_CBC_SHA uint16 = 0xC01F + cipher_TLS_SRP_SHA_WITH_AES_256_CBC_SHA uint16 = 0xC020 + cipher_TLS_SRP_SHA_RSA_WITH_AES_256_CBC_SHA uint16 = 0xC021 + cipher_TLS_SRP_SHA_DSS_WITH_AES_256_CBC_SHA uint16 = 0xC022 + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256 uint16 = 0xC023 + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384 uint16 = 0xC024 + cipher_TLS_ECDH_ECDSA_WITH_AES_128_CBC_SHA256 uint16 = 0xC025 + cipher_TLS_ECDH_ECDSA_WITH_AES_256_CBC_SHA384 uint16 = 0xC026 + cipher_TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256 uint16 = 0xC027 + cipher_TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA384 uint16 = 0xC028 + cipher_TLS_ECDH_RSA_WITH_AES_128_CBC_SHA256 uint16 = 0xC029 + cipher_TLS_ECDH_RSA_WITH_AES_256_CBC_SHA384 uint16 = 0xC02A + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_GCM_SHA256 uint16 = 0xC02B + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_GCM_SHA384 uint16 = 0xC02C + cipher_TLS_ECDH_ECDSA_WITH_AES_128_GCM_SHA256 uint16 = 0xC02D + cipher_TLS_ECDH_ECDSA_WITH_AES_256_GCM_SHA384 uint16 = 0xC02E + cipher_TLS_ECDHE_RSA_WITH_AES_128_GCM_SHA256 uint16 = 0xC02F + cipher_TLS_ECDHE_RSA_WITH_AES_256_GCM_SHA384 uint16 = 0xC030 + cipher_TLS_ECDH_RSA_WITH_AES_128_GCM_SHA256 uint16 = 0xC031 + cipher_TLS_ECDH_RSA_WITH_AES_256_GCM_SHA384 uint16 = 0xC032 + cipher_TLS_ECDHE_PSK_WITH_RC4_128_SHA uint16 = 0xC033 + cipher_TLS_ECDHE_PSK_WITH_3DES_EDE_CBC_SHA uint16 = 0xC034 + cipher_TLS_ECDHE_PSK_WITH_AES_128_CBC_SHA uint16 = 0xC035 + cipher_TLS_ECDHE_PSK_WITH_AES_256_CBC_SHA uint16 = 0xC036 + cipher_TLS_ECDHE_PSK_WITH_AES_128_CBC_SHA256 uint16 = 0xC037 + cipher_TLS_ECDHE_PSK_WITH_AES_256_CBC_SHA384 uint16 = 0xC038 + cipher_TLS_ECDHE_PSK_WITH_NULL_SHA uint16 = 0xC039 + cipher_TLS_ECDHE_PSK_WITH_NULL_SHA256 uint16 = 0xC03A + cipher_TLS_ECDHE_PSK_WITH_NULL_SHA384 uint16 = 0xC03B + cipher_TLS_RSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC03C + cipher_TLS_RSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC03D + cipher_TLS_DH_DSS_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC03E + cipher_TLS_DH_DSS_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC03F + cipher_TLS_DH_RSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC040 + cipher_TLS_DH_RSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC041 + cipher_TLS_DHE_DSS_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC042 + cipher_TLS_DHE_DSS_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC043 + cipher_TLS_DHE_RSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC044 + cipher_TLS_DHE_RSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC045 + cipher_TLS_DH_anon_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC046 + cipher_TLS_DH_anon_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC047 + cipher_TLS_ECDHE_ECDSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC048 + cipher_TLS_ECDHE_ECDSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC049 + cipher_TLS_ECDH_ECDSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC04A + cipher_TLS_ECDH_ECDSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC04B + cipher_TLS_ECDHE_RSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC04C + cipher_TLS_ECDHE_RSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC04D + cipher_TLS_ECDH_RSA_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC04E + cipher_TLS_ECDH_RSA_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC04F + cipher_TLS_RSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC050 + cipher_TLS_RSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC051 + cipher_TLS_DHE_RSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC052 + cipher_TLS_DHE_RSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC053 + cipher_TLS_DH_RSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC054 + cipher_TLS_DH_RSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC055 + cipher_TLS_DHE_DSS_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC056 + cipher_TLS_DHE_DSS_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC057 + cipher_TLS_DH_DSS_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC058 + cipher_TLS_DH_DSS_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC059 + cipher_TLS_DH_anon_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC05A + cipher_TLS_DH_anon_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC05B + cipher_TLS_ECDHE_ECDSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC05C + cipher_TLS_ECDHE_ECDSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC05D + cipher_TLS_ECDH_ECDSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC05E + cipher_TLS_ECDH_ECDSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC05F + cipher_TLS_ECDHE_RSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC060 + cipher_TLS_ECDHE_RSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC061 + cipher_TLS_ECDH_RSA_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC062 + cipher_TLS_ECDH_RSA_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC063 + cipher_TLS_PSK_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC064 + cipher_TLS_PSK_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC065 + cipher_TLS_DHE_PSK_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC066 + cipher_TLS_DHE_PSK_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC067 + cipher_TLS_RSA_PSK_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC068 + cipher_TLS_RSA_PSK_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC069 + cipher_TLS_PSK_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC06A + cipher_TLS_PSK_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC06B + cipher_TLS_DHE_PSK_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC06C + cipher_TLS_DHE_PSK_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC06D + cipher_TLS_RSA_PSK_WITH_ARIA_128_GCM_SHA256 uint16 = 0xC06E + cipher_TLS_RSA_PSK_WITH_ARIA_256_GCM_SHA384 uint16 = 0xC06F + cipher_TLS_ECDHE_PSK_WITH_ARIA_128_CBC_SHA256 uint16 = 0xC070 + cipher_TLS_ECDHE_PSK_WITH_ARIA_256_CBC_SHA384 uint16 = 0xC071 + cipher_TLS_ECDHE_ECDSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC072 + cipher_TLS_ECDHE_ECDSA_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC073 + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC074 + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC075 + cipher_TLS_ECDHE_RSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC076 + cipher_TLS_ECDHE_RSA_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC077 + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC078 + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC079 + cipher_TLS_RSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC07A + cipher_TLS_RSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC07B + cipher_TLS_DHE_RSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC07C + cipher_TLS_DHE_RSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC07D + cipher_TLS_DH_RSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC07E + cipher_TLS_DH_RSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC07F + cipher_TLS_DHE_DSS_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC080 + cipher_TLS_DHE_DSS_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC081 + cipher_TLS_DH_DSS_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC082 + cipher_TLS_DH_DSS_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC083 + cipher_TLS_DH_anon_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC084 + cipher_TLS_DH_anon_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC085 + cipher_TLS_ECDHE_ECDSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC086 + cipher_TLS_ECDHE_ECDSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC087 + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC088 + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC089 + cipher_TLS_ECDHE_RSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC08A + cipher_TLS_ECDHE_RSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC08B + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC08C + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC08D + cipher_TLS_PSK_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC08E + cipher_TLS_PSK_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC08F + cipher_TLS_DHE_PSK_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC090 + cipher_TLS_DHE_PSK_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC091 + cipher_TLS_RSA_PSK_WITH_CAMELLIA_128_GCM_SHA256 uint16 = 0xC092 + cipher_TLS_RSA_PSK_WITH_CAMELLIA_256_GCM_SHA384 uint16 = 0xC093 + cipher_TLS_PSK_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC094 + cipher_TLS_PSK_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC095 + cipher_TLS_DHE_PSK_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC096 + cipher_TLS_DHE_PSK_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC097 + cipher_TLS_RSA_PSK_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC098 + cipher_TLS_RSA_PSK_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC099 + cipher_TLS_ECDHE_PSK_WITH_CAMELLIA_128_CBC_SHA256 uint16 = 0xC09A + cipher_TLS_ECDHE_PSK_WITH_CAMELLIA_256_CBC_SHA384 uint16 = 0xC09B + cipher_TLS_RSA_WITH_AES_128_CCM uint16 = 0xC09C + cipher_TLS_RSA_WITH_AES_256_CCM uint16 = 0xC09D + cipher_TLS_DHE_RSA_WITH_AES_128_CCM uint16 = 0xC09E + cipher_TLS_DHE_RSA_WITH_AES_256_CCM uint16 = 0xC09F + cipher_TLS_RSA_WITH_AES_128_CCM_8 uint16 = 0xC0A0 + cipher_TLS_RSA_WITH_AES_256_CCM_8 uint16 = 0xC0A1 + cipher_TLS_DHE_RSA_WITH_AES_128_CCM_8 uint16 = 0xC0A2 + cipher_TLS_DHE_RSA_WITH_AES_256_CCM_8 uint16 = 0xC0A3 + cipher_TLS_PSK_WITH_AES_128_CCM uint16 = 0xC0A4 + cipher_TLS_PSK_WITH_AES_256_CCM uint16 = 0xC0A5 + cipher_TLS_DHE_PSK_WITH_AES_128_CCM uint16 = 0xC0A6 + cipher_TLS_DHE_PSK_WITH_AES_256_CCM uint16 = 0xC0A7 + cipher_TLS_PSK_WITH_AES_128_CCM_8 uint16 = 0xC0A8 + cipher_TLS_PSK_WITH_AES_256_CCM_8 uint16 = 0xC0A9 + cipher_TLS_PSK_DHE_WITH_AES_128_CCM_8 uint16 = 0xC0AA + cipher_TLS_PSK_DHE_WITH_AES_256_CCM_8 uint16 = 0xC0AB + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_CCM uint16 = 0xC0AC + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_CCM uint16 = 0xC0AD + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_CCM_8 uint16 = 0xC0AE + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_CCM_8 uint16 = 0xC0AF + // Unassigned uint16 = 0xC0B0-FF + // Unassigned uint16 = 0xC1-CB,* + // Unassigned uint16 = 0xCC00-A7 + cipher_TLS_ECDHE_RSA_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCA8 + cipher_TLS_ECDHE_ECDSA_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCA9 + cipher_TLS_DHE_RSA_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCAA + cipher_TLS_PSK_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCAB + cipher_TLS_ECDHE_PSK_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCAC + cipher_TLS_DHE_PSK_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCAD + cipher_TLS_RSA_PSK_WITH_CHACHA20_POLY1305_SHA256 uint16 = 0xCCAE +) + +// isBadCipher reports whether the cipher is blacklisted by the HTTP/2 spec. +// References: +// https://tools.ietf.org/html/rfc7540#appendix-A +// Reject cipher suites from Appendix A. +// "This list includes those cipher suites that do not +// offer an ephemeral key exchange and those that are +// based on the TLS null, stream or block cipher type" +func isBadCipher(cipher uint16) bool { + switch cipher { + case cipher_TLS_NULL_WITH_NULL_NULL, + cipher_TLS_RSA_WITH_NULL_MD5, + cipher_TLS_RSA_WITH_NULL_SHA, + cipher_TLS_RSA_EXPORT_WITH_RC4_40_MD5, + cipher_TLS_RSA_WITH_RC4_128_MD5, + cipher_TLS_RSA_WITH_RC4_128_SHA, + cipher_TLS_RSA_EXPORT_WITH_RC2_CBC_40_MD5, + cipher_TLS_RSA_WITH_IDEA_CBC_SHA, + cipher_TLS_RSA_EXPORT_WITH_DES40_CBC_SHA, + cipher_TLS_RSA_WITH_DES_CBC_SHA, + cipher_TLS_RSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_DH_DSS_EXPORT_WITH_DES40_CBC_SHA, + cipher_TLS_DH_DSS_WITH_DES_CBC_SHA, + cipher_TLS_DH_DSS_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_DH_RSA_EXPORT_WITH_DES40_CBC_SHA, + cipher_TLS_DH_RSA_WITH_DES_CBC_SHA, + cipher_TLS_DH_RSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_DHE_DSS_EXPORT_WITH_DES40_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_DES_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_DHE_RSA_EXPORT_WITH_DES40_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_DES_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_DH_anon_EXPORT_WITH_RC4_40_MD5, + cipher_TLS_DH_anon_WITH_RC4_128_MD5, + cipher_TLS_DH_anon_EXPORT_WITH_DES40_CBC_SHA, + cipher_TLS_DH_anon_WITH_DES_CBC_SHA, + cipher_TLS_DH_anon_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_KRB5_WITH_DES_CBC_SHA, + cipher_TLS_KRB5_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_KRB5_WITH_RC4_128_SHA, + cipher_TLS_KRB5_WITH_IDEA_CBC_SHA, + cipher_TLS_KRB5_WITH_DES_CBC_MD5, + cipher_TLS_KRB5_WITH_3DES_EDE_CBC_MD5, + cipher_TLS_KRB5_WITH_RC4_128_MD5, + cipher_TLS_KRB5_WITH_IDEA_CBC_MD5, + cipher_TLS_KRB5_EXPORT_WITH_DES_CBC_40_SHA, + cipher_TLS_KRB5_EXPORT_WITH_RC2_CBC_40_SHA, + cipher_TLS_KRB5_EXPORT_WITH_RC4_40_SHA, + cipher_TLS_KRB5_EXPORT_WITH_DES_CBC_40_MD5, + cipher_TLS_KRB5_EXPORT_WITH_RC2_CBC_40_MD5, + cipher_TLS_KRB5_EXPORT_WITH_RC4_40_MD5, + cipher_TLS_PSK_WITH_NULL_SHA, + cipher_TLS_DHE_PSK_WITH_NULL_SHA, + cipher_TLS_RSA_PSK_WITH_NULL_SHA, + cipher_TLS_RSA_WITH_AES_128_CBC_SHA, + cipher_TLS_DH_DSS_WITH_AES_128_CBC_SHA, + cipher_TLS_DH_RSA_WITH_AES_128_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_AES_128_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_AES_128_CBC_SHA, + cipher_TLS_DH_anon_WITH_AES_128_CBC_SHA, + cipher_TLS_RSA_WITH_AES_256_CBC_SHA, + cipher_TLS_DH_DSS_WITH_AES_256_CBC_SHA, + cipher_TLS_DH_RSA_WITH_AES_256_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_AES_256_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_AES_256_CBC_SHA, + cipher_TLS_DH_anon_WITH_AES_256_CBC_SHA, + cipher_TLS_RSA_WITH_NULL_SHA256, + cipher_TLS_RSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_RSA_WITH_AES_256_CBC_SHA256, + cipher_TLS_DH_DSS_WITH_AES_128_CBC_SHA256, + cipher_TLS_DH_RSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_DHE_DSS_WITH_AES_128_CBC_SHA256, + cipher_TLS_RSA_WITH_CAMELLIA_128_CBC_SHA, + cipher_TLS_DH_DSS_WITH_CAMELLIA_128_CBC_SHA, + cipher_TLS_DH_RSA_WITH_CAMELLIA_128_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_CAMELLIA_128_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_CAMELLIA_128_CBC_SHA, + cipher_TLS_DH_anon_WITH_CAMELLIA_128_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_DH_DSS_WITH_AES_256_CBC_SHA256, + cipher_TLS_DH_RSA_WITH_AES_256_CBC_SHA256, + cipher_TLS_DHE_DSS_WITH_AES_256_CBC_SHA256, + cipher_TLS_DHE_RSA_WITH_AES_256_CBC_SHA256, + cipher_TLS_DH_anon_WITH_AES_128_CBC_SHA256, + cipher_TLS_DH_anon_WITH_AES_256_CBC_SHA256, + cipher_TLS_RSA_WITH_CAMELLIA_256_CBC_SHA, + cipher_TLS_DH_DSS_WITH_CAMELLIA_256_CBC_SHA, + cipher_TLS_DH_RSA_WITH_CAMELLIA_256_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_CAMELLIA_256_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_CAMELLIA_256_CBC_SHA, + cipher_TLS_DH_anon_WITH_CAMELLIA_256_CBC_SHA, + cipher_TLS_PSK_WITH_RC4_128_SHA, + cipher_TLS_PSK_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_PSK_WITH_AES_128_CBC_SHA, + cipher_TLS_PSK_WITH_AES_256_CBC_SHA, + cipher_TLS_DHE_PSK_WITH_RC4_128_SHA, + cipher_TLS_DHE_PSK_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_DHE_PSK_WITH_AES_128_CBC_SHA, + cipher_TLS_DHE_PSK_WITH_AES_256_CBC_SHA, + cipher_TLS_RSA_PSK_WITH_RC4_128_SHA, + cipher_TLS_RSA_PSK_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_RSA_PSK_WITH_AES_128_CBC_SHA, + cipher_TLS_RSA_PSK_WITH_AES_256_CBC_SHA, + cipher_TLS_RSA_WITH_SEED_CBC_SHA, + cipher_TLS_DH_DSS_WITH_SEED_CBC_SHA, + cipher_TLS_DH_RSA_WITH_SEED_CBC_SHA, + cipher_TLS_DHE_DSS_WITH_SEED_CBC_SHA, + cipher_TLS_DHE_RSA_WITH_SEED_CBC_SHA, + cipher_TLS_DH_anon_WITH_SEED_CBC_SHA, + cipher_TLS_RSA_WITH_AES_128_GCM_SHA256, + cipher_TLS_RSA_WITH_AES_256_GCM_SHA384, + cipher_TLS_DH_RSA_WITH_AES_128_GCM_SHA256, + cipher_TLS_DH_RSA_WITH_AES_256_GCM_SHA384, + cipher_TLS_DH_DSS_WITH_AES_128_GCM_SHA256, + cipher_TLS_DH_DSS_WITH_AES_256_GCM_SHA384, + cipher_TLS_DH_anon_WITH_AES_128_GCM_SHA256, + cipher_TLS_DH_anon_WITH_AES_256_GCM_SHA384, + cipher_TLS_PSK_WITH_AES_128_GCM_SHA256, + cipher_TLS_PSK_WITH_AES_256_GCM_SHA384, + cipher_TLS_RSA_PSK_WITH_AES_128_GCM_SHA256, + cipher_TLS_RSA_PSK_WITH_AES_256_GCM_SHA384, + cipher_TLS_PSK_WITH_AES_128_CBC_SHA256, + cipher_TLS_PSK_WITH_AES_256_CBC_SHA384, + cipher_TLS_PSK_WITH_NULL_SHA256, + cipher_TLS_PSK_WITH_NULL_SHA384, + cipher_TLS_DHE_PSK_WITH_AES_128_CBC_SHA256, + cipher_TLS_DHE_PSK_WITH_AES_256_CBC_SHA384, + cipher_TLS_DHE_PSK_WITH_NULL_SHA256, + cipher_TLS_DHE_PSK_WITH_NULL_SHA384, + cipher_TLS_RSA_PSK_WITH_AES_128_CBC_SHA256, + cipher_TLS_RSA_PSK_WITH_AES_256_CBC_SHA384, + cipher_TLS_RSA_PSK_WITH_NULL_SHA256, + cipher_TLS_RSA_PSK_WITH_NULL_SHA384, + cipher_TLS_RSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_DH_DSS_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_DH_RSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_DHE_DSS_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_DHE_RSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_DH_anon_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_RSA_WITH_CAMELLIA_256_CBC_SHA256, + cipher_TLS_DH_DSS_WITH_CAMELLIA_256_CBC_SHA256, + cipher_TLS_DH_RSA_WITH_CAMELLIA_256_CBC_SHA256, + cipher_TLS_DHE_DSS_WITH_CAMELLIA_256_CBC_SHA256, + cipher_TLS_DHE_RSA_WITH_CAMELLIA_256_CBC_SHA256, + cipher_TLS_DH_anon_WITH_CAMELLIA_256_CBC_SHA256, + cipher_TLS_EMPTY_RENEGOTIATION_INFO_SCSV, + cipher_TLS_ECDH_ECDSA_WITH_NULL_SHA, + cipher_TLS_ECDH_ECDSA_WITH_RC4_128_SHA, + cipher_TLS_ECDH_ECDSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_ECDH_ECDSA_WITH_AES_128_CBC_SHA, + cipher_TLS_ECDH_ECDSA_WITH_AES_256_CBC_SHA, + cipher_TLS_ECDHE_ECDSA_WITH_NULL_SHA, + cipher_TLS_ECDHE_ECDSA_WITH_RC4_128_SHA, + cipher_TLS_ECDHE_ECDSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA, + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA, + cipher_TLS_ECDH_RSA_WITH_NULL_SHA, + cipher_TLS_ECDH_RSA_WITH_RC4_128_SHA, + cipher_TLS_ECDH_RSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_ECDH_RSA_WITH_AES_128_CBC_SHA, + cipher_TLS_ECDH_RSA_WITH_AES_256_CBC_SHA, + cipher_TLS_ECDHE_RSA_WITH_NULL_SHA, + cipher_TLS_ECDHE_RSA_WITH_RC4_128_SHA, + cipher_TLS_ECDHE_RSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA, + cipher_TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA, + cipher_TLS_ECDH_anon_WITH_NULL_SHA, + cipher_TLS_ECDH_anon_WITH_RC4_128_SHA, + cipher_TLS_ECDH_anon_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_ECDH_anon_WITH_AES_128_CBC_SHA, + cipher_TLS_ECDH_anon_WITH_AES_256_CBC_SHA, + cipher_TLS_SRP_SHA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_SRP_SHA_RSA_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_SRP_SHA_DSS_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_SRP_SHA_WITH_AES_128_CBC_SHA, + cipher_TLS_SRP_SHA_RSA_WITH_AES_128_CBC_SHA, + cipher_TLS_SRP_SHA_DSS_WITH_AES_128_CBC_SHA, + cipher_TLS_SRP_SHA_WITH_AES_256_CBC_SHA, + cipher_TLS_SRP_SHA_RSA_WITH_AES_256_CBC_SHA, + cipher_TLS_SRP_SHA_DSS_WITH_AES_256_CBC_SHA, + cipher_TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA384, + cipher_TLS_ECDH_ECDSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_ECDH_ECDSA_WITH_AES_256_CBC_SHA384, + cipher_TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA384, + cipher_TLS_ECDH_RSA_WITH_AES_128_CBC_SHA256, + cipher_TLS_ECDH_RSA_WITH_AES_256_CBC_SHA384, + cipher_TLS_ECDH_ECDSA_WITH_AES_128_GCM_SHA256, + cipher_TLS_ECDH_ECDSA_WITH_AES_256_GCM_SHA384, + cipher_TLS_ECDH_RSA_WITH_AES_128_GCM_SHA256, + cipher_TLS_ECDH_RSA_WITH_AES_256_GCM_SHA384, + cipher_TLS_ECDHE_PSK_WITH_RC4_128_SHA, + cipher_TLS_ECDHE_PSK_WITH_3DES_EDE_CBC_SHA, + cipher_TLS_ECDHE_PSK_WITH_AES_128_CBC_SHA, + cipher_TLS_ECDHE_PSK_WITH_AES_256_CBC_SHA, + cipher_TLS_ECDHE_PSK_WITH_AES_128_CBC_SHA256, + cipher_TLS_ECDHE_PSK_WITH_AES_256_CBC_SHA384, + cipher_TLS_ECDHE_PSK_WITH_NULL_SHA, + cipher_TLS_ECDHE_PSK_WITH_NULL_SHA256, + cipher_TLS_ECDHE_PSK_WITH_NULL_SHA384, + cipher_TLS_RSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_RSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_DH_DSS_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_DH_DSS_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_DH_RSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_DH_RSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_DHE_DSS_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_DHE_DSS_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_DHE_RSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_DHE_RSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_DH_anon_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_DH_anon_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_ECDHE_ECDSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_ECDHE_ECDSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_ECDH_ECDSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_ECDH_ECDSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_ECDHE_RSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_ECDHE_RSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_ECDH_RSA_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_ECDH_RSA_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_RSA_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_RSA_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_DH_RSA_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_DH_RSA_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_DH_DSS_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_DH_DSS_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_DH_anon_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_DH_anon_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_ECDH_ECDSA_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_ECDH_ECDSA_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_ECDH_RSA_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_ECDH_RSA_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_PSK_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_PSK_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_DHE_PSK_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_DHE_PSK_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_RSA_PSK_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_RSA_PSK_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_PSK_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_PSK_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_RSA_PSK_WITH_ARIA_128_GCM_SHA256, + cipher_TLS_RSA_PSK_WITH_ARIA_256_GCM_SHA384, + cipher_TLS_ECDHE_PSK_WITH_ARIA_128_CBC_SHA256, + cipher_TLS_ECDHE_PSK_WITH_ARIA_256_CBC_SHA384, + cipher_TLS_ECDHE_ECDSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_ECDHE_ECDSA_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_ECDHE_RSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_ECDHE_RSA_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_RSA_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_RSA_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_DH_RSA_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_DH_RSA_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_DH_DSS_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_DH_DSS_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_DH_anon_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_DH_anon_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_ECDH_ECDSA_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_ECDH_RSA_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_PSK_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_PSK_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_RSA_PSK_WITH_CAMELLIA_128_GCM_SHA256, + cipher_TLS_RSA_PSK_WITH_CAMELLIA_256_GCM_SHA384, + cipher_TLS_PSK_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_PSK_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_DHE_PSK_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_DHE_PSK_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_RSA_PSK_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_RSA_PSK_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_ECDHE_PSK_WITH_CAMELLIA_128_CBC_SHA256, + cipher_TLS_ECDHE_PSK_WITH_CAMELLIA_256_CBC_SHA384, + cipher_TLS_RSA_WITH_AES_128_CCM, + cipher_TLS_RSA_WITH_AES_256_CCM, + cipher_TLS_RSA_WITH_AES_128_CCM_8, + cipher_TLS_RSA_WITH_AES_256_CCM_8, + cipher_TLS_PSK_WITH_AES_128_CCM, + cipher_TLS_PSK_WITH_AES_256_CCM, + cipher_TLS_PSK_WITH_AES_128_CCM_8, + cipher_TLS_PSK_WITH_AES_256_CCM_8: + return true + default: + return false + } +} diff --git a/vendor/golang.org/x/net/http2/client_conn_pool.go b/vendor/golang.org/x/net/http2/client_conn_pool.go index b139412..bdf5652 100644 --- a/vendor/golang.org/x/net/http2/client_conn_pool.go +++ b/vendor/golang.org/x/net/http2/client_conn_pool.go @@ -247,7 +247,7 @@ func filterOutClientConn(in []*ClientConn, exclude *ClientConn) []*ClientConn { } // noDialClientConnPool is an implementation of http2.ClientConnPool -// which never dials. We let the HTTP/1.1 client dial and use its TLS +// which never dials. We let the HTTP/1.1 client dial and use its TLS // connection instead. type noDialClientConnPool struct{ *clientConnPool } diff --git a/vendor/golang.org/x/net/http2/databuffer.go b/vendor/golang.org/x/net/http2/databuffer.go new file mode 100644 index 0000000..a3067f8 --- /dev/null +++ b/vendor/golang.org/x/net/http2/databuffer.go @@ -0,0 +1,146 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package http2 + +import ( + "errors" + "fmt" + "sync" +) + +// Buffer chunks are allocated from a pool to reduce pressure on GC. +// The maximum wasted space per dataBuffer is 2x the largest size class, +// which happens when the dataBuffer has multiple chunks and there is +// one unread byte in both the first and last chunks. We use a few size +// classes to minimize overheads for servers that typically receive very +// small request bodies. +// +// TODO: Benchmark to determine if the pools are necessary. The GC may have +// improved enough that we can instead allocate chunks like this: +// make([]byte, max(16<<10, expectedBytesRemaining)) +var ( + dataChunkSizeClasses = []int{ + 1 << 10, + 2 << 10, + 4 << 10, + 8 << 10, + 16 << 10, + } + dataChunkPools = [...]sync.Pool{ + {New: func() interface{} { return make([]byte, 1<<10) }}, + {New: func() interface{} { return make([]byte, 2<<10) }}, + {New: func() interface{} { return make([]byte, 4<<10) }}, + {New: func() interface{} { return make([]byte, 8<<10) }}, + {New: func() interface{} { return make([]byte, 16<<10) }}, + } +) + +func getDataBufferChunk(size int64) []byte { + i := 0 + for ; i < len(dataChunkSizeClasses)-1; i++ { + if size <= int64(dataChunkSizeClasses[i]) { + break + } + } + return dataChunkPools[i].Get().([]byte) +} + +func putDataBufferChunk(p []byte) { + for i, n := range dataChunkSizeClasses { + if len(p) == n { + dataChunkPools[i].Put(p) + return + } + } + panic(fmt.Sprintf("unexpected buffer len=%v", len(p))) +} + +// dataBuffer is an io.ReadWriter backed by a list of data chunks. +// Each dataBuffer is used to read DATA frames on a single stream. +// The buffer is divided into chunks so the server can limit the +// total memory used by a single connection without limiting the +// request body size on any single stream. +type dataBuffer struct { + chunks [][]byte + r int // next byte to read is chunks[0][r] + w int // next byte to write is chunks[len(chunks)-1][w] + size int // total buffered bytes + expected int64 // we expect at least this many bytes in future Write calls (ignored if <= 0) +} + +var errReadEmpty = errors.New("read from empty dataBuffer") + +// Read copies bytes from the buffer into p. +// It is an error to read when no data is available. +func (b *dataBuffer) Read(p []byte) (int, error) { + if b.size == 0 { + return 0, errReadEmpty + } + var ntotal int + for len(p) > 0 && b.size > 0 { + readFrom := b.bytesFromFirstChunk() + n := copy(p, readFrom) + p = p[n:] + ntotal += n + b.r += n + b.size -= n + // If the first chunk has been consumed, advance to the next chunk. + if b.r == len(b.chunks[0]) { + putDataBufferChunk(b.chunks[0]) + end := len(b.chunks) - 1 + copy(b.chunks[:end], b.chunks[1:]) + b.chunks[end] = nil + b.chunks = b.chunks[:end] + b.r = 0 + } + } + return ntotal, nil +} + +func (b *dataBuffer) bytesFromFirstChunk() []byte { + if len(b.chunks) == 1 { + return b.chunks[0][b.r:b.w] + } + return b.chunks[0][b.r:] +} + +// Len returns the number of bytes of the unread portion of the buffer. +func (b *dataBuffer) Len() int { + return b.size +} + +// Write appends p to the buffer. +func (b *dataBuffer) Write(p []byte) (int, error) { + ntotal := len(p) + for len(p) > 0 { + // If the last chunk is empty, allocate a new chunk. Try to allocate + // enough to fully copy p plus any additional bytes we expect to + // receive. However, this may allocate less than len(p). + want := int64(len(p)) + if b.expected > want { + want = b.expected + } + chunk := b.lastChunkOrAlloc(want) + n := copy(chunk[b.w:], p) + p = p[n:] + b.w += n + b.size += n + b.expected -= int64(n) + } + return ntotal, nil +} + +func (b *dataBuffer) lastChunkOrAlloc(want int64) []byte { + if len(b.chunks) != 0 { + last := b.chunks[len(b.chunks)-1] + if b.w < len(last) { + return last + } + } + chunk := getDataBufferChunk(want) + b.chunks = append(b.chunks, chunk) + b.w = 0 + return chunk +} diff --git a/vendor/golang.org/x/net/http2/fixed_buffer.go b/vendor/golang.org/x/net/http2/fixed_buffer.go deleted file mode 100644 index 47da0f0..0000000 --- a/vendor/golang.org/x/net/http2/fixed_buffer.go +++ /dev/null @@ -1,60 +0,0 @@ -// Copyright 2014 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -package http2 - -import ( - "errors" -) - -// fixedBuffer is an io.ReadWriter backed by a fixed size buffer. -// It never allocates, but moves old data as new data is written. -type fixedBuffer struct { - buf []byte - r, w int -} - -var ( - errReadEmpty = errors.New("read from empty fixedBuffer") - errWriteFull = errors.New("write on full fixedBuffer") -) - -// Read copies bytes from the buffer into p. -// It is an error to read when no data is available. -func (b *fixedBuffer) Read(p []byte) (n int, err error) { - if b.r == b.w { - return 0, errReadEmpty - } - n = copy(p, b.buf[b.r:b.w]) - b.r += n - if b.r == b.w { - b.r = 0 - b.w = 0 - } - return n, nil -} - -// Len returns the number of bytes of the unread portion of the buffer. -func (b *fixedBuffer) Len() int { - return b.w - b.r -} - -// Write copies bytes from p into the buffer. -// It is an error to write more data than the buffer can hold. -func (b *fixedBuffer) Write(p []byte) (n int, err error) { - // Slide existing data to beginning. - if b.r > 0 && len(p) > len(b.buf)-b.w { - copy(b.buf, b.buf[b.r:b.w]) - b.w -= b.r - b.r = 0 - } - - // Write new data. - n = copy(b.buf[b.w:], p) - b.w += n - if n < len(p) { - err = errWriteFull - } - return n, err -} diff --git a/vendor/golang.org/x/net/http2/frame.go b/vendor/golang.org/x/net/http2/frame.go index 358833f..3b14890 100644 --- a/vendor/golang.org/x/net/http2/frame.go +++ b/vendor/golang.org/x/net/http2/frame.go @@ -122,7 +122,7 @@ var flagName = map[FrameType]map[Flags]string{ // a frameParser parses a frame given its FrameHeader and payload // bytes. The length of payload will always equal fh.Length (which // might be 0). -type frameParser func(fh FrameHeader, payload []byte) (Frame, error) +type frameParser func(fc *frameCache, fh FrameHeader, payload []byte) (Frame, error) var frameParsers = map[FrameType]frameParser{ FrameData: parseDataFrame, @@ -312,7 +312,7 @@ type Framer struct { MaxHeaderListSize uint32 // TODO: track which type of frame & with which flags was sent - // last. Then return an error (unless AllowIllegalWrites) if + // last. Then return an error (unless AllowIllegalWrites) if // we're in the middle of a header block and a // non-Continuation or Continuation on a different stream is // attempted to be written. @@ -323,6 +323,8 @@ type Framer struct { debugFramerBuf *bytes.Buffer debugReadLoggerf func(string, ...interface{}) debugWriteLoggerf func(string, ...interface{}) + + frameCache *frameCache // nil if frames aren't reused (default) } func (fr *Framer) maxHeaderListSize() uint32 { @@ -398,6 +400,27 @@ const ( maxFrameSize = 1<<24 - 1 ) +// SetReuseFrames allows the Framer to reuse Frames. +// If called on a Framer, Frames returned by calls to ReadFrame are only +// valid until the next call to ReadFrame. +func (fr *Framer) SetReuseFrames() { + if fr.frameCache != nil { + return + } + fr.frameCache = &frameCache{} +} + +type frameCache struct { + dataFrame DataFrame +} + +func (fc *frameCache) getDataFrame() *DataFrame { + if fc == nil { + return &DataFrame{} + } + return &fc.dataFrame +} + // NewFramer returns a Framer that writes frames to w and reads them from r. func NewFramer(w io.Writer, r io.Reader) *Framer { fr := &Framer{ @@ -477,7 +500,7 @@ func (fr *Framer) ReadFrame() (Frame, error) { if _, err := io.ReadFull(fr.r, payload); err != nil { return nil, err } - f, err := typeFrameParser(fh.Type)(fh, payload) + f, err := typeFrameParser(fh.Type)(fr.frameCache, fh, payload) if err != nil { if ce, ok := err.(connError); ok { return nil, fr.connError(ce.Code, ce.Reason) @@ -565,7 +588,7 @@ func (f *DataFrame) Data() []byte { return f.data } -func parseDataFrame(fh FrameHeader, payload []byte) (Frame, error) { +func parseDataFrame(fc *frameCache, fh FrameHeader, payload []byte) (Frame, error) { if fh.StreamID == 0 { // DATA frames MUST be associated with a stream. If a // DATA frame is received whose stream identifier @@ -574,9 +597,9 @@ func parseDataFrame(fh FrameHeader, payload []byte) (Frame, error) { // PROTOCOL_ERROR. return nil, connError{ErrCodeProtocol, "DATA frame with stream ID 0"} } - f := &DataFrame{ - FrameHeader: fh, - } + f := fc.getDataFrame() + f.FrameHeader = fh + var padSize byte if fh.Flags.Has(FlagDataPadded) { var err error @@ -600,6 +623,7 @@ var ( errStreamID = errors.New("invalid stream ID") errDepStreamID = errors.New("invalid dependent stream ID") errPadLength = errors.New("pad length too large") + errPadBytes = errors.New("padding bytes must all be zeros unless AllowIllegalWrites is enabled") ) func validStreamIDOrZero(streamID uint32) bool { @@ -623,6 +647,7 @@ func (f *Framer) WriteData(streamID uint32, endStream bool, data []byte) error { // // If pad is nil, the padding bit is not sent. // The length of pad must not exceed 255 bytes. +// The bytes of pad must all be zero, unless f.AllowIllegalWrites is set. // // It will perform exactly one Write to the underlying Writer. // It is the caller's responsibility not to violate the maximum frame size @@ -631,8 +656,18 @@ func (f *Framer) WriteDataPadded(streamID uint32, endStream bool, data, pad []by if !validStreamID(streamID) && !f.AllowIllegalWrites { return errStreamID } - if len(pad) > 255 { - return errPadLength + if len(pad) > 0 { + if len(pad) > 255 { + return errPadLength + } + if !f.AllowIllegalWrites { + for _, b := range pad { + if b != 0 { + // "Padding octets MUST be set to zero when sending." + return errPadBytes + } + } + } } var flags Flags if endStream { @@ -660,10 +695,10 @@ type SettingsFrame struct { p []byte } -func parseSettingsFrame(fh FrameHeader, p []byte) (Frame, error) { +func parseSettingsFrame(_ *frameCache, fh FrameHeader, p []byte) (Frame, error) { if fh.Flags.Has(FlagSettingsAck) && fh.Length > 0 { // When this (ACK 0x1) bit is set, the payload of the - // SETTINGS frame MUST be empty. Receipt of a + // SETTINGS frame MUST be empty. Receipt of a // SETTINGS frame with the ACK flag set and a length // field value other than 0 MUST be treated as a // connection error (Section 5.4.1) of type @@ -672,7 +707,7 @@ func parseSettingsFrame(fh FrameHeader, p []byte) (Frame, error) { } if fh.StreamID != 0 { // SETTINGS frames always apply to a connection, - // never a single stream. The stream identifier for a + // never a single stream. The stream identifier for a // SETTINGS frame MUST be zero (0x0). If an endpoint // receives a SETTINGS frame whose stream identifier // field is anything other than 0x0, the endpoint MUST @@ -762,7 +797,7 @@ type PingFrame struct { func (f *PingFrame) IsAck() bool { return f.Flags.Has(FlagPingAck) } -func parsePingFrame(fh FrameHeader, payload []byte) (Frame, error) { +func parsePingFrame(_ *frameCache, fh FrameHeader, payload []byte) (Frame, error) { if len(payload) != 8 { return nil, ConnectionError(ErrCodeFrameSize) } @@ -802,7 +837,7 @@ func (f *GoAwayFrame) DebugData() []byte { return f.debugData } -func parseGoAwayFrame(fh FrameHeader, p []byte) (Frame, error) { +func parseGoAwayFrame(_ *frameCache, fh FrameHeader, p []byte) (Frame, error) { if fh.StreamID != 0 { return nil, ConnectionError(ErrCodeProtocol) } @@ -842,7 +877,7 @@ func (f *UnknownFrame) Payload() []byte { return f.p } -func parseUnknownFrame(fh FrameHeader, p []byte) (Frame, error) { +func parseUnknownFrame(_ *frameCache, fh FrameHeader, p []byte) (Frame, error) { return &UnknownFrame{fh, p}, nil } @@ -853,7 +888,7 @@ type WindowUpdateFrame struct { Increment uint32 // never read with high bit set } -func parseWindowUpdateFrame(fh FrameHeader, p []byte) (Frame, error) { +func parseWindowUpdateFrame(_ *frameCache, fh FrameHeader, p []byte) (Frame, error) { if len(p) != 4 { return nil, ConnectionError(ErrCodeFrameSize) } @@ -918,12 +953,12 @@ func (f *HeadersFrame) HasPriority() bool { return f.FrameHeader.Flags.Has(FlagHeadersPriority) } -func parseHeadersFrame(fh FrameHeader, p []byte) (_ Frame, err error) { +func parseHeadersFrame(_ *frameCache, fh FrameHeader, p []byte) (_ Frame, err error) { hf := &HeadersFrame{ FrameHeader: fh, } if fh.StreamID == 0 { - // HEADERS frames MUST be associated with a stream. If a HEADERS frame + // HEADERS frames MUST be associated with a stream. If a HEADERS frame // is received whose stream identifier field is 0x0, the recipient MUST // respond with a connection error (Section 5.4.1) of type // PROTOCOL_ERROR. @@ -1045,7 +1080,7 @@ type PriorityParam struct { Exclusive bool // Weight is the stream's zero-indexed weight. It should be - // set together with StreamDep, or neither should be set. Per + // set together with StreamDep, or neither should be set. Per // the spec, "Add one to the value to obtain a weight between // 1 and 256." Weight uint8 @@ -1055,7 +1090,7 @@ func (p PriorityParam) IsZero() bool { return p == PriorityParam{} } -func parsePriorityFrame(fh FrameHeader, payload []byte) (Frame, error) { +func parsePriorityFrame(_ *frameCache, fh FrameHeader, payload []byte) (Frame, error) { if fh.StreamID == 0 { return nil, connError{ErrCodeProtocol, "PRIORITY frame with stream ID 0"} } @@ -1102,7 +1137,7 @@ type RSTStreamFrame struct { ErrCode ErrCode } -func parseRSTStreamFrame(fh FrameHeader, p []byte) (Frame, error) { +func parseRSTStreamFrame(_ *frameCache, fh FrameHeader, p []byte) (Frame, error) { if len(p) != 4 { return nil, ConnectionError(ErrCodeFrameSize) } @@ -1132,7 +1167,7 @@ type ContinuationFrame struct { headerFragBuf []byte } -func parseContinuationFrame(fh FrameHeader, p []byte) (Frame, error) { +func parseContinuationFrame(_ *frameCache, fh FrameHeader, p []byte) (Frame, error) { if fh.StreamID == 0 { return nil, connError{ErrCodeProtocol, "CONTINUATION frame with stream ID 0"} } @@ -1182,7 +1217,7 @@ func (f *PushPromiseFrame) HeadersEnded() bool { return f.FrameHeader.Flags.Has(FlagPushPromiseEndHeaders) } -func parsePushPromise(fh FrameHeader, p []byte) (_ Frame, err error) { +func parsePushPromise(_ *frameCache, fh FrameHeader, p []byte) (_ Frame, err error) { pp := &PushPromiseFrame{ FrameHeader: fh, } diff --git a/vendor/golang.org/x/net/http2/go16.go b/vendor/golang.org/x/net/http2/go16.go index 2b72855..00b2e9e 100644 --- a/vendor/golang.org/x/net/http2/go16.go +++ b/vendor/golang.org/x/net/http2/go16.go @@ -7,7 +7,6 @@ package http2 import ( - "crypto/tls" "net/http" "time" ) @@ -15,29 +14,3 @@ import ( func transportExpectContinueTimeout(t1 *http.Transport) time.Duration { return t1.ExpectContinueTimeout } - -// isBadCipher reports whether the cipher is blacklisted by the HTTP/2 spec. -func isBadCipher(cipher uint16) bool { - switch cipher { - case tls.TLS_RSA_WITH_RC4_128_SHA, - tls.TLS_RSA_WITH_3DES_EDE_CBC_SHA, - tls.TLS_RSA_WITH_AES_128_CBC_SHA, - tls.TLS_RSA_WITH_AES_256_CBC_SHA, - tls.TLS_RSA_WITH_AES_128_GCM_SHA256, - tls.TLS_RSA_WITH_AES_256_GCM_SHA384, - tls.TLS_ECDHE_ECDSA_WITH_RC4_128_SHA, - tls.TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA, - tls.TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA, - tls.TLS_ECDHE_RSA_WITH_RC4_128_SHA, - tls.TLS_ECDHE_RSA_WITH_3DES_EDE_CBC_SHA, - tls.TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA, - tls.TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: - // Reject cipher suites from Appendix A. - // "This list includes those cipher suites that do not - // offer an ephemeral key exchange and those that are - // based on the TLS null, stream or block cipher type" - return true - default: - return false - } -} diff --git a/vendor/golang.org/x/net/http2/go18.go b/vendor/golang.org/x/net/http2/go18.go index 633202c..73cc238 100644 --- a/vendor/golang.org/x/net/http2/go18.go +++ b/vendor/golang.org/x/net/http2/go18.go @@ -12,7 +12,11 @@ import ( "net/http" ) -func cloneTLSConfig(c *tls.Config) *tls.Config { return c.Clone() } +func cloneTLSConfig(c *tls.Config) *tls.Config { + c2 := c.Clone() + c2.GetClientCertificate = c.GetClientCertificate // golang.org/issue/19264 + return c2 +} var _ http.Pusher = (*responseWriter)(nil) diff --git a/vendor/golang.org/x/net/http2/hpack/encode.go b/vendor/golang.org/x/net/http2/hpack/encode.go index f9bb033..54726c2 100644 --- a/vendor/golang.org/x/net/http2/hpack/encode.go +++ b/vendor/golang.org/x/net/http2/hpack/encode.go @@ -39,13 +39,14 @@ func NewEncoder(w io.Writer) *Encoder { tableSizeUpdate: false, w: w, } + e.dynTab.table.init() e.dynTab.setMaxSize(initialHeaderTableSize) return e } // WriteField encodes f into a single Write to e's underlying Writer. // This function may also produce bytes for "Header Table Size Update" -// if necessary. If produced, it is done before encoding f. +// if necessary. If produced, it is done before encoding f. func (e *Encoder) WriteField(f HeaderField) error { e.buf = e.buf[:0] @@ -88,29 +89,17 @@ func (e *Encoder) WriteField(f HeaderField) error { // only name matches, i points to that index and nameValueMatch // becomes false. func (e *Encoder) searchTable(f HeaderField) (i uint64, nameValueMatch bool) { - for idx, hf := range staticTable { - if !constantTimeStringCompare(hf.Name, f.Name) { - continue - } - if i == 0 { - i = uint64(idx + 1) - } - if f.Sensitive { - continue - } - if !constantTimeStringCompare(hf.Value, f.Value) { - continue - } - i = uint64(idx + 1) - nameValueMatch = true - return + i, nameValueMatch = staticTable.search(f) + if nameValueMatch { + return i, true } - j, nameValueMatch := e.dynTab.search(f) + j, nameValueMatch := e.dynTab.table.search(f) if nameValueMatch || (i == 0 && j != 0) { - i = j + uint64(len(staticTable)) + return j + uint64(staticTable.len()), nameValueMatch } - return + + return i, false } // SetMaxDynamicTableSize changes the dynamic header table size to v. diff --git a/vendor/golang.org/x/net/http2/hpack/hpack.go b/vendor/golang.org/x/net/http2/hpack/hpack.go index 135b9f6..176644a 100644 --- a/vendor/golang.org/x/net/http2/hpack/hpack.go +++ b/vendor/golang.org/x/net/http2/hpack/hpack.go @@ -61,7 +61,7 @@ func (hf HeaderField) String() string { func (hf HeaderField) Size() uint32 { // http://http2.github.io/http2-spec/compression.html#rfc.section.4.1 // "The size of the dynamic table is the sum of the size of - // its entries. The size of an entry is the sum of its name's + // its entries. The size of an entry is the sum of its name's // length in octets (as defined in Section 5.2), its value's // length in octets (see Section 5.2), plus 32. The size of // an entry is calculated using the length of the name and @@ -102,6 +102,7 @@ func NewDecoder(maxDynamicTableSize uint32, emitFunc func(f HeaderField)) *Decod emit: emitFunc, emitEnabled: true, } + d.dynTab.table.init() d.dynTab.allowedMaxSize = maxDynamicTableSize d.dynTab.setMaxSize(maxDynamicTableSize) return d @@ -154,12 +155,9 @@ func (d *Decoder) SetAllowedMaxDynamicTableSize(v uint32) { } type dynamicTable struct { - // ents is the FIFO described at // http://http2.github.io/http2-spec/compression.html#rfc.section.2.3.2 - // The newest (low index) is append at the end, and items are - // evicted from the front. - ents []HeaderField - size uint32 + table headerFieldTable + size uint32 // in bytes maxSize uint32 // current maxSize allowedMaxSize uint32 // maxSize may go up to this, inclusive } @@ -169,95 +167,45 @@ func (dt *dynamicTable) setMaxSize(v uint32) { dt.evict() } -// TODO: change dynamicTable to be a struct with a slice and a size int field, -// per http://http2.github.io/http2-spec/compression.html#rfc.section.4.1: -// -// -// Then make add increment the size. maybe the max size should move from Decoder to -// dynamicTable and add should return an ok bool if there was enough space. -// -// Later we'll need a remove operation on dynamicTable. - func (dt *dynamicTable) add(f HeaderField) { - dt.ents = append(dt.ents, f) + dt.table.addEntry(f) dt.size += f.Size() dt.evict() } -// If we're too big, evict old stuff (front of the slice) +// If we're too big, evict old stuff. func (dt *dynamicTable) evict() { - base := dt.ents // keep base pointer of slice - for dt.size > dt.maxSize { - dt.size -= dt.ents[0].Size() - dt.ents = dt.ents[1:] + var n int + for dt.size > dt.maxSize && n < dt.table.len() { + dt.size -= dt.table.ents[n].Size() + n++ } - - // Shift slice contents down if we evicted things. - if len(dt.ents) != len(base) { - copy(base, dt.ents) - dt.ents = base[:len(dt.ents)] - } -} - -// constantTimeStringCompare compares string a and b in a constant -// time manner. -func constantTimeStringCompare(a, b string) bool { - if len(a) != len(b) { - return false - } - - c := byte(0) - - for i := 0; i < len(a); i++ { - c |= a[i] ^ b[i] - } - - return c == 0 -} - -// Search searches f in the table. The return value i is 0 if there is -// no name match. If there is name match or name/value match, i is the -// index of that entry (1-based). If both name and value match, -// nameValueMatch becomes true. -func (dt *dynamicTable) search(f HeaderField) (i uint64, nameValueMatch bool) { - l := len(dt.ents) - for j := l - 1; j >= 0; j-- { - ent := dt.ents[j] - if !constantTimeStringCompare(ent.Name, f.Name) { - continue - } - if i == 0 { - i = uint64(l - j) - } - if f.Sensitive { - continue - } - if !constantTimeStringCompare(ent.Value, f.Value) { - continue - } - i = uint64(l - j) - nameValueMatch = true - return - } - return + dt.table.evictOldest(n) } func (d *Decoder) maxTableIndex() int { - return len(d.dynTab.ents) + len(staticTable) + // This should never overflow. RFC 7540 Section 6.5.2 limits the size of + // the dynamic table to 2^32 bytes, where each entry will occupy more than + // one byte. Further, the staticTable has a fixed, small length. + return d.dynTab.table.len() + staticTable.len() } func (d *Decoder) at(i uint64) (hf HeaderField, ok bool) { - if i < 1 { + // See Section 2.3.3. + if i == 0 { return } + if i <= uint64(staticTable.len()) { + return staticTable.ents[i-1], true + } if i > uint64(d.maxTableIndex()) { return } - if i <= uint64(len(staticTable)) { - return staticTable[i-1], true - } - dents := d.dynTab.ents - return dents[len(dents)-(int(i)-len(staticTable))], true + // In the dynamic table, newer entries have lower indices. + // However, dt.ents[0] is the oldest entry. Hence, dt.ents is + // the reversed dynamic table. + dt := d.dynTab.table + return dt.ents[dt.len()-(int(i)-staticTable.len())], true } // Decode decodes an entire block. @@ -307,7 +255,7 @@ func (d *Decoder) Write(p []byte) (n int, err error) { err = d.parseHeaderFieldRepr() if err == errNeedMore { // Extra paranoia, making sure saveBuf won't - // get too large. All the varint and string + // get too large. All the varint and string // reading code earlier should already catch // overlong things and return ErrStringLength, // but keep this as a last resort. diff --git a/vendor/golang.org/x/net/http2/hpack/tables.go b/vendor/golang.org/x/net/http2/hpack/tables.go index b9283a0..5d7f635 100644 --- a/vendor/golang.org/x/net/http2/hpack/tables.go +++ b/vendor/golang.org/x/net/http2/hpack/tables.go @@ -4,13 +4,135 @@ package hpack +import ( + "fmt" +) + +// headerFieldTable implements a list of HeaderFields. +// This is used to implement the static and dynamic tables. +type headerFieldTable struct { + // For static tables, entries are never evicted. + // + // For dynamic tables, entries are evicted from ents[0] and added to the end. + // Each entry has a unique id that starts at one and increments for each + // entry that is added. This unique id is stable across evictions, meaning + // it can be used as a pointer to a specific entry. As in hpack, unique ids + // are 1-based. The unique id for ents[k] is k + evictCount + 1. + // + // Zero is not a valid unique id. + // + // evictCount should not overflow in any remotely practical situation. In + // practice, we will have one dynamic table per HTTP/2 connection. If we + // assume a very powerful server that handles 1M QPS per connection and each + // request adds (then evicts) 100 entries from the table, it would still take + // 2M years for evictCount to overflow. + ents []HeaderField + evictCount uint64 + + // byName maps a HeaderField name to the unique id of the newest entry with + // the same name. See above for a definition of "unique id". + byName map[string]uint64 + + // byNameValue maps a HeaderField name/value pair to the unique id of the newest + // entry with the same name and value. See above for a definition of "unique id". + byNameValue map[pairNameValue]uint64 +} + +type pairNameValue struct { + name, value string +} + +func (t *headerFieldTable) init() { + t.byName = make(map[string]uint64) + t.byNameValue = make(map[pairNameValue]uint64) +} + +// len reports the number of entries in the table. +func (t *headerFieldTable) len() int { + return len(t.ents) +} + +// addEntry adds a new entry. +func (t *headerFieldTable) addEntry(f HeaderField) { + id := uint64(t.len()) + t.evictCount + 1 + t.byName[f.Name] = id + t.byNameValue[pairNameValue{f.Name, f.Value}] = id + t.ents = append(t.ents, f) +} + +// evictOldest evicts the n oldest entries in the table. +func (t *headerFieldTable) evictOldest(n int) { + if n > t.len() { + panic(fmt.Sprintf("evictOldest(%v) on table with %v entries", n, t.len())) + } + for k := 0; k < n; k++ { + f := t.ents[k] + id := t.evictCount + uint64(k) + 1 + if t.byName[f.Name] == id { + delete(t.byName, f.Name) + } + if p := (pairNameValue{f.Name, f.Value}); t.byNameValue[p] == id { + delete(t.byNameValue, p) + } + } + copy(t.ents, t.ents[n:]) + for k := t.len() - n; k < t.len(); k++ { + t.ents[k] = HeaderField{} // so strings can be garbage collected + } + t.ents = t.ents[:t.len()-n] + if t.evictCount+uint64(n) < t.evictCount { + panic("evictCount overflow") + } + t.evictCount += uint64(n) +} + +// search finds f in the table. If there is no match, i is 0. +// If both name and value match, i is the matched index and nameValueMatch +// becomes true. If only name matches, i points to that index and +// nameValueMatch becomes false. +// +// The returned index is a 1-based HPACK index. For dynamic tables, HPACK says +// that index 1 should be the newest entry, but t.ents[0] is the oldest entry, +// meaning t.ents is reversed for dynamic tables. Hence, when t is a dynamic +// table, the return value i actually refers to the entry t.ents[t.len()-i]. +// +// All tables are assumed to be a dynamic tables except for the global +// staticTable pointer. +// +// See Section 2.3.3. +func (t *headerFieldTable) search(f HeaderField) (i uint64, nameValueMatch bool) { + if !f.Sensitive { + if id := t.byNameValue[pairNameValue{f.Name, f.Value}]; id != 0 { + return t.idToIndex(id), true + } + } + if id := t.byName[f.Name]; id != 0 { + return t.idToIndex(id), false + } + return 0, false +} + +// idToIndex converts a unique id to an HPACK index. +// See Section 2.3.3. +func (t *headerFieldTable) idToIndex(id uint64) uint64 { + if id <= t.evictCount { + panic(fmt.Sprintf("id (%v) <= evictCount (%v)", id, t.evictCount)) + } + k := id - t.evictCount - 1 // convert id to an index t.ents[k] + if t != staticTable { + return uint64(t.len()) - k // dynamic table + } + return k + 1 +} + func pair(name, value string) HeaderField { return HeaderField{Name: name, Value: value} } // http://tools.ietf.org/html/draft-ietf-httpbis-header-compression-07#appendix-B -var staticTable = [...]HeaderField{ - pair(":authority", ""), // index 1 (1-based) +var staticTable = newStaticTable() +var staticTableEntries = [...]HeaderField{ + pair(":authority", ""), pair(":method", "GET"), pair(":method", "POST"), pair(":path", "/"), @@ -73,6 +195,15 @@ var staticTable = [...]HeaderField{ pair("www-authenticate", ""), } +func newStaticTable() *headerFieldTable { + t := &headerFieldTable{} + t.init() + for _, e := range staticTableEntries[:] { + t.addEntry(e) + } + return t +} + var huffmanCodes = [256]uint32{ 0x1ff8, 0x7fffd8, diff --git a/vendor/golang.org/x/net/http2/not_go16.go b/vendor/golang.org/x/net/http2/not_go16.go index efd2e12..508cebc 100644 --- a/vendor/golang.org/x/net/http2/not_go16.go +++ b/vendor/golang.org/x/net/http2/not_go16.go @@ -7,7 +7,6 @@ package http2 import ( - "crypto/tls" "net/http" "time" ) @@ -20,27 +19,3 @@ func transportExpectContinueTimeout(t1 *http.Transport) time.Duration { return 0 } - -// isBadCipher reports whether the cipher is blacklisted by the HTTP/2 spec. -func isBadCipher(cipher uint16) bool { - switch cipher { - case tls.TLS_RSA_WITH_RC4_128_SHA, - tls.TLS_RSA_WITH_3DES_EDE_CBC_SHA, - tls.TLS_RSA_WITH_AES_128_CBC_SHA, - tls.TLS_RSA_WITH_AES_256_CBC_SHA, - tls.TLS_ECDHE_ECDSA_WITH_RC4_128_SHA, - tls.TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA, - tls.TLS_ECDHE_ECDSA_WITH_AES_256_CBC_SHA, - tls.TLS_ECDHE_RSA_WITH_RC4_128_SHA, - tls.TLS_ECDHE_RSA_WITH_3DES_EDE_CBC_SHA, - tls.TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA, - tls.TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA: - // Reject cipher suites from Appendix A. - // "This list includes those cipher suites that do not - // offer an ephemeral key exchange and those that are - // based on the TLS null, stream or block cipher type" - return true - default: - return false - } -} diff --git a/vendor/golang.org/x/net/http2/pipe.go b/vendor/golang.org/x/net/http2/pipe.go index 53b7a1d..914aaf8 100644 --- a/vendor/golang.org/x/net/http2/pipe.go +++ b/vendor/golang.org/x/net/http2/pipe.go @@ -10,7 +10,7 @@ import ( "sync" ) -// pipe is a goroutine-safe io.Reader/io.Writer pair. It's like +// pipe is a goroutine-safe io.Reader/io.Writer pair. It's like // io.Pipe except there are no PipeReader/PipeWriter halves, and the // underlying buffer is an interface. (io.Pipe is always unbuffered) type pipe struct { diff --git a/vendor/golang.org/x/net/http2/server.go b/vendor/golang.org/x/net/http2/server.go index 3c6b90c..2aba2be 100644 --- a/vendor/golang.org/x/net/http2/server.go +++ b/vendor/golang.org/x/net/http2/server.go @@ -110,11 +110,38 @@ type Server struct { // activity for the purposes of IdleTimeout. IdleTimeout time.Duration + // MaxUploadBufferPerConnection is the size of the initial flow + // control window for each connections. The HTTP/2 spec does not + // allow this to be smaller than 65535 or larger than 2^32-1. + // If the value is outside this range, a default value will be + // used instead. + MaxUploadBufferPerConnection int32 + + // MaxUploadBufferPerStream is the size of the initial flow control + // window for each stream. The HTTP/2 spec does not allow this to + // be larger than 2^32-1. If the value is zero or larger than the + // maximum, a default value will be used instead. + MaxUploadBufferPerStream int32 + // NewWriteScheduler constructs a write scheduler for a connection. // If nil, a default scheduler is chosen. NewWriteScheduler func() WriteScheduler } +func (s *Server) initialConnRecvWindowSize() int32 { + if s.MaxUploadBufferPerConnection > initialWindowSize { + return s.MaxUploadBufferPerConnection + } + return 1 << 20 +} + +func (s *Server) initialStreamRecvWindowSize() int32 { + if s.MaxUploadBufferPerStream > 0 { + return s.MaxUploadBufferPerStream + } + return 1 << 20 +} + func (s *Server) maxReadFrameSize() uint32 { if v := s.MaxReadFrameSize; v >= minMaxFrameSize && v <= maxFrameSize { return v @@ -255,35 +282,34 @@ func (s *Server) ServeConn(c net.Conn, opts *ServeConnOpts) { defer cancel() sc := &serverConn{ - srv: s, - hs: opts.baseConfig(), - conn: c, - baseCtx: baseCtx, - remoteAddrStr: c.RemoteAddr().String(), - bw: newBufferedWriter(c), - handler: opts.handler(), - streams: make(map[uint32]*stream), - readFrameCh: make(chan readFrameResult), - wantWriteFrameCh: make(chan FrameWriteRequest, 8), - wantStartPushCh: make(chan startPushRequest, 8), - wroteFrameCh: make(chan frameWriteResult, 1), // buffered; one send in writeFrameAsync - bodyReadCh: make(chan bodyReadMsg), // buffering doesn't matter either way - doneServing: make(chan struct{}), - clientMaxStreams: math.MaxUint32, // Section 6.5.2: "Initially, there is no limit to this value" - advMaxStreams: s.maxConcurrentStreams(), - initialWindowSize: initialWindowSize, - maxFrameSize: initialMaxFrameSize, - headerTableSize: initialHeaderTableSize, - serveG: newGoroutineLock(), - pushEnabled: true, + srv: s, + hs: opts.baseConfig(), + conn: c, + baseCtx: baseCtx, + remoteAddrStr: c.RemoteAddr().String(), + bw: newBufferedWriter(c), + handler: opts.handler(), + streams: make(map[uint32]*stream), + readFrameCh: make(chan readFrameResult), + wantWriteFrameCh: make(chan FrameWriteRequest, 8), + wantStartPushCh: make(chan startPushRequest, 8), + wroteFrameCh: make(chan frameWriteResult, 1), // buffered; one send in writeFrameAsync + bodyReadCh: make(chan bodyReadMsg), // buffering doesn't matter either way + doneServing: make(chan struct{}), + clientMaxStreams: math.MaxUint32, // Section 6.5.2: "Initially, there is no limit to this value" + advMaxStreams: s.maxConcurrentStreams(), + initialStreamSendWindowSize: initialWindowSize, + maxFrameSize: initialMaxFrameSize, + headerTableSize: initialHeaderTableSize, + serveG: newGoroutineLock(), + pushEnabled: true, } // The net/http package sets the write deadline from the // http.Server.WriteTimeout during the TLS handshake, but then - // passes the connection off to us with the deadline already - // set. Disarm it here so that it is not applied to additional - // streams opened on this connection. - // TODO: implement WriteTimeout fully. See Issue 18437. + // passes the connection off to us with the deadline already set. + // Write deadlines are set per stream in serverConn.newStream. + // Disarm the net.Conn write deadline here. if sc.hs.WriteTimeout != 0 { sc.conn.SetWriteDeadline(time.Time{}) } @@ -294,6 +320,9 @@ func (s *Server) ServeConn(c net.Conn, opts *ServeConnOpts) { sc.writeSched = NewRandomWriteScheduler() } + // These start at the RFC-specified defaults. If there is a higher + // configured value for inflow, that will be updated when we send a + // WINDOW_UPDATE shortly after sending SETTINGS. sc.flow.add(initialWindowSize) sc.inflow.add(initialWindowSize) sc.hpackEncoder = hpack.NewEncoder(&sc.headerWriteBuf) @@ -387,34 +416,34 @@ type serverConn struct { writeSched WriteScheduler // Everything following is owned by the serve loop; use serveG.check(): - serveG goroutineLock // used to verify funcs are on serve() - pushEnabled bool - sawFirstSettings bool // got the initial SETTINGS frame after the preface - needToSendSettingsAck bool - unackedSettings int // how many SETTINGS have we sent without ACKs? - clientMaxStreams uint32 // SETTINGS_MAX_CONCURRENT_STREAMS from client (our PUSH_PROMISE limit) - advMaxStreams uint32 // our SETTINGS_MAX_CONCURRENT_STREAMS advertised the client - curClientStreams uint32 // number of open streams initiated by the client - curPushedStreams uint32 // number of open streams initiated by server push - maxClientStreamID uint32 // max ever seen from client (odd), or 0 if there have been no client requests - maxPushPromiseID uint32 // ID of the last push promise (even), or 0 if there have been no pushes - streams map[uint32]*stream - initialWindowSize int32 - maxFrameSize int32 - headerTableSize uint32 - peerMaxHeaderListSize uint32 // zero means unknown (default) - canonHeader map[string]string // http2-lower-case -> Go-Canonical-Case - writingFrame bool // started writing a frame (on serve goroutine or separate) - writingFrameAsync bool // started a frame on its own goroutine but haven't heard back on wroteFrameCh - needsFrameFlush bool // last frame write wasn't a flush - inGoAway bool // we've started to or sent GOAWAY - inFrameScheduleLoop bool // whether we're in the scheduleFrameWrite loop - needToSendGoAway bool // we need to schedule a GOAWAY frame write - goAwayCode ErrCode - shutdownTimerCh <-chan time.Time // nil until used - shutdownTimer *time.Timer // nil until used - idleTimer *time.Timer // nil if unused - idleTimerCh <-chan time.Time // nil if unused + serveG goroutineLock // used to verify funcs are on serve() + pushEnabled bool + sawFirstSettings bool // got the initial SETTINGS frame after the preface + needToSendSettingsAck bool + unackedSettings int // how many SETTINGS have we sent without ACKs? + clientMaxStreams uint32 // SETTINGS_MAX_CONCURRENT_STREAMS from client (our PUSH_PROMISE limit) + advMaxStreams uint32 // our SETTINGS_MAX_CONCURRENT_STREAMS advertised the client + curClientStreams uint32 // number of open streams initiated by the client + curPushedStreams uint32 // number of open streams initiated by server push + maxClientStreamID uint32 // max ever seen from client (odd), or 0 if there have been no client requests + maxPushPromiseID uint32 // ID of the last push promise (even), or 0 if there have been no pushes + streams map[uint32]*stream + initialStreamSendWindowSize int32 + maxFrameSize int32 + headerTableSize uint32 + peerMaxHeaderListSize uint32 // zero means unknown (default) + canonHeader map[string]string // http2-lower-case -> Go-Canonical-Case + writingFrame bool // started writing a frame (on serve goroutine or separate) + writingFrameAsync bool // started a frame on its own goroutine but haven't heard back on wroteFrameCh + needsFrameFlush bool // last frame write wasn't a flush + inGoAway bool // we've started to or sent GOAWAY + inFrameScheduleLoop bool // whether we're in the scheduleFrameWrite loop + needToSendGoAway bool // we need to schedule a GOAWAY frame write + goAwayCode ErrCode + shutdownTimerCh <-chan time.Time // nil until used + shutdownTimer *time.Timer // nil until used + idleTimer *time.Timer // nil if unused + idleTimerCh <-chan time.Time // nil if unused // Owned by the writeFrameAsync goroutine: headerWriteBuf bytes.Buffer @@ -463,10 +492,10 @@ type stream struct { numTrailerValues int64 weight uint8 state streamState - resetQueued bool // RST_STREAM queued for write; set by sc.resetStream - gotTrailerHeader bool // HEADER frame for trailers was seen - wroteHeaders bool // whether we wrote headers (not status 100) - reqBuf []byte // if non-nil, body pipe buffer to return later at EOF + resetQueued bool // RST_STREAM queued for write; set by sc.resetStream + gotTrailerHeader bool // HEADER frame for trailers was seen + wroteHeaders bool // whether we wrote headers (not status 100) + writeDeadline *time.Timer // nil if unused trailer http.Header // accumulated trailers reqTrailer http.Header // handler's Request.Trailer @@ -696,21 +725,23 @@ func (sc *serverConn) serve() { {SettingMaxFrameSize, sc.srv.maxReadFrameSize()}, {SettingMaxConcurrentStreams, sc.advMaxStreams}, {SettingMaxHeaderListSize, sc.maxHeaderListSize()}, - - // TODO: more actual settings, notably - // SettingInitialWindowSize, but then we also - // want to bump up the conn window size the - // same amount here right after the settings + {SettingInitialWindowSize, uint32(sc.srv.initialStreamRecvWindowSize())}, }, }) sc.unackedSettings++ + // Each connection starts with intialWindowSize inflow tokens. + // If a higher value is configured, we add more tokens. + if diff := sc.srv.initialConnRecvWindowSize() - initialWindowSize; diff > 0 { + sc.sendWindowUpdate(nil, int(diff)) + } + if err := sc.readPreface(); err != nil { sc.condlogf(err, "http2: server: error reading preface from client %v: %v", sc.conn.RemoteAddr(), err) return } // Now that we've got the preface, get us out of the - // "StateNew" state. We can't go directly to idle, though. + // "StateNew" state. We can't go directly to idle, though. // Active means we read some data and anticipate a request. We'll // do another Active when we get a HEADERS frame. sc.setConnState(http.StateActive) @@ -722,9 +753,13 @@ func (sc *serverConn) serve() { sc.idleTimerCh = sc.idleTimer.C } - var gracefulShutdownCh <-chan struct{} + var gracefulShutdownCh chan struct{} if sc.hs != nil { - gracefulShutdownCh = h1ServerShutdownChan(sc.hs) + ch := h1ServerShutdownChan(sc.hs) + if ch != nil { + gracefulShutdownCh = make(chan struct{}) + go sc.awaitGracefulShutdown(ch, gracefulShutdownCh) + } } go sc.readFrames() // closed by defer sc.conn.Close above @@ -735,6 +770,10 @@ func (sc *serverConn) serve() { loopNum++ select { case wr := <-sc.wantWriteFrameCh: + if se, ok := wr.write.(StreamError); ok { + sc.resetStream(se) + break + } sc.writeFrame(wr) case spr := <-sc.wantStartPushCh: sc.startPush(spr) @@ -773,6 +812,14 @@ func (sc *serverConn) serve() { } } +func (sc *serverConn) awaitGracefulShutdown(sharedCh <-chan struct{}, privateCh chan struct{}) { + select { + case <-sc.doneServing: + case <-sharedCh: + close(privateCh) + } +} + // readPreface reads the ClientPreface greeting from the peer // or returns an error on timeout or an invalid greeting. func (sc *serverConn) readPreface() error { @@ -1014,7 +1061,11 @@ func (sc *serverConn) wroteFrame(res frameWriteResult) { // stateClosed after the RST_STREAM frame is // written. st.state = stateHalfClosedLocal - sc.resetStream(streamError(st.id, ErrCodeCancel)) + // Section 8.1: a server MAY request that the client abort + // transmission of a request without error by sending a + // RST_STREAM with an error code of NO_ERROR after sending + // a complete response. + sc.resetStream(streamError(st.id, ErrCodeNo)) case stateHalfClosedRemote: sc.closeStream(st, errHandlerComplete) } @@ -1305,6 +1356,9 @@ func (sc *serverConn) closeStream(st *stream, err error) { panic(fmt.Sprintf("invariant; can't close stream in state %v", st.state)) } st.state = stateClosed + if st.writeDeadline != nil { + st.writeDeadline.Stop() + } if st.isPushed() { sc.curPushedStreams-- } else { @@ -1395,9 +1449,9 @@ func (sc *serverConn) processSettingInitialWindowSize(val uint32) error { // adjust the size of all stream flow control windows that it // maintains by the difference between the new value and the // old value." - old := sc.initialWindowSize - sc.initialWindowSize = int32(val) - growth := sc.initialWindowSize - old // may be negative + old := sc.initialStreamSendWindowSize + sc.initialStreamSendWindowSize = int32(val) + growth := int32(val) - old // may be negative for _, st := range sc.streams { if !st.flow.add(growth) { // 6.9.2 Initial Flow Control Window Size @@ -1543,6 +1597,12 @@ func (st *stream) copyTrailersToHandlerRequest() { } } +// onWriteTimeout is run on its own goroutine (from time.AfterFunc) +// when the stream's WriteTimeout has fired. +func (st *stream) onWriteTimeout() { + st.sc.writeFrameFromHandler(FrameWriteRequest{write: streamError(st.id, ErrCodeInternal)}) +} + func (sc *serverConn) processHeaders(f *MetaHeadersFrame) error { sc.serveG.check() id := f.StreamID @@ -1719,9 +1779,12 @@ func (sc *serverConn) newStream(id, pusherID uint32, state streamState) *stream } st.cw.Init() st.flow.conn = &sc.flow // link to conn-level counter - st.flow.add(sc.initialWindowSize) - st.inflow.conn = &sc.inflow // link to conn-level counter - st.inflow.add(initialWindowSize) // TODO: update this when we send a higher initial window size in the initial settings + st.flow.add(sc.initialStreamSendWindowSize) + st.inflow.conn = &sc.inflow // link to conn-level counter + st.inflow.add(sc.srv.initialStreamRecvWindowSize()) + if sc.hs.WriteTimeout != 0 { + st.writeDeadline = time.AfterFunc(sc.hs.WriteTimeout, st.onWriteTimeout) + } sc.streams[id] = st sc.writeSched.OpenStream(st.id, OpenStreamOptions{PusherID: pusherID}) @@ -1785,16 +1848,14 @@ func (sc *serverConn) newWriterAndRequest(st *stream, f *MetaHeadersFrame) (*res return nil, nil, err } if bodyOpen { - st.reqBuf = getRequestBodyBuf() - req.Body.(*requestBody).pipe = &pipe{ - b: &fixedBuffer{buf: st.reqBuf}, - } - if vv, ok := rp.header["Content-Length"]; ok { req.ContentLength, _ = strconv.ParseInt(vv[0], 10, 64) } else { req.ContentLength = -1 } + req.Body.(*requestBody).pipe = &pipe{ + b: &dataBuffer{expected: req.ContentLength}, + } } return rw, req, nil } @@ -1890,24 +1951,6 @@ func (sc *serverConn) newWriterAndRequestNoBody(st *stream, rp requestParam) (*r return rw, req, nil } -var reqBodyCache = make(chan []byte, 8) - -func getRequestBodyBuf() []byte { - select { - case b := <-reqBodyCache: - return b - default: - return make([]byte, initialWindowSize) - } -} - -func putRequestBodyBuf(b []byte) { - select { - case reqBodyCache <- b: - default: - } -} - // Run on its own goroutine. func (sc *serverConn) runHandler(rw *responseWriter, req *http.Request, handler func(http.ResponseWriter, *http.Request)) { didPanic := true @@ -2003,12 +2046,6 @@ func (sc *serverConn) noteBodyReadFromHandler(st *stream, n int, err error) { case <-sc.doneServing: } } - if err == io.EOF { - if buf := st.reqBuf; buf != nil { - st.reqBuf = nil // shouldn't matter; field unused by other - putRequestBodyBuf(buf) - } - } } func (sc *serverConn) noteBodyRead(st *stream, n int) { @@ -2103,8 +2140,8 @@ func (b *requestBody) Read(p []byte) (n int, err error) { return } -// responseWriter is the http.ResponseWriter implementation. It's -// intentionally small (1 pointer wide) to minimize garbage. The +// responseWriter is the http.ResponseWriter implementation. It's +// intentionally small (1 pointer wide) to minimize garbage. The // responseWriterState pointer inside is zeroed at the end of a // request (in handlerDone) and calls on the responseWriter thereafter // simply crash (caller's mistake), but the much larger responseWriterState @@ -2278,7 +2315,7 @@ const TrailerPrefix = "Trailer:" // says you SHOULD (but not must) predeclare any trailers in the // header, the official ResponseWriter rules said trailers in Go must // be predeclared, and then we reuse the same ResponseWriter.Header() -// map to mean both Headers and Trailers. When it's time to write the +// map to mean both Headers and Trailers. When it's time to write the // Trailers, we pick out the fields of Headers that were declared as // trailers. That worked for a while, until we found the first major // user of Trailers in the wild: gRPC (using them only over http2), diff --git a/vendor/golang.org/x/net/http2/transport.go b/vendor/golang.org/x/net/http2/transport.go index 0c7e859..84d042d 100644 --- a/vendor/golang.org/x/net/http2/transport.go +++ b/vendor/golang.org/x/net/http2/transport.go @@ -575,7 +575,7 @@ func (cc *ClientConn) canTakeNewRequestLocked() bool { cc.nextStreamID < math.MaxInt32 } -// onIdleTimeout is called from a time.AfterFunc goroutine. It will +// onIdleTimeout is called from a time.AfterFunc goroutine. It will // only be called when we're idle, but because we're coming from a new // goroutine, there could be a new request coming in at the same time, // so this simply calls the synchronized closeIfIdle to shut down this @@ -809,8 +809,8 @@ func (cc *ClientConn) RoundTrip(req *http.Request) (*http.Response, error) { // 2xx, however, then assume the server DOES potentially // want our body (e.g. full-duplex streaming: // golang.org/issue/13444). If it turns out the server - // doesn't, they'll RST_STREAM us soon enough. This is a - // heuristic to avoid adding knobs to Transport. Hopefully + // doesn't, they'll RST_STREAM us soon enough. This is a + // heuristic to avoid adding knobs to Transport. Hopefully // we can keep it. bodyWriter.cancel() cs.abortRequestBodyWrite(errStopReqBodyWrite) @@ -1528,8 +1528,7 @@ func (rl *clientConnReadLoop) handleResponse(cs *clientStream, f *MetaHeadersFra return res, nil } - buf := new(bytes.Buffer) // TODO(bradfitz): recycle this garbage - cs.bufPipe = pipe{b: buf} + cs.bufPipe = pipe{b: &dataBuffer{expected: res.ContentLength}} cs.bytesRemain = res.ContentLength res.Body = transportResponseBody{cs} go cs.awaitRequestCancel(cs.req) diff --git a/vendor/golang.org/x/net/idna/idna.go b/vendor/golang.org/x/net/idna/idna.go index 3daa897..ee2dbda 100644 --- a/vendor/golang.org/x/net/idna/idna.go +++ b/vendor/golang.org/x/net/idna/idna.go @@ -1,61 +1,661 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +// Copyright 2016 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// Package idna implements IDNA2008 (Internationalized Domain Names for -// Applications), defined in RFC 5890, RFC 5891, RFC 5892, RFC 5893 and -// RFC 5894. +// Package idna implements IDNA2008 using the compatibility processing +// defined by UTS (Unicode Technical Standard) #46, which defines a standard to +// deal with the transition from IDNA2003. +// +// IDNA2008 (Internationalized Domain Names for Applications), is defined in RFC +// 5890, RFC 5891, RFC 5892, RFC 5893 and RFC 5894. +// UTS #46 is defined in http://www.unicode.org/reports/tr46. +// See http://unicode.org/cldr/utility/idna.jsp for a visualization of the +// differences between these two standards. package idna // import "golang.org/x/net/idna" import ( + "fmt" "strings" "unicode/utf8" + + "golang.org/x/text/secure/bidirule" + "golang.org/x/text/unicode/norm" ) -// TODO(nigeltao): specify when errors occur. For example, is ToASCII(".") or -// ToASCII("foo\x00") an error? See also http://www.unicode.org/faq/idn.html#11 +// NOTE: Unlike common practice in Go APIs, the functions will return a +// sanitized domain name in case of errors. Browsers sometimes use a partially +// evaluated string as lookup. +// TODO: the current error handling is, in my opinion, the least opinionated. +// Other strategies are also viable, though: +// Option 1) Return an empty string in case of error, but allow the user to +// specify explicitly which errors to ignore. +// Option 2) Return the partially evaluated string if it is itself a valid +// string, otherwise return the empty string in case of error. +// Option 3) Option 1 and 2. +// Option 4) Always return an empty string for now and implement Option 1 as +// needed, and document that the return string may not be empty in case of +// error in the future. +// I think Option 1 is best, but it is quite opinionated. -// acePrefix is the ASCII Compatible Encoding prefix. -const acePrefix = "xn--" +// ToASCII is a wrapper for Punycode.ToASCII. +func ToASCII(s string) (string, error) { + return Punycode.process(s, true) +} + +// ToUnicode is a wrapper for Punycode.ToUnicode. +func ToUnicode(s string) (string, error) { + return Punycode.process(s, false) +} + +// An Option configures a Profile at creation time. +type Option func(*options) + +// Transitional sets a Profile to use the Transitional mapping as defined in UTS +// #46. This will cause, for example, "ß" to be mapped to "ss". Using the +// transitional mapping provides a compromise between IDNA2003 and IDNA2008 +// compatibility. It is used by most browsers when resolving domain names. This +// option is only meaningful if combined with MapForLookup. +func Transitional(transitional bool) Option { + return func(o *options) { o.transitional = true } +} + +// VerifyDNSLength sets whether a Profile should fail if any of the IDN parts +// are longer than allowed by the RFC. +func VerifyDNSLength(verify bool) Option { + return func(o *options) { o.verifyDNSLength = verify } +} + +// ValidateLabels sets whether to check the mandatory label validation criteria +// as defined in Section 5.4 of RFC 5891. This includes testing for correct use +// of hyphens ('-'), normalization, validity of runes, and the context rules. +func ValidateLabels(enable bool) Option { + return func(o *options) { + // Don't override existing mappings, but set one that at least checks + // normalization if it is not set. + if o.mapping == nil && enable { + o.mapping = normalize + } + o.trie = trie + o.validateLabels = enable + o.fromPuny = validateFromPunycode + } +} + +// StrictDomainName limits the set of permissable ASCII characters to those +// allowed in domain names as defined in RFC 1034 (A-Z, a-z, 0-9 and the +// hyphen). This is set by default for MapForLookup and ValidateForRegistration. +// +// This option is useful, for instance, for browsers that allow characters +// outside this range, for example a '_' (U+005F LOW LINE). See +// http://www.rfc-editor.org/std/std3.txt for more details This option +// corresponds to the UseSTD3ASCIIRules option in UTS #46. +func StrictDomainName(use bool) Option { + return func(o *options) { + o.trie = trie + o.useSTD3Rules = use + o.fromPuny = validateFromPunycode + } +} + +// NOTE: the following options pull in tables. The tables should not be linked +// in as long as the options are not used. + +// BidiRule enables the Bidi rule as defined in RFC 5893. Any application +// that relies on proper validation of labels should include this rule. +func BidiRule() Option { + return func(o *options) { o.bidirule = bidirule.ValidString } +} + +// ValidateForRegistration sets validation options to verify that a given IDN is +// properly formatted for registration as defined by Section 4 of RFC 5891. +func ValidateForRegistration() Option { + return func(o *options) { + o.mapping = validateRegistration + StrictDomainName(true)(o) + ValidateLabels(true)(o) + VerifyDNSLength(true)(o) + BidiRule()(o) + } +} + +// MapForLookup sets validation and mapping options such that a given IDN is +// transformed for domain name lookup according to the requirements set out in +// Section 5 of RFC 5891. The mappings follow the recommendations of RFC 5894, +// RFC 5895 and UTS 46. It does not add the Bidi Rule. Use the BidiRule option +// to add this check. +// +// The mappings include normalization and mapping case, width and other +// compatibility mappings. +func MapForLookup() Option { + return func(o *options) { + o.mapping = validateAndMap + StrictDomainName(true)(o) + ValidateLabels(true)(o) + } +} + +type options struct { + transitional bool + useSTD3Rules bool + validateLabels bool + verifyDNSLength bool + + trie *idnaTrie + + // fromPuny calls validation rules when converting A-labels to U-labels. + fromPuny func(p *Profile, s string) error + + // mapping implements a validation and mapping step as defined in RFC 5895 + // or UTS 46, tailored to, for example, domain registration or lookup. + mapping func(p *Profile, s string) (string, error) + + // bidirule, if specified, checks whether s conforms to the Bidi Rule + // defined in RFC 5893. + bidirule func(s string) bool +} + +// A Profile defines the configuration of a IDNA mapper. +type Profile struct { + options +} + +func apply(o *options, opts []Option) { + for _, f := range opts { + f(o) + } +} + +// New creates a new Profile. +// +// With no options, the returned Profile is the most permissive and equals the +// Punycode Profile. Options can be passed to further restrict the Profile. The +// MapForLookup and ValidateForRegistration options set a collection of options, +// for lookup and registration purposes respectively, which can be tailored by +// adding more fine-grained options, where later options override earlier +// options. +func New(o ...Option) *Profile { + p := &Profile{} + apply(&p.options, o) + return p +} // ToASCII converts a domain or domain label to its ASCII form. For example, // ToASCII("bücher.example.com") is "xn--bcher-kva.example.com", and -// ToASCII("golang") is "golang". -func ToASCII(s string) (string, error) { - if ascii(s) { - return s, nil - } - labels := strings.Split(s, ".") - for i, label := range labels { - if !ascii(label) { - a, err := encode(acePrefix, label) - if err != nil { - return "", err - } - labels[i] = a - } - } - return strings.Join(labels, "."), nil +// ToASCII("golang") is "golang". If an error is encountered it will return +// an error and a (partially) processed result. +func (p *Profile) ToASCII(s string) (string, error) { + return p.process(s, true) } // ToUnicode converts a domain or domain label to its Unicode form. For example, // ToUnicode("xn--bcher-kva.example.com") is "bücher.example.com", and -// ToUnicode("golang") is "golang". -func ToUnicode(s string) (string, error) { - if !strings.Contains(s, acePrefix) { - return s, nil +// ToUnicode("golang") is "golang". If an error is encountered it will return +// an error and a (partially) processed result. +func (p *Profile) ToUnicode(s string) (string, error) { + pp := *p + pp.transitional = false + return pp.process(s, false) +} + +// String reports a string with a description of the profile for debugging +// purposes. The string format may change with different versions. +func (p *Profile) String() string { + s := "" + if p.transitional { + s = "Transitional" + } else { + s = "NonTransitional" } - labels := strings.Split(s, ".") - for i, label := range labels { - if strings.HasPrefix(label, acePrefix) { - u, err := decode(label[len(acePrefix):]) - if err != nil { - return "", err + if p.useSTD3Rules { + s += ":UseSTD3Rules" + } + if p.validateLabels { + s += ":ValidateLabels" + } + if p.verifyDNSLength { + s += ":VerifyDNSLength" + } + return s +} + +var ( + // Punycode is a Profile that does raw punycode processing with a minimum + // of validation. + Punycode *Profile = punycode + + // Lookup is the recommended profile for looking up domain names, according + // to Section 5 of RFC 5891. The exact configuration of this profile may + // change over time. + Lookup *Profile = lookup + + // Display is the recommended profile for displaying domain names. + // The configuration of this profile may change over time. + Display *Profile = display + + // Registration is the recommended profile for checking whether a given + // IDN is valid for registration, according to Section 4 of RFC 5891. + Registration *Profile = registration + + punycode = &Profile{} + lookup = &Profile{options{ + transitional: true, + useSTD3Rules: true, + validateLabels: true, + trie: trie, + fromPuny: validateFromPunycode, + mapping: validateAndMap, + bidirule: bidirule.ValidString, + }} + display = &Profile{options{ + useSTD3Rules: true, + validateLabels: true, + trie: trie, + fromPuny: validateFromPunycode, + mapping: validateAndMap, + bidirule: bidirule.ValidString, + }} + registration = &Profile{options{ + useSTD3Rules: true, + validateLabels: true, + verifyDNSLength: true, + trie: trie, + fromPuny: validateFromPunycode, + mapping: validateRegistration, + bidirule: bidirule.ValidString, + }} + + // TODO: profiles + // Register: recommended for approving domain names: don't do any mappings + // but rather reject on invalid input. Bundle or block deviation characters. +) + +type labelError struct{ label, code_ string } + +func (e labelError) code() string { return e.code_ } +func (e labelError) Error() string { + return fmt.Sprintf("idna: invalid label %q", e.label) +} + +type runeError rune + +func (e runeError) code() string { return "P1" } +func (e runeError) Error() string { + return fmt.Sprintf("idna: disallowed rune %U", e) +} + +// process implements the algorithm described in section 4 of UTS #46, +// see http://www.unicode.org/reports/tr46. +func (p *Profile) process(s string, toASCII bool) (string, error) { + var err error + if p.mapping != nil { + s, err = p.mapping(p, s) + } + // Remove leading empty labels. + for ; len(s) > 0 && s[0] == '.'; s = s[1:] { + } + // It seems like we should only create this error on ToASCII, but the + // UTS 46 conformance tests suggests we should always check this. + if err == nil && p.verifyDNSLength && s == "" { + err = &labelError{s, "A4"} + } + labels := labelIter{orig: s} + for ; !labels.done(); labels.next() { + label := labels.label() + if label == "" { + // Empty labels are not okay. The label iterator skips the last + // label if it is empty. + if err == nil && p.verifyDNSLength { + err = &labelError{s, "A4"} } - labels[i] = u + continue + } + if strings.HasPrefix(label, acePrefix) { + u, err2 := decode(label[len(acePrefix):]) + if err2 != nil { + if err == nil { + err = err2 + } + // Spec says keep the old label. + continue + } + labels.set(u) + if err == nil && p.validateLabels { + err = p.fromPuny(p, u) + } + if err == nil { + // This should be called on NonTransitional, according to the + // spec, but that currently does not have any effect. Use the + // original profile to preserve options. + err = p.validateLabel(u) + } + } else if err == nil { + err = p.validateLabel(label) } } - return strings.Join(labels, "."), nil + if toASCII { + for labels.reset(); !labels.done(); labels.next() { + label := labels.label() + if !ascii(label) { + a, err2 := encode(acePrefix, label) + if err == nil { + err = err2 + } + label = a + labels.set(a) + } + n := len(label) + if p.verifyDNSLength && err == nil && (n == 0 || n > 63) { + err = &labelError{label, "A4"} + } + } + } + s = labels.result() + if toASCII && p.verifyDNSLength && err == nil { + // Compute the length of the domain name minus the root label and its dot. + n := len(s) + if n > 0 && s[n-1] == '.' { + n-- + } + if len(s) < 1 || n > 253 { + err = &labelError{s, "A4"} + } + } + return s, err +} + +func normalize(p *Profile, s string) (string, error) { + return norm.NFC.String(s), nil +} + +func validateRegistration(p *Profile, s string) (string, error) { + if !norm.NFC.IsNormalString(s) { + return s, &labelError{s, "V1"} + } + var err error + for i := 0; i < len(s); { + v, sz := trie.lookupString(s[i:]) + i += sz + // Copy bytes not copied so far. + switch p.simplify(info(v).category()) { + // TODO: handle the NV8 defined in the Unicode idna data set to allow + // for strict conformance to IDNA2008. + case valid, deviation: + case disallowed, mapped, unknown, ignored: + if err == nil { + r, _ := utf8.DecodeRuneInString(s[i:]) + err = runeError(r) + } + } + } + return s, err +} + +func validateAndMap(p *Profile, s string) (string, error) { + var ( + err error + b []byte + k int + ) + for i := 0; i < len(s); { + v, sz := trie.lookupString(s[i:]) + start := i + i += sz + // Copy bytes not copied so far. + switch p.simplify(info(v).category()) { + case valid: + continue + case disallowed: + if err == nil { + r, _ := utf8.DecodeRuneInString(s[i:]) + err = runeError(r) + } + continue + case mapped, deviation: + b = append(b, s[k:start]...) + b = info(v).appendMapping(b, s[start:i]) + case ignored: + b = append(b, s[k:start]...) + // drop the rune + case unknown: + b = append(b, s[k:start]...) + b = append(b, "\ufffd"...) + } + k = i + } + if k == 0 { + // No changes so far. + s = norm.NFC.String(s) + } else { + b = append(b, s[k:]...) + if norm.NFC.QuickSpan(b) != len(b) { + b = norm.NFC.Bytes(b) + } + // TODO: the punycode converters require strings as input. + s = string(b) + } + return s, err +} + +// A labelIter allows iterating over domain name labels. +type labelIter struct { + orig string + slice []string + curStart int + curEnd int + i int +} + +func (l *labelIter) reset() { + l.curStart = 0 + l.curEnd = 0 + l.i = 0 +} + +func (l *labelIter) done() bool { + return l.curStart >= len(l.orig) +} + +func (l *labelIter) result() string { + if l.slice != nil { + return strings.Join(l.slice, ".") + } + return l.orig +} + +func (l *labelIter) label() string { + if l.slice != nil { + return l.slice[l.i] + } + p := strings.IndexByte(l.orig[l.curStart:], '.') + l.curEnd = l.curStart + p + if p == -1 { + l.curEnd = len(l.orig) + } + return l.orig[l.curStart:l.curEnd] +} + +// next sets the value to the next label. It skips the last label if it is empty. +func (l *labelIter) next() { + l.i++ + if l.slice != nil { + if l.i >= len(l.slice) || l.i == len(l.slice)-1 && l.slice[l.i] == "" { + l.curStart = len(l.orig) + } + } else { + l.curStart = l.curEnd + 1 + if l.curStart == len(l.orig)-1 && l.orig[l.curStart] == '.' { + l.curStart = len(l.orig) + } + } +} + +func (l *labelIter) set(s string) { + if l.slice == nil { + l.slice = strings.Split(l.orig, ".") + } + l.slice[l.i] = s +} + +// acePrefix is the ASCII Compatible Encoding prefix. +const acePrefix = "xn--" + +func (p *Profile) simplify(cat category) category { + switch cat { + case disallowedSTD3Mapped: + if p.useSTD3Rules { + cat = disallowed + } else { + cat = mapped + } + case disallowedSTD3Valid: + if p.useSTD3Rules { + cat = disallowed + } else { + cat = valid + } + case deviation: + if !p.transitional { + cat = valid + } + case validNV8, validXV8: + // TODO: handle V2008 + cat = valid + } + return cat +} + +func validateFromPunycode(p *Profile, s string) error { + if !norm.NFC.IsNormalString(s) { + return &labelError{s, "V1"} + } + for i := 0; i < len(s); { + v, sz := trie.lookupString(s[i:]) + if c := p.simplify(info(v).category()); c != valid && c != deviation { + return &labelError{s, "V6"} + } + i += sz + } + return nil +} + +const ( + zwnj = "\u200c" + zwj = "\u200d" +) + +type joinState int8 + +const ( + stateStart joinState = iota + stateVirama + stateBefore + stateBeforeVirama + stateAfter + stateFAIL +) + +var joinStates = [][numJoinTypes]joinState{ + stateStart: { + joiningL: stateBefore, + joiningD: stateBefore, + joinZWNJ: stateFAIL, + joinZWJ: stateFAIL, + joinVirama: stateVirama, + }, + stateVirama: { + joiningL: stateBefore, + joiningD: stateBefore, + }, + stateBefore: { + joiningL: stateBefore, + joiningD: stateBefore, + joiningT: stateBefore, + joinZWNJ: stateAfter, + joinZWJ: stateFAIL, + joinVirama: stateBeforeVirama, + }, + stateBeforeVirama: { + joiningL: stateBefore, + joiningD: stateBefore, + joiningT: stateBefore, + }, + stateAfter: { + joiningL: stateFAIL, + joiningD: stateBefore, + joiningT: stateAfter, + joiningR: stateStart, + joinZWNJ: stateFAIL, + joinZWJ: stateFAIL, + joinVirama: stateAfter, // no-op as we can't accept joiners here + }, + stateFAIL: { + 0: stateFAIL, + joiningL: stateFAIL, + joiningD: stateFAIL, + joiningT: stateFAIL, + joiningR: stateFAIL, + joinZWNJ: stateFAIL, + joinZWJ: stateFAIL, + joinVirama: stateFAIL, + }, +} + +// validateLabel validates the criteria from Section 4.1. Item 1, 4, and 6 are +// already implicitly satisfied by the overall implementation. +func (p *Profile) validateLabel(s string) error { + if s == "" { + if p.verifyDNSLength { + return &labelError{s, "A4"} + } + return nil + } + if p.bidirule != nil && !p.bidirule(s) { + return &labelError{s, "B"} + } + if !p.validateLabels { + return nil + } + trie := p.trie // p.validateLabels is only set if trie is set. + if len(s) > 4 && s[2] == '-' && s[3] == '-' { + return &labelError{s, "V2"} + } + if s[0] == '-' || s[len(s)-1] == '-' { + return &labelError{s, "V3"} + } + // TODO: merge the use of this in the trie. + v, sz := trie.lookupString(s) + x := info(v) + if x.isModifier() { + return &labelError{s, "V5"} + } + // Quickly return in the absence of zero-width (non) joiners. + if strings.Index(s, zwj) == -1 && strings.Index(s, zwnj) == -1 { + return nil + } + st := stateStart + for i := 0; ; { + jt := x.joinType() + if s[i:i+sz] == zwj { + jt = joinZWJ + } else if s[i:i+sz] == zwnj { + jt = joinZWNJ + } + st = joinStates[st][jt] + if x.isViramaModifier() { + st = joinStates[st][joinVirama] + } + if i += sz; i == len(s) { + break + } + v, sz = trie.lookupString(s[i:]) + x = info(v) + } + if st == stateFAIL || st == stateAfter { + return &labelError{s, "C"} + } + return nil } func ascii(s string) bool { diff --git a/vendor/golang.org/x/net/idna/punycode.go b/vendor/golang.org/x/net/idna/punycode.go index 92e733f..02c7d59 100644 --- a/vendor/golang.org/x/net/idna/punycode.go +++ b/vendor/golang.org/x/net/idna/punycode.go @@ -1,4 +1,6 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +// Copyright 2016 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -7,7 +9,6 @@ package idna // This file implements the Punycode algorithm from RFC 3492. import ( - "fmt" "math" "strings" "unicode/utf8" @@ -27,6 +28,8 @@ const ( tmin int32 = 1 ) +func punyError(s string) error { return &labelError{s, "A3"} } + // decode decodes a string as specified in section 6.2. func decode(encoded string) (string, error) { if encoded == "" { @@ -34,7 +37,7 @@ func decode(encoded string) (string, error) { } pos := 1 + strings.LastIndex(encoded, "-") if pos == 1 { - return "", fmt.Errorf("idna: invalid label %q", encoded) + return "", punyError(encoded) } if pos == len(encoded) { return encoded[:len(encoded)-1], nil @@ -50,16 +53,16 @@ func decode(encoded string) (string, error) { oldI, w := i, int32(1) for k := base; ; k += base { if pos == len(encoded) { - return "", fmt.Errorf("idna: invalid label %q", encoded) + return "", punyError(encoded) } digit, ok := decodeDigit(encoded[pos]) if !ok { - return "", fmt.Errorf("idna: invalid label %q", encoded) + return "", punyError(encoded) } pos++ i += digit * w if i < 0 { - return "", fmt.Errorf("idna: invalid label %q", encoded) + return "", punyError(encoded) } t := k - bias if t < tmin { @@ -72,7 +75,7 @@ func decode(encoded string) (string, error) { } w *= base - t if w >= math.MaxInt32/base { - return "", fmt.Errorf("idna: invalid label %q", encoded) + return "", punyError(encoded) } } x := int32(len(output) + 1) @@ -80,7 +83,7 @@ func decode(encoded string) (string, error) { n += i / x i %= x if n > utf8.MaxRune || len(output) >= 1024 { - return "", fmt.Errorf("idna: invalid label %q", encoded) + return "", punyError(encoded) } output = append(output, 0) copy(output[i+1:], output[i:]) @@ -121,14 +124,14 @@ func encode(prefix, s string) (string, error) { } delta += (m - n) * (h + 1) if delta < 0 { - return "", fmt.Errorf("idna: invalid label %q", s) + return "", punyError(s) } n = m for _, r := range s { if r < n { delta++ if delta < 0 { - return "", fmt.Errorf("idna: invalid label %q", s) + return "", punyError(s) } continue } diff --git a/vendor/golang.org/x/net/idna/tables.go b/vendor/golang.org/x/net/idna/tables.go new file mode 100644 index 0000000..d281934 --- /dev/null +++ b/vendor/golang.org/x/net/idna/tables.go @@ -0,0 +1,4477 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +package idna + +// UnicodeVersion is the Unicode version from which the tables in this package are derived. +const UnicodeVersion = "9.0.0" + +var mappings string = "" + // Size: 8176 bytes + "\x00\x01 \x03 ̈\x01a\x03 ̄\x012\x013\x03 ́\x03 ̧\x011\x01o\x051⁄4\x051⁄2" + + "\x053⁄4\x03i̇\x03l·\x03ʼn\x01s\x03dž\x03ⱥ\x03ⱦ\x01h\x01j\x01r\x01w\x01y" + + "\x03 ̆\x03 ̇\x03 ̊\x03 ̨\x03 ̃\x03 ̋\x01l\x01x\x04̈́\x03 ι\x01;\x05 ̈́" + + "\x04եւ\x04اٴ\x04وٴ\x04ۇٴ\x04يٴ\x06क़\x06ख़\x06ग़\x06ज़\x06ड़\x06ढ़\x06फ़" + + "\x06य़\x06ড়\x06ঢ়\x06য়\x06ਲ਼\x06ਸ਼\x06ਖ਼\x06ਗ਼\x06ਜ਼\x06ਫ਼\x06ଡ଼\x06ଢ଼" + + "\x06ํา\x06ໍາ\x06ຫນ\x06ຫມ\x06གྷ\x06ཌྷ\x06དྷ\x06བྷ\x06ཛྷ\x06ཀྵ\x06ཱི\x06ཱུ" + + "\x06ྲྀ\x09ྲཱྀ\x06ླྀ\x09ླཱྀ\x06ཱྀ\x06ྒྷ\x06ྜྷ\x06ྡྷ\x06ྦྷ\x06ྫྷ\x06ྐྵ\x02" + + "в\x02д\x02о\x02с\x02т\x02ъ\x02ѣ\x02æ\x01b\x01d\x01e\x02ǝ\x01g\x01i\x01k" + + "\x01m\x01n\x02ȣ\x01p\x01t\x01u\x02ɐ\x02ɑ\x02ə\x02ɛ\x02ɜ\x02ŋ\x02ɔ\x02ɯ" + + "\x01v\x02β\x02γ\x02δ\x02φ\x02χ\x02ρ\x02н\x02ɒ\x01c\x02ɕ\x02ð\x01f\x02ɟ" + + "\x02ɡ\x02ɥ\x02ɨ\x02ɩ\x02ɪ\x02ʝ\x02ɭ\x02ʟ\x02ɱ\x02ɰ\x02ɲ\x02ɳ\x02ɴ\x02ɵ" + + "\x02ɸ\x02ʂ\x02ʃ\x02ƫ\x02ʉ\x02ʊ\x02ʋ\x02ʌ\x01z\x02ʐ\x02ʑ\x02ʒ\x02θ\x02ss" + + "\x02ά\x02έ\x02ή\x02ί\x02ό\x02ύ\x02ώ\x05ἀι\x05ἁι\x05ἂι\x05ἃι\x05ἄι\x05ἅι" + + "\x05ἆι\x05ἇι\x05ἠι\x05ἡι\x05ἢι\x05ἣι\x05ἤι\x05ἥι\x05ἦι\x05ἧι\x05ὠι\x05ὡι" + + "\x05ὢι\x05ὣι\x05ὤι\x05ὥι\x05ὦι\x05ὧι\x05ὰι\x04αι\x04άι\x05ᾶι\x02ι\x05 ̈͂" + + "\x05ὴι\x04ηι\x04ήι\x05ῆι\x05 ̓̀\x05 ̓́\x05 ̓͂\x02ΐ\x05 ̔̀\x05 ̔́\x05 ̔͂" + + "\x02ΰ\x05 ̈̀\x01`\x05ὼι\x04ωι\x04ώι\x05ῶι\x06′′\x09′′′\x06‵‵\x09‵‵‵\x02!" + + "!\x02??\x02?!\x02!?\x0c′′′′\x010\x014\x015\x016\x017\x018\x019\x01+\x01=" + + "\x01(\x01)\x02rs\x02ħ\x02no\x01q\x02sm\x02tm\x02ω\x02å\x02א\x02ב\x02ג" + + "\x02ד\x02π\x051⁄7\x051⁄9\x061⁄10\x051⁄3\x052⁄3\x051⁄5\x052⁄5\x053⁄5\x054" + + "⁄5\x051⁄6\x055⁄6\x051⁄8\x053⁄8\x055⁄8\x057⁄8\x041⁄\x02ii\x02iv\x02vi" + + "\x04viii\x02ix\x02xi\x050⁄3\x06∫∫\x09∫∫∫\x06∮∮\x09∮∮∮\x0210\x0211\x0212" + + "\x0213\x0214\x0215\x0216\x0217\x0218\x0219\x0220\x04(10)\x04(11)\x04(12)" + + "\x04(13)\x04(14)\x04(15)\x04(16)\x04(17)\x04(18)\x04(19)\x04(20)\x0c∫∫∫∫" + + "\x02==\x05⫝̸\x02ɫ\x02ɽ\x02ȿ\x02ɀ\x01.\x04 ゙\x04 ゚\x06より\x06コト\x05(ᄀ)\x05" + + "(ᄂ)\x05(ᄃ)\x05(ᄅ)\x05(ᄆ)\x05(ᄇ)\x05(ᄉ)\x05(ᄋ)\x05(ᄌ)\x05(ᄎ)\x05(ᄏ)\x05(ᄐ" + + ")\x05(ᄑ)\x05(ᄒ)\x05(가)\x05(나)\x05(다)\x05(라)\x05(마)\x05(바)\x05(사)\x05(아)" + + "\x05(자)\x05(차)\x05(카)\x05(타)\x05(파)\x05(하)\x05(주)\x08(오전)\x08(오후)\x05(一)" + + "\x05(二)\x05(三)\x05(四)\x05(五)\x05(六)\x05(七)\x05(八)\x05(九)\x05(十)\x05(月)" + + "\x05(火)\x05(水)\x05(木)\x05(金)\x05(土)\x05(日)\x05(株)\x05(有)\x05(社)\x05(名)" + + "\x05(特)\x05(財)\x05(祝)\x05(労)\x05(代)\x05(呼)\x05(学)\x05(監)\x05(企)\x05(資)" + + "\x05(協)\x05(祭)\x05(休)\x05(自)\x05(至)\x0221\x0222\x0223\x0224\x0225\x0226" + + "\x0227\x0228\x0229\x0230\x0231\x0232\x0233\x0234\x0235\x06참고\x06주의\x0236" + + "\x0237\x0238\x0239\x0240\x0241\x0242\x0243\x0244\x0245\x0246\x0247\x0248" + + "\x0249\x0250\x041月\x042月\x043月\x044月\x045月\x046月\x047月\x048月\x049月\x0510" + + "月\x0511月\x0512月\x02hg\x02ev\x0cアパート\x0cアルファ\x0cアンペア\x09アール\x0cイニング\x09" + + "インチ\x09ウォン\x0fエスクード\x0cエーカー\x09オンス\x09オーム\x09カイリ\x0cカラット\x0cカロリー\x09ガロ" + + "ン\x09ガンマ\x06ギガ\x09ギニー\x0cキュリー\x0cギルダー\x06キロ\x0fキログラム\x12キロメートル\x0fキロワッ" + + "ト\x09グラム\x0fグラムトン\x0fクルゼイロ\x0cクローネ\x09ケース\x09コルナ\x09コーポ\x0cサイクル\x0fサンチ" + + "ーム\x0cシリング\x09センチ\x09セント\x09ダース\x06デシ\x06ドル\x06トン\x06ナノ\x09ノット\x09ハイツ" + + "\x0fパーセント\x09パーツ\x0cバーレル\x0fピアストル\x09ピクル\x06ピコ\x06ビル\x0fファラッド\x0cフィート" + + "\x0fブッシェル\x09フラン\x0fヘクタール\x06ペソ\x09ペニヒ\x09ヘルツ\x09ペンス\x09ページ\x09ベータ\x0cポイ" + + "ント\x09ボルト\x06ホン\x09ポンド\x09ホール\x09ホーン\x0cマイクロ\x09マイル\x09マッハ\x09マルク\x0fマ" + + "ンション\x0cミクロン\x06ミリ\x0fミリバール\x06メガ\x0cメガトン\x0cメートル\x09ヤード\x09ヤール\x09ユアン" + + "\x0cリットル\x06リラ\x09ルピー\x0cルーブル\x06レム\x0fレントゲン\x09ワット\x040点\x041点\x042点" + + "\x043点\x044点\x045点\x046点\x047点\x048点\x049点\x0510点\x0511点\x0512点\x0513点" + + "\x0514点\x0515点\x0516点\x0517点\x0518点\x0519点\x0520点\x0521点\x0522点\x0523点" + + "\x0524点\x02da\x02au\x02ov\x02pc\x02dm\x02iu\x06平成\x06昭和\x06大正\x06明治\x0c株" + + "式会社\x02pa\x02na\x02ma\x02ka\x02kb\x02mb\x02gb\x04kcal\x02pf\x02nf\x02m" + + "g\x02kg\x02hz\x02ml\x02dl\x02kl\x02fm\x02nm\x02mm\x02cm\x02km\x02m2\x02m" + + "3\x05m∕s\x06m∕s2\x07rad∕s\x08rad∕s2\x02ps\x02ns\x02ms\x02pv\x02nv\x02mv" + + "\x02kv\x02pw\x02nw\x02mw\x02kw\x02bq\x02cc\x02cd\x06c∕kg\x02db\x02gy\x02" + + "ha\x02hp\x02in\x02kk\x02kt\x02lm\x02ln\x02lx\x02ph\x02pr\x02sr\x02sv\x02" + + "wb\x05v∕m\x05a∕m\x041日\x042日\x043日\x044日\x045日\x046日\x047日\x048日\x049日" + + "\x0510日\x0511日\x0512日\x0513日\x0514日\x0515日\x0516日\x0517日\x0518日\x0519日" + + "\x0520日\x0521日\x0522日\x0523日\x0524日\x0525日\x0526日\x0527日\x0528日\x0529日" + + "\x0530日\x0531日\x02ь\x02ɦ\x02ɬ\x02ʞ\x02ʇ\x02œ\x04𤋮\x04𢡊\x04𢡄\x04𣏕\x04𥉉" + + "\x04𥳐\x04𧻓\x02ff\x02fi\x02fl\x02st\x04մն\x04մե\x04մի\x04վն\x04մխ\x04יִ" + + "\x04ײַ\x02ע\x02ה\x02כ\x02ל\x02ם\x02ר\x02ת\x04שׁ\x04שׂ\x06שּׁ\x06שּׂ\x04א" + + "ַ\x04אָ\x04אּ\x04בּ\x04גּ\x04דּ\x04הּ\x04וּ\x04זּ\x04טּ\x04יּ\x04ךּ\x04" + + "כּ\x04לּ\x04מּ\x04נּ\x04סּ\x04ףּ\x04פּ\x04צּ\x04קּ\x04רּ\x04שּ\x04תּ" + + "\x04וֹ\x04בֿ\x04כֿ\x04פֿ\x04אל\x02ٱ\x02ٻ\x02پ\x02ڀ\x02ٺ\x02ٿ\x02ٹ\x02ڤ" + + "\x02ڦ\x02ڄ\x02ڃ\x02چ\x02ڇ\x02ڍ\x02ڌ\x02ڎ\x02ڈ\x02ژ\x02ڑ\x02ک\x02گ\x02ڳ" + + "\x02ڱ\x02ں\x02ڻ\x02ۀ\x02ہ\x02ھ\x02ے\x02ۓ\x02ڭ\x02ۇ\x02ۆ\x02ۈ\x02ۋ\x02ۅ" + + "\x02ۉ\x02ې\x02ى\x04ئا\x04ئە\x04ئو\x04ئۇ\x04ئۆ\x04ئۈ\x04ئې\x04ئى\x02ی\x04" + + "ئج\x04ئح\x04ئم\x04ئي\x04بج\x04بح\x04بخ\x04بم\x04بى\x04بي\x04تج\x04تح" + + "\x04تخ\x04تم\x04تى\x04تي\x04ثج\x04ثم\x04ثى\x04ثي\x04جح\x04جم\x04حج\x04حم" + + "\x04خج\x04خح\x04خم\x04سج\x04سح\x04سخ\x04سم\x04صح\x04صم\x04ضج\x04ضح\x04ضخ" + + "\x04ضم\x04طح\x04طم\x04ظم\x04عج\x04عم\x04غج\x04غم\x04فج\x04فح\x04فخ\x04فم" + + "\x04فى\x04في\x04قح\x04قم\x04قى\x04قي\x04كا\x04كج\x04كح\x04كخ\x04كل\x04كم" + + "\x04كى\x04كي\x04لج\x04لح\x04لخ\x04لم\x04لى\x04لي\x04مج\x04مح\x04مخ\x04مم" + + "\x04مى\x04مي\x04نج\x04نح\x04نخ\x04نم\x04نى\x04ني\x04هج\x04هم\x04هى\x04هي" + + "\x04يج\x04يح\x04يخ\x04يم\x04يى\x04يي\x04ذٰ\x04رٰ\x04ىٰ\x05 ٌّ\x05 ٍّ\x05" + + " َّ\x05 ُّ\x05 ِّ\x05 ّٰ\x04ئر\x04ئز\x04ئن\x04بر\x04بز\x04بن\x04تر\x04تز" + + "\x04تن\x04ثر\x04ثز\x04ثن\x04ما\x04نر\x04نز\x04نن\x04ير\x04يز\x04ين\x04ئخ" + + "\x04ئه\x04به\x04ته\x04صخ\x04له\x04نه\x04هٰ\x04يه\x04ثه\x04سه\x04شم\x04شه" + + "\x06ـَّ\x06ـُّ\x06ـِّ\x04طى\x04طي\x04عى\x04عي\x04غى\x04غي\x04سى\x04سي" + + "\x04شى\x04شي\x04حى\x04حي\x04جى\x04جي\x04خى\x04خي\x04صى\x04صي\x04ضى\x04ضي" + + "\x04شج\x04شح\x04شخ\x04شر\x04سر\x04صر\x04ضر\x04اً\x06تجم\x06تحج\x06تحم" + + "\x06تخم\x06تمج\x06تمح\x06تمخ\x06جمح\x06حمي\x06حمى\x06سحج\x06سجح\x06سجى" + + "\x06سمح\x06سمج\x06سمم\x06صحح\x06صمم\x06شحم\x06شجي\x06شمخ\x06شمم\x06ضحى" + + "\x06ضخم\x06طمح\x06طمم\x06طمي\x06عجم\x06عمم\x06عمى\x06غمم\x06غمي\x06غمى" + + "\x06فخم\x06قمح\x06قمم\x06لحم\x06لحي\x06لحى\x06لجج\x06لخم\x06لمح\x06محج" + + "\x06محم\x06محي\x06مجح\x06مجم\x06مخج\x06مخم\x06مجخ\x06همج\x06همم\x06نحم" + + "\x06نحى\x06نجم\x06نجى\x06نمي\x06نمى\x06يمم\x06بخي\x06تجي\x06تجى\x06تخي" + + "\x06تخى\x06تمي\x06تمى\x06جمي\x06جحى\x06جمى\x06سخى\x06صحي\x06شحي\x06ضحي" + + "\x06لجي\x06لمي\x06يحي\x06يجي\x06يمي\x06ممي\x06قمي\x06نحي\x06عمي\x06كمي" + + "\x06نجح\x06مخي\x06لجم\x06كمم\x06جحي\x06حجي\x06مجي\x06فمي\x06بحي\x06سخي" + + "\x06نجي\x06صلے\x06قلے\x08الله\x08اكبر\x08محمد\x08صلعم\x08رسول\x08عليه" + + "\x08وسلم\x06صلى!صلى الله عليه وسلم\x0fجل جلاله\x08ریال\x01,\x01:\x01!" + + "\x01?\x01_\x01{\x01}\x01[\x01]\x01#\x01&\x01*\x01-\x01<\x01>\x01\\\x01$" + + "\x01%\x01@\x04ـً\x04ـَ\x04ـُ\x04ـِ\x04ـّ\x04ـْ\x02ء\x02آ\x02أ\x02ؤ\x02إ" + + "\x02ئ\x02ا\x02ب\x02ة\x02ت\x02ث\x02ج\x02ح\x02خ\x02د\x02ذ\x02ر\x02ز\x02س" + + "\x02ش\x02ص\x02ض\x02ط\x02ظ\x02ع\x02غ\x02ف\x02ق\x02ك\x02ل\x02م\x02ن\x02ه" + + "\x02و\x02ي\x04لآ\x04لأ\x04لإ\x04لا\x01\x22\x01'\x01/\x01^\x01|\x01~\x02¢" + + "\x02£\x02¬\x02¦\x02¥\x08𝅗𝅥\x08𝅘𝅥\x0c𝅘𝅥𝅮\x0c𝅘𝅥𝅯\x0c𝅘𝅥𝅰\x0c𝅘𝅥𝅱\x0c𝅘𝅥𝅲\x08𝆹" + + "𝅥\x08𝆺𝅥\x0c𝆹𝅥𝅮\x0c𝆺𝅥𝅮\x0c𝆹𝅥𝅯\x0c𝆺𝅥𝅯\x02ı\x02ȷ\x02α\x02ε\x02ζ\x02η\x02" + + "κ\x02λ\x02μ\x02ν\x02ξ\x02ο\x02σ\x02τ\x02υ\x02ψ\x03∇\x03∂\x02ϝ\x02ٮ\x02ڡ" + + "\x02ٯ\x020,\x021,\x022,\x023,\x024,\x025,\x026,\x027,\x028,\x029,\x03(a)" + + "\x03(b)\x03(c)\x03(d)\x03(e)\x03(f)\x03(g)\x03(h)\x03(i)\x03(j)\x03(k)" + + "\x03(l)\x03(m)\x03(n)\x03(o)\x03(p)\x03(q)\x03(r)\x03(s)\x03(t)\x03(u)" + + "\x03(v)\x03(w)\x03(x)\x03(y)\x03(z)\x07〔s〕\x02wz\x02hv\x02sd\x03ppv\x02w" + + "c\x02mc\x02md\x02dj\x06ほか\x06ココ\x03サ\x03手\x03字\x03双\x03デ\x03二\x03多\x03解" + + "\x03天\x03交\x03映\x03無\x03料\x03前\x03後\x03再\x03新\x03初\x03終\x03生\x03販\x03声" + + "\x03吹\x03演\x03投\x03捕\x03一\x03三\x03遊\x03左\x03中\x03右\x03指\x03走\x03打\x03禁" + + "\x03空\x03合\x03満\x03有\x03月\x03申\x03割\x03営\x03配\x09〔本〕\x09〔三〕\x09〔二〕\x09〔安" + + "〕\x09〔点〕\x09〔打〕\x09〔盗〕\x09〔勝〕\x09〔敗〕\x03得\x03可\x03丽\x03丸\x03乁\x03你\x03" + + "侮\x03侻\x03倂\x03偺\x03備\x03僧\x03像\x03㒞\x03免\x03兔\x03兤\x03具\x03㒹\x03內\x03" + + "冗\x03冤\x03仌\x03冬\x03况\x03凵\x03刃\x03㓟\x03刻\x03剆\x03剷\x03㔕\x03勇\x03勉\x03" + + "勤\x03勺\x03包\x03匆\x03北\x03卉\x03卑\x03博\x03即\x03卽\x03卿\x03灰\x03及\x03叟\x03" + + "叫\x03叱\x03吆\x03咞\x03吸\x03呈\x03周\x03咢\x03哶\x03唐\x03啓\x03啣\x03善\x03喙\x03" + + "喫\x03喳\x03嗂\x03圖\x03嘆\x03圗\x03噑\x03噴\x03切\x03壮\x03城\x03埴\x03堍\x03型\x03" + + "堲\x03報\x03墬\x03売\x03壷\x03夆\x03夢\x03奢\x03姬\x03娛\x03娧\x03姘\x03婦\x03㛮\x03" + + "嬈\x03嬾\x03寃\x03寘\x03寧\x03寳\x03寿\x03将\x03尢\x03㞁\x03屠\x03屮\x03峀\x03岍\x03" + + "嵃\x03嵮\x03嵫\x03嵼\x03巡\x03巢\x03㠯\x03巽\x03帨\x03帽\x03幩\x03㡢\x03㡼\x03庰\x03" + + "庳\x03庶\x03廊\x03廾\x03舁\x03弢\x03㣇\x03形\x03彫\x03㣣\x03徚\x03忍\x03志\x03忹\x03" + + "悁\x03㤺\x03㤜\x03悔\x03惇\x03慈\x03慌\x03慎\x03慺\x03憎\x03憲\x03憤\x03憯\x03懞\x03" + + "懲\x03懶\x03成\x03戛\x03扝\x03抱\x03拔\x03捐\x03挽\x03拼\x03捨\x03掃\x03揤\x03搢\x03" + + "揅\x03掩\x03㨮\x03摩\x03摾\x03撝\x03摷\x03㩬\x03敏\x03敬\x03旣\x03書\x03晉\x03㬙\x03" + + "暑\x03㬈\x03㫤\x03冒\x03冕\x03最\x03暜\x03肭\x03䏙\x03朗\x03望\x03朡\x03杞\x03杓\x03" + + "㭉\x03柺\x03枅\x03桒\x03梅\x03梎\x03栟\x03椔\x03㮝\x03楂\x03榣\x03槪\x03檨\x03櫛\x03" + + "㰘\x03次\x03歔\x03㱎\x03歲\x03殟\x03殺\x03殻\x03汎\x03沿\x03泍\x03汧\x03洖\x03派\x03" + + "海\x03流\x03浩\x03浸\x03涅\x03洴\x03港\x03湮\x03㴳\x03滋\x03滇\x03淹\x03潮\x03濆\x03" + + "瀹\x03瀞\x03瀛\x03㶖\x03灊\x03災\x03灷\x03炭\x03煅\x03熜\x03爨\x03爵\x03牐\x03犀\x03" + + "犕\x03獺\x03王\x03㺬\x03玥\x03㺸\x03瑇\x03瑜\x03瑱\x03璅\x03瓊\x03㼛\x03甤\x03甾\x03" + + "異\x03瘐\x03㿼\x03䀈\x03直\x03眞\x03真\x03睊\x03䀹\x03瞋\x03䁆\x03䂖\x03硎\x03碌\x03" + + "磌\x03䃣\x03祖\x03福\x03秫\x03䄯\x03穀\x03穊\x03穏\x03䈂\x03篆\x03築\x03䈧\x03糒\x03" + + "䊠\x03糨\x03糣\x03紀\x03絣\x03䌁\x03緇\x03縂\x03繅\x03䌴\x03䍙\x03罺\x03羕\x03翺\x03" + + "者\x03聠\x03聰\x03䏕\x03育\x03脃\x03䐋\x03脾\x03媵\x03舄\x03辞\x03䑫\x03芑\x03芋\x03" + + "芝\x03劳\x03花\x03芳\x03芽\x03苦\x03若\x03茝\x03荣\x03莭\x03茣\x03莽\x03菧\x03著\x03" + + "荓\x03菊\x03菌\x03菜\x03䔫\x03蓱\x03蓳\x03蔖\x03蕤\x03䕝\x03䕡\x03䕫\x03虐\x03虜\x03" + + "虧\x03虩\x03蚩\x03蚈\x03蜎\x03蛢\x03蝹\x03蜨\x03蝫\x03螆\x03蟡\x03蠁\x03䗹\x03衠\x03" + + "衣\x03裗\x03裞\x03䘵\x03裺\x03㒻\x03䚾\x03䛇\x03誠\x03諭\x03變\x03豕\x03貫\x03賁\x03" + + "贛\x03起\x03跋\x03趼\x03跰\x03軔\x03輸\x03邔\x03郱\x03鄑\x03鄛\x03鈸\x03鋗\x03鋘\x03" + + "鉼\x03鏹\x03鐕\x03開\x03䦕\x03閷\x03䧦\x03雃\x03嶲\x03霣\x03䩮\x03䩶\x03韠\x03䪲\x03" + + "頋\x03頩\x03飢\x03䬳\x03餩\x03馧\x03駂\x03駾\x03䯎\x03鬒\x03鱀\x03鳽\x03䳎\x03䳭\x03" + + "鵧\x03䳸\x03麻\x03䵖\x03黹\x03黾\x03鼅\x03鼏\x03鼖\x03鼻" + +var xorData string = "" + // Size: 4855 bytes + "\x02\x0c\x09\x02\xb0\xec\x02\xad\xd8\x02\xad\xd9\x02\x06\x07\x02\x0f\x12" + + "\x02\x0f\x1f\x02\x0f\x1d\x02\x01\x13\x02\x0f\x16\x02\x0f\x0b\x02\x0f3" + + "\x02\x0f7\x02\x0f?\x02\x0f/\x02\x0f*\x02\x0c&\x02\x0c*\x02\x0c;\x02\x0c9" + + "\x02\x0c%\x02\xab\xed\x02\xab\xe2\x02\xab\xe3\x02\xa9\xe0\x02\xa9\xe1" + + "\x02\xa9\xe6\x02\xa3\xcb\x02\xa3\xc8\x02\xa3\xc9\x02\x01#\x02\x01\x08" + + "\x02\x0e>\x02\x0e'\x02\x0f\x03\x02\x03\x0d\x02\x03\x09\x02\x03\x17\x02" + + "\x03\x0e\x02\x02\x03\x02\x011\x02\x01\x00\x02\x01\x10\x02\x03<\x02\x07" + + "\x0d\x02\x02\x0c\x02\x0c0\x02\x01\x03\x02\x01\x01\x02\x01 \x02\x01\x22" + + "\x02\x01)\x02\x01\x0a\x02\x01\x0c\x02\x02\x06\x02\x02\x02\x02\x03\x10" + + "\x03\x037 \x03\x0b+\x03\x02\x01\x04\x02\x01\x02\x02\x019\x02\x03\x1c\x02" + + "\x02$\x03\x80p$\x02\x03:\x02\x03\x0a\x03\xc1r.\x03\xc1r,\x03\xc1r\x02" + + "\x02\x02:\x02\x02>\x02\x02,\x02\x02\x10\x02\x02\x00\x03\xc1s<\x03\xc1s*" + + "\x03\xc2L$\x03\xc2L;\x02\x09)\x02\x0a\x19\x03\x83\xab\xe3\x03\x83\xab" + + "\xf2\x03 4\xe0\x03\x81\xab\xea\x03\x81\xab\xf3\x03 4\xef\x03\x96\xe1\xcd" + + "\x03\x84\xe5\xc3\x02\x0d\x11\x03\x8b\xec\xcb\x03\x94\xec\xcf\x03\x9a\xec" + + "\xc2\x03\x8b\xec\xdb\x03\x94\xec\xdf\x03\x9a\xec\xd2\x03\x01\x0c!\x03" + + "\x01\x0c#\x03ʠ\x9d\x03ʣ\x9c\x03ʢ\x9f\x03ʥ\x9e\x03ʤ\x91\x03ʧ\x90\x03ʦ\x93" + + "\x03ʩ\x92\x03ʨ\x95\x03\xca\xf3\xb5\x03\xca\xf0\xb4\x03\xca\xf1\xb7\x03" + + "\xca\xf6\xb6\x03\xca\xf7\x89\x03\xca\xf4\x88\x03\xca\xf5\x8b\x03\xca\xfa" + + "\x8a\x03\xca\xfb\x8d\x03\xca\xf8\x8c\x03\xca\xf9\x8f\x03\xca\xfe\x8e\x03" + + "\xca\xff\x81\x03\xca\xfc\x80\x03\xca\xfd\x83\x03\xca\xe2\x82\x03\xca\xe3" + + "\x85\x03\xca\xe0\x84\x03\xca\xe1\x87\x03\xca\xe6\x86\x03\xca\xe7\x99\x03" + + "\xca\xe4\x98\x03\xca\xe5\x9b\x03\xca\xea\x9a\x03\xca\xeb\x9d\x03\xca\xe8" + + "\x9c\x03ؓ\x89\x03ߔ\x8b\x02\x010\x03\x03\x04\x1e\x03\x04\x15\x12\x03\x0b" + + "\x05,\x03\x06\x04\x00\x03\x06\x04)\x03\x06\x044\x03\x06\x04<\x03\x06\x05" + + "\x1d\x03\x06\x06\x00\x03\x06\x06\x0a\x03\x06\x06'\x03\x06\x062\x03\x0786" + + "\x03\x079/\x03\x079 \x03\x07:\x0e\x03\x07:\x1b\x03\x07:%\x03\x07;/\x03" + + "\x07;%\x03\x074\x11\x03\x076\x09\x03\x077*\x03\x070\x01\x03\x070\x0f\x03" + + "\x070.\x03\x071\x16\x03\x071\x04\x03\x0710\x03\x072\x18\x03\x072-\x03" + + "\x073\x14\x03\x073>\x03\x07'\x09\x03\x07 \x00\x03\x07\x1f\x0b\x03\x07" + + "\x18#\x03\x07\x18(\x03\x07\x186\x03\x07\x18\x03\x03\x07\x19\x16\x03\x07" + + "\x116\x03\x07\x12'\x03\x07\x13\x10\x03\x07\x0c&\x03\x07\x0c\x08\x03\x07" + + "\x0c\x13\x03\x07\x0d\x02\x03\x07\x0d\x1c\x03\x07\x0b5\x03\x07\x0b\x0a" + + "\x03\x07\x0b\x01\x03\x07\x0b\x0f\x03\x07\x05\x00\x03\x07\x05\x09\x03\x07" + + "\x05\x0b\x03\x07\x07\x01\x03\x07\x07\x08\x03\x07\x00<\x03\x07\x00+\x03" + + "\x07\x01)\x03\x07\x01\x1b\x03\x07\x01\x08\x03\x07\x03?\x03\x0445\x03\x04" + + "4\x08\x03\x0454\x03\x04)/\x03\x04)5\x03\x04+\x05\x03\x04+\x14\x03\x04+ " + + "\x03\x04+<\x03\x04*&\x03\x04*\x22\x03\x04&8\x03\x04!\x01\x03\x04!\x22" + + "\x03\x04\x11+\x03\x04\x10.\x03\x04\x104\x03\x04\x13=\x03\x04\x12\x04\x03" + + "\x04\x12\x0a\x03\x04\x0d\x1d\x03\x04\x0d\x07\x03\x04\x0d \x03\x05<>\x03" + + "\x055<\x03\x055!\x03\x055#\x03\x055&\x03\x054\x1d\x03\x054\x02\x03\x054" + + "\x07\x03\x0571\x03\x053\x1a\x03\x053\x16\x03\x05.<\x03\x05.\x07\x03\x05)" + + ":\x03\x05)<\x03\x05)\x0c\x03\x05)\x15\x03\x05+-\x03\x05+5\x03\x05$\x1e" + + "\x03\x05$\x14\x03\x05'\x04\x03\x05'\x14\x03\x05&\x02\x03\x05\x226\x03" + + "\x05\x22\x0c\x03\x05\x22\x1c\x03\x05\x19\x0a\x03\x05\x1b\x09\x03\x05\x1b" + + "\x0c\x03\x05\x14\x07\x03\x05\x16?\x03\x05\x16\x0c\x03\x05\x0c\x05\x03" + + "\x05\x0e\x0f\x03\x05\x01\x0e\x03\x05\x00(\x03\x05\x030\x03\x05\x03\x06" + + "\x03\x0a==\x03\x0a=1\x03\x0a=,\x03\x0a=\x0c\x03\x0a??\x03\x0a<\x08\x03" + + "\x0a9!\x03\x0a9)\x03\x0a97\x03\x0a99\x03\x0a6\x0a\x03\x0a6\x1c\x03\x0a6" + + "\x17\x03\x0a7'\x03\x0a78\x03\x0a73\x03\x0a'\x01\x03\x0a'&\x03\x0a\x1f" + + "\x0e\x03\x0a\x1f\x03\x03\x0a\x1f3\x03\x0a\x1b/\x03\x0a\x18\x19\x03\x0a" + + "\x19\x01\x03\x0a\x16\x14\x03\x0a\x0e\x22\x03\x0a\x0f\x10\x03\x0a\x0f\x02" + + "\x03\x0a\x0f \x03\x0a\x0c\x04\x03\x0a\x0b>\x03\x0a\x0b+\x03\x0a\x08/\x03" + + "\x0a\x046\x03\x0a\x05\x14\x03\x0a\x00\x04\x03\x0a\x00\x10\x03\x0a\x00" + + "\x14\x03\x0b<3\x03\x0b;*\x03\x0b9\x22\x03\x0b9)\x03\x0b97\x03\x0b+\x10" + + "\x03\x0b((\x03\x0b&5\x03\x0b$\x1c\x03\x0b$\x12\x03\x0b%\x04\x03\x0b#<" + + "\x03\x0b#0\x03\x0b#\x0d\x03\x0b#\x19\x03\x0b!:\x03\x0b!\x1f\x03\x0b!\x00" + + "\x03\x0b\x1e5\x03\x0b\x1c\x1d\x03\x0b\x1d-\x03\x0b\x1d(\x03\x0b\x18.\x03" + + "\x0b\x18 \x03\x0b\x18\x16\x03\x0b\x14\x13\x03\x0b\x15$\x03\x0b\x15\x22" + + "\x03\x0b\x12\x1b\x03\x0b\x12\x10\x03\x0b\x132\x03\x0b\x13=\x03\x0b\x12" + + "\x18\x03\x0b\x0c&\x03\x0b\x061\x03\x0b\x06:\x03\x0b\x05#\x03\x0b\x05<" + + "\x03\x0b\x04\x0b\x03\x0b\x04\x04\x03\x0b\x04\x1b\x03\x0b\x042\x03\x0b" + + "\x041\x03\x0b\x03\x03\x03\x0b\x03\x1d\x03\x0b\x03/\x03\x0b\x03+\x03\x0b" + + "\x02\x1b\x03\x0b\x02\x00\x03\x0b\x01\x1e\x03\x0b\x01\x08\x03\x0b\x015" + + "\x03\x06\x0d9\x03\x06\x0d=\x03\x06\x0d?\x03\x02\x001\x03\x02\x003\x03" + + "\x02\x02\x19\x03\x02\x006\x03\x02\x02\x1b\x03\x02\x004\x03\x02\x00<\x03" + + "\x02\x02\x0a\x03\x02\x02\x0e\x03\x02\x01\x1a\x03\x02\x01\x07\x03\x02\x01" + + "\x05\x03\x02\x01\x0b\x03\x02\x01%\x03\x02\x01\x0c\x03\x02\x01\x04\x03" + + "\x02\x01\x1c\x03\x02\x00.\x03\x02\x002\x03\x02\x00>\x03\x02\x00\x12\x03" + + "\x02\x00\x16\x03\x02\x011\x03\x02\x013\x03\x02\x02 \x03\x02\x02%\x03\x02" + + "\x02$\x03\x02\x028\x03\x02\x02;\x03\x02\x024\x03\x02\x012\x03\x02\x022" + + "\x03\x02\x02/\x03\x02\x01,\x03\x02\x01\x13\x03\x02\x01\x16\x03\x02\x01" + + "\x11\x03\x02\x01\x1e\x03\x02\x01\x15\x03\x02\x01\x17\x03\x02\x01\x0f\x03" + + "\x02\x01\x08\x03\x02\x00?\x03\x02\x03\x07\x03\x02\x03\x0d\x03\x02\x03" + + "\x13\x03\x02\x03\x1d\x03\x02\x03\x1f\x03\x02\x00\x03\x03\x02\x00\x0d\x03" + + "\x02\x00\x01\x03\x02\x00\x1b\x03\x02\x00\x19\x03\x02\x00\x18\x03\x02\x00" + + "\x13\x03\x02\x00/\x03\x07>\x12\x03\x07<\x1f\x03\x07>\x1d\x03\x06\x1d\x0e" + + "\x03\x07>\x1c\x03\x07>:\x03\x07>\x13\x03\x04\x12+\x03\x07?\x03\x03\x07>" + + "\x02\x03\x06\x224\x03\x06\x1a.\x03\x07<%\x03\x06\x1c\x0b\x03\x0609\x03" + + "\x05\x1f\x01\x03\x04'\x08\x03\x93\xfd\xf5\x03\x02\x0d \x03\x02\x0d#\x03" + + "\x02\x0d!\x03\x02\x0d&\x03\x02\x0d\x22\x03\x02\x0d/\x03\x02\x0d,\x03\x02" + + "\x0d$\x03\x02\x0d'\x03\x02\x0d%\x03\x02\x0d;\x03\x02\x0d=\x03\x02\x0d?" + + "\x03\x099.\x03\x08\x0b7\x03\x08\x02\x14\x03\x08\x14\x0d\x03\x08.:\x03" + + "\x089'\x03\x0f\x0b\x18\x03\x0f\x1c1\x03\x0f\x17&\x03\x0f9\x1f\x03\x0f0" + + "\x0c\x03\x0e\x0a9\x03\x0e\x056\x03\x0e\x1c#\x03\x0f\x13\x0e\x03\x072\x00" + + "\x03\x070\x0d\x03\x072\x0b\x03\x06\x11\x18\x03\x070\x10\x03\x06\x0f(\x03" + + "\x072\x05\x03\x06\x0f,\x03\x073\x15\x03\x06\x07\x08\x03\x05\x16\x02\x03" + + "\x04\x0b \x03\x05:8\x03\x05\x16%\x03\x0a\x0d\x1f\x03\x06\x16\x10\x03\x05" + + "\x1d5\x03\x05*;\x03\x05\x16\x1b\x03\x04.-\x03\x06\x1a\x19\x03\x04\x03," + + "\x03\x0b87\x03\x04/\x0a\x03\x06\x00,\x03\x04-\x01\x03\x04\x1e-\x03\x06/(" + + "\x03\x0a\x0b5\x03\x06\x0e7\x03\x06\x07.\x03\x0597\x03\x0a*%\x03\x0760" + + "\x03\x06\x0c;\x03\x05'\x00\x03\x072.\x03\x072\x08\x03\x06=\x01\x03\x06" + + "\x05\x1b\x03\x06\x06\x12\x03\x06$=\x03\x06'\x0d\x03\x04\x11\x0f\x03\x076" + + ",\x03\x06\x07;\x03\x06.,\x03\x86\xf9\xea\x03\x8f\xff\xeb\x02\x092\x02" + + "\x095\x02\x094\x02\x09;\x02\x09>\x02\x098\x02\x09*\x02\x09/\x02\x09,\x02" + + "\x09%\x02\x09&\x02\x09#\x02\x09 \x02\x08!\x02\x08%\x02\x08$\x02\x08+\x02" + + "\x08.\x02\x08*\x02\x08&\x02\x088\x02\x08>\x02\x084\x02\x086\x02\x080\x02" + + "\x08\x10\x02\x08\x17\x02\x08\x12\x02\x08\x1d\x02\x08\x1f\x02\x08\x13\x02" + + "\x08\x15\x02\x08\x14\x02\x08\x0c\x03\x8b\xfd\xd0\x03\x81\xec\xc6\x03\x87" + + "\xe0\x8a\x03-2\xe3\x03\x80\xef\xe4\x03-2\xea\x03\x88\xe6\xeb\x03\x8e\xe6" + + "\xe8\x03\x84\xe6\xe9\x03\x97\xe6\xee\x03-2\xf9\x03-2\xf6\x03\x8e\xe3\xad" + + "\x03\x80\xe3\x92\x03\x88\xe3\x90\x03\x8e\xe3\x90\x03\x80\xe3\x97\x03\x88" + + "\xe3\x95\x03\x88\xfe\xcb\x03\x8e\xfe\xca\x03\x84\xfe\xcd\x03\x91\xef\xc9" + + "\x03-2\xc1\x03-2\xc0\x03-2\xcb\x03\x88@\x09\x03\x8e@\x08\x03\x8f\xe0\xf5" + + "\x03\x8e\xe6\xf9\x03\x8e\xe0\xfa\x03\x93\xff\xf4\x03\x84\xee\xd3\x03\x0b" + + "(\x04\x023 \x021;\x02\x01*\x03\x0b#\x10\x03\x0b 0\x03\x0b!\x10\x03\x0b!0" + + "\x03\x07\x15\x08\x03\x09?5\x03\x07\x1f\x08\x03\x07\x17\x0b\x03\x09\x1f" + + "\x15\x03\x0b\x1c7\x03\x0a+#\x03\x06\x1a\x1b\x03\x06\x1a\x14\x03\x0a\x01" + + "\x18\x03\x06#\x1b\x03\x0a2\x0c\x03\x0a\x01\x04\x03\x09#;\x03\x08='\x03" + + "\x08\x1a\x0a\x03\x07\x03\x0a\x111\x03\x09\x1b\x09\x03\x073.\x03\x07\x01\x00" + + "\x03\x09/,\x03\x07#>\x03\x07\x048\x03\x0a\x1f\x22\x03\x098>\x03\x09\x11" + + "\x00\x03\x08/\x17\x03\x06'\x22\x03\x0b\x1a+\x03\x0a\x22\x19\x03\x0a/1" + + "\x03\x0974\x03\x09\x0f\x22\x03\x08,\x22\x03\x08?\x14\x03\x07$5\x03\x07<3" + + "\x03\x07=*\x03\x07\x13\x18\x03\x068\x0a\x03\x06\x09\x16\x03\x06\x13\x00" + + "\x03\x08\x067\x03\x08\x01\x03\x03\x08\x12\x1d\x03\x07+7\x03\x06(;\x03" + + "\x06\x1c?\x03\x07\x0e\x17\x03\x0a\x06\x1d\x03\x0a\x19\x07\x03\x08\x14$" + + "\x03\x07$;\x03\x08,$\x03\x08\x06\x0d\x03\x07\x16\x0a\x03\x06>>\x03\x0a" + + "\x06\x12\x03\x0a\x14)\x03\x09\x0d\x1f\x03\x09\x12\x17\x03\x09\x19\x01" + + "\x03\x08\x11 \x03\x08\x1d'\x03\x06<\x1a\x03\x0a.\x00\x03\x07'\x18\x03" + + "\x0a\x22\x08\x03\x08\x0d\x0a\x03\x08\x13)\x03\x07*)\x03\x06<,\x03\x07" + + "\x0b\x1a\x03\x09.\x14\x03\x09\x0d\x1e\x03\x07\x0e#\x03\x0b\x1d'\x03\x0a" + + "\x0a8\x03\x09%2\x03\x08+&\x03\x080\x12\x03\x0a)4\x03\x08\x06\x1f\x03\x0b" + + "\x1b\x1a\x03\x0a\x1b\x0f\x03\x0b\x1d*\x03\x09\x16$\x03\x090\x11\x03\x08" + + "\x11\x08\x03\x0a*(\x03\x0a\x042\x03\x089,\x03\x074'\x03\x07\x0f\x05\x03" + + "\x09\x0b\x0a\x03\x07\x1b\x01\x03\x09\x17:\x03\x09.\x0d\x03\x07.\x11\x03" + + "\x09+\x15\x03\x080\x13\x03\x0b\x1f\x19\x03\x0a \x11\x03\x0a\x220\x03\x09" + + "\x07;\x03\x08\x16\x1c\x03\x07,\x13\x03\x07\x0e/\x03\x06\x221\x03\x0a." + + "\x0a\x03\x0a7\x02\x03\x0a\x032\x03\x0a\x1d.\x03\x091\x06\x03\x09\x19:" + + "\x03\x08\x02/\x03\x060+\x03\x06\x0f-\x03\x06\x1c\x1f\x03\x06\x1d\x07\x03" + + "\x0a,\x11\x03\x09=\x0d\x03\x09\x0b;\x03\x07\x1b/\x03\x0a\x1f:\x03\x09 " + + "\x1f\x03\x09.\x10\x03\x094\x0b\x03\x09\x1a1\x03\x08#\x1a\x03\x084\x1d" + + "\x03\x08\x01\x1f\x03\x08\x11\x22\x03\x07'8\x03\x07\x1a>\x03\x0757\x03" + + "\x06&9\x03\x06+\x11\x03\x0a.\x0b\x03\x0a,>\x03\x0a4#\x03\x08%\x17\x03" + + "\x07\x05\x22\x03\x07\x0c\x0b\x03\x0a\x1d+\x03\x0a\x19\x16\x03\x09+\x1f" + + "\x03\x09\x08\x0b\x03\x08\x16\x18\x03\x08+\x12\x03\x0b\x1d\x0c\x03\x0a=" + + "\x10\x03\x0a\x09\x0d\x03\x0a\x10\x11\x03\x09&0\x03\x08(\x1f\x03\x087\x07" + + "\x03\x08\x185\x03\x07'6\x03\x06.\x05\x03\x06=\x04\x03\x06;;\x03\x06\x06," + + "\x03\x0b\x18>\x03\x08\x00\x18\x03\x06 \x03\x03\x06<\x00\x03\x09%\x18\x03" + + "\x0b\x1c<\x03\x0a%!\x03\x0a\x09\x12\x03\x0a\x16\x02\x03\x090'\x03\x09" + + "\x0e=\x03\x08 \x0e\x03\x08>\x03\x03\x074>\x03\x06&?\x03\x06\x19\x09\x03" + + "\x06?(\x03\x0a-\x0e\x03\x09:3\x03\x098:\x03\x09\x12\x0b\x03\x09\x1d\x17" + + "\x03\x087\x05\x03\x082\x14\x03\x08\x06%\x03\x08\x13\x1f\x03\x06\x06\x0e" + + "\x03\x0a\x22<\x03\x09/<\x03\x06>+\x03\x0a'?\x03\x0a\x13\x0c\x03\x09\x10<" + + "\x03\x07\x1b=\x03\x0a\x19\x13\x03\x09\x22\x1d\x03\x09\x07\x0d\x03\x08)" + + "\x1c\x03\x06=\x1a\x03\x0a/4\x03\x0a7\x11\x03\x0a\x16:\x03\x09?3\x03\x09:" + + "/\x03\x09\x05\x0a\x03\x09\x14\x06\x03\x087\x22\x03\x080\x07\x03\x08\x1a" + + "\x1f\x03\x07\x04(\x03\x07\x04\x09\x03\x06 %\x03\x06<\x08\x03\x0a+\x14" + + "\x03\x09\x1d\x16\x03\x0a70\x03\x08 >\x03\x0857\x03\x070\x0a\x03\x06=\x12" + + "\x03\x06\x16%\x03\x06\x1d,\x03\x099#\x03\x09\x10>\x03\x07 \x1e\x03\x08" + + "\x0c<\x03\x08\x0b\x18\x03\x08\x15+\x03\x08,:\x03\x08%\x22\x03\x07\x0a$" + + "\x03\x0b\x1c=\x03\x07+\x08\x03\x0a/\x05\x03\x0a \x07\x03\x0a\x12'\x03" + + "\x09#\x11\x03\x08\x1b\x15\x03\x0a\x06\x01\x03\x09\x1c\x1b\x03\x0922\x03" + + "\x07\x14<\x03\x07\x09\x04\x03\x061\x04\x03\x07\x0e\x01\x03\x0a\x13\x18" + + "\x03\x0a-\x0c\x03\x0a?\x0d\x03\x0a\x09\x0a\x03\x091&\x03\x0a/\x0b\x03" + + "\x08$<\x03\x083\x1d\x03\x08\x0c$\x03\x08\x0d\x07\x03\x08\x0d?\x03\x08" + + "\x0e\x14\x03\x065\x0a\x03\x08\x1a#\x03\x08\x16#\x03\x0702\x03\x07\x03" + + "\x1a\x03\x06(\x1d\x03\x06+\x1b\x03\x06\x0b\x05\x03\x06\x0b\x17\x03\x06" + + "\x0c\x04\x03\x06\x1e\x19\x03\x06+0\x03\x062\x18\x03\x0b\x16\x1e\x03\x0a+" + + "\x16\x03\x0a-?\x03\x0a#:\x03\x0a#\x10\x03\x0a%$\x03\x0a>+\x03\x0a01\x03" + + "\x0a1\x10\x03\x0a\x099\x03\x0a\x0a\x12\x03\x0a\x19\x1f\x03\x0a\x19\x12" + + "\x03\x09*)\x03\x09-\x16\x03\x09.1\x03\x09.2\x03\x09<\x0e\x03\x09> \x03" + + "\x093\x12\x03\x09\x0b\x01\x03\x09\x1c2\x03\x09\x11\x1c\x03\x09\x15%\x03" + + "\x08,&\x03\x08!\x22\x03\x089(\x03\x08\x0b\x1a\x03\x08\x0d2\x03\x08\x0c" + + "\x04\x03\x08\x0c\x06\x03\x08\x0c\x1f\x03\x08\x0c\x0c\x03\x08\x0f\x1f\x03" + + "\x08\x0f\x1d\x03\x08\x00\x14\x03\x08\x03\x14\x03\x08\x06\x16\x03\x08\x1e" + + "#\x03\x08\x11\x11\x03\x08\x10\x18\x03\x08\x14(\x03\x07)\x1e\x03\x07.1" + + "\x03\x07 $\x03\x07 '\x03\x078\x08\x03\x07\x0d0\x03\x07\x0f7\x03\x07\x05#" + + "\x03\x07\x05\x1a\x03\x07\x1a7\x03\x07\x1d-\x03\x07\x17\x10\x03\x06)\x1f" + + "\x03\x062\x0b\x03\x066\x16\x03\x06\x09\x11\x03\x09(\x1e\x03\x07!5\x03" + + "\x0b\x11\x16\x03\x0a/\x04\x03\x0a,\x1a\x03\x0b\x173\x03\x0a,1\x03\x0a/5" + + "\x03\x0a\x221\x03\x0a\x22\x0d\x03\x0a?%\x03\x0a<,\x03\x0a?#\x03\x0a>\x19" + + "\x03\x0a\x08&\x03\x0a\x0b\x0e\x03\x0a\x0c:\x03\x0a\x0c+\x03\x0a\x03\x22" + + "\x03\x0a\x06)\x03\x0a\x11\x10\x03\x0a\x11\x1a\x03\x0a\x17-\x03\x0a\x14(" + + "\x03\x09)\x1e\x03\x09/\x09\x03\x09.\x00\x03\x09,\x07\x03\x09/*\x03\x09-9" + + "\x03\x09\x228\x03\x09%\x09\x03\x09:\x12\x03\x09;\x1d\x03\x09?\x06\x03" + + "\x093%\x03\x096\x05\x03\x096\x08\x03\x097\x02\x03\x09\x07,\x03\x09\x04," + + "\x03\x09\x1f\x16\x03\x09\x11\x03\x03\x09\x11\x12\x03\x09\x168\x03\x08*" + + "\x05\x03\x08/2\x03\x084:\x03\x08\x22+\x03\x08 0\x03\x08&\x0a\x03\x08;" + + "\x10\x03\x08>$\x03\x08>\x18\x03\x0829\x03\x082:\x03\x081,\x03\x081<\x03" + + "\x081\x1c\x03\x087#\x03\x087*\x03\x08\x09'\x03\x08\x00\x1d\x03\x08\x05-" + + "\x03\x08\x1f4\x03\x08\x1d\x04\x03\x08\x16\x0f\x03\x07*7\x03\x07'!\x03" + + "\x07%\x1b\x03\x077\x0c\x03\x07\x0c1\x03\x07\x0c.\x03\x07\x00\x06\x03\x07" + + "\x01\x02\x03\x07\x010\x03\x07\x06=\x03\x07\x01\x03\x03\x07\x01\x13\x03" + + "\x07\x06\x06\x03\x07\x05\x0a\x03\x07\x1f\x09\x03\x07\x17:\x03\x06*1\x03" + + "\x06-\x1d\x03\x06\x223\x03\x062:\x03\x060$\x03\x066\x1e\x03\x064\x12\x03" + + "\x0645\x03\x06\x0b\x00\x03\x06\x0b7\x03\x06\x07\x1f\x03\x06\x15\x12\x03" + + "\x0c\x05\x0f\x03\x0b+\x0b\x03\x0b+-\x03\x06\x16\x1b\x03\x06\x15\x17\x03" + + "\x89\xca\xea\x03\x89\xca\xe8\x03\x0c8\x10\x03\x0c8\x01\x03\x0c8\x0f\x03" + + "\x0d8%\x03\x0d8!\x03\x0c8-\x03\x0c8/\x03\x0c8+\x03\x0c87\x03\x0c85\x03" + + "\x0c9\x09\x03\x0c9\x0d\x03\x0c9\x0f\x03\x0c9\x0b\x03\xcfu\x0c\x03\xcfu" + + "\x0f\x03\xcfu\x0e\x03\xcfu\x09\x03\x0c9\x10\x03\x0d9\x0c\x03\xcf`;\x03" + + "\xcf`>\x03\xcf`9\x03\xcf`8\x03\xcf`7\x03\xcf`*\x03\xcf`-\x03\xcf`,\x03" + + "\x0d\x1b\x1a\x03\x0d\x1b&\x03\x0c=.\x03\x0c=%\x03\x0c>\x1e\x03\x0c>\x14" + + "\x03\x0c?\x06\x03\x0c?\x0b\x03\x0c?\x0c\x03\x0c?\x0d\x03\x0c?\x02\x03" + + "\x0c>\x0f\x03\x0c>\x08\x03\x0c>\x09\x03\x0c>,\x03\x0c>\x0c\x03\x0c?\x13" + + "\x03\x0c?\x16\x03\x0c?\x15\x03\x0c?\x1c\x03\x0c?\x1f\x03\x0c?\x1d\x03" + + "\x0c?\x1a\x03\x0c?\x17\x03\x0c?\x08\x03\x0c?\x09\x03\x0c?\x0e\x03\x0c?" + + "\x04\x03\x0c?\x05\x03\x0c" + + "\x03\x0c=2\x03\x0c=6\x03\x0c<\x07\x03\x0c<\x05\x03\x0e:!\x03\x0e:#\x03" + + "\x0e8\x09\x03\x0e:&\x03\x0e8\x0b\x03\x0e:$\x03\x0e:,\x03\x0e8\x1a\x03" + + "\x0e8\x1e\x03\x0e:*\x03\x0e:7\x03\x0e:5\x03\x0e:;\x03\x0e:\x15\x03\x0e:<" + + "\x03\x0e:4\x03\x0e:'\x03\x0e:-\x03\x0e:%\x03\x0e:?\x03\x0e:=\x03\x0e:)" + + "\x03\x0e:/\x03\xcfs'\x03\x0d=\x0f\x03\x0d+*\x03\x0d99\x03\x0d9;\x03\x0d9" + + "?\x03\x0d)\x0d\x03\x0d(%\x02\x01\x18\x02\x01(\x02\x01\x1e\x03\x0f$!\x03" + + "\x0f87\x03\x0f4\x0e\x03\x0f5\x1d\x03\x06'\x03\x03\x0f\x08\x18\x03\x0f" + + "\x0d\x1b\x03\x0e2=\x03\x0e;\x08\x03\x0e:\x0b\x03\x0e\x06$\x03\x0e\x0d)" + + "\x03\x0e\x16\x1f\x03\x0e\x16\x1b\x03\x0d$\x0a\x03\x05,\x1d\x03\x0d. \x03" + + "\x0d.#\x03\x0c(/\x03\x09%\x02\x03\x0d90\x03\x0d\x0e4\x03\x0d\x0d\x0f\x03" + + "\x0c#\x00\x03\x0c,\x1e\x03\x0c2\x0e\x03\x0c\x01\x17\x03\x0c\x09:\x03\x0e" + + "\x173\x03\x0c\x08\x03\x03\x0c\x11\x07\x03\x0c\x10\x18\x03\x0c\x1f\x1c" + + "\x03\x0c\x19\x0e\x03\x0c\x1a\x1f\x03\x0f0>\x03\x0b->\x03\x0b<+\x03\x0b8" + + "\x13\x03\x0b\x043\x03\x0b\x14\x03\x03\x0b\x16%\x03\x0d\x22&\x03\x0b\x1a" + + "\x1a\x03\x0b\x1a\x04\x03\x0a%9\x03\x0a&2\x03\x0a&0\x03\x0a!\x1a\x03\x0a!" + + "7\x03\x0a5\x10\x03\x0a=4\x03\x0a?\x0e\x03\x0a>\x10\x03\x0a\x00 \x03\x0a" + + "\x0f:\x03\x0a\x0f9\x03\x0a\x0b\x0a\x03\x0a\x17%\x03\x0a\x1b-\x03\x09-" + + "\x1a\x03\x09,4\x03\x09.,\x03\x09)\x09\x03\x096!\x03\x091\x1f\x03\x093" + + "\x16\x03\x0c+\x1f\x03\x098 \x03\x098=\x03\x0c(\x1a\x03\x0c(\x16\x03\x09" + + "\x0a+\x03\x09\x16\x12\x03\x09\x13\x0e\x03\x09\x153\x03\x08)!\x03\x09\x1a" + + "\x01\x03\x09\x18\x01\x03\x08%#\x03\x08>\x22\x03\x08\x05%\x03\x08\x02*" + + "\x03\x08\x15;\x03\x08\x1b7\x03\x0f\x07\x1d\x03\x0f\x04\x03\x03\x070\x0c" + + "\x03\x07;\x0b\x03\x07\x08\x17\x03\x07\x12\x06\x03\x06/-\x03\x0671\x03" + + "\x065+\x03\x06>7\x03\x06\x049\x03\x05+\x1e\x03\x05,\x17\x03\x05 \x1d\x03" + + "\x05\x22\x05\x03\x050\x1d" + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *idnaTrie) lookup(s []byte) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return idnaValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := idnaIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := idnaIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = idnaIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := idnaIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = idnaIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = idnaIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *idnaTrie) lookupUnsafe(s []byte) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return idnaValues[c0] + } + i := idnaIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = idnaIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = idnaIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *idnaTrie) lookupString(s string) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return idnaValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := idnaIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := idnaIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = idnaIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := idnaIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = idnaIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = idnaIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *idnaTrie) lookupStringUnsafe(s string) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return idnaValues[c0] + } + i := idnaIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = idnaIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = idnaIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// idnaTrie. Total size: 28496 bytes (27.83 KiB). Checksum: 43288b883596640e. +type idnaTrie struct{} + +func newIdnaTrie(i int) *idnaTrie { + return &idnaTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *idnaTrie) lookupValue(n uint32, b byte) uint16 { + switch { + case n < 123: + return uint16(idnaValues[n<<6+uint32(b)]) + default: + n -= 123 + return uint16(idnaSparse.lookup(n, b)) + } +} + +// idnaValues: 125 blocks, 8000 entries, 16000 bytes +// The third block is the zero block. +var idnaValues = [8000]uint16{ + // Block 0x0, offset 0x0 + 0x00: 0x0080, 0x01: 0x0080, 0x02: 0x0080, 0x03: 0x0080, 0x04: 0x0080, 0x05: 0x0080, + 0x06: 0x0080, 0x07: 0x0080, 0x08: 0x0080, 0x09: 0x0080, 0x0a: 0x0080, 0x0b: 0x0080, + 0x0c: 0x0080, 0x0d: 0x0080, 0x0e: 0x0080, 0x0f: 0x0080, 0x10: 0x0080, 0x11: 0x0080, + 0x12: 0x0080, 0x13: 0x0080, 0x14: 0x0080, 0x15: 0x0080, 0x16: 0x0080, 0x17: 0x0080, + 0x18: 0x0080, 0x19: 0x0080, 0x1a: 0x0080, 0x1b: 0x0080, 0x1c: 0x0080, 0x1d: 0x0080, + 0x1e: 0x0080, 0x1f: 0x0080, 0x20: 0x0080, 0x21: 0x0080, 0x22: 0x0080, 0x23: 0x0080, + 0x24: 0x0080, 0x25: 0x0080, 0x26: 0x0080, 0x27: 0x0080, 0x28: 0x0080, 0x29: 0x0080, + 0x2a: 0x0080, 0x2b: 0x0080, 0x2c: 0x0080, 0x2d: 0x0008, 0x2e: 0x0008, 0x2f: 0x0080, + 0x30: 0x0008, 0x31: 0x0008, 0x32: 0x0008, 0x33: 0x0008, 0x34: 0x0008, 0x35: 0x0008, + 0x36: 0x0008, 0x37: 0x0008, 0x38: 0x0008, 0x39: 0x0008, 0x3a: 0x0080, 0x3b: 0x0080, + 0x3c: 0x0080, 0x3d: 0x0080, 0x3e: 0x0080, 0x3f: 0x0080, + // Block 0x1, offset 0x40 + 0x40: 0x0080, 0x41: 0xe105, 0x42: 0xe105, 0x43: 0xe105, 0x44: 0xe105, 0x45: 0xe105, + 0x46: 0xe105, 0x47: 0xe105, 0x48: 0xe105, 0x49: 0xe105, 0x4a: 0xe105, 0x4b: 0xe105, + 0x4c: 0xe105, 0x4d: 0xe105, 0x4e: 0xe105, 0x4f: 0xe105, 0x50: 0xe105, 0x51: 0xe105, + 0x52: 0xe105, 0x53: 0xe105, 0x54: 0xe105, 0x55: 0xe105, 0x56: 0xe105, 0x57: 0xe105, + 0x58: 0xe105, 0x59: 0xe105, 0x5a: 0xe105, 0x5b: 0x0080, 0x5c: 0x0080, 0x5d: 0x0080, + 0x5e: 0x0080, 0x5f: 0x0080, 0x60: 0x0080, 0x61: 0x0008, 0x62: 0x0008, 0x63: 0x0008, + 0x64: 0x0008, 0x65: 0x0008, 0x66: 0x0008, 0x67: 0x0008, 0x68: 0x0008, 0x69: 0x0008, + 0x6a: 0x0008, 0x6b: 0x0008, 0x6c: 0x0008, 0x6d: 0x0008, 0x6e: 0x0008, 0x6f: 0x0008, + 0x70: 0x0008, 0x71: 0x0008, 0x72: 0x0008, 0x73: 0x0008, 0x74: 0x0008, 0x75: 0x0008, + 0x76: 0x0008, 0x77: 0x0008, 0x78: 0x0008, 0x79: 0x0008, 0x7a: 0x0008, 0x7b: 0x0080, + 0x7c: 0x0080, 0x7d: 0x0080, 0x7e: 0x0080, 0x7f: 0x0080, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x0040, 0xc1: 0x0040, 0xc2: 0x0040, 0xc3: 0x0040, 0xc4: 0x0040, 0xc5: 0x0040, + 0xc6: 0x0040, 0xc7: 0x0040, 0xc8: 0x0040, 0xc9: 0x0040, 0xca: 0x0040, 0xcb: 0x0040, + 0xcc: 0x0040, 0xcd: 0x0040, 0xce: 0x0040, 0xcf: 0x0040, 0xd0: 0x0040, 0xd1: 0x0040, + 0xd2: 0x0040, 0xd3: 0x0040, 0xd4: 0x0040, 0xd5: 0x0040, 0xd6: 0x0040, 0xd7: 0x0040, + 0xd8: 0x0040, 0xd9: 0x0040, 0xda: 0x0040, 0xdb: 0x0040, 0xdc: 0x0040, 0xdd: 0x0040, + 0xde: 0x0040, 0xdf: 0x0040, 0xe0: 0x000a, 0xe1: 0x0018, 0xe2: 0x0018, 0xe3: 0x0018, + 0xe4: 0x0018, 0xe5: 0x0018, 0xe6: 0x0018, 0xe7: 0x0018, 0xe8: 0x001a, 0xe9: 0x0018, + 0xea: 0x0039, 0xeb: 0x0018, 0xec: 0x0018, 0xed: 0x03c0, 0xee: 0x0018, 0xef: 0x004a, + 0xf0: 0x0018, 0xf1: 0x0018, 0xf2: 0x0069, 0xf3: 0x0079, 0xf4: 0x008a, 0xf5: 0x0005, + 0xf6: 0x0018, 0xf7: 0x0008, 0xf8: 0x00aa, 0xf9: 0x00c9, 0xfa: 0x00d9, 0xfb: 0x0018, + 0xfc: 0x00e9, 0xfd: 0x0119, 0xfe: 0x0149, 0xff: 0x0018, + // Block 0x4, offset 0x100 + 0x100: 0xe00d, 0x101: 0x0008, 0x102: 0xe00d, 0x103: 0x0008, 0x104: 0xe00d, 0x105: 0x0008, + 0x106: 0xe00d, 0x107: 0x0008, 0x108: 0xe00d, 0x109: 0x0008, 0x10a: 0xe00d, 0x10b: 0x0008, + 0x10c: 0xe00d, 0x10d: 0x0008, 0x10e: 0xe00d, 0x10f: 0x0008, 0x110: 0xe00d, 0x111: 0x0008, + 0x112: 0xe00d, 0x113: 0x0008, 0x114: 0xe00d, 0x115: 0x0008, 0x116: 0xe00d, 0x117: 0x0008, + 0x118: 0xe00d, 0x119: 0x0008, 0x11a: 0xe00d, 0x11b: 0x0008, 0x11c: 0xe00d, 0x11d: 0x0008, + 0x11e: 0xe00d, 0x11f: 0x0008, 0x120: 0xe00d, 0x121: 0x0008, 0x122: 0xe00d, 0x123: 0x0008, + 0x124: 0xe00d, 0x125: 0x0008, 0x126: 0xe00d, 0x127: 0x0008, 0x128: 0xe00d, 0x129: 0x0008, + 0x12a: 0xe00d, 0x12b: 0x0008, 0x12c: 0xe00d, 0x12d: 0x0008, 0x12e: 0xe00d, 0x12f: 0x0008, + 0x130: 0x0179, 0x131: 0x0008, 0x132: 0x0035, 0x133: 0x004d, 0x134: 0xe00d, 0x135: 0x0008, + 0x136: 0xe00d, 0x137: 0x0008, 0x138: 0x0008, 0x139: 0xe01d, 0x13a: 0x0008, 0x13b: 0xe03d, + 0x13c: 0x0008, 0x13d: 0xe01d, 0x13e: 0x0008, 0x13f: 0x0199, + // Block 0x5, offset 0x140 + 0x140: 0x0199, 0x141: 0xe01d, 0x142: 0x0008, 0x143: 0xe03d, 0x144: 0x0008, 0x145: 0xe01d, + 0x146: 0x0008, 0x147: 0xe07d, 0x148: 0x0008, 0x149: 0x01b9, 0x14a: 0xe00d, 0x14b: 0x0008, + 0x14c: 0xe00d, 0x14d: 0x0008, 0x14e: 0xe00d, 0x14f: 0x0008, 0x150: 0xe00d, 0x151: 0x0008, + 0x152: 0xe00d, 0x153: 0x0008, 0x154: 0xe00d, 0x155: 0x0008, 0x156: 0xe00d, 0x157: 0x0008, + 0x158: 0xe00d, 0x159: 0x0008, 0x15a: 0xe00d, 0x15b: 0x0008, 0x15c: 0xe00d, 0x15d: 0x0008, + 0x15e: 0xe00d, 0x15f: 0x0008, 0x160: 0xe00d, 0x161: 0x0008, 0x162: 0xe00d, 0x163: 0x0008, + 0x164: 0xe00d, 0x165: 0x0008, 0x166: 0xe00d, 0x167: 0x0008, 0x168: 0xe00d, 0x169: 0x0008, + 0x16a: 0xe00d, 0x16b: 0x0008, 0x16c: 0xe00d, 0x16d: 0x0008, 0x16e: 0xe00d, 0x16f: 0x0008, + 0x170: 0xe00d, 0x171: 0x0008, 0x172: 0xe00d, 0x173: 0x0008, 0x174: 0xe00d, 0x175: 0x0008, + 0x176: 0xe00d, 0x177: 0x0008, 0x178: 0x0065, 0x179: 0xe01d, 0x17a: 0x0008, 0x17b: 0xe03d, + 0x17c: 0x0008, 0x17d: 0xe01d, 0x17e: 0x0008, 0x17f: 0x01d9, + // Block 0x6, offset 0x180 + 0x180: 0x0008, 0x181: 0x007d, 0x182: 0xe00d, 0x183: 0x0008, 0x184: 0xe00d, 0x185: 0x0008, + 0x186: 0x007d, 0x187: 0xe07d, 0x188: 0x0008, 0x189: 0x0095, 0x18a: 0x00ad, 0x18b: 0xe03d, + 0x18c: 0x0008, 0x18d: 0x0008, 0x18e: 0x00c5, 0x18f: 0x00dd, 0x190: 0x00f5, 0x191: 0xe01d, + 0x192: 0x0008, 0x193: 0x010d, 0x194: 0x0125, 0x195: 0x0008, 0x196: 0x013d, 0x197: 0x013d, + 0x198: 0xe00d, 0x199: 0x0008, 0x19a: 0x0008, 0x19b: 0x0008, 0x19c: 0x010d, 0x19d: 0x0155, + 0x19e: 0x0008, 0x19f: 0x016d, 0x1a0: 0xe00d, 0x1a1: 0x0008, 0x1a2: 0xe00d, 0x1a3: 0x0008, + 0x1a4: 0xe00d, 0x1a5: 0x0008, 0x1a6: 0x0185, 0x1a7: 0xe07d, 0x1a8: 0x0008, 0x1a9: 0x019d, + 0x1aa: 0x0008, 0x1ab: 0x0008, 0x1ac: 0xe00d, 0x1ad: 0x0008, 0x1ae: 0x0185, 0x1af: 0xe0fd, + 0x1b0: 0x0008, 0x1b1: 0x01b5, 0x1b2: 0x01cd, 0x1b3: 0xe03d, 0x1b4: 0x0008, 0x1b5: 0xe01d, + 0x1b6: 0x0008, 0x1b7: 0x01e5, 0x1b8: 0xe00d, 0x1b9: 0x0008, 0x1ba: 0x0008, 0x1bb: 0x0008, + 0x1bc: 0xe00d, 0x1bd: 0x0008, 0x1be: 0x0008, 0x1bf: 0x0008, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x0008, 0x1c1: 0x0008, 0x1c2: 0x0008, 0x1c3: 0x0008, 0x1c4: 0x01e9, 0x1c5: 0x01e9, + 0x1c6: 0x01e9, 0x1c7: 0x01fd, 0x1c8: 0x0215, 0x1c9: 0x022d, 0x1ca: 0x0245, 0x1cb: 0x025d, + 0x1cc: 0x0275, 0x1cd: 0xe01d, 0x1ce: 0x0008, 0x1cf: 0xe0fd, 0x1d0: 0x0008, 0x1d1: 0xe01d, + 0x1d2: 0x0008, 0x1d3: 0xe03d, 0x1d4: 0x0008, 0x1d5: 0xe01d, 0x1d6: 0x0008, 0x1d7: 0xe07d, + 0x1d8: 0x0008, 0x1d9: 0xe01d, 0x1da: 0x0008, 0x1db: 0xe03d, 0x1dc: 0x0008, 0x1dd: 0x0008, + 0x1de: 0xe00d, 0x1df: 0x0008, 0x1e0: 0xe00d, 0x1e1: 0x0008, 0x1e2: 0xe00d, 0x1e3: 0x0008, + 0x1e4: 0xe00d, 0x1e5: 0x0008, 0x1e6: 0xe00d, 0x1e7: 0x0008, 0x1e8: 0xe00d, 0x1e9: 0x0008, + 0x1ea: 0xe00d, 0x1eb: 0x0008, 0x1ec: 0xe00d, 0x1ed: 0x0008, 0x1ee: 0xe00d, 0x1ef: 0x0008, + 0x1f0: 0x0008, 0x1f1: 0x028d, 0x1f2: 0x02a5, 0x1f3: 0x02bd, 0x1f4: 0xe00d, 0x1f5: 0x0008, + 0x1f6: 0x02d5, 0x1f7: 0x02ed, 0x1f8: 0xe00d, 0x1f9: 0x0008, 0x1fa: 0xe00d, 0x1fb: 0x0008, + 0x1fc: 0xe00d, 0x1fd: 0x0008, 0x1fe: 0xe00d, 0x1ff: 0x0008, + // Block 0x8, offset 0x200 + 0x200: 0xe00d, 0x201: 0x0008, 0x202: 0xe00d, 0x203: 0x0008, 0x204: 0xe00d, 0x205: 0x0008, + 0x206: 0xe00d, 0x207: 0x0008, 0x208: 0xe00d, 0x209: 0x0008, 0x20a: 0xe00d, 0x20b: 0x0008, + 0x20c: 0xe00d, 0x20d: 0x0008, 0x20e: 0xe00d, 0x20f: 0x0008, 0x210: 0xe00d, 0x211: 0x0008, + 0x212: 0xe00d, 0x213: 0x0008, 0x214: 0xe00d, 0x215: 0x0008, 0x216: 0xe00d, 0x217: 0x0008, + 0x218: 0xe00d, 0x219: 0x0008, 0x21a: 0xe00d, 0x21b: 0x0008, 0x21c: 0xe00d, 0x21d: 0x0008, + 0x21e: 0xe00d, 0x21f: 0x0008, 0x220: 0x0305, 0x221: 0x0008, 0x222: 0xe00d, 0x223: 0x0008, + 0x224: 0xe00d, 0x225: 0x0008, 0x226: 0xe00d, 0x227: 0x0008, 0x228: 0xe00d, 0x229: 0x0008, + 0x22a: 0xe00d, 0x22b: 0x0008, 0x22c: 0xe00d, 0x22d: 0x0008, 0x22e: 0xe00d, 0x22f: 0x0008, + 0x230: 0xe00d, 0x231: 0x0008, 0x232: 0xe00d, 0x233: 0x0008, 0x234: 0x0008, 0x235: 0x0008, + 0x236: 0x0008, 0x237: 0x0008, 0x238: 0x0008, 0x239: 0x0008, 0x23a: 0x0209, 0x23b: 0xe03d, + 0x23c: 0x0008, 0x23d: 0x031d, 0x23e: 0x0229, 0x23f: 0x0008, + // Block 0x9, offset 0x240 + 0x240: 0x0008, 0x241: 0x0008, 0x242: 0x0018, 0x243: 0x0018, 0x244: 0x0018, 0x245: 0x0018, + 0x246: 0x0008, 0x247: 0x0008, 0x248: 0x0008, 0x249: 0x0008, 0x24a: 0x0008, 0x24b: 0x0008, + 0x24c: 0x0008, 0x24d: 0x0008, 0x24e: 0x0008, 0x24f: 0x0008, 0x250: 0x0008, 0x251: 0x0008, + 0x252: 0x0018, 0x253: 0x0018, 0x254: 0x0018, 0x255: 0x0018, 0x256: 0x0018, 0x257: 0x0018, + 0x258: 0x029a, 0x259: 0x02ba, 0x25a: 0x02da, 0x25b: 0x02fa, 0x25c: 0x031a, 0x25d: 0x033a, + 0x25e: 0x0018, 0x25f: 0x0018, 0x260: 0x03ad, 0x261: 0x0359, 0x262: 0x01d9, 0x263: 0x0369, + 0x264: 0x03c5, 0x265: 0x0018, 0x266: 0x0018, 0x267: 0x0018, 0x268: 0x0018, 0x269: 0x0018, + 0x26a: 0x0018, 0x26b: 0x0018, 0x26c: 0x0008, 0x26d: 0x0018, 0x26e: 0x0008, 0x26f: 0x0018, + 0x270: 0x0018, 0x271: 0x0018, 0x272: 0x0018, 0x273: 0x0018, 0x274: 0x0018, 0x275: 0x0018, + 0x276: 0x0018, 0x277: 0x0018, 0x278: 0x0018, 0x279: 0x0018, 0x27a: 0x0018, 0x27b: 0x0018, + 0x27c: 0x0018, 0x27d: 0x0018, 0x27e: 0x0018, 0x27f: 0x0018, + // Block 0xa, offset 0x280 + 0x280: 0x03dd, 0x281: 0x03dd, 0x282: 0x1308, 0x283: 0x03f5, 0x284: 0x0379, 0x285: 0x040d, + 0x286: 0x1308, 0x287: 0x1308, 0x288: 0x1308, 0x289: 0x1308, 0x28a: 0x1308, 0x28b: 0x1308, + 0x28c: 0x1308, 0x28d: 0x1308, 0x28e: 0x1308, 0x28f: 0x13c0, 0x290: 0x1308, 0x291: 0x1308, + 0x292: 0x1308, 0x293: 0x1308, 0x294: 0x1308, 0x295: 0x1308, 0x296: 0x1308, 0x297: 0x1308, + 0x298: 0x1308, 0x299: 0x1308, 0x29a: 0x1308, 0x29b: 0x1308, 0x29c: 0x1308, 0x29d: 0x1308, + 0x29e: 0x1308, 0x29f: 0x1308, 0x2a0: 0x1308, 0x2a1: 0x1308, 0x2a2: 0x1308, 0x2a3: 0x1308, + 0x2a4: 0x1308, 0x2a5: 0x1308, 0x2a6: 0x1308, 0x2a7: 0x1308, 0x2a8: 0x1308, 0x2a9: 0x1308, + 0x2aa: 0x1308, 0x2ab: 0x1308, 0x2ac: 0x1308, 0x2ad: 0x1308, 0x2ae: 0x1308, 0x2af: 0x1308, + 0x2b0: 0xe00d, 0x2b1: 0x0008, 0x2b2: 0xe00d, 0x2b3: 0x0008, 0x2b4: 0x0425, 0x2b5: 0x0008, + 0x2b6: 0xe00d, 0x2b7: 0x0008, 0x2b8: 0x0040, 0x2b9: 0x0040, 0x2ba: 0x03a2, 0x2bb: 0x0008, + 0x2bc: 0x0008, 0x2bd: 0x0008, 0x2be: 0x03c2, 0x2bf: 0x043d, + // Block 0xb, offset 0x2c0 + 0x2c0: 0x0040, 0x2c1: 0x0040, 0x2c2: 0x0040, 0x2c3: 0x0040, 0x2c4: 0x008a, 0x2c5: 0x03d2, + 0x2c6: 0xe155, 0x2c7: 0x0455, 0x2c8: 0xe12d, 0x2c9: 0xe13d, 0x2ca: 0xe12d, 0x2cb: 0x0040, + 0x2cc: 0x03dd, 0x2cd: 0x0040, 0x2ce: 0x046d, 0x2cf: 0x0485, 0x2d0: 0x0008, 0x2d1: 0xe105, + 0x2d2: 0xe105, 0x2d3: 0xe105, 0x2d4: 0xe105, 0x2d5: 0xe105, 0x2d6: 0xe105, 0x2d7: 0xe105, + 0x2d8: 0xe105, 0x2d9: 0xe105, 0x2da: 0xe105, 0x2db: 0xe105, 0x2dc: 0xe105, 0x2dd: 0xe105, + 0x2de: 0xe105, 0x2df: 0xe105, 0x2e0: 0x049d, 0x2e1: 0x049d, 0x2e2: 0x0040, 0x2e3: 0x049d, + 0x2e4: 0x049d, 0x2e5: 0x049d, 0x2e6: 0x049d, 0x2e7: 0x049d, 0x2e8: 0x049d, 0x2e9: 0x049d, + 0x2ea: 0x049d, 0x2eb: 0x049d, 0x2ec: 0x0008, 0x2ed: 0x0008, 0x2ee: 0x0008, 0x2ef: 0x0008, + 0x2f0: 0x0008, 0x2f1: 0x0008, 0x2f2: 0x0008, 0x2f3: 0x0008, 0x2f4: 0x0008, 0x2f5: 0x0008, + 0x2f6: 0x0008, 0x2f7: 0x0008, 0x2f8: 0x0008, 0x2f9: 0x0008, 0x2fa: 0x0008, 0x2fb: 0x0008, + 0x2fc: 0x0008, 0x2fd: 0x0008, 0x2fe: 0x0008, 0x2ff: 0x0008, + // Block 0xc, offset 0x300 + 0x300: 0x0008, 0x301: 0x0008, 0x302: 0xe00f, 0x303: 0x0008, 0x304: 0x0008, 0x305: 0x0008, + 0x306: 0x0008, 0x307: 0x0008, 0x308: 0x0008, 0x309: 0x0008, 0x30a: 0x0008, 0x30b: 0x0008, + 0x30c: 0x0008, 0x30d: 0x0008, 0x30e: 0x0008, 0x30f: 0xe0c5, 0x310: 0x04b5, 0x311: 0x04cd, + 0x312: 0xe0bd, 0x313: 0xe0f5, 0x314: 0xe0fd, 0x315: 0xe09d, 0x316: 0xe0b5, 0x317: 0x0008, + 0x318: 0xe00d, 0x319: 0x0008, 0x31a: 0xe00d, 0x31b: 0x0008, 0x31c: 0xe00d, 0x31d: 0x0008, + 0x31e: 0xe00d, 0x31f: 0x0008, 0x320: 0xe00d, 0x321: 0x0008, 0x322: 0xe00d, 0x323: 0x0008, + 0x324: 0xe00d, 0x325: 0x0008, 0x326: 0xe00d, 0x327: 0x0008, 0x328: 0xe00d, 0x329: 0x0008, + 0x32a: 0xe00d, 0x32b: 0x0008, 0x32c: 0xe00d, 0x32d: 0x0008, 0x32e: 0xe00d, 0x32f: 0x0008, + 0x330: 0x04e5, 0x331: 0xe185, 0x332: 0xe18d, 0x333: 0x0008, 0x334: 0x04fd, 0x335: 0x03dd, + 0x336: 0x0018, 0x337: 0xe07d, 0x338: 0x0008, 0x339: 0xe1d5, 0x33a: 0xe00d, 0x33b: 0x0008, + 0x33c: 0x0008, 0x33d: 0x0515, 0x33e: 0x052d, 0x33f: 0x052d, + // Block 0xd, offset 0x340 + 0x340: 0x0008, 0x341: 0x0008, 0x342: 0x0008, 0x343: 0x0008, 0x344: 0x0008, 0x345: 0x0008, + 0x346: 0x0008, 0x347: 0x0008, 0x348: 0x0008, 0x349: 0x0008, 0x34a: 0x0008, 0x34b: 0x0008, + 0x34c: 0x0008, 0x34d: 0x0008, 0x34e: 0x0008, 0x34f: 0x0008, 0x350: 0x0008, 0x351: 0x0008, + 0x352: 0x0008, 0x353: 0x0008, 0x354: 0x0008, 0x355: 0x0008, 0x356: 0x0008, 0x357: 0x0008, + 0x358: 0x0008, 0x359: 0x0008, 0x35a: 0x0008, 0x35b: 0x0008, 0x35c: 0x0008, 0x35d: 0x0008, + 0x35e: 0x0008, 0x35f: 0x0008, 0x360: 0xe00d, 0x361: 0x0008, 0x362: 0xe00d, 0x363: 0x0008, + 0x364: 0xe00d, 0x365: 0x0008, 0x366: 0xe00d, 0x367: 0x0008, 0x368: 0xe00d, 0x369: 0x0008, + 0x36a: 0xe00d, 0x36b: 0x0008, 0x36c: 0xe00d, 0x36d: 0x0008, 0x36e: 0xe00d, 0x36f: 0x0008, + 0x370: 0xe00d, 0x371: 0x0008, 0x372: 0xe00d, 0x373: 0x0008, 0x374: 0xe00d, 0x375: 0x0008, + 0x376: 0xe00d, 0x377: 0x0008, 0x378: 0xe00d, 0x379: 0x0008, 0x37a: 0xe00d, 0x37b: 0x0008, + 0x37c: 0xe00d, 0x37d: 0x0008, 0x37e: 0xe00d, 0x37f: 0x0008, + // Block 0xe, offset 0x380 + 0x380: 0xe00d, 0x381: 0x0008, 0x382: 0x0018, 0x383: 0x1308, 0x384: 0x1308, 0x385: 0x1308, + 0x386: 0x1308, 0x387: 0x1308, 0x388: 0x1318, 0x389: 0x1318, 0x38a: 0xe00d, 0x38b: 0x0008, + 0x38c: 0xe00d, 0x38d: 0x0008, 0x38e: 0xe00d, 0x38f: 0x0008, 0x390: 0xe00d, 0x391: 0x0008, + 0x392: 0xe00d, 0x393: 0x0008, 0x394: 0xe00d, 0x395: 0x0008, 0x396: 0xe00d, 0x397: 0x0008, + 0x398: 0xe00d, 0x399: 0x0008, 0x39a: 0xe00d, 0x39b: 0x0008, 0x39c: 0xe00d, 0x39d: 0x0008, + 0x39e: 0xe00d, 0x39f: 0x0008, 0x3a0: 0xe00d, 0x3a1: 0x0008, 0x3a2: 0xe00d, 0x3a3: 0x0008, + 0x3a4: 0xe00d, 0x3a5: 0x0008, 0x3a6: 0xe00d, 0x3a7: 0x0008, 0x3a8: 0xe00d, 0x3a9: 0x0008, + 0x3aa: 0xe00d, 0x3ab: 0x0008, 0x3ac: 0xe00d, 0x3ad: 0x0008, 0x3ae: 0xe00d, 0x3af: 0x0008, + 0x3b0: 0xe00d, 0x3b1: 0x0008, 0x3b2: 0xe00d, 0x3b3: 0x0008, 0x3b4: 0xe00d, 0x3b5: 0x0008, + 0x3b6: 0xe00d, 0x3b7: 0x0008, 0x3b8: 0xe00d, 0x3b9: 0x0008, 0x3ba: 0xe00d, 0x3bb: 0x0008, + 0x3bc: 0xe00d, 0x3bd: 0x0008, 0x3be: 0xe00d, 0x3bf: 0x0008, + // Block 0xf, offset 0x3c0 + 0x3c0: 0x0040, 0x3c1: 0xe01d, 0x3c2: 0x0008, 0x3c3: 0xe03d, 0x3c4: 0x0008, 0x3c5: 0xe01d, + 0x3c6: 0x0008, 0x3c7: 0xe07d, 0x3c8: 0x0008, 0x3c9: 0xe01d, 0x3ca: 0x0008, 0x3cb: 0xe03d, + 0x3cc: 0x0008, 0x3cd: 0xe01d, 0x3ce: 0x0008, 0x3cf: 0x0008, 0x3d0: 0xe00d, 0x3d1: 0x0008, + 0x3d2: 0xe00d, 0x3d3: 0x0008, 0x3d4: 0xe00d, 0x3d5: 0x0008, 0x3d6: 0xe00d, 0x3d7: 0x0008, + 0x3d8: 0xe00d, 0x3d9: 0x0008, 0x3da: 0xe00d, 0x3db: 0x0008, 0x3dc: 0xe00d, 0x3dd: 0x0008, + 0x3de: 0xe00d, 0x3df: 0x0008, 0x3e0: 0xe00d, 0x3e1: 0x0008, 0x3e2: 0xe00d, 0x3e3: 0x0008, + 0x3e4: 0xe00d, 0x3e5: 0x0008, 0x3e6: 0xe00d, 0x3e7: 0x0008, 0x3e8: 0xe00d, 0x3e9: 0x0008, + 0x3ea: 0xe00d, 0x3eb: 0x0008, 0x3ec: 0xe00d, 0x3ed: 0x0008, 0x3ee: 0xe00d, 0x3ef: 0x0008, + 0x3f0: 0xe00d, 0x3f1: 0x0008, 0x3f2: 0xe00d, 0x3f3: 0x0008, 0x3f4: 0xe00d, 0x3f5: 0x0008, + 0x3f6: 0xe00d, 0x3f7: 0x0008, 0x3f8: 0xe00d, 0x3f9: 0x0008, 0x3fa: 0xe00d, 0x3fb: 0x0008, + 0x3fc: 0xe00d, 0x3fd: 0x0008, 0x3fe: 0xe00d, 0x3ff: 0x0008, + // Block 0x10, offset 0x400 + 0x400: 0xe00d, 0x401: 0x0008, 0x402: 0xe00d, 0x403: 0x0008, 0x404: 0xe00d, 0x405: 0x0008, + 0x406: 0xe00d, 0x407: 0x0008, 0x408: 0xe00d, 0x409: 0x0008, 0x40a: 0xe00d, 0x40b: 0x0008, + 0x40c: 0xe00d, 0x40d: 0x0008, 0x40e: 0xe00d, 0x40f: 0x0008, 0x410: 0xe00d, 0x411: 0x0008, + 0x412: 0xe00d, 0x413: 0x0008, 0x414: 0xe00d, 0x415: 0x0008, 0x416: 0xe00d, 0x417: 0x0008, + 0x418: 0xe00d, 0x419: 0x0008, 0x41a: 0xe00d, 0x41b: 0x0008, 0x41c: 0xe00d, 0x41d: 0x0008, + 0x41e: 0xe00d, 0x41f: 0x0008, 0x420: 0xe00d, 0x421: 0x0008, 0x422: 0xe00d, 0x423: 0x0008, + 0x424: 0xe00d, 0x425: 0x0008, 0x426: 0xe00d, 0x427: 0x0008, 0x428: 0xe00d, 0x429: 0x0008, + 0x42a: 0xe00d, 0x42b: 0x0008, 0x42c: 0xe00d, 0x42d: 0x0008, 0x42e: 0xe00d, 0x42f: 0x0008, + 0x430: 0x0040, 0x431: 0x03f5, 0x432: 0x03f5, 0x433: 0x03f5, 0x434: 0x03f5, 0x435: 0x03f5, + 0x436: 0x03f5, 0x437: 0x03f5, 0x438: 0x03f5, 0x439: 0x03f5, 0x43a: 0x03f5, 0x43b: 0x03f5, + 0x43c: 0x03f5, 0x43d: 0x03f5, 0x43e: 0x03f5, 0x43f: 0x03f5, + // Block 0x11, offset 0x440 + 0x440: 0x0040, 0x441: 0x0040, 0x442: 0x0040, 0x443: 0x0040, 0x444: 0x0040, 0x445: 0x0040, + 0x446: 0x0018, 0x447: 0x0018, 0x448: 0x0018, 0x449: 0x0018, 0x44a: 0x0018, 0x44b: 0x0018, + 0x44c: 0x0018, 0x44d: 0x0018, 0x44e: 0x0018, 0x44f: 0x0018, 0x450: 0x1308, 0x451: 0x1308, + 0x452: 0x1308, 0x453: 0x1308, 0x454: 0x1308, 0x455: 0x1308, 0x456: 0x1308, 0x457: 0x1308, + 0x458: 0x1308, 0x459: 0x1308, 0x45a: 0x1308, 0x45b: 0x0018, 0x45c: 0x0340, 0x45d: 0x0040, + 0x45e: 0x0018, 0x45f: 0x0018, 0x460: 0x0208, 0x461: 0x0008, 0x462: 0x0408, 0x463: 0x0408, + 0x464: 0x0408, 0x465: 0x0408, 0x466: 0x0208, 0x467: 0x0408, 0x468: 0x0208, 0x469: 0x0408, + 0x46a: 0x0208, 0x46b: 0x0208, 0x46c: 0x0208, 0x46d: 0x0208, 0x46e: 0x0208, 0x46f: 0x0408, + 0x470: 0x0408, 0x471: 0x0408, 0x472: 0x0408, 0x473: 0x0208, 0x474: 0x0208, 0x475: 0x0208, + 0x476: 0x0208, 0x477: 0x0208, 0x478: 0x0208, 0x479: 0x0208, 0x47a: 0x0208, 0x47b: 0x0208, + 0x47c: 0x0208, 0x47d: 0x0208, 0x47e: 0x0208, 0x47f: 0x0208, + // Block 0x12, offset 0x480 + 0x480: 0x0408, 0x481: 0x0208, 0x482: 0x0208, 0x483: 0x0408, 0x484: 0x0408, 0x485: 0x0408, + 0x486: 0x0408, 0x487: 0x0408, 0x488: 0x0408, 0x489: 0x0408, 0x48a: 0x0408, 0x48b: 0x0408, + 0x48c: 0x0208, 0x48d: 0x0408, 0x48e: 0x0208, 0x48f: 0x0408, 0x490: 0x0208, 0x491: 0x0208, + 0x492: 0x0408, 0x493: 0x0408, 0x494: 0x0018, 0x495: 0x0408, 0x496: 0x1308, 0x497: 0x1308, + 0x498: 0x1308, 0x499: 0x1308, 0x49a: 0x1308, 0x49b: 0x1308, 0x49c: 0x1308, 0x49d: 0x0040, + 0x49e: 0x0018, 0x49f: 0x1308, 0x4a0: 0x1308, 0x4a1: 0x1308, 0x4a2: 0x1308, 0x4a3: 0x1308, + 0x4a4: 0x1308, 0x4a5: 0x0008, 0x4a6: 0x0008, 0x4a7: 0x1308, 0x4a8: 0x1308, 0x4a9: 0x0018, + 0x4aa: 0x1308, 0x4ab: 0x1308, 0x4ac: 0x1308, 0x4ad: 0x1308, 0x4ae: 0x0408, 0x4af: 0x0408, + 0x4b0: 0x0008, 0x4b1: 0x0008, 0x4b2: 0x0008, 0x4b3: 0x0008, 0x4b4: 0x0008, 0x4b5: 0x0008, + 0x4b6: 0x0008, 0x4b7: 0x0008, 0x4b8: 0x0008, 0x4b9: 0x0008, 0x4ba: 0x0208, 0x4bb: 0x0208, + 0x4bc: 0x0208, 0x4bd: 0x0008, 0x4be: 0x0008, 0x4bf: 0x0208, + // Block 0x13, offset 0x4c0 + 0x4c0: 0x0018, 0x4c1: 0x0018, 0x4c2: 0x0018, 0x4c3: 0x0018, 0x4c4: 0x0018, 0x4c5: 0x0018, + 0x4c6: 0x0018, 0x4c7: 0x0018, 0x4c8: 0x0018, 0x4c9: 0x0018, 0x4ca: 0x0018, 0x4cb: 0x0018, + 0x4cc: 0x0018, 0x4cd: 0x0018, 0x4ce: 0x0040, 0x4cf: 0x0340, 0x4d0: 0x0408, 0x4d1: 0x1308, + 0x4d2: 0x0208, 0x4d3: 0x0208, 0x4d4: 0x0208, 0x4d5: 0x0408, 0x4d6: 0x0408, 0x4d7: 0x0408, + 0x4d8: 0x0408, 0x4d9: 0x0408, 0x4da: 0x0208, 0x4db: 0x0208, 0x4dc: 0x0208, 0x4dd: 0x0208, + 0x4de: 0x0408, 0x4df: 0x0208, 0x4e0: 0x0208, 0x4e1: 0x0208, 0x4e2: 0x0208, 0x4e3: 0x0208, + 0x4e4: 0x0208, 0x4e5: 0x0208, 0x4e6: 0x0208, 0x4e7: 0x0208, 0x4e8: 0x0408, 0x4e9: 0x0208, + 0x4ea: 0x0408, 0x4eb: 0x0208, 0x4ec: 0x0408, 0x4ed: 0x0208, 0x4ee: 0x0208, 0x4ef: 0x0408, + 0x4f0: 0x1308, 0x4f1: 0x1308, 0x4f2: 0x1308, 0x4f3: 0x1308, 0x4f4: 0x1308, 0x4f5: 0x1308, + 0x4f6: 0x1308, 0x4f7: 0x1308, 0x4f8: 0x1308, 0x4f9: 0x1308, 0x4fa: 0x1308, 0x4fb: 0x1308, + 0x4fc: 0x1308, 0x4fd: 0x1308, 0x4fe: 0x1308, 0x4ff: 0x1308, + // Block 0x14, offset 0x500 + 0x500: 0x1008, 0x501: 0x1308, 0x502: 0x1308, 0x503: 0x1308, 0x504: 0x1308, 0x505: 0x1308, + 0x506: 0x1308, 0x507: 0x1308, 0x508: 0x1308, 0x509: 0x1008, 0x50a: 0x1008, 0x50b: 0x1008, + 0x50c: 0x1008, 0x50d: 0x1b08, 0x50e: 0x1008, 0x50f: 0x1008, 0x510: 0x0008, 0x511: 0x1308, + 0x512: 0x1308, 0x513: 0x1308, 0x514: 0x1308, 0x515: 0x1308, 0x516: 0x1308, 0x517: 0x1308, + 0x518: 0x04c9, 0x519: 0x0501, 0x51a: 0x0539, 0x51b: 0x0571, 0x51c: 0x05a9, 0x51d: 0x05e1, + 0x51e: 0x0619, 0x51f: 0x0651, 0x520: 0x0008, 0x521: 0x0008, 0x522: 0x1308, 0x523: 0x1308, + 0x524: 0x0018, 0x525: 0x0018, 0x526: 0x0008, 0x527: 0x0008, 0x528: 0x0008, 0x529: 0x0008, + 0x52a: 0x0008, 0x52b: 0x0008, 0x52c: 0x0008, 0x52d: 0x0008, 0x52e: 0x0008, 0x52f: 0x0008, + 0x530: 0x0018, 0x531: 0x0008, 0x532: 0x0008, 0x533: 0x0008, 0x534: 0x0008, 0x535: 0x0008, + 0x536: 0x0008, 0x537: 0x0008, 0x538: 0x0008, 0x539: 0x0008, 0x53a: 0x0008, 0x53b: 0x0008, + 0x53c: 0x0008, 0x53d: 0x0008, 0x53e: 0x0008, 0x53f: 0x0008, + // Block 0x15, offset 0x540 + 0x540: 0x0008, 0x541: 0x1308, 0x542: 0x1008, 0x543: 0x1008, 0x544: 0x0040, 0x545: 0x0008, + 0x546: 0x0008, 0x547: 0x0008, 0x548: 0x0008, 0x549: 0x0008, 0x54a: 0x0008, 0x54b: 0x0008, + 0x54c: 0x0008, 0x54d: 0x0040, 0x54e: 0x0040, 0x54f: 0x0008, 0x550: 0x0008, 0x551: 0x0040, + 0x552: 0x0040, 0x553: 0x0008, 0x554: 0x0008, 0x555: 0x0008, 0x556: 0x0008, 0x557: 0x0008, + 0x558: 0x0008, 0x559: 0x0008, 0x55a: 0x0008, 0x55b: 0x0008, 0x55c: 0x0008, 0x55d: 0x0008, + 0x55e: 0x0008, 0x55f: 0x0008, 0x560: 0x0008, 0x561: 0x0008, 0x562: 0x0008, 0x563: 0x0008, + 0x564: 0x0008, 0x565: 0x0008, 0x566: 0x0008, 0x567: 0x0008, 0x568: 0x0008, 0x569: 0x0040, + 0x56a: 0x0008, 0x56b: 0x0008, 0x56c: 0x0008, 0x56d: 0x0008, 0x56e: 0x0008, 0x56f: 0x0008, + 0x570: 0x0008, 0x571: 0x0040, 0x572: 0x0008, 0x573: 0x0040, 0x574: 0x0040, 0x575: 0x0040, + 0x576: 0x0008, 0x577: 0x0008, 0x578: 0x0008, 0x579: 0x0008, 0x57a: 0x0040, 0x57b: 0x0040, + 0x57c: 0x1308, 0x57d: 0x0008, 0x57e: 0x1008, 0x57f: 0x1008, + // Block 0x16, offset 0x580 + 0x580: 0x1008, 0x581: 0x1308, 0x582: 0x1308, 0x583: 0x1308, 0x584: 0x1308, 0x585: 0x0040, + 0x586: 0x0040, 0x587: 0x1008, 0x588: 0x1008, 0x589: 0x0040, 0x58a: 0x0040, 0x58b: 0x1008, + 0x58c: 0x1008, 0x58d: 0x1b08, 0x58e: 0x0008, 0x58f: 0x0040, 0x590: 0x0040, 0x591: 0x0040, + 0x592: 0x0040, 0x593: 0x0040, 0x594: 0x0040, 0x595: 0x0040, 0x596: 0x0040, 0x597: 0x1008, + 0x598: 0x0040, 0x599: 0x0040, 0x59a: 0x0040, 0x59b: 0x0040, 0x59c: 0x0689, 0x59d: 0x06c1, + 0x59e: 0x0040, 0x59f: 0x06f9, 0x5a0: 0x0008, 0x5a1: 0x0008, 0x5a2: 0x1308, 0x5a3: 0x1308, + 0x5a4: 0x0040, 0x5a5: 0x0040, 0x5a6: 0x0008, 0x5a7: 0x0008, 0x5a8: 0x0008, 0x5a9: 0x0008, + 0x5aa: 0x0008, 0x5ab: 0x0008, 0x5ac: 0x0008, 0x5ad: 0x0008, 0x5ae: 0x0008, 0x5af: 0x0008, + 0x5b0: 0x0008, 0x5b1: 0x0008, 0x5b2: 0x0018, 0x5b3: 0x0018, 0x5b4: 0x0018, 0x5b5: 0x0018, + 0x5b6: 0x0018, 0x5b7: 0x0018, 0x5b8: 0x0018, 0x5b9: 0x0018, 0x5ba: 0x0018, 0x5bb: 0x0018, + 0x5bc: 0x0040, 0x5bd: 0x0040, 0x5be: 0x0040, 0x5bf: 0x0040, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x0040, 0x5c1: 0x1308, 0x5c2: 0x1308, 0x5c3: 0x1008, 0x5c4: 0x0040, 0x5c5: 0x0008, + 0x5c6: 0x0008, 0x5c7: 0x0008, 0x5c8: 0x0008, 0x5c9: 0x0008, 0x5ca: 0x0008, 0x5cb: 0x0040, + 0x5cc: 0x0040, 0x5cd: 0x0040, 0x5ce: 0x0040, 0x5cf: 0x0008, 0x5d0: 0x0008, 0x5d1: 0x0040, + 0x5d2: 0x0040, 0x5d3: 0x0008, 0x5d4: 0x0008, 0x5d5: 0x0008, 0x5d6: 0x0008, 0x5d7: 0x0008, + 0x5d8: 0x0008, 0x5d9: 0x0008, 0x5da: 0x0008, 0x5db: 0x0008, 0x5dc: 0x0008, 0x5dd: 0x0008, + 0x5de: 0x0008, 0x5df: 0x0008, 0x5e0: 0x0008, 0x5e1: 0x0008, 0x5e2: 0x0008, 0x5e3: 0x0008, + 0x5e4: 0x0008, 0x5e5: 0x0008, 0x5e6: 0x0008, 0x5e7: 0x0008, 0x5e8: 0x0008, 0x5e9: 0x0040, + 0x5ea: 0x0008, 0x5eb: 0x0008, 0x5ec: 0x0008, 0x5ed: 0x0008, 0x5ee: 0x0008, 0x5ef: 0x0008, + 0x5f0: 0x0008, 0x5f1: 0x0040, 0x5f2: 0x0008, 0x5f3: 0x0731, 0x5f4: 0x0040, 0x5f5: 0x0008, + 0x5f6: 0x0769, 0x5f7: 0x0040, 0x5f8: 0x0008, 0x5f9: 0x0008, 0x5fa: 0x0040, 0x5fb: 0x0040, + 0x5fc: 0x1308, 0x5fd: 0x0040, 0x5fe: 0x1008, 0x5ff: 0x1008, + // Block 0x18, offset 0x600 + 0x600: 0x1008, 0x601: 0x1308, 0x602: 0x1308, 0x603: 0x0040, 0x604: 0x0040, 0x605: 0x0040, + 0x606: 0x0040, 0x607: 0x1308, 0x608: 0x1308, 0x609: 0x0040, 0x60a: 0x0040, 0x60b: 0x1308, + 0x60c: 0x1308, 0x60d: 0x1b08, 0x60e: 0x0040, 0x60f: 0x0040, 0x610: 0x0040, 0x611: 0x1308, + 0x612: 0x0040, 0x613: 0x0040, 0x614: 0x0040, 0x615: 0x0040, 0x616: 0x0040, 0x617: 0x0040, + 0x618: 0x0040, 0x619: 0x07a1, 0x61a: 0x07d9, 0x61b: 0x0811, 0x61c: 0x0008, 0x61d: 0x0040, + 0x61e: 0x0849, 0x61f: 0x0040, 0x620: 0x0040, 0x621: 0x0040, 0x622: 0x0040, 0x623: 0x0040, + 0x624: 0x0040, 0x625: 0x0040, 0x626: 0x0008, 0x627: 0x0008, 0x628: 0x0008, 0x629: 0x0008, + 0x62a: 0x0008, 0x62b: 0x0008, 0x62c: 0x0008, 0x62d: 0x0008, 0x62e: 0x0008, 0x62f: 0x0008, + 0x630: 0x1308, 0x631: 0x1308, 0x632: 0x0008, 0x633: 0x0008, 0x634: 0x0008, 0x635: 0x1308, + 0x636: 0x0040, 0x637: 0x0040, 0x638: 0x0040, 0x639: 0x0040, 0x63a: 0x0040, 0x63b: 0x0040, + 0x63c: 0x0040, 0x63d: 0x0040, 0x63e: 0x0040, 0x63f: 0x0040, + // Block 0x19, offset 0x640 + 0x640: 0x0040, 0x641: 0x1308, 0x642: 0x1308, 0x643: 0x1008, 0x644: 0x0040, 0x645: 0x0008, + 0x646: 0x0008, 0x647: 0x0008, 0x648: 0x0008, 0x649: 0x0008, 0x64a: 0x0008, 0x64b: 0x0008, + 0x64c: 0x0008, 0x64d: 0x0008, 0x64e: 0x0040, 0x64f: 0x0008, 0x650: 0x0008, 0x651: 0x0008, + 0x652: 0x0040, 0x653: 0x0008, 0x654: 0x0008, 0x655: 0x0008, 0x656: 0x0008, 0x657: 0x0008, + 0x658: 0x0008, 0x659: 0x0008, 0x65a: 0x0008, 0x65b: 0x0008, 0x65c: 0x0008, 0x65d: 0x0008, + 0x65e: 0x0008, 0x65f: 0x0008, 0x660: 0x0008, 0x661: 0x0008, 0x662: 0x0008, 0x663: 0x0008, + 0x664: 0x0008, 0x665: 0x0008, 0x666: 0x0008, 0x667: 0x0008, 0x668: 0x0008, 0x669: 0x0040, + 0x66a: 0x0008, 0x66b: 0x0008, 0x66c: 0x0008, 0x66d: 0x0008, 0x66e: 0x0008, 0x66f: 0x0008, + 0x670: 0x0008, 0x671: 0x0040, 0x672: 0x0008, 0x673: 0x0008, 0x674: 0x0040, 0x675: 0x0008, + 0x676: 0x0008, 0x677: 0x0008, 0x678: 0x0008, 0x679: 0x0008, 0x67a: 0x0040, 0x67b: 0x0040, + 0x67c: 0x1308, 0x67d: 0x0008, 0x67e: 0x1008, 0x67f: 0x1008, + // Block 0x1a, offset 0x680 + 0x680: 0x1008, 0x681: 0x1308, 0x682: 0x1308, 0x683: 0x1308, 0x684: 0x1308, 0x685: 0x1308, + 0x686: 0x0040, 0x687: 0x1308, 0x688: 0x1308, 0x689: 0x1008, 0x68a: 0x0040, 0x68b: 0x1008, + 0x68c: 0x1008, 0x68d: 0x1b08, 0x68e: 0x0040, 0x68f: 0x0040, 0x690: 0x0008, 0x691: 0x0040, + 0x692: 0x0040, 0x693: 0x0040, 0x694: 0x0040, 0x695: 0x0040, 0x696: 0x0040, 0x697: 0x0040, + 0x698: 0x0040, 0x699: 0x0040, 0x69a: 0x0040, 0x69b: 0x0040, 0x69c: 0x0040, 0x69d: 0x0040, + 0x69e: 0x0040, 0x69f: 0x0040, 0x6a0: 0x0008, 0x6a1: 0x0008, 0x6a2: 0x1308, 0x6a3: 0x1308, + 0x6a4: 0x0040, 0x6a5: 0x0040, 0x6a6: 0x0008, 0x6a7: 0x0008, 0x6a8: 0x0008, 0x6a9: 0x0008, + 0x6aa: 0x0008, 0x6ab: 0x0008, 0x6ac: 0x0008, 0x6ad: 0x0008, 0x6ae: 0x0008, 0x6af: 0x0008, + 0x6b0: 0x0018, 0x6b1: 0x0018, 0x6b2: 0x0040, 0x6b3: 0x0040, 0x6b4: 0x0040, 0x6b5: 0x0040, + 0x6b6: 0x0040, 0x6b7: 0x0040, 0x6b8: 0x0040, 0x6b9: 0x0008, 0x6ba: 0x0040, 0x6bb: 0x0040, + 0x6bc: 0x0040, 0x6bd: 0x0040, 0x6be: 0x0040, 0x6bf: 0x0040, + // Block 0x1b, offset 0x6c0 + 0x6c0: 0x0040, 0x6c1: 0x1308, 0x6c2: 0x1008, 0x6c3: 0x1008, 0x6c4: 0x0040, 0x6c5: 0x0008, + 0x6c6: 0x0008, 0x6c7: 0x0008, 0x6c8: 0x0008, 0x6c9: 0x0008, 0x6ca: 0x0008, 0x6cb: 0x0008, + 0x6cc: 0x0008, 0x6cd: 0x0040, 0x6ce: 0x0040, 0x6cf: 0x0008, 0x6d0: 0x0008, 0x6d1: 0x0040, + 0x6d2: 0x0040, 0x6d3: 0x0008, 0x6d4: 0x0008, 0x6d5: 0x0008, 0x6d6: 0x0008, 0x6d7: 0x0008, + 0x6d8: 0x0008, 0x6d9: 0x0008, 0x6da: 0x0008, 0x6db: 0x0008, 0x6dc: 0x0008, 0x6dd: 0x0008, + 0x6de: 0x0008, 0x6df: 0x0008, 0x6e0: 0x0008, 0x6e1: 0x0008, 0x6e2: 0x0008, 0x6e3: 0x0008, + 0x6e4: 0x0008, 0x6e5: 0x0008, 0x6e6: 0x0008, 0x6e7: 0x0008, 0x6e8: 0x0008, 0x6e9: 0x0040, + 0x6ea: 0x0008, 0x6eb: 0x0008, 0x6ec: 0x0008, 0x6ed: 0x0008, 0x6ee: 0x0008, 0x6ef: 0x0008, + 0x6f0: 0x0008, 0x6f1: 0x0040, 0x6f2: 0x0008, 0x6f3: 0x0008, 0x6f4: 0x0040, 0x6f5: 0x0008, + 0x6f6: 0x0008, 0x6f7: 0x0008, 0x6f8: 0x0008, 0x6f9: 0x0008, 0x6fa: 0x0040, 0x6fb: 0x0040, + 0x6fc: 0x1308, 0x6fd: 0x0008, 0x6fe: 0x1008, 0x6ff: 0x1308, + // Block 0x1c, offset 0x700 + 0x700: 0x1008, 0x701: 0x1308, 0x702: 0x1308, 0x703: 0x1308, 0x704: 0x1308, 0x705: 0x0040, + 0x706: 0x0040, 0x707: 0x1008, 0x708: 0x1008, 0x709: 0x0040, 0x70a: 0x0040, 0x70b: 0x1008, + 0x70c: 0x1008, 0x70d: 0x1b08, 0x70e: 0x0040, 0x70f: 0x0040, 0x710: 0x0040, 0x711: 0x0040, + 0x712: 0x0040, 0x713: 0x0040, 0x714: 0x0040, 0x715: 0x0040, 0x716: 0x1308, 0x717: 0x1008, + 0x718: 0x0040, 0x719: 0x0040, 0x71a: 0x0040, 0x71b: 0x0040, 0x71c: 0x0881, 0x71d: 0x08b9, + 0x71e: 0x0040, 0x71f: 0x0008, 0x720: 0x0008, 0x721: 0x0008, 0x722: 0x1308, 0x723: 0x1308, + 0x724: 0x0040, 0x725: 0x0040, 0x726: 0x0008, 0x727: 0x0008, 0x728: 0x0008, 0x729: 0x0008, + 0x72a: 0x0008, 0x72b: 0x0008, 0x72c: 0x0008, 0x72d: 0x0008, 0x72e: 0x0008, 0x72f: 0x0008, + 0x730: 0x0018, 0x731: 0x0008, 0x732: 0x0018, 0x733: 0x0018, 0x734: 0x0018, 0x735: 0x0018, + 0x736: 0x0018, 0x737: 0x0018, 0x738: 0x0040, 0x739: 0x0040, 0x73a: 0x0040, 0x73b: 0x0040, + 0x73c: 0x0040, 0x73d: 0x0040, 0x73e: 0x0040, 0x73f: 0x0040, + // Block 0x1d, offset 0x740 + 0x740: 0x0040, 0x741: 0x0040, 0x742: 0x1308, 0x743: 0x0008, 0x744: 0x0040, 0x745: 0x0008, + 0x746: 0x0008, 0x747: 0x0008, 0x748: 0x0008, 0x749: 0x0008, 0x74a: 0x0008, 0x74b: 0x0040, + 0x74c: 0x0040, 0x74d: 0x0040, 0x74e: 0x0008, 0x74f: 0x0008, 0x750: 0x0008, 0x751: 0x0040, + 0x752: 0x0008, 0x753: 0x0008, 0x754: 0x0008, 0x755: 0x0008, 0x756: 0x0040, 0x757: 0x0040, + 0x758: 0x0040, 0x759: 0x0008, 0x75a: 0x0008, 0x75b: 0x0040, 0x75c: 0x0008, 0x75d: 0x0040, + 0x75e: 0x0008, 0x75f: 0x0008, 0x760: 0x0040, 0x761: 0x0040, 0x762: 0x0040, 0x763: 0x0008, + 0x764: 0x0008, 0x765: 0x0040, 0x766: 0x0040, 0x767: 0x0040, 0x768: 0x0008, 0x769: 0x0008, + 0x76a: 0x0008, 0x76b: 0x0040, 0x76c: 0x0040, 0x76d: 0x0040, 0x76e: 0x0008, 0x76f: 0x0008, + 0x770: 0x0008, 0x771: 0x0008, 0x772: 0x0008, 0x773: 0x0008, 0x774: 0x0008, 0x775: 0x0008, + 0x776: 0x0008, 0x777: 0x0008, 0x778: 0x0008, 0x779: 0x0008, 0x77a: 0x0040, 0x77b: 0x0040, + 0x77c: 0x0040, 0x77d: 0x0040, 0x77e: 0x1008, 0x77f: 0x1008, + // Block 0x1e, offset 0x780 + 0x780: 0x1308, 0x781: 0x1008, 0x782: 0x1008, 0x783: 0x1008, 0x784: 0x1008, 0x785: 0x0040, + 0x786: 0x1308, 0x787: 0x1308, 0x788: 0x1308, 0x789: 0x0040, 0x78a: 0x1308, 0x78b: 0x1308, + 0x78c: 0x1308, 0x78d: 0x1b08, 0x78e: 0x0040, 0x78f: 0x0040, 0x790: 0x0040, 0x791: 0x0040, + 0x792: 0x0040, 0x793: 0x0040, 0x794: 0x0040, 0x795: 0x1308, 0x796: 0x1308, 0x797: 0x0040, + 0x798: 0x0008, 0x799: 0x0008, 0x79a: 0x0008, 0x79b: 0x0040, 0x79c: 0x0040, 0x79d: 0x0040, + 0x79e: 0x0040, 0x79f: 0x0040, 0x7a0: 0x0008, 0x7a1: 0x0008, 0x7a2: 0x1308, 0x7a3: 0x1308, + 0x7a4: 0x0040, 0x7a5: 0x0040, 0x7a6: 0x0008, 0x7a7: 0x0008, 0x7a8: 0x0008, 0x7a9: 0x0008, + 0x7aa: 0x0008, 0x7ab: 0x0008, 0x7ac: 0x0008, 0x7ad: 0x0008, 0x7ae: 0x0008, 0x7af: 0x0008, + 0x7b0: 0x0040, 0x7b1: 0x0040, 0x7b2: 0x0040, 0x7b3: 0x0040, 0x7b4: 0x0040, 0x7b5: 0x0040, + 0x7b6: 0x0040, 0x7b7: 0x0040, 0x7b8: 0x0018, 0x7b9: 0x0018, 0x7ba: 0x0018, 0x7bb: 0x0018, + 0x7bc: 0x0018, 0x7bd: 0x0018, 0x7be: 0x0018, 0x7bf: 0x0018, + // Block 0x1f, offset 0x7c0 + 0x7c0: 0x0008, 0x7c1: 0x1308, 0x7c2: 0x1008, 0x7c3: 0x1008, 0x7c4: 0x0040, 0x7c5: 0x0008, + 0x7c6: 0x0008, 0x7c7: 0x0008, 0x7c8: 0x0008, 0x7c9: 0x0008, 0x7ca: 0x0008, 0x7cb: 0x0008, + 0x7cc: 0x0008, 0x7cd: 0x0040, 0x7ce: 0x0008, 0x7cf: 0x0008, 0x7d0: 0x0008, 0x7d1: 0x0040, + 0x7d2: 0x0008, 0x7d3: 0x0008, 0x7d4: 0x0008, 0x7d5: 0x0008, 0x7d6: 0x0008, 0x7d7: 0x0008, + 0x7d8: 0x0008, 0x7d9: 0x0008, 0x7da: 0x0008, 0x7db: 0x0008, 0x7dc: 0x0008, 0x7dd: 0x0008, + 0x7de: 0x0008, 0x7df: 0x0008, 0x7e0: 0x0008, 0x7e1: 0x0008, 0x7e2: 0x0008, 0x7e3: 0x0008, + 0x7e4: 0x0008, 0x7e5: 0x0008, 0x7e6: 0x0008, 0x7e7: 0x0008, 0x7e8: 0x0008, 0x7e9: 0x0040, + 0x7ea: 0x0008, 0x7eb: 0x0008, 0x7ec: 0x0008, 0x7ed: 0x0008, 0x7ee: 0x0008, 0x7ef: 0x0008, + 0x7f0: 0x0008, 0x7f1: 0x0008, 0x7f2: 0x0008, 0x7f3: 0x0008, 0x7f4: 0x0040, 0x7f5: 0x0008, + 0x7f6: 0x0008, 0x7f7: 0x0008, 0x7f8: 0x0008, 0x7f9: 0x0008, 0x7fa: 0x0040, 0x7fb: 0x0040, + 0x7fc: 0x1308, 0x7fd: 0x0008, 0x7fe: 0x1008, 0x7ff: 0x1308, + // Block 0x20, offset 0x800 + 0x800: 0x1008, 0x801: 0x1008, 0x802: 0x1008, 0x803: 0x1008, 0x804: 0x1008, 0x805: 0x0040, + 0x806: 0x1308, 0x807: 0x1008, 0x808: 0x1008, 0x809: 0x0040, 0x80a: 0x1008, 0x80b: 0x1008, + 0x80c: 0x1308, 0x80d: 0x1b08, 0x80e: 0x0040, 0x80f: 0x0040, 0x810: 0x0040, 0x811: 0x0040, + 0x812: 0x0040, 0x813: 0x0040, 0x814: 0x0040, 0x815: 0x1008, 0x816: 0x1008, 0x817: 0x0040, + 0x818: 0x0040, 0x819: 0x0040, 0x81a: 0x0040, 0x81b: 0x0040, 0x81c: 0x0040, 0x81d: 0x0040, + 0x81e: 0x0008, 0x81f: 0x0040, 0x820: 0x0008, 0x821: 0x0008, 0x822: 0x1308, 0x823: 0x1308, + 0x824: 0x0040, 0x825: 0x0040, 0x826: 0x0008, 0x827: 0x0008, 0x828: 0x0008, 0x829: 0x0008, + 0x82a: 0x0008, 0x82b: 0x0008, 0x82c: 0x0008, 0x82d: 0x0008, 0x82e: 0x0008, 0x82f: 0x0008, + 0x830: 0x0040, 0x831: 0x0008, 0x832: 0x0008, 0x833: 0x0040, 0x834: 0x0040, 0x835: 0x0040, + 0x836: 0x0040, 0x837: 0x0040, 0x838: 0x0040, 0x839: 0x0040, 0x83a: 0x0040, 0x83b: 0x0040, + 0x83c: 0x0040, 0x83d: 0x0040, 0x83e: 0x0040, 0x83f: 0x0040, + // Block 0x21, offset 0x840 + 0x840: 0x1008, 0x841: 0x1308, 0x842: 0x1308, 0x843: 0x1308, 0x844: 0x1308, 0x845: 0x0040, + 0x846: 0x1008, 0x847: 0x1008, 0x848: 0x1008, 0x849: 0x0040, 0x84a: 0x1008, 0x84b: 0x1008, + 0x84c: 0x1008, 0x84d: 0x1b08, 0x84e: 0x0008, 0x84f: 0x0018, 0x850: 0x0040, 0x851: 0x0040, + 0x852: 0x0040, 0x853: 0x0040, 0x854: 0x0008, 0x855: 0x0008, 0x856: 0x0008, 0x857: 0x1008, + 0x858: 0x0018, 0x859: 0x0018, 0x85a: 0x0018, 0x85b: 0x0018, 0x85c: 0x0018, 0x85d: 0x0018, + 0x85e: 0x0018, 0x85f: 0x0008, 0x860: 0x0008, 0x861: 0x0008, 0x862: 0x1308, 0x863: 0x1308, + 0x864: 0x0040, 0x865: 0x0040, 0x866: 0x0008, 0x867: 0x0008, 0x868: 0x0008, 0x869: 0x0008, + 0x86a: 0x0008, 0x86b: 0x0008, 0x86c: 0x0008, 0x86d: 0x0008, 0x86e: 0x0008, 0x86f: 0x0008, + 0x870: 0x0018, 0x871: 0x0018, 0x872: 0x0018, 0x873: 0x0018, 0x874: 0x0018, 0x875: 0x0018, + 0x876: 0x0018, 0x877: 0x0018, 0x878: 0x0018, 0x879: 0x0018, 0x87a: 0x0008, 0x87b: 0x0008, + 0x87c: 0x0008, 0x87d: 0x0008, 0x87e: 0x0008, 0x87f: 0x0008, + // Block 0x22, offset 0x880 + 0x880: 0x0040, 0x881: 0x0008, 0x882: 0x0008, 0x883: 0x0040, 0x884: 0x0008, 0x885: 0x0040, + 0x886: 0x0040, 0x887: 0x0008, 0x888: 0x0008, 0x889: 0x0040, 0x88a: 0x0008, 0x88b: 0x0040, + 0x88c: 0x0040, 0x88d: 0x0008, 0x88e: 0x0040, 0x88f: 0x0040, 0x890: 0x0040, 0x891: 0x0040, + 0x892: 0x0040, 0x893: 0x0040, 0x894: 0x0008, 0x895: 0x0008, 0x896: 0x0008, 0x897: 0x0008, + 0x898: 0x0040, 0x899: 0x0008, 0x89a: 0x0008, 0x89b: 0x0008, 0x89c: 0x0008, 0x89d: 0x0008, + 0x89e: 0x0008, 0x89f: 0x0008, 0x8a0: 0x0040, 0x8a1: 0x0008, 0x8a2: 0x0008, 0x8a3: 0x0008, + 0x8a4: 0x0040, 0x8a5: 0x0008, 0x8a6: 0x0040, 0x8a7: 0x0008, 0x8a8: 0x0040, 0x8a9: 0x0040, + 0x8aa: 0x0008, 0x8ab: 0x0008, 0x8ac: 0x0040, 0x8ad: 0x0008, 0x8ae: 0x0008, 0x8af: 0x0008, + 0x8b0: 0x0008, 0x8b1: 0x1308, 0x8b2: 0x0008, 0x8b3: 0x0929, 0x8b4: 0x1308, 0x8b5: 0x1308, + 0x8b6: 0x1308, 0x8b7: 0x1308, 0x8b8: 0x1308, 0x8b9: 0x1308, 0x8ba: 0x0040, 0x8bb: 0x1308, + 0x8bc: 0x1308, 0x8bd: 0x0008, 0x8be: 0x0040, 0x8bf: 0x0040, + // Block 0x23, offset 0x8c0 + 0x8c0: 0x0008, 0x8c1: 0x0008, 0x8c2: 0x0008, 0x8c3: 0x09d1, 0x8c4: 0x0008, 0x8c5: 0x0008, + 0x8c6: 0x0008, 0x8c7: 0x0008, 0x8c8: 0x0040, 0x8c9: 0x0008, 0x8ca: 0x0008, 0x8cb: 0x0008, + 0x8cc: 0x0008, 0x8cd: 0x0a09, 0x8ce: 0x0008, 0x8cf: 0x0008, 0x8d0: 0x0008, 0x8d1: 0x0008, + 0x8d2: 0x0a41, 0x8d3: 0x0008, 0x8d4: 0x0008, 0x8d5: 0x0008, 0x8d6: 0x0008, 0x8d7: 0x0a79, + 0x8d8: 0x0008, 0x8d9: 0x0008, 0x8da: 0x0008, 0x8db: 0x0008, 0x8dc: 0x0ab1, 0x8dd: 0x0008, + 0x8de: 0x0008, 0x8df: 0x0008, 0x8e0: 0x0008, 0x8e1: 0x0008, 0x8e2: 0x0008, 0x8e3: 0x0008, + 0x8e4: 0x0008, 0x8e5: 0x0008, 0x8e6: 0x0008, 0x8e7: 0x0008, 0x8e8: 0x0008, 0x8e9: 0x0ae9, + 0x8ea: 0x0008, 0x8eb: 0x0008, 0x8ec: 0x0008, 0x8ed: 0x0040, 0x8ee: 0x0040, 0x8ef: 0x0040, + 0x8f0: 0x0040, 0x8f1: 0x1308, 0x8f2: 0x1308, 0x8f3: 0x0b21, 0x8f4: 0x1308, 0x8f5: 0x0b59, + 0x8f6: 0x0b91, 0x8f7: 0x0bc9, 0x8f8: 0x0c19, 0x8f9: 0x0c51, 0x8fa: 0x1308, 0x8fb: 0x1308, + 0x8fc: 0x1308, 0x8fd: 0x1308, 0x8fe: 0x1308, 0x8ff: 0x1008, + // Block 0x24, offset 0x900 + 0x900: 0x1308, 0x901: 0x0ca1, 0x902: 0x1308, 0x903: 0x1308, 0x904: 0x1b08, 0x905: 0x0018, + 0x906: 0x1308, 0x907: 0x1308, 0x908: 0x0008, 0x909: 0x0008, 0x90a: 0x0008, 0x90b: 0x0008, + 0x90c: 0x0008, 0x90d: 0x1308, 0x90e: 0x1308, 0x90f: 0x1308, 0x910: 0x1308, 0x911: 0x1308, + 0x912: 0x1308, 0x913: 0x0cd9, 0x914: 0x1308, 0x915: 0x1308, 0x916: 0x1308, 0x917: 0x1308, + 0x918: 0x0040, 0x919: 0x1308, 0x91a: 0x1308, 0x91b: 0x1308, 0x91c: 0x1308, 0x91d: 0x0d11, + 0x91e: 0x1308, 0x91f: 0x1308, 0x920: 0x1308, 0x921: 0x1308, 0x922: 0x0d49, 0x923: 0x1308, + 0x924: 0x1308, 0x925: 0x1308, 0x926: 0x1308, 0x927: 0x0d81, 0x928: 0x1308, 0x929: 0x1308, + 0x92a: 0x1308, 0x92b: 0x1308, 0x92c: 0x0db9, 0x92d: 0x1308, 0x92e: 0x1308, 0x92f: 0x1308, + 0x930: 0x1308, 0x931: 0x1308, 0x932: 0x1308, 0x933: 0x1308, 0x934: 0x1308, 0x935: 0x1308, + 0x936: 0x1308, 0x937: 0x1308, 0x938: 0x1308, 0x939: 0x0df1, 0x93a: 0x1308, 0x93b: 0x1308, + 0x93c: 0x1308, 0x93d: 0x0040, 0x93e: 0x0018, 0x93f: 0x0018, + // Block 0x25, offset 0x940 + 0x940: 0x0008, 0x941: 0x0008, 0x942: 0x0008, 0x943: 0x0008, 0x944: 0x0008, 0x945: 0x0008, + 0x946: 0x0008, 0x947: 0x0008, 0x948: 0x0008, 0x949: 0x0008, 0x94a: 0x0008, 0x94b: 0x0008, + 0x94c: 0x0008, 0x94d: 0x0008, 0x94e: 0x0008, 0x94f: 0x0008, 0x950: 0x0008, 0x951: 0x0008, + 0x952: 0x0008, 0x953: 0x0008, 0x954: 0x0008, 0x955: 0x0008, 0x956: 0x0008, 0x957: 0x0008, + 0x958: 0x0008, 0x959: 0x0008, 0x95a: 0x0008, 0x95b: 0x0008, 0x95c: 0x0008, 0x95d: 0x0008, + 0x95e: 0x0008, 0x95f: 0x0008, 0x960: 0x0008, 0x961: 0x0008, 0x962: 0x0008, 0x963: 0x0008, + 0x964: 0x0008, 0x965: 0x0008, 0x966: 0x0008, 0x967: 0x0008, 0x968: 0x0008, 0x969: 0x0008, + 0x96a: 0x0008, 0x96b: 0x0008, 0x96c: 0x0039, 0x96d: 0x0ed1, 0x96e: 0x0ee9, 0x96f: 0x0008, + 0x970: 0x0ef9, 0x971: 0x0f09, 0x972: 0x0f19, 0x973: 0x0f31, 0x974: 0x0249, 0x975: 0x0f41, + 0x976: 0x0259, 0x977: 0x0f51, 0x978: 0x0359, 0x979: 0x0f61, 0x97a: 0x0f71, 0x97b: 0x0008, + 0x97c: 0x00d9, 0x97d: 0x0f81, 0x97e: 0x0f99, 0x97f: 0x0269, + // Block 0x26, offset 0x980 + 0x980: 0x0fa9, 0x981: 0x0fb9, 0x982: 0x0279, 0x983: 0x0039, 0x984: 0x0fc9, 0x985: 0x0fe1, + 0x986: 0x059d, 0x987: 0x0ee9, 0x988: 0x0ef9, 0x989: 0x0f09, 0x98a: 0x0ff9, 0x98b: 0x1011, + 0x98c: 0x1029, 0x98d: 0x0f31, 0x98e: 0x0008, 0x98f: 0x0f51, 0x990: 0x0f61, 0x991: 0x1041, + 0x992: 0x00d9, 0x993: 0x1059, 0x994: 0x05b5, 0x995: 0x05b5, 0x996: 0x0f99, 0x997: 0x0fa9, + 0x998: 0x0fb9, 0x999: 0x059d, 0x99a: 0x1071, 0x99b: 0x1089, 0x99c: 0x05cd, 0x99d: 0x1099, + 0x99e: 0x10b1, 0x99f: 0x10c9, 0x9a0: 0x10e1, 0x9a1: 0x10f9, 0x9a2: 0x0f41, 0x9a3: 0x0269, + 0x9a4: 0x0fb9, 0x9a5: 0x1089, 0x9a6: 0x1099, 0x9a7: 0x10b1, 0x9a8: 0x1111, 0x9a9: 0x10e1, + 0x9aa: 0x10f9, 0x9ab: 0x0008, 0x9ac: 0x0008, 0x9ad: 0x0008, 0x9ae: 0x0008, 0x9af: 0x0008, + 0x9b0: 0x0008, 0x9b1: 0x0008, 0x9b2: 0x0008, 0x9b3: 0x0008, 0x9b4: 0x0008, 0x9b5: 0x0008, + 0x9b6: 0x0008, 0x9b7: 0x0008, 0x9b8: 0x1129, 0x9b9: 0x0008, 0x9ba: 0x0008, 0x9bb: 0x0008, + 0x9bc: 0x0008, 0x9bd: 0x0008, 0x9be: 0x0008, 0x9bf: 0x0008, + // Block 0x27, offset 0x9c0 + 0x9c0: 0x0008, 0x9c1: 0x0008, 0x9c2: 0x0008, 0x9c3: 0x0008, 0x9c4: 0x0008, 0x9c5: 0x0008, + 0x9c6: 0x0008, 0x9c7: 0x0008, 0x9c8: 0x0008, 0x9c9: 0x0008, 0x9ca: 0x0008, 0x9cb: 0x0008, + 0x9cc: 0x0008, 0x9cd: 0x0008, 0x9ce: 0x0008, 0x9cf: 0x0008, 0x9d0: 0x0008, 0x9d1: 0x0008, + 0x9d2: 0x0008, 0x9d3: 0x0008, 0x9d4: 0x0008, 0x9d5: 0x0008, 0x9d6: 0x0008, 0x9d7: 0x0008, + 0x9d8: 0x0008, 0x9d9: 0x0008, 0x9da: 0x0008, 0x9db: 0x1141, 0x9dc: 0x1159, 0x9dd: 0x1169, + 0x9de: 0x1181, 0x9df: 0x1029, 0x9e0: 0x1199, 0x9e1: 0x11a9, 0x9e2: 0x11c1, 0x9e3: 0x11d9, + 0x9e4: 0x11f1, 0x9e5: 0x1209, 0x9e6: 0x1221, 0x9e7: 0x05e5, 0x9e8: 0x1239, 0x9e9: 0x1251, + 0x9ea: 0xe17d, 0x9eb: 0x1269, 0x9ec: 0x1281, 0x9ed: 0x1299, 0x9ee: 0x12b1, 0x9ef: 0x12c9, + 0x9f0: 0x12e1, 0x9f1: 0x12f9, 0x9f2: 0x1311, 0x9f3: 0x1329, 0x9f4: 0x1341, 0x9f5: 0x1359, + 0x9f6: 0x1371, 0x9f7: 0x1389, 0x9f8: 0x05fd, 0x9f9: 0x13a1, 0x9fa: 0x13b9, 0x9fb: 0x13d1, + 0x9fc: 0x13e1, 0x9fd: 0x13f9, 0x9fe: 0x1411, 0x9ff: 0x1429, + // Block 0x28, offset 0xa00 + 0xa00: 0xe00d, 0xa01: 0x0008, 0xa02: 0xe00d, 0xa03: 0x0008, 0xa04: 0xe00d, 0xa05: 0x0008, + 0xa06: 0xe00d, 0xa07: 0x0008, 0xa08: 0xe00d, 0xa09: 0x0008, 0xa0a: 0xe00d, 0xa0b: 0x0008, + 0xa0c: 0xe00d, 0xa0d: 0x0008, 0xa0e: 0xe00d, 0xa0f: 0x0008, 0xa10: 0xe00d, 0xa11: 0x0008, + 0xa12: 0xe00d, 0xa13: 0x0008, 0xa14: 0xe00d, 0xa15: 0x0008, 0xa16: 0xe00d, 0xa17: 0x0008, + 0xa18: 0xe00d, 0xa19: 0x0008, 0xa1a: 0xe00d, 0xa1b: 0x0008, 0xa1c: 0xe00d, 0xa1d: 0x0008, + 0xa1e: 0xe00d, 0xa1f: 0x0008, 0xa20: 0xe00d, 0xa21: 0x0008, 0xa22: 0xe00d, 0xa23: 0x0008, + 0xa24: 0xe00d, 0xa25: 0x0008, 0xa26: 0xe00d, 0xa27: 0x0008, 0xa28: 0xe00d, 0xa29: 0x0008, + 0xa2a: 0xe00d, 0xa2b: 0x0008, 0xa2c: 0xe00d, 0xa2d: 0x0008, 0xa2e: 0xe00d, 0xa2f: 0x0008, + 0xa30: 0xe00d, 0xa31: 0x0008, 0xa32: 0xe00d, 0xa33: 0x0008, 0xa34: 0xe00d, 0xa35: 0x0008, + 0xa36: 0xe00d, 0xa37: 0x0008, 0xa38: 0xe00d, 0xa39: 0x0008, 0xa3a: 0xe00d, 0xa3b: 0x0008, + 0xa3c: 0xe00d, 0xa3d: 0x0008, 0xa3e: 0xe00d, 0xa3f: 0x0008, + // Block 0x29, offset 0xa40 + 0xa40: 0xe00d, 0xa41: 0x0008, 0xa42: 0xe00d, 0xa43: 0x0008, 0xa44: 0xe00d, 0xa45: 0x0008, + 0xa46: 0xe00d, 0xa47: 0x0008, 0xa48: 0xe00d, 0xa49: 0x0008, 0xa4a: 0xe00d, 0xa4b: 0x0008, + 0xa4c: 0xe00d, 0xa4d: 0x0008, 0xa4e: 0xe00d, 0xa4f: 0x0008, 0xa50: 0xe00d, 0xa51: 0x0008, + 0xa52: 0xe00d, 0xa53: 0x0008, 0xa54: 0xe00d, 0xa55: 0x0008, 0xa56: 0x0008, 0xa57: 0x0008, + 0xa58: 0x0008, 0xa59: 0x0008, 0xa5a: 0x0615, 0xa5b: 0x0635, 0xa5c: 0x0008, 0xa5d: 0x0008, + 0xa5e: 0x1441, 0xa5f: 0x0008, 0xa60: 0xe00d, 0xa61: 0x0008, 0xa62: 0xe00d, 0xa63: 0x0008, + 0xa64: 0xe00d, 0xa65: 0x0008, 0xa66: 0xe00d, 0xa67: 0x0008, 0xa68: 0xe00d, 0xa69: 0x0008, + 0xa6a: 0xe00d, 0xa6b: 0x0008, 0xa6c: 0xe00d, 0xa6d: 0x0008, 0xa6e: 0xe00d, 0xa6f: 0x0008, + 0xa70: 0xe00d, 0xa71: 0x0008, 0xa72: 0xe00d, 0xa73: 0x0008, 0xa74: 0xe00d, 0xa75: 0x0008, + 0xa76: 0xe00d, 0xa77: 0x0008, 0xa78: 0xe00d, 0xa79: 0x0008, 0xa7a: 0xe00d, 0xa7b: 0x0008, + 0xa7c: 0xe00d, 0xa7d: 0x0008, 0xa7e: 0xe00d, 0xa7f: 0x0008, + // Block 0x2a, offset 0xa80 + 0xa80: 0x0008, 0xa81: 0x0008, 0xa82: 0x0008, 0xa83: 0x0008, 0xa84: 0x0008, 0xa85: 0x0008, + 0xa86: 0x0040, 0xa87: 0x0040, 0xa88: 0xe045, 0xa89: 0xe045, 0xa8a: 0xe045, 0xa8b: 0xe045, + 0xa8c: 0xe045, 0xa8d: 0xe045, 0xa8e: 0x0040, 0xa8f: 0x0040, 0xa90: 0x0008, 0xa91: 0x0008, + 0xa92: 0x0008, 0xa93: 0x0008, 0xa94: 0x0008, 0xa95: 0x0008, 0xa96: 0x0008, 0xa97: 0x0008, + 0xa98: 0x0040, 0xa99: 0xe045, 0xa9a: 0x0040, 0xa9b: 0xe045, 0xa9c: 0x0040, 0xa9d: 0xe045, + 0xa9e: 0x0040, 0xa9f: 0xe045, 0xaa0: 0x0008, 0xaa1: 0x0008, 0xaa2: 0x0008, 0xaa3: 0x0008, + 0xaa4: 0x0008, 0xaa5: 0x0008, 0xaa6: 0x0008, 0xaa7: 0x0008, 0xaa8: 0xe045, 0xaa9: 0xe045, + 0xaaa: 0xe045, 0xaab: 0xe045, 0xaac: 0xe045, 0xaad: 0xe045, 0xaae: 0xe045, 0xaaf: 0xe045, + 0xab0: 0x0008, 0xab1: 0x1459, 0xab2: 0x0008, 0xab3: 0x1471, 0xab4: 0x0008, 0xab5: 0x1489, + 0xab6: 0x0008, 0xab7: 0x14a1, 0xab8: 0x0008, 0xab9: 0x14b9, 0xaba: 0x0008, 0xabb: 0x14d1, + 0xabc: 0x0008, 0xabd: 0x14e9, 0xabe: 0x0040, 0xabf: 0x0040, + // Block 0x2b, offset 0xac0 + 0xac0: 0x1501, 0xac1: 0x1531, 0xac2: 0x1561, 0xac3: 0x1591, 0xac4: 0x15c1, 0xac5: 0x15f1, + 0xac6: 0x1621, 0xac7: 0x1651, 0xac8: 0x1501, 0xac9: 0x1531, 0xaca: 0x1561, 0xacb: 0x1591, + 0xacc: 0x15c1, 0xacd: 0x15f1, 0xace: 0x1621, 0xacf: 0x1651, 0xad0: 0x1681, 0xad1: 0x16b1, + 0xad2: 0x16e1, 0xad3: 0x1711, 0xad4: 0x1741, 0xad5: 0x1771, 0xad6: 0x17a1, 0xad7: 0x17d1, + 0xad8: 0x1681, 0xad9: 0x16b1, 0xada: 0x16e1, 0xadb: 0x1711, 0xadc: 0x1741, 0xadd: 0x1771, + 0xade: 0x17a1, 0xadf: 0x17d1, 0xae0: 0x1801, 0xae1: 0x1831, 0xae2: 0x1861, 0xae3: 0x1891, + 0xae4: 0x18c1, 0xae5: 0x18f1, 0xae6: 0x1921, 0xae7: 0x1951, 0xae8: 0x1801, 0xae9: 0x1831, + 0xaea: 0x1861, 0xaeb: 0x1891, 0xaec: 0x18c1, 0xaed: 0x18f1, 0xaee: 0x1921, 0xaef: 0x1951, + 0xaf0: 0x0008, 0xaf1: 0x0008, 0xaf2: 0x1981, 0xaf3: 0x19b1, 0xaf4: 0x19d9, 0xaf5: 0x0040, + 0xaf6: 0x0008, 0xaf7: 0x1a01, 0xaf8: 0xe045, 0xaf9: 0xe045, 0xafa: 0x064d, 0xafb: 0x1459, + 0xafc: 0x19b1, 0xafd: 0x0666, 0xafe: 0x1a31, 0xaff: 0x0686, + // Block 0x2c, offset 0xb00 + 0xb00: 0x06a6, 0xb01: 0x1a4a, 0xb02: 0x1a79, 0xb03: 0x1aa9, 0xb04: 0x1ad1, 0xb05: 0x0040, + 0xb06: 0x0008, 0xb07: 0x1af9, 0xb08: 0x06c5, 0xb09: 0x1471, 0xb0a: 0x06dd, 0xb0b: 0x1489, + 0xb0c: 0x1aa9, 0xb0d: 0x1b2a, 0xb0e: 0x1b5a, 0xb0f: 0x1b8a, 0xb10: 0x0008, 0xb11: 0x0008, + 0xb12: 0x0008, 0xb13: 0x1bb9, 0xb14: 0x0040, 0xb15: 0x0040, 0xb16: 0x0008, 0xb17: 0x0008, + 0xb18: 0xe045, 0xb19: 0xe045, 0xb1a: 0x06f5, 0xb1b: 0x14a1, 0xb1c: 0x0040, 0xb1d: 0x1bd2, + 0xb1e: 0x1c02, 0xb1f: 0x1c32, 0xb20: 0x0008, 0xb21: 0x0008, 0xb22: 0x0008, 0xb23: 0x1c61, + 0xb24: 0x0008, 0xb25: 0x0008, 0xb26: 0x0008, 0xb27: 0x0008, 0xb28: 0xe045, 0xb29: 0xe045, + 0xb2a: 0x070d, 0xb2b: 0x14d1, 0xb2c: 0xe04d, 0xb2d: 0x1c7a, 0xb2e: 0x03d2, 0xb2f: 0x1caa, + 0xb30: 0x0040, 0xb31: 0x0040, 0xb32: 0x1cb9, 0xb33: 0x1ce9, 0xb34: 0x1d11, 0xb35: 0x0040, + 0xb36: 0x0008, 0xb37: 0x1d39, 0xb38: 0x0725, 0xb39: 0x14b9, 0xb3a: 0x0515, 0xb3b: 0x14e9, + 0xb3c: 0x1ce9, 0xb3d: 0x073e, 0xb3e: 0x075e, 0xb3f: 0x0040, + // Block 0x2d, offset 0xb40 + 0xb40: 0x000a, 0xb41: 0x000a, 0xb42: 0x000a, 0xb43: 0x000a, 0xb44: 0x000a, 0xb45: 0x000a, + 0xb46: 0x000a, 0xb47: 0x000a, 0xb48: 0x000a, 0xb49: 0x000a, 0xb4a: 0x000a, 0xb4b: 0x03c0, + 0xb4c: 0x0003, 0xb4d: 0x0003, 0xb4e: 0x0340, 0xb4f: 0x0340, 0xb50: 0x0018, 0xb51: 0xe00d, + 0xb52: 0x0018, 0xb53: 0x0018, 0xb54: 0x0018, 0xb55: 0x0018, 0xb56: 0x0018, 0xb57: 0x077e, + 0xb58: 0x0018, 0xb59: 0x0018, 0xb5a: 0x0018, 0xb5b: 0x0018, 0xb5c: 0x0018, 0xb5d: 0x0018, + 0xb5e: 0x0018, 0xb5f: 0x0018, 0xb60: 0x0018, 0xb61: 0x0018, 0xb62: 0x0018, 0xb63: 0x0018, + 0xb64: 0x0040, 0xb65: 0x0040, 0xb66: 0x0040, 0xb67: 0x0018, 0xb68: 0x0040, 0xb69: 0x0040, + 0xb6a: 0x0340, 0xb6b: 0x0340, 0xb6c: 0x0340, 0xb6d: 0x0340, 0xb6e: 0x0340, 0xb6f: 0x000a, + 0xb70: 0x0018, 0xb71: 0x0018, 0xb72: 0x0018, 0xb73: 0x1d69, 0xb74: 0x1da1, 0xb75: 0x0018, + 0xb76: 0x1df1, 0xb77: 0x1e29, 0xb78: 0x0018, 0xb79: 0x0018, 0xb7a: 0x0018, 0xb7b: 0x0018, + 0xb7c: 0x1e7a, 0xb7d: 0x0018, 0xb7e: 0x079e, 0xb7f: 0x0018, + // Block 0x2e, offset 0xb80 + 0xb80: 0x0018, 0xb81: 0x0018, 0xb82: 0x0018, 0xb83: 0x0018, 0xb84: 0x0018, 0xb85: 0x0018, + 0xb86: 0x0018, 0xb87: 0x1e92, 0xb88: 0x1eaa, 0xb89: 0x1ec2, 0xb8a: 0x0018, 0xb8b: 0x0018, + 0xb8c: 0x0018, 0xb8d: 0x0018, 0xb8e: 0x0018, 0xb8f: 0x0018, 0xb90: 0x0018, 0xb91: 0x0018, + 0xb92: 0x0018, 0xb93: 0x0018, 0xb94: 0x0018, 0xb95: 0x0018, 0xb96: 0x0018, 0xb97: 0x1ed9, + 0xb98: 0x0018, 0xb99: 0x0018, 0xb9a: 0x0018, 0xb9b: 0x0018, 0xb9c: 0x0018, 0xb9d: 0x0018, + 0xb9e: 0x0018, 0xb9f: 0x000a, 0xba0: 0x03c0, 0xba1: 0x0340, 0xba2: 0x0340, 0xba3: 0x0340, + 0xba4: 0x03c0, 0xba5: 0x0040, 0xba6: 0x0040, 0xba7: 0x0040, 0xba8: 0x0040, 0xba9: 0x0040, + 0xbaa: 0x0340, 0xbab: 0x0340, 0xbac: 0x0340, 0xbad: 0x0340, 0xbae: 0x0340, 0xbaf: 0x0340, + 0xbb0: 0x1f41, 0xbb1: 0x0f41, 0xbb2: 0x0040, 0xbb3: 0x0040, 0xbb4: 0x1f51, 0xbb5: 0x1f61, + 0xbb6: 0x1f71, 0xbb7: 0x1f81, 0xbb8: 0x1f91, 0xbb9: 0x1fa1, 0xbba: 0x1fb2, 0xbbb: 0x07bd, + 0xbbc: 0x1fc2, 0xbbd: 0x1fd2, 0xbbe: 0x1fe2, 0xbbf: 0x0f71, + // Block 0x2f, offset 0xbc0 + 0xbc0: 0x1f41, 0xbc1: 0x00c9, 0xbc2: 0x0069, 0xbc3: 0x0079, 0xbc4: 0x1f51, 0xbc5: 0x1f61, + 0xbc6: 0x1f71, 0xbc7: 0x1f81, 0xbc8: 0x1f91, 0xbc9: 0x1fa1, 0xbca: 0x1fb2, 0xbcb: 0x07d5, + 0xbcc: 0x1fc2, 0xbcd: 0x1fd2, 0xbce: 0x1fe2, 0xbcf: 0x0040, 0xbd0: 0x0039, 0xbd1: 0x0f09, + 0xbd2: 0x00d9, 0xbd3: 0x0369, 0xbd4: 0x0ff9, 0xbd5: 0x0249, 0xbd6: 0x0f51, 0xbd7: 0x0359, + 0xbd8: 0x0f61, 0xbd9: 0x0f71, 0xbda: 0x0f99, 0xbdb: 0x01d9, 0xbdc: 0x0fa9, 0xbdd: 0x0040, + 0xbde: 0x0040, 0xbdf: 0x0040, 0xbe0: 0x0018, 0xbe1: 0x0018, 0xbe2: 0x0018, 0xbe3: 0x0018, + 0xbe4: 0x0018, 0xbe5: 0x0018, 0xbe6: 0x0018, 0xbe7: 0x0018, 0xbe8: 0x1ff1, 0xbe9: 0x0018, + 0xbea: 0x0018, 0xbeb: 0x0018, 0xbec: 0x0018, 0xbed: 0x0018, 0xbee: 0x0018, 0xbef: 0x0018, + 0xbf0: 0x0018, 0xbf1: 0x0018, 0xbf2: 0x0018, 0xbf3: 0x0018, 0xbf4: 0x0018, 0xbf5: 0x0018, + 0xbf6: 0x0018, 0xbf7: 0x0018, 0xbf8: 0x0018, 0xbf9: 0x0018, 0xbfa: 0x0018, 0xbfb: 0x0018, + 0xbfc: 0x0018, 0xbfd: 0x0018, 0xbfe: 0x0018, 0xbff: 0x0040, + // Block 0x30, offset 0xc00 + 0xc00: 0x07ee, 0xc01: 0x080e, 0xc02: 0x1159, 0xc03: 0x082d, 0xc04: 0x0018, 0xc05: 0x084e, + 0xc06: 0x086e, 0xc07: 0x1011, 0xc08: 0x0018, 0xc09: 0x088d, 0xc0a: 0x0f31, 0xc0b: 0x0249, + 0xc0c: 0x0249, 0xc0d: 0x0249, 0xc0e: 0x0249, 0xc0f: 0x2009, 0xc10: 0x0f41, 0xc11: 0x0f41, + 0xc12: 0x0359, 0xc13: 0x0359, 0xc14: 0x0018, 0xc15: 0x0f71, 0xc16: 0x2021, 0xc17: 0x0018, + 0xc18: 0x0018, 0xc19: 0x0f99, 0xc1a: 0x2039, 0xc1b: 0x0269, 0xc1c: 0x0269, 0xc1d: 0x0269, + 0xc1e: 0x0018, 0xc1f: 0x0018, 0xc20: 0x2049, 0xc21: 0x08ad, 0xc22: 0x2061, 0xc23: 0x0018, + 0xc24: 0x13d1, 0xc25: 0x0018, 0xc26: 0x2079, 0xc27: 0x0018, 0xc28: 0x13d1, 0xc29: 0x0018, + 0xc2a: 0x0f51, 0xc2b: 0x2091, 0xc2c: 0x0ee9, 0xc2d: 0x1159, 0xc2e: 0x0018, 0xc2f: 0x0f09, + 0xc30: 0x0f09, 0xc31: 0x1199, 0xc32: 0x0040, 0xc33: 0x0f61, 0xc34: 0x00d9, 0xc35: 0x20a9, + 0xc36: 0x20c1, 0xc37: 0x20d9, 0xc38: 0x20f1, 0xc39: 0x0f41, 0xc3a: 0x0018, 0xc3b: 0x08cd, + 0xc3c: 0x2109, 0xc3d: 0x10b1, 0xc3e: 0x10b1, 0xc3f: 0x2109, + // Block 0x31, offset 0xc40 + 0xc40: 0x08ed, 0xc41: 0x0018, 0xc42: 0x0018, 0xc43: 0x0018, 0xc44: 0x0018, 0xc45: 0x0ef9, + 0xc46: 0x0ef9, 0xc47: 0x0f09, 0xc48: 0x0f41, 0xc49: 0x0259, 0xc4a: 0x0018, 0xc4b: 0x0018, + 0xc4c: 0x0018, 0xc4d: 0x0018, 0xc4e: 0x0008, 0xc4f: 0x0018, 0xc50: 0x2121, 0xc51: 0x2151, + 0xc52: 0x2181, 0xc53: 0x21b9, 0xc54: 0x21e9, 0xc55: 0x2219, 0xc56: 0x2249, 0xc57: 0x2279, + 0xc58: 0x22a9, 0xc59: 0x22d9, 0xc5a: 0x2309, 0xc5b: 0x2339, 0xc5c: 0x2369, 0xc5d: 0x2399, + 0xc5e: 0x23c9, 0xc5f: 0x23f9, 0xc60: 0x0f41, 0xc61: 0x2421, 0xc62: 0x0905, 0xc63: 0x2439, + 0xc64: 0x1089, 0xc65: 0x2451, 0xc66: 0x0925, 0xc67: 0x2469, 0xc68: 0x2491, 0xc69: 0x0369, + 0xc6a: 0x24a9, 0xc6b: 0x0945, 0xc6c: 0x0359, 0xc6d: 0x1159, 0xc6e: 0x0ef9, 0xc6f: 0x0f61, + 0xc70: 0x0f41, 0xc71: 0x2421, 0xc72: 0x0965, 0xc73: 0x2439, 0xc74: 0x1089, 0xc75: 0x2451, + 0xc76: 0x0985, 0xc77: 0x2469, 0xc78: 0x2491, 0xc79: 0x0369, 0xc7a: 0x24a9, 0xc7b: 0x09a5, + 0xc7c: 0x0359, 0xc7d: 0x1159, 0xc7e: 0x0ef9, 0xc7f: 0x0f61, + // Block 0x32, offset 0xc80 + 0xc80: 0x0018, 0xc81: 0x0018, 0xc82: 0x0018, 0xc83: 0x0018, 0xc84: 0x0018, 0xc85: 0x0018, + 0xc86: 0x0018, 0xc87: 0x0018, 0xc88: 0x0018, 0xc89: 0x0018, 0xc8a: 0x0018, 0xc8b: 0x0040, + 0xc8c: 0x0040, 0xc8d: 0x0040, 0xc8e: 0x0040, 0xc8f: 0x0040, 0xc90: 0x0040, 0xc91: 0x0040, + 0xc92: 0x0040, 0xc93: 0x0040, 0xc94: 0x0040, 0xc95: 0x0040, 0xc96: 0x0040, 0xc97: 0x0040, + 0xc98: 0x0040, 0xc99: 0x0040, 0xc9a: 0x0040, 0xc9b: 0x0040, 0xc9c: 0x0040, 0xc9d: 0x0040, + 0xc9e: 0x0040, 0xc9f: 0x0040, 0xca0: 0x00c9, 0xca1: 0x0069, 0xca2: 0x0079, 0xca3: 0x1f51, + 0xca4: 0x1f61, 0xca5: 0x1f71, 0xca6: 0x1f81, 0xca7: 0x1f91, 0xca8: 0x1fa1, 0xca9: 0x2601, + 0xcaa: 0x2619, 0xcab: 0x2631, 0xcac: 0x2649, 0xcad: 0x2661, 0xcae: 0x2679, 0xcaf: 0x2691, + 0xcb0: 0x26a9, 0xcb1: 0x26c1, 0xcb2: 0x26d9, 0xcb3: 0x26f1, 0xcb4: 0x0a06, 0xcb5: 0x0a26, + 0xcb6: 0x0a46, 0xcb7: 0x0a66, 0xcb8: 0x0a86, 0xcb9: 0x0aa6, 0xcba: 0x0ac6, 0xcbb: 0x0ae6, + 0xcbc: 0x0b06, 0xcbd: 0x270a, 0xcbe: 0x2732, 0xcbf: 0x275a, + // Block 0x33, offset 0xcc0 + 0xcc0: 0x2782, 0xcc1: 0x27aa, 0xcc2: 0x27d2, 0xcc3: 0x27fa, 0xcc4: 0x2822, 0xcc5: 0x284a, + 0xcc6: 0x2872, 0xcc7: 0x289a, 0xcc8: 0x0040, 0xcc9: 0x0040, 0xcca: 0x0040, 0xccb: 0x0040, + 0xccc: 0x0040, 0xccd: 0x0040, 0xcce: 0x0040, 0xccf: 0x0040, 0xcd0: 0x0040, 0xcd1: 0x0040, + 0xcd2: 0x0040, 0xcd3: 0x0040, 0xcd4: 0x0040, 0xcd5: 0x0040, 0xcd6: 0x0040, 0xcd7: 0x0040, + 0xcd8: 0x0040, 0xcd9: 0x0040, 0xcda: 0x0040, 0xcdb: 0x0040, 0xcdc: 0x0b26, 0xcdd: 0x0b46, + 0xcde: 0x0b66, 0xcdf: 0x0b86, 0xce0: 0x0ba6, 0xce1: 0x0bc6, 0xce2: 0x0be6, 0xce3: 0x0c06, + 0xce4: 0x0c26, 0xce5: 0x0c46, 0xce6: 0x0c66, 0xce7: 0x0c86, 0xce8: 0x0ca6, 0xce9: 0x0cc6, + 0xcea: 0x0ce6, 0xceb: 0x0d06, 0xcec: 0x0d26, 0xced: 0x0d46, 0xcee: 0x0d66, 0xcef: 0x0d86, + 0xcf0: 0x0da6, 0xcf1: 0x0dc6, 0xcf2: 0x0de6, 0xcf3: 0x0e06, 0xcf4: 0x0e26, 0xcf5: 0x0e46, + 0xcf6: 0x0039, 0xcf7: 0x0ee9, 0xcf8: 0x1159, 0xcf9: 0x0ef9, 0xcfa: 0x0f09, 0xcfb: 0x1199, + 0xcfc: 0x0f31, 0xcfd: 0x0249, 0xcfe: 0x0f41, 0xcff: 0x0259, + // Block 0x34, offset 0xd00 + 0xd00: 0x0f51, 0xd01: 0x0359, 0xd02: 0x0f61, 0xd03: 0x0f71, 0xd04: 0x00d9, 0xd05: 0x0f99, + 0xd06: 0x2039, 0xd07: 0x0269, 0xd08: 0x01d9, 0xd09: 0x0fa9, 0xd0a: 0x0fb9, 0xd0b: 0x1089, + 0xd0c: 0x0279, 0xd0d: 0x0369, 0xd0e: 0x0289, 0xd0f: 0x13d1, 0xd10: 0x0039, 0xd11: 0x0ee9, + 0xd12: 0x1159, 0xd13: 0x0ef9, 0xd14: 0x0f09, 0xd15: 0x1199, 0xd16: 0x0f31, 0xd17: 0x0249, + 0xd18: 0x0f41, 0xd19: 0x0259, 0xd1a: 0x0f51, 0xd1b: 0x0359, 0xd1c: 0x0f61, 0xd1d: 0x0f71, + 0xd1e: 0x00d9, 0xd1f: 0x0f99, 0xd20: 0x2039, 0xd21: 0x0269, 0xd22: 0x01d9, 0xd23: 0x0fa9, + 0xd24: 0x0fb9, 0xd25: 0x1089, 0xd26: 0x0279, 0xd27: 0x0369, 0xd28: 0x0289, 0xd29: 0x13d1, + 0xd2a: 0x1f41, 0xd2b: 0x0018, 0xd2c: 0x0018, 0xd2d: 0x0018, 0xd2e: 0x0018, 0xd2f: 0x0018, + 0xd30: 0x0018, 0xd31: 0x0018, 0xd32: 0x0018, 0xd33: 0x0018, 0xd34: 0x0018, 0xd35: 0x0018, + 0xd36: 0x0018, 0xd37: 0x0018, 0xd38: 0x0018, 0xd39: 0x0018, 0xd3a: 0x0018, 0xd3b: 0x0018, + 0xd3c: 0x0018, 0xd3d: 0x0018, 0xd3e: 0x0018, 0xd3f: 0x0018, + // Block 0x35, offset 0xd40 + 0xd40: 0x0008, 0xd41: 0x0008, 0xd42: 0x0008, 0xd43: 0x0008, 0xd44: 0x0008, 0xd45: 0x0008, + 0xd46: 0x0008, 0xd47: 0x0008, 0xd48: 0x0008, 0xd49: 0x0008, 0xd4a: 0x0008, 0xd4b: 0x0008, + 0xd4c: 0x0008, 0xd4d: 0x0008, 0xd4e: 0x0008, 0xd4f: 0x0008, 0xd50: 0x0008, 0xd51: 0x0008, + 0xd52: 0x0008, 0xd53: 0x0008, 0xd54: 0x0008, 0xd55: 0x0008, 0xd56: 0x0008, 0xd57: 0x0008, + 0xd58: 0x0008, 0xd59: 0x0008, 0xd5a: 0x0008, 0xd5b: 0x0008, 0xd5c: 0x0008, 0xd5d: 0x0008, + 0xd5e: 0x0008, 0xd5f: 0x0040, 0xd60: 0xe00d, 0xd61: 0x0008, 0xd62: 0x2971, 0xd63: 0x0ebd, + 0xd64: 0x2989, 0xd65: 0x0008, 0xd66: 0x0008, 0xd67: 0xe07d, 0xd68: 0x0008, 0xd69: 0xe01d, + 0xd6a: 0x0008, 0xd6b: 0xe03d, 0xd6c: 0x0008, 0xd6d: 0x0fe1, 0xd6e: 0x1281, 0xd6f: 0x0fc9, + 0xd70: 0x1141, 0xd71: 0x0008, 0xd72: 0xe00d, 0xd73: 0x0008, 0xd74: 0x0008, 0xd75: 0xe01d, + 0xd76: 0x0008, 0xd77: 0x0008, 0xd78: 0x0008, 0xd79: 0x0008, 0xd7a: 0x0008, 0xd7b: 0x0008, + 0xd7c: 0x0259, 0xd7d: 0x1089, 0xd7e: 0x29a1, 0xd7f: 0x29b9, + // Block 0x36, offset 0xd80 + 0xd80: 0xe00d, 0xd81: 0x0008, 0xd82: 0xe00d, 0xd83: 0x0008, 0xd84: 0xe00d, 0xd85: 0x0008, + 0xd86: 0xe00d, 0xd87: 0x0008, 0xd88: 0xe00d, 0xd89: 0x0008, 0xd8a: 0xe00d, 0xd8b: 0x0008, + 0xd8c: 0xe00d, 0xd8d: 0x0008, 0xd8e: 0xe00d, 0xd8f: 0x0008, 0xd90: 0xe00d, 0xd91: 0x0008, + 0xd92: 0xe00d, 0xd93: 0x0008, 0xd94: 0xe00d, 0xd95: 0x0008, 0xd96: 0xe00d, 0xd97: 0x0008, + 0xd98: 0xe00d, 0xd99: 0x0008, 0xd9a: 0xe00d, 0xd9b: 0x0008, 0xd9c: 0xe00d, 0xd9d: 0x0008, + 0xd9e: 0xe00d, 0xd9f: 0x0008, 0xda0: 0xe00d, 0xda1: 0x0008, 0xda2: 0xe00d, 0xda3: 0x0008, + 0xda4: 0x0008, 0xda5: 0x0018, 0xda6: 0x0018, 0xda7: 0x0018, 0xda8: 0x0018, 0xda9: 0x0018, + 0xdaa: 0x0018, 0xdab: 0xe03d, 0xdac: 0x0008, 0xdad: 0xe01d, 0xdae: 0x0008, 0xdaf: 0x1308, + 0xdb0: 0x1308, 0xdb1: 0x1308, 0xdb2: 0xe00d, 0xdb3: 0x0008, 0xdb4: 0x0040, 0xdb5: 0x0040, + 0xdb6: 0x0040, 0xdb7: 0x0040, 0xdb8: 0x0040, 0xdb9: 0x0018, 0xdba: 0x0018, 0xdbb: 0x0018, + 0xdbc: 0x0018, 0xdbd: 0x0018, 0xdbe: 0x0018, 0xdbf: 0x0018, + // Block 0x37, offset 0xdc0 + 0xdc0: 0x26fd, 0xdc1: 0x271d, 0xdc2: 0x273d, 0xdc3: 0x275d, 0xdc4: 0x277d, 0xdc5: 0x279d, + 0xdc6: 0x27bd, 0xdc7: 0x27dd, 0xdc8: 0x27fd, 0xdc9: 0x281d, 0xdca: 0x283d, 0xdcb: 0x285d, + 0xdcc: 0x287d, 0xdcd: 0x289d, 0xdce: 0x28bd, 0xdcf: 0x28dd, 0xdd0: 0x28fd, 0xdd1: 0x291d, + 0xdd2: 0x293d, 0xdd3: 0x295d, 0xdd4: 0x297d, 0xdd5: 0x299d, 0xdd6: 0x0040, 0xdd7: 0x0040, + 0xdd8: 0x0040, 0xdd9: 0x0040, 0xdda: 0x0040, 0xddb: 0x0040, 0xddc: 0x0040, 0xddd: 0x0040, + 0xdde: 0x0040, 0xddf: 0x0040, 0xde0: 0x0040, 0xde1: 0x0040, 0xde2: 0x0040, 0xde3: 0x0040, + 0xde4: 0x0040, 0xde5: 0x0040, 0xde6: 0x0040, 0xde7: 0x0040, 0xde8: 0x0040, 0xde9: 0x0040, + 0xdea: 0x0040, 0xdeb: 0x0040, 0xdec: 0x0040, 0xded: 0x0040, 0xdee: 0x0040, 0xdef: 0x0040, + 0xdf0: 0x0040, 0xdf1: 0x0040, 0xdf2: 0x0040, 0xdf3: 0x0040, 0xdf4: 0x0040, 0xdf5: 0x0040, + 0xdf6: 0x0040, 0xdf7: 0x0040, 0xdf8: 0x0040, 0xdf9: 0x0040, 0xdfa: 0x0040, 0xdfb: 0x0040, + 0xdfc: 0x0040, 0xdfd: 0x0040, 0xdfe: 0x0040, 0xdff: 0x0040, + // Block 0x38, offset 0xe00 + 0xe00: 0x000a, 0xe01: 0x0018, 0xe02: 0x29d1, 0xe03: 0x0018, 0xe04: 0x0018, 0xe05: 0x0008, + 0xe06: 0x0008, 0xe07: 0x0008, 0xe08: 0x0018, 0xe09: 0x0018, 0xe0a: 0x0018, 0xe0b: 0x0018, + 0xe0c: 0x0018, 0xe0d: 0x0018, 0xe0e: 0x0018, 0xe0f: 0x0018, 0xe10: 0x0018, 0xe11: 0x0018, + 0xe12: 0x0018, 0xe13: 0x0018, 0xe14: 0x0018, 0xe15: 0x0018, 0xe16: 0x0018, 0xe17: 0x0018, + 0xe18: 0x0018, 0xe19: 0x0018, 0xe1a: 0x0018, 0xe1b: 0x0018, 0xe1c: 0x0018, 0xe1d: 0x0018, + 0xe1e: 0x0018, 0xe1f: 0x0018, 0xe20: 0x0018, 0xe21: 0x0018, 0xe22: 0x0018, 0xe23: 0x0018, + 0xe24: 0x0018, 0xe25: 0x0018, 0xe26: 0x0018, 0xe27: 0x0018, 0xe28: 0x0018, 0xe29: 0x0018, + 0xe2a: 0x1308, 0xe2b: 0x1308, 0xe2c: 0x1308, 0xe2d: 0x1308, 0xe2e: 0x1018, 0xe2f: 0x1018, + 0xe30: 0x0018, 0xe31: 0x0018, 0xe32: 0x0018, 0xe33: 0x0018, 0xe34: 0x0018, 0xe35: 0x0018, + 0xe36: 0xe125, 0xe37: 0x0018, 0xe38: 0x29bd, 0xe39: 0x29dd, 0xe3a: 0x29fd, 0xe3b: 0x0018, + 0xe3c: 0x0008, 0xe3d: 0x0018, 0xe3e: 0x0018, 0xe3f: 0x0018, + // Block 0x39, offset 0xe40 + 0xe40: 0x2b3d, 0xe41: 0x2b5d, 0xe42: 0x2b7d, 0xe43: 0x2b9d, 0xe44: 0x2bbd, 0xe45: 0x2bdd, + 0xe46: 0x2bdd, 0xe47: 0x2bdd, 0xe48: 0x2bfd, 0xe49: 0x2bfd, 0xe4a: 0x2bfd, 0xe4b: 0x2bfd, + 0xe4c: 0x2c1d, 0xe4d: 0x2c1d, 0xe4e: 0x2c1d, 0xe4f: 0x2c3d, 0xe50: 0x2c5d, 0xe51: 0x2c5d, + 0xe52: 0x2a7d, 0xe53: 0x2a7d, 0xe54: 0x2c5d, 0xe55: 0x2c5d, 0xe56: 0x2c7d, 0xe57: 0x2c7d, + 0xe58: 0x2c5d, 0xe59: 0x2c5d, 0xe5a: 0x2a7d, 0xe5b: 0x2a7d, 0xe5c: 0x2c5d, 0xe5d: 0x2c5d, + 0xe5e: 0x2c3d, 0xe5f: 0x2c3d, 0xe60: 0x2c9d, 0xe61: 0x2c9d, 0xe62: 0x2cbd, 0xe63: 0x2cbd, + 0xe64: 0x0040, 0xe65: 0x2cdd, 0xe66: 0x2cfd, 0xe67: 0x2d1d, 0xe68: 0x2d1d, 0xe69: 0x2d3d, + 0xe6a: 0x2d5d, 0xe6b: 0x2d7d, 0xe6c: 0x2d9d, 0xe6d: 0x2dbd, 0xe6e: 0x2ddd, 0xe6f: 0x2dfd, + 0xe70: 0x2e1d, 0xe71: 0x2e3d, 0xe72: 0x2e3d, 0xe73: 0x2e5d, 0xe74: 0x2e7d, 0xe75: 0x2e7d, + 0xe76: 0x2e9d, 0xe77: 0x2ebd, 0xe78: 0x2e5d, 0xe79: 0x2edd, 0xe7a: 0x2efd, 0xe7b: 0x2edd, + 0xe7c: 0x2e5d, 0xe7d: 0x2f1d, 0xe7e: 0x2f3d, 0xe7f: 0x2f5d, + // Block 0x3a, offset 0xe80 + 0xe80: 0x2f7d, 0xe81: 0x2f9d, 0xe82: 0x2cfd, 0xe83: 0x2cdd, 0xe84: 0x2fbd, 0xe85: 0x2fdd, + 0xe86: 0x2ffd, 0xe87: 0x301d, 0xe88: 0x303d, 0xe89: 0x305d, 0xe8a: 0x307d, 0xe8b: 0x309d, + 0xe8c: 0x30bd, 0xe8d: 0x30dd, 0xe8e: 0x30fd, 0xe8f: 0x0040, 0xe90: 0x0018, 0xe91: 0x0018, + 0xe92: 0x311d, 0xe93: 0x313d, 0xe94: 0x315d, 0xe95: 0x317d, 0xe96: 0x319d, 0xe97: 0x31bd, + 0xe98: 0x31dd, 0xe99: 0x31fd, 0xe9a: 0x321d, 0xe9b: 0x323d, 0xe9c: 0x315d, 0xe9d: 0x325d, + 0xe9e: 0x327d, 0xe9f: 0x329d, 0xea0: 0x0008, 0xea1: 0x0008, 0xea2: 0x0008, 0xea3: 0x0008, + 0xea4: 0x0008, 0xea5: 0x0008, 0xea6: 0x0008, 0xea7: 0x0008, 0xea8: 0x0008, 0xea9: 0x0008, + 0xeaa: 0x0008, 0xeab: 0x0008, 0xeac: 0x0008, 0xead: 0x0008, 0xeae: 0x0008, 0xeaf: 0x0008, + 0xeb0: 0x0008, 0xeb1: 0x0008, 0xeb2: 0x0008, 0xeb3: 0x0008, 0xeb4: 0x0008, 0xeb5: 0x0008, + 0xeb6: 0x0008, 0xeb7: 0x0008, 0xeb8: 0x0008, 0xeb9: 0x0008, 0xeba: 0x0008, 0xebb: 0x0040, + 0xebc: 0x0040, 0xebd: 0x0040, 0xebe: 0x0040, 0xebf: 0x0040, + // Block 0x3b, offset 0xec0 + 0xec0: 0x36a2, 0xec1: 0x36d2, 0xec2: 0x3702, 0xec3: 0x3732, 0xec4: 0x32bd, 0xec5: 0x32dd, + 0xec6: 0x32fd, 0xec7: 0x331d, 0xec8: 0x0018, 0xec9: 0x0018, 0xeca: 0x0018, 0xecb: 0x0018, + 0xecc: 0x0018, 0xecd: 0x0018, 0xece: 0x0018, 0xecf: 0x0018, 0xed0: 0x333d, 0xed1: 0x3761, + 0xed2: 0x3779, 0xed3: 0x3791, 0xed4: 0x37a9, 0xed5: 0x37c1, 0xed6: 0x37d9, 0xed7: 0x37f1, + 0xed8: 0x3809, 0xed9: 0x3821, 0xeda: 0x3839, 0xedb: 0x3851, 0xedc: 0x3869, 0xedd: 0x3881, + 0xede: 0x3899, 0xedf: 0x38b1, 0xee0: 0x335d, 0xee1: 0x337d, 0xee2: 0x339d, 0xee3: 0x33bd, + 0xee4: 0x33dd, 0xee5: 0x33dd, 0xee6: 0x33fd, 0xee7: 0x341d, 0xee8: 0x343d, 0xee9: 0x345d, + 0xeea: 0x347d, 0xeeb: 0x349d, 0xeec: 0x34bd, 0xeed: 0x34dd, 0xeee: 0x34fd, 0xeef: 0x351d, + 0xef0: 0x353d, 0xef1: 0x355d, 0xef2: 0x357d, 0xef3: 0x359d, 0xef4: 0x35bd, 0xef5: 0x35dd, + 0xef6: 0x35fd, 0xef7: 0x361d, 0xef8: 0x363d, 0xef9: 0x365d, 0xefa: 0x367d, 0xefb: 0x369d, + 0xefc: 0x38c9, 0xefd: 0x3901, 0xefe: 0x36bd, 0xeff: 0x0018, + // Block 0x3c, offset 0xf00 + 0xf00: 0x36dd, 0xf01: 0x36fd, 0xf02: 0x371d, 0xf03: 0x373d, 0xf04: 0x375d, 0xf05: 0x377d, + 0xf06: 0x379d, 0xf07: 0x37bd, 0xf08: 0x37dd, 0xf09: 0x37fd, 0xf0a: 0x381d, 0xf0b: 0x383d, + 0xf0c: 0x385d, 0xf0d: 0x387d, 0xf0e: 0x389d, 0xf0f: 0x38bd, 0xf10: 0x38dd, 0xf11: 0x38fd, + 0xf12: 0x391d, 0xf13: 0x393d, 0xf14: 0x395d, 0xf15: 0x397d, 0xf16: 0x399d, 0xf17: 0x39bd, + 0xf18: 0x39dd, 0xf19: 0x39fd, 0xf1a: 0x3a1d, 0xf1b: 0x3a3d, 0xf1c: 0x3a5d, 0xf1d: 0x3a7d, + 0xf1e: 0x3a9d, 0xf1f: 0x3abd, 0xf20: 0x3add, 0xf21: 0x3afd, 0xf22: 0x3b1d, 0xf23: 0x3b3d, + 0xf24: 0x3b5d, 0xf25: 0x3b7d, 0xf26: 0x127d, 0xf27: 0x3b9d, 0xf28: 0x3bbd, 0xf29: 0x3bdd, + 0xf2a: 0x3bfd, 0xf2b: 0x3c1d, 0xf2c: 0x3c3d, 0xf2d: 0x3c5d, 0xf2e: 0x239d, 0xf2f: 0x3c7d, + 0xf30: 0x3c9d, 0xf31: 0x3939, 0xf32: 0x3951, 0xf33: 0x3969, 0xf34: 0x3981, 0xf35: 0x3999, + 0xf36: 0x39b1, 0xf37: 0x39c9, 0xf38: 0x39e1, 0xf39: 0x39f9, 0xf3a: 0x3a11, 0xf3b: 0x3a29, + 0xf3c: 0x3a41, 0xf3d: 0x3a59, 0xf3e: 0x3a71, 0xf3f: 0x3a89, + // Block 0x3d, offset 0xf40 + 0xf40: 0x3aa1, 0xf41: 0x3ac9, 0xf42: 0x3af1, 0xf43: 0x3b19, 0xf44: 0x3b41, 0xf45: 0x3b69, + 0xf46: 0x3b91, 0xf47: 0x3bb9, 0xf48: 0x3be1, 0xf49: 0x3c09, 0xf4a: 0x3c39, 0xf4b: 0x3c69, + 0xf4c: 0x3c99, 0xf4d: 0x3cbd, 0xf4e: 0x3cb1, 0xf4f: 0x3cdd, 0xf50: 0x3cfd, 0xf51: 0x3d15, + 0xf52: 0x3d2d, 0xf53: 0x3d45, 0xf54: 0x3d5d, 0xf55: 0x3d5d, 0xf56: 0x3d45, 0xf57: 0x3d75, + 0xf58: 0x07bd, 0xf59: 0x3d8d, 0xf5a: 0x3da5, 0xf5b: 0x3dbd, 0xf5c: 0x3dd5, 0xf5d: 0x3ded, + 0xf5e: 0x3e05, 0xf5f: 0x3e1d, 0xf60: 0x3e35, 0xf61: 0x3e4d, 0xf62: 0x3e65, 0xf63: 0x3e7d, + 0xf64: 0x3e95, 0xf65: 0x3e95, 0xf66: 0x3ead, 0xf67: 0x3ead, 0xf68: 0x3ec5, 0xf69: 0x3ec5, + 0xf6a: 0x3edd, 0xf6b: 0x3ef5, 0xf6c: 0x3f0d, 0xf6d: 0x3f25, 0xf6e: 0x3f3d, 0xf6f: 0x3f3d, + 0xf70: 0x3f55, 0xf71: 0x3f55, 0xf72: 0x3f55, 0xf73: 0x3f6d, 0xf74: 0x3f85, 0xf75: 0x3f9d, + 0xf76: 0x3fb5, 0xf77: 0x3f9d, 0xf78: 0x3fcd, 0xf79: 0x3fe5, 0xf7a: 0x3f6d, 0xf7b: 0x3ffd, + 0xf7c: 0x4015, 0xf7d: 0x4015, 0xf7e: 0x4015, 0xf7f: 0x0040, + // Block 0x3e, offset 0xf80 + 0xf80: 0x3cc9, 0xf81: 0x3d31, 0xf82: 0x3d99, 0xf83: 0x3e01, 0xf84: 0x3e51, 0xf85: 0x3eb9, + 0xf86: 0x3f09, 0xf87: 0x3f59, 0xf88: 0x3fd9, 0xf89: 0x4041, 0xf8a: 0x4091, 0xf8b: 0x40e1, + 0xf8c: 0x4131, 0xf8d: 0x4199, 0xf8e: 0x4201, 0xf8f: 0x4251, 0xf90: 0x42a1, 0xf91: 0x42d9, + 0xf92: 0x4329, 0xf93: 0x4391, 0xf94: 0x43f9, 0xf95: 0x4431, 0xf96: 0x44b1, 0xf97: 0x4549, + 0xf98: 0x45c9, 0xf99: 0x4619, 0xf9a: 0x4699, 0xf9b: 0x4719, 0xf9c: 0x4781, 0xf9d: 0x47d1, + 0xf9e: 0x4821, 0xf9f: 0x4871, 0xfa0: 0x48d9, 0xfa1: 0x4959, 0xfa2: 0x49c1, 0xfa3: 0x4a11, + 0xfa4: 0x4a61, 0xfa5: 0x4ab1, 0xfa6: 0x4ae9, 0xfa7: 0x4b21, 0xfa8: 0x4b59, 0xfa9: 0x4b91, + 0xfaa: 0x4be1, 0xfab: 0x4c31, 0xfac: 0x4cb1, 0xfad: 0x4d01, 0xfae: 0x4d69, 0xfaf: 0x4de9, + 0xfb0: 0x4e39, 0xfb1: 0x4e71, 0xfb2: 0x4ea9, 0xfb3: 0x4f29, 0xfb4: 0x4f91, 0xfb5: 0x5011, + 0xfb6: 0x5061, 0xfb7: 0x50e1, 0xfb8: 0x5119, 0xfb9: 0x5169, 0xfba: 0x51b9, 0xfbb: 0x5209, + 0xfbc: 0x5259, 0xfbd: 0x52a9, 0xfbe: 0x5311, 0xfbf: 0x5361, + // Block 0x3f, offset 0xfc0 + 0xfc0: 0x5399, 0xfc1: 0x53e9, 0xfc2: 0x5439, 0xfc3: 0x5489, 0xfc4: 0x54f1, 0xfc5: 0x5541, + 0xfc6: 0x5591, 0xfc7: 0x55e1, 0xfc8: 0x5661, 0xfc9: 0x56c9, 0xfca: 0x5701, 0xfcb: 0x5781, + 0xfcc: 0x57b9, 0xfcd: 0x5821, 0xfce: 0x5889, 0xfcf: 0x58d9, 0xfd0: 0x5929, 0xfd1: 0x5979, + 0xfd2: 0x59e1, 0xfd3: 0x5a19, 0xfd4: 0x5a69, 0xfd5: 0x5ad1, 0xfd6: 0x5b09, 0xfd7: 0x5b89, + 0xfd8: 0x5bd9, 0xfd9: 0x5c01, 0xfda: 0x5c29, 0xfdb: 0x5c51, 0xfdc: 0x5c79, 0xfdd: 0x5ca1, + 0xfde: 0x5cc9, 0xfdf: 0x5cf1, 0xfe0: 0x5d19, 0xfe1: 0x5d41, 0xfe2: 0x5d69, 0xfe3: 0x5d99, + 0xfe4: 0x5dc9, 0xfe5: 0x5df9, 0xfe6: 0x5e29, 0xfe7: 0x5e59, 0xfe8: 0x5e89, 0xfe9: 0x5eb9, + 0xfea: 0x5ee9, 0xfeb: 0x5f19, 0xfec: 0x5f49, 0xfed: 0x5f79, 0xfee: 0x5fa9, 0xfef: 0x5fd9, + 0xff0: 0x6009, 0xff1: 0x402d, 0xff2: 0x6039, 0xff3: 0x6051, 0xff4: 0x404d, 0xff5: 0x6069, + 0xff6: 0x6081, 0xff7: 0x6099, 0xff8: 0x406d, 0xff9: 0x406d, 0xffa: 0x60b1, 0xffb: 0x60c9, + 0xffc: 0x6101, 0xffd: 0x6139, 0xffe: 0x6171, 0xfff: 0x61a9, + // Block 0x40, offset 0x1000 + 0x1000: 0x6211, 0x1001: 0x6229, 0x1002: 0x408d, 0x1003: 0x6241, 0x1004: 0x6259, 0x1005: 0x6271, + 0x1006: 0x6289, 0x1007: 0x62a1, 0x1008: 0x40ad, 0x1009: 0x62b9, 0x100a: 0x62e1, 0x100b: 0x62f9, + 0x100c: 0x40cd, 0x100d: 0x40cd, 0x100e: 0x6311, 0x100f: 0x6329, 0x1010: 0x6341, 0x1011: 0x40ed, + 0x1012: 0x410d, 0x1013: 0x412d, 0x1014: 0x414d, 0x1015: 0x416d, 0x1016: 0x6359, 0x1017: 0x6371, + 0x1018: 0x6389, 0x1019: 0x63a1, 0x101a: 0x63b9, 0x101b: 0x418d, 0x101c: 0x63d1, 0x101d: 0x63e9, + 0x101e: 0x6401, 0x101f: 0x41ad, 0x1020: 0x41cd, 0x1021: 0x6419, 0x1022: 0x41ed, 0x1023: 0x420d, + 0x1024: 0x422d, 0x1025: 0x6431, 0x1026: 0x424d, 0x1027: 0x6449, 0x1028: 0x6479, 0x1029: 0x6211, + 0x102a: 0x426d, 0x102b: 0x428d, 0x102c: 0x42ad, 0x102d: 0x42cd, 0x102e: 0x64b1, 0x102f: 0x64f1, + 0x1030: 0x6539, 0x1031: 0x6551, 0x1032: 0x42ed, 0x1033: 0x6569, 0x1034: 0x6581, 0x1035: 0x6599, + 0x1036: 0x430d, 0x1037: 0x65b1, 0x1038: 0x65c9, 0x1039: 0x65b1, 0x103a: 0x65e1, 0x103b: 0x65f9, + 0x103c: 0x432d, 0x103d: 0x6611, 0x103e: 0x6629, 0x103f: 0x6611, + // Block 0x41, offset 0x1040 + 0x1040: 0x434d, 0x1041: 0x436d, 0x1042: 0x0040, 0x1043: 0x6641, 0x1044: 0x6659, 0x1045: 0x6671, + 0x1046: 0x6689, 0x1047: 0x0040, 0x1048: 0x66c1, 0x1049: 0x66d9, 0x104a: 0x66f1, 0x104b: 0x6709, + 0x104c: 0x6721, 0x104d: 0x6739, 0x104e: 0x6401, 0x104f: 0x6751, 0x1050: 0x6769, 0x1051: 0x6781, + 0x1052: 0x438d, 0x1053: 0x6799, 0x1054: 0x6289, 0x1055: 0x43ad, 0x1056: 0x43cd, 0x1057: 0x67b1, + 0x1058: 0x0040, 0x1059: 0x43ed, 0x105a: 0x67c9, 0x105b: 0x67e1, 0x105c: 0x67f9, 0x105d: 0x6811, + 0x105e: 0x6829, 0x105f: 0x6859, 0x1060: 0x6889, 0x1061: 0x68b1, 0x1062: 0x68d9, 0x1063: 0x6901, + 0x1064: 0x6929, 0x1065: 0x6951, 0x1066: 0x6979, 0x1067: 0x69a1, 0x1068: 0x69c9, 0x1069: 0x69f1, + 0x106a: 0x6a21, 0x106b: 0x6a51, 0x106c: 0x6a81, 0x106d: 0x6ab1, 0x106e: 0x6ae1, 0x106f: 0x6b11, + 0x1070: 0x6b41, 0x1071: 0x6b71, 0x1072: 0x6ba1, 0x1073: 0x6bd1, 0x1074: 0x6c01, 0x1075: 0x6c31, + 0x1076: 0x6c61, 0x1077: 0x6c91, 0x1078: 0x6cc1, 0x1079: 0x6cf1, 0x107a: 0x6d21, 0x107b: 0x6d51, + 0x107c: 0x6d81, 0x107d: 0x6db1, 0x107e: 0x6de1, 0x107f: 0x440d, + // Block 0x42, offset 0x1080 + 0x1080: 0xe00d, 0x1081: 0x0008, 0x1082: 0xe00d, 0x1083: 0x0008, 0x1084: 0xe00d, 0x1085: 0x0008, + 0x1086: 0xe00d, 0x1087: 0x0008, 0x1088: 0xe00d, 0x1089: 0x0008, 0x108a: 0xe00d, 0x108b: 0x0008, + 0x108c: 0xe00d, 0x108d: 0x0008, 0x108e: 0xe00d, 0x108f: 0x0008, 0x1090: 0xe00d, 0x1091: 0x0008, + 0x1092: 0xe00d, 0x1093: 0x0008, 0x1094: 0xe00d, 0x1095: 0x0008, 0x1096: 0xe00d, 0x1097: 0x0008, + 0x1098: 0xe00d, 0x1099: 0x0008, 0x109a: 0xe00d, 0x109b: 0x0008, 0x109c: 0xe00d, 0x109d: 0x0008, + 0x109e: 0xe00d, 0x109f: 0x0008, 0x10a0: 0xe00d, 0x10a1: 0x0008, 0x10a2: 0xe00d, 0x10a3: 0x0008, + 0x10a4: 0xe00d, 0x10a5: 0x0008, 0x10a6: 0xe00d, 0x10a7: 0x0008, 0x10a8: 0xe00d, 0x10a9: 0x0008, + 0x10aa: 0xe00d, 0x10ab: 0x0008, 0x10ac: 0xe00d, 0x10ad: 0x0008, 0x10ae: 0x0008, 0x10af: 0x1308, + 0x10b0: 0x1318, 0x10b1: 0x1318, 0x10b2: 0x1318, 0x10b3: 0x0018, 0x10b4: 0x1308, 0x10b5: 0x1308, + 0x10b6: 0x1308, 0x10b7: 0x1308, 0x10b8: 0x1308, 0x10b9: 0x1308, 0x10ba: 0x1308, 0x10bb: 0x1308, + 0x10bc: 0x1308, 0x10bd: 0x1308, 0x10be: 0x0018, 0x10bf: 0x0008, + // Block 0x43, offset 0x10c0 + 0x10c0: 0xe00d, 0x10c1: 0x0008, 0x10c2: 0xe00d, 0x10c3: 0x0008, 0x10c4: 0xe00d, 0x10c5: 0x0008, + 0x10c6: 0xe00d, 0x10c7: 0x0008, 0x10c8: 0xe00d, 0x10c9: 0x0008, 0x10ca: 0xe00d, 0x10cb: 0x0008, + 0x10cc: 0xe00d, 0x10cd: 0x0008, 0x10ce: 0xe00d, 0x10cf: 0x0008, 0x10d0: 0xe00d, 0x10d1: 0x0008, + 0x10d2: 0xe00d, 0x10d3: 0x0008, 0x10d4: 0xe00d, 0x10d5: 0x0008, 0x10d6: 0xe00d, 0x10d7: 0x0008, + 0x10d8: 0xe00d, 0x10d9: 0x0008, 0x10da: 0xe00d, 0x10db: 0x0008, 0x10dc: 0x0ea1, 0x10dd: 0x6e11, + 0x10de: 0x1308, 0x10df: 0x1308, 0x10e0: 0x0008, 0x10e1: 0x0008, 0x10e2: 0x0008, 0x10e3: 0x0008, + 0x10e4: 0x0008, 0x10e5: 0x0008, 0x10e6: 0x0008, 0x10e7: 0x0008, 0x10e8: 0x0008, 0x10e9: 0x0008, + 0x10ea: 0x0008, 0x10eb: 0x0008, 0x10ec: 0x0008, 0x10ed: 0x0008, 0x10ee: 0x0008, 0x10ef: 0x0008, + 0x10f0: 0x0008, 0x10f1: 0x0008, 0x10f2: 0x0008, 0x10f3: 0x0008, 0x10f4: 0x0008, 0x10f5: 0x0008, + 0x10f6: 0x0008, 0x10f7: 0x0008, 0x10f8: 0x0008, 0x10f9: 0x0008, 0x10fa: 0x0008, 0x10fb: 0x0008, + 0x10fc: 0x0008, 0x10fd: 0x0008, 0x10fe: 0x0008, 0x10ff: 0x0008, + // Block 0x44, offset 0x1100 + 0x1100: 0x0018, 0x1101: 0x0018, 0x1102: 0x0018, 0x1103: 0x0018, 0x1104: 0x0018, 0x1105: 0x0018, + 0x1106: 0x0018, 0x1107: 0x0018, 0x1108: 0x0018, 0x1109: 0x0018, 0x110a: 0x0018, 0x110b: 0x0018, + 0x110c: 0x0018, 0x110d: 0x0018, 0x110e: 0x0018, 0x110f: 0x0018, 0x1110: 0x0018, 0x1111: 0x0018, + 0x1112: 0x0018, 0x1113: 0x0018, 0x1114: 0x0018, 0x1115: 0x0018, 0x1116: 0x0018, 0x1117: 0x0008, + 0x1118: 0x0008, 0x1119: 0x0008, 0x111a: 0x0008, 0x111b: 0x0008, 0x111c: 0x0008, 0x111d: 0x0008, + 0x111e: 0x0008, 0x111f: 0x0008, 0x1120: 0x0018, 0x1121: 0x0018, 0x1122: 0xe00d, 0x1123: 0x0008, + 0x1124: 0xe00d, 0x1125: 0x0008, 0x1126: 0xe00d, 0x1127: 0x0008, 0x1128: 0xe00d, 0x1129: 0x0008, + 0x112a: 0xe00d, 0x112b: 0x0008, 0x112c: 0xe00d, 0x112d: 0x0008, 0x112e: 0xe00d, 0x112f: 0x0008, + 0x1130: 0x0008, 0x1131: 0x0008, 0x1132: 0xe00d, 0x1133: 0x0008, 0x1134: 0xe00d, 0x1135: 0x0008, + 0x1136: 0xe00d, 0x1137: 0x0008, 0x1138: 0xe00d, 0x1139: 0x0008, 0x113a: 0xe00d, 0x113b: 0x0008, + 0x113c: 0xe00d, 0x113d: 0x0008, 0x113e: 0xe00d, 0x113f: 0x0008, + // Block 0x45, offset 0x1140 + 0x1140: 0xe00d, 0x1141: 0x0008, 0x1142: 0xe00d, 0x1143: 0x0008, 0x1144: 0xe00d, 0x1145: 0x0008, + 0x1146: 0xe00d, 0x1147: 0x0008, 0x1148: 0xe00d, 0x1149: 0x0008, 0x114a: 0xe00d, 0x114b: 0x0008, + 0x114c: 0xe00d, 0x114d: 0x0008, 0x114e: 0xe00d, 0x114f: 0x0008, 0x1150: 0xe00d, 0x1151: 0x0008, + 0x1152: 0xe00d, 0x1153: 0x0008, 0x1154: 0xe00d, 0x1155: 0x0008, 0x1156: 0xe00d, 0x1157: 0x0008, + 0x1158: 0xe00d, 0x1159: 0x0008, 0x115a: 0xe00d, 0x115b: 0x0008, 0x115c: 0xe00d, 0x115d: 0x0008, + 0x115e: 0xe00d, 0x115f: 0x0008, 0x1160: 0xe00d, 0x1161: 0x0008, 0x1162: 0xe00d, 0x1163: 0x0008, + 0x1164: 0xe00d, 0x1165: 0x0008, 0x1166: 0xe00d, 0x1167: 0x0008, 0x1168: 0xe00d, 0x1169: 0x0008, + 0x116a: 0xe00d, 0x116b: 0x0008, 0x116c: 0xe00d, 0x116d: 0x0008, 0x116e: 0xe00d, 0x116f: 0x0008, + 0x1170: 0xe0fd, 0x1171: 0x0008, 0x1172: 0x0008, 0x1173: 0x0008, 0x1174: 0x0008, 0x1175: 0x0008, + 0x1176: 0x0008, 0x1177: 0x0008, 0x1178: 0x0008, 0x1179: 0xe01d, 0x117a: 0x0008, 0x117b: 0xe03d, + 0x117c: 0x0008, 0x117d: 0x442d, 0x117e: 0xe00d, 0x117f: 0x0008, + // Block 0x46, offset 0x1180 + 0x1180: 0xe00d, 0x1181: 0x0008, 0x1182: 0xe00d, 0x1183: 0x0008, 0x1184: 0xe00d, 0x1185: 0x0008, + 0x1186: 0xe00d, 0x1187: 0x0008, 0x1188: 0x0008, 0x1189: 0x0018, 0x118a: 0x0018, 0x118b: 0xe03d, + 0x118c: 0x0008, 0x118d: 0x11d9, 0x118e: 0x0008, 0x118f: 0x0008, 0x1190: 0xe00d, 0x1191: 0x0008, + 0x1192: 0xe00d, 0x1193: 0x0008, 0x1194: 0x0008, 0x1195: 0x0008, 0x1196: 0xe00d, 0x1197: 0x0008, + 0x1198: 0xe00d, 0x1199: 0x0008, 0x119a: 0xe00d, 0x119b: 0x0008, 0x119c: 0xe00d, 0x119d: 0x0008, + 0x119e: 0xe00d, 0x119f: 0x0008, 0x11a0: 0xe00d, 0x11a1: 0x0008, 0x11a2: 0xe00d, 0x11a3: 0x0008, + 0x11a4: 0xe00d, 0x11a5: 0x0008, 0x11a6: 0xe00d, 0x11a7: 0x0008, 0x11a8: 0xe00d, 0x11a9: 0x0008, + 0x11aa: 0x6e29, 0x11ab: 0x1029, 0x11ac: 0x11c1, 0x11ad: 0x6e41, 0x11ae: 0x1221, 0x11af: 0x0040, + 0x11b0: 0x6e59, 0x11b1: 0x6e71, 0x11b2: 0x1239, 0x11b3: 0x444d, 0x11b4: 0xe00d, 0x11b5: 0x0008, + 0x11b6: 0xe00d, 0x11b7: 0x0008, 0x11b8: 0x0040, 0x11b9: 0x0040, 0x11ba: 0x0040, 0x11bb: 0x0040, + 0x11bc: 0x0040, 0x11bd: 0x0040, 0x11be: 0x0040, 0x11bf: 0x0040, + // Block 0x47, offset 0x11c0 + 0x11c0: 0x64d5, 0x11c1: 0x64f5, 0x11c2: 0x6515, 0x11c3: 0x6535, 0x11c4: 0x6555, 0x11c5: 0x6575, + 0x11c6: 0x6595, 0x11c7: 0x65b5, 0x11c8: 0x65d5, 0x11c9: 0x65f5, 0x11ca: 0x6615, 0x11cb: 0x6635, + 0x11cc: 0x6655, 0x11cd: 0x6675, 0x11ce: 0x0008, 0x11cf: 0x0008, 0x11d0: 0x6695, 0x11d1: 0x0008, + 0x11d2: 0x66b5, 0x11d3: 0x0008, 0x11d4: 0x0008, 0x11d5: 0x66d5, 0x11d6: 0x66f5, 0x11d7: 0x6715, + 0x11d8: 0x6735, 0x11d9: 0x6755, 0x11da: 0x6775, 0x11db: 0x6795, 0x11dc: 0x67b5, 0x11dd: 0x67d5, + 0x11de: 0x67f5, 0x11df: 0x0008, 0x11e0: 0x6815, 0x11e1: 0x0008, 0x11e2: 0x6835, 0x11e3: 0x0008, + 0x11e4: 0x0008, 0x11e5: 0x6855, 0x11e6: 0x6875, 0x11e7: 0x0008, 0x11e8: 0x0008, 0x11e9: 0x0008, + 0x11ea: 0x6895, 0x11eb: 0x68b5, 0x11ec: 0x68d5, 0x11ed: 0x68f5, 0x11ee: 0x6915, 0x11ef: 0x6935, + 0x11f0: 0x6955, 0x11f1: 0x6975, 0x11f2: 0x6995, 0x11f3: 0x69b5, 0x11f4: 0x69d5, 0x11f5: 0x69f5, + 0x11f6: 0x6a15, 0x11f7: 0x6a35, 0x11f8: 0x6a55, 0x11f9: 0x6a75, 0x11fa: 0x6a95, 0x11fb: 0x6ab5, + 0x11fc: 0x6ad5, 0x11fd: 0x6af5, 0x11fe: 0x6b15, 0x11ff: 0x6b35, + // Block 0x48, offset 0x1200 + 0x1200: 0x7a95, 0x1201: 0x7ab5, 0x1202: 0x7ad5, 0x1203: 0x7af5, 0x1204: 0x7b15, 0x1205: 0x7b35, + 0x1206: 0x7b55, 0x1207: 0x7b75, 0x1208: 0x7b95, 0x1209: 0x7bb5, 0x120a: 0x7bd5, 0x120b: 0x7bf5, + 0x120c: 0x7c15, 0x120d: 0x7c35, 0x120e: 0x7c55, 0x120f: 0x6ec9, 0x1210: 0x6ef1, 0x1211: 0x6f19, + 0x1212: 0x7c75, 0x1213: 0x7c95, 0x1214: 0x7cb5, 0x1215: 0x6f41, 0x1216: 0x6f69, 0x1217: 0x6f91, + 0x1218: 0x7cd5, 0x1219: 0x7cf5, 0x121a: 0x0040, 0x121b: 0x0040, 0x121c: 0x0040, 0x121d: 0x0040, + 0x121e: 0x0040, 0x121f: 0x0040, 0x1220: 0x0040, 0x1221: 0x0040, 0x1222: 0x0040, 0x1223: 0x0040, + 0x1224: 0x0040, 0x1225: 0x0040, 0x1226: 0x0040, 0x1227: 0x0040, 0x1228: 0x0040, 0x1229: 0x0040, + 0x122a: 0x0040, 0x122b: 0x0040, 0x122c: 0x0040, 0x122d: 0x0040, 0x122e: 0x0040, 0x122f: 0x0040, + 0x1230: 0x0040, 0x1231: 0x0040, 0x1232: 0x0040, 0x1233: 0x0040, 0x1234: 0x0040, 0x1235: 0x0040, + 0x1236: 0x0040, 0x1237: 0x0040, 0x1238: 0x0040, 0x1239: 0x0040, 0x123a: 0x0040, 0x123b: 0x0040, + 0x123c: 0x0040, 0x123d: 0x0040, 0x123e: 0x0040, 0x123f: 0x0040, + // Block 0x49, offset 0x1240 + 0x1240: 0x6fb9, 0x1241: 0x6fd1, 0x1242: 0x6fe9, 0x1243: 0x7d15, 0x1244: 0x7d35, 0x1245: 0x7001, + 0x1246: 0x7001, 0x1247: 0x0040, 0x1248: 0x0040, 0x1249: 0x0040, 0x124a: 0x0040, 0x124b: 0x0040, + 0x124c: 0x0040, 0x124d: 0x0040, 0x124e: 0x0040, 0x124f: 0x0040, 0x1250: 0x0040, 0x1251: 0x0040, + 0x1252: 0x0040, 0x1253: 0x7019, 0x1254: 0x7041, 0x1255: 0x7069, 0x1256: 0x7091, 0x1257: 0x70b9, + 0x1258: 0x0040, 0x1259: 0x0040, 0x125a: 0x0040, 0x125b: 0x0040, 0x125c: 0x0040, 0x125d: 0x70e1, + 0x125e: 0x1308, 0x125f: 0x7109, 0x1260: 0x7131, 0x1261: 0x20a9, 0x1262: 0x20f1, 0x1263: 0x7149, + 0x1264: 0x7161, 0x1265: 0x7179, 0x1266: 0x7191, 0x1267: 0x71a9, 0x1268: 0x71c1, 0x1269: 0x1fb2, + 0x126a: 0x71d9, 0x126b: 0x7201, 0x126c: 0x7229, 0x126d: 0x7261, 0x126e: 0x7299, 0x126f: 0x72c1, + 0x1270: 0x72e9, 0x1271: 0x7311, 0x1272: 0x7339, 0x1273: 0x7361, 0x1274: 0x7389, 0x1275: 0x73b1, + 0x1276: 0x73d9, 0x1277: 0x0040, 0x1278: 0x7401, 0x1279: 0x7429, 0x127a: 0x7451, 0x127b: 0x7479, + 0x127c: 0x74a1, 0x127d: 0x0040, 0x127e: 0x74c9, 0x127f: 0x0040, + // Block 0x4a, offset 0x1280 + 0x1280: 0x74f1, 0x1281: 0x7519, 0x1282: 0x0040, 0x1283: 0x7541, 0x1284: 0x7569, 0x1285: 0x0040, + 0x1286: 0x7591, 0x1287: 0x75b9, 0x1288: 0x75e1, 0x1289: 0x7609, 0x128a: 0x7631, 0x128b: 0x7659, + 0x128c: 0x7681, 0x128d: 0x76a9, 0x128e: 0x76d1, 0x128f: 0x76f9, 0x1290: 0x7721, 0x1291: 0x7721, + 0x1292: 0x7739, 0x1293: 0x7739, 0x1294: 0x7739, 0x1295: 0x7739, 0x1296: 0x7751, 0x1297: 0x7751, + 0x1298: 0x7751, 0x1299: 0x7751, 0x129a: 0x7769, 0x129b: 0x7769, 0x129c: 0x7769, 0x129d: 0x7769, + 0x129e: 0x7781, 0x129f: 0x7781, 0x12a0: 0x7781, 0x12a1: 0x7781, 0x12a2: 0x7799, 0x12a3: 0x7799, + 0x12a4: 0x7799, 0x12a5: 0x7799, 0x12a6: 0x77b1, 0x12a7: 0x77b1, 0x12a8: 0x77b1, 0x12a9: 0x77b1, + 0x12aa: 0x77c9, 0x12ab: 0x77c9, 0x12ac: 0x77c9, 0x12ad: 0x77c9, 0x12ae: 0x77e1, 0x12af: 0x77e1, + 0x12b0: 0x77e1, 0x12b1: 0x77e1, 0x12b2: 0x77f9, 0x12b3: 0x77f9, 0x12b4: 0x77f9, 0x12b5: 0x77f9, + 0x12b6: 0x7811, 0x12b7: 0x7811, 0x12b8: 0x7811, 0x12b9: 0x7811, 0x12ba: 0x7829, 0x12bb: 0x7829, + 0x12bc: 0x7829, 0x12bd: 0x7829, 0x12be: 0x7841, 0x12bf: 0x7841, + // Block 0x4b, offset 0x12c0 + 0x12c0: 0x7841, 0x12c1: 0x7841, 0x12c2: 0x7859, 0x12c3: 0x7859, 0x12c4: 0x7871, 0x12c5: 0x7871, + 0x12c6: 0x7889, 0x12c7: 0x7889, 0x12c8: 0x78a1, 0x12c9: 0x78a1, 0x12ca: 0x78b9, 0x12cb: 0x78b9, + 0x12cc: 0x78d1, 0x12cd: 0x78d1, 0x12ce: 0x78e9, 0x12cf: 0x78e9, 0x12d0: 0x78e9, 0x12d1: 0x78e9, + 0x12d2: 0x7901, 0x12d3: 0x7901, 0x12d4: 0x7901, 0x12d5: 0x7901, 0x12d6: 0x7919, 0x12d7: 0x7919, + 0x12d8: 0x7919, 0x12d9: 0x7919, 0x12da: 0x7931, 0x12db: 0x7931, 0x12dc: 0x7931, 0x12dd: 0x7931, + 0x12de: 0x7949, 0x12df: 0x7949, 0x12e0: 0x7961, 0x12e1: 0x7961, 0x12e2: 0x7961, 0x12e3: 0x7961, + 0x12e4: 0x7979, 0x12e5: 0x7979, 0x12e6: 0x7991, 0x12e7: 0x7991, 0x12e8: 0x7991, 0x12e9: 0x7991, + 0x12ea: 0x79a9, 0x12eb: 0x79a9, 0x12ec: 0x79a9, 0x12ed: 0x79a9, 0x12ee: 0x79c1, 0x12ef: 0x79c1, + 0x12f0: 0x79d9, 0x12f1: 0x79d9, 0x12f2: 0x0018, 0x12f3: 0x0018, 0x12f4: 0x0018, 0x12f5: 0x0018, + 0x12f6: 0x0018, 0x12f7: 0x0018, 0x12f8: 0x0018, 0x12f9: 0x0018, 0x12fa: 0x0018, 0x12fb: 0x0018, + 0x12fc: 0x0018, 0x12fd: 0x0018, 0x12fe: 0x0018, 0x12ff: 0x0018, + // Block 0x4c, offset 0x1300 + 0x1300: 0x0018, 0x1301: 0x0018, 0x1302: 0x0040, 0x1303: 0x0040, 0x1304: 0x0040, 0x1305: 0x0040, + 0x1306: 0x0040, 0x1307: 0x0040, 0x1308: 0x0040, 0x1309: 0x0040, 0x130a: 0x0040, 0x130b: 0x0040, + 0x130c: 0x0040, 0x130d: 0x0040, 0x130e: 0x0040, 0x130f: 0x0040, 0x1310: 0x0040, 0x1311: 0x0040, + 0x1312: 0x0040, 0x1313: 0x79f1, 0x1314: 0x79f1, 0x1315: 0x79f1, 0x1316: 0x79f1, 0x1317: 0x7a09, + 0x1318: 0x7a09, 0x1319: 0x7a21, 0x131a: 0x7a21, 0x131b: 0x7a39, 0x131c: 0x7a39, 0x131d: 0x0479, + 0x131e: 0x7a51, 0x131f: 0x7a51, 0x1320: 0x7a69, 0x1321: 0x7a69, 0x1322: 0x7a81, 0x1323: 0x7a81, + 0x1324: 0x7a99, 0x1325: 0x7a99, 0x1326: 0x7a99, 0x1327: 0x7a99, 0x1328: 0x7ab1, 0x1329: 0x7ab1, + 0x132a: 0x7ac9, 0x132b: 0x7ac9, 0x132c: 0x7af1, 0x132d: 0x7af1, 0x132e: 0x7b19, 0x132f: 0x7b19, + 0x1330: 0x7b41, 0x1331: 0x7b41, 0x1332: 0x7b69, 0x1333: 0x7b69, 0x1334: 0x7b91, 0x1335: 0x7b91, + 0x1336: 0x7bb9, 0x1337: 0x7bb9, 0x1338: 0x7bb9, 0x1339: 0x7be1, 0x133a: 0x7be1, 0x133b: 0x7be1, + 0x133c: 0x7c09, 0x133d: 0x7c09, 0x133e: 0x7c09, 0x133f: 0x7c09, + // Block 0x4d, offset 0x1340 + 0x1340: 0x85f9, 0x1341: 0x8621, 0x1342: 0x8649, 0x1343: 0x8671, 0x1344: 0x8699, 0x1345: 0x86c1, + 0x1346: 0x86e9, 0x1347: 0x8711, 0x1348: 0x8739, 0x1349: 0x8761, 0x134a: 0x8789, 0x134b: 0x87b1, + 0x134c: 0x87d9, 0x134d: 0x8801, 0x134e: 0x8829, 0x134f: 0x8851, 0x1350: 0x8879, 0x1351: 0x88a1, + 0x1352: 0x88c9, 0x1353: 0x88f1, 0x1354: 0x8919, 0x1355: 0x8941, 0x1356: 0x8969, 0x1357: 0x8991, + 0x1358: 0x89b9, 0x1359: 0x89e1, 0x135a: 0x8a09, 0x135b: 0x8a31, 0x135c: 0x8a59, 0x135d: 0x8a81, + 0x135e: 0x8aaa, 0x135f: 0x8ada, 0x1360: 0x8b0a, 0x1361: 0x8b3a, 0x1362: 0x8b6a, 0x1363: 0x8b9a, + 0x1364: 0x8bc9, 0x1365: 0x8bf1, 0x1366: 0x7c71, 0x1367: 0x8c19, 0x1368: 0x7be1, 0x1369: 0x7c99, + 0x136a: 0x8c41, 0x136b: 0x8c69, 0x136c: 0x7d39, 0x136d: 0x8c91, 0x136e: 0x7d61, 0x136f: 0x7d89, + 0x1370: 0x8cb9, 0x1371: 0x8ce1, 0x1372: 0x7e29, 0x1373: 0x8d09, 0x1374: 0x7e51, 0x1375: 0x7e79, + 0x1376: 0x8d31, 0x1377: 0x8d59, 0x1378: 0x7ec9, 0x1379: 0x8d81, 0x137a: 0x7ef1, 0x137b: 0x7f19, + 0x137c: 0x83a1, 0x137d: 0x83c9, 0x137e: 0x8441, 0x137f: 0x8469, + // Block 0x4e, offset 0x1380 + 0x1380: 0x8491, 0x1381: 0x8531, 0x1382: 0x8559, 0x1383: 0x8581, 0x1384: 0x85a9, 0x1385: 0x8649, + 0x1386: 0x8671, 0x1387: 0x8699, 0x1388: 0x8da9, 0x1389: 0x8739, 0x138a: 0x8dd1, 0x138b: 0x8df9, + 0x138c: 0x8829, 0x138d: 0x8e21, 0x138e: 0x8851, 0x138f: 0x8879, 0x1390: 0x8a81, 0x1391: 0x8e49, + 0x1392: 0x8e71, 0x1393: 0x89b9, 0x1394: 0x8e99, 0x1395: 0x89e1, 0x1396: 0x8a09, 0x1397: 0x7c21, + 0x1398: 0x7c49, 0x1399: 0x8ec1, 0x139a: 0x7c71, 0x139b: 0x8ee9, 0x139c: 0x7cc1, 0x139d: 0x7ce9, + 0x139e: 0x7d11, 0x139f: 0x7d39, 0x13a0: 0x8f11, 0x13a1: 0x7db1, 0x13a2: 0x7dd9, 0x13a3: 0x7e01, + 0x13a4: 0x7e29, 0x13a5: 0x8f39, 0x13a6: 0x7ec9, 0x13a7: 0x7f41, 0x13a8: 0x7f69, 0x13a9: 0x7f91, + 0x13aa: 0x7fb9, 0x13ab: 0x7fe1, 0x13ac: 0x8031, 0x13ad: 0x8059, 0x13ae: 0x8081, 0x13af: 0x80a9, + 0x13b0: 0x80d1, 0x13b1: 0x80f9, 0x13b2: 0x8f61, 0x13b3: 0x8121, 0x13b4: 0x8149, 0x13b5: 0x8171, + 0x13b6: 0x8199, 0x13b7: 0x81c1, 0x13b8: 0x81e9, 0x13b9: 0x8239, 0x13ba: 0x8261, 0x13bb: 0x8289, + 0x13bc: 0x82b1, 0x13bd: 0x82d9, 0x13be: 0x8301, 0x13bf: 0x8329, + // Block 0x4f, offset 0x13c0 + 0x13c0: 0x8351, 0x13c1: 0x8379, 0x13c2: 0x83f1, 0x13c3: 0x8419, 0x13c4: 0x84b9, 0x13c5: 0x84e1, + 0x13c6: 0x8509, 0x13c7: 0x8531, 0x13c8: 0x8559, 0x13c9: 0x85d1, 0x13ca: 0x85f9, 0x13cb: 0x8621, + 0x13cc: 0x8649, 0x13cd: 0x8f89, 0x13ce: 0x86c1, 0x13cf: 0x86e9, 0x13d0: 0x8711, 0x13d1: 0x8739, + 0x13d2: 0x87b1, 0x13d3: 0x87d9, 0x13d4: 0x8801, 0x13d5: 0x8829, 0x13d6: 0x8fb1, 0x13d7: 0x88a1, + 0x13d8: 0x88c9, 0x13d9: 0x8fd9, 0x13da: 0x8941, 0x13db: 0x8969, 0x13dc: 0x8991, 0x13dd: 0x89b9, + 0x13de: 0x9001, 0x13df: 0x7c71, 0x13e0: 0x8ee9, 0x13e1: 0x7d39, 0x13e2: 0x8f11, 0x13e3: 0x7e29, + 0x13e4: 0x8f39, 0x13e5: 0x7ec9, 0x13e6: 0x9029, 0x13e7: 0x80d1, 0x13e8: 0x9051, 0x13e9: 0x9079, + 0x13ea: 0x90a1, 0x13eb: 0x8531, 0x13ec: 0x8559, 0x13ed: 0x8649, 0x13ee: 0x8829, 0x13ef: 0x8fb1, + 0x13f0: 0x89b9, 0x13f1: 0x9001, 0x13f2: 0x90c9, 0x13f3: 0x9101, 0x13f4: 0x9139, 0x13f5: 0x9171, + 0x13f6: 0x9199, 0x13f7: 0x91c1, 0x13f8: 0x91e9, 0x13f9: 0x9211, 0x13fa: 0x9239, 0x13fb: 0x9261, + 0x13fc: 0x9289, 0x13fd: 0x92b1, 0x13fe: 0x92d9, 0x13ff: 0x9301, + // Block 0x50, offset 0x1400 + 0x1400: 0x9329, 0x1401: 0x9351, 0x1402: 0x9379, 0x1403: 0x93a1, 0x1404: 0x93c9, 0x1405: 0x93f1, + 0x1406: 0x9419, 0x1407: 0x9441, 0x1408: 0x9469, 0x1409: 0x9491, 0x140a: 0x94b9, 0x140b: 0x94e1, + 0x140c: 0x9079, 0x140d: 0x9509, 0x140e: 0x9531, 0x140f: 0x9559, 0x1410: 0x9581, 0x1411: 0x9171, + 0x1412: 0x9199, 0x1413: 0x91c1, 0x1414: 0x91e9, 0x1415: 0x9211, 0x1416: 0x9239, 0x1417: 0x9261, + 0x1418: 0x9289, 0x1419: 0x92b1, 0x141a: 0x92d9, 0x141b: 0x9301, 0x141c: 0x9329, 0x141d: 0x9351, + 0x141e: 0x9379, 0x141f: 0x93a1, 0x1420: 0x93c9, 0x1421: 0x93f1, 0x1422: 0x9419, 0x1423: 0x9441, + 0x1424: 0x9469, 0x1425: 0x9491, 0x1426: 0x94b9, 0x1427: 0x94e1, 0x1428: 0x9079, 0x1429: 0x9509, + 0x142a: 0x9531, 0x142b: 0x9559, 0x142c: 0x9581, 0x142d: 0x9491, 0x142e: 0x94b9, 0x142f: 0x94e1, + 0x1430: 0x9079, 0x1431: 0x9051, 0x1432: 0x90a1, 0x1433: 0x8211, 0x1434: 0x8059, 0x1435: 0x8081, + 0x1436: 0x80a9, 0x1437: 0x9491, 0x1438: 0x94b9, 0x1439: 0x94e1, 0x143a: 0x8211, 0x143b: 0x8239, + 0x143c: 0x95a9, 0x143d: 0x95a9, 0x143e: 0x0018, 0x143f: 0x0018, + // Block 0x51, offset 0x1440 + 0x1440: 0x0040, 0x1441: 0x0040, 0x1442: 0x0040, 0x1443: 0x0040, 0x1444: 0x0040, 0x1445: 0x0040, + 0x1446: 0x0040, 0x1447: 0x0040, 0x1448: 0x0040, 0x1449: 0x0040, 0x144a: 0x0040, 0x144b: 0x0040, + 0x144c: 0x0040, 0x144d: 0x0040, 0x144e: 0x0040, 0x144f: 0x0040, 0x1450: 0x95d1, 0x1451: 0x9609, + 0x1452: 0x9609, 0x1453: 0x9641, 0x1454: 0x9679, 0x1455: 0x96b1, 0x1456: 0x96e9, 0x1457: 0x9721, + 0x1458: 0x9759, 0x1459: 0x9759, 0x145a: 0x9791, 0x145b: 0x97c9, 0x145c: 0x9801, 0x145d: 0x9839, + 0x145e: 0x9871, 0x145f: 0x98a9, 0x1460: 0x98a9, 0x1461: 0x98e1, 0x1462: 0x9919, 0x1463: 0x9919, + 0x1464: 0x9951, 0x1465: 0x9951, 0x1466: 0x9989, 0x1467: 0x99c1, 0x1468: 0x99c1, 0x1469: 0x99f9, + 0x146a: 0x9a31, 0x146b: 0x9a31, 0x146c: 0x9a69, 0x146d: 0x9a69, 0x146e: 0x9aa1, 0x146f: 0x9ad9, + 0x1470: 0x9ad9, 0x1471: 0x9b11, 0x1472: 0x9b11, 0x1473: 0x9b49, 0x1474: 0x9b81, 0x1475: 0x9bb9, + 0x1476: 0x9bf1, 0x1477: 0x9bf1, 0x1478: 0x9c29, 0x1479: 0x9c61, 0x147a: 0x9c99, 0x147b: 0x9cd1, + 0x147c: 0x9d09, 0x147d: 0x9d09, 0x147e: 0x9d41, 0x147f: 0x9d79, + // Block 0x52, offset 0x1480 + 0x1480: 0xa949, 0x1481: 0xa981, 0x1482: 0xa9b9, 0x1483: 0xa8a1, 0x1484: 0x9bb9, 0x1485: 0x9989, + 0x1486: 0xa9f1, 0x1487: 0xaa29, 0x1488: 0x0040, 0x1489: 0x0040, 0x148a: 0x0040, 0x148b: 0x0040, + 0x148c: 0x0040, 0x148d: 0x0040, 0x148e: 0x0040, 0x148f: 0x0040, 0x1490: 0x0040, 0x1491: 0x0040, + 0x1492: 0x0040, 0x1493: 0x0040, 0x1494: 0x0040, 0x1495: 0x0040, 0x1496: 0x0040, 0x1497: 0x0040, + 0x1498: 0x0040, 0x1499: 0x0040, 0x149a: 0x0040, 0x149b: 0x0040, 0x149c: 0x0040, 0x149d: 0x0040, + 0x149e: 0x0040, 0x149f: 0x0040, 0x14a0: 0x0040, 0x14a1: 0x0040, 0x14a2: 0x0040, 0x14a3: 0x0040, + 0x14a4: 0x0040, 0x14a5: 0x0040, 0x14a6: 0x0040, 0x14a7: 0x0040, 0x14a8: 0x0040, 0x14a9: 0x0040, + 0x14aa: 0x0040, 0x14ab: 0x0040, 0x14ac: 0x0040, 0x14ad: 0x0040, 0x14ae: 0x0040, 0x14af: 0x0040, + 0x14b0: 0xaa61, 0x14b1: 0xaa99, 0x14b2: 0xaad1, 0x14b3: 0xab19, 0x14b4: 0xab61, 0x14b5: 0xaba9, + 0x14b6: 0xabf1, 0x14b7: 0xac39, 0x14b8: 0xac81, 0x14b9: 0xacc9, 0x14ba: 0xad02, 0x14bb: 0xae12, + 0x14bc: 0xae91, 0x14bd: 0x0018, 0x14be: 0x0040, 0x14bf: 0x0040, + // Block 0x53, offset 0x14c0 + 0x14c0: 0x13c0, 0x14c1: 0x13c0, 0x14c2: 0x13c0, 0x14c3: 0x13c0, 0x14c4: 0x13c0, 0x14c5: 0x13c0, + 0x14c6: 0x13c0, 0x14c7: 0x13c0, 0x14c8: 0x13c0, 0x14c9: 0x13c0, 0x14ca: 0x13c0, 0x14cb: 0x13c0, + 0x14cc: 0x13c0, 0x14cd: 0x13c0, 0x14ce: 0x13c0, 0x14cf: 0x13c0, 0x14d0: 0xaeda, 0x14d1: 0x7d55, + 0x14d2: 0x0040, 0x14d3: 0xaeea, 0x14d4: 0x03c2, 0x14d5: 0xaefa, 0x14d6: 0xaf0a, 0x14d7: 0x7d75, + 0x14d8: 0x7d95, 0x14d9: 0x0040, 0x14da: 0x0040, 0x14db: 0x0040, 0x14dc: 0x0040, 0x14dd: 0x0040, + 0x14de: 0x0040, 0x14df: 0x0040, 0x14e0: 0x1308, 0x14e1: 0x1308, 0x14e2: 0x1308, 0x14e3: 0x1308, + 0x14e4: 0x1308, 0x14e5: 0x1308, 0x14e6: 0x1308, 0x14e7: 0x1308, 0x14e8: 0x1308, 0x14e9: 0x1308, + 0x14ea: 0x1308, 0x14eb: 0x1308, 0x14ec: 0x1308, 0x14ed: 0x1308, 0x14ee: 0x1308, 0x14ef: 0x1308, + 0x14f0: 0x0040, 0x14f1: 0x7db5, 0x14f2: 0x7dd5, 0x14f3: 0xaf1a, 0x14f4: 0xaf1a, 0x14f5: 0x1fd2, + 0x14f6: 0x1fe2, 0x14f7: 0xaf2a, 0x14f8: 0xaf3a, 0x14f9: 0x7df5, 0x14fa: 0x7e15, 0x14fb: 0x7e35, + 0x14fc: 0x7df5, 0x14fd: 0x7e55, 0x14fe: 0x7e75, 0x14ff: 0x7e55, + // Block 0x54, offset 0x1500 + 0x1500: 0x7e95, 0x1501: 0x7eb5, 0x1502: 0x7ed5, 0x1503: 0x7eb5, 0x1504: 0x7ef5, 0x1505: 0x0018, + 0x1506: 0x0018, 0x1507: 0xaf4a, 0x1508: 0xaf5a, 0x1509: 0x7f16, 0x150a: 0x7f36, 0x150b: 0x7f56, + 0x150c: 0x7f76, 0x150d: 0xaf1a, 0x150e: 0xaf1a, 0x150f: 0xaf1a, 0x1510: 0xaeda, 0x1511: 0x7f95, + 0x1512: 0x0040, 0x1513: 0x0040, 0x1514: 0x03c2, 0x1515: 0xaeea, 0x1516: 0xaf0a, 0x1517: 0xaefa, + 0x1518: 0x7fb5, 0x1519: 0x1fd2, 0x151a: 0x1fe2, 0x151b: 0xaf2a, 0x151c: 0xaf3a, 0x151d: 0x7e95, + 0x151e: 0x7ef5, 0x151f: 0xaf6a, 0x1520: 0xaf7a, 0x1521: 0xaf8a, 0x1522: 0x1fb2, 0x1523: 0xaf99, + 0x1524: 0xafaa, 0x1525: 0xafba, 0x1526: 0x1fc2, 0x1527: 0x0040, 0x1528: 0xafca, 0x1529: 0xafda, + 0x152a: 0xafea, 0x152b: 0xaffa, 0x152c: 0x0040, 0x152d: 0x0040, 0x152e: 0x0040, 0x152f: 0x0040, + 0x1530: 0x7fd6, 0x1531: 0xb009, 0x1532: 0x7ff6, 0x1533: 0x0008, 0x1534: 0x8016, 0x1535: 0x0040, + 0x1536: 0x8036, 0x1537: 0xb031, 0x1538: 0x8056, 0x1539: 0xb059, 0x153a: 0x8076, 0x153b: 0xb081, + 0x153c: 0x8096, 0x153d: 0xb0a9, 0x153e: 0x80b6, 0x153f: 0xb0d1, + // Block 0x55, offset 0x1540 + 0x1540: 0xb0f9, 0x1541: 0xb111, 0x1542: 0xb111, 0x1543: 0xb129, 0x1544: 0xb129, 0x1545: 0xb141, + 0x1546: 0xb141, 0x1547: 0xb159, 0x1548: 0xb159, 0x1549: 0xb171, 0x154a: 0xb171, 0x154b: 0xb171, + 0x154c: 0xb171, 0x154d: 0xb189, 0x154e: 0xb189, 0x154f: 0xb1a1, 0x1550: 0xb1a1, 0x1551: 0xb1a1, + 0x1552: 0xb1a1, 0x1553: 0xb1b9, 0x1554: 0xb1b9, 0x1555: 0xb1d1, 0x1556: 0xb1d1, 0x1557: 0xb1d1, + 0x1558: 0xb1d1, 0x1559: 0xb1e9, 0x155a: 0xb1e9, 0x155b: 0xb1e9, 0x155c: 0xb1e9, 0x155d: 0xb201, + 0x155e: 0xb201, 0x155f: 0xb201, 0x1560: 0xb201, 0x1561: 0xb219, 0x1562: 0xb219, 0x1563: 0xb219, + 0x1564: 0xb219, 0x1565: 0xb231, 0x1566: 0xb231, 0x1567: 0xb231, 0x1568: 0xb231, 0x1569: 0xb249, + 0x156a: 0xb249, 0x156b: 0xb261, 0x156c: 0xb261, 0x156d: 0xb279, 0x156e: 0xb279, 0x156f: 0xb291, + 0x1570: 0xb291, 0x1571: 0xb2a9, 0x1572: 0xb2a9, 0x1573: 0xb2a9, 0x1574: 0xb2a9, 0x1575: 0xb2c1, + 0x1576: 0xb2c1, 0x1577: 0xb2c1, 0x1578: 0xb2c1, 0x1579: 0xb2d9, 0x157a: 0xb2d9, 0x157b: 0xb2d9, + 0x157c: 0xb2d9, 0x157d: 0xb2f1, 0x157e: 0xb2f1, 0x157f: 0xb2f1, + // Block 0x56, offset 0x1580 + 0x1580: 0xb2f1, 0x1581: 0xb309, 0x1582: 0xb309, 0x1583: 0xb309, 0x1584: 0xb309, 0x1585: 0xb321, + 0x1586: 0xb321, 0x1587: 0xb321, 0x1588: 0xb321, 0x1589: 0xb339, 0x158a: 0xb339, 0x158b: 0xb339, + 0x158c: 0xb339, 0x158d: 0xb351, 0x158e: 0xb351, 0x158f: 0xb351, 0x1590: 0xb351, 0x1591: 0xb369, + 0x1592: 0xb369, 0x1593: 0xb369, 0x1594: 0xb369, 0x1595: 0xb381, 0x1596: 0xb381, 0x1597: 0xb381, + 0x1598: 0xb381, 0x1599: 0xb399, 0x159a: 0xb399, 0x159b: 0xb399, 0x159c: 0xb399, 0x159d: 0xb3b1, + 0x159e: 0xb3b1, 0x159f: 0xb3b1, 0x15a0: 0xb3b1, 0x15a1: 0xb3c9, 0x15a2: 0xb3c9, 0x15a3: 0xb3c9, + 0x15a4: 0xb3c9, 0x15a5: 0xb3e1, 0x15a6: 0xb3e1, 0x15a7: 0xb3e1, 0x15a8: 0xb3e1, 0x15a9: 0xb3f9, + 0x15aa: 0xb3f9, 0x15ab: 0xb3f9, 0x15ac: 0xb3f9, 0x15ad: 0xb411, 0x15ae: 0xb411, 0x15af: 0x7ab1, + 0x15b0: 0x7ab1, 0x15b1: 0xb429, 0x15b2: 0xb429, 0x15b3: 0xb429, 0x15b4: 0xb429, 0x15b5: 0xb441, + 0x15b6: 0xb441, 0x15b7: 0xb469, 0x15b8: 0xb469, 0x15b9: 0xb491, 0x15ba: 0xb491, 0x15bb: 0xb4b9, + 0x15bc: 0xb4b9, 0x15bd: 0x0040, 0x15be: 0x0040, 0x15bf: 0x03c0, + // Block 0x57, offset 0x15c0 + 0x15c0: 0x0040, 0x15c1: 0xaefa, 0x15c2: 0xb4e2, 0x15c3: 0xaf6a, 0x15c4: 0xafda, 0x15c5: 0xafea, + 0x15c6: 0xaf7a, 0x15c7: 0xb4f2, 0x15c8: 0x1fd2, 0x15c9: 0x1fe2, 0x15ca: 0xaf8a, 0x15cb: 0x1fb2, + 0x15cc: 0xaeda, 0x15cd: 0xaf99, 0x15ce: 0x29d1, 0x15cf: 0xb502, 0x15d0: 0x1f41, 0x15d1: 0x00c9, + 0x15d2: 0x0069, 0x15d3: 0x0079, 0x15d4: 0x1f51, 0x15d5: 0x1f61, 0x15d6: 0x1f71, 0x15d7: 0x1f81, + 0x15d8: 0x1f91, 0x15d9: 0x1fa1, 0x15da: 0xaeea, 0x15db: 0x03c2, 0x15dc: 0xafaa, 0x15dd: 0x1fc2, + 0x15de: 0xafba, 0x15df: 0xaf0a, 0x15e0: 0xaffa, 0x15e1: 0x0039, 0x15e2: 0x0ee9, 0x15e3: 0x1159, + 0x15e4: 0x0ef9, 0x15e5: 0x0f09, 0x15e6: 0x1199, 0x15e7: 0x0f31, 0x15e8: 0x0249, 0x15e9: 0x0f41, + 0x15ea: 0x0259, 0x15eb: 0x0f51, 0x15ec: 0x0359, 0x15ed: 0x0f61, 0x15ee: 0x0f71, 0x15ef: 0x00d9, + 0x15f0: 0x0f99, 0x15f1: 0x2039, 0x15f2: 0x0269, 0x15f3: 0x01d9, 0x15f4: 0x0fa9, 0x15f5: 0x0fb9, + 0x15f6: 0x1089, 0x15f7: 0x0279, 0x15f8: 0x0369, 0x15f9: 0x0289, 0x15fa: 0x13d1, 0x15fb: 0xaf4a, + 0x15fc: 0xafca, 0x15fd: 0xaf5a, 0x15fe: 0xb512, 0x15ff: 0xaf1a, + // Block 0x58, offset 0x1600 + 0x1600: 0x1caa, 0x1601: 0x0039, 0x1602: 0x0ee9, 0x1603: 0x1159, 0x1604: 0x0ef9, 0x1605: 0x0f09, + 0x1606: 0x1199, 0x1607: 0x0f31, 0x1608: 0x0249, 0x1609: 0x0f41, 0x160a: 0x0259, 0x160b: 0x0f51, + 0x160c: 0x0359, 0x160d: 0x0f61, 0x160e: 0x0f71, 0x160f: 0x00d9, 0x1610: 0x0f99, 0x1611: 0x2039, + 0x1612: 0x0269, 0x1613: 0x01d9, 0x1614: 0x0fa9, 0x1615: 0x0fb9, 0x1616: 0x1089, 0x1617: 0x0279, + 0x1618: 0x0369, 0x1619: 0x0289, 0x161a: 0x13d1, 0x161b: 0xaf2a, 0x161c: 0xb522, 0x161d: 0xaf3a, + 0x161e: 0xb532, 0x161f: 0x80d5, 0x1620: 0x80f5, 0x1621: 0x29d1, 0x1622: 0x8115, 0x1623: 0x8115, + 0x1624: 0x8135, 0x1625: 0x8155, 0x1626: 0x8175, 0x1627: 0x8195, 0x1628: 0x81b5, 0x1629: 0x81d5, + 0x162a: 0x81f5, 0x162b: 0x8215, 0x162c: 0x8235, 0x162d: 0x8255, 0x162e: 0x8275, 0x162f: 0x8295, + 0x1630: 0x82b5, 0x1631: 0x82d5, 0x1632: 0x82f5, 0x1633: 0x8315, 0x1634: 0x8335, 0x1635: 0x8355, + 0x1636: 0x8375, 0x1637: 0x8395, 0x1638: 0x83b5, 0x1639: 0x83d5, 0x163a: 0x83f5, 0x163b: 0x8415, + 0x163c: 0x81b5, 0x163d: 0x8435, 0x163e: 0x8455, 0x163f: 0x8215, + // Block 0x59, offset 0x1640 + 0x1640: 0x8475, 0x1641: 0x8495, 0x1642: 0x84b5, 0x1643: 0x84d5, 0x1644: 0x84f5, 0x1645: 0x8515, + 0x1646: 0x8535, 0x1647: 0x8555, 0x1648: 0x84d5, 0x1649: 0x8575, 0x164a: 0x84d5, 0x164b: 0x8595, + 0x164c: 0x8595, 0x164d: 0x85b5, 0x164e: 0x85b5, 0x164f: 0x85d5, 0x1650: 0x8515, 0x1651: 0x85f5, + 0x1652: 0x8615, 0x1653: 0x85f5, 0x1654: 0x8635, 0x1655: 0x8615, 0x1656: 0x8655, 0x1657: 0x8655, + 0x1658: 0x8675, 0x1659: 0x8675, 0x165a: 0x8695, 0x165b: 0x8695, 0x165c: 0x8615, 0x165d: 0x8115, + 0x165e: 0x86b5, 0x165f: 0x86d5, 0x1660: 0x0040, 0x1661: 0x86f5, 0x1662: 0x8715, 0x1663: 0x8735, + 0x1664: 0x8755, 0x1665: 0x8735, 0x1666: 0x8775, 0x1667: 0x8795, 0x1668: 0x87b5, 0x1669: 0x87b5, + 0x166a: 0x87d5, 0x166b: 0x87d5, 0x166c: 0x87f5, 0x166d: 0x87f5, 0x166e: 0x87d5, 0x166f: 0x87d5, + 0x1670: 0x8815, 0x1671: 0x8835, 0x1672: 0x8855, 0x1673: 0x8875, 0x1674: 0x8895, 0x1675: 0x88b5, + 0x1676: 0x88b5, 0x1677: 0x88b5, 0x1678: 0x88d5, 0x1679: 0x88d5, 0x167a: 0x88d5, 0x167b: 0x88d5, + 0x167c: 0x87b5, 0x167d: 0x87b5, 0x167e: 0x87b5, 0x167f: 0x0040, + // Block 0x5a, offset 0x1680 + 0x1680: 0x0040, 0x1681: 0x0040, 0x1682: 0x8715, 0x1683: 0x86f5, 0x1684: 0x88f5, 0x1685: 0x86f5, + 0x1686: 0x8715, 0x1687: 0x86f5, 0x1688: 0x0040, 0x1689: 0x0040, 0x168a: 0x8915, 0x168b: 0x8715, + 0x168c: 0x8935, 0x168d: 0x88f5, 0x168e: 0x8935, 0x168f: 0x8715, 0x1690: 0x0040, 0x1691: 0x0040, + 0x1692: 0x8955, 0x1693: 0x8975, 0x1694: 0x8875, 0x1695: 0x8935, 0x1696: 0x88f5, 0x1697: 0x8935, + 0x1698: 0x0040, 0x1699: 0x0040, 0x169a: 0x8995, 0x169b: 0x89b5, 0x169c: 0x8995, 0x169d: 0x0040, + 0x169e: 0x0040, 0x169f: 0x0040, 0x16a0: 0xb541, 0x16a1: 0xb559, 0x16a2: 0xb571, 0x16a3: 0x89d6, + 0x16a4: 0xb589, 0x16a5: 0xb5a1, 0x16a6: 0x89f5, 0x16a7: 0x0040, 0x16a8: 0x8a15, 0x16a9: 0x8a35, + 0x16aa: 0x8a55, 0x16ab: 0x8a35, 0x16ac: 0x8a75, 0x16ad: 0x8a95, 0x16ae: 0x8ab5, 0x16af: 0x0040, + 0x16b0: 0x0040, 0x16b1: 0x0040, 0x16b2: 0x0040, 0x16b3: 0x0040, 0x16b4: 0x0040, 0x16b5: 0x0040, + 0x16b6: 0x0040, 0x16b7: 0x0040, 0x16b8: 0x0040, 0x16b9: 0x0340, 0x16ba: 0x0340, 0x16bb: 0x0340, + 0x16bc: 0x0040, 0x16bd: 0x0040, 0x16be: 0x0040, 0x16bf: 0x0040, + // Block 0x5b, offset 0x16c0 + 0x16c0: 0x0208, 0x16c1: 0x0208, 0x16c2: 0x0208, 0x16c3: 0x0208, 0x16c4: 0x0208, 0x16c5: 0x0408, + 0x16c6: 0x0008, 0x16c7: 0x0408, 0x16c8: 0x0018, 0x16c9: 0x0408, 0x16ca: 0x0408, 0x16cb: 0x0008, + 0x16cc: 0x0008, 0x16cd: 0x0108, 0x16ce: 0x0408, 0x16cf: 0x0408, 0x16d0: 0x0408, 0x16d1: 0x0408, + 0x16d2: 0x0408, 0x16d3: 0x0208, 0x16d4: 0x0208, 0x16d5: 0x0208, 0x16d6: 0x0208, 0x16d7: 0x0108, + 0x16d8: 0x0208, 0x16d9: 0x0208, 0x16da: 0x0208, 0x16db: 0x0208, 0x16dc: 0x0208, 0x16dd: 0x0408, + 0x16de: 0x0208, 0x16df: 0x0208, 0x16e0: 0x0208, 0x16e1: 0x0408, 0x16e2: 0x0008, 0x16e3: 0x0008, + 0x16e4: 0x0408, 0x16e5: 0x1308, 0x16e6: 0x1308, 0x16e7: 0x0040, 0x16e8: 0x0040, 0x16e9: 0x0040, + 0x16ea: 0x0040, 0x16eb: 0x0218, 0x16ec: 0x0218, 0x16ed: 0x0218, 0x16ee: 0x0218, 0x16ef: 0x0418, + 0x16f0: 0x0018, 0x16f1: 0x0018, 0x16f2: 0x0018, 0x16f3: 0x0018, 0x16f4: 0x0018, 0x16f5: 0x0018, + 0x16f6: 0x0018, 0x16f7: 0x0040, 0x16f8: 0x0040, 0x16f9: 0x0040, 0x16fa: 0x0040, 0x16fb: 0x0040, + 0x16fc: 0x0040, 0x16fd: 0x0040, 0x16fe: 0x0040, 0x16ff: 0x0040, + // Block 0x5c, offset 0x1700 + 0x1700: 0x0208, 0x1701: 0x0408, 0x1702: 0x0208, 0x1703: 0x0408, 0x1704: 0x0408, 0x1705: 0x0408, + 0x1706: 0x0208, 0x1707: 0x0208, 0x1708: 0x0208, 0x1709: 0x0408, 0x170a: 0x0208, 0x170b: 0x0208, + 0x170c: 0x0408, 0x170d: 0x0208, 0x170e: 0x0408, 0x170f: 0x0408, 0x1710: 0x0208, 0x1711: 0x0408, + 0x1712: 0x0040, 0x1713: 0x0040, 0x1714: 0x0040, 0x1715: 0x0040, 0x1716: 0x0040, 0x1717: 0x0040, + 0x1718: 0x0040, 0x1719: 0x0018, 0x171a: 0x0018, 0x171b: 0x0018, 0x171c: 0x0018, 0x171d: 0x0040, + 0x171e: 0x0040, 0x171f: 0x0040, 0x1720: 0x0040, 0x1721: 0x0040, 0x1722: 0x0040, 0x1723: 0x0040, + 0x1724: 0x0040, 0x1725: 0x0040, 0x1726: 0x0040, 0x1727: 0x0040, 0x1728: 0x0040, 0x1729: 0x0418, + 0x172a: 0x0418, 0x172b: 0x0418, 0x172c: 0x0418, 0x172d: 0x0218, 0x172e: 0x0218, 0x172f: 0x0018, + 0x1730: 0x0040, 0x1731: 0x0040, 0x1732: 0x0040, 0x1733: 0x0040, 0x1734: 0x0040, 0x1735: 0x0040, + 0x1736: 0x0040, 0x1737: 0x0040, 0x1738: 0x0040, 0x1739: 0x0040, 0x173a: 0x0040, 0x173b: 0x0040, + 0x173c: 0x0040, 0x173d: 0x0040, 0x173e: 0x0040, 0x173f: 0x0040, + // Block 0x5d, offset 0x1740 + 0x1740: 0x1308, 0x1741: 0x1308, 0x1742: 0x1008, 0x1743: 0x1008, 0x1744: 0x0040, 0x1745: 0x0008, + 0x1746: 0x0008, 0x1747: 0x0008, 0x1748: 0x0008, 0x1749: 0x0008, 0x174a: 0x0008, 0x174b: 0x0008, + 0x174c: 0x0008, 0x174d: 0x0040, 0x174e: 0x0040, 0x174f: 0x0008, 0x1750: 0x0008, 0x1751: 0x0040, + 0x1752: 0x0040, 0x1753: 0x0008, 0x1754: 0x0008, 0x1755: 0x0008, 0x1756: 0x0008, 0x1757: 0x0008, + 0x1758: 0x0008, 0x1759: 0x0008, 0x175a: 0x0008, 0x175b: 0x0008, 0x175c: 0x0008, 0x175d: 0x0008, + 0x175e: 0x0008, 0x175f: 0x0008, 0x1760: 0x0008, 0x1761: 0x0008, 0x1762: 0x0008, 0x1763: 0x0008, + 0x1764: 0x0008, 0x1765: 0x0008, 0x1766: 0x0008, 0x1767: 0x0008, 0x1768: 0x0008, 0x1769: 0x0040, + 0x176a: 0x0008, 0x176b: 0x0008, 0x176c: 0x0008, 0x176d: 0x0008, 0x176e: 0x0008, 0x176f: 0x0008, + 0x1770: 0x0008, 0x1771: 0x0040, 0x1772: 0x0008, 0x1773: 0x0008, 0x1774: 0x0040, 0x1775: 0x0008, + 0x1776: 0x0008, 0x1777: 0x0008, 0x1778: 0x0008, 0x1779: 0x0008, 0x177a: 0x0040, 0x177b: 0x0040, + 0x177c: 0x1308, 0x177d: 0x0008, 0x177e: 0x1008, 0x177f: 0x1008, + // Block 0x5e, offset 0x1780 + 0x1780: 0x1308, 0x1781: 0x1008, 0x1782: 0x1008, 0x1783: 0x1008, 0x1784: 0x1008, 0x1785: 0x0040, + 0x1786: 0x0040, 0x1787: 0x1008, 0x1788: 0x1008, 0x1789: 0x0040, 0x178a: 0x0040, 0x178b: 0x1008, + 0x178c: 0x1008, 0x178d: 0x1808, 0x178e: 0x0040, 0x178f: 0x0040, 0x1790: 0x0008, 0x1791: 0x0040, + 0x1792: 0x0040, 0x1793: 0x0040, 0x1794: 0x0040, 0x1795: 0x0040, 0x1796: 0x0040, 0x1797: 0x1008, + 0x1798: 0x0040, 0x1799: 0x0040, 0x179a: 0x0040, 0x179b: 0x0040, 0x179c: 0x0040, 0x179d: 0x0008, + 0x179e: 0x0008, 0x179f: 0x0008, 0x17a0: 0x0008, 0x17a1: 0x0008, 0x17a2: 0x1008, 0x17a3: 0x1008, + 0x17a4: 0x0040, 0x17a5: 0x0040, 0x17a6: 0x1308, 0x17a7: 0x1308, 0x17a8: 0x1308, 0x17a9: 0x1308, + 0x17aa: 0x1308, 0x17ab: 0x1308, 0x17ac: 0x1308, 0x17ad: 0x0040, 0x17ae: 0x0040, 0x17af: 0x0040, + 0x17b0: 0x1308, 0x17b1: 0x1308, 0x17b2: 0x1308, 0x17b3: 0x1308, 0x17b4: 0x1308, 0x17b5: 0x0040, + 0x17b6: 0x0040, 0x17b7: 0x0040, 0x17b8: 0x0040, 0x17b9: 0x0040, 0x17ba: 0x0040, 0x17bb: 0x0040, + 0x17bc: 0x0040, 0x17bd: 0x0040, 0x17be: 0x0040, 0x17bf: 0x0040, + // Block 0x5f, offset 0x17c0 + 0x17c0: 0x0039, 0x17c1: 0x0ee9, 0x17c2: 0x1159, 0x17c3: 0x0ef9, 0x17c4: 0x0f09, 0x17c5: 0x1199, + 0x17c6: 0x0f31, 0x17c7: 0x0249, 0x17c8: 0x0f41, 0x17c9: 0x0259, 0x17ca: 0x0f51, 0x17cb: 0x0359, + 0x17cc: 0x0f61, 0x17cd: 0x0f71, 0x17ce: 0x00d9, 0x17cf: 0x0f99, 0x17d0: 0x2039, 0x17d1: 0x0269, + 0x17d2: 0x01d9, 0x17d3: 0x0fa9, 0x17d4: 0x0fb9, 0x17d5: 0x1089, 0x17d6: 0x0279, 0x17d7: 0x0369, + 0x17d8: 0x0289, 0x17d9: 0x13d1, 0x17da: 0x0039, 0x17db: 0x0ee9, 0x17dc: 0x1159, 0x17dd: 0x0ef9, + 0x17de: 0x0f09, 0x17df: 0x1199, 0x17e0: 0x0f31, 0x17e1: 0x0249, 0x17e2: 0x0f41, 0x17e3: 0x0259, + 0x17e4: 0x0f51, 0x17e5: 0x0359, 0x17e6: 0x0f61, 0x17e7: 0x0f71, 0x17e8: 0x00d9, 0x17e9: 0x0f99, + 0x17ea: 0x2039, 0x17eb: 0x0269, 0x17ec: 0x01d9, 0x17ed: 0x0fa9, 0x17ee: 0x0fb9, 0x17ef: 0x1089, + 0x17f0: 0x0279, 0x17f1: 0x0369, 0x17f2: 0x0289, 0x17f3: 0x13d1, 0x17f4: 0x0039, 0x17f5: 0x0ee9, + 0x17f6: 0x1159, 0x17f7: 0x0ef9, 0x17f8: 0x0f09, 0x17f9: 0x1199, 0x17fa: 0x0f31, 0x17fb: 0x0249, + 0x17fc: 0x0f41, 0x17fd: 0x0259, 0x17fe: 0x0f51, 0x17ff: 0x0359, + // Block 0x60, offset 0x1800 + 0x1800: 0x0f61, 0x1801: 0x0f71, 0x1802: 0x00d9, 0x1803: 0x0f99, 0x1804: 0x2039, 0x1805: 0x0269, + 0x1806: 0x01d9, 0x1807: 0x0fa9, 0x1808: 0x0fb9, 0x1809: 0x1089, 0x180a: 0x0279, 0x180b: 0x0369, + 0x180c: 0x0289, 0x180d: 0x13d1, 0x180e: 0x0039, 0x180f: 0x0ee9, 0x1810: 0x1159, 0x1811: 0x0ef9, + 0x1812: 0x0f09, 0x1813: 0x1199, 0x1814: 0x0f31, 0x1815: 0x0040, 0x1816: 0x0f41, 0x1817: 0x0259, + 0x1818: 0x0f51, 0x1819: 0x0359, 0x181a: 0x0f61, 0x181b: 0x0f71, 0x181c: 0x00d9, 0x181d: 0x0f99, + 0x181e: 0x2039, 0x181f: 0x0269, 0x1820: 0x01d9, 0x1821: 0x0fa9, 0x1822: 0x0fb9, 0x1823: 0x1089, + 0x1824: 0x0279, 0x1825: 0x0369, 0x1826: 0x0289, 0x1827: 0x13d1, 0x1828: 0x0039, 0x1829: 0x0ee9, + 0x182a: 0x1159, 0x182b: 0x0ef9, 0x182c: 0x0f09, 0x182d: 0x1199, 0x182e: 0x0f31, 0x182f: 0x0249, + 0x1830: 0x0f41, 0x1831: 0x0259, 0x1832: 0x0f51, 0x1833: 0x0359, 0x1834: 0x0f61, 0x1835: 0x0f71, + 0x1836: 0x00d9, 0x1837: 0x0f99, 0x1838: 0x2039, 0x1839: 0x0269, 0x183a: 0x01d9, 0x183b: 0x0fa9, + 0x183c: 0x0fb9, 0x183d: 0x1089, 0x183e: 0x0279, 0x183f: 0x0369, + // Block 0x61, offset 0x1840 + 0x1840: 0x0289, 0x1841: 0x13d1, 0x1842: 0x0039, 0x1843: 0x0ee9, 0x1844: 0x1159, 0x1845: 0x0ef9, + 0x1846: 0x0f09, 0x1847: 0x1199, 0x1848: 0x0f31, 0x1849: 0x0249, 0x184a: 0x0f41, 0x184b: 0x0259, + 0x184c: 0x0f51, 0x184d: 0x0359, 0x184e: 0x0f61, 0x184f: 0x0f71, 0x1850: 0x00d9, 0x1851: 0x0f99, + 0x1852: 0x2039, 0x1853: 0x0269, 0x1854: 0x01d9, 0x1855: 0x0fa9, 0x1856: 0x0fb9, 0x1857: 0x1089, + 0x1858: 0x0279, 0x1859: 0x0369, 0x185a: 0x0289, 0x185b: 0x13d1, 0x185c: 0x0039, 0x185d: 0x0040, + 0x185e: 0x1159, 0x185f: 0x0ef9, 0x1860: 0x0040, 0x1861: 0x0040, 0x1862: 0x0f31, 0x1863: 0x0040, + 0x1864: 0x0040, 0x1865: 0x0259, 0x1866: 0x0f51, 0x1867: 0x0040, 0x1868: 0x0040, 0x1869: 0x0f71, + 0x186a: 0x00d9, 0x186b: 0x0f99, 0x186c: 0x2039, 0x186d: 0x0040, 0x186e: 0x01d9, 0x186f: 0x0fa9, + 0x1870: 0x0fb9, 0x1871: 0x1089, 0x1872: 0x0279, 0x1873: 0x0369, 0x1874: 0x0289, 0x1875: 0x13d1, + 0x1876: 0x0039, 0x1877: 0x0ee9, 0x1878: 0x1159, 0x1879: 0x0ef9, 0x187a: 0x0040, 0x187b: 0x1199, + 0x187c: 0x0040, 0x187d: 0x0249, 0x187e: 0x0f41, 0x187f: 0x0259, + // Block 0x62, offset 0x1880 + 0x1880: 0x0f51, 0x1881: 0x0359, 0x1882: 0x0f61, 0x1883: 0x0f71, 0x1884: 0x0040, 0x1885: 0x0f99, + 0x1886: 0x2039, 0x1887: 0x0269, 0x1888: 0x01d9, 0x1889: 0x0fa9, 0x188a: 0x0fb9, 0x188b: 0x1089, + 0x188c: 0x0279, 0x188d: 0x0369, 0x188e: 0x0289, 0x188f: 0x13d1, 0x1890: 0x0039, 0x1891: 0x0ee9, + 0x1892: 0x1159, 0x1893: 0x0ef9, 0x1894: 0x0f09, 0x1895: 0x1199, 0x1896: 0x0f31, 0x1897: 0x0249, + 0x1898: 0x0f41, 0x1899: 0x0259, 0x189a: 0x0f51, 0x189b: 0x0359, 0x189c: 0x0f61, 0x189d: 0x0f71, + 0x189e: 0x00d9, 0x189f: 0x0f99, 0x18a0: 0x2039, 0x18a1: 0x0269, 0x18a2: 0x01d9, 0x18a3: 0x0fa9, + 0x18a4: 0x0fb9, 0x18a5: 0x1089, 0x18a6: 0x0279, 0x18a7: 0x0369, 0x18a8: 0x0289, 0x18a9: 0x13d1, + 0x18aa: 0x0039, 0x18ab: 0x0ee9, 0x18ac: 0x1159, 0x18ad: 0x0ef9, 0x18ae: 0x0f09, 0x18af: 0x1199, + 0x18b0: 0x0f31, 0x18b1: 0x0249, 0x18b2: 0x0f41, 0x18b3: 0x0259, 0x18b4: 0x0f51, 0x18b5: 0x0359, + 0x18b6: 0x0f61, 0x18b7: 0x0f71, 0x18b8: 0x00d9, 0x18b9: 0x0f99, 0x18ba: 0x2039, 0x18bb: 0x0269, + 0x18bc: 0x01d9, 0x18bd: 0x0fa9, 0x18be: 0x0fb9, 0x18bf: 0x1089, + // Block 0x63, offset 0x18c0 + 0x18c0: 0x0279, 0x18c1: 0x0369, 0x18c2: 0x0289, 0x18c3: 0x13d1, 0x18c4: 0x0039, 0x18c5: 0x0ee9, + 0x18c6: 0x0040, 0x18c7: 0x0ef9, 0x18c8: 0x0f09, 0x18c9: 0x1199, 0x18ca: 0x0f31, 0x18cb: 0x0040, + 0x18cc: 0x0040, 0x18cd: 0x0259, 0x18ce: 0x0f51, 0x18cf: 0x0359, 0x18d0: 0x0f61, 0x18d1: 0x0f71, + 0x18d2: 0x00d9, 0x18d3: 0x0f99, 0x18d4: 0x2039, 0x18d5: 0x0040, 0x18d6: 0x01d9, 0x18d7: 0x0fa9, + 0x18d8: 0x0fb9, 0x18d9: 0x1089, 0x18da: 0x0279, 0x18db: 0x0369, 0x18dc: 0x0289, 0x18dd: 0x0040, + 0x18de: 0x0039, 0x18df: 0x0ee9, 0x18e0: 0x1159, 0x18e1: 0x0ef9, 0x18e2: 0x0f09, 0x18e3: 0x1199, + 0x18e4: 0x0f31, 0x18e5: 0x0249, 0x18e6: 0x0f41, 0x18e7: 0x0259, 0x18e8: 0x0f51, 0x18e9: 0x0359, + 0x18ea: 0x0f61, 0x18eb: 0x0f71, 0x18ec: 0x00d9, 0x18ed: 0x0f99, 0x18ee: 0x2039, 0x18ef: 0x0269, + 0x18f0: 0x01d9, 0x18f1: 0x0fa9, 0x18f2: 0x0fb9, 0x18f3: 0x1089, 0x18f4: 0x0279, 0x18f5: 0x0369, + 0x18f6: 0x0289, 0x18f7: 0x13d1, 0x18f8: 0x0039, 0x18f9: 0x0ee9, 0x18fa: 0x0040, 0x18fb: 0x0ef9, + 0x18fc: 0x0f09, 0x18fd: 0x1199, 0x18fe: 0x0f31, 0x18ff: 0x0040, + // Block 0x64, offset 0x1900 + 0x1900: 0x0f41, 0x1901: 0x0259, 0x1902: 0x0f51, 0x1903: 0x0359, 0x1904: 0x0f61, 0x1905: 0x0040, + 0x1906: 0x00d9, 0x1907: 0x0040, 0x1908: 0x0040, 0x1909: 0x0040, 0x190a: 0x01d9, 0x190b: 0x0fa9, + 0x190c: 0x0fb9, 0x190d: 0x1089, 0x190e: 0x0279, 0x190f: 0x0369, 0x1910: 0x0289, 0x1911: 0x0040, + 0x1912: 0x0039, 0x1913: 0x0ee9, 0x1914: 0x1159, 0x1915: 0x0ef9, 0x1916: 0x0f09, 0x1917: 0x1199, + 0x1918: 0x0f31, 0x1919: 0x0249, 0x191a: 0x0f41, 0x191b: 0x0259, 0x191c: 0x0f51, 0x191d: 0x0359, + 0x191e: 0x0f61, 0x191f: 0x0f71, 0x1920: 0x00d9, 0x1921: 0x0f99, 0x1922: 0x2039, 0x1923: 0x0269, + 0x1924: 0x01d9, 0x1925: 0x0fa9, 0x1926: 0x0fb9, 0x1927: 0x1089, 0x1928: 0x0279, 0x1929: 0x0369, + 0x192a: 0x0289, 0x192b: 0x13d1, 0x192c: 0x0039, 0x192d: 0x0ee9, 0x192e: 0x1159, 0x192f: 0x0ef9, + 0x1930: 0x0f09, 0x1931: 0x1199, 0x1932: 0x0f31, 0x1933: 0x0249, 0x1934: 0x0f41, 0x1935: 0x0259, + 0x1936: 0x0f51, 0x1937: 0x0359, 0x1938: 0x0f61, 0x1939: 0x0f71, 0x193a: 0x00d9, 0x193b: 0x0f99, + 0x193c: 0x2039, 0x193d: 0x0269, 0x193e: 0x01d9, 0x193f: 0x0fa9, + // Block 0x65, offset 0x1940 + 0x1940: 0x0fb9, 0x1941: 0x1089, 0x1942: 0x0279, 0x1943: 0x0369, 0x1944: 0x0289, 0x1945: 0x13d1, + 0x1946: 0x0039, 0x1947: 0x0ee9, 0x1948: 0x1159, 0x1949: 0x0ef9, 0x194a: 0x0f09, 0x194b: 0x1199, + 0x194c: 0x0f31, 0x194d: 0x0249, 0x194e: 0x0f41, 0x194f: 0x0259, 0x1950: 0x0f51, 0x1951: 0x0359, + 0x1952: 0x0f61, 0x1953: 0x0f71, 0x1954: 0x00d9, 0x1955: 0x0f99, 0x1956: 0x2039, 0x1957: 0x0269, + 0x1958: 0x01d9, 0x1959: 0x0fa9, 0x195a: 0x0fb9, 0x195b: 0x1089, 0x195c: 0x0279, 0x195d: 0x0369, + 0x195e: 0x0289, 0x195f: 0x13d1, 0x1960: 0x0039, 0x1961: 0x0ee9, 0x1962: 0x1159, 0x1963: 0x0ef9, + 0x1964: 0x0f09, 0x1965: 0x1199, 0x1966: 0x0f31, 0x1967: 0x0249, 0x1968: 0x0f41, 0x1969: 0x0259, + 0x196a: 0x0f51, 0x196b: 0x0359, 0x196c: 0x0f61, 0x196d: 0x0f71, 0x196e: 0x00d9, 0x196f: 0x0f99, + 0x1970: 0x2039, 0x1971: 0x0269, 0x1972: 0x01d9, 0x1973: 0x0fa9, 0x1974: 0x0fb9, 0x1975: 0x1089, + 0x1976: 0x0279, 0x1977: 0x0369, 0x1978: 0x0289, 0x1979: 0x13d1, 0x197a: 0x0039, 0x197b: 0x0ee9, + 0x197c: 0x1159, 0x197d: 0x0ef9, 0x197e: 0x0f09, 0x197f: 0x1199, + // Block 0x66, offset 0x1980 + 0x1980: 0x0f31, 0x1981: 0x0249, 0x1982: 0x0f41, 0x1983: 0x0259, 0x1984: 0x0f51, 0x1985: 0x0359, + 0x1986: 0x0f61, 0x1987: 0x0f71, 0x1988: 0x00d9, 0x1989: 0x0f99, 0x198a: 0x2039, 0x198b: 0x0269, + 0x198c: 0x01d9, 0x198d: 0x0fa9, 0x198e: 0x0fb9, 0x198f: 0x1089, 0x1990: 0x0279, 0x1991: 0x0369, + 0x1992: 0x0289, 0x1993: 0x13d1, 0x1994: 0x0039, 0x1995: 0x0ee9, 0x1996: 0x1159, 0x1997: 0x0ef9, + 0x1998: 0x0f09, 0x1999: 0x1199, 0x199a: 0x0f31, 0x199b: 0x0249, 0x199c: 0x0f41, 0x199d: 0x0259, + 0x199e: 0x0f51, 0x199f: 0x0359, 0x19a0: 0x0f61, 0x19a1: 0x0f71, 0x19a2: 0x00d9, 0x19a3: 0x0f99, + 0x19a4: 0x2039, 0x19a5: 0x0269, 0x19a6: 0x01d9, 0x19a7: 0x0fa9, 0x19a8: 0x0fb9, 0x19a9: 0x1089, + 0x19aa: 0x0279, 0x19ab: 0x0369, 0x19ac: 0x0289, 0x19ad: 0x13d1, 0x19ae: 0x0039, 0x19af: 0x0ee9, + 0x19b0: 0x1159, 0x19b1: 0x0ef9, 0x19b2: 0x0f09, 0x19b3: 0x1199, 0x19b4: 0x0f31, 0x19b5: 0x0249, + 0x19b6: 0x0f41, 0x19b7: 0x0259, 0x19b8: 0x0f51, 0x19b9: 0x0359, 0x19ba: 0x0f61, 0x19bb: 0x0f71, + 0x19bc: 0x00d9, 0x19bd: 0x0f99, 0x19be: 0x2039, 0x19bf: 0x0269, + // Block 0x67, offset 0x19c0 + 0x19c0: 0x01d9, 0x19c1: 0x0fa9, 0x19c2: 0x0fb9, 0x19c3: 0x1089, 0x19c4: 0x0279, 0x19c5: 0x0369, + 0x19c6: 0x0289, 0x19c7: 0x13d1, 0x19c8: 0x0039, 0x19c9: 0x0ee9, 0x19ca: 0x1159, 0x19cb: 0x0ef9, + 0x19cc: 0x0f09, 0x19cd: 0x1199, 0x19ce: 0x0f31, 0x19cf: 0x0249, 0x19d0: 0x0f41, 0x19d1: 0x0259, + 0x19d2: 0x0f51, 0x19d3: 0x0359, 0x19d4: 0x0f61, 0x19d5: 0x0f71, 0x19d6: 0x00d9, 0x19d7: 0x0f99, + 0x19d8: 0x2039, 0x19d9: 0x0269, 0x19da: 0x01d9, 0x19db: 0x0fa9, 0x19dc: 0x0fb9, 0x19dd: 0x1089, + 0x19de: 0x0279, 0x19df: 0x0369, 0x19e0: 0x0289, 0x19e1: 0x13d1, 0x19e2: 0x0039, 0x19e3: 0x0ee9, + 0x19e4: 0x1159, 0x19e5: 0x0ef9, 0x19e6: 0x0f09, 0x19e7: 0x1199, 0x19e8: 0x0f31, 0x19e9: 0x0249, + 0x19ea: 0x0f41, 0x19eb: 0x0259, 0x19ec: 0x0f51, 0x19ed: 0x0359, 0x19ee: 0x0f61, 0x19ef: 0x0f71, + 0x19f0: 0x00d9, 0x19f1: 0x0f99, 0x19f2: 0x2039, 0x19f3: 0x0269, 0x19f4: 0x01d9, 0x19f5: 0x0fa9, + 0x19f6: 0x0fb9, 0x19f7: 0x1089, 0x19f8: 0x0279, 0x19f9: 0x0369, 0x19fa: 0x0289, 0x19fb: 0x13d1, + 0x19fc: 0x0039, 0x19fd: 0x0ee9, 0x19fe: 0x1159, 0x19ff: 0x0ef9, + // Block 0x68, offset 0x1a00 + 0x1a00: 0x0f09, 0x1a01: 0x1199, 0x1a02: 0x0f31, 0x1a03: 0x0249, 0x1a04: 0x0f41, 0x1a05: 0x0259, + 0x1a06: 0x0f51, 0x1a07: 0x0359, 0x1a08: 0x0f61, 0x1a09: 0x0f71, 0x1a0a: 0x00d9, 0x1a0b: 0x0f99, + 0x1a0c: 0x2039, 0x1a0d: 0x0269, 0x1a0e: 0x01d9, 0x1a0f: 0x0fa9, 0x1a10: 0x0fb9, 0x1a11: 0x1089, + 0x1a12: 0x0279, 0x1a13: 0x0369, 0x1a14: 0x0289, 0x1a15: 0x13d1, 0x1a16: 0x0039, 0x1a17: 0x0ee9, + 0x1a18: 0x1159, 0x1a19: 0x0ef9, 0x1a1a: 0x0f09, 0x1a1b: 0x1199, 0x1a1c: 0x0f31, 0x1a1d: 0x0249, + 0x1a1e: 0x0f41, 0x1a1f: 0x0259, 0x1a20: 0x0f51, 0x1a21: 0x0359, 0x1a22: 0x0f61, 0x1a23: 0x0f71, + 0x1a24: 0x00d9, 0x1a25: 0x0f99, 0x1a26: 0x2039, 0x1a27: 0x0269, 0x1a28: 0x01d9, 0x1a29: 0x0fa9, + 0x1a2a: 0x0fb9, 0x1a2b: 0x1089, 0x1a2c: 0x0279, 0x1a2d: 0x0369, 0x1a2e: 0x0289, 0x1a2f: 0x13d1, + 0x1a30: 0x0039, 0x1a31: 0x0ee9, 0x1a32: 0x1159, 0x1a33: 0x0ef9, 0x1a34: 0x0f09, 0x1a35: 0x1199, + 0x1a36: 0x0f31, 0x1a37: 0x0249, 0x1a38: 0x0f41, 0x1a39: 0x0259, 0x1a3a: 0x0f51, 0x1a3b: 0x0359, + 0x1a3c: 0x0f61, 0x1a3d: 0x0f71, 0x1a3e: 0x00d9, 0x1a3f: 0x0f99, + // Block 0x69, offset 0x1a40 + 0x1a40: 0x2039, 0x1a41: 0x0269, 0x1a42: 0x01d9, 0x1a43: 0x0fa9, 0x1a44: 0x0fb9, 0x1a45: 0x1089, + 0x1a46: 0x0279, 0x1a47: 0x0369, 0x1a48: 0x0289, 0x1a49: 0x13d1, 0x1a4a: 0x0039, 0x1a4b: 0x0ee9, + 0x1a4c: 0x1159, 0x1a4d: 0x0ef9, 0x1a4e: 0x0f09, 0x1a4f: 0x1199, 0x1a50: 0x0f31, 0x1a51: 0x0249, + 0x1a52: 0x0f41, 0x1a53: 0x0259, 0x1a54: 0x0f51, 0x1a55: 0x0359, 0x1a56: 0x0f61, 0x1a57: 0x0f71, + 0x1a58: 0x00d9, 0x1a59: 0x0f99, 0x1a5a: 0x2039, 0x1a5b: 0x0269, 0x1a5c: 0x01d9, 0x1a5d: 0x0fa9, + 0x1a5e: 0x0fb9, 0x1a5f: 0x1089, 0x1a60: 0x0279, 0x1a61: 0x0369, 0x1a62: 0x0289, 0x1a63: 0x13d1, + 0x1a64: 0xba81, 0x1a65: 0xba99, 0x1a66: 0x0040, 0x1a67: 0x0040, 0x1a68: 0xbab1, 0x1a69: 0x1099, + 0x1a6a: 0x10b1, 0x1a6b: 0x10c9, 0x1a6c: 0xbac9, 0x1a6d: 0xbae1, 0x1a6e: 0xbaf9, 0x1a6f: 0x1429, + 0x1a70: 0x1a31, 0x1a71: 0xbb11, 0x1a72: 0xbb29, 0x1a73: 0xbb41, 0x1a74: 0xbb59, 0x1a75: 0xbb71, + 0x1a76: 0xbb89, 0x1a77: 0x2109, 0x1a78: 0x1111, 0x1a79: 0x1429, 0x1a7a: 0xbba1, 0x1a7b: 0xbbb9, + 0x1a7c: 0xbbd1, 0x1a7d: 0x10e1, 0x1a7e: 0x10f9, 0x1a7f: 0xbbe9, + // Block 0x6a, offset 0x1a80 + 0x1a80: 0x2079, 0x1a81: 0xbc01, 0x1a82: 0xbab1, 0x1a83: 0x1099, 0x1a84: 0x10b1, 0x1a85: 0x10c9, + 0x1a86: 0xbac9, 0x1a87: 0xbae1, 0x1a88: 0xbaf9, 0x1a89: 0x1429, 0x1a8a: 0x1a31, 0x1a8b: 0xbb11, + 0x1a8c: 0xbb29, 0x1a8d: 0xbb41, 0x1a8e: 0xbb59, 0x1a8f: 0xbb71, 0x1a90: 0xbb89, 0x1a91: 0x2109, + 0x1a92: 0x1111, 0x1a93: 0xbba1, 0x1a94: 0xbba1, 0x1a95: 0xbbb9, 0x1a96: 0xbbd1, 0x1a97: 0x10e1, + 0x1a98: 0x10f9, 0x1a99: 0xbbe9, 0x1a9a: 0x2079, 0x1a9b: 0xbc21, 0x1a9c: 0xbac9, 0x1a9d: 0x1429, + 0x1a9e: 0xbb11, 0x1a9f: 0x10e1, 0x1aa0: 0x1111, 0x1aa1: 0x2109, 0x1aa2: 0xbab1, 0x1aa3: 0x1099, + 0x1aa4: 0x10b1, 0x1aa5: 0x10c9, 0x1aa6: 0xbac9, 0x1aa7: 0xbae1, 0x1aa8: 0xbaf9, 0x1aa9: 0x1429, + 0x1aaa: 0x1a31, 0x1aab: 0xbb11, 0x1aac: 0xbb29, 0x1aad: 0xbb41, 0x1aae: 0xbb59, 0x1aaf: 0xbb71, + 0x1ab0: 0xbb89, 0x1ab1: 0x2109, 0x1ab2: 0x1111, 0x1ab3: 0x1429, 0x1ab4: 0xbba1, 0x1ab5: 0xbbb9, + 0x1ab6: 0xbbd1, 0x1ab7: 0x10e1, 0x1ab8: 0x10f9, 0x1ab9: 0xbbe9, 0x1aba: 0x2079, 0x1abb: 0xbc01, + 0x1abc: 0xbab1, 0x1abd: 0x1099, 0x1abe: 0x10b1, 0x1abf: 0x10c9, + // Block 0x6b, offset 0x1ac0 + 0x1ac0: 0xbac9, 0x1ac1: 0xbae1, 0x1ac2: 0xbaf9, 0x1ac3: 0x1429, 0x1ac4: 0x1a31, 0x1ac5: 0xbb11, + 0x1ac6: 0xbb29, 0x1ac7: 0xbb41, 0x1ac8: 0xbb59, 0x1ac9: 0xbb71, 0x1aca: 0xbb89, 0x1acb: 0x2109, + 0x1acc: 0x1111, 0x1acd: 0xbba1, 0x1ace: 0xbba1, 0x1acf: 0xbbb9, 0x1ad0: 0xbbd1, 0x1ad1: 0x10e1, + 0x1ad2: 0x10f9, 0x1ad3: 0xbbe9, 0x1ad4: 0x2079, 0x1ad5: 0xbc21, 0x1ad6: 0xbac9, 0x1ad7: 0x1429, + 0x1ad8: 0xbb11, 0x1ad9: 0x10e1, 0x1ada: 0x1111, 0x1adb: 0x2109, 0x1adc: 0xbab1, 0x1add: 0x1099, + 0x1ade: 0x10b1, 0x1adf: 0x10c9, 0x1ae0: 0xbac9, 0x1ae1: 0xbae1, 0x1ae2: 0xbaf9, 0x1ae3: 0x1429, + 0x1ae4: 0x1a31, 0x1ae5: 0xbb11, 0x1ae6: 0xbb29, 0x1ae7: 0xbb41, 0x1ae8: 0xbb59, 0x1ae9: 0xbb71, + 0x1aea: 0xbb89, 0x1aeb: 0x2109, 0x1aec: 0x1111, 0x1aed: 0x1429, 0x1aee: 0xbba1, 0x1aef: 0xbbb9, + 0x1af0: 0xbbd1, 0x1af1: 0x10e1, 0x1af2: 0x10f9, 0x1af3: 0xbbe9, 0x1af4: 0x2079, 0x1af5: 0xbc01, + 0x1af6: 0xbab1, 0x1af7: 0x1099, 0x1af8: 0x10b1, 0x1af9: 0x10c9, 0x1afa: 0xbac9, 0x1afb: 0xbae1, + 0x1afc: 0xbaf9, 0x1afd: 0x1429, 0x1afe: 0x1a31, 0x1aff: 0xbb11, + // Block 0x6c, offset 0x1b00 + 0x1b00: 0xbb29, 0x1b01: 0xbb41, 0x1b02: 0xbb59, 0x1b03: 0xbb71, 0x1b04: 0xbb89, 0x1b05: 0x2109, + 0x1b06: 0x1111, 0x1b07: 0xbba1, 0x1b08: 0xbba1, 0x1b09: 0xbbb9, 0x1b0a: 0xbbd1, 0x1b0b: 0x10e1, + 0x1b0c: 0x10f9, 0x1b0d: 0xbbe9, 0x1b0e: 0x2079, 0x1b0f: 0xbc21, 0x1b10: 0xbac9, 0x1b11: 0x1429, + 0x1b12: 0xbb11, 0x1b13: 0x10e1, 0x1b14: 0x1111, 0x1b15: 0x2109, 0x1b16: 0xbab1, 0x1b17: 0x1099, + 0x1b18: 0x10b1, 0x1b19: 0x10c9, 0x1b1a: 0xbac9, 0x1b1b: 0xbae1, 0x1b1c: 0xbaf9, 0x1b1d: 0x1429, + 0x1b1e: 0x1a31, 0x1b1f: 0xbb11, 0x1b20: 0xbb29, 0x1b21: 0xbb41, 0x1b22: 0xbb59, 0x1b23: 0xbb71, + 0x1b24: 0xbb89, 0x1b25: 0x2109, 0x1b26: 0x1111, 0x1b27: 0x1429, 0x1b28: 0xbba1, 0x1b29: 0xbbb9, + 0x1b2a: 0xbbd1, 0x1b2b: 0x10e1, 0x1b2c: 0x10f9, 0x1b2d: 0xbbe9, 0x1b2e: 0x2079, 0x1b2f: 0xbc01, + 0x1b30: 0xbab1, 0x1b31: 0x1099, 0x1b32: 0x10b1, 0x1b33: 0x10c9, 0x1b34: 0xbac9, 0x1b35: 0xbae1, + 0x1b36: 0xbaf9, 0x1b37: 0x1429, 0x1b38: 0x1a31, 0x1b39: 0xbb11, 0x1b3a: 0xbb29, 0x1b3b: 0xbb41, + 0x1b3c: 0xbb59, 0x1b3d: 0xbb71, 0x1b3e: 0xbb89, 0x1b3f: 0x2109, + // Block 0x6d, offset 0x1b40 + 0x1b40: 0x1111, 0x1b41: 0xbba1, 0x1b42: 0xbba1, 0x1b43: 0xbbb9, 0x1b44: 0xbbd1, 0x1b45: 0x10e1, + 0x1b46: 0x10f9, 0x1b47: 0xbbe9, 0x1b48: 0x2079, 0x1b49: 0xbc21, 0x1b4a: 0xbac9, 0x1b4b: 0x1429, + 0x1b4c: 0xbb11, 0x1b4d: 0x10e1, 0x1b4e: 0x1111, 0x1b4f: 0x2109, 0x1b50: 0xbab1, 0x1b51: 0x1099, + 0x1b52: 0x10b1, 0x1b53: 0x10c9, 0x1b54: 0xbac9, 0x1b55: 0xbae1, 0x1b56: 0xbaf9, 0x1b57: 0x1429, + 0x1b58: 0x1a31, 0x1b59: 0xbb11, 0x1b5a: 0xbb29, 0x1b5b: 0xbb41, 0x1b5c: 0xbb59, 0x1b5d: 0xbb71, + 0x1b5e: 0xbb89, 0x1b5f: 0x2109, 0x1b60: 0x1111, 0x1b61: 0x1429, 0x1b62: 0xbba1, 0x1b63: 0xbbb9, + 0x1b64: 0xbbd1, 0x1b65: 0x10e1, 0x1b66: 0x10f9, 0x1b67: 0xbbe9, 0x1b68: 0x2079, 0x1b69: 0xbc01, + 0x1b6a: 0xbab1, 0x1b6b: 0x1099, 0x1b6c: 0x10b1, 0x1b6d: 0x10c9, 0x1b6e: 0xbac9, 0x1b6f: 0xbae1, + 0x1b70: 0xbaf9, 0x1b71: 0x1429, 0x1b72: 0x1a31, 0x1b73: 0xbb11, 0x1b74: 0xbb29, 0x1b75: 0xbb41, + 0x1b76: 0xbb59, 0x1b77: 0xbb71, 0x1b78: 0xbb89, 0x1b79: 0x2109, 0x1b7a: 0x1111, 0x1b7b: 0xbba1, + 0x1b7c: 0xbba1, 0x1b7d: 0xbbb9, 0x1b7e: 0xbbd1, 0x1b7f: 0x10e1, + // Block 0x6e, offset 0x1b80 + 0x1b80: 0x10f9, 0x1b81: 0xbbe9, 0x1b82: 0x2079, 0x1b83: 0xbc21, 0x1b84: 0xbac9, 0x1b85: 0x1429, + 0x1b86: 0xbb11, 0x1b87: 0x10e1, 0x1b88: 0x1111, 0x1b89: 0x2109, 0x1b8a: 0xbc41, 0x1b8b: 0xbc41, + 0x1b8c: 0x0040, 0x1b8d: 0x0040, 0x1b8e: 0x1f41, 0x1b8f: 0x00c9, 0x1b90: 0x0069, 0x1b91: 0x0079, + 0x1b92: 0x1f51, 0x1b93: 0x1f61, 0x1b94: 0x1f71, 0x1b95: 0x1f81, 0x1b96: 0x1f91, 0x1b97: 0x1fa1, + 0x1b98: 0x1f41, 0x1b99: 0x00c9, 0x1b9a: 0x0069, 0x1b9b: 0x0079, 0x1b9c: 0x1f51, 0x1b9d: 0x1f61, + 0x1b9e: 0x1f71, 0x1b9f: 0x1f81, 0x1ba0: 0x1f91, 0x1ba1: 0x1fa1, 0x1ba2: 0x1f41, 0x1ba3: 0x00c9, + 0x1ba4: 0x0069, 0x1ba5: 0x0079, 0x1ba6: 0x1f51, 0x1ba7: 0x1f61, 0x1ba8: 0x1f71, 0x1ba9: 0x1f81, + 0x1baa: 0x1f91, 0x1bab: 0x1fa1, 0x1bac: 0x1f41, 0x1bad: 0x00c9, 0x1bae: 0x0069, 0x1baf: 0x0079, + 0x1bb0: 0x1f51, 0x1bb1: 0x1f61, 0x1bb2: 0x1f71, 0x1bb3: 0x1f81, 0x1bb4: 0x1f91, 0x1bb5: 0x1fa1, + 0x1bb6: 0x1f41, 0x1bb7: 0x00c9, 0x1bb8: 0x0069, 0x1bb9: 0x0079, 0x1bba: 0x1f51, 0x1bbb: 0x1f61, + 0x1bbc: 0x1f71, 0x1bbd: 0x1f81, 0x1bbe: 0x1f91, 0x1bbf: 0x1fa1, + // Block 0x6f, offset 0x1bc0 + 0x1bc0: 0xe115, 0x1bc1: 0xe115, 0x1bc2: 0xe135, 0x1bc3: 0xe135, 0x1bc4: 0xe115, 0x1bc5: 0xe115, + 0x1bc6: 0xe175, 0x1bc7: 0xe175, 0x1bc8: 0xe115, 0x1bc9: 0xe115, 0x1bca: 0xe135, 0x1bcb: 0xe135, + 0x1bcc: 0xe115, 0x1bcd: 0xe115, 0x1bce: 0xe1f5, 0x1bcf: 0xe1f5, 0x1bd0: 0xe115, 0x1bd1: 0xe115, + 0x1bd2: 0xe135, 0x1bd3: 0xe135, 0x1bd4: 0xe115, 0x1bd5: 0xe115, 0x1bd6: 0xe175, 0x1bd7: 0xe175, + 0x1bd8: 0xe115, 0x1bd9: 0xe115, 0x1bda: 0xe135, 0x1bdb: 0xe135, 0x1bdc: 0xe115, 0x1bdd: 0xe115, + 0x1bde: 0x8b05, 0x1bdf: 0x8b05, 0x1be0: 0x04b5, 0x1be1: 0x04b5, 0x1be2: 0x0208, 0x1be3: 0x0208, + 0x1be4: 0x0208, 0x1be5: 0x0208, 0x1be6: 0x0208, 0x1be7: 0x0208, 0x1be8: 0x0208, 0x1be9: 0x0208, + 0x1bea: 0x0208, 0x1beb: 0x0208, 0x1bec: 0x0208, 0x1bed: 0x0208, 0x1bee: 0x0208, 0x1bef: 0x0208, + 0x1bf0: 0x0208, 0x1bf1: 0x0208, 0x1bf2: 0x0208, 0x1bf3: 0x0208, 0x1bf4: 0x0208, 0x1bf5: 0x0208, + 0x1bf6: 0x0208, 0x1bf7: 0x0208, 0x1bf8: 0x0208, 0x1bf9: 0x0208, 0x1bfa: 0x0208, 0x1bfb: 0x0208, + 0x1bfc: 0x0208, 0x1bfd: 0x0208, 0x1bfe: 0x0208, 0x1bff: 0x0208, + // Block 0x70, offset 0x1c00 + 0x1c00: 0xb189, 0x1c01: 0xb1a1, 0x1c02: 0xb201, 0x1c03: 0xb249, 0x1c04: 0x0040, 0x1c05: 0xb411, + 0x1c06: 0xb291, 0x1c07: 0xb219, 0x1c08: 0xb309, 0x1c09: 0xb429, 0x1c0a: 0xb399, 0x1c0b: 0xb3b1, + 0x1c0c: 0xb3c9, 0x1c0d: 0xb3e1, 0x1c0e: 0xb2a9, 0x1c0f: 0xb339, 0x1c10: 0xb369, 0x1c11: 0xb2d9, + 0x1c12: 0xb381, 0x1c13: 0xb279, 0x1c14: 0xb2c1, 0x1c15: 0xb1d1, 0x1c16: 0xb1e9, 0x1c17: 0xb231, + 0x1c18: 0xb261, 0x1c19: 0xb2f1, 0x1c1a: 0xb321, 0x1c1b: 0xb351, 0x1c1c: 0xbc59, 0x1c1d: 0x7949, + 0x1c1e: 0xbc71, 0x1c1f: 0xbc89, 0x1c20: 0x0040, 0x1c21: 0xb1a1, 0x1c22: 0xb201, 0x1c23: 0x0040, + 0x1c24: 0xb3f9, 0x1c25: 0x0040, 0x1c26: 0x0040, 0x1c27: 0xb219, 0x1c28: 0x0040, 0x1c29: 0xb429, + 0x1c2a: 0xb399, 0x1c2b: 0xb3b1, 0x1c2c: 0xb3c9, 0x1c2d: 0xb3e1, 0x1c2e: 0xb2a9, 0x1c2f: 0xb339, + 0x1c30: 0xb369, 0x1c31: 0xb2d9, 0x1c32: 0xb381, 0x1c33: 0x0040, 0x1c34: 0xb2c1, 0x1c35: 0xb1d1, + 0x1c36: 0xb1e9, 0x1c37: 0xb231, 0x1c38: 0x0040, 0x1c39: 0xb2f1, 0x1c3a: 0x0040, 0x1c3b: 0xb351, + 0x1c3c: 0x0040, 0x1c3d: 0x0040, 0x1c3e: 0x0040, 0x1c3f: 0x0040, + // Block 0x71, offset 0x1c40 + 0x1c40: 0x0040, 0x1c41: 0x0040, 0x1c42: 0xb201, 0x1c43: 0x0040, 0x1c44: 0x0040, 0x1c45: 0x0040, + 0x1c46: 0x0040, 0x1c47: 0xb219, 0x1c48: 0x0040, 0x1c49: 0xb429, 0x1c4a: 0x0040, 0x1c4b: 0xb3b1, + 0x1c4c: 0x0040, 0x1c4d: 0xb3e1, 0x1c4e: 0xb2a9, 0x1c4f: 0xb339, 0x1c50: 0x0040, 0x1c51: 0xb2d9, + 0x1c52: 0xb381, 0x1c53: 0x0040, 0x1c54: 0xb2c1, 0x1c55: 0x0040, 0x1c56: 0x0040, 0x1c57: 0xb231, + 0x1c58: 0x0040, 0x1c59: 0xb2f1, 0x1c5a: 0x0040, 0x1c5b: 0xb351, 0x1c5c: 0x0040, 0x1c5d: 0x7949, + 0x1c5e: 0x0040, 0x1c5f: 0xbc89, 0x1c60: 0x0040, 0x1c61: 0xb1a1, 0x1c62: 0xb201, 0x1c63: 0x0040, + 0x1c64: 0xb3f9, 0x1c65: 0x0040, 0x1c66: 0x0040, 0x1c67: 0xb219, 0x1c68: 0xb309, 0x1c69: 0xb429, + 0x1c6a: 0xb399, 0x1c6b: 0x0040, 0x1c6c: 0xb3c9, 0x1c6d: 0xb3e1, 0x1c6e: 0xb2a9, 0x1c6f: 0xb339, + 0x1c70: 0xb369, 0x1c71: 0xb2d9, 0x1c72: 0xb381, 0x1c73: 0x0040, 0x1c74: 0xb2c1, 0x1c75: 0xb1d1, + 0x1c76: 0xb1e9, 0x1c77: 0xb231, 0x1c78: 0x0040, 0x1c79: 0xb2f1, 0x1c7a: 0xb321, 0x1c7b: 0xb351, + 0x1c7c: 0xbc59, 0x1c7d: 0x0040, 0x1c7e: 0xbc71, 0x1c7f: 0x0040, + // Block 0x72, offset 0x1c80 + 0x1c80: 0xb189, 0x1c81: 0xb1a1, 0x1c82: 0xb201, 0x1c83: 0xb249, 0x1c84: 0xb3f9, 0x1c85: 0xb411, + 0x1c86: 0xb291, 0x1c87: 0xb219, 0x1c88: 0xb309, 0x1c89: 0xb429, 0x1c8a: 0x0040, 0x1c8b: 0xb3b1, + 0x1c8c: 0xb3c9, 0x1c8d: 0xb3e1, 0x1c8e: 0xb2a9, 0x1c8f: 0xb339, 0x1c90: 0xb369, 0x1c91: 0xb2d9, + 0x1c92: 0xb381, 0x1c93: 0xb279, 0x1c94: 0xb2c1, 0x1c95: 0xb1d1, 0x1c96: 0xb1e9, 0x1c97: 0xb231, + 0x1c98: 0xb261, 0x1c99: 0xb2f1, 0x1c9a: 0xb321, 0x1c9b: 0xb351, 0x1c9c: 0x0040, 0x1c9d: 0x0040, + 0x1c9e: 0x0040, 0x1c9f: 0x0040, 0x1ca0: 0x0040, 0x1ca1: 0xb1a1, 0x1ca2: 0xb201, 0x1ca3: 0xb249, + 0x1ca4: 0x0040, 0x1ca5: 0xb411, 0x1ca6: 0xb291, 0x1ca7: 0xb219, 0x1ca8: 0xb309, 0x1ca9: 0xb429, + 0x1caa: 0x0040, 0x1cab: 0xb3b1, 0x1cac: 0xb3c9, 0x1cad: 0xb3e1, 0x1cae: 0xb2a9, 0x1caf: 0xb339, + 0x1cb0: 0xb369, 0x1cb1: 0xb2d9, 0x1cb2: 0xb381, 0x1cb3: 0xb279, 0x1cb4: 0xb2c1, 0x1cb5: 0xb1d1, + 0x1cb6: 0xb1e9, 0x1cb7: 0xb231, 0x1cb8: 0xb261, 0x1cb9: 0xb2f1, 0x1cba: 0xb321, 0x1cbb: 0xb351, + 0x1cbc: 0x0040, 0x1cbd: 0x0040, 0x1cbe: 0x0040, 0x1cbf: 0x0040, + // Block 0x73, offset 0x1cc0 + 0x1cc0: 0x0040, 0x1cc1: 0xbca2, 0x1cc2: 0xbcba, 0x1cc3: 0xbcd2, 0x1cc4: 0xbcea, 0x1cc5: 0xbd02, + 0x1cc6: 0xbd1a, 0x1cc7: 0xbd32, 0x1cc8: 0xbd4a, 0x1cc9: 0xbd62, 0x1cca: 0xbd7a, 0x1ccb: 0x0018, + 0x1ccc: 0x0018, 0x1ccd: 0x0040, 0x1cce: 0x0040, 0x1ccf: 0x0040, 0x1cd0: 0xbd92, 0x1cd1: 0xbdb2, + 0x1cd2: 0xbdd2, 0x1cd3: 0xbdf2, 0x1cd4: 0xbe12, 0x1cd5: 0xbe32, 0x1cd6: 0xbe52, 0x1cd7: 0xbe72, + 0x1cd8: 0xbe92, 0x1cd9: 0xbeb2, 0x1cda: 0xbed2, 0x1cdb: 0xbef2, 0x1cdc: 0xbf12, 0x1cdd: 0xbf32, + 0x1cde: 0xbf52, 0x1cdf: 0xbf72, 0x1ce0: 0xbf92, 0x1ce1: 0xbfb2, 0x1ce2: 0xbfd2, 0x1ce3: 0xbff2, + 0x1ce4: 0xc012, 0x1ce5: 0xc032, 0x1ce6: 0xc052, 0x1ce7: 0xc072, 0x1ce8: 0xc092, 0x1ce9: 0xc0b2, + 0x1cea: 0xc0d1, 0x1ceb: 0x1159, 0x1cec: 0x0269, 0x1ced: 0x6671, 0x1cee: 0xc111, 0x1cef: 0x0040, + 0x1cf0: 0x0039, 0x1cf1: 0x0ee9, 0x1cf2: 0x1159, 0x1cf3: 0x0ef9, 0x1cf4: 0x0f09, 0x1cf5: 0x1199, + 0x1cf6: 0x0f31, 0x1cf7: 0x0249, 0x1cf8: 0x0f41, 0x1cf9: 0x0259, 0x1cfa: 0x0f51, 0x1cfb: 0x0359, + 0x1cfc: 0x0f61, 0x1cfd: 0x0f71, 0x1cfe: 0x00d9, 0x1cff: 0x0f99, + // Block 0x74, offset 0x1d00 + 0x1d00: 0x2039, 0x1d01: 0x0269, 0x1d02: 0x01d9, 0x1d03: 0x0fa9, 0x1d04: 0x0fb9, 0x1d05: 0x1089, + 0x1d06: 0x0279, 0x1d07: 0x0369, 0x1d08: 0x0289, 0x1d09: 0x13d1, 0x1d0a: 0xc129, 0x1d0b: 0x65b1, + 0x1d0c: 0xc141, 0x1d0d: 0x1441, 0x1d0e: 0xc159, 0x1d0f: 0xc179, 0x1d10: 0x0018, 0x1d11: 0x0018, + 0x1d12: 0x0018, 0x1d13: 0x0018, 0x1d14: 0x0018, 0x1d15: 0x0018, 0x1d16: 0x0018, 0x1d17: 0x0018, + 0x1d18: 0x0018, 0x1d19: 0x0018, 0x1d1a: 0x0018, 0x1d1b: 0x0018, 0x1d1c: 0x0018, 0x1d1d: 0x0018, + 0x1d1e: 0x0018, 0x1d1f: 0x0018, 0x1d20: 0x0018, 0x1d21: 0x0018, 0x1d22: 0x0018, 0x1d23: 0x0018, + 0x1d24: 0x0018, 0x1d25: 0x0018, 0x1d26: 0x0018, 0x1d27: 0x0018, 0x1d28: 0x0018, 0x1d29: 0x0018, + 0x1d2a: 0xc191, 0x1d2b: 0xc1a9, 0x1d2c: 0x0040, 0x1d2d: 0x0040, 0x1d2e: 0x0040, 0x1d2f: 0x0040, + 0x1d30: 0x0018, 0x1d31: 0x0018, 0x1d32: 0x0018, 0x1d33: 0x0018, 0x1d34: 0x0018, 0x1d35: 0x0018, + 0x1d36: 0x0018, 0x1d37: 0x0018, 0x1d38: 0x0018, 0x1d39: 0x0018, 0x1d3a: 0x0018, 0x1d3b: 0x0018, + 0x1d3c: 0x0018, 0x1d3d: 0x0018, 0x1d3e: 0x0018, 0x1d3f: 0x0018, + // Block 0x75, offset 0x1d40 + 0x1d40: 0xc1d9, 0x1d41: 0xc211, 0x1d42: 0xc249, 0x1d43: 0x0040, 0x1d44: 0x0040, 0x1d45: 0x0040, + 0x1d46: 0x0040, 0x1d47: 0x0040, 0x1d48: 0x0040, 0x1d49: 0x0040, 0x1d4a: 0x0040, 0x1d4b: 0x0040, + 0x1d4c: 0x0040, 0x1d4d: 0x0040, 0x1d4e: 0x0040, 0x1d4f: 0x0040, 0x1d50: 0xc269, 0x1d51: 0xc289, + 0x1d52: 0xc2a9, 0x1d53: 0xc2c9, 0x1d54: 0xc2e9, 0x1d55: 0xc309, 0x1d56: 0xc329, 0x1d57: 0xc349, + 0x1d58: 0xc369, 0x1d59: 0xc389, 0x1d5a: 0xc3a9, 0x1d5b: 0xc3c9, 0x1d5c: 0xc3e9, 0x1d5d: 0xc409, + 0x1d5e: 0xc429, 0x1d5f: 0xc449, 0x1d60: 0xc469, 0x1d61: 0xc489, 0x1d62: 0xc4a9, 0x1d63: 0xc4c9, + 0x1d64: 0xc4e9, 0x1d65: 0xc509, 0x1d66: 0xc529, 0x1d67: 0xc549, 0x1d68: 0xc569, 0x1d69: 0xc589, + 0x1d6a: 0xc5a9, 0x1d6b: 0xc5c9, 0x1d6c: 0xc5e9, 0x1d6d: 0xc609, 0x1d6e: 0xc629, 0x1d6f: 0xc649, + 0x1d70: 0xc669, 0x1d71: 0xc689, 0x1d72: 0xc6a9, 0x1d73: 0xc6c9, 0x1d74: 0xc6e9, 0x1d75: 0xc709, + 0x1d76: 0xc729, 0x1d77: 0xc749, 0x1d78: 0xc769, 0x1d79: 0xc789, 0x1d7a: 0xc7a9, 0x1d7b: 0xc7c9, + 0x1d7c: 0x0040, 0x1d7d: 0x0040, 0x1d7e: 0x0040, 0x1d7f: 0x0040, + // Block 0x76, offset 0x1d80 + 0x1d80: 0xcaf9, 0x1d81: 0xcb19, 0x1d82: 0xcb39, 0x1d83: 0x8b1d, 0x1d84: 0xcb59, 0x1d85: 0xcb79, + 0x1d86: 0xcb99, 0x1d87: 0xcbb9, 0x1d88: 0xcbd9, 0x1d89: 0xcbf9, 0x1d8a: 0xcc19, 0x1d8b: 0xcc39, + 0x1d8c: 0xcc59, 0x1d8d: 0x8b3d, 0x1d8e: 0xcc79, 0x1d8f: 0xcc99, 0x1d90: 0xccb9, 0x1d91: 0xccd9, + 0x1d92: 0x8b5d, 0x1d93: 0xccf9, 0x1d94: 0xcd19, 0x1d95: 0xc429, 0x1d96: 0x8b7d, 0x1d97: 0xcd39, + 0x1d98: 0xcd59, 0x1d99: 0xcd79, 0x1d9a: 0xcd99, 0x1d9b: 0xcdb9, 0x1d9c: 0x8b9d, 0x1d9d: 0xcdd9, + 0x1d9e: 0xcdf9, 0x1d9f: 0xce19, 0x1da0: 0xce39, 0x1da1: 0xce59, 0x1da2: 0xc789, 0x1da3: 0xce79, + 0x1da4: 0xce99, 0x1da5: 0xceb9, 0x1da6: 0xced9, 0x1da7: 0xcef9, 0x1da8: 0xcf19, 0x1da9: 0xcf39, + 0x1daa: 0xcf59, 0x1dab: 0xcf79, 0x1dac: 0xcf99, 0x1dad: 0xcfb9, 0x1dae: 0xcfd9, 0x1daf: 0xcff9, + 0x1db0: 0xd019, 0x1db1: 0xd039, 0x1db2: 0xd039, 0x1db3: 0xd039, 0x1db4: 0x8bbd, 0x1db5: 0xd059, + 0x1db6: 0xd079, 0x1db7: 0xd099, 0x1db8: 0x8bdd, 0x1db9: 0xd0b9, 0x1dba: 0xd0d9, 0x1dbb: 0xd0f9, + 0x1dbc: 0xd119, 0x1dbd: 0xd139, 0x1dbe: 0xd159, 0x1dbf: 0xd179, + // Block 0x77, offset 0x1dc0 + 0x1dc0: 0xd199, 0x1dc1: 0xd1b9, 0x1dc2: 0xd1d9, 0x1dc3: 0xd1f9, 0x1dc4: 0xd219, 0x1dc5: 0xd239, + 0x1dc6: 0xd239, 0x1dc7: 0xd259, 0x1dc8: 0xd279, 0x1dc9: 0xd299, 0x1dca: 0xd2b9, 0x1dcb: 0xd2d9, + 0x1dcc: 0xd2f9, 0x1dcd: 0xd319, 0x1dce: 0xd339, 0x1dcf: 0xd359, 0x1dd0: 0xd379, 0x1dd1: 0xd399, + 0x1dd2: 0xd3b9, 0x1dd3: 0xd3d9, 0x1dd4: 0xd3f9, 0x1dd5: 0xd419, 0x1dd6: 0xd439, 0x1dd7: 0xd459, + 0x1dd8: 0xd479, 0x1dd9: 0x8bfd, 0x1dda: 0xd499, 0x1ddb: 0xd4b9, 0x1ddc: 0xd4d9, 0x1ddd: 0xc309, + 0x1dde: 0xd4f9, 0x1ddf: 0xd519, 0x1de0: 0x8c1d, 0x1de1: 0x8c3d, 0x1de2: 0xd539, 0x1de3: 0xd559, + 0x1de4: 0xd579, 0x1de5: 0xd599, 0x1de6: 0xd5b9, 0x1de7: 0xd5d9, 0x1de8: 0x0040, 0x1de9: 0xd5f9, + 0x1dea: 0xd619, 0x1deb: 0xd619, 0x1dec: 0x8c5d, 0x1ded: 0xd639, 0x1dee: 0xd659, 0x1def: 0xd679, + 0x1df0: 0xd699, 0x1df1: 0x8c7d, 0x1df2: 0xd6b9, 0x1df3: 0xd6d9, 0x1df4: 0x0040, 0x1df5: 0xd6f9, + 0x1df6: 0xd719, 0x1df7: 0xd739, 0x1df8: 0xd759, 0x1df9: 0xd779, 0x1dfa: 0xd799, 0x1dfb: 0x8c9d, + 0x1dfc: 0xd7b9, 0x1dfd: 0x8cbd, 0x1dfe: 0xd7d9, 0x1dff: 0xd7f9, + // Block 0x78, offset 0x1e00 + 0x1e00: 0xd819, 0x1e01: 0xd839, 0x1e02: 0xd859, 0x1e03: 0xd879, 0x1e04: 0xd899, 0x1e05: 0xd8b9, + 0x1e06: 0xd8d9, 0x1e07: 0xd8f9, 0x1e08: 0xd919, 0x1e09: 0x8cdd, 0x1e0a: 0xd939, 0x1e0b: 0xd959, + 0x1e0c: 0xd979, 0x1e0d: 0xd999, 0x1e0e: 0xd9b9, 0x1e0f: 0x8cfd, 0x1e10: 0xd9d9, 0x1e11: 0x8d1d, + 0x1e12: 0x8d3d, 0x1e13: 0xd9f9, 0x1e14: 0xda19, 0x1e15: 0xda19, 0x1e16: 0xda39, 0x1e17: 0x8d5d, + 0x1e18: 0x8d7d, 0x1e19: 0xda59, 0x1e1a: 0xda79, 0x1e1b: 0xda99, 0x1e1c: 0xdab9, 0x1e1d: 0xdad9, + 0x1e1e: 0xdaf9, 0x1e1f: 0xdb19, 0x1e20: 0xdb39, 0x1e21: 0xdb59, 0x1e22: 0xdb79, 0x1e23: 0xdb99, + 0x1e24: 0x8d9d, 0x1e25: 0xdbb9, 0x1e26: 0xdbd9, 0x1e27: 0xdbf9, 0x1e28: 0xdc19, 0x1e29: 0xdbf9, + 0x1e2a: 0xdc39, 0x1e2b: 0xdc59, 0x1e2c: 0xdc79, 0x1e2d: 0xdc99, 0x1e2e: 0xdcb9, 0x1e2f: 0xdcd9, + 0x1e30: 0xdcf9, 0x1e31: 0xdd19, 0x1e32: 0xdd39, 0x1e33: 0xdd59, 0x1e34: 0xdd79, 0x1e35: 0xdd99, + 0x1e36: 0xddb9, 0x1e37: 0xddd9, 0x1e38: 0x8dbd, 0x1e39: 0xddf9, 0x1e3a: 0xde19, 0x1e3b: 0xde39, + 0x1e3c: 0xde59, 0x1e3d: 0xde79, 0x1e3e: 0x8ddd, 0x1e3f: 0xde99, + // Block 0x79, offset 0x1e40 + 0x1e40: 0xe599, 0x1e41: 0xe5b9, 0x1e42: 0xe5d9, 0x1e43: 0xe5f9, 0x1e44: 0xe619, 0x1e45: 0xe639, + 0x1e46: 0x8efd, 0x1e47: 0xe659, 0x1e48: 0xe679, 0x1e49: 0xe699, 0x1e4a: 0xe6b9, 0x1e4b: 0xe6d9, + 0x1e4c: 0xe6f9, 0x1e4d: 0x8f1d, 0x1e4e: 0xe719, 0x1e4f: 0xe739, 0x1e50: 0x8f3d, 0x1e51: 0x8f5d, + 0x1e52: 0xe759, 0x1e53: 0xe779, 0x1e54: 0xe799, 0x1e55: 0xe7b9, 0x1e56: 0xe7d9, 0x1e57: 0xe7f9, + 0x1e58: 0xe819, 0x1e59: 0xe839, 0x1e5a: 0xe859, 0x1e5b: 0x8f7d, 0x1e5c: 0xe879, 0x1e5d: 0x8f9d, + 0x1e5e: 0xe899, 0x1e5f: 0x0040, 0x1e60: 0xe8b9, 0x1e61: 0xe8d9, 0x1e62: 0xe8f9, 0x1e63: 0x8fbd, + 0x1e64: 0xe919, 0x1e65: 0xe939, 0x1e66: 0x8fdd, 0x1e67: 0x8ffd, 0x1e68: 0xe959, 0x1e69: 0xe979, + 0x1e6a: 0xe999, 0x1e6b: 0xe9b9, 0x1e6c: 0xe9d9, 0x1e6d: 0xe9d9, 0x1e6e: 0xe9f9, 0x1e6f: 0xea19, + 0x1e70: 0xea39, 0x1e71: 0xea59, 0x1e72: 0xea79, 0x1e73: 0xea99, 0x1e74: 0xeab9, 0x1e75: 0x901d, + 0x1e76: 0xead9, 0x1e77: 0x903d, 0x1e78: 0xeaf9, 0x1e79: 0x905d, 0x1e7a: 0xeb19, 0x1e7b: 0x907d, + 0x1e7c: 0x909d, 0x1e7d: 0x90bd, 0x1e7e: 0xeb39, 0x1e7f: 0xeb59, + // Block 0x7a, offset 0x1e80 + 0x1e80: 0xeb79, 0x1e81: 0x90dd, 0x1e82: 0x90fd, 0x1e83: 0x911d, 0x1e84: 0x913d, 0x1e85: 0xeb99, + 0x1e86: 0xebb9, 0x1e87: 0xebb9, 0x1e88: 0xebd9, 0x1e89: 0xebf9, 0x1e8a: 0xec19, 0x1e8b: 0xec39, + 0x1e8c: 0xec59, 0x1e8d: 0x915d, 0x1e8e: 0xec79, 0x1e8f: 0xec99, 0x1e90: 0xecb9, 0x1e91: 0xecd9, + 0x1e92: 0x917d, 0x1e93: 0xecf9, 0x1e94: 0x919d, 0x1e95: 0x91bd, 0x1e96: 0xed19, 0x1e97: 0xed39, + 0x1e98: 0xed59, 0x1e99: 0xed79, 0x1e9a: 0xed99, 0x1e9b: 0xedb9, 0x1e9c: 0x91dd, 0x1e9d: 0x91fd, + 0x1e9e: 0x921d, 0x1e9f: 0x0040, 0x1ea0: 0xedd9, 0x1ea1: 0x923d, 0x1ea2: 0xedf9, 0x1ea3: 0xee19, + 0x1ea4: 0xee39, 0x1ea5: 0x925d, 0x1ea6: 0xee59, 0x1ea7: 0xee79, 0x1ea8: 0xee99, 0x1ea9: 0xeeb9, + 0x1eaa: 0xeed9, 0x1eab: 0x927d, 0x1eac: 0xeef9, 0x1ead: 0xef19, 0x1eae: 0xef39, 0x1eaf: 0xef59, + 0x1eb0: 0xef79, 0x1eb1: 0xef99, 0x1eb2: 0x929d, 0x1eb3: 0x92bd, 0x1eb4: 0xefb9, 0x1eb5: 0x92dd, + 0x1eb6: 0xefd9, 0x1eb7: 0x92fd, 0x1eb8: 0xeff9, 0x1eb9: 0xf019, 0x1eba: 0xf039, 0x1ebb: 0x931d, + 0x1ebc: 0x933d, 0x1ebd: 0xf059, 0x1ebe: 0x935d, 0x1ebf: 0xf079, + // Block 0x7b, offset 0x1ec0 + 0x1ec0: 0xf6b9, 0x1ec1: 0xf6d9, 0x1ec2: 0xf6f9, 0x1ec3: 0xf719, 0x1ec4: 0xf739, 0x1ec5: 0x951d, + 0x1ec6: 0xf759, 0x1ec7: 0xf779, 0x1ec8: 0xf799, 0x1ec9: 0xf7b9, 0x1eca: 0xf7d9, 0x1ecb: 0x953d, + 0x1ecc: 0x955d, 0x1ecd: 0xf7f9, 0x1ece: 0xf819, 0x1ecf: 0xf839, 0x1ed0: 0xf859, 0x1ed1: 0xf879, + 0x1ed2: 0xf899, 0x1ed3: 0x957d, 0x1ed4: 0xf8b9, 0x1ed5: 0xf8d9, 0x1ed6: 0xf8f9, 0x1ed7: 0xf919, + 0x1ed8: 0x959d, 0x1ed9: 0x95bd, 0x1eda: 0xf939, 0x1edb: 0xf959, 0x1edc: 0xf979, 0x1edd: 0x95dd, + 0x1ede: 0xf999, 0x1edf: 0xf9b9, 0x1ee0: 0x6815, 0x1ee1: 0x95fd, 0x1ee2: 0xf9d9, 0x1ee3: 0xf9f9, + 0x1ee4: 0xfa19, 0x1ee5: 0x961d, 0x1ee6: 0xfa39, 0x1ee7: 0xfa59, 0x1ee8: 0xfa79, 0x1ee9: 0xfa99, + 0x1eea: 0xfab9, 0x1eeb: 0xfad9, 0x1eec: 0xfaf9, 0x1eed: 0x963d, 0x1eee: 0xfb19, 0x1eef: 0xfb39, + 0x1ef0: 0xfb59, 0x1ef1: 0x965d, 0x1ef2: 0xfb79, 0x1ef3: 0xfb99, 0x1ef4: 0xfbb9, 0x1ef5: 0xfbd9, + 0x1ef6: 0x7b35, 0x1ef7: 0x967d, 0x1ef8: 0xfbf9, 0x1ef9: 0xfc19, 0x1efa: 0xfc39, 0x1efb: 0x969d, + 0x1efc: 0xfc59, 0x1efd: 0x96bd, 0x1efe: 0xfc79, 0x1eff: 0xfc79, + // Block 0x7c, offset 0x1f00 + 0x1f00: 0xfc99, 0x1f01: 0x96dd, 0x1f02: 0xfcb9, 0x1f03: 0xfcd9, 0x1f04: 0xfcf9, 0x1f05: 0xfd19, + 0x1f06: 0xfd39, 0x1f07: 0xfd59, 0x1f08: 0xfd79, 0x1f09: 0x96fd, 0x1f0a: 0xfd99, 0x1f0b: 0xfdb9, + 0x1f0c: 0xfdd9, 0x1f0d: 0xfdf9, 0x1f0e: 0xfe19, 0x1f0f: 0xfe39, 0x1f10: 0x971d, 0x1f11: 0xfe59, + 0x1f12: 0x973d, 0x1f13: 0x975d, 0x1f14: 0x977d, 0x1f15: 0xfe79, 0x1f16: 0xfe99, 0x1f17: 0xfeb9, + 0x1f18: 0xfed9, 0x1f19: 0xfef9, 0x1f1a: 0xff19, 0x1f1b: 0xff39, 0x1f1c: 0xff59, 0x1f1d: 0x979d, + 0x1f1e: 0x0040, 0x1f1f: 0x0040, 0x1f20: 0x0040, 0x1f21: 0x0040, 0x1f22: 0x0040, 0x1f23: 0x0040, + 0x1f24: 0x0040, 0x1f25: 0x0040, 0x1f26: 0x0040, 0x1f27: 0x0040, 0x1f28: 0x0040, 0x1f29: 0x0040, + 0x1f2a: 0x0040, 0x1f2b: 0x0040, 0x1f2c: 0x0040, 0x1f2d: 0x0040, 0x1f2e: 0x0040, 0x1f2f: 0x0040, + 0x1f30: 0x0040, 0x1f31: 0x0040, 0x1f32: 0x0040, 0x1f33: 0x0040, 0x1f34: 0x0040, 0x1f35: 0x0040, + 0x1f36: 0x0040, 0x1f37: 0x0040, 0x1f38: 0x0040, 0x1f39: 0x0040, 0x1f3a: 0x0040, 0x1f3b: 0x0040, + 0x1f3c: 0x0040, 0x1f3d: 0x0040, 0x1f3e: 0x0040, 0x1f3f: 0x0040, +} + +// idnaIndex: 35 blocks, 2240 entries, 4480 bytes +// Block 0 is the zero block. +var idnaIndex = [2240]uint16{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x01, 0xc3: 0x7b, 0xc4: 0x02, 0xc5: 0x03, 0xc6: 0x04, 0xc7: 0x05, + 0xc8: 0x06, 0xc9: 0x7c, 0xca: 0x7d, 0xcb: 0x07, 0xcc: 0x7e, 0xcd: 0x08, 0xce: 0x09, 0xcf: 0x0a, + 0xd0: 0x7f, 0xd1: 0x0b, 0xd2: 0x0c, 0xd3: 0x0d, 0xd4: 0x0e, 0xd5: 0x80, 0xd6: 0x81, 0xd7: 0x82, + 0xd8: 0x0f, 0xd9: 0x83, 0xda: 0x84, 0xdb: 0x10, 0xdc: 0x11, 0xdd: 0x85, 0xde: 0x86, 0xdf: 0x87, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, 0xe4: 0x06, 0xe5: 0x07, 0xe6: 0x07, 0xe7: 0x07, + 0xe8: 0x07, 0xe9: 0x08, 0xea: 0x09, 0xeb: 0x07, 0xec: 0x07, 0xed: 0x0a, 0xee: 0x0b, 0xef: 0x0c, + 0xf0: 0x1c, 0xf1: 0x1d, 0xf2: 0x1d, 0xf3: 0x1f, 0xf4: 0x20, + // Block 0x4, offset 0x100 + 0x120: 0x88, 0x121: 0x89, 0x122: 0x8a, 0x123: 0x8b, 0x124: 0x8c, 0x125: 0x12, 0x126: 0x13, 0x127: 0x14, + 0x128: 0x15, 0x129: 0x16, 0x12a: 0x17, 0x12b: 0x18, 0x12c: 0x19, 0x12d: 0x1a, 0x12e: 0x1b, 0x12f: 0x8d, + 0x130: 0x8e, 0x131: 0x1c, 0x132: 0x1d, 0x133: 0x1e, 0x134: 0x8f, 0x135: 0x1f, 0x136: 0x90, 0x137: 0x91, + 0x138: 0x92, 0x139: 0x93, 0x13a: 0x20, 0x13b: 0x94, 0x13c: 0x95, 0x13d: 0x21, 0x13e: 0x22, 0x13f: 0x96, + // Block 0x5, offset 0x140 + 0x140: 0x97, 0x141: 0x98, 0x142: 0x99, 0x143: 0x9a, 0x144: 0x9b, 0x145: 0x9c, 0x146: 0x9b, 0x147: 0x9b, + 0x148: 0x9d, 0x149: 0x9e, 0x14a: 0x9f, 0x14b: 0xa0, 0x14c: 0xa1, 0x14d: 0xa2, 0x14e: 0xa3, 0x14f: 0xa4, + 0x150: 0xa5, 0x151: 0x9d, 0x152: 0x9d, 0x153: 0x9d, 0x154: 0x9d, 0x155: 0x9d, 0x156: 0x9d, 0x157: 0x9d, + 0x158: 0x9d, 0x159: 0xa6, 0x15a: 0xa7, 0x15b: 0xa8, 0x15c: 0xa9, 0x15d: 0xaa, 0x15e: 0xab, 0x15f: 0xac, + 0x160: 0xad, 0x161: 0xae, 0x162: 0xaf, 0x163: 0xb0, 0x164: 0xb1, 0x165: 0xb2, 0x166: 0xb3, 0x167: 0xb4, + 0x168: 0xb5, 0x169: 0xb6, 0x16a: 0xb7, 0x16b: 0xb8, 0x16c: 0xb9, 0x16d: 0xba, 0x16e: 0xbb, 0x16f: 0xbc, + 0x170: 0xbd, 0x171: 0xbe, 0x172: 0xbf, 0x173: 0xc0, 0x174: 0x23, 0x175: 0x24, 0x176: 0x25, 0x177: 0xc1, + 0x178: 0x26, 0x179: 0x26, 0x17a: 0x27, 0x17b: 0x26, 0x17c: 0xc2, 0x17d: 0x28, 0x17e: 0x29, 0x17f: 0x2a, + // Block 0x6, offset 0x180 + 0x180: 0x2b, 0x181: 0x2c, 0x182: 0x2d, 0x183: 0xc3, 0x184: 0x2e, 0x185: 0x2f, 0x186: 0xc4, 0x187: 0x9b, + 0x188: 0xc5, 0x189: 0xc6, 0x18a: 0x9b, 0x18b: 0x9b, 0x18c: 0xc7, 0x18d: 0x9b, 0x18e: 0x9b, 0x18f: 0xc8, + 0x190: 0xc9, 0x191: 0x30, 0x192: 0x31, 0x193: 0x32, 0x194: 0x9b, 0x195: 0x9b, 0x196: 0x9b, 0x197: 0x9b, + 0x198: 0x9b, 0x199: 0x9b, 0x19a: 0x9b, 0x19b: 0x9b, 0x19c: 0x9b, 0x19d: 0x9b, 0x19e: 0x9b, 0x19f: 0x9b, + 0x1a0: 0x9b, 0x1a1: 0x9b, 0x1a2: 0x9b, 0x1a3: 0x9b, 0x1a4: 0x9b, 0x1a5: 0x9b, 0x1a6: 0x9b, 0x1a7: 0x9b, + 0x1a8: 0xca, 0x1a9: 0xcb, 0x1aa: 0x9b, 0x1ab: 0xcc, 0x1ac: 0x9b, 0x1ad: 0xcd, 0x1ae: 0xce, 0x1af: 0xcf, + 0x1b0: 0xd0, 0x1b1: 0x33, 0x1b2: 0x26, 0x1b3: 0x34, 0x1b4: 0xd1, 0x1b5: 0xd2, 0x1b6: 0xd3, 0x1b7: 0xd4, + 0x1b8: 0xd5, 0x1b9: 0xd6, 0x1ba: 0xd7, 0x1bb: 0xd8, 0x1bc: 0xd9, 0x1bd: 0xda, 0x1be: 0xdb, 0x1bf: 0x35, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x36, 0x1c1: 0xdc, 0x1c2: 0xdd, 0x1c3: 0xde, 0x1c4: 0xdf, 0x1c5: 0x37, 0x1c6: 0x38, 0x1c7: 0xe0, + 0x1c8: 0xe1, 0x1c9: 0x39, 0x1ca: 0x3a, 0x1cb: 0x3b, 0x1cc: 0x3c, 0x1cd: 0x3d, 0x1ce: 0x3e, 0x1cf: 0x3f, + 0x1d0: 0x9d, 0x1d1: 0x9d, 0x1d2: 0x9d, 0x1d3: 0x9d, 0x1d4: 0x9d, 0x1d5: 0x9d, 0x1d6: 0x9d, 0x1d7: 0x9d, + 0x1d8: 0x9d, 0x1d9: 0x9d, 0x1da: 0x9d, 0x1db: 0x9d, 0x1dc: 0x9d, 0x1dd: 0x9d, 0x1de: 0x9d, 0x1df: 0x9d, + 0x1e0: 0x9d, 0x1e1: 0x9d, 0x1e2: 0x9d, 0x1e3: 0x9d, 0x1e4: 0x9d, 0x1e5: 0x9d, 0x1e6: 0x9d, 0x1e7: 0x9d, + 0x1e8: 0x9d, 0x1e9: 0x9d, 0x1ea: 0x9d, 0x1eb: 0x9d, 0x1ec: 0x9d, 0x1ed: 0x9d, 0x1ee: 0x9d, 0x1ef: 0x9d, + 0x1f0: 0x9d, 0x1f1: 0x9d, 0x1f2: 0x9d, 0x1f3: 0x9d, 0x1f4: 0x9d, 0x1f5: 0x9d, 0x1f6: 0x9d, 0x1f7: 0x9d, + 0x1f8: 0x9d, 0x1f9: 0x9d, 0x1fa: 0x9d, 0x1fb: 0x9d, 0x1fc: 0x9d, 0x1fd: 0x9d, 0x1fe: 0x9d, 0x1ff: 0x9d, + // Block 0x8, offset 0x200 + 0x200: 0x9d, 0x201: 0x9d, 0x202: 0x9d, 0x203: 0x9d, 0x204: 0x9d, 0x205: 0x9d, 0x206: 0x9d, 0x207: 0x9d, + 0x208: 0x9d, 0x209: 0x9d, 0x20a: 0x9d, 0x20b: 0x9d, 0x20c: 0x9d, 0x20d: 0x9d, 0x20e: 0x9d, 0x20f: 0x9d, + 0x210: 0x9d, 0x211: 0x9d, 0x212: 0x9d, 0x213: 0x9d, 0x214: 0x9d, 0x215: 0x9d, 0x216: 0x9d, 0x217: 0x9d, + 0x218: 0x9d, 0x219: 0x9d, 0x21a: 0x9d, 0x21b: 0x9d, 0x21c: 0x9d, 0x21d: 0x9d, 0x21e: 0x9d, 0x21f: 0x9d, + 0x220: 0x9d, 0x221: 0x9d, 0x222: 0x9d, 0x223: 0x9d, 0x224: 0x9d, 0x225: 0x9d, 0x226: 0x9d, 0x227: 0x9d, + 0x228: 0x9d, 0x229: 0x9d, 0x22a: 0x9d, 0x22b: 0x9d, 0x22c: 0x9d, 0x22d: 0x9d, 0x22e: 0x9d, 0x22f: 0x9d, + 0x230: 0x9d, 0x231: 0x9d, 0x232: 0x9d, 0x233: 0x9d, 0x234: 0x9d, 0x235: 0x9d, 0x236: 0xb0, 0x237: 0x9b, + 0x238: 0x9d, 0x239: 0x9d, 0x23a: 0x9d, 0x23b: 0x9d, 0x23c: 0x9d, 0x23d: 0x9d, 0x23e: 0x9d, 0x23f: 0x9d, + // Block 0x9, offset 0x240 + 0x240: 0x9d, 0x241: 0x9d, 0x242: 0x9d, 0x243: 0x9d, 0x244: 0x9d, 0x245: 0x9d, 0x246: 0x9d, 0x247: 0x9d, + 0x248: 0x9d, 0x249: 0x9d, 0x24a: 0x9d, 0x24b: 0x9d, 0x24c: 0x9d, 0x24d: 0x9d, 0x24e: 0x9d, 0x24f: 0x9d, + 0x250: 0x9d, 0x251: 0x9d, 0x252: 0x9d, 0x253: 0x9d, 0x254: 0x9d, 0x255: 0x9d, 0x256: 0x9d, 0x257: 0x9d, + 0x258: 0x9d, 0x259: 0x9d, 0x25a: 0x9d, 0x25b: 0x9d, 0x25c: 0x9d, 0x25d: 0x9d, 0x25e: 0x9d, 0x25f: 0x9d, + 0x260: 0x9d, 0x261: 0x9d, 0x262: 0x9d, 0x263: 0x9d, 0x264: 0x9d, 0x265: 0x9d, 0x266: 0x9d, 0x267: 0x9d, + 0x268: 0x9d, 0x269: 0x9d, 0x26a: 0x9d, 0x26b: 0x9d, 0x26c: 0x9d, 0x26d: 0x9d, 0x26e: 0x9d, 0x26f: 0x9d, + 0x270: 0x9d, 0x271: 0x9d, 0x272: 0x9d, 0x273: 0x9d, 0x274: 0x9d, 0x275: 0x9d, 0x276: 0x9d, 0x277: 0x9d, + 0x278: 0x9d, 0x279: 0x9d, 0x27a: 0x9d, 0x27b: 0x9d, 0x27c: 0x9d, 0x27d: 0x9d, 0x27e: 0x9d, 0x27f: 0x9d, + // Block 0xa, offset 0x280 + 0x280: 0x9d, 0x281: 0x9d, 0x282: 0x9d, 0x283: 0x9d, 0x284: 0x9d, 0x285: 0x9d, 0x286: 0x9d, 0x287: 0x9d, + 0x288: 0x9d, 0x289: 0x9d, 0x28a: 0x9d, 0x28b: 0x9d, 0x28c: 0x9d, 0x28d: 0x9d, 0x28e: 0x9d, 0x28f: 0x9d, + 0x290: 0x9d, 0x291: 0x9d, 0x292: 0x9d, 0x293: 0x9d, 0x294: 0x9d, 0x295: 0x9d, 0x296: 0x9d, 0x297: 0x9d, + 0x298: 0x9d, 0x299: 0x9d, 0x29a: 0x9d, 0x29b: 0x9d, 0x29c: 0x9d, 0x29d: 0x9d, 0x29e: 0x9d, 0x29f: 0x9d, + 0x2a0: 0x9d, 0x2a1: 0x9d, 0x2a2: 0x9d, 0x2a3: 0x9d, 0x2a4: 0x9d, 0x2a5: 0x9d, 0x2a6: 0x9d, 0x2a7: 0x9d, + 0x2a8: 0x9d, 0x2a9: 0x9d, 0x2aa: 0x9d, 0x2ab: 0x9d, 0x2ac: 0x9d, 0x2ad: 0x9d, 0x2ae: 0x9d, 0x2af: 0x9d, + 0x2b0: 0x9d, 0x2b1: 0x9d, 0x2b2: 0x9d, 0x2b3: 0x9d, 0x2b4: 0x9d, 0x2b5: 0x9d, 0x2b6: 0x9d, 0x2b7: 0x9d, + 0x2b8: 0x9d, 0x2b9: 0x9d, 0x2ba: 0x9d, 0x2bb: 0x9d, 0x2bc: 0x9d, 0x2bd: 0x9d, 0x2be: 0x9d, 0x2bf: 0xe2, + // Block 0xb, offset 0x2c0 + 0x2c0: 0x9d, 0x2c1: 0x9d, 0x2c2: 0x9d, 0x2c3: 0x9d, 0x2c4: 0x9d, 0x2c5: 0x9d, 0x2c6: 0x9d, 0x2c7: 0x9d, + 0x2c8: 0x9d, 0x2c9: 0x9d, 0x2ca: 0x9d, 0x2cb: 0x9d, 0x2cc: 0x9d, 0x2cd: 0x9d, 0x2ce: 0x9d, 0x2cf: 0x9d, + 0x2d0: 0x9d, 0x2d1: 0x9d, 0x2d2: 0xe3, 0x2d3: 0xe4, 0x2d4: 0x9d, 0x2d5: 0x9d, 0x2d6: 0x9d, 0x2d7: 0x9d, + 0x2d8: 0xe5, 0x2d9: 0x40, 0x2da: 0x41, 0x2db: 0xe6, 0x2dc: 0x42, 0x2dd: 0x43, 0x2de: 0x44, 0x2df: 0xe7, + 0x2e0: 0xe8, 0x2e1: 0xe9, 0x2e2: 0xea, 0x2e3: 0xeb, 0x2e4: 0xec, 0x2e5: 0xed, 0x2e6: 0xee, 0x2e7: 0xef, + 0x2e8: 0xf0, 0x2e9: 0xf1, 0x2ea: 0xf2, 0x2eb: 0xf3, 0x2ec: 0xf4, 0x2ed: 0xf5, 0x2ee: 0xf6, 0x2ef: 0xf7, + 0x2f0: 0x9d, 0x2f1: 0x9d, 0x2f2: 0x9d, 0x2f3: 0x9d, 0x2f4: 0x9d, 0x2f5: 0x9d, 0x2f6: 0x9d, 0x2f7: 0x9d, + 0x2f8: 0x9d, 0x2f9: 0x9d, 0x2fa: 0x9d, 0x2fb: 0x9d, 0x2fc: 0x9d, 0x2fd: 0x9d, 0x2fe: 0x9d, 0x2ff: 0x9d, + // Block 0xc, offset 0x300 + 0x300: 0x9d, 0x301: 0x9d, 0x302: 0x9d, 0x303: 0x9d, 0x304: 0x9d, 0x305: 0x9d, 0x306: 0x9d, 0x307: 0x9d, + 0x308: 0x9d, 0x309: 0x9d, 0x30a: 0x9d, 0x30b: 0x9d, 0x30c: 0x9d, 0x30d: 0x9d, 0x30e: 0x9d, 0x30f: 0x9d, + 0x310: 0x9d, 0x311: 0x9d, 0x312: 0x9d, 0x313: 0x9d, 0x314: 0x9d, 0x315: 0x9d, 0x316: 0x9d, 0x317: 0x9d, + 0x318: 0x9d, 0x319: 0x9d, 0x31a: 0x9d, 0x31b: 0x9d, 0x31c: 0x9d, 0x31d: 0x9d, 0x31e: 0xf8, 0x31f: 0xf9, + // Block 0xd, offset 0x340 + 0x340: 0xb8, 0x341: 0xb8, 0x342: 0xb8, 0x343: 0xb8, 0x344: 0xb8, 0x345: 0xb8, 0x346: 0xb8, 0x347: 0xb8, + 0x348: 0xb8, 0x349: 0xb8, 0x34a: 0xb8, 0x34b: 0xb8, 0x34c: 0xb8, 0x34d: 0xb8, 0x34e: 0xb8, 0x34f: 0xb8, + 0x350: 0xb8, 0x351: 0xb8, 0x352: 0xb8, 0x353: 0xb8, 0x354: 0xb8, 0x355: 0xb8, 0x356: 0xb8, 0x357: 0xb8, + 0x358: 0xb8, 0x359: 0xb8, 0x35a: 0xb8, 0x35b: 0xb8, 0x35c: 0xb8, 0x35d: 0xb8, 0x35e: 0xb8, 0x35f: 0xb8, + 0x360: 0xb8, 0x361: 0xb8, 0x362: 0xb8, 0x363: 0xb8, 0x364: 0xb8, 0x365: 0xb8, 0x366: 0xb8, 0x367: 0xb8, + 0x368: 0xb8, 0x369: 0xb8, 0x36a: 0xb8, 0x36b: 0xb8, 0x36c: 0xb8, 0x36d: 0xb8, 0x36e: 0xb8, 0x36f: 0xb8, + 0x370: 0xb8, 0x371: 0xb8, 0x372: 0xb8, 0x373: 0xb8, 0x374: 0xb8, 0x375: 0xb8, 0x376: 0xb8, 0x377: 0xb8, + 0x378: 0xb8, 0x379: 0xb8, 0x37a: 0xb8, 0x37b: 0xb8, 0x37c: 0xb8, 0x37d: 0xb8, 0x37e: 0xb8, 0x37f: 0xb8, + // Block 0xe, offset 0x380 + 0x380: 0xb8, 0x381: 0xb8, 0x382: 0xb8, 0x383: 0xb8, 0x384: 0xb8, 0x385: 0xb8, 0x386: 0xb8, 0x387: 0xb8, + 0x388: 0xb8, 0x389: 0xb8, 0x38a: 0xb8, 0x38b: 0xb8, 0x38c: 0xb8, 0x38d: 0xb8, 0x38e: 0xb8, 0x38f: 0xb8, + 0x390: 0xb8, 0x391: 0xb8, 0x392: 0xb8, 0x393: 0xb8, 0x394: 0xb8, 0x395: 0xb8, 0x396: 0xb8, 0x397: 0xb8, + 0x398: 0xb8, 0x399: 0xb8, 0x39a: 0xb8, 0x39b: 0xb8, 0x39c: 0xb8, 0x39d: 0xb8, 0x39e: 0xb8, 0x39f: 0xb8, + 0x3a0: 0xb8, 0x3a1: 0xb8, 0x3a2: 0xb8, 0x3a3: 0xb8, 0x3a4: 0xfa, 0x3a5: 0xfb, 0x3a6: 0xfc, 0x3a7: 0xfd, + 0x3a8: 0x45, 0x3a9: 0xfe, 0x3aa: 0xff, 0x3ab: 0x46, 0x3ac: 0x47, 0x3ad: 0x48, 0x3ae: 0x49, 0x3af: 0x4a, + 0x3b0: 0x100, 0x3b1: 0x4b, 0x3b2: 0x4c, 0x3b3: 0x4d, 0x3b4: 0x4e, 0x3b5: 0x4f, 0x3b6: 0x101, 0x3b7: 0x50, + 0x3b8: 0x51, 0x3b9: 0x52, 0x3ba: 0x53, 0x3bb: 0x54, 0x3bc: 0x55, 0x3bd: 0x56, 0x3be: 0x57, 0x3bf: 0x58, + // Block 0xf, offset 0x3c0 + 0x3c0: 0x102, 0x3c1: 0x103, 0x3c2: 0x9d, 0x3c3: 0x104, 0x3c4: 0x105, 0x3c5: 0x9b, 0x3c6: 0x106, 0x3c7: 0x107, + 0x3c8: 0xb8, 0x3c9: 0xb8, 0x3ca: 0x108, 0x3cb: 0x109, 0x3cc: 0x10a, 0x3cd: 0x10b, 0x3ce: 0x10c, 0x3cf: 0x10d, + 0x3d0: 0x10e, 0x3d1: 0x9d, 0x3d2: 0x10f, 0x3d3: 0x110, 0x3d4: 0x111, 0x3d5: 0x112, 0x3d6: 0xb8, 0x3d7: 0xb8, + 0x3d8: 0x9d, 0x3d9: 0x9d, 0x3da: 0x9d, 0x3db: 0x9d, 0x3dc: 0x113, 0x3dd: 0x114, 0x3de: 0xb8, 0x3df: 0xb8, + 0x3e0: 0x115, 0x3e1: 0x116, 0x3e2: 0x117, 0x3e3: 0x118, 0x3e4: 0x119, 0x3e5: 0xb8, 0x3e6: 0x11a, 0x3e7: 0x11b, + 0x3e8: 0x11c, 0x3e9: 0x11d, 0x3ea: 0x11e, 0x3eb: 0x59, 0x3ec: 0x11f, 0x3ed: 0x120, 0x3ee: 0x5a, 0x3ef: 0xb8, + 0x3f0: 0x9d, 0x3f1: 0x121, 0x3f2: 0x122, 0x3f3: 0x123, 0x3f4: 0xb8, 0x3f5: 0xb8, 0x3f6: 0xb8, 0x3f7: 0xb8, + 0x3f8: 0xb8, 0x3f9: 0x124, 0x3fa: 0xb8, 0x3fb: 0xb8, 0x3fc: 0xb8, 0x3fd: 0xb8, 0x3fe: 0xb8, 0x3ff: 0xb8, + // Block 0x10, offset 0x400 + 0x400: 0x125, 0x401: 0x126, 0x402: 0x127, 0x403: 0x128, 0x404: 0x129, 0x405: 0x12a, 0x406: 0x12b, 0x407: 0x12c, + 0x408: 0x12d, 0x409: 0xb8, 0x40a: 0x12e, 0x40b: 0x12f, 0x40c: 0x5b, 0x40d: 0x5c, 0x40e: 0xb8, 0x40f: 0xb8, + 0x410: 0x130, 0x411: 0x131, 0x412: 0x132, 0x413: 0x133, 0x414: 0xb8, 0x415: 0xb8, 0x416: 0x134, 0x417: 0x135, + 0x418: 0x136, 0x419: 0x137, 0x41a: 0x138, 0x41b: 0x139, 0x41c: 0x13a, 0x41d: 0xb8, 0x41e: 0xb8, 0x41f: 0xb8, + 0x420: 0xb8, 0x421: 0xb8, 0x422: 0x13b, 0x423: 0x13c, 0x424: 0xb8, 0x425: 0xb8, 0x426: 0xb8, 0x427: 0xb8, + 0x428: 0xb8, 0x429: 0xb8, 0x42a: 0xb8, 0x42b: 0x13d, 0x42c: 0xb8, 0x42d: 0xb8, 0x42e: 0xb8, 0x42f: 0xb8, + 0x430: 0x13e, 0x431: 0x13f, 0x432: 0x140, 0x433: 0xb8, 0x434: 0xb8, 0x435: 0xb8, 0x436: 0xb8, 0x437: 0xb8, + 0x438: 0xb8, 0x439: 0xb8, 0x43a: 0xb8, 0x43b: 0xb8, 0x43c: 0xb8, 0x43d: 0xb8, 0x43e: 0xb8, 0x43f: 0xb8, + // Block 0x11, offset 0x440 + 0x440: 0x9d, 0x441: 0x9d, 0x442: 0x9d, 0x443: 0x9d, 0x444: 0x9d, 0x445: 0x9d, 0x446: 0x9d, 0x447: 0x9d, + 0x448: 0x9d, 0x449: 0x9d, 0x44a: 0x9d, 0x44b: 0x9d, 0x44c: 0x9d, 0x44d: 0x9d, 0x44e: 0x141, 0x44f: 0xb8, + 0x450: 0x9b, 0x451: 0x142, 0x452: 0x9d, 0x453: 0x9d, 0x454: 0x9d, 0x455: 0x143, 0x456: 0xb8, 0x457: 0xb8, + 0x458: 0xb8, 0x459: 0xb8, 0x45a: 0xb8, 0x45b: 0xb8, 0x45c: 0xb8, 0x45d: 0xb8, 0x45e: 0xb8, 0x45f: 0xb8, + 0x460: 0xb8, 0x461: 0xb8, 0x462: 0xb8, 0x463: 0xb8, 0x464: 0xb8, 0x465: 0xb8, 0x466: 0xb8, 0x467: 0xb8, + 0x468: 0xb8, 0x469: 0xb8, 0x46a: 0xb8, 0x46b: 0xb8, 0x46c: 0xb8, 0x46d: 0xb8, 0x46e: 0xb8, 0x46f: 0xb8, + 0x470: 0xb8, 0x471: 0xb8, 0x472: 0xb8, 0x473: 0xb8, 0x474: 0xb8, 0x475: 0xb8, 0x476: 0xb8, 0x477: 0xb8, + 0x478: 0xb8, 0x479: 0xb8, 0x47a: 0xb8, 0x47b: 0xb8, 0x47c: 0xb8, 0x47d: 0xb8, 0x47e: 0xb8, 0x47f: 0xb8, + // Block 0x12, offset 0x480 + 0x480: 0x9d, 0x481: 0x9d, 0x482: 0x9d, 0x483: 0x9d, 0x484: 0x9d, 0x485: 0x9d, 0x486: 0x9d, 0x487: 0x9d, + 0x488: 0x9d, 0x489: 0x9d, 0x48a: 0x9d, 0x48b: 0x9d, 0x48c: 0x9d, 0x48d: 0x9d, 0x48e: 0x9d, 0x48f: 0x9d, + 0x490: 0x144, 0x491: 0xb8, 0x492: 0xb8, 0x493: 0xb8, 0x494: 0xb8, 0x495: 0xb8, 0x496: 0xb8, 0x497: 0xb8, + 0x498: 0xb8, 0x499: 0xb8, 0x49a: 0xb8, 0x49b: 0xb8, 0x49c: 0xb8, 0x49d: 0xb8, 0x49e: 0xb8, 0x49f: 0xb8, + 0x4a0: 0xb8, 0x4a1: 0xb8, 0x4a2: 0xb8, 0x4a3: 0xb8, 0x4a4: 0xb8, 0x4a5: 0xb8, 0x4a6: 0xb8, 0x4a7: 0xb8, + 0x4a8: 0xb8, 0x4a9: 0xb8, 0x4aa: 0xb8, 0x4ab: 0xb8, 0x4ac: 0xb8, 0x4ad: 0xb8, 0x4ae: 0xb8, 0x4af: 0xb8, + 0x4b0: 0xb8, 0x4b1: 0xb8, 0x4b2: 0xb8, 0x4b3: 0xb8, 0x4b4: 0xb8, 0x4b5: 0xb8, 0x4b6: 0xb8, 0x4b7: 0xb8, + 0x4b8: 0xb8, 0x4b9: 0xb8, 0x4ba: 0xb8, 0x4bb: 0xb8, 0x4bc: 0xb8, 0x4bd: 0xb8, 0x4be: 0xb8, 0x4bf: 0xb8, + // Block 0x13, offset 0x4c0 + 0x4c0: 0xb8, 0x4c1: 0xb8, 0x4c2: 0xb8, 0x4c3: 0xb8, 0x4c4: 0xb8, 0x4c5: 0xb8, 0x4c6: 0xb8, 0x4c7: 0xb8, + 0x4c8: 0xb8, 0x4c9: 0xb8, 0x4ca: 0xb8, 0x4cb: 0xb8, 0x4cc: 0xb8, 0x4cd: 0xb8, 0x4ce: 0xb8, 0x4cf: 0xb8, + 0x4d0: 0x9d, 0x4d1: 0x9d, 0x4d2: 0x9d, 0x4d3: 0x9d, 0x4d4: 0x9d, 0x4d5: 0x9d, 0x4d6: 0x9d, 0x4d7: 0x9d, + 0x4d8: 0x9d, 0x4d9: 0x145, 0x4da: 0xb8, 0x4db: 0xb8, 0x4dc: 0xb8, 0x4dd: 0xb8, 0x4de: 0xb8, 0x4df: 0xb8, + 0x4e0: 0xb8, 0x4e1: 0xb8, 0x4e2: 0xb8, 0x4e3: 0xb8, 0x4e4: 0xb8, 0x4e5: 0xb8, 0x4e6: 0xb8, 0x4e7: 0xb8, + 0x4e8: 0xb8, 0x4e9: 0xb8, 0x4ea: 0xb8, 0x4eb: 0xb8, 0x4ec: 0xb8, 0x4ed: 0xb8, 0x4ee: 0xb8, 0x4ef: 0xb8, + 0x4f0: 0xb8, 0x4f1: 0xb8, 0x4f2: 0xb8, 0x4f3: 0xb8, 0x4f4: 0xb8, 0x4f5: 0xb8, 0x4f6: 0xb8, 0x4f7: 0xb8, + 0x4f8: 0xb8, 0x4f9: 0xb8, 0x4fa: 0xb8, 0x4fb: 0xb8, 0x4fc: 0xb8, 0x4fd: 0xb8, 0x4fe: 0xb8, 0x4ff: 0xb8, + // Block 0x14, offset 0x500 + 0x500: 0xb8, 0x501: 0xb8, 0x502: 0xb8, 0x503: 0xb8, 0x504: 0xb8, 0x505: 0xb8, 0x506: 0xb8, 0x507: 0xb8, + 0x508: 0xb8, 0x509: 0xb8, 0x50a: 0xb8, 0x50b: 0xb8, 0x50c: 0xb8, 0x50d: 0xb8, 0x50e: 0xb8, 0x50f: 0xb8, + 0x510: 0xb8, 0x511: 0xb8, 0x512: 0xb8, 0x513: 0xb8, 0x514: 0xb8, 0x515: 0xb8, 0x516: 0xb8, 0x517: 0xb8, + 0x518: 0xb8, 0x519: 0xb8, 0x51a: 0xb8, 0x51b: 0xb8, 0x51c: 0xb8, 0x51d: 0xb8, 0x51e: 0xb8, 0x51f: 0xb8, + 0x520: 0x9d, 0x521: 0x9d, 0x522: 0x9d, 0x523: 0x9d, 0x524: 0x9d, 0x525: 0x9d, 0x526: 0x9d, 0x527: 0x9d, + 0x528: 0x13d, 0x529: 0x146, 0x52a: 0xb8, 0x52b: 0x147, 0x52c: 0x148, 0x52d: 0x149, 0x52e: 0x14a, 0x52f: 0xb8, + 0x530: 0xb8, 0x531: 0xb8, 0x532: 0xb8, 0x533: 0xb8, 0x534: 0xb8, 0x535: 0xb8, 0x536: 0xb8, 0x537: 0xb8, + 0x538: 0xb8, 0x539: 0xb8, 0x53a: 0xb8, 0x53b: 0xb8, 0x53c: 0x9d, 0x53d: 0x14b, 0x53e: 0x14c, 0x53f: 0x14d, + // Block 0x15, offset 0x540 + 0x540: 0x9d, 0x541: 0x9d, 0x542: 0x9d, 0x543: 0x9d, 0x544: 0x9d, 0x545: 0x9d, 0x546: 0x9d, 0x547: 0x9d, + 0x548: 0x9d, 0x549: 0x9d, 0x54a: 0x9d, 0x54b: 0x9d, 0x54c: 0x9d, 0x54d: 0x9d, 0x54e: 0x9d, 0x54f: 0x9d, + 0x550: 0x9d, 0x551: 0x9d, 0x552: 0x9d, 0x553: 0x9d, 0x554: 0x9d, 0x555: 0x9d, 0x556: 0x9d, 0x557: 0x9d, + 0x558: 0x9d, 0x559: 0x9d, 0x55a: 0x9d, 0x55b: 0x9d, 0x55c: 0x9d, 0x55d: 0x9d, 0x55e: 0x9d, 0x55f: 0x14e, + 0x560: 0x9d, 0x561: 0x9d, 0x562: 0x9d, 0x563: 0x9d, 0x564: 0x9d, 0x565: 0x9d, 0x566: 0x9d, 0x567: 0x9d, + 0x568: 0x9d, 0x569: 0x9d, 0x56a: 0x9d, 0x56b: 0x14f, 0x56c: 0xb8, 0x56d: 0xb8, 0x56e: 0xb8, 0x56f: 0xb8, + 0x570: 0xb8, 0x571: 0xb8, 0x572: 0xb8, 0x573: 0xb8, 0x574: 0xb8, 0x575: 0xb8, 0x576: 0xb8, 0x577: 0xb8, + 0x578: 0xb8, 0x579: 0xb8, 0x57a: 0xb8, 0x57b: 0xb8, 0x57c: 0xb8, 0x57d: 0xb8, 0x57e: 0xb8, 0x57f: 0xb8, + // Block 0x16, offset 0x580 + 0x580: 0x150, 0x581: 0xb8, 0x582: 0xb8, 0x583: 0xb8, 0x584: 0xb8, 0x585: 0xb8, 0x586: 0xb8, 0x587: 0xb8, + 0x588: 0xb8, 0x589: 0xb8, 0x58a: 0xb8, 0x58b: 0xb8, 0x58c: 0xb8, 0x58d: 0xb8, 0x58e: 0xb8, 0x58f: 0xb8, + 0x590: 0xb8, 0x591: 0xb8, 0x592: 0xb8, 0x593: 0xb8, 0x594: 0xb8, 0x595: 0xb8, 0x596: 0xb8, 0x597: 0xb8, + 0x598: 0xb8, 0x599: 0xb8, 0x59a: 0xb8, 0x59b: 0xb8, 0x59c: 0xb8, 0x59d: 0xb8, 0x59e: 0xb8, 0x59f: 0xb8, + 0x5a0: 0xb8, 0x5a1: 0xb8, 0x5a2: 0xb8, 0x5a3: 0xb8, 0x5a4: 0xb8, 0x5a5: 0xb8, 0x5a6: 0xb8, 0x5a7: 0xb8, + 0x5a8: 0xb8, 0x5a9: 0xb8, 0x5aa: 0xb8, 0x5ab: 0xb8, 0x5ac: 0xb8, 0x5ad: 0xb8, 0x5ae: 0xb8, 0x5af: 0xb8, + 0x5b0: 0x9d, 0x5b1: 0x151, 0x5b2: 0x152, 0x5b3: 0xb8, 0x5b4: 0xb8, 0x5b5: 0xb8, 0x5b6: 0xb8, 0x5b7: 0xb8, + 0x5b8: 0xb8, 0x5b9: 0xb8, 0x5ba: 0xb8, 0x5bb: 0xb8, 0x5bc: 0xb8, 0x5bd: 0xb8, 0x5be: 0xb8, 0x5bf: 0xb8, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x9b, 0x5c1: 0x9b, 0x5c2: 0x9b, 0x5c3: 0x153, 0x5c4: 0x154, 0x5c5: 0x155, 0x5c6: 0x156, 0x5c7: 0x157, + 0x5c8: 0x9b, 0x5c9: 0x158, 0x5ca: 0xb8, 0x5cb: 0xb8, 0x5cc: 0x9b, 0x5cd: 0x159, 0x5ce: 0xb8, 0x5cf: 0xb8, + 0x5d0: 0x5d, 0x5d1: 0x5e, 0x5d2: 0x5f, 0x5d3: 0x60, 0x5d4: 0x61, 0x5d5: 0x62, 0x5d6: 0x63, 0x5d7: 0x64, + 0x5d8: 0x65, 0x5d9: 0x66, 0x5da: 0x67, 0x5db: 0x68, 0x5dc: 0x69, 0x5dd: 0x6a, 0x5de: 0x6b, 0x5df: 0x6c, + 0x5e0: 0x9b, 0x5e1: 0x9b, 0x5e2: 0x9b, 0x5e3: 0x9b, 0x5e4: 0x9b, 0x5e5: 0x9b, 0x5e6: 0x9b, 0x5e7: 0x9b, + 0x5e8: 0x15a, 0x5e9: 0x15b, 0x5ea: 0x15c, 0x5eb: 0xb8, 0x5ec: 0xb8, 0x5ed: 0xb8, 0x5ee: 0xb8, 0x5ef: 0xb8, + 0x5f0: 0xb8, 0x5f1: 0xb8, 0x5f2: 0xb8, 0x5f3: 0xb8, 0x5f4: 0xb8, 0x5f5: 0xb8, 0x5f6: 0xb8, 0x5f7: 0xb8, + 0x5f8: 0xb8, 0x5f9: 0xb8, 0x5fa: 0xb8, 0x5fb: 0xb8, 0x5fc: 0xb8, 0x5fd: 0xb8, 0x5fe: 0xb8, 0x5ff: 0xb8, + // Block 0x18, offset 0x600 + 0x600: 0x15d, 0x601: 0xb8, 0x602: 0xb8, 0x603: 0xb8, 0x604: 0xb8, 0x605: 0xb8, 0x606: 0xb8, 0x607: 0xb8, + 0x608: 0xb8, 0x609: 0xb8, 0x60a: 0xb8, 0x60b: 0xb8, 0x60c: 0xb8, 0x60d: 0xb8, 0x60e: 0xb8, 0x60f: 0xb8, + 0x610: 0xb8, 0x611: 0xb8, 0x612: 0xb8, 0x613: 0xb8, 0x614: 0xb8, 0x615: 0xb8, 0x616: 0xb8, 0x617: 0xb8, + 0x618: 0xb8, 0x619: 0xb8, 0x61a: 0xb8, 0x61b: 0xb8, 0x61c: 0xb8, 0x61d: 0xb8, 0x61e: 0xb8, 0x61f: 0xb8, + 0x620: 0x9d, 0x621: 0x9d, 0x622: 0x9d, 0x623: 0x15e, 0x624: 0x6d, 0x625: 0x15f, 0x626: 0xb8, 0x627: 0xb8, + 0x628: 0xb8, 0x629: 0xb8, 0x62a: 0xb8, 0x62b: 0xb8, 0x62c: 0xb8, 0x62d: 0xb8, 0x62e: 0xb8, 0x62f: 0xb8, + 0x630: 0xb8, 0x631: 0xb8, 0x632: 0xb8, 0x633: 0xb8, 0x634: 0xb8, 0x635: 0xb8, 0x636: 0xb8, 0x637: 0xb8, + 0x638: 0x6e, 0x639: 0x6f, 0x63a: 0x70, 0x63b: 0x160, 0x63c: 0xb8, 0x63d: 0xb8, 0x63e: 0xb8, 0x63f: 0xb8, + // Block 0x19, offset 0x640 + 0x640: 0x161, 0x641: 0x9b, 0x642: 0x162, 0x643: 0x163, 0x644: 0x71, 0x645: 0x72, 0x646: 0x164, 0x647: 0x165, + 0x648: 0x73, 0x649: 0x166, 0x64a: 0xb8, 0x64b: 0xb8, 0x64c: 0x9b, 0x64d: 0x9b, 0x64e: 0x9b, 0x64f: 0x9b, + 0x650: 0x9b, 0x651: 0x9b, 0x652: 0x9b, 0x653: 0x9b, 0x654: 0x9b, 0x655: 0x9b, 0x656: 0x9b, 0x657: 0x9b, + 0x658: 0x9b, 0x659: 0x9b, 0x65a: 0x9b, 0x65b: 0x167, 0x65c: 0x9b, 0x65d: 0x168, 0x65e: 0x9b, 0x65f: 0x169, + 0x660: 0x16a, 0x661: 0x16b, 0x662: 0x16c, 0x663: 0xb8, 0x664: 0x16d, 0x665: 0x16e, 0x666: 0x16f, 0x667: 0x170, + 0x668: 0xb8, 0x669: 0xb8, 0x66a: 0xb8, 0x66b: 0xb8, 0x66c: 0xb8, 0x66d: 0xb8, 0x66e: 0xb8, 0x66f: 0xb8, + 0x670: 0xb8, 0x671: 0xb8, 0x672: 0xb8, 0x673: 0xb8, 0x674: 0xb8, 0x675: 0xb8, 0x676: 0xb8, 0x677: 0xb8, + 0x678: 0xb8, 0x679: 0xb8, 0x67a: 0xb8, 0x67b: 0xb8, 0x67c: 0xb8, 0x67d: 0xb8, 0x67e: 0xb8, 0x67f: 0xb8, + // Block 0x1a, offset 0x680 + 0x680: 0x9d, 0x681: 0x9d, 0x682: 0x9d, 0x683: 0x9d, 0x684: 0x9d, 0x685: 0x9d, 0x686: 0x9d, 0x687: 0x9d, + 0x688: 0x9d, 0x689: 0x9d, 0x68a: 0x9d, 0x68b: 0x9d, 0x68c: 0x9d, 0x68d: 0x9d, 0x68e: 0x9d, 0x68f: 0x9d, + 0x690: 0x9d, 0x691: 0x9d, 0x692: 0x9d, 0x693: 0x9d, 0x694: 0x9d, 0x695: 0x9d, 0x696: 0x9d, 0x697: 0x9d, + 0x698: 0x9d, 0x699: 0x9d, 0x69a: 0x9d, 0x69b: 0x171, 0x69c: 0x9d, 0x69d: 0x9d, 0x69e: 0x9d, 0x69f: 0x9d, + 0x6a0: 0x9d, 0x6a1: 0x9d, 0x6a2: 0x9d, 0x6a3: 0x9d, 0x6a4: 0x9d, 0x6a5: 0x9d, 0x6a6: 0x9d, 0x6a7: 0x9d, + 0x6a8: 0x9d, 0x6a9: 0x9d, 0x6aa: 0x9d, 0x6ab: 0x9d, 0x6ac: 0x9d, 0x6ad: 0x9d, 0x6ae: 0x9d, 0x6af: 0x9d, + 0x6b0: 0x9d, 0x6b1: 0x9d, 0x6b2: 0x9d, 0x6b3: 0x9d, 0x6b4: 0x9d, 0x6b5: 0x9d, 0x6b6: 0x9d, 0x6b7: 0x9d, + 0x6b8: 0x9d, 0x6b9: 0x9d, 0x6ba: 0x9d, 0x6bb: 0x9d, 0x6bc: 0x9d, 0x6bd: 0x9d, 0x6be: 0x9d, 0x6bf: 0x9d, + // Block 0x1b, offset 0x6c0 + 0x6c0: 0x9d, 0x6c1: 0x9d, 0x6c2: 0x9d, 0x6c3: 0x9d, 0x6c4: 0x9d, 0x6c5: 0x9d, 0x6c6: 0x9d, 0x6c7: 0x9d, + 0x6c8: 0x9d, 0x6c9: 0x9d, 0x6ca: 0x9d, 0x6cb: 0x9d, 0x6cc: 0x9d, 0x6cd: 0x9d, 0x6ce: 0x9d, 0x6cf: 0x9d, + 0x6d0: 0x9d, 0x6d1: 0x9d, 0x6d2: 0x9d, 0x6d3: 0x9d, 0x6d4: 0x9d, 0x6d5: 0x9d, 0x6d6: 0x9d, 0x6d7: 0x9d, + 0x6d8: 0x9d, 0x6d9: 0x9d, 0x6da: 0x9d, 0x6db: 0x9d, 0x6dc: 0x172, 0x6dd: 0x9d, 0x6de: 0x9d, 0x6df: 0x9d, + 0x6e0: 0x173, 0x6e1: 0x9d, 0x6e2: 0x9d, 0x6e3: 0x9d, 0x6e4: 0x9d, 0x6e5: 0x9d, 0x6e6: 0x9d, 0x6e7: 0x9d, + 0x6e8: 0x9d, 0x6e9: 0x9d, 0x6ea: 0x9d, 0x6eb: 0x9d, 0x6ec: 0x9d, 0x6ed: 0x9d, 0x6ee: 0x9d, 0x6ef: 0x9d, + 0x6f0: 0x9d, 0x6f1: 0x9d, 0x6f2: 0x9d, 0x6f3: 0x9d, 0x6f4: 0x9d, 0x6f5: 0x9d, 0x6f6: 0x9d, 0x6f7: 0x9d, + 0x6f8: 0x9d, 0x6f9: 0x9d, 0x6fa: 0x9d, 0x6fb: 0x9d, 0x6fc: 0x9d, 0x6fd: 0x9d, 0x6fe: 0x9d, 0x6ff: 0x9d, + // Block 0x1c, offset 0x700 + 0x700: 0x9d, 0x701: 0x9d, 0x702: 0x9d, 0x703: 0x9d, 0x704: 0x9d, 0x705: 0x9d, 0x706: 0x9d, 0x707: 0x9d, + 0x708: 0x9d, 0x709: 0x9d, 0x70a: 0x9d, 0x70b: 0x9d, 0x70c: 0x9d, 0x70d: 0x9d, 0x70e: 0x9d, 0x70f: 0x9d, + 0x710: 0x9d, 0x711: 0x9d, 0x712: 0x9d, 0x713: 0x9d, 0x714: 0x9d, 0x715: 0x9d, 0x716: 0x9d, 0x717: 0x9d, + 0x718: 0x9d, 0x719: 0x9d, 0x71a: 0x9d, 0x71b: 0x9d, 0x71c: 0x9d, 0x71d: 0x9d, 0x71e: 0x9d, 0x71f: 0x9d, + 0x720: 0x9d, 0x721: 0x9d, 0x722: 0x9d, 0x723: 0x9d, 0x724: 0x9d, 0x725: 0x9d, 0x726: 0x9d, 0x727: 0x9d, + 0x728: 0x9d, 0x729: 0x9d, 0x72a: 0x9d, 0x72b: 0x9d, 0x72c: 0x9d, 0x72d: 0x9d, 0x72e: 0x9d, 0x72f: 0x9d, + 0x730: 0x9d, 0x731: 0x9d, 0x732: 0x9d, 0x733: 0x9d, 0x734: 0x9d, 0x735: 0x9d, 0x736: 0x9d, 0x737: 0x9d, + 0x738: 0x9d, 0x739: 0x9d, 0x73a: 0x174, 0x73b: 0xb8, 0x73c: 0xb8, 0x73d: 0xb8, 0x73e: 0xb8, 0x73f: 0xb8, + // Block 0x1d, offset 0x740 + 0x740: 0xb8, 0x741: 0xb8, 0x742: 0xb8, 0x743: 0xb8, 0x744: 0xb8, 0x745: 0xb8, 0x746: 0xb8, 0x747: 0xb8, + 0x748: 0xb8, 0x749: 0xb8, 0x74a: 0xb8, 0x74b: 0xb8, 0x74c: 0xb8, 0x74d: 0xb8, 0x74e: 0xb8, 0x74f: 0xb8, + 0x750: 0xb8, 0x751: 0xb8, 0x752: 0xb8, 0x753: 0xb8, 0x754: 0xb8, 0x755: 0xb8, 0x756: 0xb8, 0x757: 0xb8, + 0x758: 0xb8, 0x759: 0xb8, 0x75a: 0xb8, 0x75b: 0xb8, 0x75c: 0xb8, 0x75d: 0xb8, 0x75e: 0xb8, 0x75f: 0xb8, + 0x760: 0x74, 0x761: 0x75, 0x762: 0x76, 0x763: 0x175, 0x764: 0x77, 0x765: 0x78, 0x766: 0x176, 0x767: 0x79, + 0x768: 0x7a, 0x769: 0xb8, 0x76a: 0xb8, 0x76b: 0xb8, 0x76c: 0xb8, 0x76d: 0xb8, 0x76e: 0xb8, 0x76f: 0xb8, + 0x770: 0xb8, 0x771: 0xb8, 0x772: 0xb8, 0x773: 0xb8, 0x774: 0xb8, 0x775: 0xb8, 0x776: 0xb8, 0x777: 0xb8, + 0x778: 0xb8, 0x779: 0xb8, 0x77a: 0xb8, 0x77b: 0xb8, 0x77c: 0xb8, 0x77d: 0xb8, 0x77e: 0xb8, 0x77f: 0xb8, + // Block 0x1e, offset 0x780 + 0x790: 0x0d, 0x791: 0x0e, 0x792: 0x0f, 0x793: 0x10, 0x794: 0x11, 0x795: 0x0b, 0x796: 0x12, 0x797: 0x07, + 0x798: 0x13, 0x799: 0x0b, 0x79a: 0x0b, 0x79b: 0x14, 0x79c: 0x0b, 0x79d: 0x15, 0x79e: 0x16, 0x79f: 0x17, + 0x7a0: 0x07, 0x7a1: 0x07, 0x7a2: 0x07, 0x7a3: 0x07, 0x7a4: 0x07, 0x7a5: 0x07, 0x7a6: 0x07, 0x7a7: 0x07, + 0x7a8: 0x07, 0x7a9: 0x07, 0x7aa: 0x18, 0x7ab: 0x19, 0x7ac: 0x1a, 0x7ad: 0x0b, 0x7ae: 0x0b, 0x7af: 0x1b, + 0x7b0: 0x0b, 0x7b1: 0x0b, 0x7b2: 0x0b, 0x7b3: 0x0b, 0x7b4: 0x0b, 0x7b5: 0x0b, 0x7b6: 0x0b, 0x7b7: 0x0b, + 0x7b8: 0x0b, 0x7b9: 0x0b, 0x7ba: 0x0b, 0x7bb: 0x0b, 0x7bc: 0x0b, 0x7bd: 0x0b, 0x7be: 0x0b, 0x7bf: 0x0b, + // Block 0x1f, offset 0x7c0 + 0x7c0: 0x0b, 0x7c1: 0x0b, 0x7c2: 0x0b, 0x7c3: 0x0b, 0x7c4: 0x0b, 0x7c5: 0x0b, 0x7c6: 0x0b, 0x7c7: 0x0b, + 0x7c8: 0x0b, 0x7c9: 0x0b, 0x7ca: 0x0b, 0x7cb: 0x0b, 0x7cc: 0x0b, 0x7cd: 0x0b, 0x7ce: 0x0b, 0x7cf: 0x0b, + 0x7d0: 0x0b, 0x7d1: 0x0b, 0x7d2: 0x0b, 0x7d3: 0x0b, 0x7d4: 0x0b, 0x7d5: 0x0b, 0x7d6: 0x0b, 0x7d7: 0x0b, + 0x7d8: 0x0b, 0x7d9: 0x0b, 0x7da: 0x0b, 0x7db: 0x0b, 0x7dc: 0x0b, 0x7dd: 0x0b, 0x7de: 0x0b, 0x7df: 0x0b, + 0x7e0: 0x0b, 0x7e1: 0x0b, 0x7e2: 0x0b, 0x7e3: 0x0b, 0x7e4: 0x0b, 0x7e5: 0x0b, 0x7e6: 0x0b, 0x7e7: 0x0b, + 0x7e8: 0x0b, 0x7e9: 0x0b, 0x7ea: 0x0b, 0x7eb: 0x0b, 0x7ec: 0x0b, 0x7ed: 0x0b, 0x7ee: 0x0b, 0x7ef: 0x0b, + 0x7f0: 0x0b, 0x7f1: 0x0b, 0x7f2: 0x0b, 0x7f3: 0x0b, 0x7f4: 0x0b, 0x7f5: 0x0b, 0x7f6: 0x0b, 0x7f7: 0x0b, + 0x7f8: 0x0b, 0x7f9: 0x0b, 0x7fa: 0x0b, 0x7fb: 0x0b, 0x7fc: 0x0b, 0x7fd: 0x0b, 0x7fe: 0x0b, 0x7ff: 0x0b, + // Block 0x20, offset 0x800 + 0x800: 0x177, 0x801: 0x178, 0x802: 0xb8, 0x803: 0xb8, 0x804: 0x179, 0x805: 0x179, 0x806: 0x179, 0x807: 0x17a, + 0x808: 0xb8, 0x809: 0xb8, 0x80a: 0xb8, 0x80b: 0xb8, 0x80c: 0xb8, 0x80d: 0xb8, 0x80e: 0xb8, 0x80f: 0xb8, + 0x810: 0xb8, 0x811: 0xb8, 0x812: 0xb8, 0x813: 0xb8, 0x814: 0xb8, 0x815: 0xb8, 0x816: 0xb8, 0x817: 0xb8, + 0x818: 0xb8, 0x819: 0xb8, 0x81a: 0xb8, 0x81b: 0xb8, 0x81c: 0xb8, 0x81d: 0xb8, 0x81e: 0xb8, 0x81f: 0xb8, + 0x820: 0xb8, 0x821: 0xb8, 0x822: 0xb8, 0x823: 0xb8, 0x824: 0xb8, 0x825: 0xb8, 0x826: 0xb8, 0x827: 0xb8, + 0x828: 0xb8, 0x829: 0xb8, 0x82a: 0xb8, 0x82b: 0xb8, 0x82c: 0xb8, 0x82d: 0xb8, 0x82e: 0xb8, 0x82f: 0xb8, + 0x830: 0xb8, 0x831: 0xb8, 0x832: 0xb8, 0x833: 0xb8, 0x834: 0xb8, 0x835: 0xb8, 0x836: 0xb8, 0x837: 0xb8, + 0x838: 0xb8, 0x839: 0xb8, 0x83a: 0xb8, 0x83b: 0xb8, 0x83c: 0xb8, 0x83d: 0xb8, 0x83e: 0xb8, 0x83f: 0xb8, + // Block 0x21, offset 0x840 + 0x840: 0x0b, 0x841: 0x0b, 0x842: 0x0b, 0x843: 0x0b, 0x844: 0x0b, 0x845: 0x0b, 0x846: 0x0b, 0x847: 0x0b, + 0x848: 0x0b, 0x849: 0x0b, 0x84a: 0x0b, 0x84b: 0x0b, 0x84c: 0x0b, 0x84d: 0x0b, 0x84e: 0x0b, 0x84f: 0x0b, + 0x850: 0x0b, 0x851: 0x0b, 0x852: 0x0b, 0x853: 0x0b, 0x854: 0x0b, 0x855: 0x0b, 0x856: 0x0b, 0x857: 0x0b, + 0x858: 0x0b, 0x859: 0x0b, 0x85a: 0x0b, 0x85b: 0x0b, 0x85c: 0x0b, 0x85d: 0x0b, 0x85e: 0x0b, 0x85f: 0x0b, + 0x860: 0x1e, 0x861: 0x0b, 0x862: 0x0b, 0x863: 0x0b, 0x864: 0x0b, 0x865: 0x0b, 0x866: 0x0b, 0x867: 0x0b, + 0x868: 0x0b, 0x869: 0x0b, 0x86a: 0x0b, 0x86b: 0x0b, 0x86c: 0x0b, 0x86d: 0x0b, 0x86e: 0x0b, 0x86f: 0x0b, + 0x870: 0x0b, 0x871: 0x0b, 0x872: 0x0b, 0x873: 0x0b, 0x874: 0x0b, 0x875: 0x0b, 0x876: 0x0b, 0x877: 0x0b, + 0x878: 0x0b, 0x879: 0x0b, 0x87a: 0x0b, 0x87b: 0x0b, 0x87c: 0x0b, 0x87d: 0x0b, 0x87e: 0x0b, 0x87f: 0x0b, + // Block 0x22, offset 0x880 + 0x880: 0x0b, 0x881: 0x0b, 0x882: 0x0b, 0x883: 0x0b, 0x884: 0x0b, 0x885: 0x0b, 0x886: 0x0b, 0x887: 0x0b, + 0x888: 0x0b, 0x889: 0x0b, 0x88a: 0x0b, 0x88b: 0x0b, 0x88c: 0x0b, 0x88d: 0x0b, 0x88e: 0x0b, 0x88f: 0x0b, +} + +// idnaSparseOffset: 256 entries, 512 bytes +var idnaSparseOffset = []uint16{0x0, 0x8, 0x19, 0x25, 0x27, 0x2c, 0x34, 0x3f, 0x4b, 0x5c, 0x60, 0x6f, 0x74, 0x7b, 0x87, 0x95, 0xa3, 0xa8, 0xb1, 0xc1, 0xcf, 0xdc, 0xe8, 0xf9, 0x103, 0x10a, 0x117, 0x128, 0x12f, 0x13a, 0x149, 0x157, 0x161, 0x163, 0x167, 0x169, 0x175, 0x180, 0x188, 0x18e, 0x194, 0x199, 0x19e, 0x1a1, 0x1a5, 0x1ab, 0x1b0, 0x1bc, 0x1c6, 0x1cc, 0x1dd, 0x1e7, 0x1ea, 0x1f2, 0x1f5, 0x202, 0x20a, 0x20e, 0x215, 0x21d, 0x22d, 0x239, 0x23b, 0x245, 0x251, 0x25d, 0x269, 0x271, 0x276, 0x280, 0x291, 0x295, 0x2a0, 0x2a4, 0x2ad, 0x2b5, 0x2bb, 0x2c0, 0x2c3, 0x2c6, 0x2ca, 0x2d0, 0x2d4, 0x2d8, 0x2de, 0x2e5, 0x2eb, 0x2f3, 0x2fa, 0x305, 0x30f, 0x313, 0x316, 0x31c, 0x320, 0x322, 0x325, 0x327, 0x32a, 0x334, 0x337, 0x346, 0x34a, 0x34f, 0x352, 0x356, 0x35b, 0x360, 0x366, 0x36c, 0x37b, 0x381, 0x385, 0x394, 0x399, 0x3a1, 0x3ab, 0x3b6, 0x3be, 0x3cf, 0x3d8, 0x3e8, 0x3f5, 0x3ff, 0x404, 0x411, 0x415, 0x41a, 0x41c, 0x420, 0x422, 0x426, 0x42f, 0x435, 0x439, 0x449, 0x453, 0x458, 0x45b, 0x461, 0x468, 0x46d, 0x471, 0x477, 0x47c, 0x485, 0x48a, 0x490, 0x497, 0x49e, 0x4a5, 0x4a9, 0x4ae, 0x4b1, 0x4b6, 0x4c2, 0x4c8, 0x4cd, 0x4d4, 0x4dc, 0x4e1, 0x4e5, 0x4f5, 0x4fc, 0x500, 0x504, 0x50b, 0x50e, 0x511, 0x515, 0x519, 0x51f, 0x528, 0x534, 0x53b, 0x544, 0x54c, 0x553, 0x561, 0x56e, 0x57b, 0x584, 0x588, 0x596, 0x59e, 0x5a9, 0x5b2, 0x5b8, 0x5c0, 0x5c9, 0x5d3, 0x5d6, 0x5e2, 0x5e5, 0x5ea, 0x5ed, 0x5f7, 0x600, 0x60c, 0x60f, 0x614, 0x617, 0x61a, 0x61d, 0x624, 0x62b, 0x62f, 0x63a, 0x63d, 0x643, 0x648, 0x64c, 0x64f, 0x652, 0x655, 0x65a, 0x664, 0x667, 0x66b, 0x67a, 0x686, 0x68a, 0x68f, 0x694, 0x698, 0x69d, 0x6a6, 0x6b1, 0x6b7, 0x6bf, 0x6c3, 0x6c7, 0x6cd, 0x6d3, 0x6d8, 0x6db, 0x6e9, 0x6f0, 0x6f3, 0x6f6, 0x6fa, 0x700, 0x705, 0x70f, 0x714, 0x717, 0x71a, 0x71d, 0x720, 0x724, 0x727, 0x737, 0x748, 0x74d, 0x74f, 0x751} + +// idnaSparseValues: 1876 entries, 7504 bytes +var idnaSparseValues = [1876]valueRange{ + // Block 0x0, offset 0x0 + {value: 0x0000, lo: 0x07}, + {value: 0xe105, lo: 0x80, hi: 0x96}, + {value: 0x0018, lo: 0x97, hi: 0x97}, + {value: 0xe105, lo: 0x98, hi: 0x9e}, + {value: 0x001f, lo: 0x9f, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xb7}, + {value: 0x0008, lo: 0xb8, hi: 0xbf}, + // Block 0x1, offset 0x8 + {value: 0x0000, lo: 0x10}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0xe01d, lo: 0x81, hi: 0x81}, + {value: 0x0008, lo: 0x82, hi: 0x82}, + {value: 0x0335, lo: 0x83, hi: 0x83}, + {value: 0x034d, lo: 0x84, hi: 0x84}, + {value: 0x0365, lo: 0x85, hi: 0x85}, + {value: 0xe00d, lo: 0x86, hi: 0x86}, + {value: 0x0008, lo: 0x87, hi: 0x87}, + {value: 0xe00d, lo: 0x88, hi: 0x88}, + {value: 0x0008, lo: 0x89, hi: 0x89}, + {value: 0xe00d, lo: 0x8a, hi: 0x8a}, + {value: 0x0008, lo: 0x8b, hi: 0x8b}, + {value: 0xe00d, lo: 0x8c, hi: 0x8c}, + {value: 0x0008, lo: 0x8d, hi: 0x8d}, + {value: 0xe00d, lo: 0x8e, hi: 0x8e}, + {value: 0x0008, lo: 0x8f, hi: 0xbf}, + // Block 0x2, offset 0x19 + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0xaf}, + {value: 0x0249, lo: 0xb0, hi: 0xb0}, + {value: 0x037d, lo: 0xb1, hi: 0xb1}, + {value: 0x0259, lo: 0xb2, hi: 0xb2}, + {value: 0x0269, lo: 0xb3, hi: 0xb3}, + {value: 0x034d, lo: 0xb4, hi: 0xb4}, + {value: 0x0395, lo: 0xb5, hi: 0xb5}, + {value: 0xe1bd, lo: 0xb6, hi: 0xb6}, + {value: 0x0279, lo: 0xb7, hi: 0xb7}, + {value: 0x0289, lo: 0xb8, hi: 0xb8}, + {value: 0x0008, lo: 0xb9, hi: 0xbf}, + // Block 0x3, offset 0x25 + {value: 0x0000, lo: 0x01}, + {value: 0x1308, lo: 0x80, hi: 0xbf}, + // Block 0x4, offset 0x27 + {value: 0x0000, lo: 0x04}, + {value: 0x03f5, lo: 0x80, hi: 0x8f}, + {value: 0xe105, lo: 0x90, hi: 0x9f}, + {value: 0x049d, lo: 0xa0, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x5, offset 0x2c + {value: 0x0000, lo: 0x07}, + {value: 0xe185, lo: 0x80, hi: 0x8f}, + {value: 0x0545, lo: 0x90, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x98}, + {value: 0x0008, lo: 0x99, hi: 0x99}, + {value: 0x0018, lo: 0x9a, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xa0}, + {value: 0x0008, lo: 0xa1, hi: 0xbf}, + // Block 0x6, offset 0x34 + {value: 0x0000, lo: 0x0a}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x0401, lo: 0x87, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x88}, + {value: 0x0018, lo: 0x89, hi: 0x8a}, + {value: 0x0040, lo: 0x8b, hi: 0x8c}, + {value: 0x0018, lo: 0x8d, hi: 0x8f}, + {value: 0x0040, lo: 0x90, hi: 0x90}, + {value: 0x1308, lo: 0x91, hi: 0xbd}, + {value: 0x0018, lo: 0xbe, hi: 0xbe}, + {value: 0x1308, lo: 0xbf, hi: 0xbf}, + // Block 0x7, offset 0x3f + {value: 0x0000, lo: 0x0b}, + {value: 0x0018, lo: 0x80, hi: 0x80}, + {value: 0x1308, lo: 0x81, hi: 0x82}, + {value: 0x0018, lo: 0x83, hi: 0x83}, + {value: 0x1308, lo: 0x84, hi: 0x85}, + {value: 0x0018, lo: 0x86, hi: 0x86}, + {value: 0x1308, lo: 0x87, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xaa}, + {value: 0x0040, lo: 0xab, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xbf}, + // Block 0x8, offset 0x4b + {value: 0x0000, lo: 0x10}, + {value: 0x0018, lo: 0x80, hi: 0x80}, + {value: 0x0208, lo: 0x81, hi: 0x87}, + {value: 0x0408, lo: 0x88, hi: 0x88}, + {value: 0x0208, lo: 0x89, hi: 0x8a}, + {value: 0x1308, lo: 0x8b, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa9}, + {value: 0x0018, lo: 0xaa, hi: 0xad}, + {value: 0x0208, lo: 0xae, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb0}, + {value: 0x0408, lo: 0xb1, hi: 0xb3}, + {value: 0x0008, lo: 0xb4, hi: 0xb4}, + {value: 0x0429, lo: 0xb5, hi: 0xb5}, + {value: 0x0451, lo: 0xb6, hi: 0xb6}, + {value: 0x0479, lo: 0xb7, hi: 0xb7}, + {value: 0x04a1, lo: 0xb8, hi: 0xb8}, + {value: 0x0208, lo: 0xb9, hi: 0xbf}, + // Block 0x9, offset 0x5c + {value: 0x0000, lo: 0x03}, + {value: 0x0208, lo: 0x80, hi: 0x87}, + {value: 0x0408, lo: 0x88, hi: 0x99}, + {value: 0x0208, lo: 0x9a, hi: 0xbf}, + // Block 0xa, offset 0x60 + {value: 0x0000, lo: 0x0e}, + {value: 0x1308, lo: 0x80, hi: 0x8a}, + {value: 0x0040, lo: 0x8b, hi: 0x8c}, + {value: 0x0408, lo: 0x8d, hi: 0x8d}, + {value: 0x0208, lo: 0x8e, hi: 0x98}, + {value: 0x0408, lo: 0x99, hi: 0x9b}, + {value: 0x0208, lo: 0x9c, hi: 0xaa}, + {value: 0x0408, lo: 0xab, hi: 0xac}, + {value: 0x0208, lo: 0xad, hi: 0xb0}, + {value: 0x0408, lo: 0xb1, hi: 0xb1}, + {value: 0x0208, lo: 0xb2, hi: 0xb2}, + {value: 0x0408, lo: 0xb3, hi: 0xb4}, + {value: 0x0208, lo: 0xb5, hi: 0xb7}, + {value: 0x0408, lo: 0xb8, hi: 0xb9}, + {value: 0x0208, lo: 0xba, hi: 0xbf}, + // Block 0xb, offset 0x6f + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xa5}, + {value: 0x1308, lo: 0xa6, hi: 0xb0}, + {value: 0x0008, lo: 0xb1, hi: 0xb1}, + {value: 0x0040, lo: 0xb2, hi: 0xbf}, + // Block 0xc, offset 0x74 + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0x89}, + {value: 0x0208, lo: 0x8a, hi: 0xaa}, + {value: 0x1308, lo: 0xab, hi: 0xb3}, + {value: 0x0008, lo: 0xb4, hi: 0xb5}, + {value: 0x0018, lo: 0xb6, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbf}, + // Block 0xd, offset 0x7b + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x95}, + {value: 0x1308, lo: 0x96, hi: 0x99}, + {value: 0x0008, lo: 0x9a, hi: 0x9a}, + {value: 0x1308, lo: 0x9b, hi: 0xa3}, + {value: 0x0008, lo: 0xa4, hi: 0xa4}, + {value: 0x1308, lo: 0xa5, hi: 0xa7}, + {value: 0x0008, lo: 0xa8, hi: 0xa8}, + {value: 0x1308, lo: 0xa9, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0xe, offset 0x87 + {value: 0x0000, lo: 0x0d}, + {value: 0x0408, lo: 0x80, hi: 0x80}, + {value: 0x0208, lo: 0x81, hi: 0x85}, + {value: 0x0408, lo: 0x86, hi: 0x87}, + {value: 0x0208, lo: 0x88, hi: 0x88}, + {value: 0x0408, lo: 0x89, hi: 0x89}, + {value: 0x0208, lo: 0x8a, hi: 0x93}, + {value: 0x0408, lo: 0x94, hi: 0x94}, + {value: 0x0208, lo: 0x95, hi: 0x95}, + {value: 0x0008, lo: 0x96, hi: 0x98}, + {value: 0x1308, lo: 0x99, hi: 0x9b}, + {value: 0x0040, lo: 0x9c, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0xbf}, + // Block 0xf, offset 0x95 + {value: 0x0000, lo: 0x0d}, + {value: 0x0040, lo: 0x80, hi: 0x9f}, + {value: 0x0208, lo: 0xa0, hi: 0xa9}, + {value: 0x0408, lo: 0xaa, hi: 0xac}, + {value: 0x0008, lo: 0xad, hi: 0xad}, + {value: 0x0408, lo: 0xae, hi: 0xae}, + {value: 0x0208, lo: 0xaf, hi: 0xb0}, + {value: 0x0408, lo: 0xb1, hi: 0xb2}, + {value: 0x0208, lo: 0xb3, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xb5}, + {value: 0x0208, lo: 0xb6, hi: 0xb8}, + {value: 0x0408, lo: 0xb9, hi: 0xb9}, + {value: 0x0208, lo: 0xba, hi: 0xbd}, + {value: 0x0040, lo: 0xbe, hi: 0xbf}, + // Block 0x10, offset 0xa3 + {value: 0x0000, lo: 0x04}, + {value: 0x0040, lo: 0x80, hi: 0x93}, + {value: 0x1308, lo: 0x94, hi: 0xa1}, + {value: 0x0040, lo: 0xa2, hi: 0xa2}, + {value: 0x1308, lo: 0xa3, hi: 0xbf}, + // Block 0x11, offset 0xa8 + {value: 0x0000, lo: 0x08}, + {value: 0x1308, lo: 0x80, hi: 0x82}, + {value: 0x1008, lo: 0x83, hi: 0x83}, + {value: 0x0008, lo: 0x84, hi: 0xb9}, + {value: 0x1308, lo: 0xba, hi: 0xba}, + {value: 0x1008, lo: 0xbb, hi: 0xbb}, + {value: 0x1308, lo: 0xbc, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbf}, + // Block 0x12, offset 0xb1 + {value: 0x0000, lo: 0x0f}, + {value: 0x1308, lo: 0x80, hi: 0x80}, + {value: 0x1008, lo: 0x81, hi: 0x82}, + {value: 0x0040, lo: 0x83, hi: 0x85}, + {value: 0x1008, lo: 0x86, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x1008, lo: 0x8a, hi: 0x8c}, + {value: 0x1b08, lo: 0x8d, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x90}, + {value: 0x0040, lo: 0x91, hi: 0x96}, + {value: 0x1008, lo: 0x97, hi: 0x97}, + {value: 0x0040, lo: 0x98, hi: 0xa5}, + {value: 0x0008, lo: 0xa6, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbf}, + // Block 0x13, offset 0xc1 + {value: 0x0000, lo: 0x0d}, + {value: 0x1308, lo: 0x80, hi: 0x80}, + {value: 0x1008, lo: 0x81, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0x84}, + {value: 0x0008, lo: 0x85, hi: 0x8c}, + {value: 0x0040, lo: 0x8d, hi: 0x8d}, + {value: 0x0008, lo: 0x8e, hi: 0x90}, + {value: 0x0040, lo: 0x91, hi: 0x91}, + {value: 0x0008, lo: 0x92, hi: 0xa8}, + {value: 0x0040, lo: 0xa9, hi: 0xa9}, + {value: 0x0008, lo: 0xaa, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbd}, + {value: 0x1308, lo: 0xbe, hi: 0xbf}, + // Block 0x14, offset 0xcf + {value: 0x0000, lo: 0x0c}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x1308, lo: 0x81, hi: 0x81}, + {value: 0x1008, lo: 0x82, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0x84}, + {value: 0x0008, lo: 0x85, hi: 0x8c}, + {value: 0x0040, lo: 0x8d, hi: 0x8d}, + {value: 0x0008, lo: 0x8e, hi: 0x90}, + {value: 0x0040, lo: 0x91, hi: 0x91}, + {value: 0x0008, lo: 0x92, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbf}, + // Block 0x15, offset 0xdc + {value: 0x0000, lo: 0x0b}, + {value: 0x0040, lo: 0x80, hi: 0x81}, + {value: 0x1008, lo: 0x82, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0x84}, + {value: 0x0008, lo: 0x85, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x99}, + {value: 0x0008, lo: 0x9a, hi: 0xb1}, + {value: 0x0040, lo: 0xb2, hi: 0xb2}, + {value: 0x0008, lo: 0xb3, hi: 0xbb}, + {value: 0x0040, lo: 0xbc, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbd}, + {value: 0x0040, lo: 0xbe, hi: 0xbf}, + // Block 0x16, offset 0xe8 + {value: 0x0000, lo: 0x10}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x89}, + {value: 0x1b08, lo: 0x8a, hi: 0x8a}, + {value: 0x0040, lo: 0x8b, hi: 0x8e}, + {value: 0x1008, lo: 0x8f, hi: 0x91}, + {value: 0x1308, lo: 0x92, hi: 0x94}, + {value: 0x0040, lo: 0x95, hi: 0x95}, + {value: 0x1308, lo: 0x96, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x97}, + {value: 0x1008, lo: 0x98, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xa5}, + {value: 0x0008, lo: 0xa6, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xb1}, + {value: 0x1008, lo: 0xb2, hi: 0xb3}, + {value: 0x0018, lo: 0xb4, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xbf}, + // Block 0x17, offset 0xf9 + {value: 0x0000, lo: 0x09}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x0008, lo: 0x81, hi: 0xb0}, + {value: 0x1308, lo: 0xb1, hi: 0xb1}, + {value: 0x0008, lo: 0xb2, hi: 0xb2}, + {value: 0x08f1, lo: 0xb3, hi: 0xb3}, + {value: 0x1308, lo: 0xb4, hi: 0xb9}, + {value: 0x1b08, lo: 0xba, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbe}, + {value: 0x0018, lo: 0xbf, hi: 0xbf}, + // Block 0x18, offset 0x103 + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x1308, lo: 0x87, hi: 0x8e}, + {value: 0x0018, lo: 0x8f, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0018, lo: 0x9a, hi: 0x9b}, + {value: 0x0040, lo: 0x9c, hi: 0xbf}, + // Block 0x19, offset 0x10a + {value: 0x0000, lo: 0x0c}, + {value: 0x0008, lo: 0x80, hi: 0x84}, + {value: 0x0040, lo: 0x85, hi: 0x85}, + {value: 0x0008, lo: 0x86, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x87}, + {value: 0x1308, lo: 0x88, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9b}, + {value: 0x0961, lo: 0x9c, hi: 0x9c}, + {value: 0x0999, lo: 0x9d, hi: 0x9d}, + {value: 0x0008, lo: 0x9e, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xbf}, + // Block 0x1a, offset 0x117 + {value: 0x0000, lo: 0x10}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x8a}, + {value: 0x0008, lo: 0x8b, hi: 0x8b}, + {value: 0xe03d, lo: 0x8c, hi: 0x8c}, + {value: 0x0018, lo: 0x8d, hi: 0x97}, + {value: 0x1308, lo: 0x98, hi: 0x99}, + {value: 0x0018, lo: 0x9a, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa9}, + {value: 0x0018, lo: 0xaa, hi: 0xb4}, + {value: 0x1308, lo: 0xb5, hi: 0xb5}, + {value: 0x0018, lo: 0xb6, hi: 0xb6}, + {value: 0x1308, lo: 0xb7, hi: 0xb7}, + {value: 0x0018, lo: 0xb8, hi: 0xb8}, + {value: 0x1308, lo: 0xb9, hi: 0xb9}, + {value: 0x0018, lo: 0xba, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbf}, + // Block 0x1b, offset 0x128 + {value: 0x0000, lo: 0x06}, + {value: 0x0018, lo: 0x80, hi: 0x85}, + {value: 0x1308, lo: 0x86, hi: 0x86}, + {value: 0x0018, lo: 0x87, hi: 0x8c}, + {value: 0x0040, lo: 0x8d, hi: 0x8d}, + {value: 0x0018, lo: 0x8e, hi: 0x9a}, + {value: 0x0040, lo: 0x9b, hi: 0xbf}, + // Block 0x1c, offset 0x12f + {value: 0x0000, lo: 0x0a}, + {value: 0x0008, lo: 0x80, hi: 0xaa}, + {value: 0x1008, lo: 0xab, hi: 0xac}, + {value: 0x1308, lo: 0xad, hi: 0xb0}, + {value: 0x1008, lo: 0xb1, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb7}, + {value: 0x1008, lo: 0xb8, hi: 0xb8}, + {value: 0x1b08, lo: 0xb9, hi: 0xba}, + {value: 0x1008, lo: 0xbb, hi: 0xbc}, + {value: 0x1308, lo: 0xbd, hi: 0xbe}, + {value: 0x0008, lo: 0xbf, hi: 0xbf}, + // Block 0x1d, offset 0x13a + {value: 0x0000, lo: 0x0e}, + {value: 0x0008, lo: 0x80, hi: 0x89}, + {value: 0x0018, lo: 0x8a, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x95}, + {value: 0x1008, lo: 0x96, hi: 0x97}, + {value: 0x1308, lo: 0x98, hi: 0x99}, + {value: 0x0008, lo: 0x9a, hi: 0x9d}, + {value: 0x1308, lo: 0x9e, hi: 0xa0}, + {value: 0x0008, lo: 0xa1, hi: 0xa1}, + {value: 0x1008, lo: 0xa2, hi: 0xa4}, + {value: 0x0008, lo: 0xa5, hi: 0xa6}, + {value: 0x1008, lo: 0xa7, hi: 0xad}, + {value: 0x0008, lo: 0xae, hi: 0xb0}, + {value: 0x1308, lo: 0xb1, hi: 0xb4}, + {value: 0x0008, lo: 0xb5, hi: 0xbf}, + // Block 0x1e, offset 0x149 + {value: 0x0000, lo: 0x0d}, + {value: 0x0008, lo: 0x80, hi: 0x81}, + {value: 0x1308, lo: 0x82, hi: 0x82}, + {value: 0x1008, lo: 0x83, hi: 0x84}, + {value: 0x1308, lo: 0x85, hi: 0x86}, + {value: 0x1008, lo: 0x87, hi: 0x8c}, + {value: 0x1308, lo: 0x8d, hi: 0x8d}, + {value: 0x0008, lo: 0x8e, hi: 0x8e}, + {value: 0x1008, lo: 0x8f, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x1008, lo: 0x9a, hi: 0x9c}, + {value: 0x1308, lo: 0x9d, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xbf}, + // Block 0x1f, offset 0x157 + {value: 0x0000, lo: 0x09}, + {value: 0x0040, lo: 0x80, hi: 0x86}, + {value: 0x055d, lo: 0x87, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8c}, + {value: 0x055d, lo: 0x8d, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xba}, + {value: 0x0018, lo: 0xbb, hi: 0xbb}, + {value: 0xe105, lo: 0xbc, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbf}, + // Block 0x20, offset 0x161 + {value: 0x0000, lo: 0x01}, + {value: 0x0018, lo: 0x80, hi: 0xbf}, + // Block 0x21, offset 0x163 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0xa0}, + {value: 0x0018, lo: 0xa1, hi: 0xbf}, + // Block 0x22, offset 0x167 + {value: 0x0000, lo: 0x01}, + {value: 0x0008, lo: 0x80, hi: 0xbf}, + // Block 0x23, offset 0x169 + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x0008, lo: 0x8a, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x97}, + {value: 0x0008, lo: 0x98, hi: 0x98}, + {value: 0x0040, lo: 0x99, hi: 0x99}, + {value: 0x0008, lo: 0x9a, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0x24, offset 0x175 + {value: 0x0000, lo: 0x0a}, + {value: 0x0008, lo: 0x80, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x0008, lo: 0x8a, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xb0}, + {value: 0x0040, lo: 0xb1, hi: 0xb1}, + {value: 0x0008, lo: 0xb2, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xb7}, + {value: 0x0008, lo: 0xb8, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0x25, offset 0x180 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0x0040, lo: 0x81, hi: 0x81}, + {value: 0x0008, lo: 0x82, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0x87}, + {value: 0x0008, lo: 0x88, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x97}, + {value: 0x0008, lo: 0x98, hi: 0xbf}, + // Block 0x26, offset 0x188 + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x90}, + {value: 0x0040, lo: 0x91, hi: 0x91}, + {value: 0x0008, lo: 0x92, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0x97}, + {value: 0x0008, lo: 0x98, hi: 0xbf}, + // Block 0x27, offset 0x18e + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x9a}, + {value: 0x0040, lo: 0x9b, hi: 0x9c}, + {value: 0x1308, lo: 0x9d, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xbc}, + {value: 0x0040, lo: 0xbd, hi: 0xbf}, + // Block 0x28, offset 0x194 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0x29, offset 0x199 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xb7}, + {value: 0xe045, lo: 0xb8, hi: 0xbd}, + {value: 0x0040, lo: 0xbe, hi: 0xbf}, + // Block 0x2a, offset 0x19e + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0x80}, + {value: 0x0008, lo: 0x81, hi: 0xbf}, + // Block 0x2b, offset 0x1a1 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xac}, + {value: 0x0018, lo: 0xad, hi: 0xae}, + {value: 0x0008, lo: 0xaf, hi: 0xbf}, + // Block 0x2c, offset 0x1a5 + {value: 0x0000, lo: 0x05}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x0008, lo: 0x81, hi: 0x9a}, + {value: 0x0018, lo: 0x9b, hi: 0x9c}, + {value: 0x0040, lo: 0x9d, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0x2d, offset 0x1ab + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xaa}, + {value: 0x0018, lo: 0xab, hi: 0xb0}, + {value: 0x0008, lo: 0xb1, hi: 0xb8}, + {value: 0x0040, lo: 0xb9, hi: 0xbf}, + // Block 0x2e, offset 0x1b0 + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x8c}, + {value: 0x0040, lo: 0x8d, hi: 0x8d}, + {value: 0x0008, lo: 0x8e, hi: 0x91}, + {value: 0x1308, lo: 0x92, hi: 0x93}, + {value: 0x1b08, lo: 0x94, hi: 0x94}, + {value: 0x0040, lo: 0x95, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb3}, + {value: 0x1b08, lo: 0xb4, hi: 0xb4}, + {value: 0x0018, lo: 0xb5, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0x2f, offset 0x1bc + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x91}, + {value: 0x1308, lo: 0x92, hi: 0x93}, + {value: 0x0040, lo: 0x94, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xac}, + {value: 0x0040, lo: 0xad, hi: 0xad}, + {value: 0x0008, lo: 0xae, hi: 0xb0}, + {value: 0x0040, lo: 0xb1, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xbf}, + // Block 0x30, offset 0x1c6 + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0xb3}, + {value: 0x1340, lo: 0xb4, hi: 0xb5}, + {value: 0x1008, lo: 0xb6, hi: 0xb6}, + {value: 0x1308, lo: 0xb7, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbf}, + // Block 0x31, offset 0x1cc + {value: 0x0000, lo: 0x10}, + {value: 0x1008, lo: 0x80, hi: 0x85}, + {value: 0x1308, lo: 0x86, hi: 0x86}, + {value: 0x1008, lo: 0x87, hi: 0x88}, + {value: 0x1308, lo: 0x89, hi: 0x91}, + {value: 0x1b08, lo: 0x92, hi: 0x92}, + {value: 0x1308, lo: 0x93, hi: 0x93}, + {value: 0x0018, lo: 0x94, hi: 0x96}, + {value: 0x0008, lo: 0x97, hi: 0x97}, + {value: 0x0018, lo: 0x98, hi: 0x9b}, + {value: 0x0008, lo: 0x9c, hi: 0x9c}, + {value: 0x1308, lo: 0x9d, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa9}, + {value: 0x0040, lo: 0xaa, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbf}, + // Block 0x32, offset 0x1dd + {value: 0x0000, lo: 0x09}, + {value: 0x0018, lo: 0x80, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0x86}, + {value: 0x0218, lo: 0x87, hi: 0x87}, + {value: 0x0018, lo: 0x88, hi: 0x8a}, + {value: 0x13c0, lo: 0x8b, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9f}, + {value: 0x0208, lo: 0xa0, hi: 0xbf}, + // Block 0x33, offset 0x1e7 + {value: 0x0000, lo: 0x02}, + {value: 0x0208, lo: 0x80, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xbf}, + // Block 0x34, offset 0x1ea + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0x84}, + {value: 0x1308, lo: 0x85, hi: 0x86}, + {value: 0x0208, lo: 0x87, hi: 0xa8}, + {value: 0x1308, lo: 0xa9, hi: 0xa9}, + {value: 0x0208, lo: 0xaa, hi: 0xaa}, + {value: 0x0040, lo: 0xab, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x35, offset 0x1f2 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xbf}, + // Block 0x36, offset 0x1f5 + {value: 0x0000, lo: 0x0c}, + {value: 0x0008, lo: 0x80, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0x9f}, + {value: 0x1308, lo: 0xa0, hi: 0xa2}, + {value: 0x1008, lo: 0xa3, hi: 0xa6}, + {value: 0x1308, lo: 0xa7, hi: 0xa8}, + {value: 0x1008, lo: 0xa9, hi: 0xab}, + {value: 0x0040, lo: 0xac, hi: 0xaf}, + {value: 0x1008, lo: 0xb0, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb2}, + {value: 0x1008, lo: 0xb3, hi: 0xb8}, + {value: 0x1308, lo: 0xb9, hi: 0xbb}, + {value: 0x0040, lo: 0xbc, hi: 0xbf}, + // Block 0x37, offset 0x202 + {value: 0x0000, lo: 0x07}, + {value: 0x0018, lo: 0x80, hi: 0x80}, + {value: 0x0040, lo: 0x81, hi: 0x83}, + {value: 0x0018, lo: 0x84, hi: 0x85}, + {value: 0x0008, lo: 0x86, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xbf}, + // Block 0x38, offset 0x20a + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xab}, + {value: 0x0040, lo: 0xac, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x39, offset 0x20e + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0x89}, + {value: 0x0040, lo: 0x8a, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0028, lo: 0x9a, hi: 0x9a}, + {value: 0x0040, lo: 0x9b, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0xbf}, + // Block 0x3a, offset 0x215 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0x96}, + {value: 0x1308, lo: 0x97, hi: 0x98}, + {value: 0x1008, lo: 0x99, hi: 0x9a}, + {value: 0x1308, lo: 0x9b, hi: 0x9b}, + {value: 0x0040, lo: 0x9c, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0x3b, offset 0x21d + {value: 0x0000, lo: 0x0f}, + {value: 0x0008, lo: 0x80, hi: 0x94}, + {value: 0x1008, lo: 0x95, hi: 0x95}, + {value: 0x1308, lo: 0x96, hi: 0x96}, + {value: 0x1008, lo: 0x97, hi: 0x97}, + {value: 0x1308, lo: 0x98, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0x9f}, + {value: 0x1b08, lo: 0xa0, hi: 0xa0}, + {value: 0x1008, lo: 0xa1, hi: 0xa1}, + {value: 0x1308, lo: 0xa2, hi: 0xa2}, + {value: 0x1008, lo: 0xa3, hi: 0xa4}, + {value: 0x1308, lo: 0xa5, hi: 0xac}, + {value: 0x1008, lo: 0xad, hi: 0xb2}, + {value: 0x1308, lo: 0xb3, hi: 0xbc}, + {value: 0x0040, lo: 0xbd, hi: 0xbe}, + {value: 0x1308, lo: 0xbf, hi: 0xbf}, + // Block 0x3c, offset 0x22d + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x89}, + {value: 0x0040, lo: 0x8a, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xa6}, + {value: 0x0008, lo: 0xa7, hi: 0xa7}, + {value: 0x0018, lo: 0xa8, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xbd}, + {value: 0x1318, lo: 0xbe, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0x3d, offset 0x239 + {value: 0x0000, lo: 0x01}, + {value: 0x0040, lo: 0x80, hi: 0xbf}, + // Block 0x3e, offset 0x23b + {value: 0x0000, lo: 0x09}, + {value: 0x1308, lo: 0x80, hi: 0x83}, + {value: 0x1008, lo: 0x84, hi: 0x84}, + {value: 0x0008, lo: 0x85, hi: 0xb3}, + {value: 0x1308, lo: 0xb4, hi: 0xb4}, + {value: 0x1008, lo: 0xb5, hi: 0xb5}, + {value: 0x1308, lo: 0xb6, hi: 0xba}, + {value: 0x1008, lo: 0xbb, hi: 0xbb}, + {value: 0x1308, lo: 0xbc, hi: 0xbc}, + {value: 0x1008, lo: 0xbd, hi: 0xbf}, + // Block 0x3f, offset 0x245 + {value: 0x0000, lo: 0x0b}, + {value: 0x1008, lo: 0x80, hi: 0x81}, + {value: 0x1308, lo: 0x82, hi: 0x82}, + {value: 0x1008, lo: 0x83, hi: 0x83}, + {value: 0x1808, lo: 0x84, hi: 0x84}, + {value: 0x0008, lo: 0x85, hi: 0x8b}, + {value: 0x0040, lo: 0x8c, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0018, lo: 0x9a, hi: 0xaa}, + {value: 0x1308, lo: 0xab, hi: 0xb3}, + {value: 0x0018, lo: 0xb4, hi: 0xbc}, + {value: 0x0040, lo: 0xbd, hi: 0xbf}, + // Block 0x40, offset 0x251 + {value: 0x0000, lo: 0x0b}, + {value: 0x1308, lo: 0x80, hi: 0x81}, + {value: 0x1008, lo: 0x82, hi: 0x82}, + {value: 0x0008, lo: 0x83, hi: 0xa0}, + {value: 0x1008, lo: 0xa1, hi: 0xa1}, + {value: 0x1308, lo: 0xa2, hi: 0xa5}, + {value: 0x1008, lo: 0xa6, hi: 0xa7}, + {value: 0x1308, lo: 0xa8, hi: 0xa9}, + {value: 0x1808, lo: 0xaa, hi: 0xaa}, + {value: 0x1b08, lo: 0xab, hi: 0xab}, + {value: 0x1308, lo: 0xac, hi: 0xad}, + {value: 0x0008, lo: 0xae, hi: 0xbf}, + // Block 0x41, offset 0x25d + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0xa5}, + {value: 0x1308, lo: 0xa6, hi: 0xa6}, + {value: 0x1008, lo: 0xa7, hi: 0xa7}, + {value: 0x1308, lo: 0xa8, hi: 0xa9}, + {value: 0x1008, lo: 0xaa, hi: 0xac}, + {value: 0x1308, lo: 0xad, hi: 0xad}, + {value: 0x1008, lo: 0xae, hi: 0xae}, + {value: 0x1308, lo: 0xaf, hi: 0xb1}, + {value: 0x1808, lo: 0xb2, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xbb}, + {value: 0x0018, lo: 0xbc, hi: 0xbf}, + // Block 0x42, offset 0x269 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0xa3}, + {value: 0x1008, lo: 0xa4, hi: 0xab}, + {value: 0x1308, lo: 0xac, hi: 0xb3}, + {value: 0x1008, lo: 0xb4, hi: 0xb5}, + {value: 0x1308, lo: 0xb6, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xba}, + {value: 0x0018, lo: 0xbb, hi: 0xbf}, + // Block 0x43, offset 0x271 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x89}, + {value: 0x0040, lo: 0x8a, hi: 0x8c}, + {value: 0x0008, lo: 0x8d, hi: 0xbd}, + {value: 0x0018, lo: 0xbe, hi: 0xbf}, + // Block 0x44, offset 0x276 + {value: 0x0000, lo: 0x09}, + {value: 0x0e29, lo: 0x80, hi: 0x80}, + {value: 0x0e41, lo: 0x81, hi: 0x81}, + {value: 0x0e59, lo: 0x82, hi: 0x82}, + {value: 0x0e71, lo: 0x83, hi: 0x83}, + {value: 0x0e89, lo: 0x84, hi: 0x85}, + {value: 0x0ea1, lo: 0x86, hi: 0x86}, + {value: 0x0eb9, lo: 0x87, hi: 0x87}, + {value: 0x057d, lo: 0x88, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0xbf}, + // Block 0x45, offset 0x280 + {value: 0x0000, lo: 0x10}, + {value: 0x0018, lo: 0x80, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8f}, + {value: 0x1308, lo: 0x90, hi: 0x92}, + {value: 0x0018, lo: 0x93, hi: 0x93}, + {value: 0x1308, lo: 0x94, hi: 0xa0}, + {value: 0x1008, lo: 0xa1, hi: 0xa1}, + {value: 0x1308, lo: 0xa2, hi: 0xa8}, + {value: 0x0008, lo: 0xa9, hi: 0xac}, + {value: 0x1308, lo: 0xad, hi: 0xad}, + {value: 0x0008, lo: 0xae, hi: 0xb1}, + {value: 0x1008, lo: 0xb2, hi: 0xb3}, + {value: 0x1308, lo: 0xb4, hi: 0xb4}, + {value: 0x0008, lo: 0xb5, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xb7}, + {value: 0x1308, lo: 0xb8, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbf}, + // Block 0x46, offset 0x291 + {value: 0x0000, lo: 0x03}, + {value: 0x1308, lo: 0x80, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xba}, + {value: 0x1308, lo: 0xbb, hi: 0xbf}, + // Block 0x47, offset 0x295 + {value: 0x0000, lo: 0x0a}, + {value: 0x0008, lo: 0x80, hi: 0x87}, + {value: 0xe045, lo: 0x88, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0x97}, + {value: 0xe045, lo: 0x98, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa7}, + {value: 0xe045, lo: 0xa8, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb7}, + {value: 0xe045, lo: 0xb8, hi: 0xbf}, + // Block 0x48, offset 0x2a0 + {value: 0x0000, lo: 0x03}, + {value: 0x0040, lo: 0x80, hi: 0x8f}, + {value: 0x1318, lo: 0x90, hi: 0xb0}, + {value: 0x0040, lo: 0xb1, hi: 0xbf}, + // Block 0x49, offset 0x2a4 + {value: 0x0000, lo: 0x08}, + {value: 0x0018, lo: 0x80, hi: 0x82}, + {value: 0x0040, lo: 0x83, hi: 0x83}, + {value: 0x0008, lo: 0x84, hi: 0x84}, + {value: 0x0018, lo: 0x85, hi: 0x88}, + {value: 0x24c1, lo: 0x89, hi: 0x89}, + {value: 0x0018, lo: 0x8a, hi: 0x8b}, + {value: 0x0040, lo: 0x8c, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0xbf}, + // Block 0x4a, offset 0x2ad + {value: 0x0000, lo: 0x07}, + {value: 0x0018, lo: 0x80, hi: 0xab}, + {value: 0x24f1, lo: 0xac, hi: 0xac}, + {value: 0x2529, lo: 0xad, hi: 0xad}, + {value: 0x0018, lo: 0xae, hi: 0xae}, + {value: 0x2579, lo: 0xaf, hi: 0xaf}, + {value: 0x25b1, lo: 0xb0, hi: 0xb0}, + {value: 0x0018, lo: 0xb1, hi: 0xbf}, + // Block 0x4b, offset 0x2b5 + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0x9f}, + {value: 0x0080, lo: 0xa0, hi: 0xa0}, + {value: 0x0018, lo: 0xa1, hi: 0xad}, + {value: 0x0080, lo: 0xae, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xbf}, + // Block 0x4c, offset 0x2bb + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0xa8}, + {value: 0x09c5, lo: 0xa9, hi: 0xa9}, + {value: 0x09e5, lo: 0xaa, hi: 0xaa}, + {value: 0x0018, lo: 0xab, hi: 0xbf}, + // Block 0x4d, offset 0x2c0 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0x4e, offset 0x2c3 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0xa6}, + {value: 0x0040, lo: 0xa7, hi: 0xbf}, + // Block 0x4f, offset 0x2c6 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0x8b}, + {value: 0x28c1, lo: 0x8c, hi: 0x8c}, + {value: 0x0018, lo: 0x8d, hi: 0xbf}, + // Block 0x50, offset 0x2ca + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0xb3}, + {value: 0x0e66, lo: 0xb4, hi: 0xb4}, + {value: 0x292a, lo: 0xb5, hi: 0xb5}, + {value: 0x0e86, lo: 0xb6, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xbf}, + // Block 0x51, offset 0x2d0 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0x9b}, + {value: 0x2941, lo: 0x9c, hi: 0x9c}, + {value: 0x0018, lo: 0x9d, hi: 0xbf}, + // Block 0x52, offset 0x2d4 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xb5}, + {value: 0x0018, lo: 0xb6, hi: 0xbf}, + // Block 0x53, offset 0x2d8 + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0x97}, + {value: 0x0018, lo: 0x98, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbc}, + {value: 0x0018, lo: 0xbd, hi: 0xbf}, + // Block 0x54, offset 0x2de + {value: 0x0000, lo: 0x06}, + {value: 0x0018, lo: 0x80, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x0018, lo: 0x8a, hi: 0x91}, + {value: 0x0040, lo: 0x92, hi: 0xab}, + {value: 0x0018, lo: 0xac, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbf}, + // Block 0x55, offset 0x2e5 + {value: 0x0000, lo: 0x05}, + {value: 0xe185, lo: 0x80, hi: 0x8f}, + {value: 0x03f5, lo: 0x90, hi: 0x9f}, + {value: 0x0ea5, lo: 0xa0, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x56, offset 0x2eb + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0xa5}, + {value: 0x0040, lo: 0xa6, hi: 0xa6}, + {value: 0x0008, lo: 0xa7, hi: 0xa7}, + {value: 0x0040, lo: 0xa8, hi: 0xac}, + {value: 0x0008, lo: 0xad, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x57, offset 0x2f3 + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0xa7}, + {value: 0x0040, lo: 0xa8, hi: 0xae}, + {value: 0xe075, lo: 0xaf, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb0}, + {value: 0x0040, lo: 0xb1, hi: 0xbe}, + {value: 0x1b08, lo: 0xbf, hi: 0xbf}, + // Block 0x58, offset 0x2fa + {value: 0x0000, lo: 0x0a}, + {value: 0x0008, lo: 0x80, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa6}, + {value: 0x0040, lo: 0xa7, hi: 0xa7}, + {value: 0x0008, lo: 0xa8, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xb7}, + {value: 0x0008, lo: 0xb8, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0x59, offset 0x305 + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x87}, + {value: 0x0008, lo: 0x88, hi: 0x8e}, + {value: 0x0040, lo: 0x8f, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x97}, + {value: 0x0008, lo: 0x98, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0x9f}, + {value: 0x1308, lo: 0xa0, hi: 0xbf}, + // Block 0x5a, offset 0x30f + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0xae}, + {value: 0x0008, lo: 0xaf, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xbf}, + // Block 0x5b, offset 0x313 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0x84}, + {value: 0x0040, lo: 0x85, hi: 0xbf}, + // Block 0x5c, offset 0x316 + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9a}, + {value: 0x0018, lo: 0x9b, hi: 0x9e}, + {value: 0x0edd, lo: 0x9f, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xbf}, + // Block 0x5d, offset 0x31c + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0xb2}, + {value: 0x0efd, lo: 0xb3, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xbf}, + // Block 0x5e, offset 0x320 + {value: 0x0020, lo: 0x01}, + {value: 0x0f1d, lo: 0x80, hi: 0xbf}, + // Block 0x5f, offset 0x322 + {value: 0x0020, lo: 0x02}, + {value: 0x171d, lo: 0x80, hi: 0x8f}, + {value: 0x18fd, lo: 0x90, hi: 0xbf}, + // Block 0x60, offset 0x325 + {value: 0x0020, lo: 0x01}, + {value: 0x1efd, lo: 0x80, hi: 0xbf}, + // Block 0x61, offset 0x327 + {value: 0x0000, lo: 0x02}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x0008, lo: 0x81, hi: 0xbf}, + // Block 0x62, offset 0x32a + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x98}, + {value: 0x1308, lo: 0x99, hi: 0x9a}, + {value: 0x29e2, lo: 0x9b, hi: 0x9b}, + {value: 0x2a0a, lo: 0x9c, hi: 0x9c}, + {value: 0x0008, lo: 0x9d, hi: 0x9e}, + {value: 0x2a31, lo: 0x9f, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xa0}, + {value: 0x0008, lo: 0xa1, hi: 0xbf}, + // Block 0x63, offset 0x334 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xbe}, + {value: 0x2a69, lo: 0xbf, hi: 0xbf}, + // Block 0x64, offset 0x337 + {value: 0x0000, lo: 0x0e}, + {value: 0x0040, lo: 0x80, hi: 0x84}, + {value: 0x0008, lo: 0x85, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xb0}, + {value: 0x2a1d, lo: 0xb1, hi: 0xb1}, + {value: 0x2a3d, lo: 0xb2, hi: 0xb2}, + {value: 0x2a5d, lo: 0xb3, hi: 0xb3}, + {value: 0x2a7d, lo: 0xb4, hi: 0xb4}, + {value: 0x2a5d, lo: 0xb5, hi: 0xb5}, + {value: 0x2a9d, lo: 0xb6, hi: 0xb6}, + {value: 0x2abd, lo: 0xb7, hi: 0xb7}, + {value: 0x2add, lo: 0xb8, hi: 0xb9}, + {value: 0x2afd, lo: 0xba, hi: 0xbb}, + {value: 0x2b1d, lo: 0xbc, hi: 0xbd}, + {value: 0x2afd, lo: 0xbe, hi: 0xbf}, + // Block 0x65, offset 0x346 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0xa3}, + {value: 0x0040, lo: 0xa4, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x66, offset 0x34a + {value: 0x0030, lo: 0x04}, + {value: 0x2aa2, lo: 0x80, hi: 0x9d}, + {value: 0x305a, lo: 0x9e, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0x9f}, + {value: 0x30a2, lo: 0xa0, hi: 0xbf}, + // Block 0x67, offset 0x34f + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0xbf}, + // Block 0x68, offset 0x352 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0x8c}, + {value: 0x0040, lo: 0x8d, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0xbf}, + // Block 0x69, offset 0x356 + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xbd}, + {value: 0x0018, lo: 0xbe, hi: 0xbf}, + // Block 0x6a, offset 0x35b + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x8c}, + {value: 0x0018, lo: 0x8d, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xab}, + {value: 0x0040, lo: 0xac, hi: 0xbf}, + // Block 0x6b, offset 0x360 + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0xa5}, + {value: 0x0018, lo: 0xa6, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb1}, + {value: 0x0018, lo: 0xb2, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xbf}, + // Block 0x6c, offset 0x366 + {value: 0x0000, lo: 0x05}, + {value: 0x0040, lo: 0x80, hi: 0xb6}, + {value: 0x0008, lo: 0xb7, hi: 0xb7}, + {value: 0x2009, lo: 0xb8, hi: 0xb8}, + {value: 0x6e89, lo: 0xb9, hi: 0xb9}, + {value: 0x0008, lo: 0xba, hi: 0xbf}, + // Block 0x6d, offset 0x36c + {value: 0x0000, lo: 0x0e}, + {value: 0x0008, lo: 0x80, hi: 0x81}, + {value: 0x1308, lo: 0x82, hi: 0x82}, + {value: 0x0008, lo: 0x83, hi: 0x85}, + {value: 0x1b08, lo: 0x86, hi: 0x86}, + {value: 0x0008, lo: 0x87, hi: 0x8a}, + {value: 0x1308, lo: 0x8b, hi: 0x8b}, + {value: 0x0008, lo: 0x8c, hi: 0xa2}, + {value: 0x1008, lo: 0xa3, hi: 0xa4}, + {value: 0x1308, lo: 0xa5, hi: 0xa6}, + {value: 0x1008, lo: 0xa7, hi: 0xa7}, + {value: 0x0018, lo: 0xa8, hi: 0xab}, + {value: 0x0040, lo: 0xac, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbf}, + // Block 0x6e, offset 0x37b + {value: 0x0000, lo: 0x05}, + {value: 0x0208, lo: 0x80, hi: 0xb1}, + {value: 0x0108, lo: 0xb2, hi: 0xb2}, + {value: 0x0008, lo: 0xb3, hi: 0xb3}, + {value: 0x0018, lo: 0xb4, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xbf}, + // Block 0x6f, offset 0x381 + {value: 0x0000, lo: 0x03}, + {value: 0x1008, lo: 0x80, hi: 0x81}, + {value: 0x0008, lo: 0x82, hi: 0xb3}, + {value: 0x1008, lo: 0xb4, hi: 0xbf}, + // Block 0x70, offset 0x385 + {value: 0x0000, lo: 0x0e}, + {value: 0x1008, lo: 0x80, hi: 0x83}, + {value: 0x1b08, lo: 0x84, hi: 0x84}, + {value: 0x1308, lo: 0x85, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0x8d}, + {value: 0x0018, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9f}, + {value: 0x1308, lo: 0xa0, hi: 0xb1}, + {value: 0x0008, lo: 0xb2, hi: 0xb7}, + {value: 0x0018, lo: 0xb8, hi: 0xba}, + {value: 0x0008, lo: 0xbb, hi: 0xbb}, + {value: 0x0018, lo: 0xbc, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbd}, + {value: 0x0040, lo: 0xbe, hi: 0xbf}, + // Block 0x71, offset 0x394 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xa5}, + {value: 0x1308, lo: 0xa6, hi: 0xad}, + {value: 0x0018, lo: 0xae, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x72, offset 0x399 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x1308, lo: 0x87, hi: 0x91}, + {value: 0x1008, lo: 0x92, hi: 0x92}, + {value: 0x1808, lo: 0x93, hi: 0x93}, + {value: 0x0040, lo: 0x94, hi: 0x9e}, + {value: 0x0018, lo: 0x9f, hi: 0xbc}, + {value: 0x0040, lo: 0xbd, hi: 0xbf}, + // Block 0x73, offset 0x3a1 + {value: 0x0000, lo: 0x09}, + {value: 0x1308, lo: 0x80, hi: 0x82}, + {value: 0x1008, lo: 0x83, hi: 0x83}, + {value: 0x0008, lo: 0x84, hi: 0xb2}, + {value: 0x1308, lo: 0xb3, hi: 0xb3}, + {value: 0x1008, lo: 0xb4, hi: 0xb5}, + {value: 0x1308, lo: 0xb6, hi: 0xb9}, + {value: 0x1008, lo: 0xba, hi: 0xbb}, + {value: 0x1308, lo: 0xbc, hi: 0xbc}, + {value: 0x1008, lo: 0xbd, hi: 0xbf}, + // Block 0x74, offset 0x3ab + {value: 0x0000, lo: 0x0a}, + {value: 0x1808, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8e}, + {value: 0x0008, lo: 0x8f, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa4}, + {value: 0x1308, lo: 0xa5, hi: 0xa5}, + {value: 0x0008, lo: 0xa6, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0x75, offset 0x3b6 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0xa8}, + {value: 0x1308, lo: 0xa9, hi: 0xae}, + {value: 0x1008, lo: 0xaf, hi: 0xb0}, + {value: 0x1308, lo: 0xb1, hi: 0xb2}, + {value: 0x1008, lo: 0xb3, hi: 0xb4}, + {value: 0x1308, lo: 0xb5, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0x76, offset 0x3be + {value: 0x0000, lo: 0x10}, + {value: 0x0008, lo: 0x80, hi: 0x82}, + {value: 0x1308, lo: 0x83, hi: 0x83}, + {value: 0x0008, lo: 0x84, hi: 0x8b}, + {value: 0x1308, lo: 0x8c, hi: 0x8c}, + {value: 0x1008, lo: 0x8d, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9b}, + {value: 0x0018, lo: 0x9c, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xb9}, + {value: 0x0008, lo: 0xba, hi: 0xba}, + {value: 0x1008, lo: 0xbb, hi: 0xbb}, + {value: 0x1308, lo: 0xbc, hi: 0xbc}, + {value: 0x1008, lo: 0xbd, hi: 0xbd}, + {value: 0x0008, lo: 0xbe, hi: 0xbf}, + // Block 0x77, offset 0x3cf + {value: 0x0000, lo: 0x08}, + {value: 0x0008, lo: 0x80, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb0}, + {value: 0x0008, lo: 0xb1, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb4}, + {value: 0x0008, lo: 0xb5, hi: 0xb6}, + {value: 0x1308, lo: 0xb7, hi: 0xb8}, + {value: 0x0008, lo: 0xb9, hi: 0xbd}, + {value: 0x1308, lo: 0xbe, hi: 0xbf}, + // Block 0x78, offset 0x3d8 + {value: 0x0000, lo: 0x0f}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0x1308, lo: 0x81, hi: 0x81}, + {value: 0x0008, lo: 0x82, hi: 0x82}, + {value: 0x0040, lo: 0x83, hi: 0x9a}, + {value: 0x0008, lo: 0x9b, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xaa}, + {value: 0x1008, lo: 0xab, hi: 0xab}, + {value: 0x1308, lo: 0xac, hi: 0xad}, + {value: 0x1008, lo: 0xae, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb1}, + {value: 0x0008, lo: 0xb2, hi: 0xb4}, + {value: 0x1008, lo: 0xb5, hi: 0xb5}, + {value: 0x1b08, lo: 0xb6, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0x79, offset 0x3e8 + {value: 0x0000, lo: 0x0c}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x0008, lo: 0x81, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x88}, + {value: 0x0008, lo: 0x89, hi: 0x8e}, + {value: 0x0040, lo: 0x8f, hi: 0x90}, + {value: 0x0008, lo: 0x91, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa6}, + {value: 0x0040, lo: 0xa7, hi: 0xa7}, + {value: 0x0008, lo: 0xa8, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x7a, offset 0x3f5 + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x9a}, + {value: 0x0018, lo: 0x9b, hi: 0x9b}, + {value: 0x4465, lo: 0x9c, hi: 0x9c}, + {value: 0x447d, lo: 0x9d, hi: 0x9d}, + {value: 0x2971, lo: 0x9e, hi: 0x9e}, + {value: 0xe06d, lo: 0x9f, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa5}, + {value: 0x0040, lo: 0xa6, hi: 0xaf}, + {value: 0x4495, lo: 0xb0, hi: 0xbf}, + // Block 0x7b, offset 0x3ff + {value: 0x0000, lo: 0x04}, + {value: 0x44b5, lo: 0x80, hi: 0x8f}, + {value: 0x44d5, lo: 0x90, hi: 0x9f}, + {value: 0x44f5, lo: 0xa0, hi: 0xaf}, + {value: 0x44d5, lo: 0xb0, hi: 0xbf}, + // Block 0x7c, offset 0x404 + {value: 0x0000, lo: 0x0c}, + {value: 0x0008, lo: 0x80, hi: 0xa2}, + {value: 0x1008, lo: 0xa3, hi: 0xa4}, + {value: 0x1308, lo: 0xa5, hi: 0xa5}, + {value: 0x1008, lo: 0xa6, hi: 0xa7}, + {value: 0x1308, lo: 0xa8, hi: 0xa8}, + {value: 0x1008, lo: 0xa9, hi: 0xaa}, + {value: 0x0018, lo: 0xab, hi: 0xab}, + {value: 0x1008, lo: 0xac, hi: 0xac}, + {value: 0x1b08, lo: 0xad, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbf}, + // Block 0x7d, offset 0x411 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xa3}, + {value: 0x0040, lo: 0xa4, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xbf}, + // Block 0x7e, offset 0x415 + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x8a}, + {value: 0x0018, lo: 0x8b, hi: 0xbb}, + {value: 0x0040, lo: 0xbc, hi: 0xbf}, + // Block 0x7f, offset 0x41a + {value: 0x0020, lo: 0x01}, + {value: 0x4515, lo: 0x80, hi: 0xbf}, + // Block 0x80, offset 0x41c + {value: 0x0020, lo: 0x03}, + {value: 0x4d15, lo: 0x80, hi: 0x94}, + {value: 0x4ad5, lo: 0x95, hi: 0x95}, + {value: 0x4fb5, lo: 0x96, hi: 0xbf}, + // Block 0x81, offset 0x420 + {value: 0x0020, lo: 0x01}, + {value: 0x54f5, lo: 0x80, hi: 0xbf}, + // Block 0x82, offset 0x422 + {value: 0x0020, lo: 0x03}, + {value: 0x5cf5, lo: 0x80, hi: 0x84}, + {value: 0x5655, lo: 0x85, hi: 0x85}, + {value: 0x5d95, lo: 0x86, hi: 0xbf}, + // Block 0x83, offset 0x426 + {value: 0x0020, lo: 0x08}, + {value: 0x6b55, lo: 0x80, hi: 0x8f}, + {value: 0x6d15, lo: 0x90, hi: 0x90}, + {value: 0x6d55, lo: 0x91, hi: 0xab}, + {value: 0x6ea1, lo: 0xac, hi: 0xac}, + {value: 0x70b5, lo: 0xad, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xaf}, + {value: 0x70d5, lo: 0xb0, hi: 0xbf}, + // Block 0x84, offset 0x42f + {value: 0x0020, lo: 0x05}, + {value: 0x72d5, lo: 0x80, hi: 0xad}, + {value: 0x6535, lo: 0xae, hi: 0xae}, + {value: 0x7895, lo: 0xaf, hi: 0xb5}, + {value: 0x6f55, lo: 0xb6, hi: 0xb6}, + {value: 0x7975, lo: 0xb7, hi: 0xbf}, + // Block 0x85, offset 0x435 + {value: 0x0028, lo: 0x03}, + {value: 0x7c21, lo: 0x80, hi: 0x82}, + {value: 0x7be1, lo: 0x83, hi: 0x83}, + {value: 0x7c99, lo: 0x84, hi: 0xbf}, + // Block 0x86, offset 0x439 + {value: 0x0038, lo: 0x0f}, + {value: 0x9db1, lo: 0x80, hi: 0x83}, + {value: 0x9e59, lo: 0x84, hi: 0x85}, + {value: 0x9e91, lo: 0x86, hi: 0x87}, + {value: 0x9ec9, lo: 0x88, hi: 0x8f}, + {value: 0x0040, lo: 0x90, hi: 0x90}, + {value: 0x0040, lo: 0x91, hi: 0x91}, + {value: 0xa089, lo: 0x92, hi: 0x97}, + {value: 0xa1a1, lo: 0x98, hi: 0x9c}, + {value: 0xa281, lo: 0x9d, hi: 0xb3}, + {value: 0x9d41, lo: 0xb4, hi: 0xb4}, + {value: 0x9db1, lo: 0xb5, hi: 0xb5}, + {value: 0xa789, lo: 0xb6, hi: 0xbb}, + {value: 0xa869, lo: 0xbc, hi: 0xbc}, + {value: 0xa7f9, lo: 0xbd, hi: 0xbd}, + {value: 0xa8d9, lo: 0xbe, hi: 0xbf}, + // Block 0x87, offset 0x449 + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x8b}, + {value: 0x0040, lo: 0x8c, hi: 0x8c}, + {value: 0x0008, lo: 0x8d, hi: 0xa6}, + {value: 0x0040, lo: 0xa7, hi: 0xa7}, + {value: 0x0008, lo: 0xa8, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbb}, + {value: 0x0008, lo: 0xbc, hi: 0xbd}, + {value: 0x0040, lo: 0xbe, hi: 0xbe}, + {value: 0x0008, lo: 0xbf, hi: 0xbf}, + // Block 0x88, offset 0x453 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0xbf}, + // Block 0x89, offset 0x458 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbf}, + // Block 0x8a, offset 0x45b + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0x82}, + {value: 0x0040, lo: 0x83, hi: 0x86}, + {value: 0x0018, lo: 0x87, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xbf}, + // Block 0x8b, offset 0x461 + {value: 0x0000, lo: 0x06}, + {value: 0x0018, lo: 0x80, hi: 0x8e}, + {value: 0x0040, lo: 0x8f, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x9b}, + {value: 0x0040, lo: 0x9c, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xa0}, + {value: 0x0040, lo: 0xa1, hi: 0xbf}, + // Block 0x8c, offset 0x468 + {value: 0x0000, lo: 0x04}, + {value: 0x0040, lo: 0x80, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0xbc}, + {value: 0x1308, lo: 0xbd, hi: 0xbd}, + {value: 0x0040, lo: 0xbe, hi: 0xbf}, + // Block 0x8d, offset 0x46d + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0x9c}, + {value: 0x0040, lo: 0x9d, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0x8e, offset 0x471 + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x90}, + {value: 0x0040, lo: 0x91, hi: 0x9f}, + {value: 0x1308, lo: 0xa0, hi: 0xa0}, + {value: 0x0018, lo: 0xa1, hi: 0xbb}, + {value: 0x0040, lo: 0xbc, hi: 0xbf}, + // Block 0x8f, offset 0x477 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xa3}, + {value: 0x0040, lo: 0xa4, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x90, offset 0x47c + {value: 0x0000, lo: 0x08}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x81}, + {value: 0x0008, lo: 0x82, hi: 0x89}, + {value: 0x0018, lo: 0x8a, hi: 0x8a}, + {value: 0x0040, lo: 0x8b, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xb5}, + {value: 0x1308, lo: 0xb6, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbf}, + // Block 0x91, offset 0x485 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9e}, + {value: 0x0018, lo: 0x9f, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0x92, offset 0x48a + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0x87}, + {value: 0x0008, lo: 0x88, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0xbf}, + // Block 0x93, offset 0x490 + {value: 0x0000, lo: 0x06}, + {value: 0xe145, lo: 0x80, hi: 0x87}, + {value: 0xe1c5, lo: 0x88, hi: 0x8f}, + {value: 0xe145, lo: 0x90, hi: 0x97}, + {value: 0x8ad5, lo: 0x98, hi: 0x9f}, + {value: 0x8aed, lo: 0xa0, hi: 0xa7}, + {value: 0x0008, lo: 0xa8, hi: 0xbf}, + // Block 0x94, offset 0x497 + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa9}, + {value: 0x0040, lo: 0xaa, hi: 0xaf}, + {value: 0x8aed, lo: 0xb0, hi: 0xb7}, + {value: 0x8ad5, lo: 0xb8, hi: 0xbf}, + // Block 0x95, offset 0x49e + {value: 0x0000, lo: 0x06}, + {value: 0xe145, lo: 0x80, hi: 0x87}, + {value: 0xe1c5, lo: 0x88, hi: 0x8f}, + {value: 0xe145, lo: 0x90, hi: 0x93}, + {value: 0x0040, lo: 0x94, hi: 0x97}, + {value: 0x0008, lo: 0x98, hi: 0xbb}, + {value: 0x0040, lo: 0xbc, hi: 0xbf}, + // Block 0x96, offset 0x4a5 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xa7}, + {value: 0x0040, lo: 0xa8, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0x97, offset 0x4a9 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xa3}, + {value: 0x0040, lo: 0xa4, hi: 0xae}, + {value: 0x0018, lo: 0xaf, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbf}, + // Block 0x98, offset 0x4ae + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0x99, offset 0x4b1 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa7}, + {value: 0x0040, lo: 0xa8, hi: 0xbf}, + // Block 0x9a, offset 0x4b6 + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0x87}, + {value: 0x0008, lo: 0x88, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x0008, lo: 0x8a, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xb6}, + {value: 0x0008, lo: 0xb7, hi: 0xb8}, + {value: 0x0040, lo: 0xb9, hi: 0xbb}, + {value: 0x0008, lo: 0xbc, hi: 0xbc}, + {value: 0x0040, lo: 0xbd, hi: 0xbe}, + {value: 0x0008, lo: 0xbf, hi: 0xbf}, + // Block 0x9b, offset 0x4c2 + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0x96}, + {value: 0x0018, lo: 0x97, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xbf}, + // Block 0x9c, offset 0x4c8 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0xa6}, + {value: 0x0018, lo: 0xa7, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbf}, + // Block 0x9d, offset 0x4cd + {value: 0x0000, lo: 0x06}, + {value: 0x0040, lo: 0x80, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb2}, + {value: 0x0040, lo: 0xb3, hi: 0xb3}, + {value: 0x0008, lo: 0xb4, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xba}, + {value: 0x0018, lo: 0xbb, hi: 0xbf}, + // Block 0x9e, offset 0x4d4 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0x95}, + {value: 0x0018, lo: 0x96, hi: 0x9b}, + {value: 0x0040, lo: 0x9c, hi: 0x9e}, + {value: 0x0018, lo: 0x9f, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbe}, + {value: 0x0018, lo: 0xbf, hi: 0xbf}, + // Block 0x9f, offset 0x4dc + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xbb}, + {value: 0x0018, lo: 0xbc, hi: 0xbd}, + {value: 0x0008, lo: 0xbe, hi: 0xbf}, + // Block 0xa0, offset 0x4e1 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0x8f}, + {value: 0x0040, lo: 0x90, hi: 0x91}, + {value: 0x0018, lo: 0x92, hi: 0xbf}, + // Block 0xa1, offset 0x4e5 + {value: 0x0000, lo: 0x0f}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0x1308, lo: 0x81, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0x84}, + {value: 0x1308, lo: 0x85, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x8b}, + {value: 0x1308, lo: 0x8c, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x93}, + {value: 0x0040, lo: 0x94, hi: 0x94}, + {value: 0x0008, lo: 0x95, hi: 0x97}, + {value: 0x0040, lo: 0x98, hi: 0x98}, + {value: 0x0008, lo: 0x99, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xb7}, + {value: 0x1308, lo: 0xb8, hi: 0xba}, + {value: 0x0040, lo: 0xbb, hi: 0xbe}, + {value: 0x1b08, lo: 0xbf, hi: 0xbf}, + // Block 0xa2, offset 0x4f5 + {value: 0x0000, lo: 0x06}, + {value: 0x0018, lo: 0x80, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x98}, + {value: 0x0040, lo: 0x99, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbc}, + {value: 0x0018, lo: 0xbd, hi: 0xbf}, + // Block 0xa3, offset 0x4fc + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0x9c}, + {value: 0x0018, lo: 0x9d, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xbf}, + // Block 0xa4, offset 0x500 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xb8}, + {value: 0x0018, lo: 0xb9, hi: 0xbf}, + // Block 0xa5, offset 0x504 + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0x95}, + {value: 0x0040, lo: 0x96, hi: 0x97}, + {value: 0x0018, lo: 0x98, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xb2}, + {value: 0x0040, lo: 0xb3, hi: 0xb7}, + {value: 0x0018, lo: 0xb8, hi: 0xbf}, + // Block 0xa6, offset 0x50b + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0xbf}, + // Block 0xa7, offset 0x50e + {value: 0x0000, lo: 0x02}, + {value: 0x03dd, lo: 0x80, hi: 0xb2}, + {value: 0x0040, lo: 0xb3, hi: 0xbf}, + // Block 0xa8, offset 0x511 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xb2}, + {value: 0x0040, lo: 0xb3, hi: 0xb9}, + {value: 0x0018, lo: 0xba, hi: 0xbf}, + // Block 0xa9, offset 0x515 + {value: 0x0000, lo: 0x03}, + {value: 0x0040, lo: 0x80, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0xaa, offset 0x519 + {value: 0x0000, lo: 0x05}, + {value: 0x1008, lo: 0x80, hi: 0x80}, + {value: 0x1308, lo: 0x81, hi: 0x81}, + {value: 0x1008, lo: 0x82, hi: 0x82}, + {value: 0x0008, lo: 0x83, hi: 0xb7}, + {value: 0x1308, lo: 0xb8, hi: 0xbf}, + // Block 0xab, offset 0x51f + {value: 0x0000, lo: 0x08}, + {value: 0x1308, lo: 0x80, hi: 0x85}, + {value: 0x1b08, lo: 0x86, hi: 0x86}, + {value: 0x0018, lo: 0x87, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x91}, + {value: 0x0018, lo: 0x92, hi: 0xa5}, + {value: 0x0008, lo: 0xa6, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbe}, + {value: 0x1b08, lo: 0xbf, hi: 0xbf}, + // Block 0xac, offset 0x528 + {value: 0x0000, lo: 0x0b}, + {value: 0x1308, lo: 0x80, hi: 0x81}, + {value: 0x1008, lo: 0x82, hi: 0x82}, + {value: 0x0008, lo: 0x83, hi: 0xaf}, + {value: 0x1008, lo: 0xb0, hi: 0xb2}, + {value: 0x1308, lo: 0xb3, hi: 0xb6}, + {value: 0x1008, lo: 0xb7, hi: 0xb8}, + {value: 0x1b08, lo: 0xb9, hi: 0xb9}, + {value: 0x1308, lo: 0xba, hi: 0xba}, + {value: 0x0018, lo: 0xbb, hi: 0xbc}, + {value: 0x0340, lo: 0xbd, hi: 0xbd}, + {value: 0x0018, lo: 0xbe, hi: 0xbf}, + // Block 0xad, offset 0x534 + {value: 0x0000, lo: 0x06}, + {value: 0x0018, lo: 0x80, hi: 0x81}, + {value: 0x0040, lo: 0x82, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xa8}, + {value: 0x0040, lo: 0xa9, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbf}, + // Block 0xae, offset 0x53b + {value: 0x0000, lo: 0x08}, + {value: 0x1308, lo: 0x80, hi: 0x82}, + {value: 0x0008, lo: 0x83, hi: 0xa6}, + {value: 0x1308, lo: 0xa7, hi: 0xab}, + {value: 0x1008, lo: 0xac, hi: 0xac}, + {value: 0x1308, lo: 0xad, hi: 0xb2}, + {value: 0x1b08, lo: 0xb3, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xb5}, + {value: 0x0008, lo: 0xb6, hi: 0xbf}, + // Block 0xaf, offset 0x544 + {value: 0x0000, lo: 0x07}, + {value: 0x0018, lo: 0x80, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xb2}, + {value: 0x1308, lo: 0xb3, hi: 0xb3}, + {value: 0x0018, lo: 0xb4, hi: 0xb5}, + {value: 0x0008, lo: 0xb6, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0xb0, offset 0x54c + {value: 0x0000, lo: 0x06}, + {value: 0x1308, lo: 0x80, hi: 0x81}, + {value: 0x1008, lo: 0x82, hi: 0x82}, + {value: 0x0008, lo: 0x83, hi: 0xb2}, + {value: 0x1008, lo: 0xb3, hi: 0xb5}, + {value: 0x1308, lo: 0xb6, hi: 0xbe}, + {value: 0x1008, lo: 0xbf, hi: 0xbf}, + // Block 0xb1, offset 0x553 + {value: 0x0000, lo: 0x0d}, + {value: 0x1808, lo: 0x80, hi: 0x80}, + {value: 0x0008, lo: 0x81, hi: 0x84}, + {value: 0x0018, lo: 0x85, hi: 0x89}, + {value: 0x1308, lo: 0x8a, hi: 0x8c}, + {value: 0x0018, lo: 0x8d, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x9a}, + {value: 0x0018, lo: 0x9b, hi: 0x9b}, + {value: 0x0008, lo: 0x9c, hi: 0x9c}, + {value: 0x0018, lo: 0x9d, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xa0}, + {value: 0x0018, lo: 0xa1, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xbf}, + // Block 0xb2, offset 0x561 + {value: 0x0000, lo: 0x0c}, + {value: 0x0008, lo: 0x80, hi: 0x91}, + {value: 0x0040, lo: 0x92, hi: 0x92}, + {value: 0x0008, lo: 0x93, hi: 0xab}, + {value: 0x1008, lo: 0xac, hi: 0xae}, + {value: 0x1308, lo: 0xaf, hi: 0xb1}, + {value: 0x1008, lo: 0xb2, hi: 0xb3}, + {value: 0x1308, lo: 0xb4, hi: 0xb4}, + {value: 0x1808, lo: 0xb5, hi: 0xb5}, + {value: 0x1308, lo: 0xb6, hi: 0xb7}, + {value: 0x0018, lo: 0xb8, hi: 0xbd}, + {value: 0x1308, lo: 0xbe, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0xb3, offset 0x56e + {value: 0x0000, lo: 0x0c}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x87}, + {value: 0x0008, lo: 0x88, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x0008, lo: 0x8a, hi: 0x8d}, + {value: 0x0040, lo: 0x8e, hi: 0x8e}, + {value: 0x0008, lo: 0x8f, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9e}, + {value: 0x0008, lo: 0x9f, hi: 0xa8}, + {value: 0x0018, lo: 0xa9, hi: 0xa9}, + {value: 0x0040, lo: 0xaa, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbf}, + // Block 0xb4, offset 0x57b + {value: 0x0000, lo: 0x08}, + {value: 0x0008, lo: 0x80, hi: 0x9e}, + {value: 0x1308, lo: 0x9f, hi: 0x9f}, + {value: 0x1008, lo: 0xa0, hi: 0xa2}, + {value: 0x1308, lo: 0xa3, hi: 0xa9}, + {value: 0x1b08, lo: 0xaa, hi: 0xaa}, + {value: 0x0040, lo: 0xab, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb9}, + {value: 0x0040, lo: 0xba, hi: 0xbf}, + // Block 0xb5, offset 0x584 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xb4}, + {value: 0x1008, lo: 0xb5, hi: 0xb7}, + {value: 0x1308, lo: 0xb8, hi: 0xbf}, + // Block 0xb6, offset 0x588 + {value: 0x0000, lo: 0x0d}, + {value: 0x1008, lo: 0x80, hi: 0x81}, + {value: 0x1b08, lo: 0x82, hi: 0x82}, + {value: 0x1308, lo: 0x83, hi: 0x84}, + {value: 0x1008, lo: 0x85, hi: 0x85}, + {value: 0x1308, lo: 0x86, hi: 0x86}, + {value: 0x0008, lo: 0x87, hi: 0x8a}, + {value: 0x0018, lo: 0x8b, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9a}, + {value: 0x0018, lo: 0x9b, hi: 0x9b}, + {value: 0x0040, lo: 0x9c, hi: 0x9c}, + {value: 0x0018, lo: 0x9d, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0xbf}, + // Block 0xb7, offset 0x596 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0xaf}, + {value: 0x1008, lo: 0xb0, hi: 0xb2}, + {value: 0x1308, lo: 0xb3, hi: 0xb8}, + {value: 0x1008, lo: 0xb9, hi: 0xb9}, + {value: 0x1308, lo: 0xba, hi: 0xba}, + {value: 0x1008, lo: 0xbb, hi: 0xbe}, + {value: 0x1308, lo: 0xbf, hi: 0xbf}, + // Block 0xb8, offset 0x59e + {value: 0x0000, lo: 0x0a}, + {value: 0x1308, lo: 0x80, hi: 0x80}, + {value: 0x1008, lo: 0x81, hi: 0x81}, + {value: 0x1b08, lo: 0x82, hi: 0x82}, + {value: 0x1308, lo: 0x83, hi: 0x83}, + {value: 0x0008, lo: 0x84, hi: 0x85}, + {value: 0x0018, lo: 0x86, hi: 0x86}, + {value: 0x0008, lo: 0x87, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0xbf}, + // Block 0xb9, offset 0x5a9 + {value: 0x0000, lo: 0x08}, + {value: 0x0008, lo: 0x80, hi: 0xae}, + {value: 0x1008, lo: 0xaf, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xb7}, + {value: 0x1008, lo: 0xb8, hi: 0xbb}, + {value: 0x1308, lo: 0xbc, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbe}, + {value: 0x1b08, lo: 0xbf, hi: 0xbf}, + // Block 0xba, offset 0x5b2 + {value: 0x0000, lo: 0x05}, + {value: 0x1308, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x97}, + {value: 0x0008, lo: 0x98, hi: 0x9b}, + {value: 0x1308, lo: 0x9c, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0xbf}, + // Block 0xbb, offset 0x5b8 + {value: 0x0000, lo: 0x07}, + {value: 0x0008, lo: 0x80, hi: 0xaf}, + {value: 0x1008, lo: 0xb0, hi: 0xb2}, + {value: 0x1308, lo: 0xb3, hi: 0xba}, + {value: 0x1008, lo: 0xbb, hi: 0xbc}, + {value: 0x1308, lo: 0xbd, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbe}, + {value: 0x1b08, lo: 0xbf, hi: 0xbf}, + // Block 0xbc, offset 0x5c0 + {value: 0x0000, lo: 0x08}, + {value: 0x1308, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x83}, + {value: 0x0008, lo: 0x84, hi: 0x84}, + {value: 0x0040, lo: 0x85, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xac}, + {value: 0x0040, lo: 0xad, hi: 0xbf}, + // Block 0xbd, offset 0x5c9 + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0xaa}, + {value: 0x1308, lo: 0xab, hi: 0xab}, + {value: 0x1008, lo: 0xac, hi: 0xac}, + {value: 0x1308, lo: 0xad, hi: 0xad}, + {value: 0x1008, lo: 0xae, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb5}, + {value: 0x1808, lo: 0xb6, hi: 0xb6}, + {value: 0x1308, lo: 0xb7, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xbf}, + // Block 0xbe, offset 0x5d3 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x89}, + {value: 0x0040, lo: 0x8a, hi: 0xbf}, + // Block 0xbf, offset 0x5d6 + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9c}, + {value: 0x1308, lo: 0x9d, hi: 0x9f}, + {value: 0x1008, lo: 0xa0, hi: 0xa1}, + {value: 0x1308, lo: 0xa2, hi: 0xa5}, + {value: 0x1008, lo: 0xa6, hi: 0xa6}, + {value: 0x1308, lo: 0xa7, hi: 0xaa}, + {value: 0x1b08, lo: 0xab, hi: 0xab}, + {value: 0x0040, lo: 0xac, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xb9}, + {value: 0x0018, lo: 0xba, hi: 0xbf}, + // Block 0xc0, offset 0x5e2 + {value: 0x0000, lo: 0x02}, + {value: 0x0040, lo: 0x80, hi: 0x9f}, + {value: 0x049d, lo: 0xa0, hi: 0xbf}, + // Block 0xc1, offset 0x5e5 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xa9}, + {value: 0x0018, lo: 0xaa, hi: 0xb2}, + {value: 0x0040, lo: 0xb3, hi: 0xbe}, + {value: 0x0008, lo: 0xbf, hi: 0xbf}, + // Block 0xc2, offset 0x5ea + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xb8}, + {value: 0x0040, lo: 0xb9, hi: 0xbf}, + // Block 0xc3, offset 0x5ed + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x89}, + {value: 0x0008, lo: 0x8a, hi: 0xae}, + {value: 0x1008, lo: 0xaf, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xb7}, + {value: 0x1308, lo: 0xb8, hi: 0xbd}, + {value: 0x1008, lo: 0xbe, hi: 0xbe}, + {value: 0x1b08, lo: 0xbf, hi: 0xbf}, + // Block 0xc4, offset 0x5f7 + {value: 0x0000, lo: 0x08}, + {value: 0x0008, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0018, lo: 0x9a, hi: 0xac}, + {value: 0x0040, lo: 0xad, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb1}, + {value: 0x0008, lo: 0xb2, hi: 0xbf}, + // Block 0xc5, offset 0x600 + {value: 0x0000, lo: 0x0b}, + {value: 0x0008, lo: 0x80, hi: 0x8f}, + {value: 0x0040, lo: 0x90, hi: 0x91}, + {value: 0x1308, lo: 0x92, hi: 0xa7}, + {value: 0x0040, lo: 0xa8, hi: 0xa8}, + {value: 0x1008, lo: 0xa9, hi: 0xa9}, + {value: 0x1308, lo: 0xaa, hi: 0xb0}, + {value: 0x1008, lo: 0xb1, hi: 0xb1}, + {value: 0x1308, lo: 0xb2, hi: 0xb3}, + {value: 0x1008, lo: 0xb4, hi: 0xb4}, + {value: 0x1308, lo: 0xb5, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0xc6, offset 0x60c + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0xbf}, + // Block 0xc7, offset 0x60f + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xbf}, + // Block 0xc8, offset 0x614 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x83}, + {value: 0x0040, lo: 0x84, hi: 0xbf}, + // Block 0xc9, offset 0x617 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xbf}, + // Block 0xca, offset 0x61a + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0xbf}, + // Block 0xcb, offset 0x61d + {value: 0x0000, lo: 0x06}, + {value: 0x0008, lo: 0x80, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa9}, + {value: 0x0040, lo: 0xaa, hi: 0xad}, + {value: 0x0018, lo: 0xae, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbf}, + // Block 0xcc, offset 0x624 + {value: 0x0000, lo: 0x06}, + {value: 0x0040, lo: 0x80, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb4}, + {value: 0x0018, lo: 0xb5, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xbf}, + // Block 0xcd, offset 0x62b + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0xaf}, + {value: 0x1308, lo: 0xb0, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xbf}, + // Block 0xce, offset 0x62f + {value: 0x0000, lo: 0x0a}, + {value: 0x0008, lo: 0x80, hi: 0x83}, + {value: 0x0018, lo: 0x84, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9a}, + {value: 0x0018, lo: 0x9b, hi: 0xa1}, + {value: 0x0040, lo: 0xa2, hi: 0xa2}, + {value: 0x0008, lo: 0xa3, hi: 0xb7}, + {value: 0x0040, lo: 0xb8, hi: 0xbc}, + {value: 0x0008, lo: 0xbd, hi: 0xbf}, + // Block 0xcf, offset 0x63a + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x8f}, + {value: 0x0040, lo: 0x90, hi: 0xbf}, + // Block 0xd0, offset 0x63d + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x84}, + {value: 0x0040, lo: 0x85, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x90}, + {value: 0x1008, lo: 0x91, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0xd1, offset 0x643 + {value: 0x0000, lo: 0x04}, + {value: 0x0040, lo: 0x80, hi: 0x8e}, + {value: 0x1308, lo: 0x8f, hi: 0x92}, + {value: 0x0008, lo: 0x93, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xbf}, + // Block 0xd2, offset 0x648 + {value: 0x0000, lo: 0x03}, + {value: 0x0040, lo: 0x80, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xa0}, + {value: 0x0040, lo: 0xa1, hi: 0xbf}, + // Block 0xd3, offset 0x64c + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xac}, + {value: 0x0040, lo: 0xad, hi: 0xbf}, + // Block 0xd4, offset 0x64f + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xb2}, + {value: 0x0040, lo: 0xb3, hi: 0xbf}, + // Block 0xd5, offset 0x652 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x81}, + {value: 0x0040, lo: 0x82, hi: 0xbf}, + // Block 0xd6, offset 0x655 + {value: 0x0000, lo: 0x04}, + {value: 0x0008, lo: 0x80, hi: 0xaa}, + {value: 0x0040, lo: 0xab, hi: 0xaf}, + {value: 0x0008, lo: 0xb0, hi: 0xbc}, + {value: 0x0040, lo: 0xbd, hi: 0xbf}, + // Block 0xd7, offset 0x65a + {value: 0x0000, lo: 0x09}, + {value: 0x0008, lo: 0x80, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9b}, + {value: 0x0018, lo: 0x9c, hi: 0x9c}, + {value: 0x1308, lo: 0x9d, hi: 0x9e}, + {value: 0x0018, lo: 0x9f, hi: 0x9f}, + {value: 0x03c0, lo: 0xa0, hi: 0xa3}, + {value: 0x0040, lo: 0xa4, hi: 0xbf}, + // Block 0xd8, offset 0x664 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xbf}, + // Block 0xd9, offset 0x667 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0xa6}, + {value: 0x0040, lo: 0xa7, hi: 0xa8}, + {value: 0x0018, lo: 0xa9, hi: 0xbf}, + // Block 0xda, offset 0x66b + {value: 0x0000, lo: 0x0e}, + {value: 0x0018, lo: 0x80, hi: 0x9d}, + {value: 0xb5b9, lo: 0x9e, hi: 0x9e}, + {value: 0xb601, lo: 0x9f, hi: 0x9f}, + {value: 0xb649, lo: 0xa0, hi: 0xa0}, + {value: 0xb6b1, lo: 0xa1, hi: 0xa1}, + {value: 0xb719, lo: 0xa2, hi: 0xa2}, + {value: 0xb781, lo: 0xa3, hi: 0xa3}, + {value: 0xb7e9, lo: 0xa4, hi: 0xa4}, + {value: 0x1018, lo: 0xa5, hi: 0xa6}, + {value: 0x1318, lo: 0xa7, hi: 0xa9}, + {value: 0x0018, lo: 0xaa, hi: 0xac}, + {value: 0x1018, lo: 0xad, hi: 0xb2}, + {value: 0x0340, lo: 0xb3, hi: 0xba}, + {value: 0x1318, lo: 0xbb, hi: 0xbf}, + // Block 0xdb, offset 0x67a + {value: 0x0000, lo: 0x0b}, + {value: 0x1318, lo: 0x80, hi: 0x82}, + {value: 0x0018, lo: 0x83, hi: 0x84}, + {value: 0x1318, lo: 0x85, hi: 0x8b}, + {value: 0x0018, lo: 0x8c, hi: 0xa9}, + {value: 0x1318, lo: 0xaa, hi: 0xad}, + {value: 0x0018, lo: 0xae, hi: 0xba}, + {value: 0xb851, lo: 0xbb, hi: 0xbb}, + {value: 0xb899, lo: 0xbc, hi: 0xbc}, + {value: 0xb8e1, lo: 0xbd, hi: 0xbd}, + {value: 0xb949, lo: 0xbe, hi: 0xbe}, + {value: 0xb9b1, lo: 0xbf, hi: 0xbf}, + // Block 0xdc, offset 0x686 + {value: 0x0000, lo: 0x03}, + {value: 0xba19, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0xa8}, + {value: 0x0040, lo: 0xa9, hi: 0xbf}, + // Block 0xdd, offset 0x68a + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x81}, + {value: 0x1318, lo: 0x82, hi: 0x84}, + {value: 0x0018, lo: 0x85, hi: 0x85}, + {value: 0x0040, lo: 0x86, hi: 0xbf}, + // Block 0xde, offset 0x68f + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xb1}, + {value: 0x0040, lo: 0xb2, hi: 0xbf}, + // Block 0xdf, offset 0x694 + {value: 0x0000, lo: 0x03}, + {value: 0x1308, lo: 0x80, hi: 0xb6}, + {value: 0x0018, lo: 0xb7, hi: 0xba}, + {value: 0x1308, lo: 0xbb, hi: 0xbf}, + // Block 0xe0, offset 0x698 + {value: 0x0000, lo: 0x04}, + {value: 0x1308, lo: 0x80, hi: 0xac}, + {value: 0x0018, lo: 0xad, hi: 0xb4}, + {value: 0x1308, lo: 0xb5, hi: 0xb5}, + {value: 0x0018, lo: 0xb6, hi: 0xbf}, + // Block 0xe1, offset 0x69d + {value: 0x0000, lo: 0x08}, + {value: 0x0018, lo: 0x80, hi: 0x83}, + {value: 0x1308, lo: 0x84, hi: 0x84}, + {value: 0x0018, lo: 0x85, hi: 0x8b}, + {value: 0x0040, lo: 0x8c, hi: 0x9a}, + {value: 0x1308, lo: 0x9b, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xa0}, + {value: 0x1308, lo: 0xa1, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbf}, + // Block 0xe2, offset 0x6a6 + {value: 0x0000, lo: 0x0a}, + {value: 0x1308, lo: 0x80, hi: 0x86}, + {value: 0x0040, lo: 0x87, hi: 0x87}, + {value: 0x1308, lo: 0x88, hi: 0x98}, + {value: 0x0040, lo: 0x99, hi: 0x9a}, + {value: 0x1308, lo: 0x9b, hi: 0xa1}, + {value: 0x0040, lo: 0xa2, hi: 0xa2}, + {value: 0x1308, lo: 0xa3, hi: 0xa4}, + {value: 0x0040, lo: 0xa5, hi: 0xa5}, + {value: 0x1308, lo: 0xa6, hi: 0xaa}, + {value: 0x0040, lo: 0xab, hi: 0xbf}, + // Block 0xe3, offset 0x6b1 + {value: 0x0000, lo: 0x05}, + {value: 0x0008, lo: 0x80, hi: 0x84}, + {value: 0x0040, lo: 0x85, hi: 0x86}, + {value: 0x0018, lo: 0x87, hi: 0x8f}, + {value: 0x1308, lo: 0x90, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0xbf}, + // Block 0xe4, offset 0x6b7 + {value: 0x0000, lo: 0x07}, + {value: 0x0208, lo: 0x80, hi: 0x83}, + {value: 0x1308, lo: 0x84, hi: 0x8a}, + {value: 0x0040, lo: 0x8b, hi: 0x8f}, + {value: 0x0008, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9d}, + {value: 0x0018, lo: 0x9e, hi: 0x9f}, + {value: 0x0040, lo: 0xa0, hi: 0xbf}, + // Block 0xe5, offset 0x6bf + {value: 0x0000, lo: 0x03}, + {value: 0x0040, lo: 0x80, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb1}, + {value: 0x0040, lo: 0xb2, hi: 0xbf}, + // Block 0xe6, offset 0x6c3 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0xab}, + {value: 0x0040, lo: 0xac, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xbf}, + // Block 0xe7, offset 0x6c7 + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0x93}, + {value: 0x0040, lo: 0x94, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xae}, + {value: 0x0040, lo: 0xaf, hi: 0xb0}, + {value: 0x0018, lo: 0xb1, hi: 0xbf}, + // Block 0xe8, offset 0x6cd + {value: 0x0000, lo: 0x05}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x0018, lo: 0x81, hi: 0x8f}, + {value: 0x0040, lo: 0x90, hi: 0x90}, + {value: 0x0018, lo: 0x91, hi: 0xb5}, + {value: 0x0040, lo: 0xb6, hi: 0xbf}, + // Block 0xe9, offset 0x6d3 + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x8f}, + {value: 0xc1c1, lo: 0x90, hi: 0x90}, + {value: 0x0018, lo: 0x91, hi: 0xac}, + {value: 0x0040, lo: 0xad, hi: 0xbf}, + // Block 0xea, offset 0x6d8 + {value: 0x0000, lo: 0x02}, + {value: 0x0040, lo: 0x80, hi: 0xa5}, + {value: 0x0018, lo: 0xa6, hi: 0xbf}, + // Block 0xeb, offset 0x6db + {value: 0x0000, lo: 0x0d}, + {value: 0xc7e9, lo: 0x80, hi: 0x80}, + {value: 0xc839, lo: 0x81, hi: 0x81}, + {value: 0xc889, lo: 0x82, hi: 0x82}, + {value: 0xc8d9, lo: 0x83, hi: 0x83}, + {value: 0xc929, lo: 0x84, hi: 0x84}, + {value: 0xc979, lo: 0x85, hi: 0x85}, + {value: 0xc9c9, lo: 0x86, hi: 0x86}, + {value: 0xca19, lo: 0x87, hi: 0x87}, + {value: 0xca69, lo: 0x88, hi: 0x88}, + {value: 0x0040, lo: 0x89, hi: 0x8f}, + {value: 0xcab9, lo: 0x90, hi: 0x90}, + {value: 0xcad9, lo: 0x91, hi: 0x91}, + {value: 0x0040, lo: 0x92, hi: 0xbf}, + // Block 0xec, offset 0x6e9 + {value: 0x0000, lo: 0x06}, + {value: 0x0018, lo: 0x80, hi: 0x92}, + {value: 0x0040, lo: 0x93, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xac}, + {value: 0x0040, lo: 0xad, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb6}, + {value: 0x0040, lo: 0xb7, hi: 0xbf}, + // Block 0xed, offset 0x6f0 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0xb3}, + {value: 0x0040, lo: 0xb4, hi: 0xbf}, + // Block 0xee, offset 0x6f3 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0x94}, + {value: 0x0040, lo: 0x95, hi: 0xbf}, + // Block 0xef, offset 0x6f6 + {value: 0x0000, lo: 0x03}, + {value: 0x0018, lo: 0x80, hi: 0x8b}, + {value: 0x0040, lo: 0x8c, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0xbf}, + // Block 0xf0, offset 0x6fa + {value: 0x0000, lo: 0x05}, + {value: 0x0018, lo: 0x80, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x99}, + {value: 0x0040, lo: 0x9a, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xbf}, + // Block 0xf1, offset 0x700 + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x87}, + {value: 0x0040, lo: 0x88, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0xad}, + {value: 0x0040, lo: 0xae, hi: 0xbf}, + // Block 0xf2, offset 0x705 + {value: 0x0000, lo: 0x09}, + {value: 0x0040, lo: 0x80, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0x9f}, + {value: 0x0018, lo: 0xa0, hi: 0xa7}, + {value: 0x0040, lo: 0xa8, hi: 0xaf}, + {value: 0x0018, lo: 0xb0, hi: 0xb0}, + {value: 0x0040, lo: 0xb1, hi: 0xb2}, + {value: 0x0018, lo: 0xb3, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0xf3, offset 0x70f + {value: 0x0000, lo: 0x04}, + {value: 0x0018, lo: 0x80, hi: 0x8b}, + {value: 0x0040, lo: 0x8c, hi: 0x8f}, + {value: 0x0018, lo: 0x90, hi: 0x9e}, + {value: 0x0040, lo: 0x9f, hi: 0xbf}, + // Block 0xf4, offset 0x714 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0x91}, + {value: 0x0040, lo: 0x92, hi: 0xbf}, + // Block 0xf5, offset 0x717 + {value: 0x0000, lo: 0x02}, + {value: 0x0018, lo: 0x80, hi: 0x80}, + {value: 0x0040, lo: 0x81, hi: 0xbf}, + // Block 0xf6, offset 0x71a + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0x96}, + {value: 0x0040, lo: 0x97, hi: 0xbf}, + // Block 0xf7, offset 0x71d + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xb4}, + {value: 0x0040, lo: 0xb5, hi: 0xbf}, + // Block 0xf8, offset 0x720 + {value: 0x0000, lo: 0x03}, + {value: 0x0008, lo: 0x80, hi: 0x9d}, + {value: 0x0040, lo: 0x9e, hi: 0x9f}, + {value: 0x0008, lo: 0xa0, hi: 0xbf}, + // Block 0xf9, offset 0x724 + {value: 0x0000, lo: 0x02}, + {value: 0x0008, lo: 0x80, hi: 0xa1}, + {value: 0x0040, lo: 0xa2, hi: 0xbf}, + // Block 0xfa, offset 0x727 + {value: 0x0020, lo: 0x0f}, + {value: 0xdeb9, lo: 0x80, hi: 0x89}, + {value: 0x8dfd, lo: 0x8a, hi: 0x8a}, + {value: 0xdff9, lo: 0x8b, hi: 0x9c}, + {value: 0x8e1d, lo: 0x9d, hi: 0x9d}, + {value: 0xe239, lo: 0x9e, hi: 0xa2}, + {value: 0x8e3d, lo: 0xa3, hi: 0xa3}, + {value: 0xe2d9, lo: 0xa4, hi: 0xab}, + {value: 0x7ed5, lo: 0xac, hi: 0xac}, + {value: 0xe3d9, lo: 0xad, hi: 0xaf}, + {value: 0x8e5d, lo: 0xb0, hi: 0xb0}, + {value: 0xe439, lo: 0xb1, hi: 0xb6}, + {value: 0x8e7d, lo: 0xb7, hi: 0xb9}, + {value: 0xe4f9, lo: 0xba, hi: 0xba}, + {value: 0x8edd, lo: 0xbb, hi: 0xbb}, + {value: 0xe519, lo: 0xbc, hi: 0xbf}, + // Block 0xfb, offset 0x737 + {value: 0x0020, lo: 0x10}, + {value: 0x937d, lo: 0x80, hi: 0x80}, + {value: 0xf099, lo: 0x81, hi: 0x86}, + {value: 0x939d, lo: 0x87, hi: 0x8a}, + {value: 0xd9f9, lo: 0x8b, hi: 0x8b}, + {value: 0xf159, lo: 0x8c, hi: 0x96}, + {value: 0x941d, lo: 0x97, hi: 0x97}, + {value: 0xf2b9, lo: 0x98, hi: 0xa3}, + {value: 0x943d, lo: 0xa4, hi: 0xa6}, + {value: 0xf439, lo: 0xa7, hi: 0xaa}, + {value: 0x949d, lo: 0xab, hi: 0xab}, + {value: 0xf4b9, lo: 0xac, hi: 0xac}, + {value: 0x94bd, lo: 0xad, hi: 0xad}, + {value: 0xf4d9, lo: 0xae, hi: 0xaf}, + {value: 0x94dd, lo: 0xb0, hi: 0xb1}, + {value: 0xf519, lo: 0xb2, hi: 0xbe}, + {value: 0x0040, lo: 0xbf, hi: 0xbf}, + // Block 0xfc, offset 0x748 + {value: 0x0000, lo: 0x04}, + {value: 0x0040, lo: 0x80, hi: 0x80}, + {value: 0x0340, lo: 0x81, hi: 0x81}, + {value: 0x0040, lo: 0x82, hi: 0x9f}, + {value: 0x0340, lo: 0xa0, hi: 0xbf}, + // Block 0xfd, offset 0x74d + {value: 0x0000, lo: 0x01}, + {value: 0x0340, lo: 0x80, hi: 0xbf}, + // Block 0xfe, offset 0x74f + {value: 0x0000, lo: 0x01}, + {value: 0x13c0, lo: 0x80, hi: 0xbf}, + // Block 0xff, offset 0x751 + {value: 0x0000, lo: 0x02}, + {value: 0x13c0, lo: 0x80, hi: 0xaf}, + {value: 0x0040, lo: 0xb0, hi: 0xbf}, +} + +// Total table size 41559 bytes (40KiB); checksum: F4A1FA4E diff --git a/vendor/golang.org/x/net/idna/trie.go b/vendor/golang.org/x/net/idna/trie.go new file mode 100644 index 0000000..c4ef847 --- /dev/null +++ b/vendor/golang.org/x/net/idna/trie.go @@ -0,0 +1,72 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package idna + +// appendMapping appends the mapping for the respective rune. isMapped must be +// true. A mapping is a categorization of a rune as defined in UTS #46. +func (c info) appendMapping(b []byte, s string) []byte { + index := int(c >> indexShift) + if c&xorBit == 0 { + s := mappings[index:] + return append(b, s[1:s[0]+1]...) + } + b = append(b, s...) + if c&inlineXOR == inlineXOR { + // TODO: support and handle two-byte inline masks + b[len(b)-1] ^= byte(index) + } else { + for p := len(b) - int(xorData[index]); p < len(b); p++ { + index++ + b[p] ^= xorData[index] + } + } + return b +} + +// Sparse block handling code. + +type valueRange struct { + value uint16 // header: value:stride + lo, hi byte // header: lo:n +} + +type sparseBlocks struct { + values []valueRange + offset []uint16 +} + +var idnaSparse = sparseBlocks{ + values: idnaSparseValues[:], + offset: idnaSparseOffset[:], +} + +// Don't use newIdnaTrie to avoid unconditional linking in of the table. +var trie = &idnaTrie{} + +// lookup determines the type of block n and looks up the value for b. +// For n < t.cutoff, the block is a simple lookup table. Otherwise, the block +// is a list of ranges with an accompanying value. Given a matching range r, +// the value for b is by r.value + (b - r.lo) * stride. +func (t *sparseBlocks) lookup(n uint32, b byte) uint16 { + offset := t.offset[n] + header := t.values[offset] + lo := offset + 1 + hi := lo + uint16(header.lo) + for lo < hi { + m := lo + (hi-lo)/2 + r := t.values[m] + if r.lo <= b && b <= r.hi { + return r.value + uint16(b-r.lo)*header.value + } + if b < r.lo { + hi = m + } else { + lo = m + 1 + } + } + return 0 +} diff --git a/vendor/golang.org/x/net/idna/trieval.go b/vendor/golang.org/x/net/idna/trieval.go new file mode 100644 index 0000000..63cb03b --- /dev/null +++ b/vendor/golang.org/x/net/idna/trieval.go @@ -0,0 +1,114 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +package idna + +// This file contains definitions for interpreting the trie value of the idna +// trie generated by "go run gen*.go". It is shared by both the generator +// program and the resultant package. Sharing is achieved by the generator +// copying gen_trieval.go to trieval.go and changing what's above this comment. + +// info holds information from the IDNA mapping table for a single rune. It is +// the value returned by a trie lookup. In most cases, all information fits in +// a 16-bit value. For mappings, this value may contain an index into a slice +// with the mapped string. Such mappings can consist of the actual mapped value +// or an XOR pattern to be applied to the bytes of the UTF8 encoding of the +// input rune. This technique is used by the cases packages and reduces the +// table size significantly. +// +// The per-rune values have the following format: +// +// if mapped { +// if inlinedXOR { +// 15..13 inline XOR marker +// 12..11 unused +// 10..3 inline XOR mask +// } else { +// 15..3 index into xor or mapping table +// } +// } else { +// 15..13 unused +// 12 modifier (including virama) +// 11 virama modifier +// 10..8 joining type +// 7..3 category type +// } +// 2 use xor pattern +// 1..0 mapped category +// +// See the definitions below for a more detailed description of the various +// bits. +type info uint16 + +const ( + catSmallMask = 0x3 + catBigMask = 0xF8 + indexShift = 3 + xorBit = 0x4 // interpret the index as an xor pattern + inlineXOR = 0xE000 // These bits are set if the XOR pattern is inlined. + + joinShift = 8 + joinMask = 0x07 + + viramaModifier = 0x0800 + modifier = 0x1000 +) + +// A category corresponds to a category defined in the IDNA mapping table. +type category uint16 + +const ( + unknown category = 0 // not defined currently in unicode. + mapped category = 1 + disallowedSTD3Mapped category = 2 + deviation category = 3 +) + +const ( + valid category = 0x08 + validNV8 category = 0x18 + validXV8 category = 0x28 + disallowed category = 0x40 + disallowedSTD3Valid category = 0x80 + ignored category = 0xC0 +) + +// join types and additional rune information +const ( + joiningL = (iota + 1) + joiningD + joiningT + joiningR + + //the following types are derived during processing + joinZWJ + joinZWNJ + joinVirama + numJoinTypes +) + +func (c info) isMapped() bool { + return c&0x3 != 0 +} + +func (c info) category() category { + small := c & catSmallMask + if small != 0 { + return category(small) + } + return category(c & catBigMask) +} + +func (c info) joinType() info { + if c.isMapped() { + return 0 + } + return (c >> joinShift) & joinMask +} + +func (c info) isModifier() bool { + return c&(modifier|catSmallMask) == modifier +} + +func (c info) isViramaModifier() bool { + return c&(viramaModifier|catSmallMask) == viramaModifier +} diff --git a/vendor/golang.org/x/net/internal/iana/gen.go b/vendor/golang.org/x/net/internal/iana/gen.go index 2d8c07c..86c78b3 100644 --- a/vendor/golang.org/x/net/internal/iana/gen.go +++ b/vendor/golang.org/x/net/internal/iana/gen.go @@ -1,4 +1,4 @@ -// Copyright 2013 The Go Authors. All rights reserved. +// Copyright 2013 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/internal/netreflect/socket.go b/vendor/golang.org/x/net/internal/netreflect/socket.go index e82e51c..1495b65 100644 --- a/vendor/golang.org/x/net/internal/netreflect/socket.go +++ b/vendor/golang.org/x/net/internal/netreflect/socket.go @@ -2,8 +2,12 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. +// +build !go1.9 + // Package netreflect implements run-time reflection for the // facilities of net package. +// +// This package works only for Go 1.8 or below. package netreflect import ( diff --git a/vendor/golang.org/x/net/internal/netreflect/socket_19.go b/vendor/golang.org/x/net/internal/netreflect/socket_19.go new file mode 100644 index 0000000..74df52e --- /dev/null +++ b/vendor/golang.org/x/net/internal/netreflect/socket_19.go @@ -0,0 +1,37 @@ +// Copyright 2017 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build go1.9 + +package netreflect + +import ( + "errors" + "net" +) + +var ( + errInvalidType = errors.New("invalid type") + errOpNoSupport = errors.New("operation not supported") +) + +// SocketOf returns the socket descriptor of c. +func SocketOf(c net.Conn) (uintptr, error) { + switch c.(type) { + case *net.TCPConn, *net.UDPConn, *net.IPConn, *net.UnixConn: + return 0, errOpNoSupport + default: + return 0, errInvalidType + } +} + +// PacketSocketOf returns the socket descriptor of c. +func PacketSocketOf(c net.PacketConn) (uintptr, error) { + switch c.(type) { + case *net.UDPConn, *net.IPConn, *net.UnixConn: + return 0, errOpNoSupport + default: + return 0, errInvalidType + } +} diff --git a/vendor/golang.org/x/net/internal/netreflect/socket_posix.go b/vendor/golang.org/x/net/internal/netreflect/socket_posix.go index df475a2..410c092 100644 --- a/vendor/golang.org/x/net/internal/netreflect/socket_posix.go +++ b/vendor/golang.org/x/net/internal/netreflect/socket_posix.go @@ -2,6 +2,7 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. +// +build !go1.9 // +build darwin dragonfly freebsd linux netbsd openbsd solaris windows package netreflect diff --git a/vendor/golang.org/x/net/internal/netreflect/socket_stub.go b/vendor/golang.org/x/net/internal/netreflect/socket_stub.go index 85adb4b..17b20c4 100644 --- a/vendor/golang.org/x/net/internal/netreflect/socket_stub.go +++ b/vendor/golang.org/x/net/internal/netreflect/socket_stub.go @@ -2,6 +2,7 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. +// +build !go1.9 // +build !darwin,!dragonfly,!freebsd,!linux,!netbsd,!openbsd,!solaris,!windows package netreflect diff --git a/vendor/golang.org/x/net/ipv4/control.go b/vendor/golang.org/x/net/ipv4/control.go index 8cadfd7..da4da2d 100644 --- a/vendor/golang.org/x/net/ipv4/control.go +++ b/vendor/golang.org/x/net/ipv4/control.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/control_bsd.go b/vendor/golang.org/x/net/ipv4/control_bsd.go index 33d8bc8..3f27f99 100644 --- a/vendor/golang.org/x/net/ipv4/control_bsd.go +++ b/vendor/golang.org/x/net/ipv4/control_bsd.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/control_stub.go b/vendor/golang.org/x/net/ipv4/control_stub.go index 88602c3..27e618b 100644 --- a/vendor/golang.org/x/net/ipv4/control_stub.go +++ b/vendor/golang.org/x/net/ipv4/control_stub.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/control_unix.go b/vendor/golang.org/x/net/ipv4/control_unix.go index 211f4b4..25ef661 100644 --- a/vendor/golang.org/x/net/ipv4/control_unix.go +++ b/vendor/golang.org/x/net/ipv4/control_unix.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/control_windows.go b/vendor/golang.org/x/net/ipv4/control_windows.go index 49a113b..b27407d 100644 --- a/vendor/golang.org/x/net/ipv4/control_windows.go +++ b/vendor/golang.org/x/net/ipv4/control_windows.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/dgramopt_posix.go b/vendor/golang.org/x/net/ipv4/dgramopt_posix.go index 693c137..fbc5df1 100644 --- a/vendor/golang.org/x/net/ipv4/dgramopt_posix.go +++ b/vendor/golang.org/x/net/ipv4/dgramopt_posix.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/dgramopt_stub.go b/vendor/golang.org/x/net/ipv4/dgramopt_stub.go index 53cf1c6..f6b867f 100644 --- a/vendor/golang.org/x/net/ipv4/dgramopt_stub.go +++ b/vendor/golang.org/x/net/ipv4/dgramopt_stub.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/doc.go b/vendor/golang.org/x/net/ipv4/doc.go index d58a4c9..b43935a 100644 --- a/vendor/golang.org/x/net/ipv4/doc.go +++ b/vendor/golang.org/x/net/ipv4/doc.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -21,10 +21,10 @@ // // The options for unicasting are available for net.TCPConn, // net.UDPConn and net.IPConn which are created as network connections -// that use the IPv4 transport. When a single TCP connection carrying +// that use the IPv4 transport. When a single TCP connection carrying // a data flow of multiple packets needs to indicate the flow is -// important, ipv4.Conn is used to set the type-of-service field on -// the IPv4 header for each packet. +// important, Conn is used to set the type-of-service field on the +// IPv4 header for each packet. // // ln, err := net.Listen("tcp4", "0.0.0.0:1024") // if err != nil { @@ -56,7 +56,7 @@ // // The options for multicasting are available for net.UDPConn and // net.IPconn which are created as network connections that use the -// IPv4 transport. A few network facilities must be prepared before +// IPv4 transport. A few network facilities must be prepared before // you begin multicasting, at a minimum joining network interfaces and // multicast groups. // @@ -80,7 +80,7 @@ // defer c.Close() // // Second, the application joins multicast groups, starts listening to -// the groups on the specified network interfaces. Note that the +// the groups on the specified network interfaces. Note that the // service port for transport layer protocol does not matter with this // operation as joining groups affects only network and link layer // protocols, such as IPv4 and Ethernet. @@ -94,10 +94,10 @@ // } // // The application might set per packet control message transmissions -// between the protocol stack within the kernel. When the application +// between the protocol stack within the kernel. When the application // needs a destination address on an incoming packet, -// SetControlMessage of ipv4.PacketConn is used to enable control -// message transmissions. +// SetControlMessage of PacketConn is used to enable control message +// transmissions. // // if err := p.SetControlMessage(ipv4.FlagDst, true); err != nil { // // error handling @@ -145,7 +145,7 @@ // More multicasting // // An application that uses PacketConn or RawConn may join multiple -// multicast groups. For example, a UDP listener with port 1024 might +// multicast groups. For example, a UDP listener with port 1024 might // join two different groups across over two different network // interfaces by using: // @@ -166,7 +166,7 @@ // } // // It is possible for multiple UDP listeners that listen on the same -// UDP port to join the same multicast group. The net package will +// UDP port to join the same multicast group. The net package will // provide a socket that listens to a wildcard address with reusable // UDP port when an appropriate multicast address prefix is passed to // the net.ListenPacket or net.ListenUDP. @@ -240,3 +240,5 @@ // In the fallback case, ExcludeSourceSpecificGroup and // IncludeSourceSpecificGroup may return an error. package ipv4 // import "golang.org/x/net/ipv4" + +// BUG(mikio): This package is not implemented on NaCl and Plan 9. diff --git a/vendor/golang.org/x/net/ipv4/endpoint.go b/vendor/golang.org/x/net/ipv4/endpoint.go index a8ca2ff..8f7e07a 100644 --- a/vendor/golang.org/x/net/ipv4/endpoint.go +++ b/vendor/golang.org/x/net/ipv4/endpoint.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -12,6 +12,11 @@ import ( "golang.org/x/net/internal/netreflect" ) +// BUG(mikio): On Windows, the JoinSourceSpecificGroup, +// LeaveSourceSpecificGroup, ExcludeSourceSpecificGroup and +// IncludeSourceSpecificGroup methods of PacketConn and RawConn are +// not implemented. + // A Conn represents a network endpoint that uses the IPv4 transport. // It is used to control basic IP-level socket options such as TOS and // TTL. @@ -33,8 +38,8 @@ func NewConn(c net.Conn) *Conn { } // A PacketConn represents a packet network endpoint that uses the -// IPv4 transport. It is used to control several IP-level socket -// options including multicasting. It also provides datagram based +// IPv4 transport. It is used to control several IP-level socket +// options including multicasting. It also provides datagram based // network I/O methods specific to the IPv4 and higher layer protocols // such as UDP. type PacketConn struct { @@ -113,8 +118,8 @@ func NewPacketConn(c net.PacketConn) *PacketConn { } // A RawConn represents a packet network endpoint that uses the IPv4 -// transport. It is used to control several IP-level socket options -// including IPv4 header manipulation. It also provides datagram +// transport. It is used to control several IP-level socket options +// including IPv4 header manipulation. It also provides datagram // based network I/O methods specific to the IPv4 and higher layer // protocols that handle IPv4 datagram directly such as OSPF, GRE. type RawConn struct { diff --git a/vendor/golang.org/x/net/ipv4/gen.go b/vendor/golang.org/x/net/ipv4/gen.go index 187d648..ffb44fe 100644 --- a/vendor/golang.org/x/net/ipv4/gen.go +++ b/vendor/golang.org/x/net/ipv4/gen.go @@ -1,4 +1,4 @@ -// Copyright 2013 The Go Authors. All rights reserved. +// Copyright 2013 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/genericopt_posix.go b/vendor/golang.org/x/net/ipv4/genericopt_posix.go index f333581..58168b7 100644 --- a/vendor/golang.org/x/net/ipv4/genericopt_posix.go +++ b/vendor/golang.org/x/net/ipv4/genericopt_posix.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/genericopt_stub.go b/vendor/golang.org/x/net/ipv4/genericopt_stub.go index f907189..661a4d1 100644 --- a/vendor/golang.org/x/net/ipv4/genericopt_stub.go +++ b/vendor/golang.org/x/net/ipv4/genericopt_stub.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/header.go b/vendor/golang.org/x/net/ipv4/header.go index f31be59..6dc26d4 100644 --- a/vendor/golang.org/x/net/ipv4/header.go +++ b/vendor/golang.org/x/net/ipv4/header.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/helper.go b/vendor/golang.org/x/net/ipv4/helper.go index acecfd0..0838979 100644 --- a/vendor/golang.org/x/net/ipv4/helper.go +++ b/vendor/golang.org/x/net/ipv4/helper.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/icmp.go b/vendor/golang.org/x/net/ipv4/icmp.go index e869c23..097bea8 100644 --- a/vendor/golang.org/x/net/ipv4/icmp.go +++ b/vendor/golang.org/x/net/ipv4/icmp.go @@ -1,4 +1,4 @@ -// Copyright 2013 The Go Authors. All rights reserved. +// Copyright 2013 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/packet.go b/vendor/golang.org/x/net/ipv4/packet.go index 0986431..d43723c 100644 --- a/vendor/golang.org/x/net/ipv4/packet.go +++ b/vendor/golang.org/x/net/ipv4/packet.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -9,6 +9,9 @@ import ( "syscall" ) +// BUG(mikio): On Windows, the ReadFrom and WriteTo methods of RawConn +// are not implemented. + // A packetHandler represents the IPv4 datagram handler. type packetHandler struct { c *net.IPConn @@ -18,7 +21,7 @@ type packetHandler struct { func (c *packetHandler) ok() bool { return c != nil && c.c != nil } // ReadFrom reads an IPv4 datagram from the endpoint c, copying the -// datagram into b. It returns the received datagram as the IPv4 +// datagram into b. It returns the received datagram as the IPv4 // header h, the payload p and the control message cm. func (c *packetHandler) ReadFrom(b []byte) (h *Header, p []byte, cm *ControlMessage, err error) { if !c.ok() { @@ -54,14 +57,14 @@ func slicePacket(b []byte) (h, p []byte, err error) { } // WriteTo writes an IPv4 datagram through the endpoint c, copying the -// datagram from the IPv4 header h and the payload p. The control +// datagram from the IPv4 header h and the payload p. The control // message cm allows the datagram path and the outgoing interface to be -// specified. Currently only Darwin and Linux support this. The cm +// specified. Currently only Darwin and Linux support this. The cm // may be nil if control of the outgoing datagram is not required. // // The IPv4 header h must contain appropriate fields that include: // -// Version = ipv4.Version +// Version = // Len = // TOS = // TotalLen = diff --git a/vendor/golang.org/x/net/ipv4/payload.go b/vendor/golang.org/x/net/ipv4/payload.go index d7698cb..be130e4 100644 --- a/vendor/golang.org/x/net/ipv4/payload.go +++ b/vendor/golang.org/x/net/ipv4/payload.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -6,6 +6,9 @@ package ipv4 import "net" +// BUG(mikio): On Windows, the ControlMessage for ReadFrom and WriteTo +// methods of PacketConn is not implemented. + // A payloadHandler represents the IPv4 datagram payload handler. type payloadHandler struct { net.PacketConn diff --git a/vendor/golang.org/x/net/ipv4/payload_cmsg.go b/vendor/golang.org/x/net/ipv4/payload_cmsg.go index 5da0cbe..5e6e55c 100644 --- a/vendor/golang.org/x/net/ipv4/payload_cmsg.go +++ b/vendor/golang.org/x/net/ipv4/payload_cmsg.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -12,7 +12,7 @@ import ( ) // ReadFrom reads a payload of the received IPv4 datagram, from the -// endpoint c, copying the payload into b. It returns the number of +// endpoint c, copying the payload into b. It returns the number of // bytes copied into b, the control message cm and the source address // src of the received datagram. func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net.Addr, err error) { @@ -53,10 +53,10 @@ func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net. } // WriteTo writes a payload of the IPv4 datagram, to the destination -// address dst through the endpoint c, copying the payload from b. It -// returns the number of bytes written. The control message cm allows +// address dst through the endpoint c, copying the payload from b. It +// returns the number of bytes written. The control message cm allows // the datagram path and the outgoing interface to be specified. -// Currently only Darwin and Linux support this. The cm may be nil if +// Currently only Darwin and Linux support this. The cm may be nil if // control of the outgoing datagram is not required. func (c *payloadHandler) WriteTo(b []byte, cm *ControlMessage, dst net.Addr) (n int, err error) { if !c.ok() { diff --git a/vendor/golang.org/x/net/ipv4/payload_nocmsg.go b/vendor/golang.org/x/net/ipv4/payload_nocmsg.go index b874de0..6f9d5b0 100644 --- a/vendor/golang.org/x/net/ipv4/payload_nocmsg.go +++ b/vendor/golang.org/x/net/ipv4/payload_nocmsg.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. @@ -12,7 +12,7 @@ import ( ) // ReadFrom reads a payload of the received IPv4 datagram, from the -// endpoint c, copying the payload into b. It returns the number of +// endpoint c, copying the payload into b. It returns the number of // bytes copied into b, the control message cm and the source address // src of the received datagram. func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net.Addr, err error) { @@ -26,10 +26,10 @@ func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net. } // WriteTo writes a payload of the IPv4 datagram, to the destination -// address dst through the endpoint c, copying the payload from b. It -// returns the number of bytes written. The control message cm allows +// address dst through the endpoint c, copying the payload from b. It +// returns the number of bytes written. The control message cm allows // the datagram path and the outgoing interface to be specified. -// Currently only Darwin and Linux support this. The cm may be nil if +// Currently only Darwin and Linux support this. The cm may be nil if // control of the outgoing datagram is not required. func (c *payloadHandler) WriteTo(b []byte, cm *ControlMessage, dst net.Addr) (n int, err error) { if !c.ok() { diff --git a/vendor/golang.org/x/net/ipv4/sockopt_asmreq.go b/vendor/golang.org/x/net/ipv4/sockopt_asmreq.go index 04b5a30..8092f1d 100644 --- a/vendor/golang.org/x/net/ipv4/sockopt_asmreq.go +++ b/vendor/golang.org/x/net/ipv4/sockopt_asmreq.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/sockopt_asmreq_posix.go b/vendor/golang.org/x/net/ipv4/sockopt_asmreq_posix.go index 1db5f24..2259a39 100644 --- a/vendor/golang.org/x/net/ipv4/sockopt_asmreq_posix.go +++ b/vendor/golang.org/x/net/ipv4/sockopt_asmreq_posix.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/sockopt_asmreq_stub.go b/vendor/golang.org/x/net/ipv4/sockopt_asmreq_stub.go index 0fbdf47..e655635 100644 --- a/vendor/golang.org/x/net/ipv4/sockopt_asmreq_stub.go +++ b/vendor/golang.org/x/net/ipv4/sockopt_asmreq_stub.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/sockopt_posix.go b/vendor/golang.org/x/net/ipv4/sockopt_posix.go index 30dd2d7..d806803 100644 --- a/vendor/golang.org/x/net/ipv4/sockopt_posix.go +++ b/vendor/golang.org/x/net/ipv4/sockopt_posix.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/sockopt_stub.go b/vendor/golang.org/x/net/ipv4/sockopt_stub.go index c7278c1..4ff6099 100644 --- a/vendor/golang.org/x/net/ipv4/sockopt_stub.go +++ b/vendor/golang.org/x/net/ipv4/sockopt_stub.go @@ -1,4 +1,4 @@ -// Copyright 2012 The Go Authors. All rights reserved. +// Copyright 2012 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. diff --git a/vendor/golang.org/x/net/ipv4/sys_darwin.go b/vendor/golang.org/x/net/ipv4/sys_darwin.go index bc69414..abfffca 100644 --- a/vendor/golang.org/x/net/ipv4/sys_darwin.go +++ b/vendor/golang.org/x/net/ipv4/sys_darwin.go @@ -6,6 +6,8 @@ package ipv4 import ( "net" + "strconv" + "strings" "syscall" "unsafe" ) @@ -36,41 +38,40 @@ var ( func init() { // Seems like kern.osreldate is veiled on latest OS X. We use // kern.osrelease instead. - osver, err := syscall.Sysctl("kern.osrelease") + s, err := syscall.Sysctl("kern.osrelease") if err != nil { return } - var i int - for i = range osver { - if osver[i] == '.' { - break - } + ss := strings.Split(s, ".") + if len(ss) == 0 { + return } // The IP_PKTINFO and protocol-independent multicast API were - // introduced in OS X 10.7 (Darwin 11.0.0). But it looks like - // those features require OS X 10.8 (Darwin 12.0.0) and above. + // introduced in OS X 10.7 (Darwin 11). But it looks like + // those features require OS X 10.8 (Darwin 12) or above. // See http://support.apple.com/kb/HT1633. - if i > 2 || i == 2 && osver[0] >= '1' && osver[1] >= '2' { - ctlOpts[ctlPacketInfo].name = sysIP_PKTINFO - ctlOpts[ctlPacketInfo].length = sizeofInetPktinfo - ctlOpts[ctlPacketInfo].marshal = marshalPacketInfo - ctlOpts[ctlPacketInfo].parse = parsePacketInfo - sockOpts[ssoPacketInfo].name = sysIP_RECVPKTINFO - sockOpts[ssoPacketInfo].typ = ssoTypeInt - sockOpts[ssoMulticastInterface].typ = ssoTypeIPMreqn - sockOpts[ssoJoinGroup].name = sysMCAST_JOIN_GROUP - sockOpts[ssoJoinGroup].typ = ssoTypeGroupReq - sockOpts[ssoLeaveGroup].name = sysMCAST_LEAVE_GROUP - sockOpts[ssoLeaveGroup].typ = ssoTypeGroupReq - sockOpts[ssoJoinSourceGroup].name = sysMCAST_JOIN_SOURCE_GROUP - sockOpts[ssoJoinSourceGroup].typ = ssoTypeGroupSourceReq - sockOpts[ssoLeaveSourceGroup].name = sysMCAST_LEAVE_SOURCE_GROUP - sockOpts[ssoLeaveSourceGroup].typ = ssoTypeGroupSourceReq - sockOpts[ssoBlockSourceGroup].name = sysMCAST_BLOCK_SOURCE - sockOpts[ssoBlockSourceGroup].typ = ssoTypeGroupSourceReq - sockOpts[ssoUnblockSourceGroup].name = sysMCAST_UNBLOCK_SOURCE - sockOpts[ssoUnblockSourceGroup].typ = ssoTypeGroupSourceReq + if mjver, err := strconv.Atoi(ss[0]); err != nil || mjver < 12 { + return } + ctlOpts[ctlPacketInfo].name = sysIP_PKTINFO + ctlOpts[ctlPacketInfo].length = sizeofInetPktinfo + ctlOpts[ctlPacketInfo].marshal = marshalPacketInfo + ctlOpts[ctlPacketInfo].parse = parsePacketInfo + sockOpts[ssoPacketInfo].name = sysIP_RECVPKTINFO + sockOpts[ssoPacketInfo].typ = ssoTypeInt + sockOpts[ssoMulticastInterface].typ = ssoTypeIPMreqn + sockOpts[ssoJoinGroup].name = sysMCAST_JOIN_GROUP + sockOpts[ssoJoinGroup].typ = ssoTypeGroupReq + sockOpts[ssoLeaveGroup].name = sysMCAST_LEAVE_GROUP + sockOpts[ssoLeaveGroup].typ = ssoTypeGroupReq + sockOpts[ssoJoinSourceGroup].name = sysMCAST_JOIN_SOURCE_GROUP + sockOpts[ssoJoinSourceGroup].typ = ssoTypeGroupSourceReq + sockOpts[ssoLeaveSourceGroup].name = sysMCAST_LEAVE_SOURCE_GROUP + sockOpts[ssoLeaveSourceGroup].typ = ssoTypeGroupSourceReq + sockOpts[ssoBlockSourceGroup].name = sysMCAST_BLOCK_SOURCE + sockOpts[ssoBlockSourceGroup].typ = ssoTypeGroupSourceReq + sockOpts[ssoUnblockSourceGroup].name = sysMCAST_UNBLOCK_SOURCE + sockOpts[ssoUnblockSourceGroup].typ = ssoTypeGroupSourceReq } func (pi *inetPktinfo) setIfindex(i int) { diff --git a/vendor/golang.org/x/net/ipv4/sys_windows.go b/vendor/golang.org/x/net/ipv4/sys_windows.go index 3f4c535..fac00bd 100644 --- a/vendor/golang.org/x/net/ipv4/sys_windows.go +++ b/vendor/golang.org/x/net/ipv4/sys_windows.go @@ -51,6 +51,7 @@ var ( ssoMulticastTTL: {sysIP_MULTICAST_TTL, ssoTypeInt}, ssoMulticastInterface: {sysIP_MULTICAST_IF, ssoTypeInterface}, ssoMulticastLoopback: {sysIP_MULTICAST_LOOP, ssoTypeInt}, + ssoHeaderPrepend: {sysIP_HDRINCL, ssoTypeInt}, ssoJoinGroup: {sysIP_ADD_MEMBERSHIP, ssoTypeIPMreq}, ssoLeaveGroup: {sysIP_DROP_MEMBERSHIP, ssoTypeIPMreq}, } diff --git a/vendor/golang.org/x/net/ipv4/zsys_linux_mips.go b/vendor/golang.org/x/net/ipv4/zsys_linux_mips.go new file mode 100644 index 0000000..4da6720 --- /dev/null +++ b/vendor/golang.org/x/net/ipv4/zsys_linux_mips.go @@ -0,0 +1,146 @@ +// Created by cgo -godefs - DO NOT EDIT +// cgo -godefs defs_linux.go + +package ipv4 + +const ( + sysIP_TOS = 0x1 + sysIP_TTL = 0x2 + sysIP_HDRINCL = 0x3 + sysIP_OPTIONS = 0x4 + sysIP_ROUTER_ALERT = 0x5 + sysIP_RECVOPTS = 0x6 + sysIP_RETOPTS = 0x7 + sysIP_PKTINFO = 0x8 + sysIP_PKTOPTIONS = 0x9 + sysIP_MTU_DISCOVER = 0xa + sysIP_RECVERR = 0xb + sysIP_RECVTTL = 0xc + sysIP_RECVTOS = 0xd + sysIP_MTU = 0xe + sysIP_FREEBIND = 0xf + sysIP_TRANSPARENT = 0x13 + sysIP_RECVRETOPTS = 0x7 + sysIP_ORIGDSTADDR = 0x14 + sysIP_RECVORIGDSTADDR = 0x14 + sysIP_MINTTL = 0x15 + sysIP_NODEFRAG = 0x16 + sysIP_UNICAST_IF = 0x32 + + sysIP_MULTICAST_IF = 0x20 + sysIP_MULTICAST_TTL = 0x21 + sysIP_MULTICAST_LOOP = 0x22 + sysIP_ADD_MEMBERSHIP = 0x23 + sysIP_DROP_MEMBERSHIP = 0x24 + sysIP_UNBLOCK_SOURCE = 0x25 + sysIP_BLOCK_SOURCE = 0x26 + sysIP_ADD_SOURCE_MEMBERSHIP = 0x27 + sysIP_DROP_SOURCE_MEMBERSHIP = 0x28 + sysIP_MSFILTER = 0x29 + sysMCAST_JOIN_GROUP = 0x2a + sysMCAST_LEAVE_GROUP = 0x2d + sysMCAST_JOIN_SOURCE_GROUP = 0x2e + sysMCAST_LEAVE_SOURCE_GROUP = 0x2f + sysMCAST_BLOCK_SOURCE = 0x2b + sysMCAST_UNBLOCK_SOURCE = 0x2c + sysMCAST_MSFILTER = 0x30 + sysIP_MULTICAST_ALL = 0x31 + + sysICMP_FILTER = 0x1 + + sysSO_EE_ORIGIN_NONE = 0x0 + sysSO_EE_ORIGIN_LOCAL = 0x1 + sysSO_EE_ORIGIN_ICMP = 0x2 + sysSO_EE_ORIGIN_ICMP6 = 0x3 + sysSO_EE_ORIGIN_TXSTATUS = 0x4 + sysSO_EE_ORIGIN_TIMESTAMPING = 0x4 + + sysSOL_SOCKET = 0x1 + sysSO_ATTACH_FILTER = 0x1a + + sizeofKernelSockaddrStorage = 0x80 + sizeofSockaddrInet = 0x10 + sizeofInetPktinfo = 0xc + sizeofSockExtendedErr = 0x10 + + sizeofIPMreq = 0x8 + sizeofIPMreqn = 0xc + sizeofIPMreqSource = 0xc + sizeofGroupReq = 0x84 + sizeofGroupSourceReq = 0x104 + + sizeofICMPFilter = 0x4 +) + +type kernelSockaddrStorage struct { + Family uint16 + X__data [126]int8 +} + +type sockaddrInet struct { + Family uint16 + Port uint16 + Addr [4]byte /* in_addr */ + X__pad [8]uint8 +} + +type inetPktinfo struct { + Ifindex int32 + Spec_dst [4]byte /* in_addr */ + Addr [4]byte /* in_addr */ +} + +type sockExtendedErr struct { + Errno uint32 + Origin uint8 + Type uint8 + Code uint8 + Pad uint8 + Info uint32 + Data uint32 +} + +type ipMreq struct { + Multiaddr [4]byte /* in_addr */ + Interface [4]byte /* in_addr */ +} + +type ipMreqn struct { + Multiaddr [4]byte /* in_addr */ + Address [4]byte /* in_addr */ + Ifindex int32 +} + +type ipMreqSource struct { + Multiaddr uint32 + Interface uint32 + Sourceaddr uint32 +} + +type groupReq struct { + Interface uint32 + Group kernelSockaddrStorage +} + +type groupSourceReq struct { + Interface uint32 + Group kernelSockaddrStorage + Source kernelSockaddrStorage +} + +type icmpFilter struct { + Data uint32 +} + +type sockFProg struct { + Len uint16 + Pad_cgo_0 [2]byte + Filter *sockFilter +} + +type sockFilter struct { + Code uint16 + Jt uint8 + Jf uint8 + K uint32 +} diff --git a/vendor/golang.org/x/net/ipv4/zsys_linux_mipsle.go b/vendor/golang.org/x/net/ipv4/zsys_linux_mipsle.go new file mode 100644 index 0000000..4da6720 --- /dev/null +++ b/vendor/golang.org/x/net/ipv4/zsys_linux_mipsle.go @@ -0,0 +1,146 @@ +// Created by cgo -godefs - DO NOT EDIT +// cgo -godefs defs_linux.go + +package ipv4 + +const ( + sysIP_TOS = 0x1 + sysIP_TTL = 0x2 + sysIP_HDRINCL = 0x3 + sysIP_OPTIONS = 0x4 + sysIP_ROUTER_ALERT = 0x5 + sysIP_RECVOPTS = 0x6 + sysIP_RETOPTS = 0x7 + sysIP_PKTINFO = 0x8 + sysIP_PKTOPTIONS = 0x9 + sysIP_MTU_DISCOVER = 0xa + sysIP_RECVERR = 0xb + sysIP_RECVTTL = 0xc + sysIP_RECVTOS = 0xd + sysIP_MTU = 0xe + sysIP_FREEBIND = 0xf + sysIP_TRANSPARENT = 0x13 + sysIP_RECVRETOPTS = 0x7 + sysIP_ORIGDSTADDR = 0x14 + sysIP_RECVORIGDSTADDR = 0x14 + sysIP_MINTTL = 0x15 + sysIP_NODEFRAG = 0x16 + sysIP_UNICAST_IF = 0x32 + + sysIP_MULTICAST_IF = 0x20 + sysIP_MULTICAST_TTL = 0x21 + sysIP_MULTICAST_LOOP = 0x22 + sysIP_ADD_MEMBERSHIP = 0x23 + sysIP_DROP_MEMBERSHIP = 0x24 + sysIP_UNBLOCK_SOURCE = 0x25 + sysIP_BLOCK_SOURCE = 0x26 + sysIP_ADD_SOURCE_MEMBERSHIP = 0x27 + sysIP_DROP_SOURCE_MEMBERSHIP = 0x28 + sysIP_MSFILTER = 0x29 + sysMCAST_JOIN_GROUP = 0x2a + sysMCAST_LEAVE_GROUP = 0x2d + sysMCAST_JOIN_SOURCE_GROUP = 0x2e + sysMCAST_LEAVE_SOURCE_GROUP = 0x2f + sysMCAST_BLOCK_SOURCE = 0x2b + sysMCAST_UNBLOCK_SOURCE = 0x2c + sysMCAST_MSFILTER = 0x30 + sysIP_MULTICAST_ALL = 0x31 + + sysICMP_FILTER = 0x1 + + sysSO_EE_ORIGIN_NONE = 0x0 + sysSO_EE_ORIGIN_LOCAL = 0x1 + sysSO_EE_ORIGIN_ICMP = 0x2 + sysSO_EE_ORIGIN_ICMP6 = 0x3 + sysSO_EE_ORIGIN_TXSTATUS = 0x4 + sysSO_EE_ORIGIN_TIMESTAMPING = 0x4 + + sysSOL_SOCKET = 0x1 + sysSO_ATTACH_FILTER = 0x1a + + sizeofKernelSockaddrStorage = 0x80 + sizeofSockaddrInet = 0x10 + sizeofInetPktinfo = 0xc + sizeofSockExtendedErr = 0x10 + + sizeofIPMreq = 0x8 + sizeofIPMreqn = 0xc + sizeofIPMreqSource = 0xc + sizeofGroupReq = 0x84 + sizeofGroupSourceReq = 0x104 + + sizeofICMPFilter = 0x4 +) + +type kernelSockaddrStorage struct { + Family uint16 + X__data [126]int8 +} + +type sockaddrInet struct { + Family uint16 + Port uint16 + Addr [4]byte /* in_addr */ + X__pad [8]uint8 +} + +type inetPktinfo struct { + Ifindex int32 + Spec_dst [4]byte /* in_addr */ + Addr [4]byte /* in_addr */ +} + +type sockExtendedErr struct { + Errno uint32 + Origin uint8 + Type uint8 + Code uint8 + Pad uint8 + Info uint32 + Data uint32 +} + +type ipMreq struct { + Multiaddr [4]byte /* in_addr */ + Interface [4]byte /* in_addr */ +} + +type ipMreqn struct { + Multiaddr [4]byte /* in_addr */ + Address [4]byte /* in_addr */ + Ifindex int32 +} + +type ipMreqSource struct { + Multiaddr uint32 + Interface uint32 + Sourceaddr uint32 +} + +type groupReq struct { + Interface uint32 + Group kernelSockaddrStorage +} + +type groupSourceReq struct { + Interface uint32 + Group kernelSockaddrStorage + Source kernelSockaddrStorage +} + +type icmpFilter struct { + Data uint32 +} + +type sockFProg struct { + Len uint16 + Pad_cgo_0 [2]byte + Filter *sockFilter +} + +type sockFilter struct { + Code uint16 + Jt uint8 + Jf uint8 + K uint32 +} diff --git a/vendor/golang.org/x/text/LICENSE b/vendor/golang.org/x/text/LICENSE new file mode 100644 index 0000000..6a66aea --- /dev/null +++ b/vendor/golang.org/x/text/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/text/PATENTS b/vendor/golang.org/x/text/PATENTS new file mode 100644 index 0000000..7330990 --- /dev/null +++ b/vendor/golang.org/x/text/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/text/secure/bidirule/bidirule.go b/vendor/golang.org/x/text/secure/bidirule/bidirule.go new file mode 100644 index 0000000..a7161bd --- /dev/null +++ b/vendor/golang.org/x/text/secure/bidirule/bidirule.go @@ -0,0 +1,342 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package bidirule implements the Bidi Rule defined by RFC 5893. +// +// This package is under development. The API may change without notice and +// without preserving backward compatibility. +package bidirule + +import ( + "errors" + "unicode/utf8" + + "golang.org/x/text/transform" + "golang.org/x/text/unicode/bidi" +) + +// This file contains an implementation of RFC 5893: Right-to-Left Scripts for +// Internationalized Domain Names for Applications (IDNA) +// +// A label is an individual component of a domain name. Labels are usually +// shown separated by dots; for example, the domain name "www.example.com" is +// composed of three labels: "www", "example", and "com". +// +// An RTL label is a label that contains at least one character of class R, AL, +// or AN. An LTR label is any label that is not an RTL label. +// +// A "Bidi domain name" is a domain name that contains at least one RTL label. +// +// The following guarantees can be made based on the above: +// +// o In a domain name consisting of only labels that satisfy the rule, +// the requirements of Section 3 are satisfied. Note that even LTR +// labels and pure ASCII labels have to be tested. +// +// o In a domain name consisting of only LDH labels (as defined in the +// Definitions document [RFC5890]) and labels that satisfy the rule, +// the requirements of Section 3 are satisfied as long as a label +// that starts with an ASCII digit does not come after a +// right-to-left label. +// +// No guarantee is given for other combinations. + +// ErrInvalid indicates a label is invalid according to the Bidi Rule. +var ErrInvalid = errors.New("bidirule: failed Bidi Rule") + +type ruleState uint8 + +const ( + ruleInitial ruleState = iota + ruleLTR + ruleLTRFinal + ruleRTL + ruleRTLFinal + ruleInvalid +) + +type ruleTransition struct { + next ruleState + mask uint16 +} + +var transitions = [...][2]ruleTransition{ + // [2.1] The first character must be a character with Bidi property L, R, or + // AL. If it has the R or AL property, it is an RTL label; if it has the L + // property, it is an LTR label. + ruleInitial: { + {ruleLTRFinal, 1 << bidi.L}, + {ruleRTLFinal, 1< 0 bytes returned + // before considering the error". + if r.src0 != r.src1 || r.err != nil { + r.dst0 = 0 + r.dst1, n, err = r.t.Transform(r.dst, r.src[r.src0:r.src1], r.err == io.EOF) + r.src0 += n + + switch { + case err == nil: + if r.src0 != r.src1 { + r.err = errInconsistentByteCount + } + // The Transform call was successful; we are complete if we + // cannot read more bytes into src. + r.transformComplete = r.err != nil + continue + case err == ErrShortDst && (r.dst1 != 0 || n != 0): + // Make room in dst by copying out, and try again. + continue + case err == ErrShortSrc && r.src1-r.src0 != len(r.src) && r.err == nil: + // Read more bytes into src via the code below, and try again. + default: + r.transformComplete = true + // The reader error (r.err) takes precedence over the + // transformer error (err) unless r.err is nil or io.EOF. + if r.err == nil || r.err == io.EOF { + r.err = err + } + continue + } + } + + // Move any untransformed source bytes to the start of the buffer + // and read more bytes. + if r.src0 != 0 { + r.src0, r.src1 = 0, copy(r.src, r.src[r.src0:r.src1]) + } + n, r.err = r.r.Read(r.src[r.src1:]) + r.src1 += n + } +} + +// TODO: implement ReadByte (and ReadRune??). + +// Writer wraps another io.Writer by transforming the bytes read. +// The user needs to call Close to flush unwritten bytes that may +// be buffered. +type Writer struct { + w io.Writer + t Transformer + dst []byte + + // src[:n] contains bytes that have not yet passed through t. + src []byte + n int +} + +// NewWriter returns a new Writer that wraps w by transforming the bytes written +// via t. It calls Reset on t. +func NewWriter(w io.Writer, t Transformer) *Writer { + t.Reset() + return &Writer{ + w: w, + t: t, + dst: make([]byte, defaultBufSize), + src: make([]byte, defaultBufSize), + } +} + +// Write implements the io.Writer interface. If there are not enough +// bytes available to complete a Transform, the bytes will be buffered +// for the next write. Call Close to convert the remaining bytes. +func (w *Writer) Write(data []byte) (n int, err error) { + src := data + if w.n > 0 { + // Append bytes from data to the last remainder. + // TODO: limit the amount copied on first try. + n = copy(w.src[w.n:], data) + w.n += n + src = w.src[:w.n] + } + for { + nDst, nSrc, err := w.t.Transform(w.dst, src, false) + if _, werr := w.w.Write(w.dst[:nDst]); werr != nil { + return n, werr + } + src = src[nSrc:] + if w.n == 0 { + n += nSrc + } else if len(src) <= n { + // Enough bytes from w.src have been consumed. We make src point + // to data instead to reduce the copying. + w.n = 0 + n -= len(src) + src = data[n:] + if n < len(data) && (err == nil || err == ErrShortSrc) { + continue + } + } + switch err { + case ErrShortDst: + // This error is okay as long as we are making progress. + if nDst > 0 || nSrc > 0 { + continue + } + case ErrShortSrc: + if len(src) < len(w.src) { + m := copy(w.src, src) + // If w.n > 0, bytes from data were already copied to w.src and n + // was already set to the number of bytes consumed. + if w.n == 0 { + n += m + } + w.n = m + err = nil + } else if nDst > 0 || nSrc > 0 { + // Not enough buffer to store the remainder. Keep processing as + // long as there is progress. Without this case, transforms that + // require a lookahead larger than the buffer may result in an + // error. This is not something one may expect to be common in + // practice, but it may occur when buffers are set to small + // sizes during testing. + continue + } + case nil: + if w.n > 0 { + err = errInconsistentByteCount + } + } + return n, err + } +} + +// Close implements the io.Closer interface. +func (w *Writer) Close() error { + src := w.src[:w.n] + for { + nDst, nSrc, err := w.t.Transform(w.dst, src, true) + if _, werr := w.w.Write(w.dst[:nDst]); werr != nil { + return werr + } + if err != ErrShortDst { + return err + } + src = src[nSrc:] + } +} + +type nop struct{ NopResetter } + +func (nop) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { + n := copy(dst, src) + if n < len(src) { + err = ErrShortDst + } + return n, n, err +} + +func (nop) Span(src []byte, atEOF bool) (n int, err error) { + return len(src), nil +} + +type discard struct{ NopResetter } + +func (discard) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { + return 0, len(src), nil +} + +var ( + // Discard is a Transformer for which all Transform calls succeed + // by consuming all bytes and writing nothing. + Discard Transformer = discard{} + + // Nop is a SpanningTransformer that copies src to dst. + Nop SpanningTransformer = nop{} +) + +// chain is a sequence of links. A chain with N Transformers has N+1 links and +// N+1 buffers. Of those N+1 buffers, the first and last are the src and dst +// buffers given to chain.Transform and the middle N-1 buffers are intermediate +// buffers owned by the chain. The i'th link transforms bytes from the i'th +// buffer chain.link[i].b at read offset chain.link[i].p to the i+1'th buffer +// chain.link[i+1].b at write offset chain.link[i+1].n, for i in [0, N). +type chain struct { + link []link + err error + // errStart is the index at which the error occurred plus 1. Processing + // errStart at this level at the next call to Transform. As long as + // errStart > 0, chain will not consume any more source bytes. + errStart int +} + +func (c *chain) fatalError(errIndex int, err error) { + if i := errIndex + 1; i > c.errStart { + c.errStart = i + c.err = err + } +} + +type link struct { + t Transformer + // b[p:n] holds the bytes to be transformed by t. + b []byte + p int + n int +} + +func (l *link) src() []byte { + return l.b[l.p:l.n] +} + +func (l *link) dst() []byte { + return l.b[l.n:] +} + +// Chain returns a Transformer that applies t in sequence. +func Chain(t ...Transformer) Transformer { + if len(t) == 0 { + return nop{} + } + c := &chain{link: make([]link, len(t)+1)} + for i, tt := range t { + c.link[i].t = tt + } + // Allocate intermediate buffers. + b := make([][defaultBufSize]byte, len(t)-1) + for i := range b { + c.link[i+1].b = b[i][:] + } + return c +} + +// Reset resets the state of Chain. It calls Reset on all the Transformers. +func (c *chain) Reset() { + for i, l := range c.link { + if l.t != nil { + l.t.Reset() + } + c.link[i].p, c.link[i].n = 0, 0 + } +} + +// TODO: make chain use Span (is going to be fun to implement!) + +// Transform applies the transformers of c in sequence. +func (c *chain) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { + // Set up src and dst in the chain. + srcL := &c.link[0] + dstL := &c.link[len(c.link)-1] + srcL.b, srcL.p, srcL.n = src, 0, len(src) + dstL.b, dstL.n = dst, 0 + var lastFull, needProgress bool // for detecting progress + + // i is the index of the next Transformer to apply, for i in [low, high]. + // low is the lowest index for which c.link[low] may still produce bytes. + // high is the highest index for which c.link[high] has a Transformer. + // The error returned by Transform determines whether to increase or + // decrease i. We try to completely fill a buffer before converting it. + for low, i, high := c.errStart, c.errStart, len(c.link)-2; low <= i && i <= high; { + in, out := &c.link[i], &c.link[i+1] + nDst, nSrc, err0 := in.t.Transform(out.dst(), in.src(), atEOF && low == i) + out.n += nDst + in.p += nSrc + if i > 0 && in.p == in.n { + in.p, in.n = 0, 0 + } + needProgress, lastFull = lastFull, false + switch err0 { + case ErrShortDst: + // Process the destination buffer next. Return if we are already + // at the high index. + if i == high { + return dstL.n, srcL.p, ErrShortDst + } + if out.n != 0 { + i++ + // If the Transformer at the next index is not able to process any + // source bytes there is nothing that can be done to make progress + // and the bytes will remain unprocessed. lastFull is used to + // detect this and break out of the loop with a fatal error. + lastFull = true + continue + } + // The destination buffer was too small, but is completely empty. + // Return a fatal error as this transformation can never complete. + c.fatalError(i, errShortInternal) + case ErrShortSrc: + if i == 0 { + // Save ErrShortSrc in err. All other errors take precedence. + err = ErrShortSrc + break + } + // Source bytes were depleted before filling up the destination buffer. + // Verify we made some progress, move the remaining bytes to the errStart + // and try to get more source bytes. + if needProgress && nSrc == 0 || in.n-in.p == len(in.b) { + // There were not enough source bytes to proceed while the source + // buffer cannot hold any more bytes. Return a fatal error as this + // transformation can never complete. + c.fatalError(i, errShortInternal) + break + } + // in.b is an internal buffer and we can make progress. + in.p, in.n = 0, copy(in.b, in.src()) + fallthrough + case nil: + // if i == low, we have depleted the bytes at index i or any lower levels. + // In that case we increase low and i. In all other cases we decrease i to + // fetch more bytes before proceeding to the next index. + if i > low { + i-- + continue + } + default: + c.fatalError(i, err0) + } + // Exhausted level low or fatal error: increase low and continue + // to process the bytes accepted so far. + i++ + low = i + } + + // If c.errStart > 0, this means we found a fatal error. We will clear + // all upstream buffers. At this point, no more progress can be made + // downstream, as Transform would have bailed while handling ErrShortDst. + if c.errStart > 0 { + for i := 1; i < c.errStart; i++ { + c.link[i].p, c.link[i].n = 0, 0 + } + err, c.errStart, c.err = c.err, 0, nil + } + return dstL.n, srcL.p, err +} + +// Deprecated: use runes.Remove instead. +func RemoveFunc(f func(r rune) bool) Transformer { + return removeF(f) +} + +type removeF func(r rune) bool + +func (removeF) Reset() {} + +// Transform implements the Transformer interface. +func (t removeF) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { + for r, sz := rune(0), 0; len(src) > 0; src = src[sz:] { + + if r = rune(src[0]); r < utf8.RuneSelf { + sz = 1 + } else { + r, sz = utf8.DecodeRune(src) + + if sz == 1 { + // Invalid rune. + if !atEOF && !utf8.FullRune(src) { + err = ErrShortSrc + break + } + // We replace illegal bytes with RuneError. Not doing so might + // otherwise turn a sequence of invalid UTF-8 into valid UTF-8. + // The resulting byte sequence may subsequently contain runes + // for which t(r) is true that were passed unnoticed. + if !t(r) { + if nDst+3 > len(dst) { + err = ErrShortDst + break + } + nDst += copy(dst[nDst:], "\uFFFD") + } + nSrc++ + continue + } + } + + if !t(r) { + if nDst+sz > len(dst) { + err = ErrShortDst + break + } + nDst += copy(dst[nDst:], src[:sz]) + } + nSrc += sz + } + return +} + +// grow returns a new []byte that is longer than b, and copies the first n bytes +// of b to the start of the new slice. +func grow(b []byte, n int) []byte { + m := len(b) + if m <= 32 { + m = 64 + } else if m <= 256 { + m *= 2 + } else { + m += m >> 1 + } + buf := make([]byte, m) + copy(buf, b[:n]) + return buf +} + +const initialBufSize = 128 + +// String returns a string with the result of converting s[:n] using t, where +// n <= len(s). If err == nil, n will be len(s). It calls Reset on t. +func String(t Transformer, s string) (result string, n int, err error) { + t.Reset() + if s == "" { + // Fast path for the common case for empty input. Results in about a + // 86% reduction of running time for BenchmarkStringLowerEmpty. + if _, _, err := t.Transform(nil, nil, true); err == nil { + return "", 0, nil + } + } + + // Allocate only once. Note that both dst and src escape when passed to + // Transform. + buf := [2 * initialBufSize]byte{} + dst := buf[:initialBufSize:initialBufSize] + src := buf[initialBufSize : 2*initialBufSize] + + // The input string s is transformed in multiple chunks (starting with a + // chunk size of initialBufSize). nDst and nSrc are per-chunk (or + // per-Transform-call) indexes, pDst and pSrc are overall indexes. + nDst, nSrc := 0, 0 + pDst, pSrc := 0, 0 + + // pPrefix is the length of a common prefix: the first pPrefix bytes of the + // result will equal the first pPrefix bytes of s. It is not guaranteed to + // be the largest such value, but if pPrefix, len(result) and len(s) are + // all equal after the final transform (i.e. calling Transform with atEOF + // being true returned nil error) then we don't need to allocate a new + // result string. + pPrefix := 0 + for { + // Invariant: pDst == pPrefix && pSrc == pPrefix. + + n := copy(src, s[pSrc:]) + nDst, nSrc, err = t.Transform(dst, src[:n], pSrc+n == len(s)) + pDst += nDst + pSrc += nSrc + + // TODO: let transformers implement an optional Spanner interface, akin + // to norm's QuickSpan. This would even allow us to avoid any allocation. + if !bytes.Equal(dst[:nDst], src[:nSrc]) { + break + } + pPrefix = pSrc + if err == ErrShortDst { + // A buffer can only be short if a transformer modifies its input. + break + } else if err == ErrShortSrc { + if nSrc == 0 { + // No progress was made. + break + } + // Equal so far and !atEOF, so continue checking. + } else if err != nil || pPrefix == len(s) { + return string(s[:pPrefix]), pPrefix, err + } + } + // Post-condition: pDst == pPrefix + nDst && pSrc == pPrefix + nSrc. + + // We have transformed the first pSrc bytes of the input s to become pDst + // transformed bytes. Those transformed bytes are discontiguous: the first + // pPrefix of them equal s[:pPrefix] and the last nDst of them equal + // dst[:nDst]. We copy them around, into a new dst buffer if necessary, so + // that they become one contiguous slice: dst[:pDst]. + if pPrefix != 0 { + newDst := dst + if pDst > len(newDst) { + newDst = make([]byte, len(s)+nDst-nSrc) + } + copy(newDst[pPrefix:pDst], dst[:nDst]) + copy(newDst[:pPrefix], s[:pPrefix]) + dst = newDst + } + + // Prevent duplicate Transform calls with atEOF being true at the end of + // the input. Also return if we have an unrecoverable error. + if (err == nil && pSrc == len(s)) || + (err != nil && err != ErrShortDst && err != ErrShortSrc) { + return string(dst[:pDst]), pSrc, err + } + + // Transform the remaining input, growing dst and src buffers as necessary. + for { + n := copy(src, s[pSrc:]) + nDst, nSrc, err := t.Transform(dst[pDst:], src[:n], pSrc+n == len(s)) + pDst += nDst + pSrc += nSrc + + // If we got ErrShortDst or ErrShortSrc, do not grow as long as we can + // make progress. This may avoid excessive allocations. + if err == ErrShortDst { + if nDst == 0 { + dst = grow(dst, pDst) + } + } else if err == ErrShortSrc { + if nSrc == 0 { + src = grow(src, 0) + } + } else if err != nil || pSrc == len(s) { + return string(dst[:pDst]), pSrc, err + } + } +} + +// Bytes returns a new byte slice with the result of converting b[:n] using t, +// where n <= len(b). If err == nil, n will be len(b). It calls Reset on t. +func Bytes(t Transformer, b []byte) (result []byte, n int, err error) { + return doAppend(t, 0, make([]byte, len(b)), b) +} + +// Append appends the result of converting src[:n] using t to dst, where +// n <= len(src), If err == nil, n will be len(src). It calls Reset on t. +func Append(t Transformer, dst, src []byte) (result []byte, n int, err error) { + if len(dst) == cap(dst) { + n := len(src) + len(dst) // It is okay for this to be 0. + b := make([]byte, n) + dst = b[:copy(b, dst)] + } + return doAppend(t, len(dst), dst[:cap(dst)], src) +} + +func doAppend(t Transformer, pDst int, dst, src []byte) (result []byte, n int, err error) { + t.Reset() + pSrc := 0 + for { + nDst, nSrc, err := t.Transform(dst[pDst:], src[pSrc:], true) + pDst += nDst + pSrc += nSrc + if err != ErrShortDst { + return dst[:pDst], pSrc, err + } + + // Grow the destination buffer, but do not grow as long as we can make + // progress. This may avoid excessive allocations. + if nDst == 0 { + dst = grow(dst, pDst) + } + } +} diff --git a/vendor/golang.org/x/text/unicode/bidi/bidi.go b/vendor/golang.org/x/text/unicode/bidi/bidi.go new file mode 100644 index 0000000..3fc4a62 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/bidi.go @@ -0,0 +1,198 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//go:generate go run gen.go gen_trieval.go gen_ranges.go + +// Package bidi contains functionality for bidirectional text support. +// +// See http://www.unicode.org/reports/tr9. +// +// NOTE: UNDER CONSTRUCTION. This API may change in backwards incompatible ways +// and without notice. +package bidi // import "golang.org/x/text/unicode/bidi" + +// TODO: +// The following functionality would not be hard to implement, but hinges on +// the definition of a Segmenter interface. For now this is up to the user. +// - Iterate over paragraphs +// - Segmenter to iterate over runs directly from a given text. +// Also: +// - Transformer for reordering? +// - Transformer (validator, really) for Bidi Rule. + +// This API tries to avoid dealing with embedding levels for now. Under the hood +// these will be computed, but the question is to which extent the user should +// know they exist. We should at some point allow the user to specify an +// embedding hierarchy, though. + +// A Direction indicates the overall flow of text. +type Direction int + +const ( + // LeftToRight indicates the text contains no right-to-left characters and + // that either there are some left-to-right characters or the option + // DefaultDirection(LeftToRight) was passed. + LeftToRight Direction = iota + + // RightToLeft indicates the text contains no left-to-right characters and + // that either there are some right-to-left characters or the option + // DefaultDirection(RightToLeft) was passed. + RightToLeft + + // Mixed indicates text contains both left-to-right and right-to-left + // characters. + Mixed + + // Neutral means that text contains no left-to-right and right-to-left + // characters and that no default direction has been set. + Neutral +) + +type options struct{} + +// An Option is an option for Bidi processing. +type Option func(*options) + +// ICU allows the user to define embedding levels. This may be used, for example, +// to use hierarchical structure of markup languages to define embeddings. +// The following option may be a way to expose this functionality in this API. +// // LevelFunc sets a function that associates nesting levels with the given text. +// // The levels function will be called with monotonically increasing values for p. +// func LevelFunc(levels func(p int) int) Option { +// panic("unimplemented") +// } + +// DefaultDirection sets the default direction for a Paragraph. The direction is +// overridden if the text contains directional characters. +func DefaultDirection(d Direction) Option { + panic("unimplemented") +} + +// A Paragraph holds a single Paragraph for Bidi processing. +type Paragraph struct { + // buffers +} + +// SetBytes configures p for the given paragraph text. It replaces text +// previously set by SetBytes or SetString. If b contains a paragraph separator +// it will only process the first paragraph and report the number of bytes +// consumed from b including this separator. Error may be non-nil if options are +// given. +func (p *Paragraph) SetBytes(b []byte, opts ...Option) (n int, err error) { + panic("unimplemented") +} + +// SetString configures p for the given paragraph text. It replaces text +// previously set by SetBytes or SetString. If b contains a paragraph separator +// it will only process the first paragraph and report the number of bytes +// consumed from b including this separator. Error may be non-nil if options are +// given. +func (p *Paragraph) SetString(s string, opts ...Option) (n int, err error) { + panic("unimplemented") +} + +// IsLeftToRight reports whether the principle direction of rendering for this +// paragraphs is left-to-right. If this returns false, the principle direction +// of rendering is right-to-left. +func (p *Paragraph) IsLeftToRight() bool { + panic("unimplemented") +} + +// Direction returns the direction of the text of this paragraph. +// +// The direction may be LeftToRight, RightToLeft, Mixed, or Neutral. +func (p *Paragraph) Direction() Direction { + panic("unimplemented") +} + +// RunAt reports the Run at the given position of the input text. +// +// This method can be used for computing line breaks on paragraphs. +func (p *Paragraph) RunAt(pos int) Run { + panic("unimplemented") +} + +// Order computes the visual ordering of all the runs in a Paragraph. +func (p *Paragraph) Order() (Ordering, error) { + panic("unimplemented") +} + +// Line computes the visual ordering of runs for a single line starting and +// ending at the given positions in the original text. +func (p *Paragraph) Line(start, end int) (Ordering, error) { + panic("unimplemented") +} + +// An Ordering holds the computed visual order of runs of a Paragraph. Calling +// SetBytes or SetString on the originating Paragraph invalidates an Ordering. +// The methods of an Ordering should only be called by one goroutine at a time. +type Ordering struct{} + +// Direction reports the directionality of the runs. +// +// The direction may be LeftToRight, RightToLeft, Mixed, or Neutral. +func (o *Ordering) Direction() Direction { + panic("unimplemented") +} + +// NumRuns returns the number of runs. +func (o *Ordering) NumRuns() int { + panic("unimplemented") +} + +// Run returns the ith run within the ordering. +func (o *Ordering) Run(i int) Run { + panic("unimplemented") +} + +// TODO: perhaps with options. +// // Reorder creates a reader that reads the runes in visual order per character. +// // Modifiers remain after the runes they modify. +// func (l *Runs) Reorder() io.Reader { +// panic("unimplemented") +// } + +// A Run is a continuous sequence of characters of a single direction. +type Run struct { +} + +// String returns the text of the run in its original order. +func (r *Run) String() string { + panic("unimplemented") +} + +// Bytes returns the text of the run in its original order. +func (r *Run) Bytes() []byte { + panic("unimplemented") +} + +// TODO: methods for +// - Display order +// - headers and footers +// - bracket replacement. + +// Direction reports the direction of the run. +func (r *Run) Direction() Direction { + panic("unimplemented") +} + +// Position of the Run within the text passed to SetBytes or SetString of the +// originating Paragraph value. +func (r *Run) Pos() (start, end int) { + panic("unimplemented") +} + +// AppendReverse reverses the order of characters of in, appends them to out, +// and returns the result. Modifiers will still follow the runes they modify. +// Brackets are replaced with their counterparts. +func AppendReverse(out, in []byte) []byte { + panic("unimplemented") +} + +// ReverseString reverses the order of characters in s and returns a new string. +// Modifiers will still follow the runes they modify. Brackets are replaced with +// their counterparts. +func ReverseString(s string) string { + panic("unimplemented") +} diff --git a/vendor/golang.org/x/text/unicode/bidi/bracket.go b/vendor/golang.org/x/text/unicode/bidi/bracket.go new file mode 100644 index 0000000..601e259 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/bracket.go @@ -0,0 +1,335 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package bidi + +import ( + "container/list" + "fmt" + "sort" +) + +// This file contains a port of the reference implementation of the +// Bidi Parentheses Algorithm: +// http://www.unicode.org/Public/PROGRAMS/BidiReferenceJava/BidiPBAReference.java +// +// The implementation in this file covers definitions BD14-BD16 and rule N0 +// of UAX#9. +// +// Some preprocessing is done for each rune before data is passed to this +// algorithm: +// - opening and closing brackets are identified +// - a bracket pair type, like '(' and ')' is assigned a unique identifier that +// is identical for the opening and closing bracket. It is left to do these +// mappings. +// - The BPA algorithm requires that bracket characters that are canonical +// equivalents of each other be able to be substituted for each other. +// It is the responsibility of the caller to do this canonicalization. +// +// In implementing BD16, this implementation departs slightly from the "logical" +// algorithm defined in UAX#9. In particular, the stack referenced there +// supports operations that go beyond a "basic" stack. An equivalent +// implementation based on a linked list is used here. + +// Bidi_Paired_Bracket_Type +// BD14. An opening paired bracket is a character whose +// Bidi_Paired_Bracket_Type property value is Open. +// +// BD15. A closing paired bracket is a character whose +// Bidi_Paired_Bracket_Type property value is Close. +type bracketType byte + +const ( + bpNone bracketType = iota + bpOpen + bpClose +) + +// bracketPair holds a pair of index values for opening and closing bracket +// location of a bracket pair. +type bracketPair struct { + opener int + closer int +} + +func (b *bracketPair) String() string { + return fmt.Sprintf("(%v, %v)", b.opener, b.closer) +} + +// bracketPairs is a slice of bracketPairs with a sort.Interface implementation. +type bracketPairs []bracketPair + +func (b bracketPairs) Len() int { return len(b) } +func (b bracketPairs) Swap(i, j int) { b[i], b[j] = b[j], b[i] } +func (b bracketPairs) Less(i, j int) bool { return b[i].opener < b[j].opener } + +// resolvePairedBrackets runs the paired bracket part of the UBA algorithm. +// +// For each rune, it takes the indexes into the original string, the class the +// bracket type (in pairTypes) and the bracket identifier (pairValues). It also +// takes the direction type for the start-of-sentence and the embedding level. +// +// The identifiers for bracket types are the rune of the canonicalized opening +// bracket for brackets (open or close) or 0 for runes that are not brackets. +func resolvePairedBrackets(s *isolatingRunSequence) { + p := bracketPairer{ + sos: s.sos, + openers: list.New(), + codesIsolatedRun: s.types, + indexes: s.indexes, + } + dirEmbed := L + if s.level&1 != 0 { + dirEmbed = R + } + p.locateBrackets(s.p.pairTypes, s.p.pairValues) + p.resolveBrackets(dirEmbed, s.p.initialTypes) +} + +type bracketPairer struct { + sos Class // direction corresponding to start of sequence + + // The following is a restatement of BD 16 using non-algorithmic language. + // + // A bracket pair is a pair of characters consisting of an opening + // paired bracket and a closing paired bracket such that the + // Bidi_Paired_Bracket property value of the former equals the latter, + // subject to the following constraints. + // - both characters of a pair occur in the same isolating run sequence + // - the closing character of a pair follows the opening character + // - any bracket character can belong at most to one pair, the earliest possible one + // - any bracket character not part of a pair is treated like an ordinary character + // - pairs may nest properly, but their spans may not overlap otherwise + + // Bracket characters with canonical decompositions are supposed to be + // treated as if they had been normalized, to allow normalized and non- + // normalized text to give the same result. In this implementation that step + // is pushed out to the caller. The caller has to ensure that the pairValue + // slices contain the rune of the opening bracket after normalization for + // any opening or closing bracket. + + openers *list.List // list of positions for opening brackets + + // bracket pair positions sorted by location of opening bracket + pairPositions bracketPairs + + codesIsolatedRun []Class // directional bidi codes for an isolated run + indexes []int // array of index values into the original string + +} + +// matchOpener reports whether characters at given positions form a matching +// bracket pair. +func (p *bracketPairer) matchOpener(pairValues []rune, opener, closer int) bool { + return pairValues[p.indexes[opener]] == pairValues[p.indexes[closer]] +} + +const maxPairingDepth = 63 + +// locateBrackets locates matching bracket pairs according to BD16. +// +// This implementation uses a linked list instead of a stack, because, while +// elements are added at the front (like a push) they are not generally removed +// in atomic 'pop' operations, reducing the benefit of the stack archetype. +func (p *bracketPairer) locateBrackets(pairTypes []bracketType, pairValues []rune) { + // traverse the run + // do that explicitly (not in a for-each) so we can record position + for i, index := range p.indexes { + + // look at the bracket type for each character + if pairTypes[index] == bpNone || p.codesIsolatedRun[i] != ON { + // continue scanning + continue + } + switch pairTypes[index] { + case bpOpen: + // check if maximum pairing depth reached + if p.openers.Len() == maxPairingDepth { + p.openers.Init() + return + } + // remember opener location, most recent first + p.openers.PushFront(i) + + case bpClose: + // see if there is a match + count := 0 + for elem := p.openers.Front(); elem != nil; elem = elem.Next() { + count++ + opener := elem.Value.(int) + if p.matchOpener(pairValues, opener, i) { + // if the opener matches, add nested pair to the ordered list + p.pairPositions = append(p.pairPositions, bracketPair{opener, i}) + // remove up to and including matched opener + for ; count > 0; count-- { + p.openers.Remove(p.openers.Front()) + } + break + } + } + sort.Sort(p.pairPositions) + // if we get here, the closing bracket matched no openers + // and gets ignored + } + } +} + +// Bracket pairs within an isolating run sequence are processed as units so +// that both the opening and the closing paired bracket in a pair resolve to +// the same direction. +// +// N0. Process bracket pairs in an isolating run sequence sequentially in +// the logical order of the text positions of the opening paired brackets +// using the logic given below. Within this scope, bidirectional types EN +// and AN are treated as R. +// +// Identify the bracket pairs in the current isolating run sequence +// according to BD16. For each bracket-pair element in the list of pairs of +// text positions: +// +// a Inspect the bidirectional types of the characters enclosed within the +// bracket pair. +// +// b If any strong type (either L or R) matching the embedding direction is +// found, set the type for both brackets in the pair to match the embedding +// direction. +// +// o [ e ] o -> o e e e o +// +// o [ o e ] -> o e o e e +// +// o [ NI e ] -> o e NI e e +// +// c Otherwise, if a strong type (opposite the embedding direction) is +// found, test for adjacent strong types as follows: 1 First, check +// backwards before the opening paired bracket until the first strong type +// (L, R, or sos) is found. If that first preceding strong type is opposite +// the embedding direction, then set the type for both brackets in the pair +// to that type. 2 Otherwise, set the type for both brackets in the pair to +// the embedding direction. +// +// o [ o ] e -> o o o o e +// +// o [ o NI ] o -> o o o NI o o +// +// e [ o ] o -> e e o e o +// +// e [ o ] e -> e e o e e +// +// e ( o [ o ] NI ) e -> e e o o o o NI e e +// +// d Otherwise, do not set the type for the current bracket pair. Note that +// if the enclosed text contains no strong types the paired brackets will +// both resolve to the same level when resolved individually using rules N1 +// and N2. +// +// e ( NI ) o -> e ( NI ) o + +// getStrongTypeN0 maps character's directional code to strong type as required +// by rule N0. +// +// TODO: have separate type for "strong" directionality. +func (p *bracketPairer) getStrongTypeN0(index int) Class { + switch p.codesIsolatedRun[index] { + // in the scope of N0, number types are treated as R + case EN, AN, AL, R: + return R + case L: + return L + default: + return ON + } +} + +// classifyPairContent reports the strong types contained inside a Bracket Pair, +// assuming the given embedding direction. +// +// It returns ON if no strong type is found. If a single strong type is found, +// it returns this this type. Otherwise it returns the embedding direction. +// +// TODO: use separate type for "strong" directionality. +func (p *bracketPairer) classifyPairContent(loc bracketPair, dirEmbed Class) Class { + dirOpposite := ON + for i := loc.opener + 1; i < loc.closer; i++ { + dir := p.getStrongTypeN0(i) + if dir == ON { + continue + } + if dir == dirEmbed { + return dir // type matching embedding direction found + } + dirOpposite = dir + } + // return ON if no strong type found, or class opposite to dirEmbed + return dirOpposite +} + +// classBeforePair determines which strong types are present before a Bracket +// Pair. Return R or L if strong type found, otherwise ON. +func (p *bracketPairer) classBeforePair(loc bracketPair) Class { + for i := loc.opener - 1; i >= 0; i-- { + if dir := p.getStrongTypeN0(i); dir != ON { + return dir + } + } + // no strong types found, return sos + return p.sos +} + +// assignBracketType implements rule N0 for a single bracket pair. +func (p *bracketPairer) assignBracketType(loc bracketPair, dirEmbed Class, initialTypes []Class) { + // rule "N0, a", inspect contents of pair + dirPair := p.classifyPairContent(loc, dirEmbed) + + // dirPair is now L, R, or N (no strong type found) + + // the following logical tests are performed out of order compared to + // the statement of the rules but yield the same results + if dirPair == ON { + return // case "d" - nothing to do + } + + if dirPair != dirEmbed { + // case "c": strong type found, opposite - check before (c.1) + dirPair = p.classBeforePair(loc) + if dirPair == dirEmbed || dirPair == ON { + // no strong opposite type found before - use embedding (c.2) + dirPair = dirEmbed + } + } + // else: case "b", strong type found matching embedding, + // no explicit action needed, as dirPair is already set to embedding + // direction + + // set the bracket types to the type found + p.setBracketsToType(loc, dirPair, initialTypes) +} + +func (p *bracketPairer) setBracketsToType(loc bracketPair, dirPair Class, initialTypes []Class) { + p.codesIsolatedRun[loc.opener] = dirPair + p.codesIsolatedRun[loc.closer] = dirPair + + for i := loc.opener + 1; i < loc.closer; i++ { + index := p.indexes[i] + if initialTypes[index] != NSM { + break + } + p.codesIsolatedRun[i] = dirPair + } + + for i := loc.closer + 1; i < len(p.indexes); i++ { + index := p.indexes[i] + if initialTypes[index] != NSM { + break + } + p.codesIsolatedRun[i] = dirPair + } +} + +// resolveBrackets implements rule N0 for a list of pairs. +func (p *bracketPairer) resolveBrackets(dirEmbed Class, initialTypes []Class) { + for _, loc := range p.pairPositions { + p.assignBracketType(loc, dirEmbed, initialTypes) + } +} diff --git a/vendor/golang.org/x/text/unicode/bidi/core.go b/vendor/golang.org/x/text/unicode/bidi/core.go new file mode 100644 index 0000000..d4c1399 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/core.go @@ -0,0 +1,1058 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package bidi + +import "log" + +// This implementation is a port based on the reference implementation found at: +// http://www.unicode.org/Public/PROGRAMS/BidiReferenceJava/ +// +// described in Unicode Bidirectional Algorithm (UAX #9). +// +// Input: +// There are two levels of input to the algorithm, since clients may prefer to +// supply some information from out-of-band sources rather than relying on the +// default behavior. +// +// - Bidi class array +// - Bidi class array, with externally supplied base line direction +// +// Output: +// Output is separated into several stages: +// +// - levels array over entire paragraph +// - reordering array over entire paragraph +// - levels array over line +// - reordering array over line +// +// Note that for conformance to the Unicode Bidirectional Algorithm, +// implementations are only required to generate correct reordering and +// character directionality (odd or even levels) over a line. Generating +// identical level arrays over a line is not required. Bidi explicit format +// codes (LRE, RLE, LRO, RLO, PDF) and BN can be assigned arbitrary levels and +// positions as long as the rest of the input is properly reordered. +// +// As the algorithm is defined to operate on a single paragraph at a time, this +// implementation is written to handle single paragraphs. Thus rule P1 is +// presumed by this implementation-- the data provided to the implementation is +// assumed to be a single paragraph, and either contains no 'B' codes, or a +// single 'B' code at the end of the input. 'B' is allowed as input to +// illustrate how the algorithm assigns it a level. +// +// Also note that rules L3 and L4 depend on the rendering engine that uses the +// result of the bidi algorithm. This implementation assumes that the rendering +// engine expects combining marks in visual order (e.g. to the left of their +// base character in RTL runs) and that it adjusts the glyphs used to render +// mirrored characters that are in RTL runs so that they render appropriately. + +// level is the embedding level of a character. Even embedding levels indicate +// left-to-right order and odd levels indicate right-to-left order. The special +// level of -1 is reserved for undefined order. +type level int8 + +const implicitLevel level = -1 + +// in returns if x is equal to any of the values in set. +func (c Class) in(set ...Class) bool { + for _, s := range set { + if c == s { + return true + } + } + return false +} + +// A paragraph contains the state of a paragraph. +type paragraph struct { + initialTypes []Class + + // Arrays of properties needed for paired bracket evaluation in N0 + pairTypes []bracketType // paired Bracket types for paragraph + pairValues []rune // rune for opening bracket or pbOpen and pbClose; 0 for pbNone + + embeddingLevel level // default: = implicitLevel; + + // at the paragraph levels + resultTypes []Class + resultLevels []level + + // Index of matching PDI for isolate initiator characters. For other + // characters, the value of matchingPDI will be set to -1. For isolate + // initiators with no matching PDI, matchingPDI will be set to the length of + // the input string. + matchingPDI []int + + // Index of matching isolate initiator for PDI characters. For other + // characters, and for PDIs with no matching isolate initiator, the value of + // matchingIsolateInitiator will be set to -1. + matchingIsolateInitiator []int +} + +// newParagraph initializes a paragraph. The user needs to supply a few arrays +// corresponding to the preprocessed text input. The types correspond to the +// Unicode BiDi classes for each rune. pairTypes indicates the bracket type for +// each rune. pairValues provides a unique bracket class identifier for each +// rune (suggested is the rune of the open bracket for opening and matching +// close brackets, after normalization). The embedding levels are optional, but +// may be supplied to encode embedding levels of styled text. +// +// TODO: return an error. +func newParagraph(types []Class, pairTypes []bracketType, pairValues []rune, levels level) *paragraph { + validateTypes(types) + validatePbTypes(pairTypes) + validatePbValues(pairValues, pairTypes) + validateParagraphEmbeddingLevel(levels) + + p := ¶graph{ + initialTypes: append([]Class(nil), types...), + embeddingLevel: levels, + + pairTypes: pairTypes, + pairValues: pairValues, + + resultTypes: append([]Class(nil), types...), + } + p.run() + return p +} + +func (p *paragraph) Len() int { return len(p.initialTypes) } + +// The algorithm. Does not include line-based processing (Rules L1, L2). +// These are applied later in the line-based phase of the algorithm. +func (p *paragraph) run() { + p.determineMatchingIsolates() + + // 1) determining the paragraph level + // Rule P1 is the requirement for entering this algorithm. + // Rules P2, P3. + // If no externally supplied paragraph embedding level, use default. + if p.embeddingLevel == implicitLevel { + p.embeddingLevel = p.determineParagraphEmbeddingLevel(0, p.Len()) + } + + // Initialize result levels to paragraph embedding level. + p.resultLevels = make([]level, p.Len()) + setLevels(p.resultLevels, p.embeddingLevel) + + // 2) Explicit levels and directions + // Rules X1-X8. + p.determineExplicitEmbeddingLevels() + + // Rule X9. + // We do not remove the embeddings, the overrides, the PDFs, and the BNs + // from the string explicitly. But they are not copied into isolating run + // sequences when they are created, so they are removed for all + // practical purposes. + + // Rule X10. + // Run remainder of algorithm one isolating run sequence at a time + for _, seq := range p.determineIsolatingRunSequences() { + // 3) resolving weak types + // Rules W1-W7. + seq.resolveWeakTypes() + + // 4a) resolving paired brackets + // Rule N0 + resolvePairedBrackets(seq) + + // 4b) resolving neutral types + // Rules N1-N3. + seq.resolveNeutralTypes() + + // 5) resolving implicit embedding levels + // Rules I1, I2. + seq.resolveImplicitLevels() + + // Apply the computed levels and types + seq.applyLevelsAndTypes() + } + + // Assign appropriate levels to 'hide' LREs, RLEs, LROs, RLOs, PDFs, and + // BNs. This is for convenience, so the resulting level array will have + // a value for every character. + p.assignLevelsToCharactersRemovedByX9() +} + +// determineMatchingIsolates determines the matching PDI for each isolate +// initiator and vice versa. +// +// Definition BD9. +// +// At the end of this function: +// +// - The member variable matchingPDI is set to point to the index of the +// matching PDI character for each isolate initiator character. If there is +// no matching PDI, it is set to the length of the input text. For other +// characters, it is set to -1. +// - The member variable matchingIsolateInitiator is set to point to the +// index of the matching isolate initiator character for each PDI character. +// If there is no matching isolate initiator, or the character is not a PDI, +// it is set to -1. +func (p *paragraph) determineMatchingIsolates() { + p.matchingPDI = make([]int, p.Len()) + p.matchingIsolateInitiator = make([]int, p.Len()) + + for i := range p.matchingIsolateInitiator { + p.matchingIsolateInitiator[i] = -1 + } + + for i := range p.matchingPDI { + p.matchingPDI[i] = -1 + + if t := p.resultTypes[i]; t.in(LRI, RLI, FSI) { + depthCounter := 1 + for j := i + 1; j < p.Len(); j++ { + if u := p.resultTypes[j]; u.in(LRI, RLI, FSI) { + depthCounter++ + } else if u == PDI { + if depthCounter--; depthCounter == 0 { + p.matchingPDI[i] = j + p.matchingIsolateInitiator[j] = i + break + } + } + } + if p.matchingPDI[i] == -1 { + p.matchingPDI[i] = p.Len() + } + } + } +} + +// determineParagraphEmbeddingLevel reports the resolved paragraph direction of +// the substring limited by the given range [start, end). +// +// Determines the paragraph level based on rules P2, P3. This is also used +// in rule X5c to find if an FSI should resolve to LRI or RLI. +func (p *paragraph) determineParagraphEmbeddingLevel(start, end int) level { + var strongType Class = unknownClass + + // Rule P2. + for i := start; i < end; i++ { + if t := p.resultTypes[i]; t.in(L, AL, R) { + strongType = t + break + } else if t.in(FSI, LRI, RLI) { + i = p.matchingPDI[i] // skip over to the matching PDI + if i > end { + log.Panic("assert (i <= end)") + } + } + } + // Rule P3. + switch strongType { + case unknownClass: // none found + // default embedding level when no strong types found is 0. + return 0 + case L: + return 0 + default: // AL, R + return 1 + } +} + +const maxDepth = 125 + +// This stack will store the embedding levels and override and isolated +// statuses +type directionalStatusStack struct { + stackCounter int + embeddingLevelStack [maxDepth + 1]level + overrideStatusStack [maxDepth + 1]Class + isolateStatusStack [maxDepth + 1]bool +} + +func (s *directionalStatusStack) empty() { s.stackCounter = 0 } +func (s *directionalStatusStack) pop() { s.stackCounter-- } +func (s *directionalStatusStack) depth() int { return s.stackCounter } + +func (s *directionalStatusStack) push(level level, overrideStatus Class, isolateStatus bool) { + s.embeddingLevelStack[s.stackCounter] = level + s.overrideStatusStack[s.stackCounter] = overrideStatus + s.isolateStatusStack[s.stackCounter] = isolateStatus + s.stackCounter++ +} + +func (s *directionalStatusStack) lastEmbeddingLevel() level { + return s.embeddingLevelStack[s.stackCounter-1] +} + +func (s *directionalStatusStack) lastDirectionalOverrideStatus() Class { + return s.overrideStatusStack[s.stackCounter-1] +} + +func (s *directionalStatusStack) lastDirectionalIsolateStatus() bool { + return s.isolateStatusStack[s.stackCounter-1] +} + +// Determine explicit levels using rules X1 - X8 +func (p *paragraph) determineExplicitEmbeddingLevels() { + var stack directionalStatusStack + var overflowIsolateCount, overflowEmbeddingCount, validIsolateCount int + + // Rule X1. + stack.push(p.embeddingLevel, ON, false) + + for i, t := range p.resultTypes { + // Rules X2, X3, X4, X5, X5a, X5b, X5c + switch t { + case RLE, LRE, RLO, LRO, RLI, LRI, FSI: + isIsolate := t.in(RLI, LRI, FSI) + isRTL := t.in(RLE, RLO, RLI) + + // override if this is an FSI that resolves to RLI + if t == FSI { + isRTL = (p.determineParagraphEmbeddingLevel(i+1, p.matchingPDI[i]) == 1) + } + if isIsolate { + p.resultLevels[i] = stack.lastEmbeddingLevel() + if stack.lastDirectionalOverrideStatus() != ON { + p.resultTypes[i] = stack.lastDirectionalOverrideStatus() + } + } + + var newLevel level + if isRTL { + // least greater odd + newLevel = (stack.lastEmbeddingLevel() + 1) | 1 + } else { + // least greater even + newLevel = (stack.lastEmbeddingLevel() + 2) &^ 1 + } + + if newLevel <= maxDepth && overflowIsolateCount == 0 && overflowEmbeddingCount == 0 { + if isIsolate { + validIsolateCount++ + } + // Push new embedding level, override status, and isolated + // status. + // No check for valid stack counter, since the level check + // suffices. + switch t { + case LRO: + stack.push(newLevel, L, isIsolate) + case RLO: + stack.push(newLevel, R, isIsolate) + default: + stack.push(newLevel, ON, isIsolate) + } + // Not really part of the spec + if !isIsolate { + p.resultLevels[i] = newLevel + } + } else { + // This is an invalid explicit formatting character, + // so apply the "Otherwise" part of rules X2-X5b. + if isIsolate { + overflowIsolateCount++ + } else { // !isIsolate + if overflowIsolateCount == 0 { + overflowEmbeddingCount++ + } + } + } + + // Rule X6a + case PDI: + if overflowIsolateCount > 0 { + overflowIsolateCount-- + } else if validIsolateCount == 0 { + // do nothing + } else { + overflowEmbeddingCount = 0 + for !stack.lastDirectionalIsolateStatus() { + stack.pop() + } + stack.pop() + validIsolateCount-- + } + p.resultLevels[i] = stack.lastEmbeddingLevel() + + // Rule X7 + case PDF: + // Not really part of the spec + p.resultLevels[i] = stack.lastEmbeddingLevel() + + if overflowIsolateCount > 0 { + // do nothing + } else if overflowEmbeddingCount > 0 { + overflowEmbeddingCount-- + } else if !stack.lastDirectionalIsolateStatus() && stack.depth() >= 2 { + stack.pop() + } + + case B: // paragraph separator. + // Rule X8. + + // These values are reset for clarity, in this implementation B + // can only occur as the last code in the array. + stack.empty() + overflowIsolateCount = 0 + overflowEmbeddingCount = 0 + validIsolateCount = 0 + p.resultLevels[i] = p.embeddingLevel + + default: + p.resultLevels[i] = stack.lastEmbeddingLevel() + if stack.lastDirectionalOverrideStatus() != ON { + p.resultTypes[i] = stack.lastDirectionalOverrideStatus() + } + } + } +} + +type isolatingRunSequence struct { + p *paragraph + + indexes []int // indexes to the original string + + types []Class // type of each character using the index + resolvedLevels []level // resolved levels after application of rules + level level + sos, eos Class +} + +func (i *isolatingRunSequence) Len() int { return len(i.indexes) } + +func maxLevel(a, b level) level { + if a > b { + return a + } + return b +} + +// Rule X10, second bullet: Determine the start-of-sequence (sos) and end-of-sequence (eos) types, +// either L or R, for each isolating run sequence. +func (p *paragraph) isolatingRunSequence(indexes []int) *isolatingRunSequence { + length := len(indexes) + types := make([]Class, length) + for i, x := range indexes { + types[i] = p.resultTypes[x] + } + + // assign level, sos and eos + prevChar := indexes[0] - 1 + for prevChar >= 0 && isRemovedByX9(p.initialTypes[prevChar]) { + prevChar-- + } + prevLevel := p.embeddingLevel + if prevChar >= 0 { + prevLevel = p.resultLevels[prevChar] + } + + var succLevel level + lastType := types[length-1] + if lastType.in(LRI, RLI, FSI) { + succLevel = p.embeddingLevel + } else { + // the first character after the end of run sequence + limit := indexes[length-1] + 1 + for ; limit < p.Len() && isRemovedByX9(p.initialTypes[limit]); limit++ { + + } + succLevel = p.embeddingLevel + if limit < p.Len() { + succLevel = p.resultLevels[limit] + } + } + level := p.resultLevels[indexes[0]] + return &isolatingRunSequence{ + p: p, + indexes: indexes, + types: types, + level: level, + sos: typeForLevel(maxLevel(prevLevel, level)), + eos: typeForLevel(maxLevel(succLevel, level)), + } +} + +// Resolving weak types Rules W1-W7. +// +// Note that some weak types (EN, AN) remain after this processing is +// complete. +func (s *isolatingRunSequence) resolveWeakTypes() { + + // on entry, only these types remain + s.assertOnly(L, R, AL, EN, ES, ET, AN, CS, B, S, WS, ON, NSM, LRI, RLI, FSI, PDI) + + // Rule W1. + // Changes all NSMs. + preceedingCharacterType := s.sos + for i, t := range s.types { + if t == NSM { + s.types[i] = preceedingCharacterType + } else { + if t.in(LRI, RLI, FSI, PDI) { + preceedingCharacterType = ON + } + preceedingCharacterType = t + } + } + + // Rule W2. + // EN does not change at the start of the run, because sos != AL. + for i, t := range s.types { + if t == EN { + for j := i - 1; j >= 0; j-- { + if t := s.types[j]; t.in(L, R, AL) { + if t == AL { + s.types[i] = AN + } + break + } + } + } + } + + // Rule W3. + for i, t := range s.types { + if t == AL { + s.types[i] = R + } + } + + // Rule W4. + // Since there must be values on both sides for this rule to have an + // effect, the scan skips the first and last value. + // + // Although the scan proceeds left to right, and changes the type + // values in a way that would appear to affect the computations + // later in the scan, there is actually no problem. A change in the + // current value can only affect the value to its immediate right, + // and only affect it if it is ES or CS. But the current value can + // only change if the value to its right is not ES or CS. Thus + // either the current value will not change, or its change will have + // no effect on the remainder of the analysis. + + for i := 1; i < s.Len()-1; i++ { + t := s.types[i] + if t == ES || t == CS { + prevSepType := s.types[i-1] + succSepType := s.types[i+1] + if prevSepType == EN && succSepType == EN { + s.types[i] = EN + } else if s.types[i] == CS && prevSepType == AN && succSepType == AN { + s.types[i] = AN + } + } + } + + // Rule W5. + for i, t := range s.types { + if t == ET { + // locate end of sequence + runStart := i + runEnd := s.findRunLimit(runStart, ET) + + // check values at ends of sequence + t := s.sos + if runStart > 0 { + t = s.types[runStart-1] + } + if t != EN { + t = s.eos + if runEnd < len(s.types) { + t = s.types[runEnd] + } + } + if t == EN { + setTypes(s.types[runStart:runEnd], EN) + } + // continue at end of sequence + i = runEnd + } + } + + // Rule W6. + for i, t := range s.types { + if t.in(ES, ET, CS) { + s.types[i] = ON + } + } + + // Rule W7. + for i, t := range s.types { + if t == EN { + // set default if we reach start of run + prevStrongType := s.sos + for j := i - 1; j >= 0; j-- { + t = s.types[j] + if t == L || t == R { // AL's have been changed to R + prevStrongType = t + break + } + } + if prevStrongType == L { + s.types[i] = L + } + } + } +} + +// 6) resolving neutral types Rules N1-N2. +func (s *isolatingRunSequence) resolveNeutralTypes() { + + // on entry, only these types can be in resultTypes + s.assertOnly(L, R, EN, AN, B, S, WS, ON, RLI, LRI, FSI, PDI) + + for i, t := range s.types { + switch t { + case WS, ON, B, S, RLI, LRI, FSI, PDI: + // find bounds of run of neutrals + runStart := i + runEnd := s.findRunLimit(runStart, B, S, WS, ON, RLI, LRI, FSI, PDI) + + // determine effective types at ends of run + var leadType, trailType Class + + // Note that the character found can only be L, R, AN, or + // EN. + if runStart == 0 { + leadType = s.sos + } else { + leadType = s.types[runStart-1] + if leadType.in(AN, EN) { + leadType = R + } + } + if runEnd == len(s.types) { + trailType = s.eos + } else { + trailType = s.types[runEnd] + if trailType.in(AN, EN) { + trailType = R + } + } + + var resolvedType Class + if leadType == trailType { + // Rule N1. + resolvedType = leadType + } else { + // Rule N2. + // Notice the embedding level of the run is used, not + // the paragraph embedding level. + resolvedType = typeForLevel(s.level) + } + + setTypes(s.types[runStart:runEnd], resolvedType) + + // skip over run of (former) neutrals + i = runEnd + } + } +} + +func setLevels(levels []level, newLevel level) { + for i := range levels { + levels[i] = newLevel + } +} + +func setTypes(types []Class, newType Class) { + for i := range types { + types[i] = newType + } +} + +// 7) resolving implicit embedding levels Rules I1, I2. +func (s *isolatingRunSequence) resolveImplicitLevels() { + + // on entry, only these types can be in resultTypes + s.assertOnly(L, R, EN, AN) + + s.resolvedLevels = make([]level, len(s.types)) + setLevels(s.resolvedLevels, s.level) + + if (s.level & 1) == 0 { // even level + for i, t := range s.types { + // Rule I1. + if t == L { + // no change + } else if t == R { + s.resolvedLevels[i] += 1 + } else { // t == AN || t == EN + s.resolvedLevels[i] += 2 + } + } + } else { // odd level + for i, t := range s.types { + // Rule I2. + if t == R { + // no change + } else { // t == L || t == AN || t == EN + s.resolvedLevels[i] += 1 + } + } + } +} + +// Applies the levels and types resolved in rules W1-I2 to the +// resultLevels array. +func (s *isolatingRunSequence) applyLevelsAndTypes() { + for i, x := range s.indexes { + s.p.resultTypes[x] = s.types[i] + s.p.resultLevels[x] = s.resolvedLevels[i] + } +} + +// Return the limit of the run consisting only of the types in validSet +// starting at index. This checks the value at index, and will return +// index if that value is not in validSet. +func (s *isolatingRunSequence) findRunLimit(index int, validSet ...Class) int { +loop: + for ; index < len(s.types); index++ { + t := s.types[index] + for _, valid := range validSet { + if t == valid { + continue loop + } + } + return index // didn't find a match in validSet + } + return len(s.types) +} + +// Algorithm validation. Assert that all values in types are in the +// provided set. +func (s *isolatingRunSequence) assertOnly(codes ...Class) { +loop: + for i, t := range s.types { + for _, c := range codes { + if t == c { + continue loop + } + } + log.Panicf("invalid bidi code %v present in assertOnly at position %d", t, s.indexes[i]) + } +} + +// determineLevelRuns returns an array of level runs. Each level run is +// described as an array of indexes into the input string. +// +// Determines the level runs. Rule X9 will be applied in determining the +// runs, in the way that makes sure the characters that are supposed to be +// removed are not included in the runs. +func (p *paragraph) determineLevelRuns() [][]int { + run := []int{} + allRuns := [][]int{} + currentLevel := implicitLevel + + for i := range p.initialTypes { + if !isRemovedByX9(p.initialTypes[i]) { + if p.resultLevels[i] != currentLevel { + // we just encountered a new run; wrap up last run + if currentLevel >= 0 { // only wrap it up if there was a run + allRuns = append(allRuns, run) + run = nil + } + // Start new run + currentLevel = p.resultLevels[i] + } + run = append(run, i) + } + } + // Wrap up the final run, if any + if len(run) > 0 { + allRuns = append(allRuns, run) + } + return allRuns +} + +// Definition BD13. Determine isolating run sequences. +func (p *paragraph) determineIsolatingRunSequences() []*isolatingRunSequence { + levelRuns := p.determineLevelRuns() + + // Compute the run that each character belongs to + runForCharacter := make([]int, p.Len()) + for i, run := range levelRuns { + for _, index := range run { + runForCharacter[index] = i + } + } + + sequences := []*isolatingRunSequence{} + + var currentRunSequence []int + + for _, run := range levelRuns { + first := run[0] + if p.initialTypes[first] != PDI || p.matchingIsolateInitiator[first] == -1 { + currentRunSequence = nil + // int run = i; + for { + // Copy this level run into currentRunSequence + currentRunSequence = append(currentRunSequence, run...) + + last := currentRunSequence[len(currentRunSequence)-1] + lastT := p.initialTypes[last] + if lastT.in(LRI, RLI, FSI) && p.matchingPDI[last] != p.Len() { + run = levelRuns[runForCharacter[p.matchingPDI[last]]] + } else { + break + } + } + sequences = append(sequences, p.isolatingRunSequence(currentRunSequence)) + } + } + return sequences +} + +// Assign level information to characters removed by rule X9. This is for +// ease of relating the level information to the original input data. Note +// that the levels assigned to these codes are arbitrary, they're chosen so +// as to avoid breaking level runs. +func (p *paragraph) assignLevelsToCharactersRemovedByX9() { + for i, t := range p.initialTypes { + if t.in(LRE, RLE, LRO, RLO, PDF, BN) { + p.resultTypes[i] = t + p.resultLevels[i] = -1 + } + } + // now propagate forward the levels information (could have + // propagated backward, the main thing is not to introduce a level + // break where one doesn't already exist). + + if p.resultLevels[0] == -1 { + p.resultLevels[0] = p.embeddingLevel + } + for i := 1; i < len(p.initialTypes); i++ { + if p.resultLevels[i] == -1 { + p.resultLevels[i] = p.resultLevels[i-1] + } + } + // Embedding information is for informational purposes only so need not be + // adjusted. +} + +// +// Output +// + +// getLevels computes levels array breaking lines at offsets in linebreaks. +// Rule L1. +// +// The linebreaks array must include at least one value. The values must be +// in strictly increasing order (no duplicates) between 1 and the length of +// the text, inclusive. The last value must be the length of the text. +func (p *paragraph) getLevels(linebreaks []int) []level { + // Note that since the previous processing has removed all + // P, S, and WS values from resultTypes, the values referred to + // in these rules are the initial types, before any processing + // has been applied (including processing of overrides). + // + // This example implementation has reinserted explicit format codes + // and BN, in order that the levels array correspond to the + // initial text. Their final placement is not normative. + // These codes are treated like WS in this implementation, + // so they don't interrupt sequences of WS. + + validateLineBreaks(linebreaks, p.Len()) + + result := append([]level(nil), p.resultLevels...) + + // don't worry about linebreaks since if there is a break within + // a series of WS values preceding S, the linebreak itself + // causes the reset. + for i, t := range p.initialTypes { + if t.in(B, S) { + // Rule L1, clauses one and two. + result[i] = p.embeddingLevel + + // Rule L1, clause three. + for j := i - 1; j >= 0; j-- { + if isWhitespace(p.initialTypes[j]) { // including format codes + result[j] = p.embeddingLevel + } else { + break + } + } + } + } + + // Rule L1, clause four. + start := 0 + for _, limit := range linebreaks { + for j := limit - 1; j >= start; j-- { + if isWhitespace(p.initialTypes[j]) { // including format codes + result[j] = p.embeddingLevel + } else { + break + } + } + start = limit + } + + return result +} + +// getReordering returns the reordering of lines from a visual index to a +// logical index for line breaks at the given offsets. +// +// Lines are concatenated from left to right. So for example, the fifth +// character from the left on the third line is +// +// getReordering(linebreaks)[linebreaks[1] + 4] +// +// (linebreaks[1] is the position after the last character of the second +// line, which is also the index of the first character on the third line, +// and adding four gets the fifth character from the left). +// +// The linebreaks array must include at least one value. The values must be +// in strictly increasing order (no duplicates) between 1 and the length of +// the text, inclusive. The last value must be the length of the text. +func (p *paragraph) getReordering(linebreaks []int) []int { + validateLineBreaks(linebreaks, p.Len()) + + return computeMultilineReordering(p.getLevels(linebreaks), linebreaks) +} + +// Return multiline reordering array for a given level array. Reordering +// does not occur across a line break. +func computeMultilineReordering(levels []level, linebreaks []int) []int { + result := make([]int, len(levels)) + + start := 0 + for _, limit := range linebreaks { + tempLevels := make([]level, limit-start) + copy(tempLevels, levels[start:]) + + for j, order := range computeReordering(tempLevels) { + result[start+j] = order + start + } + start = limit + } + return result +} + +// Return reordering array for a given level array. This reorders a single +// line. The reordering is a visual to logical map. For example, the +// leftmost char is string.charAt(order[0]). Rule L2. +func computeReordering(levels []level) []int { + result := make([]int, len(levels)) + // initialize order + for i := range result { + result[i] = i + } + + // locate highest level found on line. + // Note the rules say text, but no reordering across line bounds is + // performed, so this is sufficient. + highestLevel := level(0) + lowestOddLevel := level(maxDepth + 2) + for _, level := range levels { + if level > highestLevel { + highestLevel = level + } + if level&1 != 0 && level < lowestOddLevel { + lowestOddLevel = level + } + } + + for level := highestLevel; level >= lowestOddLevel; level-- { + for i := 0; i < len(levels); i++ { + if levels[i] >= level { + // find range of text at or above this level + start := i + limit := i + 1 + for limit < len(levels) && levels[limit] >= level { + limit++ + } + + for j, k := start, limit-1; j < k; j, k = j+1, k-1 { + result[j], result[k] = result[k], result[j] + } + // skip to end of level run + i = limit + } + } + } + + return result +} + +// isWhitespace reports whether the type is considered a whitespace type for the +// line break rules. +func isWhitespace(c Class) bool { + switch c { + case LRE, RLE, LRO, RLO, PDF, LRI, RLI, FSI, PDI, BN, WS: + return true + } + return false +} + +// isRemovedByX9 reports whether the type is one of the types removed in X9. +func isRemovedByX9(c Class) bool { + switch c { + case LRE, RLE, LRO, RLO, PDF, BN: + return true + } + return false +} + +// typeForLevel reports the strong type (L or R) corresponding to the level. +func typeForLevel(level level) Class { + if (level & 0x1) == 0 { + return L + } + return R +} + +// TODO: change validation to not panic + +func validateTypes(types []Class) { + if len(types) == 0 { + log.Panic("types is null") + } + for i, t := range types[:len(types)-1] { + if t == B { + log.Panicf("B type before end of paragraph at index: %d", i) + } + } +} + +func validateParagraphEmbeddingLevel(embeddingLevel level) { + if embeddingLevel != implicitLevel && + embeddingLevel != 0 && + embeddingLevel != 1 { + log.Panicf("illegal paragraph embedding level: %d", embeddingLevel) + } +} + +func validateLineBreaks(linebreaks []int, textLength int) { + prev := 0 + for i, next := range linebreaks { + if next <= prev { + log.Panicf("bad linebreak: %d at index: %d", next, i) + } + prev = next + } + if prev != textLength { + log.Panicf("last linebreak was %d, want %d", prev, textLength) + } +} + +func validatePbTypes(pairTypes []bracketType) { + if len(pairTypes) == 0 { + log.Panic("pairTypes is null") + } + for i, pt := range pairTypes { + switch pt { + case bpNone, bpOpen, bpClose: + default: + log.Panicf("illegal pairType value at %d: %v", i, pairTypes[i]) + } + } +} + +func validatePbValues(pairValues []rune, pairTypes []bracketType) { + if pairValues == nil { + log.Panic("pairValues is null") + } + if len(pairTypes) != len(pairValues) { + log.Panic("pairTypes is different length from pairValues") + } +} diff --git a/vendor/golang.org/x/text/unicode/bidi/gen.go b/vendor/golang.org/x/text/unicode/bidi/gen.go new file mode 100644 index 0000000..040f301 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/gen.go @@ -0,0 +1,133 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +package main + +import ( + "flag" + "log" + + "golang.org/x/text/internal/gen" + "golang.org/x/text/internal/triegen" + "golang.org/x/text/internal/ucd" +) + +var outputFile = flag.String("out", "tables.go", "output file") + +func main() { + gen.Init() + gen.Repackage("gen_trieval.go", "trieval.go", "bidi") + gen.Repackage("gen_ranges.go", "ranges_test.go", "bidi") + + genTables() +} + +// bidiClass names and codes taken from class "bc" in +// http://www.unicode.org/Public/8.0.0/ucd/PropertyValueAliases.txt +var bidiClass = map[string]Class{ + "AL": AL, // ArabicLetter + "AN": AN, // ArabicNumber + "B": B, // ParagraphSeparator + "BN": BN, // BoundaryNeutral + "CS": CS, // CommonSeparator + "EN": EN, // EuropeanNumber + "ES": ES, // EuropeanSeparator + "ET": ET, // EuropeanTerminator + "L": L, // LeftToRight + "NSM": NSM, // NonspacingMark + "ON": ON, // OtherNeutral + "R": R, // RightToLeft + "S": S, // SegmentSeparator + "WS": WS, // WhiteSpace + + "FSI": Control, + "PDF": Control, + "PDI": Control, + "LRE": Control, + "LRI": Control, + "LRO": Control, + "RLE": Control, + "RLI": Control, + "RLO": Control, +} + +func genTables() { + if numClass > 0x0F { + log.Fatalf("Too many Class constants (%#x > 0x0F).", numClass) + } + w := gen.NewCodeWriter() + defer w.WriteGoFile(*outputFile, "bidi") + + gen.WriteUnicodeVersion(w) + + t := triegen.NewTrie("bidi") + + // Build data about bracket mapping. These bits need to be or-ed with + // any other bits. + orMask := map[rune]uint64{} + + xorMap := map[rune]int{} + xorMasks := []rune{0} // First value is no-op. + + ucd.Parse(gen.OpenUCDFile("BidiBrackets.txt"), func(p *ucd.Parser) { + r1 := p.Rune(0) + r2 := p.Rune(1) + xor := r1 ^ r2 + if _, ok := xorMap[xor]; !ok { + xorMap[xor] = len(xorMasks) + xorMasks = append(xorMasks, xor) + } + entry := uint64(xorMap[xor]) << xorMaskShift + switch p.String(2) { + case "o": + entry |= openMask + case "c", "n": + default: + log.Fatalf("Unknown bracket class %q.", p.String(2)) + } + orMask[r1] = entry + }) + + w.WriteComment(` + xorMasks contains masks to be xor-ed with brackets to get the reverse + version.`) + w.WriteVar("xorMasks", xorMasks) + + done := map[rune]bool{} + + insert := func(r rune, c Class) { + if !done[r] { + t.Insert(r, orMask[r]|uint64(c)) + done[r] = true + } + } + + // Insert the derived BiDi properties. + ucd.Parse(gen.OpenUCDFile("extracted/DerivedBidiClass.txt"), func(p *ucd.Parser) { + r := p.Rune(0) + class, ok := bidiClass[p.String(1)] + if !ok { + log.Fatalf("%U: Unknown BiDi class %q", r, p.String(1)) + } + insert(r, class) + }) + visitDefaults(insert) + + // TODO: use sparse blocks. This would reduce table size considerably + // from the looks of it. + + sz, err := t.Gen(w) + if err != nil { + log.Fatal(err) + } + w.Size += sz +} + +// dummy values to make methods in gen_common compile. The real versions +// will be generated by this file to tables.go. +var ( + xorMasks []rune +) diff --git a/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go b/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go new file mode 100644 index 0000000..51bd68f --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/gen_ranges.go @@ -0,0 +1,57 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +package main + +import ( + "unicode" + + "golang.org/x/text/internal/gen" + "golang.org/x/text/internal/ucd" + "golang.org/x/text/unicode/rangetable" +) + +// These tables are hand-extracted from: +// http://www.unicode.org/Public/8.0.0/ucd/extracted/DerivedBidiClass.txt +func visitDefaults(fn func(r rune, c Class)) { + // first write default values for ranges listed above. + visitRunes(fn, AL, []rune{ + 0x0600, 0x07BF, // Arabic + 0x08A0, 0x08FF, // Arabic Extended-A + 0xFB50, 0xFDCF, // Arabic Presentation Forms + 0xFDF0, 0xFDFF, + 0xFE70, 0xFEFF, + 0x0001EE00, 0x0001EEFF, // Arabic Mathematical Alpha Symbols + }) + visitRunes(fn, R, []rune{ + 0x0590, 0x05FF, // Hebrew + 0x07C0, 0x089F, // Nko et al. + 0xFB1D, 0xFB4F, + 0x00010800, 0x00010FFF, // Cypriot Syllabary et. al. + 0x0001E800, 0x0001EDFF, + 0x0001EF00, 0x0001EFFF, + }) + visitRunes(fn, ET, []rune{ // European Terminator + 0x20A0, 0x20Cf, // Currency symbols + }) + rangetable.Visit(unicode.Noncharacter_Code_Point, func(r rune) { + fn(r, BN) // Boundary Neutral + }) + ucd.Parse(gen.OpenUCDFile("DerivedCoreProperties.txt"), func(p *ucd.Parser) { + if p.String(1) == "Default_Ignorable_Code_Point" { + fn(p.Rune(0), BN) // Boundary Neutral + } + }) +} + +func visitRunes(fn func(r rune, c Class), c Class, runes []rune) { + for i := 0; i < len(runes); i += 2 { + lo, hi := runes[i], runes[i+1] + for j := lo; j <= hi; j++ { + fn(j, c) + } + } +} diff --git a/vendor/golang.org/x/text/unicode/bidi/gen_trieval.go b/vendor/golang.org/x/text/unicode/bidi/gen_trieval.go new file mode 100644 index 0000000..9cb9942 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/gen_trieval.go @@ -0,0 +1,64 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +package main + +// Class is the Unicode BiDi class. Each rune has a single class. +type Class uint + +const ( + L Class = iota // LeftToRight + R // RightToLeft + EN // EuropeanNumber + ES // EuropeanSeparator + ET // EuropeanTerminator + AN // ArabicNumber + CS // CommonSeparator + B // ParagraphSeparator + S // SegmentSeparator + WS // WhiteSpace + ON // OtherNeutral + BN // BoundaryNeutral + NSM // NonspacingMark + AL // ArabicLetter + Control // Control LRO - PDI + + numClass + + LRO // LeftToRightOverride + RLO // RightToLeftOverride + LRE // LeftToRightEmbedding + RLE // RightToLeftEmbedding + PDF // PopDirectionalFormat + LRI // LeftToRightIsolate + RLI // RightToLeftIsolate + FSI // FirstStrongIsolate + PDI // PopDirectionalIsolate + + unknownClass = ^Class(0) +) + +var controlToClass = map[rune]Class{ + 0x202D: LRO, // LeftToRightOverride, + 0x202E: RLO, // RightToLeftOverride, + 0x202A: LRE, // LeftToRightEmbedding, + 0x202B: RLE, // RightToLeftEmbedding, + 0x202C: PDF, // PopDirectionalFormat, + 0x2066: LRI, // LeftToRightIsolate, + 0x2067: RLI, // RightToLeftIsolate, + 0x2068: FSI, // FirstStrongIsolate, + 0x2069: PDI, // PopDirectionalIsolate, +} + +// A trie entry has the following bits: +// 7..5 XOR mask for brackets +// 4 1: Bracket open, 0: Bracket close +// 3..0 Class type + +const ( + openMask = 0x10 + xorMaskShift = 5 +) diff --git a/vendor/golang.org/x/text/unicode/bidi/prop.go b/vendor/golang.org/x/text/unicode/bidi/prop.go new file mode 100644 index 0000000..7c9484e --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/prop.go @@ -0,0 +1,206 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package bidi + +import "unicode/utf8" + +// Properties provides access to BiDi properties of runes. +type Properties struct { + entry uint8 + last uint8 +} + +var trie = newBidiTrie(0) + +// TODO: using this for bidirule reduces the running time by about 5%. Consider +// if this is worth exposing or if we can find a way to speed up the Class +// method. +// +// // CompactClass is like Class, but maps all of the BiDi control classes +// // (LRO, RLO, LRE, RLE, PDF, LRI, RLI, FSI, PDI) to the class Control. +// func (p Properties) CompactClass() Class { +// return Class(p.entry & 0x0F) +// } + +// Class returns the Bidi class for p. +func (p Properties) Class() Class { + c := Class(p.entry & 0x0F) + if c == Control { + c = controlByteToClass[p.last&0xF] + } + return c +} + +// IsBracket reports whether the rune is a bracket. +func (p Properties) IsBracket() bool { return p.entry&0xF0 != 0 } + +// IsOpeningBracket reports whether the rune is an opening bracket. +// IsBracket must return true. +func (p Properties) IsOpeningBracket() bool { return p.entry&openMask != 0 } + +// TODO: find a better API and expose. +func (p Properties) reverseBracket(r rune) rune { + return xorMasks[p.entry>>xorMaskShift] ^ r +} + +var controlByteToClass = [16]Class{ + 0xD: LRO, // U+202D LeftToRightOverride, + 0xE: RLO, // U+202E RightToLeftOverride, + 0xA: LRE, // U+202A LeftToRightEmbedding, + 0xB: RLE, // U+202B RightToLeftEmbedding, + 0xC: PDF, // U+202C PopDirectionalFormat, + 0x6: LRI, // U+2066 LeftToRightIsolate, + 0x7: RLI, // U+2067 RightToLeftIsolate, + 0x8: FSI, // U+2068 FirstStrongIsolate, + 0x9: PDI, // U+2069 PopDirectionalIsolate, +} + +// LookupRune returns properties for r. +func LookupRune(r rune) (p Properties, size int) { + var buf [4]byte + n := utf8.EncodeRune(buf[:], r) + return Lookup(buf[:n]) +} + +// TODO: these lookup methods are based on the generated trie code. The returned +// sizes have slightly different semantics from the generated code, in that it +// always returns size==1 for an illegal UTF-8 byte (instead of the length +// of the maximum invalid subsequence). Most Transformers, like unicode/norm, +// leave invalid UTF-8 untouched, in which case it has performance benefits to +// do so (without changing the semantics). Bidi requires the semantics used here +// for the bidirule implementation to be compatible with the Go semantics. +// They ultimately should perhaps be adopted by all trie implementations, for +// convenience sake. +// This unrolled code also boosts performance of the secure/bidirule package by +// about 30%. +// So, to remove this code: +// - add option to trie generator to define return type. +// - always return 1 byte size for ill-formed UTF-8 runes. + +// Lookup returns properties for the first rune in s and the width in bytes of +// its encoding. The size will be 0 if s does not hold enough bytes to complete +// the encoding. +func Lookup(s []byte) (p Properties, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return Properties{entry: bidiValues[c0]}, 1 + case c0 < 0xC2: + return Properties{}, 1 + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return Properties{}, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return Properties{}, 1 + } + return Properties{entry: trie.lookupValue(uint32(i), c1)}, 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return Properties{}, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return Properties{}, 1 + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return Properties{}, 1 + } + return Properties{entry: trie.lookupValue(uint32(i), c2), last: c2}, 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return Properties{}, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return Properties{}, 1 + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return Properties{}, 1 + } + o = uint32(i)<<6 + uint32(c2) + i = bidiIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return Properties{}, 1 + } + return Properties{entry: trie.lookupValue(uint32(i), c3)}, 4 + } + // Illegal rune + return Properties{}, 1 +} + +// LookupString returns properties for the first rune in s and the width in +// bytes of its encoding. The size will be 0 if s does not hold enough bytes to +// complete the encoding. +func LookupString(s string) (p Properties, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return Properties{entry: bidiValues[c0]}, 1 + case c0 < 0xC2: + return Properties{}, 1 + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return Properties{}, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return Properties{}, 1 + } + return Properties{entry: trie.lookupValue(uint32(i), c1)}, 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return Properties{}, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return Properties{}, 1 + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return Properties{}, 1 + } + return Properties{entry: trie.lookupValue(uint32(i), c2), last: c2}, 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return Properties{}, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return Properties{}, 1 + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return Properties{}, 1 + } + o = uint32(i)<<6 + uint32(c2) + i = bidiIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return Properties{}, 1 + } + return Properties{entry: trie.lookupValue(uint32(i), c3)}, 4 + } + // Illegal rune + return Properties{}, 1 +} diff --git a/vendor/golang.org/x/text/unicode/bidi/tables.go b/vendor/golang.org/x/text/unicode/bidi/tables.go new file mode 100644 index 0000000..7212d5a --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/tables.go @@ -0,0 +1,1779 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +package bidi + +// UnicodeVersion is the Unicode version from which the tables in this package are derived. +const UnicodeVersion = "9.0.0" + +// xorMasks contains masks to be xor-ed with brackets to get the reverse +// version. +var xorMasks = []int32{ // 8 elements + 0, 1, 6, 7, 3, 15, 29, 63, +} // Size: 56 bytes + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *bidiTrie) lookup(s []byte) (v uint8, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return bidiValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = bidiIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *bidiTrie) lookupUnsafe(s []byte) uint8 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return bidiValues[c0] + } + i := bidiIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *bidiTrie) lookupString(s string) (v uint8, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return bidiValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := bidiIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = bidiIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = bidiIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *bidiTrie) lookupStringUnsafe(s string) uint8 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return bidiValues[c0] + } + i := bidiIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = bidiIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// bidiTrie. Total size: 15744 bytes (15.38 KiB). Checksum: b4c3b70954803b86. +type bidiTrie struct{} + +func newBidiTrie(i int) *bidiTrie { + return &bidiTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *bidiTrie) lookupValue(n uint32, b byte) uint8 { + switch { + default: + return uint8(bidiValues[n<<6+uint32(b)]) + } +} + +// bidiValues: 222 blocks, 14208 entries, 14208 bytes +// The third block is the zero block. +var bidiValues = [14208]uint8{ + // Block 0x0, offset 0x0 + 0x00: 0x000b, 0x01: 0x000b, 0x02: 0x000b, 0x03: 0x000b, 0x04: 0x000b, 0x05: 0x000b, + 0x06: 0x000b, 0x07: 0x000b, 0x08: 0x000b, 0x09: 0x0008, 0x0a: 0x0007, 0x0b: 0x0008, + 0x0c: 0x0009, 0x0d: 0x0007, 0x0e: 0x000b, 0x0f: 0x000b, 0x10: 0x000b, 0x11: 0x000b, + 0x12: 0x000b, 0x13: 0x000b, 0x14: 0x000b, 0x15: 0x000b, 0x16: 0x000b, 0x17: 0x000b, + 0x18: 0x000b, 0x19: 0x000b, 0x1a: 0x000b, 0x1b: 0x000b, 0x1c: 0x0007, 0x1d: 0x0007, + 0x1e: 0x0007, 0x1f: 0x0008, 0x20: 0x0009, 0x21: 0x000a, 0x22: 0x000a, 0x23: 0x0004, + 0x24: 0x0004, 0x25: 0x0004, 0x26: 0x000a, 0x27: 0x000a, 0x28: 0x003a, 0x29: 0x002a, + 0x2a: 0x000a, 0x2b: 0x0003, 0x2c: 0x0006, 0x2d: 0x0003, 0x2e: 0x0006, 0x2f: 0x0006, + 0x30: 0x0002, 0x31: 0x0002, 0x32: 0x0002, 0x33: 0x0002, 0x34: 0x0002, 0x35: 0x0002, + 0x36: 0x0002, 0x37: 0x0002, 0x38: 0x0002, 0x39: 0x0002, 0x3a: 0x0006, 0x3b: 0x000a, + 0x3c: 0x000a, 0x3d: 0x000a, 0x3e: 0x000a, 0x3f: 0x000a, + // Block 0x1, offset 0x40 + 0x40: 0x000a, + 0x5b: 0x005a, 0x5c: 0x000a, 0x5d: 0x004a, + 0x5e: 0x000a, 0x5f: 0x000a, 0x60: 0x000a, + 0x7b: 0x005a, + 0x7c: 0x000a, 0x7d: 0x004a, 0x7e: 0x000a, 0x7f: 0x000b, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x000b, 0xc1: 0x000b, 0xc2: 0x000b, 0xc3: 0x000b, 0xc4: 0x000b, 0xc5: 0x0007, + 0xc6: 0x000b, 0xc7: 0x000b, 0xc8: 0x000b, 0xc9: 0x000b, 0xca: 0x000b, 0xcb: 0x000b, + 0xcc: 0x000b, 0xcd: 0x000b, 0xce: 0x000b, 0xcf: 0x000b, 0xd0: 0x000b, 0xd1: 0x000b, + 0xd2: 0x000b, 0xd3: 0x000b, 0xd4: 0x000b, 0xd5: 0x000b, 0xd6: 0x000b, 0xd7: 0x000b, + 0xd8: 0x000b, 0xd9: 0x000b, 0xda: 0x000b, 0xdb: 0x000b, 0xdc: 0x000b, 0xdd: 0x000b, + 0xde: 0x000b, 0xdf: 0x000b, 0xe0: 0x0006, 0xe1: 0x000a, 0xe2: 0x0004, 0xe3: 0x0004, + 0xe4: 0x0004, 0xe5: 0x0004, 0xe6: 0x000a, 0xe7: 0x000a, 0xe8: 0x000a, 0xe9: 0x000a, + 0xeb: 0x000a, 0xec: 0x000a, 0xed: 0x000b, 0xee: 0x000a, 0xef: 0x000a, + 0xf0: 0x0004, 0xf1: 0x0004, 0xf2: 0x0002, 0xf3: 0x0002, 0xf4: 0x000a, + 0xf6: 0x000a, 0xf7: 0x000a, 0xf8: 0x000a, 0xf9: 0x0002, 0xfb: 0x000a, + 0xfc: 0x000a, 0xfd: 0x000a, 0xfe: 0x000a, 0xff: 0x000a, + // Block 0x4, offset 0x100 + 0x117: 0x000a, + 0x137: 0x000a, + // Block 0x5, offset 0x140 + 0x179: 0x000a, 0x17a: 0x000a, + // Block 0x6, offset 0x180 + 0x182: 0x000a, 0x183: 0x000a, 0x184: 0x000a, 0x185: 0x000a, + 0x186: 0x000a, 0x187: 0x000a, 0x188: 0x000a, 0x189: 0x000a, 0x18a: 0x000a, 0x18b: 0x000a, + 0x18c: 0x000a, 0x18d: 0x000a, 0x18e: 0x000a, 0x18f: 0x000a, + 0x192: 0x000a, 0x193: 0x000a, 0x194: 0x000a, 0x195: 0x000a, 0x196: 0x000a, 0x197: 0x000a, + 0x198: 0x000a, 0x199: 0x000a, 0x19a: 0x000a, 0x19b: 0x000a, 0x19c: 0x000a, 0x19d: 0x000a, + 0x19e: 0x000a, 0x19f: 0x000a, + 0x1a5: 0x000a, 0x1a6: 0x000a, 0x1a7: 0x000a, 0x1a8: 0x000a, 0x1a9: 0x000a, + 0x1aa: 0x000a, 0x1ab: 0x000a, 0x1ac: 0x000a, 0x1ad: 0x000a, 0x1af: 0x000a, + 0x1b0: 0x000a, 0x1b1: 0x000a, 0x1b2: 0x000a, 0x1b3: 0x000a, 0x1b4: 0x000a, 0x1b5: 0x000a, + 0x1b6: 0x000a, 0x1b7: 0x000a, 0x1b8: 0x000a, 0x1b9: 0x000a, 0x1ba: 0x000a, 0x1bb: 0x000a, + 0x1bc: 0x000a, 0x1bd: 0x000a, 0x1be: 0x000a, 0x1bf: 0x000a, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x000c, 0x1c1: 0x000c, 0x1c2: 0x000c, 0x1c3: 0x000c, 0x1c4: 0x000c, 0x1c5: 0x000c, + 0x1c6: 0x000c, 0x1c7: 0x000c, 0x1c8: 0x000c, 0x1c9: 0x000c, 0x1ca: 0x000c, 0x1cb: 0x000c, + 0x1cc: 0x000c, 0x1cd: 0x000c, 0x1ce: 0x000c, 0x1cf: 0x000c, 0x1d0: 0x000c, 0x1d1: 0x000c, + 0x1d2: 0x000c, 0x1d3: 0x000c, 0x1d4: 0x000c, 0x1d5: 0x000c, 0x1d6: 0x000c, 0x1d7: 0x000c, + 0x1d8: 0x000c, 0x1d9: 0x000c, 0x1da: 0x000c, 0x1db: 0x000c, 0x1dc: 0x000c, 0x1dd: 0x000c, + 0x1de: 0x000c, 0x1df: 0x000c, 0x1e0: 0x000c, 0x1e1: 0x000c, 0x1e2: 0x000c, 0x1e3: 0x000c, + 0x1e4: 0x000c, 0x1e5: 0x000c, 0x1e6: 0x000c, 0x1e7: 0x000c, 0x1e8: 0x000c, 0x1e9: 0x000c, + 0x1ea: 0x000c, 0x1eb: 0x000c, 0x1ec: 0x000c, 0x1ed: 0x000c, 0x1ee: 0x000c, 0x1ef: 0x000c, + 0x1f0: 0x000c, 0x1f1: 0x000c, 0x1f2: 0x000c, 0x1f3: 0x000c, 0x1f4: 0x000c, 0x1f5: 0x000c, + 0x1f6: 0x000c, 0x1f7: 0x000c, 0x1f8: 0x000c, 0x1f9: 0x000c, 0x1fa: 0x000c, 0x1fb: 0x000c, + 0x1fc: 0x000c, 0x1fd: 0x000c, 0x1fe: 0x000c, 0x1ff: 0x000c, + // Block 0x8, offset 0x200 + 0x200: 0x000c, 0x201: 0x000c, 0x202: 0x000c, 0x203: 0x000c, 0x204: 0x000c, 0x205: 0x000c, + 0x206: 0x000c, 0x207: 0x000c, 0x208: 0x000c, 0x209: 0x000c, 0x20a: 0x000c, 0x20b: 0x000c, + 0x20c: 0x000c, 0x20d: 0x000c, 0x20e: 0x000c, 0x20f: 0x000c, 0x210: 0x000c, 0x211: 0x000c, + 0x212: 0x000c, 0x213: 0x000c, 0x214: 0x000c, 0x215: 0x000c, 0x216: 0x000c, 0x217: 0x000c, + 0x218: 0x000c, 0x219: 0x000c, 0x21a: 0x000c, 0x21b: 0x000c, 0x21c: 0x000c, 0x21d: 0x000c, + 0x21e: 0x000c, 0x21f: 0x000c, 0x220: 0x000c, 0x221: 0x000c, 0x222: 0x000c, 0x223: 0x000c, + 0x224: 0x000c, 0x225: 0x000c, 0x226: 0x000c, 0x227: 0x000c, 0x228: 0x000c, 0x229: 0x000c, + 0x22a: 0x000c, 0x22b: 0x000c, 0x22c: 0x000c, 0x22d: 0x000c, 0x22e: 0x000c, 0x22f: 0x000c, + 0x234: 0x000a, 0x235: 0x000a, + 0x23e: 0x000a, + // Block 0x9, offset 0x240 + 0x244: 0x000a, 0x245: 0x000a, + 0x247: 0x000a, + // Block 0xa, offset 0x280 + 0x2b6: 0x000a, + // Block 0xb, offset 0x2c0 + 0x2c3: 0x000c, 0x2c4: 0x000c, 0x2c5: 0x000c, + 0x2c6: 0x000c, 0x2c7: 0x000c, 0x2c8: 0x000c, 0x2c9: 0x000c, + // Block 0xc, offset 0x300 + 0x30a: 0x000a, + 0x30d: 0x000a, 0x30e: 0x000a, 0x30f: 0x0004, 0x310: 0x0001, 0x311: 0x000c, + 0x312: 0x000c, 0x313: 0x000c, 0x314: 0x000c, 0x315: 0x000c, 0x316: 0x000c, 0x317: 0x000c, + 0x318: 0x000c, 0x319: 0x000c, 0x31a: 0x000c, 0x31b: 0x000c, 0x31c: 0x000c, 0x31d: 0x000c, + 0x31e: 0x000c, 0x31f: 0x000c, 0x320: 0x000c, 0x321: 0x000c, 0x322: 0x000c, 0x323: 0x000c, + 0x324: 0x000c, 0x325: 0x000c, 0x326: 0x000c, 0x327: 0x000c, 0x328: 0x000c, 0x329: 0x000c, + 0x32a: 0x000c, 0x32b: 0x000c, 0x32c: 0x000c, 0x32d: 0x000c, 0x32e: 0x000c, 0x32f: 0x000c, + 0x330: 0x000c, 0x331: 0x000c, 0x332: 0x000c, 0x333: 0x000c, 0x334: 0x000c, 0x335: 0x000c, + 0x336: 0x000c, 0x337: 0x000c, 0x338: 0x000c, 0x339: 0x000c, 0x33a: 0x000c, 0x33b: 0x000c, + 0x33c: 0x000c, 0x33d: 0x000c, 0x33e: 0x0001, 0x33f: 0x000c, + // Block 0xd, offset 0x340 + 0x340: 0x0001, 0x341: 0x000c, 0x342: 0x000c, 0x343: 0x0001, 0x344: 0x000c, 0x345: 0x000c, + 0x346: 0x0001, 0x347: 0x000c, 0x348: 0x0001, 0x349: 0x0001, 0x34a: 0x0001, 0x34b: 0x0001, + 0x34c: 0x0001, 0x34d: 0x0001, 0x34e: 0x0001, 0x34f: 0x0001, 0x350: 0x0001, 0x351: 0x0001, + 0x352: 0x0001, 0x353: 0x0001, 0x354: 0x0001, 0x355: 0x0001, 0x356: 0x0001, 0x357: 0x0001, + 0x358: 0x0001, 0x359: 0x0001, 0x35a: 0x0001, 0x35b: 0x0001, 0x35c: 0x0001, 0x35d: 0x0001, + 0x35e: 0x0001, 0x35f: 0x0001, 0x360: 0x0001, 0x361: 0x0001, 0x362: 0x0001, 0x363: 0x0001, + 0x364: 0x0001, 0x365: 0x0001, 0x366: 0x0001, 0x367: 0x0001, 0x368: 0x0001, 0x369: 0x0001, + 0x36a: 0x0001, 0x36b: 0x0001, 0x36c: 0x0001, 0x36d: 0x0001, 0x36e: 0x0001, 0x36f: 0x0001, + 0x370: 0x0001, 0x371: 0x0001, 0x372: 0x0001, 0x373: 0x0001, 0x374: 0x0001, 0x375: 0x0001, + 0x376: 0x0001, 0x377: 0x0001, 0x378: 0x0001, 0x379: 0x0001, 0x37a: 0x0001, 0x37b: 0x0001, + 0x37c: 0x0001, 0x37d: 0x0001, 0x37e: 0x0001, 0x37f: 0x0001, + // Block 0xe, offset 0x380 + 0x380: 0x0005, 0x381: 0x0005, 0x382: 0x0005, 0x383: 0x0005, 0x384: 0x0005, 0x385: 0x0005, + 0x386: 0x000a, 0x387: 0x000a, 0x388: 0x000d, 0x389: 0x0004, 0x38a: 0x0004, 0x38b: 0x000d, + 0x38c: 0x0006, 0x38d: 0x000d, 0x38e: 0x000a, 0x38f: 0x000a, 0x390: 0x000c, 0x391: 0x000c, + 0x392: 0x000c, 0x393: 0x000c, 0x394: 0x000c, 0x395: 0x000c, 0x396: 0x000c, 0x397: 0x000c, + 0x398: 0x000c, 0x399: 0x000c, 0x39a: 0x000c, 0x39b: 0x000d, 0x39c: 0x000d, 0x39d: 0x000d, + 0x39e: 0x000d, 0x39f: 0x000d, 0x3a0: 0x000d, 0x3a1: 0x000d, 0x3a2: 0x000d, 0x3a3: 0x000d, + 0x3a4: 0x000d, 0x3a5: 0x000d, 0x3a6: 0x000d, 0x3a7: 0x000d, 0x3a8: 0x000d, 0x3a9: 0x000d, + 0x3aa: 0x000d, 0x3ab: 0x000d, 0x3ac: 0x000d, 0x3ad: 0x000d, 0x3ae: 0x000d, 0x3af: 0x000d, + 0x3b0: 0x000d, 0x3b1: 0x000d, 0x3b2: 0x000d, 0x3b3: 0x000d, 0x3b4: 0x000d, 0x3b5: 0x000d, + 0x3b6: 0x000d, 0x3b7: 0x000d, 0x3b8: 0x000d, 0x3b9: 0x000d, 0x3ba: 0x000d, 0x3bb: 0x000d, + 0x3bc: 0x000d, 0x3bd: 0x000d, 0x3be: 0x000d, 0x3bf: 0x000d, + // Block 0xf, offset 0x3c0 + 0x3c0: 0x000d, 0x3c1: 0x000d, 0x3c2: 0x000d, 0x3c3: 0x000d, 0x3c4: 0x000d, 0x3c5: 0x000d, + 0x3c6: 0x000d, 0x3c7: 0x000d, 0x3c8: 0x000d, 0x3c9: 0x000d, 0x3ca: 0x000d, 0x3cb: 0x000c, + 0x3cc: 0x000c, 0x3cd: 0x000c, 0x3ce: 0x000c, 0x3cf: 0x000c, 0x3d0: 0x000c, 0x3d1: 0x000c, + 0x3d2: 0x000c, 0x3d3: 0x000c, 0x3d4: 0x000c, 0x3d5: 0x000c, 0x3d6: 0x000c, 0x3d7: 0x000c, + 0x3d8: 0x000c, 0x3d9: 0x000c, 0x3da: 0x000c, 0x3db: 0x000c, 0x3dc: 0x000c, 0x3dd: 0x000c, + 0x3de: 0x000c, 0x3df: 0x000c, 0x3e0: 0x0005, 0x3e1: 0x0005, 0x3e2: 0x0005, 0x3e3: 0x0005, + 0x3e4: 0x0005, 0x3e5: 0x0005, 0x3e6: 0x0005, 0x3e7: 0x0005, 0x3e8: 0x0005, 0x3e9: 0x0005, + 0x3ea: 0x0004, 0x3eb: 0x0005, 0x3ec: 0x0005, 0x3ed: 0x000d, 0x3ee: 0x000d, 0x3ef: 0x000d, + 0x3f0: 0x000c, 0x3f1: 0x000d, 0x3f2: 0x000d, 0x3f3: 0x000d, 0x3f4: 0x000d, 0x3f5: 0x000d, + 0x3f6: 0x000d, 0x3f7: 0x000d, 0x3f8: 0x000d, 0x3f9: 0x000d, 0x3fa: 0x000d, 0x3fb: 0x000d, + 0x3fc: 0x000d, 0x3fd: 0x000d, 0x3fe: 0x000d, 0x3ff: 0x000d, + // Block 0x10, offset 0x400 + 0x400: 0x000d, 0x401: 0x000d, 0x402: 0x000d, 0x403: 0x000d, 0x404: 0x000d, 0x405: 0x000d, + 0x406: 0x000d, 0x407: 0x000d, 0x408: 0x000d, 0x409: 0x000d, 0x40a: 0x000d, 0x40b: 0x000d, + 0x40c: 0x000d, 0x40d: 0x000d, 0x40e: 0x000d, 0x40f: 0x000d, 0x410: 0x000d, 0x411: 0x000d, + 0x412: 0x000d, 0x413: 0x000d, 0x414: 0x000d, 0x415: 0x000d, 0x416: 0x000d, 0x417: 0x000d, + 0x418: 0x000d, 0x419: 0x000d, 0x41a: 0x000d, 0x41b: 0x000d, 0x41c: 0x000d, 0x41d: 0x000d, + 0x41e: 0x000d, 0x41f: 0x000d, 0x420: 0x000d, 0x421: 0x000d, 0x422: 0x000d, 0x423: 0x000d, + 0x424: 0x000d, 0x425: 0x000d, 0x426: 0x000d, 0x427: 0x000d, 0x428: 0x000d, 0x429: 0x000d, + 0x42a: 0x000d, 0x42b: 0x000d, 0x42c: 0x000d, 0x42d: 0x000d, 0x42e: 0x000d, 0x42f: 0x000d, + 0x430: 0x000d, 0x431: 0x000d, 0x432: 0x000d, 0x433: 0x000d, 0x434: 0x000d, 0x435: 0x000d, + 0x436: 0x000d, 0x437: 0x000d, 0x438: 0x000d, 0x439: 0x000d, 0x43a: 0x000d, 0x43b: 0x000d, + 0x43c: 0x000d, 0x43d: 0x000d, 0x43e: 0x000d, 0x43f: 0x000d, + // Block 0x11, offset 0x440 + 0x440: 0x000d, 0x441: 0x000d, 0x442: 0x000d, 0x443: 0x000d, 0x444: 0x000d, 0x445: 0x000d, + 0x446: 0x000d, 0x447: 0x000d, 0x448: 0x000d, 0x449: 0x000d, 0x44a: 0x000d, 0x44b: 0x000d, + 0x44c: 0x000d, 0x44d: 0x000d, 0x44e: 0x000d, 0x44f: 0x000d, 0x450: 0x000d, 0x451: 0x000d, + 0x452: 0x000d, 0x453: 0x000d, 0x454: 0x000d, 0x455: 0x000d, 0x456: 0x000c, 0x457: 0x000c, + 0x458: 0x000c, 0x459: 0x000c, 0x45a: 0x000c, 0x45b: 0x000c, 0x45c: 0x000c, 0x45d: 0x0005, + 0x45e: 0x000a, 0x45f: 0x000c, 0x460: 0x000c, 0x461: 0x000c, 0x462: 0x000c, 0x463: 0x000c, + 0x464: 0x000c, 0x465: 0x000d, 0x466: 0x000d, 0x467: 0x000c, 0x468: 0x000c, 0x469: 0x000a, + 0x46a: 0x000c, 0x46b: 0x000c, 0x46c: 0x000c, 0x46d: 0x000c, 0x46e: 0x000d, 0x46f: 0x000d, + 0x470: 0x0002, 0x471: 0x0002, 0x472: 0x0002, 0x473: 0x0002, 0x474: 0x0002, 0x475: 0x0002, + 0x476: 0x0002, 0x477: 0x0002, 0x478: 0x0002, 0x479: 0x0002, 0x47a: 0x000d, 0x47b: 0x000d, + 0x47c: 0x000d, 0x47d: 0x000d, 0x47e: 0x000d, 0x47f: 0x000d, + // Block 0x12, offset 0x480 + 0x480: 0x000d, 0x481: 0x000d, 0x482: 0x000d, 0x483: 0x000d, 0x484: 0x000d, 0x485: 0x000d, + 0x486: 0x000d, 0x487: 0x000d, 0x488: 0x000d, 0x489: 0x000d, 0x48a: 0x000d, 0x48b: 0x000d, + 0x48c: 0x000d, 0x48d: 0x000d, 0x48e: 0x000d, 0x48f: 0x000d, 0x490: 0x000d, 0x491: 0x000c, + 0x492: 0x000d, 0x493: 0x000d, 0x494: 0x000d, 0x495: 0x000d, 0x496: 0x000d, 0x497: 0x000d, + 0x498: 0x000d, 0x499: 0x000d, 0x49a: 0x000d, 0x49b: 0x000d, 0x49c: 0x000d, 0x49d: 0x000d, + 0x49e: 0x000d, 0x49f: 0x000d, 0x4a0: 0x000d, 0x4a1: 0x000d, 0x4a2: 0x000d, 0x4a3: 0x000d, + 0x4a4: 0x000d, 0x4a5: 0x000d, 0x4a6: 0x000d, 0x4a7: 0x000d, 0x4a8: 0x000d, 0x4a9: 0x000d, + 0x4aa: 0x000d, 0x4ab: 0x000d, 0x4ac: 0x000d, 0x4ad: 0x000d, 0x4ae: 0x000d, 0x4af: 0x000d, + 0x4b0: 0x000c, 0x4b1: 0x000c, 0x4b2: 0x000c, 0x4b3: 0x000c, 0x4b4: 0x000c, 0x4b5: 0x000c, + 0x4b6: 0x000c, 0x4b7: 0x000c, 0x4b8: 0x000c, 0x4b9: 0x000c, 0x4ba: 0x000c, 0x4bb: 0x000c, + 0x4bc: 0x000c, 0x4bd: 0x000c, 0x4be: 0x000c, 0x4bf: 0x000c, + // Block 0x13, offset 0x4c0 + 0x4c0: 0x000c, 0x4c1: 0x000c, 0x4c2: 0x000c, 0x4c3: 0x000c, 0x4c4: 0x000c, 0x4c5: 0x000c, + 0x4c6: 0x000c, 0x4c7: 0x000c, 0x4c8: 0x000c, 0x4c9: 0x000c, 0x4ca: 0x000c, 0x4cb: 0x000d, + 0x4cc: 0x000d, 0x4cd: 0x000d, 0x4ce: 0x000d, 0x4cf: 0x000d, 0x4d0: 0x000d, 0x4d1: 0x000d, + 0x4d2: 0x000d, 0x4d3: 0x000d, 0x4d4: 0x000d, 0x4d5: 0x000d, 0x4d6: 0x000d, 0x4d7: 0x000d, + 0x4d8: 0x000d, 0x4d9: 0x000d, 0x4da: 0x000d, 0x4db: 0x000d, 0x4dc: 0x000d, 0x4dd: 0x000d, + 0x4de: 0x000d, 0x4df: 0x000d, 0x4e0: 0x000d, 0x4e1: 0x000d, 0x4e2: 0x000d, 0x4e3: 0x000d, + 0x4e4: 0x000d, 0x4e5: 0x000d, 0x4e6: 0x000d, 0x4e7: 0x000d, 0x4e8: 0x000d, 0x4e9: 0x000d, + 0x4ea: 0x000d, 0x4eb: 0x000d, 0x4ec: 0x000d, 0x4ed: 0x000d, 0x4ee: 0x000d, 0x4ef: 0x000d, + 0x4f0: 0x000d, 0x4f1: 0x000d, 0x4f2: 0x000d, 0x4f3: 0x000d, 0x4f4: 0x000d, 0x4f5: 0x000d, + 0x4f6: 0x000d, 0x4f7: 0x000d, 0x4f8: 0x000d, 0x4f9: 0x000d, 0x4fa: 0x000d, 0x4fb: 0x000d, + 0x4fc: 0x000d, 0x4fd: 0x000d, 0x4fe: 0x000d, 0x4ff: 0x000d, + // Block 0x14, offset 0x500 + 0x500: 0x000d, 0x501: 0x000d, 0x502: 0x000d, 0x503: 0x000d, 0x504: 0x000d, 0x505: 0x000d, + 0x506: 0x000d, 0x507: 0x000d, 0x508: 0x000d, 0x509: 0x000d, 0x50a: 0x000d, 0x50b: 0x000d, + 0x50c: 0x000d, 0x50d: 0x000d, 0x50e: 0x000d, 0x50f: 0x000d, 0x510: 0x000d, 0x511: 0x000d, + 0x512: 0x000d, 0x513: 0x000d, 0x514: 0x000d, 0x515: 0x000d, 0x516: 0x000d, 0x517: 0x000d, + 0x518: 0x000d, 0x519: 0x000d, 0x51a: 0x000d, 0x51b: 0x000d, 0x51c: 0x000d, 0x51d: 0x000d, + 0x51e: 0x000d, 0x51f: 0x000d, 0x520: 0x000d, 0x521: 0x000d, 0x522: 0x000d, 0x523: 0x000d, + 0x524: 0x000d, 0x525: 0x000d, 0x526: 0x000c, 0x527: 0x000c, 0x528: 0x000c, 0x529: 0x000c, + 0x52a: 0x000c, 0x52b: 0x000c, 0x52c: 0x000c, 0x52d: 0x000c, 0x52e: 0x000c, 0x52f: 0x000c, + 0x530: 0x000c, 0x531: 0x000d, 0x532: 0x000d, 0x533: 0x000d, 0x534: 0x000d, 0x535: 0x000d, + 0x536: 0x000d, 0x537: 0x000d, 0x538: 0x000d, 0x539: 0x000d, 0x53a: 0x000d, 0x53b: 0x000d, + 0x53c: 0x000d, 0x53d: 0x000d, 0x53e: 0x000d, 0x53f: 0x000d, + // Block 0x15, offset 0x540 + 0x540: 0x0001, 0x541: 0x0001, 0x542: 0x0001, 0x543: 0x0001, 0x544: 0x0001, 0x545: 0x0001, + 0x546: 0x0001, 0x547: 0x0001, 0x548: 0x0001, 0x549: 0x0001, 0x54a: 0x0001, 0x54b: 0x0001, + 0x54c: 0x0001, 0x54d: 0x0001, 0x54e: 0x0001, 0x54f: 0x0001, 0x550: 0x0001, 0x551: 0x0001, + 0x552: 0x0001, 0x553: 0x0001, 0x554: 0x0001, 0x555: 0x0001, 0x556: 0x0001, 0x557: 0x0001, + 0x558: 0x0001, 0x559: 0x0001, 0x55a: 0x0001, 0x55b: 0x0001, 0x55c: 0x0001, 0x55d: 0x0001, + 0x55e: 0x0001, 0x55f: 0x0001, 0x560: 0x0001, 0x561: 0x0001, 0x562: 0x0001, 0x563: 0x0001, + 0x564: 0x0001, 0x565: 0x0001, 0x566: 0x0001, 0x567: 0x0001, 0x568: 0x0001, 0x569: 0x0001, + 0x56a: 0x0001, 0x56b: 0x000c, 0x56c: 0x000c, 0x56d: 0x000c, 0x56e: 0x000c, 0x56f: 0x000c, + 0x570: 0x000c, 0x571: 0x000c, 0x572: 0x000c, 0x573: 0x000c, 0x574: 0x0001, 0x575: 0x0001, + 0x576: 0x000a, 0x577: 0x000a, 0x578: 0x000a, 0x579: 0x000a, 0x57a: 0x0001, 0x57b: 0x0001, + 0x57c: 0x0001, 0x57d: 0x0001, 0x57e: 0x0001, 0x57f: 0x0001, + // Block 0x16, offset 0x580 + 0x580: 0x0001, 0x581: 0x0001, 0x582: 0x0001, 0x583: 0x0001, 0x584: 0x0001, 0x585: 0x0001, + 0x586: 0x0001, 0x587: 0x0001, 0x588: 0x0001, 0x589: 0x0001, 0x58a: 0x0001, 0x58b: 0x0001, + 0x58c: 0x0001, 0x58d: 0x0001, 0x58e: 0x0001, 0x58f: 0x0001, 0x590: 0x0001, 0x591: 0x0001, + 0x592: 0x0001, 0x593: 0x0001, 0x594: 0x0001, 0x595: 0x0001, 0x596: 0x000c, 0x597: 0x000c, + 0x598: 0x000c, 0x599: 0x000c, 0x59a: 0x0001, 0x59b: 0x000c, 0x59c: 0x000c, 0x59d: 0x000c, + 0x59e: 0x000c, 0x59f: 0x000c, 0x5a0: 0x000c, 0x5a1: 0x000c, 0x5a2: 0x000c, 0x5a3: 0x000c, + 0x5a4: 0x0001, 0x5a5: 0x000c, 0x5a6: 0x000c, 0x5a7: 0x000c, 0x5a8: 0x0001, 0x5a9: 0x000c, + 0x5aa: 0x000c, 0x5ab: 0x000c, 0x5ac: 0x000c, 0x5ad: 0x000c, 0x5ae: 0x0001, 0x5af: 0x0001, + 0x5b0: 0x0001, 0x5b1: 0x0001, 0x5b2: 0x0001, 0x5b3: 0x0001, 0x5b4: 0x0001, 0x5b5: 0x0001, + 0x5b6: 0x0001, 0x5b7: 0x0001, 0x5b8: 0x0001, 0x5b9: 0x0001, 0x5ba: 0x0001, 0x5bb: 0x0001, + 0x5bc: 0x0001, 0x5bd: 0x0001, 0x5be: 0x0001, 0x5bf: 0x0001, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x0001, 0x5c1: 0x0001, 0x5c2: 0x0001, 0x5c3: 0x0001, 0x5c4: 0x0001, 0x5c5: 0x0001, + 0x5c6: 0x0001, 0x5c7: 0x0001, 0x5c8: 0x0001, 0x5c9: 0x0001, 0x5ca: 0x0001, 0x5cb: 0x0001, + 0x5cc: 0x0001, 0x5cd: 0x0001, 0x5ce: 0x0001, 0x5cf: 0x0001, 0x5d0: 0x0001, 0x5d1: 0x0001, + 0x5d2: 0x0001, 0x5d3: 0x0001, 0x5d4: 0x0001, 0x5d5: 0x0001, 0x5d6: 0x0001, 0x5d7: 0x0001, + 0x5d8: 0x0001, 0x5d9: 0x000c, 0x5da: 0x000c, 0x5db: 0x000c, 0x5dc: 0x0001, 0x5dd: 0x0001, + 0x5de: 0x0001, 0x5df: 0x0001, 0x5e0: 0x0001, 0x5e1: 0x0001, 0x5e2: 0x0001, 0x5e3: 0x0001, + 0x5e4: 0x0001, 0x5e5: 0x0001, 0x5e6: 0x0001, 0x5e7: 0x0001, 0x5e8: 0x0001, 0x5e9: 0x0001, + 0x5ea: 0x0001, 0x5eb: 0x0001, 0x5ec: 0x0001, 0x5ed: 0x0001, 0x5ee: 0x0001, 0x5ef: 0x0001, + 0x5f0: 0x0001, 0x5f1: 0x0001, 0x5f2: 0x0001, 0x5f3: 0x0001, 0x5f4: 0x0001, 0x5f5: 0x0001, + 0x5f6: 0x0001, 0x5f7: 0x0001, 0x5f8: 0x0001, 0x5f9: 0x0001, 0x5fa: 0x0001, 0x5fb: 0x0001, + 0x5fc: 0x0001, 0x5fd: 0x0001, 0x5fe: 0x0001, 0x5ff: 0x0001, + // Block 0x18, offset 0x600 + 0x600: 0x0001, 0x601: 0x0001, 0x602: 0x0001, 0x603: 0x0001, 0x604: 0x0001, 0x605: 0x0001, + 0x606: 0x0001, 0x607: 0x0001, 0x608: 0x0001, 0x609: 0x0001, 0x60a: 0x0001, 0x60b: 0x0001, + 0x60c: 0x0001, 0x60d: 0x0001, 0x60e: 0x0001, 0x60f: 0x0001, 0x610: 0x0001, 0x611: 0x0001, + 0x612: 0x0001, 0x613: 0x0001, 0x614: 0x0001, 0x615: 0x0001, 0x616: 0x0001, 0x617: 0x0001, + 0x618: 0x0001, 0x619: 0x0001, 0x61a: 0x0001, 0x61b: 0x0001, 0x61c: 0x0001, 0x61d: 0x0001, + 0x61e: 0x0001, 0x61f: 0x0001, 0x620: 0x000d, 0x621: 0x000d, 0x622: 0x000d, 0x623: 0x000d, + 0x624: 0x000d, 0x625: 0x000d, 0x626: 0x000d, 0x627: 0x000d, 0x628: 0x000d, 0x629: 0x000d, + 0x62a: 0x000d, 0x62b: 0x000d, 0x62c: 0x000d, 0x62d: 0x000d, 0x62e: 0x000d, 0x62f: 0x000d, + 0x630: 0x000d, 0x631: 0x000d, 0x632: 0x000d, 0x633: 0x000d, 0x634: 0x000d, 0x635: 0x000d, + 0x636: 0x000d, 0x637: 0x000d, 0x638: 0x000d, 0x639: 0x000d, 0x63a: 0x000d, 0x63b: 0x000d, + 0x63c: 0x000d, 0x63d: 0x000d, 0x63e: 0x000d, 0x63f: 0x000d, + // Block 0x19, offset 0x640 + 0x640: 0x000d, 0x641: 0x000d, 0x642: 0x000d, 0x643: 0x000d, 0x644: 0x000d, 0x645: 0x000d, + 0x646: 0x000d, 0x647: 0x000d, 0x648: 0x000d, 0x649: 0x000d, 0x64a: 0x000d, 0x64b: 0x000d, + 0x64c: 0x000d, 0x64d: 0x000d, 0x64e: 0x000d, 0x64f: 0x000d, 0x650: 0x000d, 0x651: 0x000d, + 0x652: 0x000d, 0x653: 0x000d, 0x654: 0x000c, 0x655: 0x000c, 0x656: 0x000c, 0x657: 0x000c, + 0x658: 0x000c, 0x659: 0x000c, 0x65a: 0x000c, 0x65b: 0x000c, 0x65c: 0x000c, 0x65d: 0x000c, + 0x65e: 0x000c, 0x65f: 0x000c, 0x660: 0x000c, 0x661: 0x000c, 0x662: 0x0005, 0x663: 0x000c, + 0x664: 0x000c, 0x665: 0x000c, 0x666: 0x000c, 0x667: 0x000c, 0x668: 0x000c, 0x669: 0x000c, + 0x66a: 0x000c, 0x66b: 0x000c, 0x66c: 0x000c, 0x66d: 0x000c, 0x66e: 0x000c, 0x66f: 0x000c, + 0x670: 0x000c, 0x671: 0x000c, 0x672: 0x000c, 0x673: 0x000c, 0x674: 0x000c, 0x675: 0x000c, + 0x676: 0x000c, 0x677: 0x000c, 0x678: 0x000c, 0x679: 0x000c, 0x67a: 0x000c, 0x67b: 0x000c, + 0x67c: 0x000c, 0x67d: 0x000c, 0x67e: 0x000c, 0x67f: 0x000c, + // Block 0x1a, offset 0x680 + 0x680: 0x000c, 0x681: 0x000c, 0x682: 0x000c, + 0x6ba: 0x000c, + 0x6bc: 0x000c, + // Block 0x1b, offset 0x6c0 + 0x6c1: 0x000c, 0x6c2: 0x000c, 0x6c3: 0x000c, 0x6c4: 0x000c, 0x6c5: 0x000c, + 0x6c6: 0x000c, 0x6c7: 0x000c, 0x6c8: 0x000c, + 0x6cd: 0x000c, 0x6d1: 0x000c, + 0x6d2: 0x000c, 0x6d3: 0x000c, 0x6d4: 0x000c, 0x6d5: 0x000c, 0x6d6: 0x000c, 0x6d7: 0x000c, + 0x6e2: 0x000c, 0x6e3: 0x000c, + // Block 0x1c, offset 0x700 + 0x701: 0x000c, + 0x73c: 0x000c, + // Block 0x1d, offset 0x740 + 0x741: 0x000c, 0x742: 0x000c, 0x743: 0x000c, 0x744: 0x000c, + 0x74d: 0x000c, + 0x762: 0x000c, 0x763: 0x000c, + 0x772: 0x0004, 0x773: 0x0004, + 0x77b: 0x0004, + // Block 0x1e, offset 0x780 + 0x781: 0x000c, 0x782: 0x000c, + 0x7bc: 0x000c, + // Block 0x1f, offset 0x7c0 + 0x7c1: 0x000c, 0x7c2: 0x000c, + 0x7c7: 0x000c, 0x7c8: 0x000c, 0x7cb: 0x000c, + 0x7cc: 0x000c, 0x7cd: 0x000c, 0x7d1: 0x000c, + 0x7f0: 0x000c, 0x7f1: 0x000c, 0x7f5: 0x000c, + // Block 0x20, offset 0x800 + 0x801: 0x000c, 0x802: 0x000c, 0x803: 0x000c, 0x804: 0x000c, 0x805: 0x000c, + 0x807: 0x000c, 0x808: 0x000c, + 0x80d: 0x000c, + 0x822: 0x000c, 0x823: 0x000c, + 0x831: 0x0004, + // Block 0x21, offset 0x840 + 0x841: 0x000c, + 0x87c: 0x000c, 0x87f: 0x000c, + // Block 0x22, offset 0x880 + 0x881: 0x000c, 0x882: 0x000c, 0x883: 0x000c, 0x884: 0x000c, + 0x88d: 0x000c, + 0x896: 0x000c, + 0x8a2: 0x000c, 0x8a3: 0x000c, + // Block 0x23, offset 0x8c0 + 0x8c2: 0x000c, + // Block 0x24, offset 0x900 + 0x900: 0x000c, + 0x90d: 0x000c, + 0x933: 0x000a, 0x934: 0x000a, 0x935: 0x000a, + 0x936: 0x000a, 0x937: 0x000a, 0x938: 0x000a, 0x939: 0x0004, 0x93a: 0x000a, + // Block 0x25, offset 0x940 + 0x940: 0x000c, + 0x97e: 0x000c, 0x97f: 0x000c, + // Block 0x26, offset 0x980 + 0x980: 0x000c, + 0x986: 0x000c, 0x987: 0x000c, 0x988: 0x000c, 0x98a: 0x000c, 0x98b: 0x000c, + 0x98c: 0x000c, 0x98d: 0x000c, + 0x995: 0x000c, 0x996: 0x000c, + 0x9a2: 0x000c, 0x9a3: 0x000c, + 0x9b8: 0x000a, 0x9b9: 0x000a, 0x9ba: 0x000a, 0x9bb: 0x000a, + 0x9bc: 0x000a, 0x9bd: 0x000a, 0x9be: 0x000a, + // Block 0x27, offset 0x9c0 + 0x9cc: 0x000c, 0x9cd: 0x000c, + 0x9e2: 0x000c, 0x9e3: 0x000c, + // Block 0x28, offset 0xa00 + 0xa01: 0x000c, + // Block 0x29, offset 0xa40 + 0xa41: 0x000c, 0xa42: 0x000c, 0xa43: 0x000c, 0xa44: 0x000c, + 0xa4d: 0x000c, + 0xa62: 0x000c, 0xa63: 0x000c, + // Block 0x2a, offset 0xa80 + 0xa8a: 0x000c, + 0xa92: 0x000c, 0xa93: 0x000c, 0xa94: 0x000c, 0xa96: 0x000c, + // Block 0x2b, offset 0xac0 + 0xaf1: 0x000c, 0xaf4: 0x000c, 0xaf5: 0x000c, + 0xaf6: 0x000c, 0xaf7: 0x000c, 0xaf8: 0x000c, 0xaf9: 0x000c, 0xafa: 0x000c, + 0xaff: 0x0004, + // Block 0x2c, offset 0xb00 + 0xb07: 0x000c, 0xb08: 0x000c, 0xb09: 0x000c, 0xb0a: 0x000c, 0xb0b: 0x000c, + 0xb0c: 0x000c, 0xb0d: 0x000c, 0xb0e: 0x000c, + // Block 0x2d, offset 0xb40 + 0xb71: 0x000c, 0xb74: 0x000c, 0xb75: 0x000c, + 0xb76: 0x000c, 0xb77: 0x000c, 0xb78: 0x000c, 0xb79: 0x000c, 0xb7b: 0x000c, + 0xb7c: 0x000c, + // Block 0x2e, offset 0xb80 + 0xb88: 0x000c, 0xb89: 0x000c, 0xb8a: 0x000c, 0xb8b: 0x000c, + 0xb8c: 0x000c, 0xb8d: 0x000c, + // Block 0x2f, offset 0xbc0 + 0xbd8: 0x000c, 0xbd9: 0x000c, + 0xbf5: 0x000c, + 0xbf7: 0x000c, 0xbf9: 0x000c, 0xbfa: 0x003a, 0xbfb: 0x002a, + 0xbfc: 0x003a, 0xbfd: 0x002a, + // Block 0x30, offset 0xc00 + 0xc31: 0x000c, 0xc32: 0x000c, 0xc33: 0x000c, 0xc34: 0x000c, 0xc35: 0x000c, + 0xc36: 0x000c, 0xc37: 0x000c, 0xc38: 0x000c, 0xc39: 0x000c, 0xc3a: 0x000c, 0xc3b: 0x000c, + 0xc3c: 0x000c, 0xc3d: 0x000c, 0xc3e: 0x000c, + // Block 0x31, offset 0xc40 + 0xc40: 0x000c, 0xc41: 0x000c, 0xc42: 0x000c, 0xc43: 0x000c, 0xc44: 0x000c, + 0xc46: 0x000c, 0xc47: 0x000c, + 0xc4d: 0x000c, 0xc4e: 0x000c, 0xc4f: 0x000c, 0xc50: 0x000c, 0xc51: 0x000c, + 0xc52: 0x000c, 0xc53: 0x000c, 0xc54: 0x000c, 0xc55: 0x000c, 0xc56: 0x000c, 0xc57: 0x000c, + 0xc59: 0x000c, 0xc5a: 0x000c, 0xc5b: 0x000c, 0xc5c: 0x000c, 0xc5d: 0x000c, + 0xc5e: 0x000c, 0xc5f: 0x000c, 0xc60: 0x000c, 0xc61: 0x000c, 0xc62: 0x000c, 0xc63: 0x000c, + 0xc64: 0x000c, 0xc65: 0x000c, 0xc66: 0x000c, 0xc67: 0x000c, 0xc68: 0x000c, 0xc69: 0x000c, + 0xc6a: 0x000c, 0xc6b: 0x000c, 0xc6c: 0x000c, 0xc6d: 0x000c, 0xc6e: 0x000c, 0xc6f: 0x000c, + 0xc70: 0x000c, 0xc71: 0x000c, 0xc72: 0x000c, 0xc73: 0x000c, 0xc74: 0x000c, 0xc75: 0x000c, + 0xc76: 0x000c, 0xc77: 0x000c, 0xc78: 0x000c, 0xc79: 0x000c, 0xc7a: 0x000c, 0xc7b: 0x000c, + 0xc7c: 0x000c, + // Block 0x32, offset 0xc80 + 0xc86: 0x000c, + // Block 0x33, offset 0xcc0 + 0xced: 0x000c, 0xcee: 0x000c, 0xcef: 0x000c, + 0xcf0: 0x000c, 0xcf2: 0x000c, 0xcf3: 0x000c, 0xcf4: 0x000c, 0xcf5: 0x000c, + 0xcf6: 0x000c, 0xcf7: 0x000c, 0xcf9: 0x000c, 0xcfa: 0x000c, + 0xcfd: 0x000c, 0xcfe: 0x000c, + // Block 0x34, offset 0xd00 + 0xd18: 0x000c, 0xd19: 0x000c, + 0xd1e: 0x000c, 0xd1f: 0x000c, 0xd20: 0x000c, + 0xd31: 0x000c, 0xd32: 0x000c, 0xd33: 0x000c, 0xd34: 0x000c, + // Block 0x35, offset 0xd40 + 0xd42: 0x000c, 0xd45: 0x000c, + 0xd46: 0x000c, + 0xd4d: 0x000c, + 0xd5d: 0x000c, + // Block 0x36, offset 0xd80 + 0xd9d: 0x000c, + 0xd9e: 0x000c, 0xd9f: 0x000c, + // Block 0x37, offset 0xdc0 + 0xdd0: 0x000a, 0xdd1: 0x000a, + 0xdd2: 0x000a, 0xdd3: 0x000a, 0xdd4: 0x000a, 0xdd5: 0x000a, 0xdd6: 0x000a, 0xdd7: 0x000a, + 0xdd8: 0x000a, 0xdd9: 0x000a, + // Block 0x38, offset 0xe00 + 0xe00: 0x000a, + // Block 0x39, offset 0xe40 + 0xe40: 0x0009, + 0xe5b: 0x007a, 0xe5c: 0x006a, + // Block 0x3a, offset 0xe80 + 0xe92: 0x000c, 0xe93: 0x000c, 0xe94: 0x000c, + 0xeb2: 0x000c, 0xeb3: 0x000c, 0xeb4: 0x000c, + // Block 0x3b, offset 0xec0 + 0xed2: 0x000c, 0xed3: 0x000c, + 0xef2: 0x000c, 0xef3: 0x000c, + // Block 0x3c, offset 0xf00 + 0xf34: 0x000c, 0xf35: 0x000c, + 0xf37: 0x000c, 0xf38: 0x000c, 0xf39: 0x000c, 0xf3a: 0x000c, 0xf3b: 0x000c, + 0xf3c: 0x000c, 0xf3d: 0x000c, + // Block 0x3d, offset 0xf40 + 0xf46: 0x000c, 0xf49: 0x000c, 0xf4a: 0x000c, 0xf4b: 0x000c, + 0xf4c: 0x000c, 0xf4d: 0x000c, 0xf4e: 0x000c, 0xf4f: 0x000c, 0xf50: 0x000c, 0xf51: 0x000c, + 0xf52: 0x000c, 0xf53: 0x000c, + 0xf5b: 0x0004, 0xf5d: 0x000c, + 0xf70: 0x000a, 0xf71: 0x000a, 0xf72: 0x000a, 0xf73: 0x000a, 0xf74: 0x000a, 0xf75: 0x000a, + 0xf76: 0x000a, 0xf77: 0x000a, 0xf78: 0x000a, 0xf79: 0x000a, + // Block 0x3e, offset 0xf80 + 0xf80: 0x000a, 0xf81: 0x000a, 0xf82: 0x000a, 0xf83: 0x000a, 0xf84: 0x000a, 0xf85: 0x000a, + 0xf86: 0x000a, 0xf87: 0x000a, 0xf88: 0x000a, 0xf89: 0x000a, 0xf8a: 0x000a, 0xf8b: 0x000c, + 0xf8c: 0x000c, 0xf8d: 0x000c, 0xf8e: 0x000b, + // Block 0x3f, offset 0xfc0 + 0xfc5: 0x000c, + 0xfc6: 0x000c, + 0xfe9: 0x000c, + // Block 0x40, offset 0x1000 + 0x1020: 0x000c, 0x1021: 0x000c, 0x1022: 0x000c, + 0x1027: 0x000c, 0x1028: 0x000c, + 0x1032: 0x000c, + 0x1039: 0x000c, 0x103a: 0x000c, 0x103b: 0x000c, + // Block 0x41, offset 0x1040 + 0x1040: 0x000a, 0x1044: 0x000a, 0x1045: 0x000a, + // Block 0x42, offset 0x1080 + 0x109e: 0x000a, 0x109f: 0x000a, 0x10a0: 0x000a, 0x10a1: 0x000a, 0x10a2: 0x000a, 0x10a3: 0x000a, + 0x10a4: 0x000a, 0x10a5: 0x000a, 0x10a6: 0x000a, 0x10a7: 0x000a, 0x10a8: 0x000a, 0x10a9: 0x000a, + 0x10aa: 0x000a, 0x10ab: 0x000a, 0x10ac: 0x000a, 0x10ad: 0x000a, 0x10ae: 0x000a, 0x10af: 0x000a, + 0x10b0: 0x000a, 0x10b1: 0x000a, 0x10b2: 0x000a, 0x10b3: 0x000a, 0x10b4: 0x000a, 0x10b5: 0x000a, + 0x10b6: 0x000a, 0x10b7: 0x000a, 0x10b8: 0x000a, 0x10b9: 0x000a, 0x10ba: 0x000a, 0x10bb: 0x000a, + 0x10bc: 0x000a, 0x10bd: 0x000a, 0x10be: 0x000a, 0x10bf: 0x000a, + // Block 0x43, offset 0x10c0 + 0x10d7: 0x000c, + 0x10d8: 0x000c, 0x10db: 0x000c, + // Block 0x44, offset 0x1100 + 0x1116: 0x000c, + 0x1118: 0x000c, 0x1119: 0x000c, 0x111a: 0x000c, 0x111b: 0x000c, 0x111c: 0x000c, 0x111d: 0x000c, + 0x111e: 0x000c, 0x1120: 0x000c, 0x1122: 0x000c, + 0x1125: 0x000c, 0x1126: 0x000c, 0x1127: 0x000c, 0x1128: 0x000c, 0x1129: 0x000c, + 0x112a: 0x000c, 0x112b: 0x000c, 0x112c: 0x000c, + 0x1133: 0x000c, 0x1134: 0x000c, 0x1135: 0x000c, + 0x1136: 0x000c, 0x1137: 0x000c, 0x1138: 0x000c, 0x1139: 0x000c, 0x113a: 0x000c, 0x113b: 0x000c, + 0x113c: 0x000c, 0x113f: 0x000c, + // Block 0x45, offset 0x1140 + 0x1170: 0x000c, 0x1171: 0x000c, 0x1172: 0x000c, 0x1173: 0x000c, 0x1174: 0x000c, 0x1175: 0x000c, + 0x1176: 0x000c, 0x1177: 0x000c, 0x1178: 0x000c, 0x1179: 0x000c, 0x117a: 0x000c, 0x117b: 0x000c, + 0x117c: 0x000c, 0x117d: 0x000c, 0x117e: 0x000c, + // Block 0x46, offset 0x1180 + 0x1180: 0x000c, 0x1181: 0x000c, 0x1182: 0x000c, 0x1183: 0x000c, + 0x11b4: 0x000c, + 0x11b6: 0x000c, 0x11b7: 0x000c, 0x11b8: 0x000c, 0x11b9: 0x000c, 0x11ba: 0x000c, + 0x11bc: 0x000c, + // Block 0x47, offset 0x11c0 + 0x11c2: 0x000c, + 0x11eb: 0x000c, 0x11ec: 0x000c, 0x11ed: 0x000c, 0x11ee: 0x000c, 0x11ef: 0x000c, + 0x11f0: 0x000c, 0x11f1: 0x000c, 0x11f2: 0x000c, 0x11f3: 0x000c, + // Block 0x48, offset 0x1200 + 0x1200: 0x000c, 0x1201: 0x000c, + 0x1222: 0x000c, 0x1223: 0x000c, + 0x1224: 0x000c, 0x1225: 0x000c, 0x1228: 0x000c, 0x1229: 0x000c, + 0x122b: 0x000c, 0x122c: 0x000c, 0x122d: 0x000c, + // Block 0x49, offset 0x1240 + 0x1266: 0x000c, 0x1268: 0x000c, 0x1269: 0x000c, + 0x126d: 0x000c, 0x126f: 0x000c, + 0x1270: 0x000c, 0x1271: 0x000c, + // Block 0x4a, offset 0x1280 + 0x12ac: 0x000c, 0x12ad: 0x000c, 0x12ae: 0x000c, 0x12af: 0x000c, + 0x12b0: 0x000c, 0x12b1: 0x000c, 0x12b2: 0x000c, 0x12b3: 0x000c, + 0x12b6: 0x000c, 0x12b7: 0x000c, + // Block 0x4b, offset 0x12c0 + 0x12d0: 0x000c, 0x12d1: 0x000c, + 0x12d2: 0x000c, 0x12d4: 0x000c, 0x12d5: 0x000c, 0x12d6: 0x000c, 0x12d7: 0x000c, + 0x12d8: 0x000c, 0x12d9: 0x000c, 0x12da: 0x000c, 0x12db: 0x000c, 0x12dc: 0x000c, 0x12dd: 0x000c, + 0x12de: 0x000c, 0x12df: 0x000c, 0x12e0: 0x000c, 0x12e2: 0x000c, 0x12e3: 0x000c, + 0x12e4: 0x000c, 0x12e5: 0x000c, 0x12e6: 0x000c, 0x12e7: 0x000c, 0x12e8: 0x000c, + 0x12ed: 0x000c, + 0x12f4: 0x000c, + 0x12f8: 0x000c, 0x12f9: 0x000c, + // Block 0x4c, offset 0x1300 + 0x1300: 0x000c, 0x1301: 0x000c, 0x1302: 0x000c, 0x1303: 0x000c, 0x1304: 0x000c, 0x1305: 0x000c, + 0x1306: 0x000c, 0x1307: 0x000c, 0x1308: 0x000c, 0x1309: 0x000c, 0x130a: 0x000c, 0x130b: 0x000c, + 0x130c: 0x000c, 0x130d: 0x000c, 0x130e: 0x000c, 0x130f: 0x000c, 0x1310: 0x000c, 0x1311: 0x000c, + 0x1312: 0x000c, 0x1313: 0x000c, 0x1314: 0x000c, 0x1315: 0x000c, 0x1316: 0x000c, 0x1317: 0x000c, + 0x1318: 0x000c, 0x1319: 0x000c, 0x131a: 0x000c, 0x131b: 0x000c, 0x131c: 0x000c, 0x131d: 0x000c, + 0x131e: 0x000c, 0x131f: 0x000c, 0x1320: 0x000c, 0x1321: 0x000c, 0x1322: 0x000c, 0x1323: 0x000c, + 0x1324: 0x000c, 0x1325: 0x000c, 0x1326: 0x000c, 0x1327: 0x000c, 0x1328: 0x000c, 0x1329: 0x000c, + 0x132a: 0x000c, 0x132b: 0x000c, 0x132c: 0x000c, 0x132d: 0x000c, 0x132e: 0x000c, 0x132f: 0x000c, + 0x1330: 0x000c, 0x1331: 0x000c, 0x1332: 0x000c, 0x1333: 0x000c, 0x1334: 0x000c, 0x1335: 0x000c, + 0x133b: 0x000c, + 0x133c: 0x000c, 0x133d: 0x000c, 0x133e: 0x000c, 0x133f: 0x000c, + // Block 0x4d, offset 0x1340 + 0x137d: 0x000a, 0x137f: 0x000a, + // Block 0x4e, offset 0x1380 + 0x1380: 0x000a, 0x1381: 0x000a, + 0x138d: 0x000a, 0x138e: 0x000a, 0x138f: 0x000a, + 0x139d: 0x000a, + 0x139e: 0x000a, 0x139f: 0x000a, + 0x13ad: 0x000a, 0x13ae: 0x000a, 0x13af: 0x000a, + 0x13bd: 0x000a, 0x13be: 0x000a, + // Block 0x4f, offset 0x13c0 + 0x13c0: 0x0009, 0x13c1: 0x0009, 0x13c2: 0x0009, 0x13c3: 0x0009, 0x13c4: 0x0009, 0x13c5: 0x0009, + 0x13c6: 0x0009, 0x13c7: 0x0009, 0x13c8: 0x0009, 0x13c9: 0x0009, 0x13ca: 0x0009, 0x13cb: 0x000b, + 0x13cc: 0x000b, 0x13cd: 0x000b, 0x13cf: 0x0001, 0x13d0: 0x000a, 0x13d1: 0x000a, + 0x13d2: 0x000a, 0x13d3: 0x000a, 0x13d4: 0x000a, 0x13d5: 0x000a, 0x13d6: 0x000a, 0x13d7: 0x000a, + 0x13d8: 0x000a, 0x13d9: 0x000a, 0x13da: 0x000a, 0x13db: 0x000a, 0x13dc: 0x000a, 0x13dd: 0x000a, + 0x13de: 0x000a, 0x13df: 0x000a, 0x13e0: 0x000a, 0x13e1: 0x000a, 0x13e2: 0x000a, 0x13e3: 0x000a, + 0x13e4: 0x000a, 0x13e5: 0x000a, 0x13e6: 0x000a, 0x13e7: 0x000a, 0x13e8: 0x0009, 0x13e9: 0x0007, + 0x13ea: 0x000e, 0x13eb: 0x000e, 0x13ec: 0x000e, 0x13ed: 0x000e, 0x13ee: 0x000e, 0x13ef: 0x0006, + 0x13f0: 0x0004, 0x13f1: 0x0004, 0x13f2: 0x0004, 0x13f3: 0x0004, 0x13f4: 0x0004, 0x13f5: 0x000a, + 0x13f6: 0x000a, 0x13f7: 0x000a, 0x13f8: 0x000a, 0x13f9: 0x000a, 0x13fa: 0x000a, 0x13fb: 0x000a, + 0x13fc: 0x000a, 0x13fd: 0x000a, 0x13fe: 0x000a, 0x13ff: 0x000a, + // Block 0x50, offset 0x1400 + 0x1400: 0x000a, 0x1401: 0x000a, 0x1402: 0x000a, 0x1403: 0x000a, 0x1404: 0x0006, 0x1405: 0x009a, + 0x1406: 0x008a, 0x1407: 0x000a, 0x1408: 0x000a, 0x1409: 0x000a, 0x140a: 0x000a, 0x140b: 0x000a, + 0x140c: 0x000a, 0x140d: 0x000a, 0x140e: 0x000a, 0x140f: 0x000a, 0x1410: 0x000a, 0x1411: 0x000a, + 0x1412: 0x000a, 0x1413: 0x000a, 0x1414: 0x000a, 0x1415: 0x000a, 0x1416: 0x000a, 0x1417: 0x000a, + 0x1418: 0x000a, 0x1419: 0x000a, 0x141a: 0x000a, 0x141b: 0x000a, 0x141c: 0x000a, 0x141d: 0x000a, + 0x141e: 0x000a, 0x141f: 0x0009, 0x1420: 0x000b, 0x1421: 0x000b, 0x1422: 0x000b, 0x1423: 0x000b, + 0x1424: 0x000b, 0x1425: 0x000b, 0x1426: 0x000e, 0x1427: 0x000e, 0x1428: 0x000e, 0x1429: 0x000e, + 0x142a: 0x000b, 0x142b: 0x000b, 0x142c: 0x000b, 0x142d: 0x000b, 0x142e: 0x000b, 0x142f: 0x000b, + 0x1430: 0x0002, 0x1434: 0x0002, 0x1435: 0x0002, + 0x1436: 0x0002, 0x1437: 0x0002, 0x1438: 0x0002, 0x1439: 0x0002, 0x143a: 0x0003, 0x143b: 0x0003, + 0x143c: 0x000a, 0x143d: 0x009a, 0x143e: 0x008a, + // Block 0x51, offset 0x1440 + 0x1440: 0x0002, 0x1441: 0x0002, 0x1442: 0x0002, 0x1443: 0x0002, 0x1444: 0x0002, 0x1445: 0x0002, + 0x1446: 0x0002, 0x1447: 0x0002, 0x1448: 0x0002, 0x1449: 0x0002, 0x144a: 0x0003, 0x144b: 0x0003, + 0x144c: 0x000a, 0x144d: 0x009a, 0x144e: 0x008a, + 0x1460: 0x0004, 0x1461: 0x0004, 0x1462: 0x0004, 0x1463: 0x0004, + 0x1464: 0x0004, 0x1465: 0x0004, 0x1466: 0x0004, 0x1467: 0x0004, 0x1468: 0x0004, 0x1469: 0x0004, + 0x146a: 0x0004, 0x146b: 0x0004, 0x146c: 0x0004, 0x146d: 0x0004, 0x146e: 0x0004, 0x146f: 0x0004, + 0x1470: 0x0004, 0x1471: 0x0004, 0x1472: 0x0004, 0x1473: 0x0004, 0x1474: 0x0004, 0x1475: 0x0004, + 0x1476: 0x0004, 0x1477: 0x0004, 0x1478: 0x0004, 0x1479: 0x0004, 0x147a: 0x0004, 0x147b: 0x0004, + 0x147c: 0x0004, 0x147d: 0x0004, 0x147e: 0x0004, 0x147f: 0x0004, + // Block 0x52, offset 0x1480 + 0x1480: 0x0004, 0x1481: 0x0004, 0x1482: 0x0004, 0x1483: 0x0004, 0x1484: 0x0004, 0x1485: 0x0004, + 0x1486: 0x0004, 0x1487: 0x0004, 0x1488: 0x0004, 0x1489: 0x0004, 0x148a: 0x0004, 0x148b: 0x0004, + 0x148c: 0x0004, 0x148d: 0x0004, 0x148e: 0x0004, 0x148f: 0x0004, 0x1490: 0x000c, 0x1491: 0x000c, + 0x1492: 0x000c, 0x1493: 0x000c, 0x1494: 0x000c, 0x1495: 0x000c, 0x1496: 0x000c, 0x1497: 0x000c, + 0x1498: 0x000c, 0x1499: 0x000c, 0x149a: 0x000c, 0x149b: 0x000c, 0x149c: 0x000c, 0x149d: 0x000c, + 0x149e: 0x000c, 0x149f: 0x000c, 0x14a0: 0x000c, 0x14a1: 0x000c, 0x14a2: 0x000c, 0x14a3: 0x000c, + 0x14a4: 0x000c, 0x14a5: 0x000c, 0x14a6: 0x000c, 0x14a7: 0x000c, 0x14a8: 0x000c, 0x14a9: 0x000c, + 0x14aa: 0x000c, 0x14ab: 0x000c, 0x14ac: 0x000c, 0x14ad: 0x000c, 0x14ae: 0x000c, 0x14af: 0x000c, + 0x14b0: 0x000c, + // Block 0x53, offset 0x14c0 + 0x14c0: 0x000a, 0x14c1: 0x000a, 0x14c3: 0x000a, 0x14c4: 0x000a, 0x14c5: 0x000a, + 0x14c6: 0x000a, 0x14c8: 0x000a, 0x14c9: 0x000a, + 0x14d4: 0x000a, 0x14d6: 0x000a, 0x14d7: 0x000a, + 0x14d8: 0x000a, + 0x14de: 0x000a, 0x14df: 0x000a, 0x14e0: 0x000a, 0x14e1: 0x000a, 0x14e2: 0x000a, 0x14e3: 0x000a, + 0x14e5: 0x000a, 0x14e7: 0x000a, 0x14e9: 0x000a, + 0x14ee: 0x0004, + 0x14fa: 0x000a, 0x14fb: 0x000a, + // Block 0x54, offset 0x1500 + 0x1500: 0x000a, 0x1501: 0x000a, 0x1502: 0x000a, 0x1503: 0x000a, 0x1504: 0x000a, + 0x150a: 0x000a, 0x150b: 0x000a, + 0x150c: 0x000a, 0x150d: 0x000a, 0x1510: 0x000a, 0x1511: 0x000a, + 0x1512: 0x000a, 0x1513: 0x000a, 0x1514: 0x000a, 0x1515: 0x000a, 0x1516: 0x000a, 0x1517: 0x000a, + 0x1518: 0x000a, 0x1519: 0x000a, 0x151a: 0x000a, 0x151b: 0x000a, 0x151c: 0x000a, 0x151d: 0x000a, + 0x151e: 0x000a, 0x151f: 0x000a, + // Block 0x55, offset 0x1540 + 0x1549: 0x000a, 0x154a: 0x000a, 0x154b: 0x000a, + 0x1550: 0x000a, 0x1551: 0x000a, + 0x1552: 0x000a, 0x1553: 0x000a, 0x1554: 0x000a, 0x1555: 0x000a, 0x1556: 0x000a, 0x1557: 0x000a, + 0x1558: 0x000a, 0x1559: 0x000a, 0x155a: 0x000a, 0x155b: 0x000a, 0x155c: 0x000a, 0x155d: 0x000a, + 0x155e: 0x000a, 0x155f: 0x000a, 0x1560: 0x000a, 0x1561: 0x000a, 0x1562: 0x000a, 0x1563: 0x000a, + 0x1564: 0x000a, 0x1565: 0x000a, 0x1566: 0x000a, 0x1567: 0x000a, 0x1568: 0x000a, 0x1569: 0x000a, + 0x156a: 0x000a, 0x156b: 0x000a, 0x156c: 0x000a, 0x156d: 0x000a, 0x156e: 0x000a, 0x156f: 0x000a, + 0x1570: 0x000a, 0x1571: 0x000a, 0x1572: 0x000a, 0x1573: 0x000a, 0x1574: 0x000a, 0x1575: 0x000a, + 0x1576: 0x000a, 0x1577: 0x000a, 0x1578: 0x000a, 0x1579: 0x000a, 0x157a: 0x000a, 0x157b: 0x000a, + 0x157c: 0x000a, 0x157d: 0x000a, 0x157e: 0x000a, 0x157f: 0x000a, + // Block 0x56, offset 0x1580 + 0x1580: 0x000a, 0x1581: 0x000a, 0x1582: 0x000a, 0x1583: 0x000a, 0x1584: 0x000a, 0x1585: 0x000a, + 0x1586: 0x000a, 0x1587: 0x000a, 0x1588: 0x000a, 0x1589: 0x000a, 0x158a: 0x000a, 0x158b: 0x000a, + 0x158c: 0x000a, 0x158d: 0x000a, 0x158e: 0x000a, 0x158f: 0x000a, 0x1590: 0x000a, 0x1591: 0x000a, + 0x1592: 0x000a, 0x1593: 0x000a, 0x1594: 0x000a, 0x1595: 0x000a, 0x1596: 0x000a, 0x1597: 0x000a, + 0x1598: 0x000a, 0x1599: 0x000a, 0x159a: 0x000a, 0x159b: 0x000a, 0x159c: 0x000a, 0x159d: 0x000a, + 0x159e: 0x000a, 0x159f: 0x000a, 0x15a0: 0x000a, 0x15a1: 0x000a, 0x15a2: 0x000a, 0x15a3: 0x000a, + 0x15a4: 0x000a, 0x15a5: 0x000a, 0x15a6: 0x000a, 0x15a7: 0x000a, 0x15a8: 0x000a, 0x15a9: 0x000a, + 0x15aa: 0x000a, 0x15ab: 0x000a, 0x15ac: 0x000a, 0x15ad: 0x000a, 0x15ae: 0x000a, 0x15af: 0x000a, + 0x15b0: 0x000a, 0x15b1: 0x000a, 0x15b2: 0x000a, 0x15b3: 0x000a, 0x15b4: 0x000a, 0x15b5: 0x000a, + 0x15b6: 0x000a, 0x15b7: 0x000a, 0x15b8: 0x000a, 0x15b9: 0x000a, 0x15ba: 0x000a, 0x15bb: 0x000a, + 0x15bc: 0x000a, 0x15bd: 0x000a, 0x15be: 0x000a, 0x15bf: 0x000a, + // Block 0x57, offset 0x15c0 + 0x15c0: 0x000a, 0x15c1: 0x000a, 0x15c2: 0x000a, 0x15c3: 0x000a, 0x15c4: 0x000a, 0x15c5: 0x000a, + 0x15c6: 0x000a, 0x15c7: 0x000a, 0x15c8: 0x000a, 0x15c9: 0x000a, 0x15ca: 0x000a, 0x15cb: 0x000a, + 0x15cc: 0x000a, 0x15cd: 0x000a, 0x15ce: 0x000a, 0x15cf: 0x000a, 0x15d0: 0x000a, 0x15d1: 0x000a, + 0x15d2: 0x0003, 0x15d3: 0x0004, 0x15d4: 0x000a, 0x15d5: 0x000a, 0x15d6: 0x000a, 0x15d7: 0x000a, + 0x15d8: 0x000a, 0x15d9: 0x000a, 0x15da: 0x000a, 0x15db: 0x000a, 0x15dc: 0x000a, 0x15dd: 0x000a, + 0x15de: 0x000a, 0x15df: 0x000a, 0x15e0: 0x000a, 0x15e1: 0x000a, 0x15e2: 0x000a, 0x15e3: 0x000a, + 0x15e4: 0x000a, 0x15e5: 0x000a, 0x15e6: 0x000a, 0x15e7: 0x000a, 0x15e8: 0x000a, 0x15e9: 0x000a, + 0x15ea: 0x000a, 0x15eb: 0x000a, 0x15ec: 0x000a, 0x15ed: 0x000a, 0x15ee: 0x000a, 0x15ef: 0x000a, + 0x15f0: 0x000a, 0x15f1: 0x000a, 0x15f2: 0x000a, 0x15f3: 0x000a, 0x15f4: 0x000a, 0x15f5: 0x000a, + 0x15f6: 0x000a, 0x15f7: 0x000a, 0x15f8: 0x000a, 0x15f9: 0x000a, 0x15fa: 0x000a, 0x15fb: 0x000a, + 0x15fc: 0x000a, 0x15fd: 0x000a, 0x15fe: 0x000a, 0x15ff: 0x000a, + // Block 0x58, offset 0x1600 + 0x1600: 0x000a, 0x1601: 0x000a, 0x1602: 0x000a, 0x1603: 0x000a, 0x1604: 0x000a, 0x1605: 0x000a, + 0x1606: 0x000a, 0x1607: 0x000a, 0x1608: 0x003a, 0x1609: 0x002a, 0x160a: 0x003a, 0x160b: 0x002a, + 0x160c: 0x000a, 0x160d: 0x000a, 0x160e: 0x000a, 0x160f: 0x000a, 0x1610: 0x000a, 0x1611: 0x000a, + 0x1612: 0x000a, 0x1613: 0x000a, 0x1614: 0x000a, 0x1615: 0x000a, 0x1616: 0x000a, 0x1617: 0x000a, + 0x1618: 0x000a, 0x1619: 0x000a, 0x161a: 0x000a, 0x161b: 0x000a, 0x161c: 0x000a, 0x161d: 0x000a, + 0x161e: 0x000a, 0x161f: 0x000a, 0x1620: 0x000a, 0x1621: 0x000a, 0x1622: 0x000a, 0x1623: 0x000a, + 0x1624: 0x000a, 0x1625: 0x000a, 0x1626: 0x000a, 0x1627: 0x000a, 0x1628: 0x000a, 0x1629: 0x009a, + 0x162a: 0x008a, 0x162b: 0x000a, 0x162c: 0x000a, 0x162d: 0x000a, 0x162e: 0x000a, 0x162f: 0x000a, + 0x1630: 0x000a, 0x1631: 0x000a, 0x1632: 0x000a, 0x1633: 0x000a, 0x1634: 0x000a, 0x1635: 0x000a, + // Block 0x59, offset 0x1640 + 0x167b: 0x000a, + 0x167c: 0x000a, 0x167d: 0x000a, 0x167e: 0x000a, 0x167f: 0x000a, + // Block 0x5a, offset 0x1680 + 0x1680: 0x000a, 0x1681: 0x000a, 0x1682: 0x000a, 0x1683: 0x000a, 0x1684: 0x000a, 0x1685: 0x000a, + 0x1686: 0x000a, 0x1687: 0x000a, 0x1688: 0x000a, 0x1689: 0x000a, 0x168a: 0x000a, 0x168b: 0x000a, + 0x168c: 0x000a, 0x168d: 0x000a, 0x168e: 0x000a, 0x168f: 0x000a, 0x1690: 0x000a, 0x1691: 0x000a, + 0x1692: 0x000a, 0x1693: 0x000a, 0x1694: 0x000a, 0x1696: 0x000a, 0x1697: 0x000a, + 0x1698: 0x000a, 0x1699: 0x000a, 0x169a: 0x000a, 0x169b: 0x000a, 0x169c: 0x000a, 0x169d: 0x000a, + 0x169e: 0x000a, 0x169f: 0x000a, 0x16a0: 0x000a, 0x16a1: 0x000a, 0x16a2: 0x000a, 0x16a3: 0x000a, + 0x16a4: 0x000a, 0x16a5: 0x000a, 0x16a6: 0x000a, 0x16a7: 0x000a, 0x16a8: 0x000a, 0x16a9: 0x000a, + 0x16aa: 0x000a, 0x16ab: 0x000a, 0x16ac: 0x000a, 0x16ad: 0x000a, 0x16ae: 0x000a, 0x16af: 0x000a, + 0x16b0: 0x000a, 0x16b1: 0x000a, 0x16b2: 0x000a, 0x16b3: 0x000a, 0x16b4: 0x000a, 0x16b5: 0x000a, + 0x16b6: 0x000a, 0x16b7: 0x000a, 0x16b8: 0x000a, 0x16b9: 0x000a, 0x16ba: 0x000a, 0x16bb: 0x000a, + 0x16bc: 0x000a, 0x16bd: 0x000a, 0x16be: 0x000a, 0x16bf: 0x000a, + // Block 0x5b, offset 0x16c0 + 0x16c0: 0x000a, 0x16c1: 0x000a, 0x16c2: 0x000a, 0x16c3: 0x000a, 0x16c4: 0x000a, 0x16c5: 0x000a, + 0x16c6: 0x000a, 0x16c7: 0x000a, 0x16c8: 0x000a, 0x16c9: 0x000a, 0x16ca: 0x000a, 0x16cb: 0x000a, + 0x16cc: 0x000a, 0x16cd: 0x000a, 0x16ce: 0x000a, 0x16cf: 0x000a, 0x16d0: 0x000a, 0x16d1: 0x000a, + 0x16d2: 0x000a, 0x16d3: 0x000a, 0x16d4: 0x000a, 0x16d5: 0x000a, 0x16d6: 0x000a, 0x16d7: 0x000a, + 0x16d8: 0x000a, 0x16d9: 0x000a, 0x16da: 0x000a, 0x16db: 0x000a, 0x16dc: 0x000a, 0x16dd: 0x000a, + 0x16de: 0x000a, 0x16df: 0x000a, 0x16e0: 0x000a, 0x16e1: 0x000a, 0x16e2: 0x000a, 0x16e3: 0x000a, + 0x16e4: 0x000a, 0x16e5: 0x000a, 0x16e6: 0x000a, 0x16e7: 0x000a, 0x16e8: 0x000a, 0x16e9: 0x000a, + 0x16ea: 0x000a, 0x16eb: 0x000a, 0x16ec: 0x000a, 0x16ed: 0x000a, 0x16ee: 0x000a, 0x16ef: 0x000a, + 0x16f0: 0x000a, 0x16f1: 0x000a, 0x16f2: 0x000a, 0x16f3: 0x000a, 0x16f4: 0x000a, 0x16f5: 0x000a, + 0x16f6: 0x000a, 0x16f7: 0x000a, 0x16f8: 0x000a, 0x16f9: 0x000a, 0x16fa: 0x000a, 0x16fb: 0x000a, + 0x16fc: 0x000a, 0x16fd: 0x000a, 0x16fe: 0x000a, + // Block 0x5c, offset 0x1700 + 0x1700: 0x000a, 0x1701: 0x000a, 0x1702: 0x000a, 0x1703: 0x000a, 0x1704: 0x000a, 0x1705: 0x000a, + 0x1706: 0x000a, 0x1707: 0x000a, 0x1708: 0x000a, 0x1709: 0x000a, 0x170a: 0x000a, 0x170b: 0x000a, + 0x170c: 0x000a, 0x170d: 0x000a, 0x170e: 0x000a, 0x170f: 0x000a, 0x1710: 0x000a, 0x1711: 0x000a, + 0x1712: 0x000a, 0x1713: 0x000a, 0x1714: 0x000a, 0x1715: 0x000a, 0x1716: 0x000a, 0x1717: 0x000a, + 0x1718: 0x000a, 0x1719: 0x000a, 0x171a: 0x000a, 0x171b: 0x000a, 0x171c: 0x000a, 0x171d: 0x000a, + 0x171e: 0x000a, 0x171f: 0x000a, 0x1720: 0x000a, 0x1721: 0x000a, 0x1722: 0x000a, 0x1723: 0x000a, + 0x1724: 0x000a, 0x1725: 0x000a, 0x1726: 0x000a, + // Block 0x5d, offset 0x1740 + 0x1740: 0x000a, 0x1741: 0x000a, 0x1742: 0x000a, 0x1743: 0x000a, 0x1744: 0x000a, 0x1745: 0x000a, + 0x1746: 0x000a, 0x1747: 0x000a, 0x1748: 0x000a, 0x1749: 0x000a, 0x174a: 0x000a, + 0x1760: 0x000a, 0x1761: 0x000a, 0x1762: 0x000a, 0x1763: 0x000a, + 0x1764: 0x000a, 0x1765: 0x000a, 0x1766: 0x000a, 0x1767: 0x000a, 0x1768: 0x000a, 0x1769: 0x000a, + 0x176a: 0x000a, 0x176b: 0x000a, 0x176c: 0x000a, 0x176d: 0x000a, 0x176e: 0x000a, 0x176f: 0x000a, + 0x1770: 0x000a, 0x1771: 0x000a, 0x1772: 0x000a, 0x1773: 0x000a, 0x1774: 0x000a, 0x1775: 0x000a, + 0x1776: 0x000a, 0x1777: 0x000a, 0x1778: 0x000a, 0x1779: 0x000a, 0x177a: 0x000a, 0x177b: 0x000a, + 0x177c: 0x000a, 0x177d: 0x000a, 0x177e: 0x000a, 0x177f: 0x000a, + // Block 0x5e, offset 0x1780 + 0x1780: 0x000a, 0x1781: 0x000a, 0x1782: 0x000a, 0x1783: 0x000a, 0x1784: 0x000a, 0x1785: 0x000a, + 0x1786: 0x000a, 0x1787: 0x000a, 0x1788: 0x0002, 0x1789: 0x0002, 0x178a: 0x0002, 0x178b: 0x0002, + 0x178c: 0x0002, 0x178d: 0x0002, 0x178e: 0x0002, 0x178f: 0x0002, 0x1790: 0x0002, 0x1791: 0x0002, + 0x1792: 0x0002, 0x1793: 0x0002, 0x1794: 0x0002, 0x1795: 0x0002, 0x1796: 0x0002, 0x1797: 0x0002, + 0x1798: 0x0002, 0x1799: 0x0002, 0x179a: 0x0002, 0x179b: 0x0002, + // Block 0x5f, offset 0x17c0 + 0x17ea: 0x000a, 0x17eb: 0x000a, 0x17ec: 0x000a, 0x17ed: 0x000a, 0x17ee: 0x000a, 0x17ef: 0x000a, + 0x17f0: 0x000a, 0x17f1: 0x000a, 0x17f2: 0x000a, 0x17f3: 0x000a, 0x17f4: 0x000a, 0x17f5: 0x000a, + 0x17f6: 0x000a, 0x17f7: 0x000a, 0x17f8: 0x000a, 0x17f9: 0x000a, 0x17fa: 0x000a, 0x17fb: 0x000a, + 0x17fc: 0x000a, 0x17fd: 0x000a, 0x17fe: 0x000a, 0x17ff: 0x000a, + // Block 0x60, offset 0x1800 + 0x1800: 0x000a, 0x1801: 0x000a, 0x1802: 0x000a, 0x1803: 0x000a, 0x1804: 0x000a, 0x1805: 0x000a, + 0x1806: 0x000a, 0x1807: 0x000a, 0x1808: 0x000a, 0x1809: 0x000a, 0x180a: 0x000a, 0x180b: 0x000a, + 0x180c: 0x000a, 0x180d: 0x000a, 0x180e: 0x000a, 0x180f: 0x000a, 0x1810: 0x000a, 0x1811: 0x000a, + 0x1812: 0x000a, 0x1813: 0x000a, 0x1814: 0x000a, 0x1815: 0x000a, 0x1816: 0x000a, 0x1817: 0x000a, + 0x1818: 0x000a, 0x1819: 0x000a, 0x181a: 0x000a, 0x181b: 0x000a, 0x181c: 0x000a, 0x181d: 0x000a, + 0x181e: 0x000a, 0x181f: 0x000a, 0x1820: 0x000a, 0x1821: 0x000a, 0x1822: 0x000a, 0x1823: 0x000a, + 0x1824: 0x000a, 0x1825: 0x000a, 0x1826: 0x000a, 0x1827: 0x000a, 0x1828: 0x000a, 0x1829: 0x000a, + 0x182a: 0x000a, 0x182b: 0x000a, 0x182d: 0x000a, 0x182e: 0x000a, 0x182f: 0x000a, + 0x1830: 0x000a, 0x1831: 0x000a, 0x1832: 0x000a, 0x1833: 0x000a, 0x1834: 0x000a, 0x1835: 0x000a, + 0x1836: 0x000a, 0x1837: 0x000a, 0x1838: 0x000a, 0x1839: 0x000a, 0x183a: 0x000a, 0x183b: 0x000a, + 0x183c: 0x000a, 0x183d: 0x000a, 0x183e: 0x000a, 0x183f: 0x000a, + // Block 0x61, offset 0x1840 + 0x1840: 0x000a, 0x1841: 0x000a, 0x1842: 0x000a, 0x1843: 0x000a, 0x1844: 0x000a, 0x1845: 0x000a, + 0x1846: 0x000a, 0x1847: 0x000a, 0x1848: 0x000a, 0x1849: 0x000a, 0x184a: 0x000a, 0x184b: 0x000a, + 0x184c: 0x000a, 0x184d: 0x000a, 0x184e: 0x000a, 0x184f: 0x000a, 0x1850: 0x000a, 0x1851: 0x000a, + 0x1852: 0x000a, 0x1853: 0x000a, 0x1854: 0x000a, 0x1855: 0x000a, 0x1856: 0x000a, 0x1857: 0x000a, + 0x1858: 0x000a, 0x1859: 0x000a, 0x185a: 0x000a, 0x185b: 0x000a, 0x185c: 0x000a, 0x185d: 0x000a, + 0x185e: 0x000a, 0x185f: 0x000a, 0x1860: 0x000a, 0x1861: 0x000a, 0x1862: 0x000a, 0x1863: 0x000a, + 0x1864: 0x000a, 0x1865: 0x000a, 0x1866: 0x000a, 0x1867: 0x000a, 0x1868: 0x003a, 0x1869: 0x002a, + 0x186a: 0x003a, 0x186b: 0x002a, 0x186c: 0x003a, 0x186d: 0x002a, 0x186e: 0x003a, 0x186f: 0x002a, + 0x1870: 0x003a, 0x1871: 0x002a, 0x1872: 0x003a, 0x1873: 0x002a, 0x1874: 0x003a, 0x1875: 0x002a, + 0x1876: 0x000a, 0x1877: 0x000a, 0x1878: 0x000a, 0x1879: 0x000a, 0x187a: 0x000a, 0x187b: 0x000a, + 0x187c: 0x000a, 0x187d: 0x000a, 0x187e: 0x000a, 0x187f: 0x000a, + // Block 0x62, offset 0x1880 + 0x1880: 0x000a, 0x1881: 0x000a, 0x1882: 0x000a, 0x1883: 0x000a, 0x1884: 0x000a, 0x1885: 0x009a, + 0x1886: 0x008a, 0x1887: 0x000a, 0x1888: 0x000a, 0x1889: 0x000a, 0x188a: 0x000a, 0x188b: 0x000a, + 0x188c: 0x000a, 0x188d: 0x000a, 0x188e: 0x000a, 0x188f: 0x000a, 0x1890: 0x000a, 0x1891: 0x000a, + 0x1892: 0x000a, 0x1893: 0x000a, 0x1894: 0x000a, 0x1895: 0x000a, 0x1896: 0x000a, 0x1897: 0x000a, + 0x1898: 0x000a, 0x1899: 0x000a, 0x189a: 0x000a, 0x189b: 0x000a, 0x189c: 0x000a, 0x189d: 0x000a, + 0x189e: 0x000a, 0x189f: 0x000a, 0x18a0: 0x000a, 0x18a1: 0x000a, 0x18a2: 0x000a, 0x18a3: 0x000a, + 0x18a4: 0x000a, 0x18a5: 0x000a, 0x18a6: 0x003a, 0x18a7: 0x002a, 0x18a8: 0x003a, 0x18a9: 0x002a, + 0x18aa: 0x003a, 0x18ab: 0x002a, 0x18ac: 0x003a, 0x18ad: 0x002a, 0x18ae: 0x003a, 0x18af: 0x002a, + 0x18b0: 0x000a, 0x18b1: 0x000a, 0x18b2: 0x000a, 0x18b3: 0x000a, 0x18b4: 0x000a, 0x18b5: 0x000a, + 0x18b6: 0x000a, 0x18b7: 0x000a, 0x18b8: 0x000a, 0x18b9: 0x000a, 0x18ba: 0x000a, 0x18bb: 0x000a, + 0x18bc: 0x000a, 0x18bd: 0x000a, 0x18be: 0x000a, 0x18bf: 0x000a, + // Block 0x63, offset 0x18c0 + 0x18c0: 0x000a, 0x18c1: 0x000a, 0x18c2: 0x000a, 0x18c3: 0x007a, 0x18c4: 0x006a, 0x18c5: 0x009a, + 0x18c6: 0x008a, 0x18c7: 0x00ba, 0x18c8: 0x00aa, 0x18c9: 0x009a, 0x18ca: 0x008a, 0x18cb: 0x007a, + 0x18cc: 0x006a, 0x18cd: 0x00da, 0x18ce: 0x002a, 0x18cf: 0x003a, 0x18d0: 0x00ca, 0x18d1: 0x009a, + 0x18d2: 0x008a, 0x18d3: 0x007a, 0x18d4: 0x006a, 0x18d5: 0x009a, 0x18d6: 0x008a, 0x18d7: 0x00ba, + 0x18d8: 0x00aa, 0x18d9: 0x000a, 0x18da: 0x000a, 0x18db: 0x000a, 0x18dc: 0x000a, 0x18dd: 0x000a, + 0x18de: 0x000a, 0x18df: 0x000a, 0x18e0: 0x000a, 0x18e1: 0x000a, 0x18e2: 0x000a, 0x18e3: 0x000a, + 0x18e4: 0x000a, 0x18e5: 0x000a, 0x18e6: 0x000a, 0x18e7: 0x000a, 0x18e8: 0x000a, 0x18e9: 0x000a, + 0x18ea: 0x000a, 0x18eb: 0x000a, 0x18ec: 0x000a, 0x18ed: 0x000a, 0x18ee: 0x000a, 0x18ef: 0x000a, + 0x18f0: 0x000a, 0x18f1: 0x000a, 0x18f2: 0x000a, 0x18f3: 0x000a, 0x18f4: 0x000a, 0x18f5: 0x000a, + 0x18f6: 0x000a, 0x18f7: 0x000a, 0x18f8: 0x000a, 0x18f9: 0x000a, 0x18fa: 0x000a, 0x18fb: 0x000a, + 0x18fc: 0x000a, 0x18fd: 0x000a, 0x18fe: 0x000a, 0x18ff: 0x000a, + // Block 0x64, offset 0x1900 + 0x1900: 0x000a, 0x1901: 0x000a, 0x1902: 0x000a, 0x1903: 0x000a, 0x1904: 0x000a, 0x1905: 0x000a, + 0x1906: 0x000a, 0x1907: 0x000a, 0x1908: 0x000a, 0x1909: 0x000a, 0x190a: 0x000a, 0x190b: 0x000a, + 0x190c: 0x000a, 0x190d: 0x000a, 0x190e: 0x000a, 0x190f: 0x000a, 0x1910: 0x000a, 0x1911: 0x000a, + 0x1912: 0x000a, 0x1913: 0x000a, 0x1914: 0x000a, 0x1915: 0x000a, 0x1916: 0x000a, 0x1917: 0x000a, + 0x1918: 0x003a, 0x1919: 0x002a, 0x191a: 0x003a, 0x191b: 0x002a, 0x191c: 0x000a, 0x191d: 0x000a, + 0x191e: 0x000a, 0x191f: 0x000a, 0x1920: 0x000a, 0x1921: 0x000a, 0x1922: 0x000a, 0x1923: 0x000a, + 0x1924: 0x000a, 0x1925: 0x000a, 0x1926: 0x000a, 0x1927: 0x000a, 0x1928: 0x000a, 0x1929: 0x000a, + 0x192a: 0x000a, 0x192b: 0x000a, 0x192c: 0x000a, 0x192d: 0x000a, 0x192e: 0x000a, 0x192f: 0x000a, + 0x1930: 0x000a, 0x1931: 0x000a, 0x1932: 0x000a, 0x1933: 0x000a, 0x1934: 0x000a, 0x1935: 0x000a, + 0x1936: 0x000a, 0x1937: 0x000a, 0x1938: 0x000a, 0x1939: 0x000a, 0x193a: 0x000a, 0x193b: 0x000a, + 0x193c: 0x003a, 0x193d: 0x002a, 0x193e: 0x000a, 0x193f: 0x000a, + // Block 0x65, offset 0x1940 + 0x1940: 0x000a, 0x1941: 0x000a, 0x1942: 0x000a, 0x1943: 0x000a, 0x1944: 0x000a, 0x1945: 0x000a, + 0x1946: 0x000a, 0x1947: 0x000a, 0x1948: 0x000a, 0x1949: 0x000a, 0x194a: 0x000a, 0x194b: 0x000a, + 0x194c: 0x000a, 0x194d: 0x000a, 0x194e: 0x000a, 0x194f: 0x000a, 0x1950: 0x000a, 0x1951: 0x000a, + 0x1952: 0x000a, 0x1953: 0x000a, 0x1954: 0x000a, 0x1955: 0x000a, 0x1956: 0x000a, 0x1957: 0x000a, + 0x1958: 0x000a, 0x1959: 0x000a, 0x195a: 0x000a, 0x195b: 0x000a, 0x195c: 0x000a, 0x195d: 0x000a, + 0x195e: 0x000a, 0x195f: 0x000a, 0x1960: 0x000a, 0x1961: 0x000a, 0x1962: 0x000a, 0x1963: 0x000a, + 0x1964: 0x000a, 0x1965: 0x000a, 0x1966: 0x000a, 0x1967: 0x000a, 0x1968: 0x000a, 0x1969: 0x000a, + 0x196a: 0x000a, 0x196b: 0x000a, 0x196c: 0x000a, 0x196d: 0x000a, 0x196e: 0x000a, 0x196f: 0x000a, + 0x1970: 0x000a, 0x1971: 0x000a, 0x1972: 0x000a, 0x1973: 0x000a, + 0x1976: 0x000a, 0x1977: 0x000a, 0x1978: 0x000a, 0x1979: 0x000a, 0x197a: 0x000a, 0x197b: 0x000a, + 0x197c: 0x000a, 0x197d: 0x000a, 0x197e: 0x000a, 0x197f: 0x000a, + // Block 0x66, offset 0x1980 + 0x1980: 0x000a, 0x1981: 0x000a, 0x1982: 0x000a, 0x1983: 0x000a, 0x1984: 0x000a, 0x1985: 0x000a, + 0x1986: 0x000a, 0x1987: 0x000a, 0x1988: 0x000a, 0x1989: 0x000a, 0x198a: 0x000a, 0x198b: 0x000a, + 0x198c: 0x000a, 0x198d: 0x000a, 0x198e: 0x000a, 0x198f: 0x000a, 0x1990: 0x000a, 0x1991: 0x000a, + 0x1992: 0x000a, 0x1993: 0x000a, 0x1994: 0x000a, 0x1995: 0x000a, + 0x1998: 0x000a, 0x1999: 0x000a, 0x199a: 0x000a, 0x199b: 0x000a, 0x199c: 0x000a, 0x199d: 0x000a, + 0x199e: 0x000a, 0x199f: 0x000a, 0x19a0: 0x000a, 0x19a1: 0x000a, 0x19a2: 0x000a, 0x19a3: 0x000a, + 0x19a4: 0x000a, 0x19a5: 0x000a, 0x19a6: 0x000a, 0x19a7: 0x000a, 0x19a8: 0x000a, 0x19a9: 0x000a, + 0x19aa: 0x000a, 0x19ab: 0x000a, 0x19ac: 0x000a, 0x19ad: 0x000a, 0x19ae: 0x000a, 0x19af: 0x000a, + 0x19b0: 0x000a, 0x19b1: 0x000a, 0x19b2: 0x000a, 0x19b3: 0x000a, 0x19b4: 0x000a, 0x19b5: 0x000a, + 0x19b6: 0x000a, 0x19b7: 0x000a, 0x19b8: 0x000a, 0x19b9: 0x000a, + 0x19bd: 0x000a, 0x19be: 0x000a, 0x19bf: 0x000a, + // Block 0x67, offset 0x19c0 + 0x19c0: 0x000a, 0x19c1: 0x000a, 0x19c2: 0x000a, 0x19c3: 0x000a, 0x19c4: 0x000a, 0x19c5: 0x000a, + 0x19c6: 0x000a, 0x19c7: 0x000a, 0x19c8: 0x000a, 0x19ca: 0x000a, 0x19cb: 0x000a, + 0x19cc: 0x000a, 0x19cd: 0x000a, 0x19ce: 0x000a, 0x19cf: 0x000a, 0x19d0: 0x000a, 0x19d1: 0x000a, + 0x19ec: 0x000a, 0x19ed: 0x000a, 0x19ee: 0x000a, 0x19ef: 0x000a, + // Block 0x68, offset 0x1a00 + 0x1a25: 0x000a, 0x1a26: 0x000a, 0x1a27: 0x000a, 0x1a28: 0x000a, 0x1a29: 0x000a, + 0x1a2a: 0x000a, 0x1a2f: 0x000c, + 0x1a30: 0x000c, 0x1a31: 0x000c, + 0x1a39: 0x000a, 0x1a3a: 0x000a, 0x1a3b: 0x000a, + 0x1a3c: 0x000a, 0x1a3d: 0x000a, 0x1a3e: 0x000a, 0x1a3f: 0x000a, + // Block 0x69, offset 0x1a40 + 0x1a7f: 0x000c, + // Block 0x6a, offset 0x1a80 + 0x1aa0: 0x000c, 0x1aa1: 0x000c, 0x1aa2: 0x000c, 0x1aa3: 0x000c, + 0x1aa4: 0x000c, 0x1aa5: 0x000c, 0x1aa6: 0x000c, 0x1aa7: 0x000c, 0x1aa8: 0x000c, 0x1aa9: 0x000c, + 0x1aaa: 0x000c, 0x1aab: 0x000c, 0x1aac: 0x000c, 0x1aad: 0x000c, 0x1aae: 0x000c, 0x1aaf: 0x000c, + 0x1ab0: 0x000c, 0x1ab1: 0x000c, 0x1ab2: 0x000c, 0x1ab3: 0x000c, 0x1ab4: 0x000c, 0x1ab5: 0x000c, + 0x1ab6: 0x000c, 0x1ab7: 0x000c, 0x1ab8: 0x000c, 0x1ab9: 0x000c, 0x1aba: 0x000c, 0x1abb: 0x000c, + 0x1abc: 0x000c, 0x1abd: 0x000c, 0x1abe: 0x000c, 0x1abf: 0x000c, + // Block 0x6b, offset 0x1ac0 + 0x1ac0: 0x000a, 0x1ac1: 0x000a, 0x1ac2: 0x000a, 0x1ac3: 0x000a, 0x1ac4: 0x000a, 0x1ac5: 0x000a, + 0x1ac6: 0x000a, 0x1ac7: 0x000a, 0x1ac8: 0x000a, 0x1ac9: 0x000a, 0x1aca: 0x000a, 0x1acb: 0x000a, + 0x1acc: 0x000a, 0x1acd: 0x000a, 0x1ace: 0x000a, 0x1acf: 0x000a, 0x1ad0: 0x000a, 0x1ad1: 0x000a, + 0x1ad2: 0x000a, 0x1ad3: 0x000a, 0x1ad4: 0x000a, 0x1ad5: 0x000a, 0x1ad6: 0x000a, 0x1ad7: 0x000a, + 0x1ad8: 0x000a, 0x1ad9: 0x000a, 0x1ada: 0x000a, 0x1adb: 0x000a, 0x1adc: 0x000a, 0x1add: 0x000a, + 0x1ade: 0x000a, 0x1adf: 0x000a, 0x1ae0: 0x000a, 0x1ae1: 0x000a, 0x1ae2: 0x003a, 0x1ae3: 0x002a, + 0x1ae4: 0x003a, 0x1ae5: 0x002a, 0x1ae6: 0x003a, 0x1ae7: 0x002a, 0x1ae8: 0x003a, 0x1ae9: 0x002a, + 0x1aea: 0x000a, 0x1aeb: 0x000a, 0x1aec: 0x000a, 0x1aed: 0x000a, 0x1aee: 0x000a, 0x1aef: 0x000a, + 0x1af0: 0x000a, 0x1af1: 0x000a, 0x1af2: 0x000a, 0x1af3: 0x000a, 0x1af4: 0x000a, 0x1af5: 0x000a, + 0x1af6: 0x000a, 0x1af7: 0x000a, 0x1af8: 0x000a, 0x1af9: 0x000a, 0x1afa: 0x000a, 0x1afb: 0x000a, + 0x1afc: 0x000a, 0x1afd: 0x000a, 0x1afe: 0x000a, 0x1aff: 0x000a, + // Block 0x6c, offset 0x1b00 + 0x1b00: 0x000a, 0x1b01: 0x000a, 0x1b02: 0x000a, 0x1b03: 0x000a, 0x1b04: 0x000a, + // Block 0x6d, offset 0x1b40 + 0x1b40: 0x000a, 0x1b41: 0x000a, 0x1b42: 0x000a, 0x1b43: 0x000a, 0x1b44: 0x000a, 0x1b45: 0x000a, + 0x1b46: 0x000a, 0x1b47: 0x000a, 0x1b48: 0x000a, 0x1b49: 0x000a, 0x1b4a: 0x000a, 0x1b4b: 0x000a, + 0x1b4c: 0x000a, 0x1b4d: 0x000a, 0x1b4e: 0x000a, 0x1b4f: 0x000a, 0x1b50: 0x000a, 0x1b51: 0x000a, + 0x1b52: 0x000a, 0x1b53: 0x000a, 0x1b54: 0x000a, 0x1b55: 0x000a, 0x1b56: 0x000a, 0x1b57: 0x000a, + 0x1b58: 0x000a, 0x1b59: 0x000a, 0x1b5b: 0x000a, 0x1b5c: 0x000a, 0x1b5d: 0x000a, + 0x1b5e: 0x000a, 0x1b5f: 0x000a, 0x1b60: 0x000a, 0x1b61: 0x000a, 0x1b62: 0x000a, 0x1b63: 0x000a, + 0x1b64: 0x000a, 0x1b65: 0x000a, 0x1b66: 0x000a, 0x1b67: 0x000a, 0x1b68: 0x000a, 0x1b69: 0x000a, + 0x1b6a: 0x000a, 0x1b6b: 0x000a, 0x1b6c: 0x000a, 0x1b6d: 0x000a, 0x1b6e: 0x000a, 0x1b6f: 0x000a, + 0x1b70: 0x000a, 0x1b71: 0x000a, 0x1b72: 0x000a, 0x1b73: 0x000a, 0x1b74: 0x000a, 0x1b75: 0x000a, + 0x1b76: 0x000a, 0x1b77: 0x000a, 0x1b78: 0x000a, 0x1b79: 0x000a, 0x1b7a: 0x000a, 0x1b7b: 0x000a, + 0x1b7c: 0x000a, 0x1b7d: 0x000a, 0x1b7e: 0x000a, 0x1b7f: 0x000a, + // Block 0x6e, offset 0x1b80 + 0x1b80: 0x000a, 0x1b81: 0x000a, 0x1b82: 0x000a, 0x1b83: 0x000a, 0x1b84: 0x000a, 0x1b85: 0x000a, + 0x1b86: 0x000a, 0x1b87: 0x000a, 0x1b88: 0x000a, 0x1b89: 0x000a, 0x1b8a: 0x000a, 0x1b8b: 0x000a, + 0x1b8c: 0x000a, 0x1b8d: 0x000a, 0x1b8e: 0x000a, 0x1b8f: 0x000a, 0x1b90: 0x000a, 0x1b91: 0x000a, + 0x1b92: 0x000a, 0x1b93: 0x000a, 0x1b94: 0x000a, 0x1b95: 0x000a, 0x1b96: 0x000a, 0x1b97: 0x000a, + 0x1b98: 0x000a, 0x1b99: 0x000a, 0x1b9a: 0x000a, 0x1b9b: 0x000a, 0x1b9c: 0x000a, 0x1b9d: 0x000a, + 0x1b9e: 0x000a, 0x1b9f: 0x000a, 0x1ba0: 0x000a, 0x1ba1: 0x000a, 0x1ba2: 0x000a, 0x1ba3: 0x000a, + 0x1ba4: 0x000a, 0x1ba5: 0x000a, 0x1ba6: 0x000a, 0x1ba7: 0x000a, 0x1ba8: 0x000a, 0x1ba9: 0x000a, + 0x1baa: 0x000a, 0x1bab: 0x000a, 0x1bac: 0x000a, 0x1bad: 0x000a, 0x1bae: 0x000a, 0x1baf: 0x000a, + 0x1bb0: 0x000a, 0x1bb1: 0x000a, 0x1bb2: 0x000a, 0x1bb3: 0x000a, + // Block 0x6f, offset 0x1bc0 + 0x1bc0: 0x000a, 0x1bc1: 0x000a, 0x1bc2: 0x000a, 0x1bc3: 0x000a, 0x1bc4: 0x000a, 0x1bc5: 0x000a, + 0x1bc6: 0x000a, 0x1bc7: 0x000a, 0x1bc8: 0x000a, 0x1bc9: 0x000a, 0x1bca: 0x000a, 0x1bcb: 0x000a, + 0x1bcc: 0x000a, 0x1bcd: 0x000a, 0x1bce: 0x000a, 0x1bcf: 0x000a, 0x1bd0: 0x000a, 0x1bd1: 0x000a, + 0x1bd2: 0x000a, 0x1bd3: 0x000a, 0x1bd4: 0x000a, 0x1bd5: 0x000a, + 0x1bf0: 0x000a, 0x1bf1: 0x000a, 0x1bf2: 0x000a, 0x1bf3: 0x000a, 0x1bf4: 0x000a, 0x1bf5: 0x000a, + 0x1bf6: 0x000a, 0x1bf7: 0x000a, 0x1bf8: 0x000a, 0x1bf9: 0x000a, 0x1bfa: 0x000a, 0x1bfb: 0x000a, + // Block 0x70, offset 0x1c00 + 0x1c00: 0x0009, 0x1c01: 0x000a, 0x1c02: 0x000a, 0x1c03: 0x000a, 0x1c04: 0x000a, + 0x1c08: 0x003a, 0x1c09: 0x002a, 0x1c0a: 0x003a, 0x1c0b: 0x002a, + 0x1c0c: 0x003a, 0x1c0d: 0x002a, 0x1c0e: 0x003a, 0x1c0f: 0x002a, 0x1c10: 0x003a, 0x1c11: 0x002a, + 0x1c12: 0x000a, 0x1c13: 0x000a, 0x1c14: 0x003a, 0x1c15: 0x002a, 0x1c16: 0x003a, 0x1c17: 0x002a, + 0x1c18: 0x003a, 0x1c19: 0x002a, 0x1c1a: 0x003a, 0x1c1b: 0x002a, 0x1c1c: 0x000a, 0x1c1d: 0x000a, + 0x1c1e: 0x000a, 0x1c1f: 0x000a, 0x1c20: 0x000a, + 0x1c2a: 0x000c, 0x1c2b: 0x000c, 0x1c2c: 0x000c, 0x1c2d: 0x000c, + 0x1c30: 0x000a, + 0x1c36: 0x000a, 0x1c37: 0x000a, + 0x1c3d: 0x000a, 0x1c3e: 0x000a, 0x1c3f: 0x000a, + // Block 0x71, offset 0x1c40 + 0x1c59: 0x000c, 0x1c5a: 0x000c, 0x1c5b: 0x000a, 0x1c5c: 0x000a, + 0x1c60: 0x000a, + // Block 0x72, offset 0x1c80 + 0x1cbb: 0x000a, + // Block 0x73, offset 0x1cc0 + 0x1cc0: 0x000a, 0x1cc1: 0x000a, 0x1cc2: 0x000a, 0x1cc3: 0x000a, 0x1cc4: 0x000a, 0x1cc5: 0x000a, + 0x1cc6: 0x000a, 0x1cc7: 0x000a, 0x1cc8: 0x000a, 0x1cc9: 0x000a, 0x1cca: 0x000a, 0x1ccb: 0x000a, + 0x1ccc: 0x000a, 0x1ccd: 0x000a, 0x1cce: 0x000a, 0x1ccf: 0x000a, 0x1cd0: 0x000a, 0x1cd1: 0x000a, + 0x1cd2: 0x000a, 0x1cd3: 0x000a, 0x1cd4: 0x000a, 0x1cd5: 0x000a, 0x1cd6: 0x000a, 0x1cd7: 0x000a, + 0x1cd8: 0x000a, 0x1cd9: 0x000a, 0x1cda: 0x000a, 0x1cdb: 0x000a, 0x1cdc: 0x000a, 0x1cdd: 0x000a, + 0x1cde: 0x000a, 0x1cdf: 0x000a, 0x1ce0: 0x000a, 0x1ce1: 0x000a, 0x1ce2: 0x000a, 0x1ce3: 0x000a, + // Block 0x74, offset 0x1d00 + 0x1d1d: 0x000a, + 0x1d1e: 0x000a, + // Block 0x75, offset 0x1d40 + 0x1d50: 0x000a, 0x1d51: 0x000a, + 0x1d52: 0x000a, 0x1d53: 0x000a, 0x1d54: 0x000a, 0x1d55: 0x000a, 0x1d56: 0x000a, 0x1d57: 0x000a, + 0x1d58: 0x000a, 0x1d59: 0x000a, 0x1d5a: 0x000a, 0x1d5b: 0x000a, 0x1d5c: 0x000a, 0x1d5d: 0x000a, + 0x1d5e: 0x000a, 0x1d5f: 0x000a, + 0x1d7c: 0x000a, 0x1d7d: 0x000a, 0x1d7e: 0x000a, + // Block 0x76, offset 0x1d80 + 0x1db1: 0x000a, 0x1db2: 0x000a, 0x1db3: 0x000a, 0x1db4: 0x000a, 0x1db5: 0x000a, + 0x1db6: 0x000a, 0x1db7: 0x000a, 0x1db8: 0x000a, 0x1db9: 0x000a, 0x1dba: 0x000a, 0x1dbb: 0x000a, + 0x1dbc: 0x000a, 0x1dbd: 0x000a, 0x1dbe: 0x000a, 0x1dbf: 0x000a, + // Block 0x77, offset 0x1dc0 + 0x1dcc: 0x000a, 0x1dcd: 0x000a, 0x1dce: 0x000a, 0x1dcf: 0x000a, + // Block 0x78, offset 0x1e00 + 0x1e37: 0x000a, 0x1e38: 0x000a, 0x1e39: 0x000a, 0x1e3a: 0x000a, + // Block 0x79, offset 0x1e40 + 0x1e5e: 0x000a, 0x1e5f: 0x000a, + 0x1e7f: 0x000a, + // Block 0x7a, offset 0x1e80 + 0x1e90: 0x000a, 0x1e91: 0x000a, + 0x1e92: 0x000a, 0x1e93: 0x000a, 0x1e94: 0x000a, 0x1e95: 0x000a, 0x1e96: 0x000a, 0x1e97: 0x000a, + 0x1e98: 0x000a, 0x1e99: 0x000a, 0x1e9a: 0x000a, 0x1e9b: 0x000a, 0x1e9c: 0x000a, 0x1e9d: 0x000a, + 0x1e9e: 0x000a, 0x1e9f: 0x000a, 0x1ea0: 0x000a, 0x1ea1: 0x000a, 0x1ea2: 0x000a, 0x1ea3: 0x000a, + 0x1ea4: 0x000a, 0x1ea5: 0x000a, 0x1ea6: 0x000a, 0x1ea7: 0x000a, 0x1ea8: 0x000a, 0x1ea9: 0x000a, + 0x1eaa: 0x000a, 0x1eab: 0x000a, 0x1eac: 0x000a, 0x1ead: 0x000a, 0x1eae: 0x000a, 0x1eaf: 0x000a, + 0x1eb0: 0x000a, 0x1eb1: 0x000a, 0x1eb2: 0x000a, 0x1eb3: 0x000a, 0x1eb4: 0x000a, 0x1eb5: 0x000a, + 0x1eb6: 0x000a, 0x1eb7: 0x000a, 0x1eb8: 0x000a, 0x1eb9: 0x000a, 0x1eba: 0x000a, 0x1ebb: 0x000a, + 0x1ebc: 0x000a, 0x1ebd: 0x000a, 0x1ebe: 0x000a, 0x1ebf: 0x000a, + // Block 0x7b, offset 0x1ec0 + 0x1ec0: 0x000a, 0x1ec1: 0x000a, 0x1ec2: 0x000a, 0x1ec3: 0x000a, 0x1ec4: 0x000a, 0x1ec5: 0x000a, + 0x1ec6: 0x000a, + // Block 0x7c, offset 0x1f00 + 0x1f0d: 0x000a, 0x1f0e: 0x000a, 0x1f0f: 0x000a, + // Block 0x7d, offset 0x1f40 + 0x1f6f: 0x000c, + 0x1f70: 0x000c, 0x1f71: 0x000c, 0x1f72: 0x000c, 0x1f73: 0x000a, 0x1f74: 0x000c, 0x1f75: 0x000c, + 0x1f76: 0x000c, 0x1f77: 0x000c, 0x1f78: 0x000c, 0x1f79: 0x000c, 0x1f7a: 0x000c, 0x1f7b: 0x000c, + 0x1f7c: 0x000c, 0x1f7d: 0x000c, 0x1f7e: 0x000a, 0x1f7f: 0x000a, + // Block 0x7e, offset 0x1f80 + 0x1f9e: 0x000c, 0x1f9f: 0x000c, + // Block 0x7f, offset 0x1fc0 + 0x1ff0: 0x000c, 0x1ff1: 0x000c, + // Block 0x80, offset 0x2000 + 0x2000: 0x000a, 0x2001: 0x000a, 0x2002: 0x000a, 0x2003: 0x000a, 0x2004: 0x000a, 0x2005: 0x000a, + 0x2006: 0x000a, 0x2007: 0x000a, 0x2008: 0x000a, 0x2009: 0x000a, 0x200a: 0x000a, 0x200b: 0x000a, + 0x200c: 0x000a, 0x200d: 0x000a, 0x200e: 0x000a, 0x200f: 0x000a, 0x2010: 0x000a, 0x2011: 0x000a, + 0x2012: 0x000a, 0x2013: 0x000a, 0x2014: 0x000a, 0x2015: 0x000a, 0x2016: 0x000a, 0x2017: 0x000a, + 0x2018: 0x000a, 0x2019: 0x000a, 0x201a: 0x000a, 0x201b: 0x000a, 0x201c: 0x000a, 0x201d: 0x000a, + 0x201e: 0x000a, 0x201f: 0x000a, 0x2020: 0x000a, 0x2021: 0x000a, + // Block 0x81, offset 0x2040 + 0x2048: 0x000a, + // Block 0x82, offset 0x2080 + 0x2082: 0x000c, + 0x2086: 0x000c, 0x208b: 0x000c, + 0x20a5: 0x000c, 0x20a6: 0x000c, 0x20a8: 0x000a, 0x20a9: 0x000a, + 0x20aa: 0x000a, 0x20ab: 0x000a, + 0x20b8: 0x0004, 0x20b9: 0x0004, + // Block 0x83, offset 0x20c0 + 0x20f4: 0x000a, 0x20f5: 0x000a, + 0x20f6: 0x000a, 0x20f7: 0x000a, + // Block 0x84, offset 0x2100 + 0x2104: 0x000c, 0x2105: 0x000c, + 0x2120: 0x000c, 0x2121: 0x000c, 0x2122: 0x000c, 0x2123: 0x000c, + 0x2124: 0x000c, 0x2125: 0x000c, 0x2126: 0x000c, 0x2127: 0x000c, 0x2128: 0x000c, 0x2129: 0x000c, + 0x212a: 0x000c, 0x212b: 0x000c, 0x212c: 0x000c, 0x212d: 0x000c, 0x212e: 0x000c, 0x212f: 0x000c, + 0x2130: 0x000c, 0x2131: 0x000c, + // Block 0x85, offset 0x2140 + 0x2166: 0x000c, 0x2167: 0x000c, 0x2168: 0x000c, 0x2169: 0x000c, + 0x216a: 0x000c, 0x216b: 0x000c, 0x216c: 0x000c, 0x216d: 0x000c, + // Block 0x86, offset 0x2180 + 0x2187: 0x000c, 0x2188: 0x000c, 0x2189: 0x000c, 0x218a: 0x000c, 0x218b: 0x000c, + 0x218c: 0x000c, 0x218d: 0x000c, 0x218e: 0x000c, 0x218f: 0x000c, 0x2190: 0x000c, 0x2191: 0x000c, + // Block 0x87, offset 0x21c0 + 0x21c0: 0x000c, 0x21c1: 0x000c, 0x21c2: 0x000c, + 0x21f3: 0x000c, + 0x21f6: 0x000c, 0x21f7: 0x000c, 0x21f8: 0x000c, 0x21f9: 0x000c, + 0x21fc: 0x000c, + // Block 0x88, offset 0x2200 + 0x2225: 0x000c, + // Block 0x89, offset 0x2240 + 0x2269: 0x000c, + 0x226a: 0x000c, 0x226b: 0x000c, 0x226c: 0x000c, 0x226d: 0x000c, 0x226e: 0x000c, + 0x2271: 0x000c, 0x2272: 0x000c, 0x2275: 0x000c, + 0x2276: 0x000c, + // Block 0x8a, offset 0x2280 + 0x2283: 0x000c, + 0x228c: 0x000c, + 0x22bc: 0x000c, + // Block 0x8b, offset 0x22c0 + 0x22f0: 0x000c, 0x22f2: 0x000c, 0x22f3: 0x000c, 0x22f4: 0x000c, + 0x22f7: 0x000c, 0x22f8: 0x000c, + 0x22fe: 0x000c, 0x22ff: 0x000c, + // Block 0x8c, offset 0x2300 + 0x2301: 0x000c, + 0x232c: 0x000c, 0x232d: 0x000c, + 0x2336: 0x000c, + // Block 0x8d, offset 0x2340 + 0x2365: 0x000c, 0x2368: 0x000c, + 0x236d: 0x000c, + // Block 0x8e, offset 0x2380 + 0x239d: 0x0001, + 0x239e: 0x000c, 0x239f: 0x0001, 0x23a0: 0x0001, 0x23a1: 0x0001, 0x23a2: 0x0001, 0x23a3: 0x0001, + 0x23a4: 0x0001, 0x23a5: 0x0001, 0x23a6: 0x0001, 0x23a7: 0x0001, 0x23a8: 0x0001, 0x23a9: 0x0003, + 0x23aa: 0x0001, 0x23ab: 0x0001, 0x23ac: 0x0001, 0x23ad: 0x0001, 0x23ae: 0x0001, 0x23af: 0x0001, + 0x23b0: 0x0001, 0x23b1: 0x0001, 0x23b2: 0x0001, 0x23b3: 0x0001, 0x23b4: 0x0001, 0x23b5: 0x0001, + 0x23b6: 0x0001, 0x23b7: 0x0001, 0x23b8: 0x0001, 0x23b9: 0x0001, 0x23ba: 0x0001, 0x23bb: 0x0001, + 0x23bc: 0x0001, 0x23bd: 0x0001, 0x23be: 0x0001, 0x23bf: 0x0001, + // Block 0x8f, offset 0x23c0 + 0x23c0: 0x0001, 0x23c1: 0x0001, 0x23c2: 0x0001, 0x23c3: 0x0001, 0x23c4: 0x0001, 0x23c5: 0x0001, + 0x23c6: 0x0001, 0x23c7: 0x0001, 0x23c8: 0x0001, 0x23c9: 0x0001, 0x23ca: 0x0001, 0x23cb: 0x0001, + 0x23cc: 0x0001, 0x23cd: 0x0001, 0x23ce: 0x0001, 0x23cf: 0x0001, 0x23d0: 0x000d, 0x23d1: 0x000d, + 0x23d2: 0x000d, 0x23d3: 0x000d, 0x23d4: 0x000d, 0x23d5: 0x000d, 0x23d6: 0x000d, 0x23d7: 0x000d, + 0x23d8: 0x000d, 0x23d9: 0x000d, 0x23da: 0x000d, 0x23db: 0x000d, 0x23dc: 0x000d, 0x23dd: 0x000d, + 0x23de: 0x000d, 0x23df: 0x000d, 0x23e0: 0x000d, 0x23e1: 0x000d, 0x23e2: 0x000d, 0x23e3: 0x000d, + 0x23e4: 0x000d, 0x23e5: 0x000d, 0x23e6: 0x000d, 0x23e7: 0x000d, 0x23e8: 0x000d, 0x23e9: 0x000d, + 0x23ea: 0x000d, 0x23eb: 0x000d, 0x23ec: 0x000d, 0x23ed: 0x000d, 0x23ee: 0x000d, 0x23ef: 0x000d, + 0x23f0: 0x000d, 0x23f1: 0x000d, 0x23f2: 0x000d, 0x23f3: 0x000d, 0x23f4: 0x000d, 0x23f5: 0x000d, + 0x23f6: 0x000d, 0x23f7: 0x000d, 0x23f8: 0x000d, 0x23f9: 0x000d, 0x23fa: 0x000d, 0x23fb: 0x000d, + 0x23fc: 0x000d, 0x23fd: 0x000d, 0x23fe: 0x000d, 0x23ff: 0x000d, + // Block 0x90, offset 0x2400 + 0x2400: 0x000d, 0x2401: 0x000d, 0x2402: 0x000d, 0x2403: 0x000d, 0x2404: 0x000d, 0x2405: 0x000d, + 0x2406: 0x000d, 0x2407: 0x000d, 0x2408: 0x000d, 0x2409: 0x000d, 0x240a: 0x000d, 0x240b: 0x000d, + 0x240c: 0x000d, 0x240d: 0x000d, 0x240e: 0x000d, 0x240f: 0x000d, 0x2410: 0x000d, 0x2411: 0x000d, + 0x2412: 0x000d, 0x2413: 0x000d, 0x2414: 0x000d, 0x2415: 0x000d, 0x2416: 0x000d, 0x2417: 0x000d, + 0x2418: 0x000d, 0x2419: 0x000d, 0x241a: 0x000d, 0x241b: 0x000d, 0x241c: 0x000d, 0x241d: 0x000d, + 0x241e: 0x000d, 0x241f: 0x000d, 0x2420: 0x000d, 0x2421: 0x000d, 0x2422: 0x000d, 0x2423: 0x000d, + 0x2424: 0x000d, 0x2425: 0x000d, 0x2426: 0x000d, 0x2427: 0x000d, 0x2428: 0x000d, 0x2429: 0x000d, + 0x242a: 0x000d, 0x242b: 0x000d, 0x242c: 0x000d, 0x242d: 0x000d, 0x242e: 0x000d, 0x242f: 0x000d, + 0x2430: 0x000d, 0x2431: 0x000d, 0x2432: 0x000d, 0x2433: 0x000d, 0x2434: 0x000d, 0x2435: 0x000d, + 0x2436: 0x000d, 0x2437: 0x000d, 0x2438: 0x000d, 0x2439: 0x000d, 0x243a: 0x000d, 0x243b: 0x000d, + 0x243c: 0x000d, 0x243d: 0x000d, 0x243e: 0x000a, 0x243f: 0x000a, + // Block 0x91, offset 0x2440 + 0x2440: 0x000d, 0x2441: 0x000d, 0x2442: 0x000d, 0x2443: 0x000d, 0x2444: 0x000d, 0x2445: 0x000d, + 0x2446: 0x000d, 0x2447: 0x000d, 0x2448: 0x000d, 0x2449: 0x000d, 0x244a: 0x000d, 0x244b: 0x000d, + 0x244c: 0x000d, 0x244d: 0x000d, 0x244e: 0x000d, 0x244f: 0x000d, 0x2450: 0x000b, 0x2451: 0x000b, + 0x2452: 0x000b, 0x2453: 0x000b, 0x2454: 0x000b, 0x2455: 0x000b, 0x2456: 0x000b, 0x2457: 0x000b, + 0x2458: 0x000b, 0x2459: 0x000b, 0x245a: 0x000b, 0x245b: 0x000b, 0x245c: 0x000b, 0x245d: 0x000b, + 0x245e: 0x000b, 0x245f: 0x000b, 0x2460: 0x000b, 0x2461: 0x000b, 0x2462: 0x000b, 0x2463: 0x000b, + 0x2464: 0x000b, 0x2465: 0x000b, 0x2466: 0x000b, 0x2467: 0x000b, 0x2468: 0x000b, 0x2469: 0x000b, + 0x246a: 0x000b, 0x246b: 0x000b, 0x246c: 0x000b, 0x246d: 0x000b, 0x246e: 0x000b, 0x246f: 0x000b, + 0x2470: 0x000d, 0x2471: 0x000d, 0x2472: 0x000d, 0x2473: 0x000d, 0x2474: 0x000d, 0x2475: 0x000d, + 0x2476: 0x000d, 0x2477: 0x000d, 0x2478: 0x000d, 0x2479: 0x000d, 0x247a: 0x000d, 0x247b: 0x000d, + 0x247c: 0x000d, 0x247d: 0x000a, 0x247e: 0x000d, 0x247f: 0x000d, + // Block 0x92, offset 0x2480 + 0x2480: 0x000c, 0x2481: 0x000c, 0x2482: 0x000c, 0x2483: 0x000c, 0x2484: 0x000c, 0x2485: 0x000c, + 0x2486: 0x000c, 0x2487: 0x000c, 0x2488: 0x000c, 0x2489: 0x000c, 0x248a: 0x000c, 0x248b: 0x000c, + 0x248c: 0x000c, 0x248d: 0x000c, 0x248e: 0x000c, 0x248f: 0x000c, 0x2490: 0x000a, 0x2491: 0x000a, + 0x2492: 0x000a, 0x2493: 0x000a, 0x2494: 0x000a, 0x2495: 0x000a, 0x2496: 0x000a, 0x2497: 0x000a, + 0x2498: 0x000a, 0x2499: 0x000a, + 0x24a0: 0x000c, 0x24a1: 0x000c, 0x24a2: 0x000c, 0x24a3: 0x000c, + 0x24a4: 0x000c, 0x24a5: 0x000c, 0x24a6: 0x000c, 0x24a7: 0x000c, 0x24a8: 0x000c, 0x24a9: 0x000c, + 0x24aa: 0x000c, 0x24ab: 0x000c, 0x24ac: 0x000c, 0x24ad: 0x000c, 0x24ae: 0x000c, 0x24af: 0x000c, + 0x24b0: 0x000a, 0x24b1: 0x000a, 0x24b2: 0x000a, 0x24b3: 0x000a, 0x24b4: 0x000a, 0x24b5: 0x000a, + 0x24b6: 0x000a, 0x24b7: 0x000a, 0x24b8: 0x000a, 0x24b9: 0x000a, 0x24ba: 0x000a, 0x24bb: 0x000a, + 0x24bc: 0x000a, 0x24bd: 0x000a, 0x24be: 0x000a, 0x24bf: 0x000a, + // Block 0x93, offset 0x24c0 + 0x24c0: 0x000a, 0x24c1: 0x000a, 0x24c2: 0x000a, 0x24c3: 0x000a, 0x24c4: 0x000a, 0x24c5: 0x000a, + 0x24c6: 0x000a, 0x24c7: 0x000a, 0x24c8: 0x000a, 0x24c9: 0x000a, 0x24ca: 0x000a, 0x24cb: 0x000a, + 0x24cc: 0x000a, 0x24cd: 0x000a, 0x24ce: 0x000a, 0x24cf: 0x000a, 0x24d0: 0x0006, 0x24d1: 0x000a, + 0x24d2: 0x0006, 0x24d4: 0x000a, 0x24d5: 0x0006, 0x24d6: 0x000a, 0x24d7: 0x000a, + 0x24d8: 0x000a, 0x24d9: 0x009a, 0x24da: 0x008a, 0x24db: 0x007a, 0x24dc: 0x006a, 0x24dd: 0x009a, + 0x24de: 0x008a, 0x24df: 0x0004, 0x24e0: 0x000a, 0x24e1: 0x000a, 0x24e2: 0x0003, 0x24e3: 0x0003, + 0x24e4: 0x000a, 0x24e5: 0x000a, 0x24e6: 0x000a, 0x24e8: 0x000a, 0x24e9: 0x0004, + 0x24ea: 0x0004, 0x24eb: 0x000a, + 0x24f0: 0x000d, 0x24f1: 0x000d, 0x24f2: 0x000d, 0x24f3: 0x000d, 0x24f4: 0x000d, 0x24f5: 0x000d, + 0x24f6: 0x000d, 0x24f7: 0x000d, 0x24f8: 0x000d, 0x24f9: 0x000d, 0x24fa: 0x000d, 0x24fb: 0x000d, + 0x24fc: 0x000d, 0x24fd: 0x000d, 0x24fe: 0x000d, 0x24ff: 0x000d, + // Block 0x94, offset 0x2500 + 0x2500: 0x000d, 0x2501: 0x000d, 0x2502: 0x000d, 0x2503: 0x000d, 0x2504: 0x000d, 0x2505: 0x000d, + 0x2506: 0x000d, 0x2507: 0x000d, 0x2508: 0x000d, 0x2509: 0x000d, 0x250a: 0x000d, 0x250b: 0x000d, + 0x250c: 0x000d, 0x250d: 0x000d, 0x250e: 0x000d, 0x250f: 0x000d, 0x2510: 0x000d, 0x2511: 0x000d, + 0x2512: 0x000d, 0x2513: 0x000d, 0x2514: 0x000d, 0x2515: 0x000d, 0x2516: 0x000d, 0x2517: 0x000d, + 0x2518: 0x000d, 0x2519: 0x000d, 0x251a: 0x000d, 0x251b: 0x000d, 0x251c: 0x000d, 0x251d: 0x000d, + 0x251e: 0x000d, 0x251f: 0x000d, 0x2520: 0x000d, 0x2521: 0x000d, 0x2522: 0x000d, 0x2523: 0x000d, + 0x2524: 0x000d, 0x2525: 0x000d, 0x2526: 0x000d, 0x2527: 0x000d, 0x2528: 0x000d, 0x2529: 0x000d, + 0x252a: 0x000d, 0x252b: 0x000d, 0x252c: 0x000d, 0x252d: 0x000d, 0x252e: 0x000d, 0x252f: 0x000d, + 0x2530: 0x000d, 0x2531: 0x000d, 0x2532: 0x000d, 0x2533: 0x000d, 0x2534: 0x000d, 0x2535: 0x000d, + 0x2536: 0x000d, 0x2537: 0x000d, 0x2538: 0x000d, 0x2539: 0x000d, 0x253a: 0x000d, 0x253b: 0x000d, + 0x253c: 0x000d, 0x253d: 0x000d, 0x253e: 0x000d, 0x253f: 0x000b, + // Block 0x95, offset 0x2540 + 0x2541: 0x000a, 0x2542: 0x000a, 0x2543: 0x0004, 0x2544: 0x0004, 0x2545: 0x0004, + 0x2546: 0x000a, 0x2547: 0x000a, 0x2548: 0x003a, 0x2549: 0x002a, 0x254a: 0x000a, 0x254b: 0x0003, + 0x254c: 0x0006, 0x254d: 0x0003, 0x254e: 0x0006, 0x254f: 0x0006, 0x2550: 0x0002, 0x2551: 0x0002, + 0x2552: 0x0002, 0x2553: 0x0002, 0x2554: 0x0002, 0x2555: 0x0002, 0x2556: 0x0002, 0x2557: 0x0002, + 0x2558: 0x0002, 0x2559: 0x0002, 0x255a: 0x0006, 0x255b: 0x000a, 0x255c: 0x000a, 0x255d: 0x000a, + 0x255e: 0x000a, 0x255f: 0x000a, 0x2560: 0x000a, + 0x257b: 0x005a, + 0x257c: 0x000a, 0x257d: 0x004a, 0x257e: 0x000a, 0x257f: 0x000a, + // Block 0x96, offset 0x2580 + 0x2580: 0x000a, + 0x259b: 0x005a, 0x259c: 0x000a, 0x259d: 0x004a, + 0x259e: 0x000a, 0x259f: 0x00fa, 0x25a0: 0x00ea, 0x25a1: 0x000a, 0x25a2: 0x003a, 0x25a3: 0x002a, + 0x25a4: 0x000a, 0x25a5: 0x000a, + // Block 0x97, offset 0x25c0 + 0x25e0: 0x0004, 0x25e1: 0x0004, 0x25e2: 0x000a, 0x25e3: 0x000a, + 0x25e4: 0x000a, 0x25e5: 0x0004, 0x25e6: 0x0004, 0x25e8: 0x000a, 0x25e9: 0x000a, + 0x25ea: 0x000a, 0x25eb: 0x000a, 0x25ec: 0x000a, 0x25ed: 0x000a, 0x25ee: 0x000a, + 0x25f0: 0x000b, 0x25f1: 0x000b, 0x25f2: 0x000b, 0x25f3: 0x000b, 0x25f4: 0x000b, 0x25f5: 0x000b, + 0x25f6: 0x000b, 0x25f7: 0x000b, 0x25f8: 0x000b, 0x25f9: 0x000a, 0x25fa: 0x000a, 0x25fb: 0x000a, + 0x25fc: 0x000a, 0x25fd: 0x000a, 0x25fe: 0x000b, 0x25ff: 0x000b, + // Block 0x98, offset 0x2600 + 0x2601: 0x000a, + // Block 0x99, offset 0x2640 + 0x2640: 0x000a, 0x2641: 0x000a, 0x2642: 0x000a, 0x2643: 0x000a, 0x2644: 0x000a, 0x2645: 0x000a, + 0x2646: 0x000a, 0x2647: 0x000a, 0x2648: 0x000a, 0x2649: 0x000a, 0x264a: 0x000a, 0x264b: 0x000a, + 0x264c: 0x000a, 0x2650: 0x000a, 0x2651: 0x000a, + 0x2652: 0x000a, 0x2653: 0x000a, 0x2654: 0x000a, 0x2655: 0x000a, 0x2656: 0x000a, 0x2657: 0x000a, + 0x2658: 0x000a, 0x2659: 0x000a, 0x265a: 0x000a, 0x265b: 0x000a, + 0x2660: 0x000a, + // Block 0x9a, offset 0x2680 + 0x26bd: 0x000c, + // Block 0x9b, offset 0x26c0 + 0x26e0: 0x000c, 0x26e1: 0x0002, 0x26e2: 0x0002, 0x26e3: 0x0002, + 0x26e4: 0x0002, 0x26e5: 0x0002, 0x26e6: 0x0002, 0x26e7: 0x0002, 0x26e8: 0x0002, 0x26e9: 0x0002, + 0x26ea: 0x0002, 0x26eb: 0x0002, 0x26ec: 0x0002, 0x26ed: 0x0002, 0x26ee: 0x0002, 0x26ef: 0x0002, + 0x26f0: 0x0002, 0x26f1: 0x0002, 0x26f2: 0x0002, 0x26f3: 0x0002, 0x26f4: 0x0002, 0x26f5: 0x0002, + 0x26f6: 0x0002, 0x26f7: 0x0002, 0x26f8: 0x0002, 0x26f9: 0x0002, 0x26fa: 0x0002, 0x26fb: 0x0002, + // Block 0x9c, offset 0x2700 + 0x2736: 0x000c, 0x2737: 0x000c, 0x2738: 0x000c, 0x2739: 0x000c, 0x273a: 0x000c, + // Block 0x9d, offset 0x2740 + 0x2740: 0x0001, 0x2741: 0x0001, 0x2742: 0x0001, 0x2743: 0x0001, 0x2744: 0x0001, 0x2745: 0x0001, + 0x2746: 0x0001, 0x2747: 0x0001, 0x2748: 0x0001, 0x2749: 0x0001, 0x274a: 0x0001, 0x274b: 0x0001, + 0x274c: 0x0001, 0x274d: 0x0001, 0x274e: 0x0001, 0x274f: 0x0001, 0x2750: 0x0001, 0x2751: 0x0001, + 0x2752: 0x0001, 0x2753: 0x0001, 0x2754: 0x0001, 0x2755: 0x0001, 0x2756: 0x0001, 0x2757: 0x0001, + 0x2758: 0x0001, 0x2759: 0x0001, 0x275a: 0x0001, 0x275b: 0x0001, 0x275c: 0x0001, 0x275d: 0x0001, + 0x275e: 0x0001, 0x275f: 0x0001, 0x2760: 0x0001, 0x2761: 0x0001, 0x2762: 0x0001, 0x2763: 0x0001, + 0x2764: 0x0001, 0x2765: 0x0001, 0x2766: 0x0001, 0x2767: 0x0001, 0x2768: 0x0001, 0x2769: 0x0001, + 0x276a: 0x0001, 0x276b: 0x0001, 0x276c: 0x0001, 0x276d: 0x0001, 0x276e: 0x0001, 0x276f: 0x0001, + 0x2770: 0x0001, 0x2771: 0x0001, 0x2772: 0x0001, 0x2773: 0x0001, 0x2774: 0x0001, 0x2775: 0x0001, + 0x2776: 0x0001, 0x2777: 0x0001, 0x2778: 0x0001, 0x2779: 0x0001, 0x277a: 0x0001, 0x277b: 0x0001, + 0x277c: 0x0001, 0x277d: 0x0001, 0x277e: 0x0001, 0x277f: 0x0001, + // Block 0x9e, offset 0x2780 + 0x2780: 0x0001, 0x2781: 0x0001, 0x2782: 0x0001, 0x2783: 0x0001, 0x2784: 0x0001, 0x2785: 0x0001, + 0x2786: 0x0001, 0x2787: 0x0001, 0x2788: 0x0001, 0x2789: 0x0001, 0x278a: 0x0001, 0x278b: 0x0001, + 0x278c: 0x0001, 0x278d: 0x0001, 0x278e: 0x0001, 0x278f: 0x0001, 0x2790: 0x0001, 0x2791: 0x0001, + 0x2792: 0x0001, 0x2793: 0x0001, 0x2794: 0x0001, 0x2795: 0x0001, 0x2796: 0x0001, 0x2797: 0x0001, + 0x2798: 0x0001, 0x2799: 0x0001, 0x279a: 0x0001, 0x279b: 0x0001, 0x279c: 0x0001, 0x279d: 0x0001, + 0x279e: 0x0001, 0x279f: 0x000a, 0x27a0: 0x0001, 0x27a1: 0x0001, 0x27a2: 0x0001, 0x27a3: 0x0001, + 0x27a4: 0x0001, 0x27a5: 0x0001, 0x27a6: 0x0001, 0x27a7: 0x0001, 0x27a8: 0x0001, 0x27a9: 0x0001, + 0x27aa: 0x0001, 0x27ab: 0x0001, 0x27ac: 0x0001, 0x27ad: 0x0001, 0x27ae: 0x0001, 0x27af: 0x0001, + 0x27b0: 0x0001, 0x27b1: 0x0001, 0x27b2: 0x0001, 0x27b3: 0x0001, 0x27b4: 0x0001, 0x27b5: 0x0001, + 0x27b6: 0x0001, 0x27b7: 0x0001, 0x27b8: 0x0001, 0x27b9: 0x0001, 0x27ba: 0x0001, 0x27bb: 0x0001, + 0x27bc: 0x0001, 0x27bd: 0x0001, 0x27be: 0x0001, 0x27bf: 0x0001, + // Block 0x9f, offset 0x27c0 + 0x27c0: 0x0001, 0x27c1: 0x000c, 0x27c2: 0x000c, 0x27c3: 0x000c, 0x27c4: 0x0001, 0x27c5: 0x000c, + 0x27c6: 0x000c, 0x27c7: 0x0001, 0x27c8: 0x0001, 0x27c9: 0x0001, 0x27ca: 0x0001, 0x27cb: 0x0001, + 0x27cc: 0x000c, 0x27cd: 0x000c, 0x27ce: 0x000c, 0x27cf: 0x000c, 0x27d0: 0x0001, 0x27d1: 0x0001, + 0x27d2: 0x0001, 0x27d3: 0x0001, 0x27d4: 0x0001, 0x27d5: 0x0001, 0x27d6: 0x0001, 0x27d7: 0x0001, + 0x27d8: 0x0001, 0x27d9: 0x0001, 0x27da: 0x0001, 0x27db: 0x0001, 0x27dc: 0x0001, 0x27dd: 0x0001, + 0x27de: 0x0001, 0x27df: 0x0001, 0x27e0: 0x0001, 0x27e1: 0x0001, 0x27e2: 0x0001, 0x27e3: 0x0001, + 0x27e4: 0x0001, 0x27e5: 0x0001, 0x27e6: 0x0001, 0x27e7: 0x0001, 0x27e8: 0x0001, 0x27e9: 0x0001, + 0x27ea: 0x0001, 0x27eb: 0x0001, 0x27ec: 0x0001, 0x27ed: 0x0001, 0x27ee: 0x0001, 0x27ef: 0x0001, + 0x27f0: 0x0001, 0x27f1: 0x0001, 0x27f2: 0x0001, 0x27f3: 0x0001, 0x27f4: 0x0001, 0x27f5: 0x0001, + 0x27f6: 0x0001, 0x27f7: 0x0001, 0x27f8: 0x000c, 0x27f9: 0x000c, 0x27fa: 0x000c, 0x27fb: 0x0001, + 0x27fc: 0x0001, 0x27fd: 0x0001, 0x27fe: 0x0001, 0x27ff: 0x000c, + // Block 0xa0, offset 0x2800 + 0x2800: 0x0001, 0x2801: 0x0001, 0x2802: 0x0001, 0x2803: 0x0001, 0x2804: 0x0001, 0x2805: 0x0001, + 0x2806: 0x0001, 0x2807: 0x0001, 0x2808: 0x0001, 0x2809: 0x0001, 0x280a: 0x0001, 0x280b: 0x0001, + 0x280c: 0x0001, 0x280d: 0x0001, 0x280e: 0x0001, 0x280f: 0x0001, 0x2810: 0x0001, 0x2811: 0x0001, + 0x2812: 0x0001, 0x2813: 0x0001, 0x2814: 0x0001, 0x2815: 0x0001, 0x2816: 0x0001, 0x2817: 0x0001, + 0x2818: 0x0001, 0x2819: 0x0001, 0x281a: 0x0001, 0x281b: 0x0001, 0x281c: 0x0001, 0x281d: 0x0001, + 0x281e: 0x0001, 0x281f: 0x0001, 0x2820: 0x0001, 0x2821: 0x0001, 0x2822: 0x0001, 0x2823: 0x0001, + 0x2824: 0x0001, 0x2825: 0x000c, 0x2826: 0x000c, 0x2827: 0x0001, 0x2828: 0x0001, 0x2829: 0x0001, + 0x282a: 0x0001, 0x282b: 0x0001, 0x282c: 0x0001, 0x282d: 0x0001, 0x282e: 0x0001, 0x282f: 0x0001, + 0x2830: 0x0001, 0x2831: 0x0001, 0x2832: 0x0001, 0x2833: 0x0001, 0x2834: 0x0001, 0x2835: 0x0001, + 0x2836: 0x0001, 0x2837: 0x0001, 0x2838: 0x0001, 0x2839: 0x0001, 0x283a: 0x0001, 0x283b: 0x0001, + 0x283c: 0x0001, 0x283d: 0x0001, 0x283e: 0x0001, 0x283f: 0x0001, + // Block 0xa1, offset 0x2840 + 0x2840: 0x0001, 0x2841: 0x0001, 0x2842: 0x0001, 0x2843: 0x0001, 0x2844: 0x0001, 0x2845: 0x0001, + 0x2846: 0x0001, 0x2847: 0x0001, 0x2848: 0x0001, 0x2849: 0x0001, 0x284a: 0x0001, 0x284b: 0x0001, + 0x284c: 0x0001, 0x284d: 0x0001, 0x284e: 0x0001, 0x284f: 0x0001, 0x2850: 0x0001, 0x2851: 0x0001, + 0x2852: 0x0001, 0x2853: 0x0001, 0x2854: 0x0001, 0x2855: 0x0001, 0x2856: 0x0001, 0x2857: 0x0001, + 0x2858: 0x0001, 0x2859: 0x0001, 0x285a: 0x0001, 0x285b: 0x0001, 0x285c: 0x0001, 0x285d: 0x0001, + 0x285e: 0x0001, 0x285f: 0x0001, 0x2860: 0x0001, 0x2861: 0x0001, 0x2862: 0x0001, 0x2863: 0x0001, + 0x2864: 0x0001, 0x2865: 0x0001, 0x2866: 0x0001, 0x2867: 0x0001, 0x2868: 0x0001, 0x2869: 0x0001, + 0x286a: 0x0001, 0x286b: 0x0001, 0x286c: 0x0001, 0x286d: 0x0001, 0x286e: 0x0001, 0x286f: 0x0001, + 0x2870: 0x0001, 0x2871: 0x0001, 0x2872: 0x0001, 0x2873: 0x0001, 0x2874: 0x0001, 0x2875: 0x0001, + 0x2876: 0x0001, 0x2877: 0x0001, 0x2878: 0x0001, 0x2879: 0x000a, 0x287a: 0x000a, 0x287b: 0x000a, + 0x287c: 0x000a, 0x287d: 0x000a, 0x287e: 0x000a, 0x287f: 0x000a, + // Block 0xa2, offset 0x2880 + 0x2880: 0x0001, 0x2881: 0x0001, 0x2882: 0x0001, 0x2883: 0x0001, 0x2884: 0x0001, 0x2885: 0x0001, + 0x2886: 0x0001, 0x2887: 0x0001, 0x2888: 0x0001, 0x2889: 0x0001, 0x288a: 0x0001, 0x288b: 0x0001, + 0x288c: 0x0001, 0x288d: 0x0001, 0x288e: 0x0001, 0x288f: 0x0001, 0x2890: 0x0001, 0x2891: 0x0001, + 0x2892: 0x0001, 0x2893: 0x0001, 0x2894: 0x0001, 0x2895: 0x0001, 0x2896: 0x0001, 0x2897: 0x0001, + 0x2898: 0x0001, 0x2899: 0x0001, 0x289a: 0x0001, 0x289b: 0x0001, 0x289c: 0x0001, 0x289d: 0x0001, + 0x289e: 0x0001, 0x289f: 0x0001, 0x28a0: 0x0005, 0x28a1: 0x0005, 0x28a2: 0x0005, 0x28a3: 0x0005, + 0x28a4: 0x0005, 0x28a5: 0x0005, 0x28a6: 0x0005, 0x28a7: 0x0005, 0x28a8: 0x0005, 0x28a9: 0x0005, + 0x28aa: 0x0005, 0x28ab: 0x0005, 0x28ac: 0x0005, 0x28ad: 0x0005, 0x28ae: 0x0005, 0x28af: 0x0005, + 0x28b0: 0x0005, 0x28b1: 0x0005, 0x28b2: 0x0005, 0x28b3: 0x0005, 0x28b4: 0x0005, 0x28b5: 0x0005, + 0x28b6: 0x0005, 0x28b7: 0x0005, 0x28b8: 0x0005, 0x28b9: 0x0005, 0x28ba: 0x0005, 0x28bb: 0x0005, + 0x28bc: 0x0005, 0x28bd: 0x0005, 0x28be: 0x0005, 0x28bf: 0x0001, + // Block 0xa3, offset 0x28c0 + 0x28c1: 0x000c, + 0x28f8: 0x000c, 0x28f9: 0x000c, 0x28fa: 0x000c, 0x28fb: 0x000c, + 0x28fc: 0x000c, 0x28fd: 0x000c, 0x28fe: 0x000c, 0x28ff: 0x000c, + // Block 0xa4, offset 0x2900 + 0x2900: 0x000c, 0x2901: 0x000c, 0x2902: 0x000c, 0x2903: 0x000c, 0x2904: 0x000c, 0x2905: 0x000c, + 0x2906: 0x000c, + 0x2912: 0x000a, 0x2913: 0x000a, 0x2914: 0x000a, 0x2915: 0x000a, 0x2916: 0x000a, 0x2917: 0x000a, + 0x2918: 0x000a, 0x2919: 0x000a, 0x291a: 0x000a, 0x291b: 0x000a, 0x291c: 0x000a, 0x291d: 0x000a, + 0x291e: 0x000a, 0x291f: 0x000a, 0x2920: 0x000a, 0x2921: 0x000a, 0x2922: 0x000a, 0x2923: 0x000a, + 0x2924: 0x000a, 0x2925: 0x000a, + 0x293f: 0x000c, + // Block 0xa5, offset 0x2940 + 0x2940: 0x000c, 0x2941: 0x000c, + 0x2973: 0x000c, 0x2974: 0x000c, 0x2975: 0x000c, + 0x2976: 0x000c, 0x2979: 0x000c, 0x297a: 0x000c, + // Block 0xa6, offset 0x2980 + 0x2980: 0x000c, 0x2981: 0x000c, 0x2982: 0x000c, + 0x29a7: 0x000c, 0x29a8: 0x000c, 0x29a9: 0x000c, + 0x29aa: 0x000c, 0x29ab: 0x000c, 0x29ad: 0x000c, 0x29ae: 0x000c, 0x29af: 0x000c, + 0x29b0: 0x000c, 0x29b1: 0x000c, 0x29b2: 0x000c, 0x29b3: 0x000c, 0x29b4: 0x000c, + // Block 0xa7, offset 0x29c0 + 0x29f3: 0x000c, + // Block 0xa8, offset 0x2a00 + 0x2a00: 0x000c, 0x2a01: 0x000c, + 0x2a36: 0x000c, 0x2a37: 0x000c, 0x2a38: 0x000c, 0x2a39: 0x000c, 0x2a3a: 0x000c, 0x2a3b: 0x000c, + 0x2a3c: 0x000c, 0x2a3d: 0x000c, 0x2a3e: 0x000c, + // Block 0xa9, offset 0x2a40 + 0x2a4a: 0x000c, 0x2a4b: 0x000c, + 0x2a4c: 0x000c, + // Block 0xaa, offset 0x2a80 + 0x2aaf: 0x000c, + 0x2ab0: 0x000c, 0x2ab1: 0x000c, 0x2ab4: 0x000c, + 0x2ab6: 0x000c, 0x2ab7: 0x000c, + 0x2abe: 0x000c, + // Block 0xab, offset 0x2ac0 + 0x2adf: 0x000c, 0x2ae3: 0x000c, + 0x2ae4: 0x000c, 0x2ae5: 0x000c, 0x2ae6: 0x000c, 0x2ae7: 0x000c, 0x2ae8: 0x000c, 0x2ae9: 0x000c, + 0x2aea: 0x000c, + // Block 0xac, offset 0x2b00 + 0x2b00: 0x000c, 0x2b01: 0x000c, + 0x2b3c: 0x000c, + // Block 0xad, offset 0x2b40 + 0x2b40: 0x000c, + 0x2b66: 0x000c, 0x2b67: 0x000c, 0x2b68: 0x000c, 0x2b69: 0x000c, + 0x2b6a: 0x000c, 0x2b6b: 0x000c, 0x2b6c: 0x000c, + 0x2b70: 0x000c, 0x2b71: 0x000c, 0x2b72: 0x000c, 0x2b73: 0x000c, 0x2b74: 0x000c, + // Block 0xae, offset 0x2b80 + 0x2bb8: 0x000c, 0x2bb9: 0x000c, 0x2bba: 0x000c, 0x2bbb: 0x000c, + 0x2bbc: 0x000c, 0x2bbd: 0x000c, 0x2bbe: 0x000c, 0x2bbf: 0x000c, + // Block 0xaf, offset 0x2bc0 + 0x2bc2: 0x000c, 0x2bc3: 0x000c, 0x2bc4: 0x000c, + 0x2bc6: 0x000c, + // Block 0xb0, offset 0x2c00 + 0x2c33: 0x000c, 0x2c34: 0x000c, 0x2c35: 0x000c, + 0x2c36: 0x000c, 0x2c37: 0x000c, 0x2c38: 0x000c, 0x2c3a: 0x000c, + 0x2c3f: 0x000c, + // Block 0xb1, offset 0x2c40 + 0x2c40: 0x000c, 0x2c42: 0x000c, 0x2c43: 0x000c, + // Block 0xb2, offset 0x2c80 + 0x2cb2: 0x000c, 0x2cb3: 0x000c, 0x2cb4: 0x000c, 0x2cb5: 0x000c, + 0x2cbc: 0x000c, 0x2cbd: 0x000c, 0x2cbf: 0x000c, + // Block 0xb3, offset 0x2cc0 + 0x2cc0: 0x000c, + 0x2cdc: 0x000c, 0x2cdd: 0x000c, + // Block 0xb4, offset 0x2d00 + 0x2d33: 0x000c, 0x2d34: 0x000c, 0x2d35: 0x000c, + 0x2d36: 0x000c, 0x2d37: 0x000c, 0x2d38: 0x000c, 0x2d39: 0x000c, 0x2d3a: 0x000c, + 0x2d3d: 0x000c, 0x2d3f: 0x000c, + // Block 0xb5, offset 0x2d40 + 0x2d40: 0x000c, + 0x2d60: 0x000a, 0x2d61: 0x000a, 0x2d62: 0x000a, 0x2d63: 0x000a, + 0x2d64: 0x000a, 0x2d65: 0x000a, 0x2d66: 0x000a, 0x2d67: 0x000a, 0x2d68: 0x000a, 0x2d69: 0x000a, + 0x2d6a: 0x000a, 0x2d6b: 0x000a, 0x2d6c: 0x000a, + // Block 0xb6, offset 0x2d80 + 0x2dab: 0x000c, 0x2dad: 0x000c, + 0x2db0: 0x000c, 0x2db1: 0x000c, 0x2db2: 0x000c, 0x2db3: 0x000c, 0x2db4: 0x000c, 0x2db5: 0x000c, + 0x2db7: 0x000c, + // Block 0xb7, offset 0x2dc0 + 0x2ddd: 0x000c, + 0x2dde: 0x000c, 0x2ddf: 0x000c, 0x2de2: 0x000c, 0x2de3: 0x000c, + 0x2de4: 0x000c, 0x2de5: 0x000c, 0x2de7: 0x000c, 0x2de8: 0x000c, 0x2de9: 0x000c, + 0x2dea: 0x000c, 0x2deb: 0x000c, + // Block 0xb8, offset 0x2e00 + 0x2e30: 0x000c, 0x2e31: 0x000c, 0x2e32: 0x000c, 0x2e33: 0x000c, 0x2e34: 0x000c, 0x2e35: 0x000c, + 0x2e36: 0x000c, 0x2e38: 0x000c, 0x2e39: 0x000c, 0x2e3a: 0x000c, 0x2e3b: 0x000c, + 0x2e3c: 0x000c, 0x2e3d: 0x000c, + // Block 0xb9, offset 0x2e40 + 0x2e52: 0x000c, 0x2e53: 0x000c, 0x2e54: 0x000c, 0x2e55: 0x000c, 0x2e56: 0x000c, 0x2e57: 0x000c, + 0x2e58: 0x000c, 0x2e59: 0x000c, 0x2e5a: 0x000c, 0x2e5b: 0x000c, 0x2e5c: 0x000c, 0x2e5d: 0x000c, + 0x2e5e: 0x000c, 0x2e5f: 0x000c, 0x2e60: 0x000c, 0x2e61: 0x000c, 0x2e62: 0x000c, 0x2e63: 0x000c, + 0x2e64: 0x000c, 0x2e65: 0x000c, 0x2e66: 0x000c, 0x2e67: 0x000c, + 0x2e6a: 0x000c, 0x2e6b: 0x000c, 0x2e6c: 0x000c, 0x2e6d: 0x000c, 0x2e6e: 0x000c, 0x2e6f: 0x000c, + 0x2e70: 0x000c, 0x2e72: 0x000c, 0x2e73: 0x000c, 0x2e75: 0x000c, + 0x2e76: 0x000c, + // Block 0xba, offset 0x2e80 + 0x2eb0: 0x000c, 0x2eb1: 0x000c, 0x2eb2: 0x000c, 0x2eb3: 0x000c, 0x2eb4: 0x000c, + // Block 0xbb, offset 0x2ec0 + 0x2ef0: 0x000c, 0x2ef1: 0x000c, 0x2ef2: 0x000c, 0x2ef3: 0x000c, 0x2ef4: 0x000c, 0x2ef5: 0x000c, + 0x2ef6: 0x000c, + // Block 0xbc, offset 0x2f00 + 0x2f0f: 0x000c, 0x2f10: 0x000c, 0x2f11: 0x000c, + 0x2f12: 0x000c, + // Block 0xbd, offset 0x2f40 + 0x2f5d: 0x000c, + 0x2f5e: 0x000c, 0x2f60: 0x000b, 0x2f61: 0x000b, 0x2f62: 0x000b, 0x2f63: 0x000b, + // Block 0xbe, offset 0x2f80 + 0x2fa7: 0x000c, 0x2fa8: 0x000c, 0x2fa9: 0x000c, + 0x2fb3: 0x000b, 0x2fb4: 0x000b, 0x2fb5: 0x000b, + 0x2fb6: 0x000b, 0x2fb7: 0x000b, 0x2fb8: 0x000b, 0x2fb9: 0x000b, 0x2fba: 0x000b, 0x2fbb: 0x000c, + 0x2fbc: 0x000c, 0x2fbd: 0x000c, 0x2fbe: 0x000c, 0x2fbf: 0x000c, + // Block 0xbf, offset 0x2fc0 + 0x2fc0: 0x000c, 0x2fc1: 0x000c, 0x2fc2: 0x000c, 0x2fc5: 0x000c, + 0x2fc6: 0x000c, 0x2fc7: 0x000c, 0x2fc8: 0x000c, 0x2fc9: 0x000c, 0x2fca: 0x000c, 0x2fcb: 0x000c, + 0x2fea: 0x000c, 0x2feb: 0x000c, 0x2fec: 0x000c, 0x2fed: 0x000c, + // Block 0xc0, offset 0x3000 + 0x3000: 0x000a, 0x3001: 0x000a, 0x3002: 0x000c, 0x3003: 0x000c, 0x3004: 0x000c, 0x3005: 0x000a, + // Block 0xc1, offset 0x3040 + 0x3040: 0x000a, 0x3041: 0x000a, 0x3042: 0x000a, 0x3043: 0x000a, 0x3044: 0x000a, 0x3045: 0x000a, + 0x3046: 0x000a, 0x3047: 0x000a, 0x3048: 0x000a, 0x3049: 0x000a, 0x304a: 0x000a, 0x304b: 0x000a, + 0x304c: 0x000a, 0x304d: 0x000a, 0x304e: 0x000a, 0x304f: 0x000a, 0x3050: 0x000a, 0x3051: 0x000a, + 0x3052: 0x000a, 0x3053: 0x000a, 0x3054: 0x000a, 0x3055: 0x000a, 0x3056: 0x000a, + // Block 0xc2, offset 0x3080 + 0x309b: 0x000a, + // Block 0xc3, offset 0x30c0 + 0x30d5: 0x000a, + // Block 0xc4, offset 0x3100 + 0x310f: 0x000a, + // Block 0xc5, offset 0x3140 + 0x3149: 0x000a, + // Block 0xc6, offset 0x3180 + 0x3183: 0x000a, + 0x318e: 0x0002, 0x318f: 0x0002, 0x3190: 0x0002, 0x3191: 0x0002, + 0x3192: 0x0002, 0x3193: 0x0002, 0x3194: 0x0002, 0x3195: 0x0002, 0x3196: 0x0002, 0x3197: 0x0002, + 0x3198: 0x0002, 0x3199: 0x0002, 0x319a: 0x0002, 0x319b: 0x0002, 0x319c: 0x0002, 0x319d: 0x0002, + 0x319e: 0x0002, 0x319f: 0x0002, 0x31a0: 0x0002, 0x31a1: 0x0002, 0x31a2: 0x0002, 0x31a3: 0x0002, + 0x31a4: 0x0002, 0x31a5: 0x0002, 0x31a6: 0x0002, 0x31a7: 0x0002, 0x31a8: 0x0002, 0x31a9: 0x0002, + 0x31aa: 0x0002, 0x31ab: 0x0002, 0x31ac: 0x0002, 0x31ad: 0x0002, 0x31ae: 0x0002, 0x31af: 0x0002, + 0x31b0: 0x0002, 0x31b1: 0x0002, 0x31b2: 0x0002, 0x31b3: 0x0002, 0x31b4: 0x0002, 0x31b5: 0x0002, + 0x31b6: 0x0002, 0x31b7: 0x0002, 0x31b8: 0x0002, 0x31b9: 0x0002, 0x31ba: 0x0002, 0x31bb: 0x0002, + 0x31bc: 0x0002, 0x31bd: 0x0002, 0x31be: 0x0002, 0x31bf: 0x0002, + // Block 0xc7, offset 0x31c0 + 0x31c0: 0x000c, 0x31c1: 0x000c, 0x31c2: 0x000c, 0x31c3: 0x000c, 0x31c4: 0x000c, 0x31c5: 0x000c, + 0x31c6: 0x000c, 0x31c7: 0x000c, 0x31c8: 0x000c, 0x31c9: 0x000c, 0x31ca: 0x000c, 0x31cb: 0x000c, + 0x31cc: 0x000c, 0x31cd: 0x000c, 0x31ce: 0x000c, 0x31cf: 0x000c, 0x31d0: 0x000c, 0x31d1: 0x000c, + 0x31d2: 0x000c, 0x31d3: 0x000c, 0x31d4: 0x000c, 0x31d5: 0x000c, 0x31d6: 0x000c, 0x31d7: 0x000c, + 0x31d8: 0x000c, 0x31d9: 0x000c, 0x31da: 0x000c, 0x31db: 0x000c, 0x31dc: 0x000c, 0x31dd: 0x000c, + 0x31de: 0x000c, 0x31df: 0x000c, 0x31e0: 0x000c, 0x31e1: 0x000c, 0x31e2: 0x000c, 0x31e3: 0x000c, + 0x31e4: 0x000c, 0x31e5: 0x000c, 0x31e6: 0x000c, 0x31e7: 0x000c, 0x31e8: 0x000c, 0x31e9: 0x000c, + 0x31ea: 0x000c, 0x31eb: 0x000c, 0x31ec: 0x000c, 0x31ed: 0x000c, 0x31ee: 0x000c, 0x31ef: 0x000c, + 0x31f0: 0x000c, 0x31f1: 0x000c, 0x31f2: 0x000c, 0x31f3: 0x000c, 0x31f4: 0x000c, 0x31f5: 0x000c, + 0x31f6: 0x000c, 0x31fb: 0x000c, + 0x31fc: 0x000c, 0x31fd: 0x000c, 0x31fe: 0x000c, 0x31ff: 0x000c, + // Block 0xc8, offset 0x3200 + 0x3200: 0x000c, 0x3201: 0x000c, 0x3202: 0x000c, 0x3203: 0x000c, 0x3204: 0x000c, 0x3205: 0x000c, + 0x3206: 0x000c, 0x3207: 0x000c, 0x3208: 0x000c, 0x3209: 0x000c, 0x320a: 0x000c, 0x320b: 0x000c, + 0x320c: 0x000c, 0x320d: 0x000c, 0x320e: 0x000c, 0x320f: 0x000c, 0x3210: 0x000c, 0x3211: 0x000c, + 0x3212: 0x000c, 0x3213: 0x000c, 0x3214: 0x000c, 0x3215: 0x000c, 0x3216: 0x000c, 0x3217: 0x000c, + 0x3218: 0x000c, 0x3219: 0x000c, 0x321a: 0x000c, 0x321b: 0x000c, 0x321c: 0x000c, 0x321d: 0x000c, + 0x321e: 0x000c, 0x321f: 0x000c, 0x3220: 0x000c, 0x3221: 0x000c, 0x3222: 0x000c, 0x3223: 0x000c, + 0x3224: 0x000c, 0x3225: 0x000c, 0x3226: 0x000c, 0x3227: 0x000c, 0x3228: 0x000c, 0x3229: 0x000c, + 0x322a: 0x000c, 0x322b: 0x000c, 0x322c: 0x000c, + 0x3235: 0x000c, + // Block 0xc9, offset 0x3240 + 0x3244: 0x000c, + 0x325b: 0x000c, 0x325c: 0x000c, 0x325d: 0x000c, + 0x325e: 0x000c, 0x325f: 0x000c, 0x3261: 0x000c, 0x3262: 0x000c, 0x3263: 0x000c, + 0x3264: 0x000c, 0x3265: 0x000c, 0x3266: 0x000c, 0x3267: 0x000c, 0x3268: 0x000c, 0x3269: 0x000c, + 0x326a: 0x000c, 0x326b: 0x000c, 0x326c: 0x000c, 0x326d: 0x000c, 0x326e: 0x000c, 0x326f: 0x000c, + // Block 0xca, offset 0x3280 + 0x3280: 0x000c, 0x3281: 0x000c, 0x3282: 0x000c, 0x3283: 0x000c, 0x3284: 0x000c, 0x3285: 0x000c, + 0x3286: 0x000c, 0x3288: 0x000c, 0x3289: 0x000c, 0x328a: 0x000c, 0x328b: 0x000c, + 0x328c: 0x000c, 0x328d: 0x000c, 0x328e: 0x000c, 0x328f: 0x000c, 0x3290: 0x000c, 0x3291: 0x000c, + 0x3292: 0x000c, 0x3293: 0x000c, 0x3294: 0x000c, 0x3295: 0x000c, 0x3296: 0x000c, 0x3297: 0x000c, + 0x3298: 0x000c, 0x329b: 0x000c, 0x329c: 0x000c, 0x329d: 0x000c, + 0x329e: 0x000c, 0x329f: 0x000c, 0x32a0: 0x000c, 0x32a1: 0x000c, 0x32a3: 0x000c, + 0x32a4: 0x000c, 0x32a6: 0x000c, 0x32a7: 0x000c, 0x32a8: 0x000c, 0x32a9: 0x000c, + 0x32aa: 0x000c, + // Block 0xcb, offset 0x32c0 + 0x32c0: 0x0001, 0x32c1: 0x0001, 0x32c2: 0x0001, 0x32c3: 0x0001, 0x32c4: 0x0001, 0x32c5: 0x0001, + 0x32c6: 0x0001, 0x32c7: 0x0001, 0x32c8: 0x0001, 0x32c9: 0x0001, 0x32ca: 0x0001, 0x32cb: 0x0001, + 0x32cc: 0x0001, 0x32cd: 0x0001, 0x32ce: 0x0001, 0x32cf: 0x0001, 0x32d0: 0x000c, 0x32d1: 0x000c, + 0x32d2: 0x000c, 0x32d3: 0x000c, 0x32d4: 0x000c, 0x32d5: 0x000c, 0x32d6: 0x000c, 0x32d7: 0x0001, + 0x32d8: 0x0001, 0x32d9: 0x0001, 0x32da: 0x0001, 0x32db: 0x0001, 0x32dc: 0x0001, 0x32dd: 0x0001, + 0x32de: 0x0001, 0x32df: 0x0001, 0x32e0: 0x0001, 0x32e1: 0x0001, 0x32e2: 0x0001, 0x32e3: 0x0001, + 0x32e4: 0x0001, 0x32e5: 0x0001, 0x32e6: 0x0001, 0x32e7: 0x0001, 0x32e8: 0x0001, 0x32e9: 0x0001, + 0x32ea: 0x0001, 0x32eb: 0x0001, 0x32ec: 0x0001, 0x32ed: 0x0001, 0x32ee: 0x0001, 0x32ef: 0x0001, + 0x32f0: 0x0001, 0x32f1: 0x0001, 0x32f2: 0x0001, 0x32f3: 0x0001, 0x32f4: 0x0001, 0x32f5: 0x0001, + 0x32f6: 0x0001, 0x32f7: 0x0001, 0x32f8: 0x0001, 0x32f9: 0x0001, 0x32fa: 0x0001, 0x32fb: 0x0001, + 0x32fc: 0x0001, 0x32fd: 0x0001, 0x32fe: 0x0001, 0x32ff: 0x0001, + // Block 0xcc, offset 0x3300 + 0x3300: 0x0001, 0x3301: 0x0001, 0x3302: 0x0001, 0x3303: 0x0001, 0x3304: 0x000c, 0x3305: 0x000c, + 0x3306: 0x000c, 0x3307: 0x000c, 0x3308: 0x000c, 0x3309: 0x000c, 0x330a: 0x000c, 0x330b: 0x0001, + 0x330c: 0x0001, 0x330d: 0x0001, 0x330e: 0x0001, 0x330f: 0x0001, 0x3310: 0x0001, 0x3311: 0x0001, + 0x3312: 0x0001, 0x3313: 0x0001, 0x3314: 0x0001, 0x3315: 0x0001, 0x3316: 0x0001, 0x3317: 0x0001, + 0x3318: 0x0001, 0x3319: 0x0001, 0x331a: 0x0001, 0x331b: 0x0001, 0x331c: 0x0001, 0x331d: 0x0001, + 0x331e: 0x0001, 0x331f: 0x0001, 0x3320: 0x0001, 0x3321: 0x0001, 0x3322: 0x0001, 0x3323: 0x0001, + 0x3324: 0x0001, 0x3325: 0x0001, 0x3326: 0x0001, 0x3327: 0x0001, 0x3328: 0x0001, 0x3329: 0x0001, + 0x332a: 0x0001, 0x332b: 0x0001, 0x332c: 0x0001, 0x332d: 0x0001, 0x332e: 0x0001, 0x332f: 0x0001, + 0x3330: 0x0001, 0x3331: 0x0001, 0x3332: 0x0001, 0x3333: 0x0001, 0x3334: 0x0001, 0x3335: 0x0001, + 0x3336: 0x0001, 0x3337: 0x0001, 0x3338: 0x0001, 0x3339: 0x0001, 0x333a: 0x0001, 0x333b: 0x0001, + 0x333c: 0x0001, 0x333d: 0x0001, 0x333e: 0x0001, 0x333f: 0x0001, + // Block 0xcd, offset 0x3340 + 0x3340: 0x000d, 0x3341: 0x000d, 0x3342: 0x000d, 0x3343: 0x000d, 0x3344: 0x000d, 0x3345: 0x000d, + 0x3346: 0x000d, 0x3347: 0x000d, 0x3348: 0x000d, 0x3349: 0x000d, 0x334a: 0x000d, 0x334b: 0x000d, + 0x334c: 0x000d, 0x334d: 0x000d, 0x334e: 0x000d, 0x334f: 0x000d, 0x3350: 0x000d, 0x3351: 0x000d, + 0x3352: 0x000d, 0x3353: 0x000d, 0x3354: 0x000d, 0x3355: 0x000d, 0x3356: 0x000d, 0x3357: 0x000d, + 0x3358: 0x000d, 0x3359: 0x000d, 0x335a: 0x000d, 0x335b: 0x000d, 0x335c: 0x000d, 0x335d: 0x000d, + 0x335e: 0x000d, 0x335f: 0x000d, 0x3360: 0x000d, 0x3361: 0x000d, 0x3362: 0x000d, 0x3363: 0x000d, + 0x3364: 0x000d, 0x3365: 0x000d, 0x3366: 0x000d, 0x3367: 0x000d, 0x3368: 0x000d, 0x3369: 0x000d, + 0x336a: 0x000d, 0x336b: 0x000d, 0x336c: 0x000d, 0x336d: 0x000d, 0x336e: 0x000d, 0x336f: 0x000d, + 0x3370: 0x000a, 0x3371: 0x000a, 0x3372: 0x000d, 0x3373: 0x000d, 0x3374: 0x000d, 0x3375: 0x000d, + 0x3376: 0x000d, 0x3377: 0x000d, 0x3378: 0x000d, 0x3379: 0x000d, 0x337a: 0x000d, 0x337b: 0x000d, + 0x337c: 0x000d, 0x337d: 0x000d, 0x337e: 0x000d, 0x337f: 0x000d, + // Block 0xce, offset 0x3380 + 0x3380: 0x000a, 0x3381: 0x000a, 0x3382: 0x000a, 0x3383: 0x000a, 0x3384: 0x000a, 0x3385: 0x000a, + 0x3386: 0x000a, 0x3387: 0x000a, 0x3388: 0x000a, 0x3389: 0x000a, 0x338a: 0x000a, 0x338b: 0x000a, + 0x338c: 0x000a, 0x338d: 0x000a, 0x338e: 0x000a, 0x338f: 0x000a, 0x3390: 0x000a, 0x3391: 0x000a, + 0x3392: 0x000a, 0x3393: 0x000a, 0x3394: 0x000a, 0x3395: 0x000a, 0x3396: 0x000a, 0x3397: 0x000a, + 0x3398: 0x000a, 0x3399: 0x000a, 0x339a: 0x000a, 0x339b: 0x000a, 0x339c: 0x000a, 0x339d: 0x000a, + 0x339e: 0x000a, 0x339f: 0x000a, 0x33a0: 0x000a, 0x33a1: 0x000a, 0x33a2: 0x000a, 0x33a3: 0x000a, + 0x33a4: 0x000a, 0x33a5: 0x000a, 0x33a6: 0x000a, 0x33a7: 0x000a, 0x33a8: 0x000a, 0x33a9: 0x000a, + 0x33aa: 0x000a, 0x33ab: 0x000a, + 0x33b0: 0x000a, 0x33b1: 0x000a, 0x33b2: 0x000a, 0x33b3: 0x000a, 0x33b4: 0x000a, 0x33b5: 0x000a, + 0x33b6: 0x000a, 0x33b7: 0x000a, 0x33b8: 0x000a, 0x33b9: 0x000a, 0x33ba: 0x000a, 0x33bb: 0x000a, + 0x33bc: 0x000a, 0x33bd: 0x000a, 0x33be: 0x000a, 0x33bf: 0x000a, + // Block 0xcf, offset 0x33c0 + 0x33c0: 0x000a, 0x33c1: 0x000a, 0x33c2: 0x000a, 0x33c3: 0x000a, 0x33c4: 0x000a, 0x33c5: 0x000a, + 0x33c6: 0x000a, 0x33c7: 0x000a, 0x33c8: 0x000a, 0x33c9: 0x000a, 0x33ca: 0x000a, 0x33cb: 0x000a, + 0x33cc: 0x000a, 0x33cd: 0x000a, 0x33ce: 0x000a, 0x33cf: 0x000a, 0x33d0: 0x000a, 0x33d1: 0x000a, + 0x33d2: 0x000a, 0x33d3: 0x000a, + 0x33e0: 0x000a, 0x33e1: 0x000a, 0x33e2: 0x000a, 0x33e3: 0x000a, + 0x33e4: 0x000a, 0x33e5: 0x000a, 0x33e6: 0x000a, 0x33e7: 0x000a, 0x33e8: 0x000a, 0x33e9: 0x000a, + 0x33ea: 0x000a, 0x33eb: 0x000a, 0x33ec: 0x000a, 0x33ed: 0x000a, 0x33ee: 0x000a, + 0x33f1: 0x000a, 0x33f2: 0x000a, 0x33f3: 0x000a, 0x33f4: 0x000a, 0x33f5: 0x000a, + 0x33f6: 0x000a, 0x33f7: 0x000a, 0x33f8: 0x000a, 0x33f9: 0x000a, 0x33fa: 0x000a, 0x33fb: 0x000a, + 0x33fc: 0x000a, 0x33fd: 0x000a, 0x33fe: 0x000a, 0x33ff: 0x000a, + // Block 0xd0, offset 0x3400 + 0x3401: 0x000a, 0x3402: 0x000a, 0x3403: 0x000a, 0x3404: 0x000a, 0x3405: 0x000a, + 0x3406: 0x000a, 0x3407: 0x000a, 0x3408: 0x000a, 0x3409: 0x000a, 0x340a: 0x000a, 0x340b: 0x000a, + 0x340c: 0x000a, 0x340d: 0x000a, 0x340e: 0x000a, 0x340f: 0x000a, 0x3411: 0x000a, + 0x3412: 0x000a, 0x3413: 0x000a, 0x3414: 0x000a, 0x3415: 0x000a, 0x3416: 0x000a, 0x3417: 0x000a, + 0x3418: 0x000a, 0x3419: 0x000a, 0x341a: 0x000a, 0x341b: 0x000a, 0x341c: 0x000a, 0x341d: 0x000a, + 0x341e: 0x000a, 0x341f: 0x000a, 0x3420: 0x000a, 0x3421: 0x000a, 0x3422: 0x000a, 0x3423: 0x000a, + 0x3424: 0x000a, 0x3425: 0x000a, 0x3426: 0x000a, 0x3427: 0x000a, 0x3428: 0x000a, 0x3429: 0x000a, + 0x342a: 0x000a, 0x342b: 0x000a, 0x342c: 0x000a, 0x342d: 0x000a, 0x342e: 0x000a, 0x342f: 0x000a, + 0x3430: 0x000a, 0x3431: 0x000a, 0x3432: 0x000a, 0x3433: 0x000a, 0x3434: 0x000a, 0x3435: 0x000a, + // Block 0xd1, offset 0x3440 + 0x3440: 0x0002, 0x3441: 0x0002, 0x3442: 0x0002, 0x3443: 0x0002, 0x3444: 0x0002, 0x3445: 0x0002, + 0x3446: 0x0002, 0x3447: 0x0002, 0x3448: 0x0002, 0x3449: 0x0002, 0x344a: 0x0002, 0x344b: 0x000a, + 0x344c: 0x000a, + // Block 0xd2, offset 0x3480 + 0x34aa: 0x000a, 0x34ab: 0x000a, + // Block 0xd3, offset 0x34c0 + 0x34c0: 0x000a, 0x34c1: 0x000a, 0x34c2: 0x000a, 0x34c3: 0x000a, 0x34c4: 0x000a, 0x34c5: 0x000a, + 0x34c6: 0x000a, 0x34c7: 0x000a, 0x34c8: 0x000a, 0x34c9: 0x000a, 0x34ca: 0x000a, 0x34cb: 0x000a, + 0x34cc: 0x000a, 0x34cd: 0x000a, 0x34ce: 0x000a, 0x34cf: 0x000a, 0x34d0: 0x000a, 0x34d1: 0x000a, + 0x34d2: 0x000a, + 0x34e0: 0x000a, 0x34e1: 0x000a, 0x34e2: 0x000a, 0x34e3: 0x000a, + 0x34e4: 0x000a, 0x34e5: 0x000a, 0x34e6: 0x000a, 0x34e7: 0x000a, 0x34e8: 0x000a, 0x34e9: 0x000a, + 0x34ea: 0x000a, 0x34eb: 0x000a, 0x34ec: 0x000a, + 0x34f0: 0x000a, 0x34f1: 0x000a, 0x34f2: 0x000a, 0x34f3: 0x000a, 0x34f4: 0x000a, 0x34f5: 0x000a, + 0x34f6: 0x000a, + // Block 0xd4, offset 0x3500 + 0x3500: 0x000a, 0x3501: 0x000a, 0x3502: 0x000a, 0x3503: 0x000a, 0x3504: 0x000a, 0x3505: 0x000a, + 0x3506: 0x000a, 0x3507: 0x000a, 0x3508: 0x000a, 0x3509: 0x000a, 0x350a: 0x000a, 0x350b: 0x000a, + 0x350c: 0x000a, 0x350d: 0x000a, 0x350e: 0x000a, 0x350f: 0x000a, 0x3510: 0x000a, 0x3511: 0x000a, + 0x3512: 0x000a, 0x3513: 0x000a, 0x3514: 0x000a, + // Block 0xd5, offset 0x3540 + 0x3540: 0x000a, 0x3541: 0x000a, 0x3542: 0x000a, 0x3543: 0x000a, 0x3544: 0x000a, 0x3545: 0x000a, + 0x3546: 0x000a, 0x3547: 0x000a, 0x3548: 0x000a, 0x3549: 0x000a, 0x354a: 0x000a, 0x354b: 0x000a, + 0x3550: 0x000a, 0x3551: 0x000a, + 0x3552: 0x000a, 0x3553: 0x000a, 0x3554: 0x000a, 0x3555: 0x000a, 0x3556: 0x000a, 0x3557: 0x000a, + 0x3558: 0x000a, 0x3559: 0x000a, 0x355a: 0x000a, 0x355b: 0x000a, 0x355c: 0x000a, 0x355d: 0x000a, + 0x355e: 0x000a, 0x355f: 0x000a, 0x3560: 0x000a, 0x3561: 0x000a, 0x3562: 0x000a, 0x3563: 0x000a, + 0x3564: 0x000a, 0x3565: 0x000a, 0x3566: 0x000a, 0x3567: 0x000a, 0x3568: 0x000a, 0x3569: 0x000a, + 0x356a: 0x000a, 0x356b: 0x000a, 0x356c: 0x000a, 0x356d: 0x000a, 0x356e: 0x000a, 0x356f: 0x000a, + 0x3570: 0x000a, 0x3571: 0x000a, 0x3572: 0x000a, 0x3573: 0x000a, 0x3574: 0x000a, 0x3575: 0x000a, + 0x3576: 0x000a, 0x3577: 0x000a, 0x3578: 0x000a, 0x3579: 0x000a, 0x357a: 0x000a, 0x357b: 0x000a, + 0x357c: 0x000a, 0x357d: 0x000a, 0x357e: 0x000a, 0x357f: 0x000a, + // Block 0xd6, offset 0x3580 + 0x3580: 0x000a, 0x3581: 0x000a, 0x3582: 0x000a, 0x3583: 0x000a, 0x3584: 0x000a, 0x3585: 0x000a, + 0x3586: 0x000a, 0x3587: 0x000a, + 0x3590: 0x000a, 0x3591: 0x000a, + 0x3592: 0x000a, 0x3593: 0x000a, 0x3594: 0x000a, 0x3595: 0x000a, 0x3596: 0x000a, 0x3597: 0x000a, + 0x3598: 0x000a, 0x3599: 0x000a, + 0x35a0: 0x000a, 0x35a1: 0x000a, 0x35a2: 0x000a, 0x35a3: 0x000a, + 0x35a4: 0x000a, 0x35a5: 0x000a, 0x35a6: 0x000a, 0x35a7: 0x000a, 0x35a8: 0x000a, 0x35a9: 0x000a, + 0x35aa: 0x000a, 0x35ab: 0x000a, 0x35ac: 0x000a, 0x35ad: 0x000a, 0x35ae: 0x000a, 0x35af: 0x000a, + 0x35b0: 0x000a, 0x35b1: 0x000a, 0x35b2: 0x000a, 0x35b3: 0x000a, 0x35b4: 0x000a, 0x35b5: 0x000a, + 0x35b6: 0x000a, 0x35b7: 0x000a, 0x35b8: 0x000a, 0x35b9: 0x000a, 0x35ba: 0x000a, 0x35bb: 0x000a, + 0x35bc: 0x000a, 0x35bd: 0x000a, 0x35be: 0x000a, 0x35bf: 0x000a, + // Block 0xd7, offset 0x35c0 + 0x35c0: 0x000a, 0x35c1: 0x000a, 0x35c2: 0x000a, 0x35c3: 0x000a, 0x35c4: 0x000a, 0x35c5: 0x000a, + 0x35c6: 0x000a, 0x35c7: 0x000a, + 0x35d0: 0x000a, 0x35d1: 0x000a, + 0x35d2: 0x000a, 0x35d3: 0x000a, 0x35d4: 0x000a, 0x35d5: 0x000a, 0x35d6: 0x000a, 0x35d7: 0x000a, + 0x35d8: 0x000a, 0x35d9: 0x000a, 0x35da: 0x000a, 0x35db: 0x000a, 0x35dc: 0x000a, 0x35dd: 0x000a, + 0x35de: 0x000a, 0x35df: 0x000a, 0x35e0: 0x000a, 0x35e1: 0x000a, 0x35e2: 0x000a, 0x35e3: 0x000a, + 0x35e4: 0x000a, 0x35e5: 0x000a, 0x35e6: 0x000a, 0x35e7: 0x000a, 0x35e8: 0x000a, 0x35e9: 0x000a, + 0x35ea: 0x000a, 0x35eb: 0x000a, 0x35ec: 0x000a, 0x35ed: 0x000a, + // Block 0xd8, offset 0x3600 + 0x3610: 0x000a, 0x3611: 0x000a, + 0x3612: 0x000a, 0x3613: 0x000a, 0x3614: 0x000a, 0x3615: 0x000a, 0x3616: 0x000a, 0x3617: 0x000a, + 0x3618: 0x000a, 0x3619: 0x000a, 0x361a: 0x000a, 0x361b: 0x000a, 0x361c: 0x000a, 0x361d: 0x000a, + 0x361e: 0x000a, 0x3620: 0x000a, 0x3621: 0x000a, 0x3622: 0x000a, 0x3623: 0x000a, + 0x3624: 0x000a, 0x3625: 0x000a, 0x3626: 0x000a, 0x3627: 0x000a, + 0x3630: 0x000a, 0x3633: 0x000a, 0x3634: 0x000a, 0x3635: 0x000a, + 0x3636: 0x000a, 0x3637: 0x000a, 0x3638: 0x000a, 0x3639: 0x000a, 0x363a: 0x000a, 0x363b: 0x000a, + 0x363c: 0x000a, 0x363d: 0x000a, 0x363e: 0x000a, + // Block 0xd9, offset 0x3640 + 0x3640: 0x000a, 0x3641: 0x000a, 0x3642: 0x000a, 0x3643: 0x000a, 0x3644: 0x000a, 0x3645: 0x000a, + 0x3646: 0x000a, 0x3647: 0x000a, 0x3648: 0x000a, 0x3649: 0x000a, 0x364a: 0x000a, 0x364b: 0x000a, + 0x3650: 0x000a, 0x3651: 0x000a, + 0x3652: 0x000a, 0x3653: 0x000a, 0x3654: 0x000a, 0x3655: 0x000a, 0x3656: 0x000a, 0x3657: 0x000a, + 0x3658: 0x000a, 0x3659: 0x000a, 0x365a: 0x000a, 0x365b: 0x000a, 0x365c: 0x000a, 0x365d: 0x000a, + 0x365e: 0x000a, + // Block 0xda, offset 0x3680 + 0x3680: 0x000a, 0x3681: 0x000a, 0x3682: 0x000a, 0x3683: 0x000a, 0x3684: 0x000a, 0x3685: 0x000a, + 0x3686: 0x000a, 0x3687: 0x000a, 0x3688: 0x000a, 0x3689: 0x000a, 0x368a: 0x000a, 0x368b: 0x000a, + 0x368c: 0x000a, 0x368d: 0x000a, 0x368e: 0x000a, 0x368f: 0x000a, 0x3690: 0x000a, 0x3691: 0x000a, + // Block 0xdb, offset 0x36c0 + 0x36fe: 0x000b, 0x36ff: 0x000b, + // Block 0xdc, offset 0x3700 + 0x3700: 0x000b, 0x3701: 0x000b, 0x3702: 0x000b, 0x3703: 0x000b, 0x3704: 0x000b, 0x3705: 0x000b, + 0x3706: 0x000b, 0x3707: 0x000b, 0x3708: 0x000b, 0x3709: 0x000b, 0x370a: 0x000b, 0x370b: 0x000b, + 0x370c: 0x000b, 0x370d: 0x000b, 0x370e: 0x000b, 0x370f: 0x000b, 0x3710: 0x000b, 0x3711: 0x000b, + 0x3712: 0x000b, 0x3713: 0x000b, 0x3714: 0x000b, 0x3715: 0x000b, 0x3716: 0x000b, 0x3717: 0x000b, + 0x3718: 0x000b, 0x3719: 0x000b, 0x371a: 0x000b, 0x371b: 0x000b, 0x371c: 0x000b, 0x371d: 0x000b, + 0x371e: 0x000b, 0x371f: 0x000b, 0x3720: 0x000b, 0x3721: 0x000b, 0x3722: 0x000b, 0x3723: 0x000b, + 0x3724: 0x000b, 0x3725: 0x000b, 0x3726: 0x000b, 0x3727: 0x000b, 0x3728: 0x000b, 0x3729: 0x000b, + 0x372a: 0x000b, 0x372b: 0x000b, 0x372c: 0x000b, 0x372d: 0x000b, 0x372e: 0x000b, 0x372f: 0x000b, + 0x3730: 0x000b, 0x3731: 0x000b, 0x3732: 0x000b, 0x3733: 0x000b, 0x3734: 0x000b, 0x3735: 0x000b, + 0x3736: 0x000b, 0x3737: 0x000b, 0x3738: 0x000b, 0x3739: 0x000b, 0x373a: 0x000b, 0x373b: 0x000b, + 0x373c: 0x000b, 0x373d: 0x000b, 0x373e: 0x000b, 0x373f: 0x000b, + // Block 0xdd, offset 0x3740 + 0x3740: 0x000c, 0x3741: 0x000c, 0x3742: 0x000c, 0x3743: 0x000c, 0x3744: 0x000c, 0x3745: 0x000c, + 0x3746: 0x000c, 0x3747: 0x000c, 0x3748: 0x000c, 0x3749: 0x000c, 0x374a: 0x000c, 0x374b: 0x000c, + 0x374c: 0x000c, 0x374d: 0x000c, 0x374e: 0x000c, 0x374f: 0x000c, 0x3750: 0x000c, 0x3751: 0x000c, + 0x3752: 0x000c, 0x3753: 0x000c, 0x3754: 0x000c, 0x3755: 0x000c, 0x3756: 0x000c, 0x3757: 0x000c, + 0x3758: 0x000c, 0x3759: 0x000c, 0x375a: 0x000c, 0x375b: 0x000c, 0x375c: 0x000c, 0x375d: 0x000c, + 0x375e: 0x000c, 0x375f: 0x000c, 0x3760: 0x000c, 0x3761: 0x000c, 0x3762: 0x000c, 0x3763: 0x000c, + 0x3764: 0x000c, 0x3765: 0x000c, 0x3766: 0x000c, 0x3767: 0x000c, 0x3768: 0x000c, 0x3769: 0x000c, + 0x376a: 0x000c, 0x376b: 0x000c, 0x376c: 0x000c, 0x376d: 0x000c, 0x376e: 0x000c, 0x376f: 0x000c, + 0x3770: 0x000b, 0x3771: 0x000b, 0x3772: 0x000b, 0x3773: 0x000b, 0x3774: 0x000b, 0x3775: 0x000b, + 0x3776: 0x000b, 0x3777: 0x000b, 0x3778: 0x000b, 0x3779: 0x000b, 0x377a: 0x000b, 0x377b: 0x000b, + 0x377c: 0x000b, 0x377d: 0x000b, 0x377e: 0x000b, 0x377f: 0x000b, +} + +// bidiIndex: 24 blocks, 1536 entries, 1536 bytes +// Block 0 is the zero block. +var bidiIndex = [1536]uint8{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x01, 0xc3: 0x02, + 0xca: 0x03, 0xcb: 0x04, 0xcc: 0x05, 0xcd: 0x06, 0xce: 0x07, 0xcf: 0x08, + 0xd2: 0x09, 0xd6: 0x0a, 0xd7: 0x0b, + 0xd8: 0x0c, 0xd9: 0x0d, 0xda: 0x0e, 0xdb: 0x0f, 0xdc: 0x10, 0xdd: 0x11, 0xde: 0x12, 0xdf: 0x13, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, 0xe4: 0x06, + 0xea: 0x07, 0xef: 0x08, + 0xf0: 0x11, 0xf1: 0x12, 0xf2: 0x12, 0xf3: 0x14, 0xf4: 0x15, + // Block 0x4, offset 0x100 + 0x120: 0x14, 0x121: 0x15, 0x122: 0x16, 0x123: 0x17, 0x124: 0x18, 0x125: 0x19, 0x126: 0x1a, 0x127: 0x1b, + 0x128: 0x1c, 0x129: 0x1d, 0x12a: 0x1c, 0x12b: 0x1e, 0x12c: 0x1f, 0x12d: 0x20, 0x12e: 0x21, 0x12f: 0x22, + 0x130: 0x23, 0x131: 0x24, 0x132: 0x1a, 0x133: 0x25, 0x134: 0x26, 0x135: 0x27, 0x137: 0x28, + 0x138: 0x29, 0x139: 0x2a, 0x13a: 0x2b, 0x13b: 0x2c, 0x13c: 0x2d, 0x13d: 0x2e, 0x13e: 0x2f, 0x13f: 0x30, + // Block 0x5, offset 0x140 + 0x140: 0x31, 0x141: 0x32, 0x142: 0x33, + 0x14d: 0x34, 0x14e: 0x35, + 0x150: 0x36, + 0x15a: 0x37, 0x15c: 0x38, 0x15d: 0x39, 0x15e: 0x3a, 0x15f: 0x3b, + 0x160: 0x3c, 0x162: 0x3d, 0x164: 0x3e, 0x165: 0x3f, 0x167: 0x40, + 0x168: 0x41, 0x169: 0x42, 0x16a: 0x43, 0x16c: 0x44, 0x16d: 0x45, 0x16e: 0x46, 0x16f: 0x47, + 0x170: 0x48, 0x173: 0x49, 0x177: 0x4a, + 0x17e: 0x4b, 0x17f: 0x4c, + // Block 0x6, offset 0x180 + 0x180: 0x4d, 0x181: 0x4e, 0x182: 0x4f, 0x183: 0x50, 0x184: 0x51, 0x185: 0x52, 0x186: 0x53, 0x187: 0x54, + 0x188: 0x55, 0x189: 0x54, 0x18a: 0x54, 0x18b: 0x54, 0x18c: 0x56, 0x18d: 0x57, 0x18e: 0x58, 0x18f: 0x59, + 0x190: 0x5a, 0x191: 0x5b, 0x192: 0x5c, 0x193: 0x5d, 0x194: 0x54, 0x195: 0x54, 0x196: 0x54, 0x197: 0x54, + 0x198: 0x54, 0x199: 0x54, 0x19a: 0x5e, 0x19b: 0x54, 0x19c: 0x54, 0x19d: 0x5f, 0x19e: 0x54, 0x19f: 0x60, + 0x1a4: 0x54, 0x1a5: 0x54, 0x1a6: 0x61, 0x1a7: 0x62, + 0x1a8: 0x54, 0x1a9: 0x54, 0x1aa: 0x54, 0x1ab: 0x54, 0x1ac: 0x54, 0x1ad: 0x63, 0x1ae: 0x64, 0x1af: 0x65, + 0x1b3: 0x66, 0x1b5: 0x67, 0x1b7: 0x68, + 0x1b8: 0x69, 0x1b9: 0x6a, 0x1ba: 0x6b, 0x1bb: 0x6c, 0x1bc: 0x54, 0x1bd: 0x54, 0x1be: 0x54, 0x1bf: 0x6d, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x6e, 0x1c2: 0x6f, 0x1c3: 0x70, 0x1c7: 0x71, + 0x1c8: 0x72, 0x1c9: 0x73, 0x1ca: 0x74, 0x1cb: 0x75, 0x1cd: 0x76, 0x1cf: 0x77, + // Block 0x8, offset 0x200 + 0x237: 0x54, + // Block 0x9, offset 0x240 + 0x252: 0x78, 0x253: 0x79, + 0x258: 0x7a, 0x259: 0x7b, 0x25a: 0x7c, 0x25b: 0x7d, 0x25c: 0x7e, 0x25e: 0x7f, + 0x260: 0x80, 0x261: 0x81, 0x263: 0x82, 0x264: 0x83, 0x265: 0x84, 0x266: 0x85, 0x267: 0x86, + 0x268: 0x87, 0x269: 0x88, 0x26a: 0x89, 0x26b: 0x8a, 0x26f: 0x8b, + // Block 0xa, offset 0x280 + 0x2ac: 0x8c, 0x2ad: 0x8d, 0x2ae: 0x0e, 0x2af: 0x0e, + 0x2b0: 0x0e, 0x2b1: 0x0e, 0x2b2: 0x0e, 0x2b3: 0x0e, 0x2b4: 0x8e, 0x2b5: 0x0e, 0x2b6: 0x0e, 0x2b7: 0x8f, + 0x2b8: 0x90, 0x2b9: 0x91, 0x2ba: 0x0e, 0x2bb: 0x92, 0x2bc: 0x93, 0x2bd: 0x94, 0x2bf: 0x95, + // Block 0xb, offset 0x2c0 + 0x2c4: 0x96, 0x2c5: 0x54, 0x2c6: 0x97, 0x2c7: 0x98, + 0x2cb: 0x99, 0x2cd: 0x9a, + 0x2e0: 0x9b, 0x2e1: 0x9b, 0x2e2: 0x9b, 0x2e3: 0x9b, 0x2e4: 0x9c, 0x2e5: 0x9b, 0x2e6: 0x9b, 0x2e7: 0x9b, + 0x2e8: 0x9d, 0x2e9: 0x9b, 0x2ea: 0x9b, 0x2eb: 0x9e, 0x2ec: 0x9f, 0x2ed: 0x9b, 0x2ee: 0x9b, 0x2ef: 0x9b, + 0x2f0: 0x9b, 0x2f1: 0x9b, 0x2f2: 0x9b, 0x2f3: 0x9b, 0x2f4: 0x9b, 0x2f5: 0x9b, 0x2f6: 0x9b, 0x2f7: 0x9b, + 0x2f8: 0x9b, 0x2f9: 0xa0, 0x2fa: 0x9b, 0x2fb: 0x9b, 0x2fc: 0x9b, 0x2fd: 0x9b, 0x2fe: 0x9b, 0x2ff: 0x9b, + // Block 0xc, offset 0x300 + 0x300: 0xa1, 0x301: 0xa2, 0x302: 0xa3, 0x304: 0xa4, 0x305: 0xa5, 0x306: 0xa6, 0x307: 0xa7, + 0x308: 0xa8, 0x30b: 0xa9, 0x30c: 0xaa, 0x30d: 0xab, + 0x310: 0xac, 0x311: 0xad, 0x312: 0xae, 0x313: 0xaf, 0x316: 0xb0, 0x317: 0xb1, + 0x318: 0xb2, 0x319: 0xb3, 0x31a: 0xb4, 0x31c: 0xb5, + 0x330: 0xb6, 0x332: 0xb7, + // Block 0xd, offset 0x340 + 0x36b: 0xb8, 0x36c: 0xb9, + 0x37e: 0xba, + // Block 0xe, offset 0x380 + 0x3b2: 0xbb, + // Block 0xf, offset 0x3c0 + 0x3c5: 0xbc, 0x3c6: 0xbd, + 0x3c8: 0x54, 0x3c9: 0xbe, 0x3cc: 0x54, 0x3cd: 0xbf, + 0x3db: 0xc0, 0x3dc: 0xc1, 0x3dd: 0xc2, 0x3de: 0xc3, 0x3df: 0xc4, + 0x3e8: 0xc5, 0x3e9: 0xc6, 0x3ea: 0xc7, + // Block 0x10, offset 0x400 + 0x400: 0xc8, + 0x420: 0x9b, 0x421: 0x9b, 0x422: 0x9b, 0x423: 0xc9, 0x424: 0x9b, 0x425: 0xca, 0x426: 0x9b, 0x427: 0x9b, + 0x428: 0x9b, 0x429: 0x9b, 0x42a: 0x9b, 0x42b: 0x9b, 0x42c: 0x9b, 0x42d: 0x9b, 0x42e: 0x9b, 0x42f: 0x9b, + 0x430: 0x9b, 0x431: 0x9b, 0x432: 0x9b, 0x433: 0x9b, 0x434: 0x9b, 0x435: 0x9b, 0x436: 0x9b, 0x437: 0x9b, + 0x438: 0x0e, 0x439: 0x0e, 0x43a: 0x0e, 0x43b: 0xcb, 0x43c: 0x9b, 0x43d: 0x9b, 0x43e: 0x9b, 0x43f: 0x9b, + // Block 0x11, offset 0x440 + 0x440: 0xcc, 0x441: 0x54, 0x442: 0xcd, 0x443: 0xce, 0x444: 0xcf, 0x445: 0xd0, + 0x44c: 0x54, 0x44d: 0x54, 0x44e: 0x54, 0x44f: 0x54, + 0x450: 0x54, 0x451: 0x54, 0x452: 0x54, 0x453: 0x54, 0x454: 0x54, 0x455: 0x54, 0x456: 0x54, 0x457: 0x54, + 0x458: 0x54, 0x459: 0x54, 0x45a: 0x54, 0x45b: 0xd1, 0x45c: 0x54, 0x45d: 0x6c, 0x45e: 0x54, 0x45f: 0xd2, + 0x460: 0xd3, 0x461: 0xd4, 0x462: 0xd5, 0x464: 0xd6, 0x465: 0xd7, 0x466: 0xd8, 0x467: 0x36, + 0x47f: 0xd9, + // Block 0x12, offset 0x480 + 0x4bf: 0xd9, + // Block 0x13, offset 0x4c0 + 0x4d0: 0x09, 0x4d1: 0x0a, 0x4d6: 0x0b, + 0x4db: 0x0c, 0x4dd: 0x0d, 0x4de: 0x0e, 0x4df: 0x0f, + 0x4ef: 0x10, + 0x4ff: 0x10, + // Block 0x14, offset 0x500 + 0x50f: 0x10, + 0x51f: 0x10, + 0x52f: 0x10, + 0x53f: 0x10, + // Block 0x15, offset 0x540 + 0x540: 0xda, 0x541: 0xda, 0x542: 0xda, 0x543: 0xda, 0x544: 0x05, 0x545: 0x05, 0x546: 0x05, 0x547: 0xdb, + 0x548: 0xda, 0x549: 0xda, 0x54a: 0xda, 0x54b: 0xda, 0x54c: 0xda, 0x54d: 0xda, 0x54e: 0xda, 0x54f: 0xda, + 0x550: 0xda, 0x551: 0xda, 0x552: 0xda, 0x553: 0xda, 0x554: 0xda, 0x555: 0xda, 0x556: 0xda, 0x557: 0xda, + 0x558: 0xda, 0x559: 0xda, 0x55a: 0xda, 0x55b: 0xda, 0x55c: 0xda, 0x55d: 0xda, 0x55e: 0xda, 0x55f: 0xda, + 0x560: 0xda, 0x561: 0xda, 0x562: 0xda, 0x563: 0xda, 0x564: 0xda, 0x565: 0xda, 0x566: 0xda, 0x567: 0xda, + 0x568: 0xda, 0x569: 0xda, 0x56a: 0xda, 0x56b: 0xda, 0x56c: 0xda, 0x56d: 0xda, 0x56e: 0xda, 0x56f: 0xda, + 0x570: 0xda, 0x571: 0xda, 0x572: 0xda, 0x573: 0xda, 0x574: 0xda, 0x575: 0xda, 0x576: 0xda, 0x577: 0xda, + 0x578: 0xda, 0x579: 0xda, 0x57a: 0xda, 0x57b: 0xda, 0x57c: 0xda, 0x57d: 0xda, 0x57e: 0xda, 0x57f: 0xda, + // Block 0x16, offset 0x580 + 0x58f: 0x10, + 0x59f: 0x10, + 0x5a0: 0x13, + 0x5af: 0x10, + 0x5bf: 0x10, + // Block 0x17, offset 0x5c0 + 0x5cf: 0x10, +} + +// Total table size 15800 bytes (15KiB); checksum: F50EF68C diff --git a/vendor/golang.org/x/text/unicode/bidi/trieval.go b/vendor/golang.org/x/text/unicode/bidi/trieval.go new file mode 100644 index 0000000..4c459c4 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/bidi/trieval.go @@ -0,0 +1,60 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +package bidi + +// Class is the Unicode BiDi class. Each rune has a single class. +type Class uint + +const ( + L Class = iota // LeftToRight + R // RightToLeft + EN // EuropeanNumber + ES // EuropeanSeparator + ET // EuropeanTerminator + AN // ArabicNumber + CS // CommonSeparator + B // ParagraphSeparator + S // SegmentSeparator + WS // WhiteSpace + ON // OtherNeutral + BN // BoundaryNeutral + NSM // NonspacingMark + AL // ArabicLetter + Control // Control LRO - PDI + + numClass + + LRO // LeftToRightOverride + RLO // RightToLeftOverride + LRE // LeftToRightEmbedding + RLE // RightToLeftEmbedding + PDF // PopDirectionalFormat + LRI // LeftToRightIsolate + RLI // RightToLeftIsolate + FSI // FirstStrongIsolate + PDI // PopDirectionalIsolate + + unknownClass = ^Class(0) +) + +var controlToClass = map[rune]Class{ + 0x202D: LRO, // LeftToRightOverride, + 0x202E: RLO, // RightToLeftOverride, + 0x202A: LRE, // LeftToRightEmbedding, + 0x202B: RLE, // RightToLeftEmbedding, + 0x202C: PDF, // PopDirectionalFormat, + 0x2066: LRI, // LeftToRightIsolate, + 0x2067: RLI, // RightToLeftIsolate, + 0x2068: FSI, // FirstStrongIsolate, + 0x2069: PDI, // PopDirectionalIsolate, +} + +// A trie entry has the following bits: +// 7..5 XOR mask for brackets +// 4 1: Bracket open, 0: Bracket close +// 3..0 Class type + +const ( + openMask = 0x10 + xorMaskShift = 5 +) diff --git a/vendor/golang.org/x/text/unicode/norm/composition.go b/vendor/golang.org/x/text/unicode/norm/composition.go new file mode 100644 index 0000000..bab4c5d --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/composition.go @@ -0,0 +1,508 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +import "unicode/utf8" + +const ( + maxNonStarters = 30 + // The maximum number of characters needed for a buffer is + // maxNonStarters + 1 for the starter + 1 for the GCJ + maxBufferSize = maxNonStarters + 2 + maxNFCExpansion = 3 // NFC(0x1D160) + maxNFKCExpansion = 18 // NFKC(0xFDFA) + + maxByteBufferSize = utf8.UTFMax * maxBufferSize // 128 +) + +// ssState is used for reporting the segment state after inserting a rune. +// It is returned by streamSafe.next. +type ssState int + +const ( + // Indicates a rune was successfully added to the segment. + ssSuccess ssState = iota + // Indicates a rune starts a new segment and should not be added. + ssStarter + // Indicates a rune caused a segment overflow and a CGJ should be inserted. + ssOverflow +) + +// streamSafe implements the policy of when a CGJ should be inserted. +type streamSafe uint8 + +// first inserts the first rune of a segment. It is a faster version of next if +// it is known p represents the first rune in a segment. +func (ss *streamSafe) first(p Properties) { + *ss = streamSafe(p.nTrailingNonStarters()) +} + +// insert returns a ssState value to indicate whether a rune represented by p +// can be inserted. +func (ss *streamSafe) next(p Properties) ssState { + if *ss > maxNonStarters { + panic("streamSafe was not reset") + } + n := p.nLeadingNonStarters() + if *ss += streamSafe(n); *ss > maxNonStarters { + *ss = 0 + return ssOverflow + } + // The Stream-Safe Text Processing prescribes that the counting can stop + // as soon as a starter is encountered. However, there are some starters, + // like Jamo V and T, that can combine with other runes, leaving their + // successive non-starters appended to the previous, possibly causing an + // overflow. We will therefore consider any rune with a non-zero nLead to + // be a non-starter. Note that it always hold that if nLead > 0 then + // nLead == nTrail. + if n == 0 { + *ss = streamSafe(p.nTrailingNonStarters()) + return ssStarter + } + return ssSuccess +} + +// backwards is used for checking for overflow and segment starts +// when traversing a string backwards. Users do not need to call first +// for the first rune. The state of the streamSafe retains the count of +// the non-starters loaded. +func (ss *streamSafe) backwards(p Properties) ssState { + if *ss > maxNonStarters { + panic("streamSafe was not reset") + } + c := *ss + streamSafe(p.nTrailingNonStarters()) + if c > maxNonStarters { + return ssOverflow + } + *ss = c + if p.nLeadingNonStarters() == 0 { + return ssStarter + } + return ssSuccess +} + +func (ss streamSafe) isMax() bool { + return ss == maxNonStarters +} + +// GraphemeJoiner is inserted after maxNonStarters non-starter runes. +const GraphemeJoiner = "\u034F" + +// reorderBuffer is used to normalize a single segment. Characters inserted with +// insert are decomposed and reordered based on CCC. The compose method can +// be used to recombine characters. Note that the byte buffer does not hold +// the UTF-8 characters in order. Only the rune array is maintained in sorted +// order. flush writes the resulting segment to a byte array. +type reorderBuffer struct { + rune [maxBufferSize]Properties // Per character info. + byte [maxByteBufferSize]byte // UTF-8 buffer. Referenced by runeInfo.pos. + nbyte uint8 // Number or bytes. + ss streamSafe // For limiting length of non-starter sequence. + nrune int // Number of runeInfos. + f formInfo + + src input + nsrc int + tmpBytes input + + out []byte + flushF func(*reorderBuffer) bool +} + +func (rb *reorderBuffer) init(f Form, src []byte) { + rb.f = *formTable[f] + rb.src.setBytes(src) + rb.nsrc = len(src) + rb.ss = 0 +} + +func (rb *reorderBuffer) initString(f Form, src string) { + rb.f = *formTable[f] + rb.src.setString(src) + rb.nsrc = len(src) + rb.ss = 0 +} + +func (rb *reorderBuffer) setFlusher(out []byte, f func(*reorderBuffer) bool) { + rb.out = out + rb.flushF = f +} + +// reset discards all characters from the buffer. +func (rb *reorderBuffer) reset() { + rb.nrune = 0 + rb.nbyte = 0 +} + +func (rb *reorderBuffer) doFlush() bool { + if rb.f.composing { + rb.compose() + } + res := rb.flushF(rb) + rb.reset() + return res +} + +// appendFlush appends the normalized segment to rb.out. +func appendFlush(rb *reorderBuffer) bool { + for i := 0; i < rb.nrune; i++ { + start := rb.rune[i].pos + end := start + rb.rune[i].size + rb.out = append(rb.out, rb.byte[start:end]...) + } + return true +} + +// flush appends the normalized segment to out and resets rb. +func (rb *reorderBuffer) flush(out []byte) []byte { + for i := 0; i < rb.nrune; i++ { + start := rb.rune[i].pos + end := start + rb.rune[i].size + out = append(out, rb.byte[start:end]...) + } + rb.reset() + return out +} + +// flushCopy copies the normalized segment to buf and resets rb. +// It returns the number of bytes written to buf. +func (rb *reorderBuffer) flushCopy(buf []byte) int { + p := 0 + for i := 0; i < rb.nrune; i++ { + runep := rb.rune[i] + p += copy(buf[p:], rb.byte[runep.pos:runep.pos+runep.size]) + } + rb.reset() + return p +} + +// insertOrdered inserts a rune in the buffer, ordered by Canonical Combining Class. +// It returns false if the buffer is not large enough to hold the rune. +// It is used internally by insert and insertString only. +func (rb *reorderBuffer) insertOrdered(info Properties) { + n := rb.nrune + b := rb.rune[:] + cc := info.ccc + if cc > 0 { + // Find insertion position + move elements to make room. + for ; n > 0; n-- { + if b[n-1].ccc <= cc { + break + } + b[n] = b[n-1] + } + } + rb.nrune += 1 + pos := uint8(rb.nbyte) + rb.nbyte += utf8.UTFMax + info.pos = pos + b[n] = info +} + +// insertErr is an error code returned by insert. Using this type instead +// of error improves performance up to 20% for many of the benchmarks. +type insertErr int + +const ( + iSuccess insertErr = -iota + iShortDst + iShortSrc +) + +// insertFlush inserts the given rune in the buffer ordered by CCC. +// If a decomposition with multiple segments are encountered, they leading +// ones are flushed. +// It returns a non-zero error code if the rune was not inserted. +func (rb *reorderBuffer) insertFlush(src input, i int, info Properties) insertErr { + if rune := src.hangul(i); rune != 0 { + rb.decomposeHangul(rune) + return iSuccess + } + if info.hasDecomposition() { + return rb.insertDecomposed(info.Decomposition()) + } + rb.insertSingle(src, i, info) + return iSuccess +} + +// insertUnsafe inserts the given rune in the buffer ordered by CCC. +// It is assumed there is sufficient space to hold the runes. It is the +// responsibility of the caller to ensure this. This can be done by checking +// the state returned by the streamSafe type. +func (rb *reorderBuffer) insertUnsafe(src input, i int, info Properties) { + if rune := src.hangul(i); rune != 0 { + rb.decomposeHangul(rune) + } + if info.hasDecomposition() { + // TODO: inline. + rb.insertDecomposed(info.Decomposition()) + } else { + rb.insertSingle(src, i, info) + } +} + +// insertDecomposed inserts an entry in to the reorderBuffer for each rune +// in dcomp. dcomp must be a sequence of decomposed UTF-8-encoded runes. +// It flushes the buffer on each new segment start. +func (rb *reorderBuffer) insertDecomposed(dcomp []byte) insertErr { + rb.tmpBytes.setBytes(dcomp) + // As the streamSafe accounting already handles the counting for modifiers, + // we don't have to call next. However, we do need to keep the accounting + // intact when flushing the buffer. + for i := 0; i < len(dcomp); { + info := rb.f.info(rb.tmpBytes, i) + if info.BoundaryBefore() && rb.nrune > 0 && !rb.doFlush() { + return iShortDst + } + i += copy(rb.byte[rb.nbyte:], dcomp[i:i+int(info.size)]) + rb.insertOrdered(info) + } + return iSuccess +} + +// insertSingle inserts an entry in the reorderBuffer for the rune at +// position i. info is the runeInfo for the rune at position i. +func (rb *reorderBuffer) insertSingle(src input, i int, info Properties) { + src.copySlice(rb.byte[rb.nbyte:], i, i+int(info.size)) + rb.insertOrdered(info) +} + +// insertCGJ inserts a Combining Grapheme Joiner (0x034f) into rb. +func (rb *reorderBuffer) insertCGJ() { + rb.insertSingle(input{str: GraphemeJoiner}, 0, Properties{size: uint8(len(GraphemeJoiner))}) +} + +// appendRune inserts a rune at the end of the buffer. It is used for Hangul. +func (rb *reorderBuffer) appendRune(r rune) { + bn := rb.nbyte + sz := utf8.EncodeRune(rb.byte[bn:], rune(r)) + rb.nbyte += utf8.UTFMax + rb.rune[rb.nrune] = Properties{pos: bn, size: uint8(sz)} + rb.nrune++ +} + +// assignRune sets a rune at position pos. It is used for Hangul and recomposition. +func (rb *reorderBuffer) assignRune(pos int, r rune) { + bn := rb.rune[pos].pos + sz := utf8.EncodeRune(rb.byte[bn:], rune(r)) + rb.rune[pos] = Properties{pos: bn, size: uint8(sz)} +} + +// runeAt returns the rune at position n. It is used for Hangul and recomposition. +func (rb *reorderBuffer) runeAt(n int) rune { + inf := rb.rune[n] + r, _ := utf8.DecodeRune(rb.byte[inf.pos : inf.pos+inf.size]) + return r +} + +// bytesAt returns the UTF-8 encoding of the rune at position n. +// It is used for Hangul and recomposition. +func (rb *reorderBuffer) bytesAt(n int) []byte { + inf := rb.rune[n] + return rb.byte[inf.pos : int(inf.pos)+int(inf.size)] +} + +// For Hangul we combine algorithmically, instead of using tables. +const ( + hangulBase = 0xAC00 // UTF-8(hangulBase) -> EA B0 80 + hangulBase0 = 0xEA + hangulBase1 = 0xB0 + hangulBase2 = 0x80 + + hangulEnd = hangulBase + jamoLVTCount // UTF-8(0xD7A4) -> ED 9E A4 + hangulEnd0 = 0xED + hangulEnd1 = 0x9E + hangulEnd2 = 0xA4 + + jamoLBase = 0x1100 // UTF-8(jamoLBase) -> E1 84 00 + jamoLBase0 = 0xE1 + jamoLBase1 = 0x84 + jamoLEnd = 0x1113 + jamoVBase = 0x1161 + jamoVEnd = 0x1176 + jamoTBase = 0x11A7 + jamoTEnd = 0x11C3 + + jamoTCount = 28 + jamoVCount = 21 + jamoVTCount = 21 * 28 + jamoLVTCount = 19 * 21 * 28 +) + +const hangulUTF8Size = 3 + +func isHangul(b []byte) bool { + if len(b) < hangulUTF8Size { + return false + } + b0 := b[0] + if b0 < hangulBase0 { + return false + } + b1 := b[1] + switch { + case b0 == hangulBase0: + return b1 >= hangulBase1 + case b0 < hangulEnd0: + return true + case b0 > hangulEnd0: + return false + case b1 < hangulEnd1: + return true + } + return b1 == hangulEnd1 && b[2] < hangulEnd2 +} + +func isHangulString(b string) bool { + if len(b) < hangulUTF8Size { + return false + } + b0 := b[0] + if b0 < hangulBase0 { + return false + } + b1 := b[1] + switch { + case b0 == hangulBase0: + return b1 >= hangulBase1 + case b0 < hangulEnd0: + return true + case b0 > hangulEnd0: + return false + case b1 < hangulEnd1: + return true + } + return b1 == hangulEnd1 && b[2] < hangulEnd2 +} + +// Caller must ensure len(b) >= 2. +func isJamoVT(b []byte) bool { + // True if (rune & 0xff00) == jamoLBase + return b[0] == jamoLBase0 && (b[1]&0xFC) == jamoLBase1 +} + +func isHangulWithoutJamoT(b []byte) bool { + c, _ := utf8.DecodeRune(b) + c -= hangulBase + return c < jamoLVTCount && c%jamoTCount == 0 +} + +// decomposeHangul writes the decomposed Hangul to buf and returns the number +// of bytes written. len(buf) should be at least 9. +func decomposeHangul(buf []byte, r rune) int { + const JamoUTF8Len = 3 + r -= hangulBase + x := r % jamoTCount + r /= jamoTCount + utf8.EncodeRune(buf, jamoLBase+r/jamoVCount) + utf8.EncodeRune(buf[JamoUTF8Len:], jamoVBase+r%jamoVCount) + if x != 0 { + utf8.EncodeRune(buf[2*JamoUTF8Len:], jamoTBase+x) + return 3 * JamoUTF8Len + } + return 2 * JamoUTF8Len +} + +// decomposeHangul algorithmically decomposes a Hangul rune into +// its Jamo components. +// See http://unicode.org/reports/tr15/#Hangul for details on decomposing Hangul. +func (rb *reorderBuffer) decomposeHangul(r rune) { + r -= hangulBase + x := r % jamoTCount + r /= jamoTCount + rb.appendRune(jamoLBase + r/jamoVCount) + rb.appendRune(jamoVBase + r%jamoVCount) + if x != 0 { + rb.appendRune(jamoTBase + x) + } +} + +// combineHangul algorithmically combines Jamo character components into Hangul. +// See http://unicode.org/reports/tr15/#Hangul for details on combining Hangul. +func (rb *reorderBuffer) combineHangul(s, i, k int) { + b := rb.rune[:] + bn := rb.nrune + for ; i < bn; i++ { + cccB := b[k-1].ccc + cccC := b[i].ccc + if cccB == 0 { + s = k - 1 + } + if s != k-1 && cccB >= cccC { + // b[i] is blocked by greater-equal cccX below it + b[k] = b[i] + k++ + } else { + l := rb.runeAt(s) // also used to compare to hangulBase + v := rb.runeAt(i) // also used to compare to jamoT + switch { + case jamoLBase <= l && l < jamoLEnd && + jamoVBase <= v && v < jamoVEnd: + // 11xx plus 116x to LV + rb.assignRune(s, hangulBase+ + (l-jamoLBase)*jamoVTCount+(v-jamoVBase)*jamoTCount) + case hangulBase <= l && l < hangulEnd && + jamoTBase < v && v < jamoTEnd && + ((l-hangulBase)%jamoTCount) == 0: + // ACxx plus 11Ax to LVT + rb.assignRune(s, l+v-jamoTBase) + default: + b[k] = b[i] + k++ + } + } + } + rb.nrune = k +} + +// compose recombines the runes in the buffer. +// It should only be used to recompose a single segment, as it will not +// handle alternations between Hangul and non-Hangul characters correctly. +func (rb *reorderBuffer) compose() { + // UAX #15, section X5 , including Corrigendum #5 + // "In any character sequence beginning with starter S, a character C is + // blocked from S if and only if there is some character B between S + // and C, and either B is a starter or it has the same or higher + // combining class as C." + bn := rb.nrune + if bn == 0 { + return + } + k := 1 + b := rb.rune[:] + for s, i := 0, 1; i < bn; i++ { + if isJamoVT(rb.bytesAt(i)) { + // Redo from start in Hangul mode. Necessary to support + // U+320E..U+321E in NFKC mode. + rb.combineHangul(s, i, k) + return + } + ii := b[i] + // We can only use combineForward as a filter if we later + // get the info for the combined character. This is more + // expensive than using the filter. Using combinesBackward() + // is safe. + if ii.combinesBackward() { + cccB := b[k-1].ccc + cccC := ii.ccc + blocked := false // b[i] blocked by starter or greater or equal CCC? + if cccB == 0 { + s = k - 1 + } else { + blocked = s != k-1 && cccB >= cccC + } + if !blocked { + combined := combine(rb.runeAt(s), rb.runeAt(i)) + if combined != 0 { + rb.assignRune(s, combined) + continue + } + } + } + b[k] = b[i] + k++ + } + rb.nrune = k +} diff --git a/vendor/golang.org/x/text/unicode/norm/forminfo.go b/vendor/golang.org/x/text/unicode/norm/forminfo.go new file mode 100644 index 0000000..e67e765 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/forminfo.go @@ -0,0 +1,259 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +// This file contains Form-specific logic and wrappers for data in tables.go. + +// Rune info is stored in a separate trie per composing form. A composing form +// and its corresponding decomposing form share the same trie. Each trie maps +// a rune to a uint16. The values take two forms. For v >= 0x8000: +// bits +// 15: 1 (inverse of NFD_QC bit of qcInfo) +// 13..7: qcInfo (see below). isYesD is always true (no decompostion). +// 6..0: ccc (compressed CCC value). +// For v < 0x8000, the respective rune has a decomposition and v is an index +// into a byte array of UTF-8 decomposition sequences and additional info and +// has the form: +//

* [ []] +// The header contains the number of bytes in the decomposition (excluding this +// length byte). The two most significant bits of this length byte correspond +// to bit 5 and 4 of qcInfo (see below). The byte sequence itself starts at v+1. +// The byte sequence is followed by a trailing and leading CCC if the values +// for these are not zero. The value of v determines which ccc are appended +// to the sequences. For v < firstCCC, there are none, for v >= firstCCC, +// the sequence is followed by a trailing ccc, and for v >= firstLeadingCC +// there is an additional leading ccc. The value of tccc itself is the +// trailing CCC shifted left 2 bits. The two least-significant bits of tccc +// are the number of trailing non-starters. + +const ( + qcInfoMask = 0x3F // to clear all but the relevant bits in a qcInfo + headerLenMask = 0x3F // extract the length value from the header byte + headerFlagsMask = 0xC0 // extract the qcInfo bits from the header byte +) + +// Properties provides access to normalization properties of a rune. +type Properties struct { + pos uint8 // start position in reorderBuffer; used in composition.go + size uint8 // length of UTF-8 encoding of this rune + ccc uint8 // leading canonical combining class (ccc if not decomposition) + tccc uint8 // trailing canonical combining class (ccc if not decomposition) + nLead uint8 // number of leading non-starters. + flags qcInfo // quick check flags + index uint16 +} + +// functions dispatchable per form +type lookupFunc func(b input, i int) Properties + +// formInfo holds Form-specific functions and tables. +type formInfo struct { + form Form + composing, compatibility bool // form type + info lookupFunc + nextMain iterFunc +} + +var formTable = []*formInfo{{ + form: NFC, + composing: true, + compatibility: false, + info: lookupInfoNFC, + nextMain: nextComposed, +}, { + form: NFD, + composing: false, + compatibility: false, + info: lookupInfoNFC, + nextMain: nextDecomposed, +}, { + form: NFKC, + composing: true, + compatibility: true, + info: lookupInfoNFKC, + nextMain: nextComposed, +}, { + form: NFKD, + composing: false, + compatibility: true, + info: lookupInfoNFKC, + nextMain: nextDecomposed, +}} + +// We do not distinguish between boundaries for NFC, NFD, etc. to avoid +// unexpected behavior for the user. For example, in NFD, there is a boundary +// after 'a'. However, 'a' might combine with modifiers, so from the application's +// perspective it is not a good boundary. We will therefore always use the +// boundaries for the combining variants. + +// BoundaryBefore returns true if this rune starts a new segment and +// cannot combine with any rune on the left. +func (p Properties) BoundaryBefore() bool { + if p.ccc == 0 && !p.combinesBackward() { + return true + } + // We assume that the CCC of the first character in a decomposition + // is always non-zero if different from info.ccc and that we can return + // false at this point. This is verified by maketables. + return false +} + +// BoundaryAfter returns true if runes cannot combine with or otherwise +// interact with this or previous runes. +func (p Properties) BoundaryAfter() bool { + // TODO: loosen these conditions. + return p.isInert() +} + +// We pack quick check data in 4 bits: +// 5: Combines forward (0 == false, 1 == true) +// 4..3: NFC_QC Yes(00), No (10), or Maybe (11) +// 2: NFD_QC Yes (0) or No (1). No also means there is a decomposition. +// 1..0: Number of trailing non-starters. +// +// When all 4 bits are zero, the character is inert, meaning it is never +// influenced by normalization. +type qcInfo uint8 + +func (p Properties) isYesC() bool { return p.flags&0x10 == 0 } +func (p Properties) isYesD() bool { return p.flags&0x4 == 0 } + +func (p Properties) combinesForward() bool { return p.flags&0x20 != 0 } +func (p Properties) combinesBackward() bool { return p.flags&0x8 != 0 } // == isMaybe +func (p Properties) hasDecomposition() bool { return p.flags&0x4 != 0 } // == isNoD + +func (p Properties) isInert() bool { + return p.flags&qcInfoMask == 0 && p.ccc == 0 +} + +func (p Properties) multiSegment() bool { + return p.index >= firstMulti && p.index < endMulti +} + +func (p Properties) nLeadingNonStarters() uint8 { + return p.nLead +} + +func (p Properties) nTrailingNonStarters() uint8 { + return uint8(p.flags & 0x03) +} + +// Decomposition returns the decomposition for the underlying rune +// or nil if there is none. +func (p Properties) Decomposition() []byte { + // TODO: create the decomposition for Hangul? + if p.index == 0 { + return nil + } + i := p.index + n := decomps[i] & headerLenMask + i++ + return decomps[i : i+uint16(n)] +} + +// Size returns the length of UTF-8 encoding of the rune. +func (p Properties) Size() int { + return int(p.size) +} + +// CCC returns the canonical combining class of the underlying rune. +func (p Properties) CCC() uint8 { + if p.index >= firstCCCZeroExcept { + return 0 + } + return ccc[p.ccc] +} + +// LeadCCC returns the CCC of the first rune in the decomposition. +// If there is no decomposition, LeadCCC equals CCC. +func (p Properties) LeadCCC() uint8 { + return ccc[p.ccc] +} + +// TrailCCC returns the CCC of the last rune in the decomposition. +// If there is no decomposition, TrailCCC equals CCC. +func (p Properties) TrailCCC() uint8 { + return ccc[p.tccc] +} + +// Recomposition +// We use 32-bit keys instead of 64-bit for the two codepoint keys. +// This clips off the bits of three entries, but we know this will not +// result in a collision. In the unlikely event that changes to +// UnicodeData.txt introduce collisions, the compiler will catch it. +// Note that the recomposition map for NFC and NFKC are identical. + +// combine returns the combined rune or 0 if it doesn't exist. +func combine(a, b rune) rune { + key := uint32(uint16(a))<<16 + uint32(uint16(b)) + return recompMap[key] +} + +func lookupInfoNFC(b input, i int) Properties { + v, sz := b.charinfoNFC(i) + return compInfo(v, sz) +} + +func lookupInfoNFKC(b input, i int) Properties { + v, sz := b.charinfoNFKC(i) + return compInfo(v, sz) +} + +// Properties returns properties for the first rune in s. +func (f Form) Properties(s []byte) Properties { + if f == NFC || f == NFD { + return compInfo(nfcData.lookup(s)) + } + return compInfo(nfkcData.lookup(s)) +} + +// PropertiesString returns properties for the first rune in s. +func (f Form) PropertiesString(s string) Properties { + if f == NFC || f == NFD { + return compInfo(nfcData.lookupString(s)) + } + return compInfo(nfkcData.lookupString(s)) +} + +// compInfo converts the information contained in v and sz +// to a Properties. See the comment at the top of the file +// for more information on the format. +func compInfo(v uint16, sz int) Properties { + if v == 0 { + return Properties{size: uint8(sz)} + } else if v >= 0x8000 { + p := Properties{ + size: uint8(sz), + ccc: uint8(v), + tccc: uint8(v), + flags: qcInfo(v >> 8), + } + if p.ccc > 0 || p.combinesBackward() { + p.nLead = uint8(p.flags & 0x3) + } + return p + } + // has decomposition + h := decomps[v] + f := (qcInfo(h&headerFlagsMask) >> 2) | 0x4 + p := Properties{size: uint8(sz), flags: f, index: v} + if v >= firstCCC { + v += uint16(h&headerLenMask) + 1 + c := decomps[v] + p.tccc = c >> 2 + p.flags |= qcInfo(c & 0x3) + if v >= firstLeadingCCC { + p.nLead = c & 0x3 + if v >= firstStarterWithNLead { + // We were tricked. Remove the decomposition. + p.flags &= 0x03 + p.index = 0 + return p + } + p.ccc = decomps[v+1] + } + } + return p +} diff --git a/vendor/golang.org/x/text/unicode/norm/input.go b/vendor/golang.org/x/text/unicode/norm/input.go new file mode 100644 index 0000000..479e35b --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/input.go @@ -0,0 +1,109 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +import "unicode/utf8" + +type input struct { + str string + bytes []byte +} + +func inputBytes(str []byte) input { + return input{bytes: str} +} + +func inputString(str string) input { + return input{str: str} +} + +func (in *input) setBytes(str []byte) { + in.str = "" + in.bytes = str +} + +func (in *input) setString(str string) { + in.str = str + in.bytes = nil +} + +func (in *input) _byte(p int) byte { + if in.bytes == nil { + return in.str[p] + } + return in.bytes[p] +} + +func (in *input) skipASCII(p, max int) int { + if in.bytes == nil { + for ; p < max && in.str[p] < utf8.RuneSelf; p++ { + } + } else { + for ; p < max && in.bytes[p] < utf8.RuneSelf; p++ { + } + } + return p +} + +func (in *input) skipContinuationBytes(p int) int { + if in.bytes == nil { + for ; p < len(in.str) && !utf8.RuneStart(in.str[p]); p++ { + } + } else { + for ; p < len(in.bytes) && !utf8.RuneStart(in.bytes[p]); p++ { + } + } + return p +} + +func (in *input) appendSlice(buf []byte, b, e int) []byte { + if in.bytes != nil { + return append(buf, in.bytes[b:e]...) + } + for i := b; i < e; i++ { + buf = append(buf, in.str[i]) + } + return buf +} + +func (in *input) copySlice(buf []byte, b, e int) int { + if in.bytes == nil { + return copy(buf, in.str[b:e]) + } + return copy(buf, in.bytes[b:e]) +} + +func (in *input) charinfoNFC(p int) (uint16, int) { + if in.bytes == nil { + return nfcData.lookupString(in.str[p:]) + } + return nfcData.lookup(in.bytes[p:]) +} + +func (in *input) charinfoNFKC(p int) (uint16, int) { + if in.bytes == nil { + return nfkcData.lookupString(in.str[p:]) + } + return nfkcData.lookup(in.bytes[p:]) +} + +func (in *input) hangul(p int) (r rune) { + var size int + if in.bytes == nil { + if !isHangulString(in.str[p:]) { + return 0 + } + r, size = utf8.DecodeRuneInString(in.str[p:]) + } else { + if !isHangul(in.bytes[p:]) { + return 0 + } + r, size = utf8.DecodeRune(in.bytes[p:]) + } + if size != hangulUTF8Size { + return 0 + } + return r +} diff --git a/vendor/golang.org/x/text/unicode/norm/iter.go b/vendor/golang.org/x/text/unicode/norm/iter.go new file mode 100644 index 0000000..ce17f96 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/iter.go @@ -0,0 +1,457 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +import ( + "fmt" + "unicode/utf8" +) + +// MaxSegmentSize is the maximum size of a byte buffer needed to consider any +// sequence of starter and non-starter runes for the purpose of normalization. +const MaxSegmentSize = maxByteBufferSize + +// An Iter iterates over a string or byte slice, while normalizing it +// to a given Form. +type Iter struct { + rb reorderBuffer + buf [maxByteBufferSize]byte + info Properties // first character saved from previous iteration + next iterFunc // implementation of next depends on form + asciiF iterFunc + + p int // current position in input source + multiSeg []byte // remainder of multi-segment decomposition +} + +type iterFunc func(*Iter) []byte + +// Init initializes i to iterate over src after normalizing it to Form f. +func (i *Iter) Init(f Form, src []byte) { + i.p = 0 + if len(src) == 0 { + i.setDone() + i.rb.nsrc = 0 + return + } + i.multiSeg = nil + i.rb.init(f, src) + i.next = i.rb.f.nextMain + i.asciiF = nextASCIIBytes + i.info = i.rb.f.info(i.rb.src, i.p) + i.rb.ss.first(i.info) +} + +// InitString initializes i to iterate over src after normalizing it to Form f. +func (i *Iter) InitString(f Form, src string) { + i.p = 0 + if len(src) == 0 { + i.setDone() + i.rb.nsrc = 0 + return + } + i.multiSeg = nil + i.rb.initString(f, src) + i.next = i.rb.f.nextMain + i.asciiF = nextASCIIString + i.info = i.rb.f.info(i.rb.src, i.p) + i.rb.ss.first(i.info) +} + +// Seek sets the segment to be returned by the next call to Next to start +// at position p. It is the responsibility of the caller to set p to the +// start of a segment. +func (i *Iter) Seek(offset int64, whence int) (int64, error) { + var abs int64 + switch whence { + case 0: + abs = offset + case 1: + abs = int64(i.p) + offset + case 2: + abs = int64(i.rb.nsrc) + offset + default: + return 0, fmt.Errorf("norm: invalid whence") + } + if abs < 0 { + return 0, fmt.Errorf("norm: negative position") + } + if int(abs) >= i.rb.nsrc { + i.setDone() + return int64(i.p), nil + } + i.p = int(abs) + i.multiSeg = nil + i.next = i.rb.f.nextMain + i.info = i.rb.f.info(i.rb.src, i.p) + i.rb.ss.first(i.info) + return abs, nil +} + +// returnSlice returns a slice of the underlying input type as a byte slice. +// If the underlying is of type []byte, it will simply return a slice. +// If the underlying is of type string, it will copy the slice to the buffer +// and return that. +func (i *Iter) returnSlice(a, b int) []byte { + if i.rb.src.bytes == nil { + return i.buf[:copy(i.buf[:], i.rb.src.str[a:b])] + } + return i.rb.src.bytes[a:b] +} + +// Pos returns the byte position at which the next call to Next will commence processing. +func (i *Iter) Pos() int { + return i.p +} + +func (i *Iter) setDone() { + i.next = nextDone + i.p = i.rb.nsrc +} + +// Done returns true if there is no more input to process. +func (i *Iter) Done() bool { + return i.p >= i.rb.nsrc +} + +// Next returns f(i.input[i.Pos():n]), where n is a boundary of i.input. +// For any input a and b for which f(a) == f(b), subsequent calls +// to Next will return the same segments. +// Modifying runes are grouped together with the preceding starter, if such a starter exists. +// Although not guaranteed, n will typically be the smallest possible n. +func (i *Iter) Next() []byte { + return i.next(i) +} + +func nextASCIIBytes(i *Iter) []byte { + p := i.p + 1 + if p >= i.rb.nsrc { + i.setDone() + return i.rb.src.bytes[i.p:p] + } + if i.rb.src.bytes[p] < utf8.RuneSelf { + p0 := i.p + i.p = p + return i.rb.src.bytes[p0:p] + } + i.info = i.rb.f.info(i.rb.src, i.p) + i.next = i.rb.f.nextMain + return i.next(i) +} + +func nextASCIIString(i *Iter) []byte { + p := i.p + 1 + if p >= i.rb.nsrc { + i.buf[0] = i.rb.src.str[i.p] + i.setDone() + return i.buf[:1] + } + if i.rb.src.str[p] < utf8.RuneSelf { + i.buf[0] = i.rb.src.str[i.p] + i.p = p + return i.buf[:1] + } + i.info = i.rb.f.info(i.rb.src, i.p) + i.next = i.rb.f.nextMain + return i.next(i) +} + +func nextHangul(i *Iter) []byte { + p := i.p + next := p + hangulUTF8Size + if next >= i.rb.nsrc { + i.setDone() + } else if i.rb.src.hangul(next) == 0 { + i.rb.ss.next(i.info) + i.info = i.rb.f.info(i.rb.src, i.p) + i.next = i.rb.f.nextMain + return i.next(i) + } + i.p = next + return i.buf[:decomposeHangul(i.buf[:], i.rb.src.hangul(p))] +} + +func nextDone(i *Iter) []byte { + return nil +} + +// nextMulti is used for iterating over multi-segment decompositions +// for decomposing normal forms. +func nextMulti(i *Iter) []byte { + j := 0 + d := i.multiSeg + // skip first rune + for j = 1; j < len(d) && !utf8.RuneStart(d[j]); j++ { + } + for j < len(d) { + info := i.rb.f.info(input{bytes: d}, j) + if info.BoundaryBefore() { + i.multiSeg = d[j:] + return d[:j] + } + j += int(info.size) + } + // treat last segment as normal decomposition + i.next = i.rb.f.nextMain + return i.next(i) +} + +// nextMultiNorm is used for iterating over multi-segment decompositions +// for composing normal forms. +func nextMultiNorm(i *Iter) []byte { + j := 0 + d := i.multiSeg + for j < len(d) { + info := i.rb.f.info(input{bytes: d}, j) + if info.BoundaryBefore() { + i.rb.compose() + seg := i.buf[:i.rb.flushCopy(i.buf[:])] + i.rb.insertUnsafe(input{bytes: d}, j, info) + i.multiSeg = d[j+int(info.size):] + return seg + } + i.rb.insertUnsafe(input{bytes: d}, j, info) + j += int(info.size) + } + i.multiSeg = nil + i.next = nextComposed + return doNormComposed(i) +} + +// nextDecomposed is the implementation of Next for forms NFD and NFKD. +func nextDecomposed(i *Iter) (next []byte) { + outp := 0 + inCopyStart, outCopyStart := i.p, 0 + for { + if sz := int(i.info.size); sz <= 1 { + i.rb.ss = 0 + p := i.p + i.p++ // ASCII or illegal byte. Either way, advance by 1. + if i.p >= i.rb.nsrc { + i.setDone() + return i.returnSlice(p, i.p) + } else if i.rb.src._byte(i.p) < utf8.RuneSelf { + i.next = i.asciiF + return i.returnSlice(p, i.p) + } + outp++ + } else if d := i.info.Decomposition(); d != nil { + // Note: If leading CCC != 0, then len(d) == 2 and last is also non-zero. + // Case 1: there is a leftover to copy. In this case the decomposition + // must begin with a modifier and should always be appended. + // Case 2: no leftover. Simply return d if followed by a ccc == 0 value. + p := outp + len(d) + if outp > 0 { + i.rb.src.copySlice(i.buf[outCopyStart:], inCopyStart, i.p) + // TODO: this condition should not be possible, but we leave it + // in for defensive purposes. + if p > len(i.buf) { + return i.buf[:outp] + } + } else if i.info.multiSegment() { + // outp must be 0 as multi-segment decompositions always + // start a new segment. + if i.multiSeg == nil { + i.multiSeg = d + i.next = nextMulti + return nextMulti(i) + } + // We are in the last segment. Treat as normal decomposition. + d = i.multiSeg + i.multiSeg = nil + p = len(d) + } + prevCC := i.info.tccc + if i.p += sz; i.p >= i.rb.nsrc { + i.setDone() + i.info = Properties{} // Force BoundaryBefore to succeed. + } else { + i.info = i.rb.f.info(i.rb.src, i.p) + } + switch i.rb.ss.next(i.info) { + case ssOverflow: + i.next = nextCGJDecompose + fallthrough + case ssStarter: + if outp > 0 { + copy(i.buf[outp:], d) + return i.buf[:p] + } + return d + } + copy(i.buf[outp:], d) + outp = p + inCopyStart, outCopyStart = i.p, outp + if i.info.ccc < prevCC { + goto doNorm + } + continue + } else if r := i.rb.src.hangul(i.p); r != 0 { + outp = decomposeHangul(i.buf[:], r) + i.p += hangulUTF8Size + inCopyStart, outCopyStart = i.p, outp + if i.p >= i.rb.nsrc { + i.setDone() + break + } else if i.rb.src.hangul(i.p) != 0 { + i.next = nextHangul + return i.buf[:outp] + } + } else { + p := outp + sz + if p > len(i.buf) { + break + } + outp = p + i.p += sz + } + if i.p >= i.rb.nsrc { + i.setDone() + break + } + prevCC := i.info.tccc + i.info = i.rb.f.info(i.rb.src, i.p) + if v := i.rb.ss.next(i.info); v == ssStarter { + break + } else if v == ssOverflow { + i.next = nextCGJDecompose + break + } + if i.info.ccc < prevCC { + goto doNorm + } + } + if outCopyStart == 0 { + return i.returnSlice(inCopyStart, i.p) + } else if inCopyStart < i.p { + i.rb.src.copySlice(i.buf[outCopyStart:], inCopyStart, i.p) + } + return i.buf[:outp] +doNorm: + // Insert what we have decomposed so far in the reorderBuffer. + // As we will only reorder, there will always be enough room. + i.rb.src.copySlice(i.buf[outCopyStart:], inCopyStart, i.p) + i.rb.insertDecomposed(i.buf[0:outp]) + return doNormDecomposed(i) +} + +func doNormDecomposed(i *Iter) []byte { + for { + i.rb.insertUnsafe(i.rb.src, i.p, i.info) + if i.p += int(i.info.size); i.p >= i.rb.nsrc { + i.setDone() + break + } + i.info = i.rb.f.info(i.rb.src, i.p) + if i.info.ccc == 0 { + break + } + if s := i.rb.ss.next(i.info); s == ssOverflow { + i.next = nextCGJDecompose + break + } + } + // new segment or too many combining characters: exit normalization + return i.buf[:i.rb.flushCopy(i.buf[:])] +} + +func nextCGJDecompose(i *Iter) []byte { + i.rb.ss = 0 + i.rb.insertCGJ() + i.next = nextDecomposed + i.rb.ss.first(i.info) + buf := doNormDecomposed(i) + return buf +} + +// nextComposed is the implementation of Next for forms NFC and NFKC. +func nextComposed(i *Iter) []byte { + outp, startp := 0, i.p + var prevCC uint8 + for { + if !i.info.isYesC() { + goto doNorm + } + prevCC = i.info.tccc + sz := int(i.info.size) + if sz == 0 { + sz = 1 // illegal rune: copy byte-by-byte + } + p := outp + sz + if p > len(i.buf) { + break + } + outp = p + i.p += sz + if i.p >= i.rb.nsrc { + i.setDone() + break + } else if i.rb.src._byte(i.p) < utf8.RuneSelf { + i.rb.ss = 0 + i.next = i.asciiF + break + } + i.info = i.rb.f.info(i.rb.src, i.p) + if v := i.rb.ss.next(i.info); v == ssStarter { + break + } else if v == ssOverflow { + i.next = nextCGJCompose + break + } + if i.info.ccc < prevCC { + goto doNorm + } + } + return i.returnSlice(startp, i.p) +doNorm: + // reset to start position + i.p = startp + i.info = i.rb.f.info(i.rb.src, i.p) + i.rb.ss.first(i.info) + if i.info.multiSegment() { + d := i.info.Decomposition() + info := i.rb.f.info(input{bytes: d}, 0) + i.rb.insertUnsafe(input{bytes: d}, 0, info) + i.multiSeg = d[int(info.size):] + i.next = nextMultiNorm + return nextMultiNorm(i) + } + i.rb.ss.first(i.info) + i.rb.insertUnsafe(i.rb.src, i.p, i.info) + return doNormComposed(i) +} + +func doNormComposed(i *Iter) []byte { + // First rune should already be inserted. + for { + if i.p += int(i.info.size); i.p >= i.rb.nsrc { + i.setDone() + break + } + i.info = i.rb.f.info(i.rb.src, i.p) + if s := i.rb.ss.next(i.info); s == ssStarter { + break + } else if s == ssOverflow { + i.next = nextCGJCompose + break + } + i.rb.insertUnsafe(i.rb.src, i.p, i.info) + } + i.rb.compose() + seg := i.buf[:i.rb.flushCopy(i.buf[:])] + return seg +} + +func nextCGJCompose(i *Iter) []byte { + i.rb.ss = 0 // instead of first + i.rb.insertCGJ() + i.next = nextComposed + // Note that we treat any rune with nLeadingNonStarters > 0 as a non-starter, + // even if they are not. This is particularly dubious for U+FF9E and UFF9A. + // If we ever change that, insert a check here. + i.rb.ss.first(i.info) + i.rb.insertUnsafe(i.rb.src, i.p, i.info) + return doNormComposed(i) +} diff --git a/vendor/golang.org/x/text/unicode/norm/maketables.go b/vendor/golang.org/x/text/unicode/norm/maketables.go new file mode 100644 index 0000000..8d41816 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/maketables.go @@ -0,0 +1,976 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +// Normalization table generator. +// Data read from the web. +// See forminfo.go for a description of the trie values associated with each rune. + +package main + +import ( + "bytes" + "flag" + "fmt" + "io" + "log" + "sort" + "strconv" + "strings" + + "golang.org/x/text/internal/gen" + "golang.org/x/text/internal/triegen" + "golang.org/x/text/internal/ucd" +) + +func main() { + gen.Init() + loadUnicodeData() + compactCCC() + loadCompositionExclusions() + completeCharFields(FCanonical) + completeCharFields(FCompatibility) + computeNonStarterCounts() + verifyComputed() + printChars() + testDerived() + printTestdata() + makeTables() +} + +var ( + tablelist = flag.String("tables", + "all", + "comma-separated list of which tables to generate; "+ + "can be 'decomp', 'recomp', 'info' and 'all'") + test = flag.Bool("test", + false, + "test existing tables against DerivedNormalizationProps and generate test data for regression testing") + verbose = flag.Bool("verbose", + false, + "write data to stdout as it is parsed") +) + +const MaxChar = 0x10FFFF // anything above this shouldn't exist + +// Quick Check properties of runes allow us to quickly +// determine whether a rune may occur in a normal form. +// For a given normal form, a rune may be guaranteed to occur +// verbatim (QC=Yes), may or may not combine with another +// rune (QC=Maybe), or may not occur (QC=No). +type QCResult int + +const ( + QCUnknown QCResult = iota + QCYes + QCNo + QCMaybe +) + +func (r QCResult) String() string { + switch r { + case QCYes: + return "Yes" + case QCNo: + return "No" + case QCMaybe: + return "Maybe" + } + return "***UNKNOWN***" +} + +const ( + FCanonical = iota // NFC or NFD + FCompatibility // NFKC or NFKD + FNumberOfFormTypes +) + +const ( + MComposed = iota // NFC or NFKC + MDecomposed // NFD or NFKD + MNumberOfModes +) + +// This contains only the properties we're interested in. +type Char struct { + name string + codePoint rune // if zero, this index is not a valid code point. + ccc uint8 // canonical combining class + origCCC uint8 + excludeInComp bool // from CompositionExclusions.txt + compatDecomp bool // it has a compatibility expansion + + nTrailingNonStarters uint8 + nLeadingNonStarters uint8 // must be equal to trailing if non-zero + + forms [FNumberOfFormTypes]FormInfo // For FCanonical and FCompatibility + + state State +} + +var chars = make([]Char, MaxChar+1) +var cccMap = make(map[uint8]uint8) + +func (c Char) String() string { + buf := new(bytes.Buffer) + + fmt.Fprintf(buf, "%U [%s]:\n", c.codePoint, c.name) + fmt.Fprintf(buf, " ccc: %v\n", c.ccc) + fmt.Fprintf(buf, " excludeInComp: %v\n", c.excludeInComp) + fmt.Fprintf(buf, " compatDecomp: %v\n", c.compatDecomp) + fmt.Fprintf(buf, " state: %v\n", c.state) + fmt.Fprintf(buf, " NFC:\n") + fmt.Fprint(buf, c.forms[FCanonical]) + fmt.Fprintf(buf, " NFKC:\n") + fmt.Fprint(buf, c.forms[FCompatibility]) + + return buf.String() +} + +// In UnicodeData.txt, some ranges are marked like this: +// 3400;;Lo;0;L;;;;;N;;;;; +// 4DB5;;Lo;0;L;;;;;N;;;;; +// parseCharacter keeps a state variable indicating the weirdness. +type State int + +const ( + SNormal State = iota // known to be zero for the type + SFirst + SLast + SMissing +) + +var lastChar = rune('\u0000') + +func (c Char) isValid() bool { + return c.codePoint != 0 && c.state != SMissing +} + +type FormInfo struct { + quickCheck [MNumberOfModes]QCResult // index: MComposed or MDecomposed + verified [MNumberOfModes]bool // index: MComposed or MDecomposed + + combinesForward bool // May combine with rune on the right + combinesBackward bool // May combine with rune on the left + isOneWay bool // Never appears in result + inDecomp bool // Some decompositions result in this char. + decomp Decomposition + expandedDecomp Decomposition +} + +func (f FormInfo) String() string { + buf := bytes.NewBuffer(make([]byte, 0)) + + fmt.Fprintf(buf, " quickCheck[C]: %v\n", f.quickCheck[MComposed]) + fmt.Fprintf(buf, " quickCheck[D]: %v\n", f.quickCheck[MDecomposed]) + fmt.Fprintf(buf, " cmbForward: %v\n", f.combinesForward) + fmt.Fprintf(buf, " cmbBackward: %v\n", f.combinesBackward) + fmt.Fprintf(buf, " isOneWay: %v\n", f.isOneWay) + fmt.Fprintf(buf, " inDecomp: %v\n", f.inDecomp) + fmt.Fprintf(buf, " decomposition: %X\n", f.decomp) + fmt.Fprintf(buf, " expandedDecomp: %X\n", f.expandedDecomp) + + return buf.String() +} + +type Decomposition []rune + +func parseDecomposition(s string, skipfirst bool) (a []rune, err error) { + decomp := strings.Split(s, " ") + if len(decomp) > 0 && skipfirst { + decomp = decomp[1:] + } + for _, d := range decomp { + point, err := strconv.ParseUint(d, 16, 64) + if err != nil { + return a, err + } + a = append(a, rune(point)) + } + return a, nil +} + +func loadUnicodeData() { + f := gen.OpenUCDFile("UnicodeData.txt") + defer f.Close() + p := ucd.New(f) + for p.Next() { + r := p.Rune(ucd.CodePoint) + char := &chars[r] + + char.ccc = uint8(p.Uint(ucd.CanonicalCombiningClass)) + decmap := p.String(ucd.DecompMapping) + + exp, err := parseDecomposition(decmap, false) + isCompat := false + if err != nil { + if len(decmap) > 0 { + exp, err = parseDecomposition(decmap, true) + if err != nil { + log.Fatalf(`%U: bad decomp |%v|: "%s"`, r, decmap, err) + } + isCompat = true + } + } + + char.name = p.String(ucd.Name) + char.codePoint = r + char.forms[FCompatibility].decomp = exp + if !isCompat { + char.forms[FCanonical].decomp = exp + } else { + char.compatDecomp = true + } + if len(decmap) > 0 { + char.forms[FCompatibility].decomp = exp + } + } + if err := p.Err(); err != nil { + log.Fatal(err) + } +} + +// compactCCC converts the sparse set of CCC values to a continguous one, +// reducing the number of bits needed from 8 to 6. +func compactCCC() { + m := make(map[uint8]uint8) + for i := range chars { + c := &chars[i] + m[c.ccc] = 0 + } + cccs := []int{} + for v, _ := range m { + cccs = append(cccs, int(v)) + } + sort.Ints(cccs) + for i, c := range cccs { + cccMap[uint8(i)] = uint8(c) + m[uint8(c)] = uint8(i) + } + for i := range chars { + c := &chars[i] + c.origCCC = c.ccc + c.ccc = m[c.ccc] + } + if len(m) >= 1<<6 { + log.Fatalf("too many difference CCC values: %d >= 64", len(m)) + } +} + +// CompositionExclusions.txt has form: +// 0958 # ... +// See http://unicode.org/reports/tr44/ for full explanation +func loadCompositionExclusions() { + f := gen.OpenUCDFile("CompositionExclusions.txt") + defer f.Close() + p := ucd.New(f) + for p.Next() { + c := &chars[p.Rune(0)] + if c.excludeInComp { + log.Fatalf("%U: Duplicate entry in exclusions.", c.codePoint) + } + c.excludeInComp = true + } + if e := p.Err(); e != nil { + log.Fatal(e) + } +} + +// hasCompatDecomp returns true if any of the recursive +// decompositions contains a compatibility expansion. +// In this case, the character may not occur in NFK*. +func hasCompatDecomp(r rune) bool { + c := &chars[r] + if c.compatDecomp { + return true + } + for _, d := range c.forms[FCompatibility].decomp { + if hasCompatDecomp(d) { + return true + } + } + return false +} + +// Hangul related constants. +const ( + HangulBase = 0xAC00 + HangulEnd = 0xD7A4 // hangulBase + Jamo combinations (19 * 21 * 28) + + JamoLBase = 0x1100 + JamoLEnd = 0x1113 + JamoVBase = 0x1161 + JamoVEnd = 0x1176 + JamoTBase = 0x11A8 + JamoTEnd = 0x11C3 + + JamoLVTCount = 19 * 21 * 28 + JamoTCount = 28 +) + +func isHangul(r rune) bool { + return HangulBase <= r && r < HangulEnd +} + +func isHangulWithoutJamoT(r rune) bool { + if !isHangul(r) { + return false + } + r -= HangulBase + return r < JamoLVTCount && r%JamoTCount == 0 +} + +func ccc(r rune) uint8 { + return chars[r].ccc +} + +// Insert a rune in a buffer, ordered by Canonical Combining Class. +func insertOrdered(b Decomposition, r rune) Decomposition { + n := len(b) + b = append(b, 0) + cc := ccc(r) + if cc > 0 { + // Use bubble sort. + for ; n > 0; n-- { + if ccc(b[n-1]) <= cc { + break + } + b[n] = b[n-1] + } + } + b[n] = r + return b +} + +// Recursively decompose. +func decomposeRecursive(form int, r rune, d Decomposition) Decomposition { + dcomp := chars[r].forms[form].decomp + if len(dcomp) == 0 { + return insertOrdered(d, r) + } + for _, c := range dcomp { + d = decomposeRecursive(form, c, d) + } + return d +} + +func completeCharFields(form int) { + // Phase 0: pre-expand decomposition. + for i := range chars { + f := &chars[i].forms[form] + if len(f.decomp) == 0 { + continue + } + exp := make(Decomposition, 0) + for _, c := range f.decomp { + exp = decomposeRecursive(form, c, exp) + } + f.expandedDecomp = exp + } + + // Phase 1: composition exclusion, mark decomposition. + for i := range chars { + c := &chars[i] + f := &c.forms[form] + + // Marks script-specific exclusions and version restricted. + f.isOneWay = c.excludeInComp + + // Singletons + f.isOneWay = f.isOneWay || len(f.decomp) == 1 + + // Non-starter decompositions + if len(f.decomp) > 1 { + chk := c.ccc != 0 || chars[f.decomp[0]].ccc != 0 + f.isOneWay = f.isOneWay || chk + } + + // Runes that decompose into more than two runes. + f.isOneWay = f.isOneWay || len(f.decomp) > 2 + + if form == FCompatibility { + f.isOneWay = f.isOneWay || hasCompatDecomp(c.codePoint) + } + + for _, r := range f.decomp { + chars[r].forms[form].inDecomp = true + } + } + + // Phase 2: forward and backward combining. + for i := range chars { + c := &chars[i] + f := &c.forms[form] + + if !f.isOneWay && len(f.decomp) == 2 { + f0 := &chars[f.decomp[0]].forms[form] + f1 := &chars[f.decomp[1]].forms[form] + if !f0.isOneWay { + f0.combinesForward = true + } + if !f1.isOneWay { + f1.combinesBackward = true + } + } + if isHangulWithoutJamoT(rune(i)) { + f.combinesForward = true + } + } + + // Phase 3: quick check values. + for i := range chars { + c := &chars[i] + f := &c.forms[form] + + switch { + case len(f.decomp) > 0: + f.quickCheck[MDecomposed] = QCNo + case isHangul(rune(i)): + f.quickCheck[MDecomposed] = QCNo + default: + f.quickCheck[MDecomposed] = QCYes + } + switch { + case f.isOneWay: + f.quickCheck[MComposed] = QCNo + case (i & 0xffff00) == JamoLBase: + f.quickCheck[MComposed] = QCYes + if JamoLBase <= i && i < JamoLEnd { + f.combinesForward = true + } + if JamoVBase <= i && i < JamoVEnd { + f.quickCheck[MComposed] = QCMaybe + f.combinesBackward = true + f.combinesForward = true + } + if JamoTBase <= i && i < JamoTEnd { + f.quickCheck[MComposed] = QCMaybe + f.combinesBackward = true + } + case !f.combinesBackward: + f.quickCheck[MComposed] = QCYes + default: + f.quickCheck[MComposed] = QCMaybe + } + } +} + +func computeNonStarterCounts() { + // Phase 4: leading and trailing non-starter count + for i := range chars { + c := &chars[i] + + runes := []rune{rune(i)} + // We always use FCompatibility so that the CGJ insertion points do not + // change for repeated normalizations with different forms. + if exp := c.forms[FCompatibility].expandedDecomp; len(exp) > 0 { + runes = exp + } + // We consider runes that combine backwards to be non-starters for the + // purpose of Stream-Safe Text Processing. + for _, r := range runes { + if cr := &chars[r]; cr.ccc == 0 && !cr.forms[FCompatibility].combinesBackward { + break + } + c.nLeadingNonStarters++ + } + for i := len(runes) - 1; i >= 0; i-- { + if cr := &chars[runes[i]]; cr.ccc == 0 && !cr.forms[FCompatibility].combinesBackward { + break + } + c.nTrailingNonStarters++ + } + if c.nTrailingNonStarters > 3 { + log.Fatalf("%U: Decomposition with more than 3 (%d) trailing modifiers (%U)", i, c.nTrailingNonStarters, runes) + } + + if isHangul(rune(i)) { + c.nTrailingNonStarters = 2 + if isHangulWithoutJamoT(rune(i)) { + c.nTrailingNonStarters = 1 + } + } + + if l, t := c.nLeadingNonStarters, c.nTrailingNonStarters; l > 0 && l != t { + log.Fatalf("%U: number of leading and trailing non-starters should be equal (%d vs %d)", i, l, t) + } + if t := c.nTrailingNonStarters; t > 3 { + log.Fatalf("%U: number of trailing non-starters is %d > 3", t) + } + } +} + +func printBytes(w io.Writer, b []byte, name string) { + fmt.Fprintf(w, "// %s: %d bytes\n", name, len(b)) + fmt.Fprintf(w, "var %s = [...]byte {", name) + for i, c := range b { + switch { + case i%64 == 0: + fmt.Fprintf(w, "\n// Bytes %x - %x\n", i, i+63) + case i%8 == 0: + fmt.Fprintf(w, "\n") + } + fmt.Fprintf(w, "0x%.2X, ", c) + } + fmt.Fprint(w, "\n}\n\n") +} + +// See forminfo.go for format. +func makeEntry(f *FormInfo, c *Char) uint16 { + e := uint16(0) + if r := c.codePoint; HangulBase <= r && r < HangulEnd { + e |= 0x40 + } + if f.combinesForward { + e |= 0x20 + } + if f.quickCheck[MDecomposed] == QCNo { + e |= 0x4 + } + switch f.quickCheck[MComposed] { + case QCYes: + case QCNo: + e |= 0x10 + case QCMaybe: + e |= 0x18 + default: + log.Fatalf("Illegal quickcheck value %v.", f.quickCheck[MComposed]) + } + e |= uint16(c.nTrailingNonStarters) + return e +} + +// decompSet keeps track of unique decompositions, grouped by whether +// the decomposition is followed by a trailing and/or leading CCC. +type decompSet [7]map[string]bool + +const ( + normalDecomp = iota + firstMulti + firstCCC + endMulti + firstLeadingCCC + firstCCCZeroExcept + firstStarterWithNLead + lastDecomp +) + +var cname = []string{"firstMulti", "firstCCC", "endMulti", "firstLeadingCCC", "firstCCCZeroExcept", "firstStarterWithNLead", "lastDecomp"} + +func makeDecompSet() decompSet { + m := decompSet{} + for i := range m { + m[i] = make(map[string]bool) + } + return m +} +func (m *decompSet) insert(key int, s string) { + m[key][s] = true +} + +func printCharInfoTables(w io.Writer) int { + mkstr := func(r rune, f *FormInfo) (int, string) { + d := f.expandedDecomp + s := string([]rune(d)) + if max := 1 << 6; len(s) >= max { + const msg = "%U: too many bytes in decomposition: %d >= %d" + log.Fatalf(msg, r, len(s), max) + } + head := uint8(len(s)) + if f.quickCheck[MComposed] != QCYes { + head |= 0x40 + } + if f.combinesForward { + head |= 0x80 + } + s = string([]byte{head}) + s + + lccc := ccc(d[0]) + tccc := ccc(d[len(d)-1]) + cc := ccc(r) + if cc != 0 && lccc == 0 && tccc == 0 { + log.Fatalf("%U: trailing and leading ccc are 0 for non-zero ccc %d", r, cc) + } + if tccc < lccc && lccc != 0 { + const msg = "%U: lccc (%d) must be <= tcc (%d)" + log.Fatalf(msg, r, lccc, tccc) + } + index := normalDecomp + nTrail := chars[r].nTrailingNonStarters + nLead := chars[r].nLeadingNonStarters + if tccc > 0 || lccc > 0 || nTrail > 0 { + tccc <<= 2 + tccc |= nTrail + s += string([]byte{tccc}) + index = endMulti + for _, r := range d[1:] { + if ccc(r) == 0 { + index = firstCCC + } + } + if lccc > 0 || nLead > 0 { + s += string([]byte{lccc}) + if index == firstCCC { + log.Fatalf("%U: multi-segment decomposition not supported for decompositions with leading CCC != 0", r) + } + index = firstLeadingCCC + } + if cc != lccc { + if cc != 0 { + log.Fatalf("%U: for lccc != ccc, expected ccc to be 0; was %d", r, cc) + } + index = firstCCCZeroExcept + } + } else if len(d) > 1 { + index = firstMulti + } + return index, s + } + + decompSet := makeDecompSet() + const nLeadStr = "\x00\x01" // 0-byte length and tccc with nTrail. + decompSet.insert(firstStarterWithNLead, nLeadStr) + + // Store the uniqued decompositions in a byte buffer, + // preceded by their byte length. + for _, c := range chars { + for _, f := range c.forms { + if len(f.expandedDecomp) == 0 { + continue + } + if f.combinesBackward { + log.Fatalf("%U: combinesBackward and decompose", c.codePoint) + } + index, s := mkstr(c.codePoint, &f) + decompSet.insert(index, s) + } + } + + decompositions := bytes.NewBuffer(make([]byte, 0, 10000)) + size := 0 + positionMap := make(map[string]uint16) + decompositions.WriteString("\000") + fmt.Fprintln(w, "const (") + for i, m := range decompSet { + sa := []string{} + for s := range m { + sa = append(sa, s) + } + sort.Strings(sa) + for _, s := range sa { + p := decompositions.Len() + decompositions.WriteString(s) + positionMap[s] = uint16(p) + } + if cname[i] != "" { + fmt.Fprintf(w, "%s = 0x%X\n", cname[i], decompositions.Len()) + } + } + fmt.Fprintln(w, "maxDecomp = 0x8000") + fmt.Fprintln(w, ")") + b := decompositions.Bytes() + printBytes(w, b, "decomps") + size += len(b) + + varnames := []string{"nfc", "nfkc"} + for i := 0; i < FNumberOfFormTypes; i++ { + trie := triegen.NewTrie(varnames[i]) + + for r, c := range chars { + f := c.forms[i] + d := f.expandedDecomp + if len(d) != 0 { + _, key := mkstr(c.codePoint, &f) + trie.Insert(rune(r), uint64(positionMap[key])) + if c.ccc != ccc(d[0]) { + // We assume the lead ccc of a decomposition !=0 in this case. + if ccc(d[0]) == 0 { + log.Fatalf("Expected leading CCC to be non-zero; ccc is %d", c.ccc) + } + } + } else if c.nLeadingNonStarters > 0 && len(f.expandedDecomp) == 0 && c.ccc == 0 && !f.combinesBackward { + // Handle cases where it can't be detected that the nLead should be equal + // to nTrail. + trie.Insert(c.codePoint, uint64(positionMap[nLeadStr])) + } else if v := makeEntry(&f, &c)<<8 | uint16(c.ccc); v != 0 { + trie.Insert(c.codePoint, uint64(0x8000|v)) + } + } + sz, err := trie.Gen(w, triegen.Compact(&normCompacter{name: varnames[i]})) + if err != nil { + log.Fatal(err) + } + size += sz + } + return size +} + +func contains(sa []string, s string) bool { + for _, a := range sa { + if a == s { + return true + } + } + return false +} + +func makeTables() { + w := &bytes.Buffer{} + + size := 0 + if *tablelist == "" { + return + } + list := strings.Split(*tablelist, ",") + if *tablelist == "all" { + list = []string{"recomp", "info"} + } + + // Compute maximum decomposition size. + max := 0 + for _, c := range chars { + if n := len(string(c.forms[FCompatibility].expandedDecomp)); n > max { + max = n + } + } + + fmt.Fprintln(w, "const (") + fmt.Fprintln(w, "\t// Version is the Unicode edition from which the tables are derived.") + fmt.Fprintf(w, "\tVersion = %q\n", gen.UnicodeVersion()) + fmt.Fprintln(w) + fmt.Fprintln(w, "\t// MaxTransformChunkSize indicates the maximum number of bytes that Transform") + fmt.Fprintln(w, "\t// may need to write atomically for any Form. Making a destination buffer at") + fmt.Fprintln(w, "\t// least this size ensures that Transform can always make progress and that") + fmt.Fprintln(w, "\t// the user does not need to grow the buffer on an ErrShortDst.") + fmt.Fprintf(w, "\tMaxTransformChunkSize = %d+maxNonStarters*4\n", len(string(0x034F))+max) + fmt.Fprintln(w, ")\n") + + // Print the CCC remap table. + size += len(cccMap) + fmt.Fprintf(w, "var ccc = [%d]uint8{", len(cccMap)) + for i := 0; i < len(cccMap); i++ { + if i%8 == 0 { + fmt.Fprintln(w) + } + fmt.Fprintf(w, "%3d, ", cccMap[uint8(i)]) + } + fmt.Fprintln(w, "\n}\n") + + if contains(list, "info") { + size += printCharInfoTables(w) + } + + if contains(list, "recomp") { + // Note that we use 32 bit keys, instead of 64 bit. + // This clips the bits of three entries, but we know + // this won't cause a collision. The compiler will catch + // any changes made to UnicodeData.txt that introduces + // a collision. + // Note that the recomposition map for NFC and NFKC + // are identical. + + // Recomposition map + nrentries := 0 + for _, c := range chars { + f := c.forms[FCanonical] + if !f.isOneWay && len(f.decomp) > 0 { + nrentries++ + } + } + sz := nrentries * 8 + size += sz + fmt.Fprintf(w, "// recompMap: %d bytes (entries only)\n", sz) + fmt.Fprintln(w, "var recompMap = map[uint32]rune{") + for i, c := range chars { + f := c.forms[FCanonical] + d := f.decomp + if !f.isOneWay && len(d) > 0 { + key := uint32(uint16(d[0]))<<16 + uint32(uint16(d[1])) + fmt.Fprintf(w, "0x%.8X: 0x%.4X,\n", key, i) + } + } + fmt.Fprintf(w, "}\n\n") + } + + fmt.Fprintf(w, "// Total size of tables: %dKB (%d bytes)\n", (size+512)/1024, size) + gen.WriteGoFile("tables.go", "norm", w.Bytes()) +} + +func printChars() { + if *verbose { + for _, c := range chars { + if !c.isValid() || c.state == SMissing { + continue + } + fmt.Println(c) + } + } +} + +// verifyComputed does various consistency tests. +func verifyComputed() { + for i, c := range chars { + for _, f := range c.forms { + isNo := (f.quickCheck[MDecomposed] == QCNo) + if (len(f.decomp) > 0) != isNo && !isHangul(rune(i)) { + log.Fatalf("%U: NF*D QC must be No if rune decomposes", i) + } + + isMaybe := f.quickCheck[MComposed] == QCMaybe + if f.combinesBackward != isMaybe { + log.Fatalf("%U: NF*C QC must be Maybe if combinesBackward", i) + } + if len(f.decomp) > 0 && f.combinesForward && isMaybe { + log.Fatalf("%U: NF*C QC must be Yes or No if combinesForward and decomposes", i) + } + + if len(f.expandedDecomp) != 0 { + continue + } + if a, b := c.nLeadingNonStarters > 0, (c.ccc > 0 || f.combinesBackward); a != b { + // We accept these runes to be treated differently (it only affects + // segment breaking in iteration, most likely on improper use), but + // reconsider if more characters are added. + // U+FF9E HALFWIDTH KATAKANA VOICED SOUND MARK;Lm;0;L; 3099;;;;N;;;;; + // U+FF9F HALFWIDTH KATAKANA SEMI-VOICED SOUND MARK;Lm;0;L; 309A;;;;N;;;;; + // U+3133 HANGUL LETTER KIYEOK-SIOS;Lo;0;L; 11AA;;;;N;HANGUL LETTER GIYEOG SIOS;;;; + // U+318E HANGUL LETTER ARAEAE;Lo;0;L; 11A1;;;;N;HANGUL LETTER ALAE AE;;;; + // U+FFA3 HALFWIDTH HANGUL LETTER KIYEOK-SIOS;Lo;0;L; 3133;;;;N;HALFWIDTH HANGUL LETTER GIYEOG SIOS;;;; + // U+FFDC HALFWIDTH HANGUL LETTER I;Lo;0;L; 3163;;;;N;;;;; + if i != 0xFF9E && i != 0xFF9F && !(0x3133 <= i && i <= 0x318E) && !(0xFFA3 <= i && i <= 0xFFDC) { + log.Fatalf("%U: nLead was %v; want %v", i, a, b) + } + } + } + nfc := c.forms[FCanonical] + nfkc := c.forms[FCompatibility] + if nfc.combinesBackward != nfkc.combinesBackward { + log.Fatalf("%U: Cannot combine combinesBackward\n", c.codePoint) + } + } +} + +// Use values in DerivedNormalizationProps.txt to compare against the +// values we computed. +// DerivedNormalizationProps.txt has form: +// 00C0..00C5 ; NFD_QC; N # ... +// 0374 ; NFD_QC; N # ... +// See http://unicode.org/reports/tr44/ for full explanation +func testDerived() { + f := gen.OpenUCDFile("DerivedNormalizationProps.txt") + defer f.Close() + p := ucd.New(f) + for p.Next() { + r := p.Rune(0) + c := &chars[r] + + var ftype, mode int + qt := p.String(1) + switch qt { + case "NFC_QC": + ftype, mode = FCanonical, MComposed + case "NFD_QC": + ftype, mode = FCanonical, MDecomposed + case "NFKC_QC": + ftype, mode = FCompatibility, MComposed + case "NFKD_QC": + ftype, mode = FCompatibility, MDecomposed + default: + continue + } + var qr QCResult + switch p.String(2) { + case "Y": + qr = QCYes + case "N": + qr = QCNo + case "M": + qr = QCMaybe + default: + log.Fatalf(`Unexpected quick check value "%s"`, p.String(2)) + } + if got := c.forms[ftype].quickCheck[mode]; got != qr { + log.Printf("%U: FAILED %s (was %v need %v)\n", r, qt, got, qr) + } + c.forms[ftype].verified[mode] = true + } + if err := p.Err(); err != nil { + log.Fatal(err) + } + // Any unspecified value must be QCYes. Verify this. + for i, c := range chars { + for j, fd := range c.forms { + for k, qr := range fd.quickCheck { + if !fd.verified[k] && qr != QCYes { + m := "%U: FAIL F:%d M:%d (was %v need Yes) %s\n" + log.Printf(m, i, j, k, qr, c.name) + } + } + } + } +} + +var testHeader = `const ( + Yes = iota + No + Maybe +) + +type formData struct { + qc uint8 + combinesForward bool + decomposition string +} + +type runeData struct { + r rune + ccc uint8 + nLead uint8 + nTrail uint8 + f [2]formData // 0: canonical; 1: compatibility +} + +func f(qc uint8, cf bool, dec string) [2]formData { + return [2]formData{{qc, cf, dec}, {qc, cf, dec}} +} + +func g(qc, qck uint8, cf, cfk bool, d, dk string) [2]formData { + return [2]formData{{qc, cf, d}, {qck, cfk, dk}} +} + +var testData = []runeData{ +` + +func printTestdata() { + type lastInfo struct { + ccc uint8 + nLead uint8 + nTrail uint8 + f string + } + + last := lastInfo{} + w := &bytes.Buffer{} + fmt.Fprintf(w, testHeader) + for r, c := range chars { + f := c.forms[FCanonical] + qc, cf, d := f.quickCheck[MComposed], f.combinesForward, string(f.expandedDecomp) + f = c.forms[FCompatibility] + qck, cfk, dk := f.quickCheck[MComposed], f.combinesForward, string(f.expandedDecomp) + s := "" + if d == dk && qc == qck && cf == cfk { + s = fmt.Sprintf("f(%s, %v, %q)", qc, cf, d) + } else { + s = fmt.Sprintf("g(%s, %s, %v, %v, %q, %q)", qc, qck, cf, cfk, d, dk) + } + current := lastInfo{c.ccc, c.nLeadingNonStarters, c.nTrailingNonStarters, s} + if last != current { + fmt.Fprintf(w, "\t{0x%x, %d, %d, %d, %s},\n", r, c.origCCC, c.nLeadingNonStarters, c.nTrailingNonStarters, s) + last = current + } + } + fmt.Fprintln(w, "}") + gen.WriteGoFile("data_test.go", "norm", w.Bytes()) +} diff --git a/vendor/golang.org/x/text/unicode/norm/normalize.go b/vendor/golang.org/x/text/unicode/norm/normalize.go new file mode 100644 index 0000000..e28ac64 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/normalize.go @@ -0,0 +1,609 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Note: the file data_test.go that is generated should not be checked in. +//go:generate go run maketables.go triegen.go +//go:generate go test -tags test + +// Package norm contains types and functions for normalizing Unicode strings. +package norm // import "golang.org/x/text/unicode/norm" + +import ( + "unicode/utf8" + + "golang.org/x/text/transform" +) + +// A Form denotes a canonical representation of Unicode code points. +// The Unicode-defined normalization and equivalence forms are: +// +// NFC Unicode Normalization Form C +// NFD Unicode Normalization Form D +// NFKC Unicode Normalization Form KC +// NFKD Unicode Normalization Form KD +// +// For a Form f, this documentation uses the notation f(x) to mean +// the bytes or string x converted to the given form. +// A position n in x is called a boundary if conversion to the form can +// proceed independently on both sides: +// f(x) == append(f(x[0:n]), f(x[n:])...) +// +// References: http://unicode.org/reports/tr15/ and +// http://unicode.org/notes/tn5/. +type Form int + +const ( + NFC Form = iota + NFD + NFKC + NFKD +) + +// Bytes returns f(b). May return b if f(b) = b. +func (f Form) Bytes(b []byte) []byte { + src := inputBytes(b) + ft := formTable[f] + n, ok := ft.quickSpan(src, 0, len(b), true) + if ok { + return b + } + out := make([]byte, n, len(b)) + copy(out, b[0:n]) + rb := reorderBuffer{f: *ft, src: src, nsrc: len(b), out: out, flushF: appendFlush} + return doAppendInner(&rb, n) +} + +// String returns f(s). +func (f Form) String(s string) string { + src := inputString(s) + ft := formTable[f] + n, ok := ft.quickSpan(src, 0, len(s), true) + if ok { + return s + } + out := make([]byte, n, len(s)) + copy(out, s[0:n]) + rb := reorderBuffer{f: *ft, src: src, nsrc: len(s), out: out, flushF: appendFlush} + return string(doAppendInner(&rb, n)) +} + +// IsNormal returns true if b == f(b). +func (f Form) IsNormal(b []byte) bool { + src := inputBytes(b) + ft := formTable[f] + bp, ok := ft.quickSpan(src, 0, len(b), true) + if ok { + return true + } + rb := reorderBuffer{f: *ft, src: src, nsrc: len(b)} + rb.setFlusher(nil, cmpNormalBytes) + for bp < len(b) { + rb.out = b[bp:] + if bp = decomposeSegment(&rb, bp, true); bp < 0 { + return false + } + bp, _ = rb.f.quickSpan(rb.src, bp, len(b), true) + } + return true +} + +func cmpNormalBytes(rb *reorderBuffer) bool { + b := rb.out + for i := 0; i < rb.nrune; i++ { + info := rb.rune[i] + if int(info.size) > len(b) { + return false + } + p := info.pos + pe := p + info.size + for ; p < pe; p++ { + if b[0] != rb.byte[p] { + return false + } + b = b[1:] + } + } + return true +} + +// IsNormalString returns true if s == f(s). +func (f Form) IsNormalString(s string) bool { + src := inputString(s) + ft := formTable[f] + bp, ok := ft.quickSpan(src, 0, len(s), true) + if ok { + return true + } + rb := reorderBuffer{f: *ft, src: src, nsrc: len(s)} + rb.setFlusher(nil, func(rb *reorderBuffer) bool { + for i := 0; i < rb.nrune; i++ { + info := rb.rune[i] + if bp+int(info.size) > len(s) { + return false + } + p := info.pos + pe := p + info.size + for ; p < pe; p++ { + if s[bp] != rb.byte[p] { + return false + } + bp++ + } + } + return true + }) + for bp < len(s) { + if bp = decomposeSegment(&rb, bp, true); bp < 0 { + return false + } + bp, _ = rb.f.quickSpan(rb.src, bp, len(s), true) + } + return true +} + +// patchTail fixes a case where a rune may be incorrectly normalized +// if it is followed by illegal continuation bytes. It returns the +// patched buffer and whether the decomposition is still in progress. +func patchTail(rb *reorderBuffer) bool { + info, p := lastRuneStart(&rb.f, rb.out) + if p == -1 || info.size == 0 { + return true + } + end := p + int(info.size) + extra := len(rb.out) - end + if extra > 0 { + // Potentially allocating memory. However, this only + // happens with ill-formed UTF-8. + x := make([]byte, 0) + x = append(x, rb.out[len(rb.out)-extra:]...) + rb.out = rb.out[:end] + decomposeToLastBoundary(rb) + rb.doFlush() + rb.out = append(rb.out, x...) + return false + } + buf := rb.out[p:] + rb.out = rb.out[:p] + decomposeToLastBoundary(rb) + if s := rb.ss.next(info); s == ssStarter { + rb.doFlush() + rb.ss.first(info) + } else if s == ssOverflow { + rb.doFlush() + rb.insertCGJ() + rb.ss = 0 + } + rb.insertUnsafe(inputBytes(buf), 0, info) + return true +} + +func appendQuick(rb *reorderBuffer, i int) int { + if rb.nsrc == i { + return i + } + end, _ := rb.f.quickSpan(rb.src, i, rb.nsrc, true) + rb.out = rb.src.appendSlice(rb.out, i, end) + return end +} + +// Append returns f(append(out, b...)). +// The buffer out must be nil, empty, or equal to f(out). +func (f Form) Append(out []byte, src ...byte) []byte { + return f.doAppend(out, inputBytes(src), len(src)) +} + +func (f Form) doAppend(out []byte, src input, n int) []byte { + if n == 0 { + return out + } + ft := formTable[f] + // Attempt to do a quickSpan first so we can avoid initializing the reorderBuffer. + if len(out) == 0 { + p, _ := ft.quickSpan(src, 0, n, true) + out = src.appendSlice(out, 0, p) + if p == n { + return out + } + rb := reorderBuffer{f: *ft, src: src, nsrc: n, out: out, flushF: appendFlush} + return doAppendInner(&rb, p) + } + rb := reorderBuffer{f: *ft, src: src, nsrc: n} + return doAppend(&rb, out, 0) +} + +func doAppend(rb *reorderBuffer, out []byte, p int) []byte { + rb.setFlusher(out, appendFlush) + src, n := rb.src, rb.nsrc + doMerge := len(out) > 0 + if q := src.skipContinuationBytes(p); q > p { + // Move leading non-starters to destination. + rb.out = src.appendSlice(rb.out, p, q) + p = q + doMerge = patchTail(rb) + } + fd := &rb.f + if doMerge { + var info Properties + if p < n { + info = fd.info(src, p) + if !info.BoundaryBefore() || info.nLeadingNonStarters() > 0 { + if p == 0 { + decomposeToLastBoundary(rb) + } + p = decomposeSegment(rb, p, true) + } + } + if info.size == 0 { + rb.doFlush() + // Append incomplete UTF-8 encoding. + return src.appendSlice(rb.out, p, n) + } + if rb.nrune > 0 { + return doAppendInner(rb, p) + } + } + p = appendQuick(rb, p) + return doAppendInner(rb, p) +} + +func doAppendInner(rb *reorderBuffer, p int) []byte { + for n := rb.nsrc; p < n; { + p = decomposeSegment(rb, p, true) + p = appendQuick(rb, p) + } + return rb.out +} + +// AppendString returns f(append(out, []byte(s))). +// The buffer out must be nil, empty, or equal to f(out). +func (f Form) AppendString(out []byte, src string) []byte { + return f.doAppend(out, inputString(src), len(src)) +} + +// QuickSpan returns a boundary n such that b[0:n] == f(b[0:n]). +// It is not guaranteed to return the largest such n. +func (f Form) QuickSpan(b []byte) int { + n, _ := formTable[f].quickSpan(inputBytes(b), 0, len(b), true) + return n +} + +// Span implements transform.SpanningTransformer. It returns a boundary n such +// that b[0:n] == f(b[0:n]). It is not guaranteed to return the largest such n. +func (f Form) Span(b []byte, atEOF bool) (n int, err error) { + n, ok := formTable[f].quickSpan(inputBytes(b), 0, len(b), atEOF) + if n < len(b) { + if !ok { + err = transform.ErrEndOfSpan + } else { + err = transform.ErrShortSrc + } + } + return n, err +} + +// SpanString returns a boundary n such that s[0:n] == f(s[0:n]). +// It is not guaranteed to return the largest such n. +func (f Form) SpanString(s string, atEOF bool) (n int, err error) { + n, ok := formTable[f].quickSpan(inputString(s), 0, len(s), atEOF) + if n < len(s) { + if !ok { + err = transform.ErrEndOfSpan + } else { + err = transform.ErrShortSrc + } + } + return n, err +} + +// quickSpan returns a boundary n such that src[0:n] == f(src[0:n]) and +// whether any non-normalized parts were found. If atEOF is false, n will +// not point past the last segment if this segment might be become +// non-normalized by appending other runes. +func (f *formInfo) quickSpan(src input, i, end int, atEOF bool) (n int, ok bool) { + var lastCC uint8 + ss := streamSafe(0) + lastSegStart := i + for n = end; i < n; { + if j := src.skipASCII(i, n); i != j { + i = j + lastSegStart = i - 1 + lastCC = 0 + ss = 0 + continue + } + info := f.info(src, i) + if info.size == 0 { + if atEOF { + // include incomplete runes + return n, true + } + return lastSegStart, true + } + // This block needs to be before the next, because it is possible to + // have an overflow for runes that are starters (e.g. with U+FF9E). + switch ss.next(info) { + case ssStarter: + lastSegStart = i + case ssOverflow: + return lastSegStart, false + case ssSuccess: + if lastCC > info.ccc { + return lastSegStart, false + } + } + if f.composing { + if !info.isYesC() { + break + } + } else { + if !info.isYesD() { + break + } + } + lastCC = info.ccc + i += int(info.size) + } + if i == n { + if !atEOF { + n = lastSegStart + } + return n, true + } + return lastSegStart, false +} + +// QuickSpanString returns a boundary n such that s[0:n] == f(s[0:n]). +// It is not guaranteed to return the largest such n. +func (f Form) QuickSpanString(s string) int { + n, _ := formTable[f].quickSpan(inputString(s), 0, len(s), true) + return n +} + +// FirstBoundary returns the position i of the first boundary in b +// or -1 if b contains no boundary. +func (f Form) FirstBoundary(b []byte) int { + return f.firstBoundary(inputBytes(b), len(b)) +} + +func (f Form) firstBoundary(src input, nsrc int) int { + i := src.skipContinuationBytes(0) + if i >= nsrc { + return -1 + } + fd := formTable[f] + ss := streamSafe(0) + // We should call ss.first here, but we can't as the first rune is + // skipped already. This means FirstBoundary can't really determine + // CGJ insertion points correctly. Luckily it doesn't have to. + for { + info := fd.info(src, i) + if info.size == 0 { + return -1 + } + if s := ss.next(info); s != ssSuccess { + return i + } + i += int(info.size) + if i >= nsrc { + if !info.BoundaryAfter() && !ss.isMax() { + return -1 + } + return nsrc + } + } +} + +// FirstBoundaryInString returns the position i of the first boundary in s +// or -1 if s contains no boundary. +func (f Form) FirstBoundaryInString(s string) int { + return f.firstBoundary(inputString(s), len(s)) +} + +// NextBoundary reports the index of the boundary between the first and next +// segment in b or -1 if atEOF is false and there are not enough bytes to +// determine this boundary. +func (f Form) NextBoundary(b []byte, atEOF bool) int { + return f.nextBoundary(inputBytes(b), len(b), atEOF) +} + +// NextBoundaryInString reports the index of the boundary between the first and +// next segment in b or -1 if atEOF is false and there are not enough bytes to +// determine this boundary. +func (f Form) NextBoundaryInString(s string, atEOF bool) int { + return f.nextBoundary(inputString(s), len(s), atEOF) +} + +func (f Form) nextBoundary(src input, nsrc int, atEOF bool) int { + if nsrc == 0 { + if atEOF { + return 0 + } + return -1 + } + fd := formTable[f] + info := fd.info(src, 0) + if info.size == 0 { + if atEOF { + return 1 + } + return -1 + } + ss := streamSafe(0) + ss.first(info) + + for i := int(info.size); i < nsrc; i += int(info.size) { + info = fd.info(src, i) + if info.size == 0 { + if atEOF { + return i + } + return -1 + } + // TODO: Using streamSafe to determine the boundary isn't the same as + // using BoundaryBefore. Determine which should be used. + if s := ss.next(info); s != ssSuccess { + return i + } + } + if !atEOF && !info.BoundaryAfter() && !ss.isMax() { + return -1 + } + return nsrc +} + +// LastBoundary returns the position i of the last boundary in b +// or -1 if b contains no boundary. +func (f Form) LastBoundary(b []byte) int { + return lastBoundary(formTable[f], b) +} + +func lastBoundary(fd *formInfo, b []byte) int { + i := len(b) + info, p := lastRuneStart(fd, b) + if p == -1 { + return -1 + } + if info.size == 0 { // ends with incomplete rune + if p == 0 { // starts with incomplete rune + return -1 + } + i = p + info, p = lastRuneStart(fd, b[:i]) + if p == -1 { // incomplete UTF-8 encoding or non-starter bytes without a starter + return i + } + } + if p+int(info.size) != i { // trailing non-starter bytes: illegal UTF-8 + return i + } + if info.BoundaryAfter() { + return i + } + ss := streamSafe(0) + v := ss.backwards(info) + for i = p; i >= 0 && v != ssStarter; i = p { + info, p = lastRuneStart(fd, b[:i]) + if v = ss.backwards(info); v == ssOverflow { + break + } + if p+int(info.size) != i { + if p == -1 { // no boundary found + return -1 + } + return i // boundary after an illegal UTF-8 encoding + } + } + return i +} + +// decomposeSegment scans the first segment in src into rb. It inserts 0x034f +// (Grapheme Joiner) when it encounters a sequence of more than 30 non-starters +// and returns the number of bytes consumed from src or iShortDst or iShortSrc. +func decomposeSegment(rb *reorderBuffer, sp int, atEOF bool) int { + // Force one character to be consumed. + info := rb.f.info(rb.src, sp) + if info.size == 0 { + return 0 + } + if s := rb.ss.next(info); s == ssStarter { + // TODO: this could be removed if we don't support merging. + if rb.nrune > 0 { + goto end + } + } else if s == ssOverflow { + rb.insertCGJ() + goto end + } + if err := rb.insertFlush(rb.src, sp, info); err != iSuccess { + return int(err) + } + for { + sp += int(info.size) + if sp >= rb.nsrc { + if !atEOF && !info.BoundaryAfter() { + return int(iShortSrc) + } + break + } + info = rb.f.info(rb.src, sp) + if info.size == 0 { + if !atEOF { + return int(iShortSrc) + } + break + } + if s := rb.ss.next(info); s == ssStarter { + break + } else if s == ssOverflow { + rb.insertCGJ() + break + } + if err := rb.insertFlush(rb.src, sp, info); err != iSuccess { + return int(err) + } + } +end: + if !rb.doFlush() { + return int(iShortDst) + } + return sp +} + +// lastRuneStart returns the runeInfo and position of the last +// rune in buf or the zero runeInfo and -1 if no rune was found. +func lastRuneStart(fd *formInfo, buf []byte) (Properties, int) { + p := len(buf) - 1 + for ; p >= 0 && !utf8.RuneStart(buf[p]); p-- { + } + if p < 0 { + return Properties{}, -1 + } + return fd.info(inputBytes(buf), p), p +} + +// decomposeToLastBoundary finds an open segment at the end of the buffer +// and scans it into rb. Returns the buffer minus the last segment. +func decomposeToLastBoundary(rb *reorderBuffer) { + fd := &rb.f + info, i := lastRuneStart(fd, rb.out) + if int(info.size) != len(rb.out)-i { + // illegal trailing continuation bytes + return + } + if info.BoundaryAfter() { + return + } + var add [maxNonStarters + 1]Properties // stores runeInfo in reverse order + padd := 0 + ss := streamSafe(0) + p := len(rb.out) + for { + add[padd] = info + v := ss.backwards(info) + if v == ssOverflow { + // Note that if we have an overflow, it the string we are appending to + // is not correctly normalized. In this case the behavior is undefined. + break + } + padd++ + p -= int(info.size) + if v == ssStarter || p < 0 { + break + } + info, i = lastRuneStart(fd, rb.out[:p]) + if int(info.size) != p-i { + break + } + } + rb.ss = ss + // Copy bytes for insertion as we may need to overwrite rb.out. + var buf [maxBufferSize * utf8.UTFMax]byte + cp := buf[:copy(buf[:], rb.out[p:])] + rb.out = rb.out[:p] + for padd--; padd >= 0; padd-- { + info = add[padd] + rb.insertUnsafe(inputBytes(cp), 0, info) + cp = cp[info.size:] + } +} diff --git a/vendor/golang.org/x/text/unicode/norm/readwriter.go b/vendor/golang.org/x/text/unicode/norm/readwriter.go new file mode 100644 index 0000000..d926ee9 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/readwriter.go @@ -0,0 +1,125 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +import "io" + +type normWriter struct { + rb reorderBuffer + w io.Writer + buf []byte +} + +// Write implements the standard write interface. If the last characters are +// not at a normalization boundary, the bytes will be buffered for the next +// write. The remaining bytes will be written on close. +func (w *normWriter) Write(data []byte) (n int, err error) { + // Process data in pieces to keep w.buf size bounded. + const chunk = 4000 + + for len(data) > 0 { + // Normalize into w.buf. + m := len(data) + if m > chunk { + m = chunk + } + w.rb.src = inputBytes(data[:m]) + w.rb.nsrc = m + w.buf = doAppend(&w.rb, w.buf, 0) + data = data[m:] + n += m + + // Write out complete prefix, save remainder. + // Note that lastBoundary looks back at most 31 runes. + i := lastBoundary(&w.rb.f, w.buf) + if i == -1 { + i = 0 + } + if i > 0 { + if _, err = w.w.Write(w.buf[:i]); err != nil { + break + } + bn := copy(w.buf, w.buf[i:]) + w.buf = w.buf[:bn] + } + } + return n, err +} + +// Close forces data that remains in the buffer to be written. +func (w *normWriter) Close() error { + if len(w.buf) > 0 { + _, err := w.w.Write(w.buf) + if err != nil { + return err + } + } + return nil +} + +// Writer returns a new writer that implements Write(b) +// by writing f(b) to w. The returned writer may use an +// an internal buffer to maintain state across Write calls. +// Calling its Close method writes any buffered data to w. +func (f Form) Writer(w io.Writer) io.WriteCloser { + wr := &normWriter{rb: reorderBuffer{}, w: w} + wr.rb.init(f, nil) + return wr +} + +type normReader struct { + rb reorderBuffer + r io.Reader + inbuf []byte + outbuf []byte + bufStart int + lastBoundary int + err error +} + +// Read implements the standard read interface. +func (r *normReader) Read(p []byte) (int, error) { + for { + if r.lastBoundary-r.bufStart > 0 { + n := copy(p, r.outbuf[r.bufStart:r.lastBoundary]) + r.bufStart += n + if r.lastBoundary-r.bufStart > 0 { + return n, nil + } + return n, r.err + } + if r.err != nil { + return 0, r.err + } + outn := copy(r.outbuf, r.outbuf[r.lastBoundary:]) + r.outbuf = r.outbuf[0:outn] + r.bufStart = 0 + + n, err := r.r.Read(r.inbuf) + r.rb.src = inputBytes(r.inbuf[0:n]) + r.rb.nsrc, r.err = n, err + if n > 0 { + r.outbuf = doAppend(&r.rb, r.outbuf, 0) + } + if err == io.EOF { + r.lastBoundary = len(r.outbuf) + } else { + r.lastBoundary = lastBoundary(&r.rb.f, r.outbuf) + if r.lastBoundary == -1 { + r.lastBoundary = 0 + } + } + } +} + +// Reader returns a new reader that implements Read +// by reading data from r and returning f(data). +func (f Form) Reader(r io.Reader) io.Reader { + const chunk = 4000 + buf := make([]byte, chunk) + rr := &normReader{rb: reorderBuffer{}, r: r, inbuf: buf} + rr.rb.init(f, buf) + return rr +} diff --git a/vendor/golang.org/x/text/unicode/norm/tables.go b/vendor/golang.org/x/text/unicode/norm/tables.go new file mode 100644 index 0000000..bf9ff80 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/tables.go @@ -0,0 +1,7631 @@ +// Code generated by running "go generate" in golang.org/x/text. DO NOT EDIT. + +package norm + +const ( + // Version is the Unicode edition from which the tables are derived. + Version = "9.0.0" + + // MaxTransformChunkSize indicates the maximum number of bytes that Transform + // may need to write atomically for any Form. Making a destination buffer at + // least this size ensures that Transform can always make progress and that + // the user does not need to grow the buffer on an ErrShortDst. + MaxTransformChunkSize = 35 + maxNonStarters*4 +) + +var ccc = [55]uint8{ + 0, 1, 7, 8, 9, 10, 11, 12, + 13, 14, 15, 16, 17, 18, 19, 20, + 21, 22, 23, 24, 25, 26, 27, 28, + 29, 30, 31, 32, 33, 34, 35, 36, + 84, 91, 103, 107, 118, 122, 129, 130, + 132, 202, 214, 216, 218, 220, 222, 224, + 226, 228, 230, 232, 233, 234, 240, +} + +const ( + firstMulti = 0x186D + firstCCC = 0x2C9E + endMulti = 0x2F60 + firstLeadingCCC = 0x49AE + firstCCCZeroExcept = 0x4A78 + firstStarterWithNLead = 0x4A9F + lastDecomp = 0x4AA1 + maxDecomp = 0x8000 +) + +// decomps: 19105 bytes +var decomps = [...]byte{ + // Bytes 0 - 3f + 0x00, 0x41, 0x20, 0x41, 0x21, 0x41, 0x22, 0x41, + 0x23, 0x41, 0x24, 0x41, 0x25, 0x41, 0x26, 0x41, + 0x27, 0x41, 0x28, 0x41, 0x29, 0x41, 0x2A, 0x41, + 0x2B, 0x41, 0x2C, 0x41, 0x2D, 0x41, 0x2E, 0x41, + 0x2F, 0x41, 0x30, 0x41, 0x31, 0x41, 0x32, 0x41, + 0x33, 0x41, 0x34, 0x41, 0x35, 0x41, 0x36, 0x41, + 0x37, 0x41, 0x38, 0x41, 0x39, 0x41, 0x3A, 0x41, + 0x3B, 0x41, 0x3C, 0x41, 0x3D, 0x41, 0x3E, 0x41, + // Bytes 40 - 7f + 0x3F, 0x41, 0x40, 0x41, 0x41, 0x41, 0x42, 0x41, + 0x43, 0x41, 0x44, 0x41, 0x45, 0x41, 0x46, 0x41, + 0x47, 0x41, 0x48, 0x41, 0x49, 0x41, 0x4A, 0x41, + 0x4B, 0x41, 0x4C, 0x41, 0x4D, 0x41, 0x4E, 0x41, + 0x4F, 0x41, 0x50, 0x41, 0x51, 0x41, 0x52, 0x41, + 0x53, 0x41, 0x54, 0x41, 0x55, 0x41, 0x56, 0x41, + 0x57, 0x41, 0x58, 0x41, 0x59, 0x41, 0x5A, 0x41, + 0x5B, 0x41, 0x5C, 0x41, 0x5D, 0x41, 0x5E, 0x41, + // Bytes 80 - bf + 0x5F, 0x41, 0x60, 0x41, 0x61, 0x41, 0x62, 0x41, + 0x63, 0x41, 0x64, 0x41, 0x65, 0x41, 0x66, 0x41, + 0x67, 0x41, 0x68, 0x41, 0x69, 0x41, 0x6A, 0x41, + 0x6B, 0x41, 0x6C, 0x41, 0x6D, 0x41, 0x6E, 0x41, + 0x6F, 0x41, 0x70, 0x41, 0x71, 0x41, 0x72, 0x41, + 0x73, 0x41, 0x74, 0x41, 0x75, 0x41, 0x76, 0x41, + 0x77, 0x41, 0x78, 0x41, 0x79, 0x41, 0x7A, 0x41, + 0x7B, 0x41, 0x7C, 0x41, 0x7D, 0x41, 0x7E, 0x42, + // Bytes c0 - ff + 0xC2, 0xA2, 0x42, 0xC2, 0xA3, 0x42, 0xC2, 0xA5, + 0x42, 0xC2, 0xA6, 0x42, 0xC2, 0xAC, 0x42, 0xC2, + 0xB7, 0x42, 0xC3, 0x86, 0x42, 0xC3, 0xB0, 0x42, + 0xC4, 0xA6, 0x42, 0xC4, 0xA7, 0x42, 0xC4, 0xB1, + 0x42, 0xC5, 0x8B, 0x42, 0xC5, 0x93, 0x42, 0xC6, + 0x8E, 0x42, 0xC6, 0x90, 0x42, 0xC6, 0xAB, 0x42, + 0xC8, 0xA2, 0x42, 0xC8, 0xB7, 0x42, 0xC9, 0x90, + 0x42, 0xC9, 0x91, 0x42, 0xC9, 0x92, 0x42, 0xC9, + // Bytes 100 - 13f + 0x94, 0x42, 0xC9, 0x95, 0x42, 0xC9, 0x99, 0x42, + 0xC9, 0x9B, 0x42, 0xC9, 0x9C, 0x42, 0xC9, 0x9F, + 0x42, 0xC9, 0xA1, 0x42, 0xC9, 0xA3, 0x42, 0xC9, + 0xA5, 0x42, 0xC9, 0xA6, 0x42, 0xC9, 0xA8, 0x42, + 0xC9, 0xA9, 0x42, 0xC9, 0xAA, 0x42, 0xC9, 0xAB, + 0x42, 0xC9, 0xAD, 0x42, 0xC9, 0xAF, 0x42, 0xC9, + 0xB0, 0x42, 0xC9, 0xB1, 0x42, 0xC9, 0xB2, 0x42, + 0xC9, 0xB3, 0x42, 0xC9, 0xB4, 0x42, 0xC9, 0xB5, + // Bytes 140 - 17f + 0x42, 0xC9, 0xB8, 0x42, 0xC9, 0xB9, 0x42, 0xC9, + 0xBB, 0x42, 0xCA, 0x81, 0x42, 0xCA, 0x82, 0x42, + 0xCA, 0x83, 0x42, 0xCA, 0x89, 0x42, 0xCA, 0x8A, + 0x42, 0xCA, 0x8B, 0x42, 0xCA, 0x8C, 0x42, 0xCA, + 0x90, 0x42, 0xCA, 0x91, 0x42, 0xCA, 0x92, 0x42, + 0xCA, 0x95, 0x42, 0xCA, 0x9D, 0x42, 0xCA, 0x9F, + 0x42, 0xCA, 0xB9, 0x42, 0xCE, 0x91, 0x42, 0xCE, + 0x92, 0x42, 0xCE, 0x93, 0x42, 0xCE, 0x94, 0x42, + // Bytes 180 - 1bf + 0xCE, 0x95, 0x42, 0xCE, 0x96, 0x42, 0xCE, 0x97, + 0x42, 0xCE, 0x98, 0x42, 0xCE, 0x99, 0x42, 0xCE, + 0x9A, 0x42, 0xCE, 0x9B, 0x42, 0xCE, 0x9C, 0x42, + 0xCE, 0x9D, 0x42, 0xCE, 0x9E, 0x42, 0xCE, 0x9F, + 0x42, 0xCE, 0xA0, 0x42, 0xCE, 0xA1, 0x42, 0xCE, + 0xA3, 0x42, 0xCE, 0xA4, 0x42, 0xCE, 0xA5, 0x42, + 0xCE, 0xA6, 0x42, 0xCE, 0xA7, 0x42, 0xCE, 0xA8, + 0x42, 0xCE, 0xA9, 0x42, 0xCE, 0xB1, 0x42, 0xCE, + // Bytes 1c0 - 1ff + 0xB2, 0x42, 0xCE, 0xB3, 0x42, 0xCE, 0xB4, 0x42, + 0xCE, 0xB5, 0x42, 0xCE, 0xB6, 0x42, 0xCE, 0xB7, + 0x42, 0xCE, 0xB8, 0x42, 0xCE, 0xB9, 0x42, 0xCE, + 0xBA, 0x42, 0xCE, 0xBB, 0x42, 0xCE, 0xBC, 0x42, + 0xCE, 0xBD, 0x42, 0xCE, 0xBE, 0x42, 0xCE, 0xBF, + 0x42, 0xCF, 0x80, 0x42, 0xCF, 0x81, 0x42, 0xCF, + 0x82, 0x42, 0xCF, 0x83, 0x42, 0xCF, 0x84, 0x42, + 0xCF, 0x85, 0x42, 0xCF, 0x86, 0x42, 0xCF, 0x87, + // Bytes 200 - 23f + 0x42, 0xCF, 0x88, 0x42, 0xCF, 0x89, 0x42, 0xCF, + 0x9C, 0x42, 0xCF, 0x9D, 0x42, 0xD0, 0xBD, 0x42, + 0xD1, 0x8A, 0x42, 0xD1, 0x8C, 0x42, 0xD7, 0x90, + 0x42, 0xD7, 0x91, 0x42, 0xD7, 0x92, 0x42, 0xD7, + 0x93, 0x42, 0xD7, 0x94, 0x42, 0xD7, 0x9B, 0x42, + 0xD7, 0x9C, 0x42, 0xD7, 0x9D, 0x42, 0xD7, 0xA2, + 0x42, 0xD7, 0xA8, 0x42, 0xD7, 0xAA, 0x42, 0xD8, + 0xA1, 0x42, 0xD8, 0xA7, 0x42, 0xD8, 0xA8, 0x42, + // Bytes 240 - 27f + 0xD8, 0xA9, 0x42, 0xD8, 0xAA, 0x42, 0xD8, 0xAB, + 0x42, 0xD8, 0xAC, 0x42, 0xD8, 0xAD, 0x42, 0xD8, + 0xAE, 0x42, 0xD8, 0xAF, 0x42, 0xD8, 0xB0, 0x42, + 0xD8, 0xB1, 0x42, 0xD8, 0xB2, 0x42, 0xD8, 0xB3, + 0x42, 0xD8, 0xB4, 0x42, 0xD8, 0xB5, 0x42, 0xD8, + 0xB6, 0x42, 0xD8, 0xB7, 0x42, 0xD8, 0xB8, 0x42, + 0xD8, 0xB9, 0x42, 0xD8, 0xBA, 0x42, 0xD9, 0x81, + 0x42, 0xD9, 0x82, 0x42, 0xD9, 0x83, 0x42, 0xD9, + // Bytes 280 - 2bf + 0x84, 0x42, 0xD9, 0x85, 0x42, 0xD9, 0x86, 0x42, + 0xD9, 0x87, 0x42, 0xD9, 0x88, 0x42, 0xD9, 0x89, + 0x42, 0xD9, 0x8A, 0x42, 0xD9, 0xAE, 0x42, 0xD9, + 0xAF, 0x42, 0xD9, 0xB1, 0x42, 0xD9, 0xB9, 0x42, + 0xD9, 0xBA, 0x42, 0xD9, 0xBB, 0x42, 0xD9, 0xBE, + 0x42, 0xD9, 0xBF, 0x42, 0xDA, 0x80, 0x42, 0xDA, + 0x83, 0x42, 0xDA, 0x84, 0x42, 0xDA, 0x86, 0x42, + 0xDA, 0x87, 0x42, 0xDA, 0x88, 0x42, 0xDA, 0x8C, + // Bytes 2c0 - 2ff + 0x42, 0xDA, 0x8D, 0x42, 0xDA, 0x8E, 0x42, 0xDA, + 0x91, 0x42, 0xDA, 0x98, 0x42, 0xDA, 0xA1, 0x42, + 0xDA, 0xA4, 0x42, 0xDA, 0xA6, 0x42, 0xDA, 0xA9, + 0x42, 0xDA, 0xAD, 0x42, 0xDA, 0xAF, 0x42, 0xDA, + 0xB1, 0x42, 0xDA, 0xB3, 0x42, 0xDA, 0xBA, 0x42, + 0xDA, 0xBB, 0x42, 0xDA, 0xBE, 0x42, 0xDB, 0x81, + 0x42, 0xDB, 0x85, 0x42, 0xDB, 0x86, 0x42, 0xDB, + 0x87, 0x42, 0xDB, 0x88, 0x42, 0xDB, 0x89, 0x42, + // Bytes 300 - 33f + 0xDB, 0x8B, 0x42, 0xDB, 0x8C, 0x42, 0xDB, 0x90, + 0x42, 0xDB, 0x92, 0x43, 0xE0, 0xBC, 0x8B, 0x43, + 0xE1, 0x83, 0x9C, 0x43, 0xE1, 0x84, 0x80, 0x43, + 0xE1, 0x84, 0x81, 0x43, 0xE1, 0x84, 0x82, 0x43, + 0xE1, 0x84, 0x83, 0x43, 0xE1, 0x84, 0x84, 0x43, + 0xE1, 0x84, 0x85, 0x43, 0xE1, 0x84, 0x86, 0x43, + 0xE1, 0x84, 0x87, 0x43, 0xE1, 0x84, 0x88, 0x43, + 0xE1, 0x84, 0x89, 0x43, 0xE1, 0x84, 0x8A, 0x43, + // Bytes 340 - 37f + 0xE1, 0x84, 0x8B, 0x43, 0xE1, 0x84, 0x8C, 0x43, + 0xE1, 0x84, 0x8D, 0x43, 0xE1, 0x84, 0x8E, 0x43, + 0xE1, 0x84, 0x8F, 0x43, 0xE1, 0x84, 0x90, 0x43, + 0xE1, 0x84, 0x91, 0x43, 0xE1, 0x84, 0x92, 0x43, + 0xE1, 0x84, 0x94, 0x43, 0xE1, 0x84, 0x95, 0x43, + 0xE1, 0x84, 0x9A, 0x43, 0xE1, 0x84, 0x9C, 0x43, + 0xE1, 0x84, 0x9D, 0x43, 0xE1, 0x84, 0x9E, 0x43, + 0xE1, 0x84, 0xA0, 0x43, 0xE1, 0x84, 0xA1, 0x43, + // Bytes 380 - 3bf + 0xE1, 0x84, 0xA2, 0x43, 0xE1, 0x84, 0xA3, 0x43, + 0xE1, 0x84, 0xA7, 0x43, 0xE1, 0x84, 0xA9, 0x43, + 0xE1, 0x84, 0xAB, 0x43, 0xE1, 0x84, 0xAC, 0x43, + 0xE1, 0x84, 0xAD, 0x43, 0xE1, 0x84, 0xAE, 0x43, + 0xE1, 0x84, 0xAF, 0x43, 0xE1, 0x84, 0xB2, 0x43, + 0xE1, 0x84, 0xB6, 0x43, 0xE1, 0x85, 0x80, 0x43, + 0xE1, 0x85, 0x87, 0x43, 0xE1, 0x85, 0x8C, 0x43, + 0xE1, 0x85, 0x97, 0x43, 0xE1, 0x85, 0x98, 0x43, + // Bytes 3c0 - 3ff + 0xE1, 0x85, 0x99, 0x43, 0xE1, 0x85, 0xA0, 0x43, + 0xE1, 0x86, 0x84, 0x43, 0xE1, 0x86, 0x85, 0x43, + 0xE1, 0x86, 0x88, 0x43, 0xE1, 0x86, 0x91, 0x43, + 0xE1, 0x86, 0x92, 0x43, 0xE1, 0x86, 0x94, 0x43, + 0xE1, 0x86, 0x9E, 0x43, 0xE1, 0x86, 0xA1, 0x43, + 0xE1, 0x87, 0x87, 0x43, 0xE1, 0x87, 0x88, 0x43, + 0xE1, 0x87, 0x8C, 0x43, 0xE1, 0x87, 0x8E, 0x43, + 0xE1, 0x87, 0x93, 0x43, 0xE1, 0x87, 0x97, 0x43, + // Bytes 400 - 43f + 0xE1, 0x87, 0x99, 0x43, 0xE1, 0x87, 0x9D, 0x43, + 0xE1, 0x87, 0x9F, 0x43, 0xE1, 0x87, 0xB1, 0x43, + 0xE1, 0x87, 0xB2, 0x43, 0xE1, 0xB4, 0x82, 0x43, + 0xE1, 0xB4, 0x96, 0x43, 0xE1, 0xB4, 0x97, 0x43, + 0xE1, 0xB4, 0x9C, 0x43, 0xE1, 0xB4, 0x9D, 0x43, + 0xE1, 0xB4, 0xA5, 0x43, 0xE1, 0xB5, 0xBB, 0x43, + 0xE1, 0xB6, 0x85, 0x43, 0xE2, 0x80, 0x82, 0x43, + 0xE2, 0x80, 0x83, 0x43, 0xE2, 0x80, 0x90, 0x43, + // Bytes 440 - 47f + 0xE2, 0x80, 0x93, 0x43, 0xE2, 0x80, 0x94, 0x43, + 0xE2, 0x82, 0xA9, 0x43, 0xE2, 0x86, 0x90, 0x43, + 0xE2, 0x86, 0x91, 0x43, 0xE2, 0x86, 0x92, 0x43, + 0xE2, 0x86, 0x93, 0x43, 0xE2, 0x88, 0x82, 0x43, + 0xE2, 0x88, 0x87, 0x43, 0xE2, 0x88, 0x91, 0x43, + 0xE2, 0x88, 0x92, 0x43, 0xE2, 0x94, 0x82, 0x43, + 0xE2, 0x96, 0xA0, 0x43, 0xE2, 0x97, 0x8B, 0x43, + 0xE2, 0xA6, 0x85, 0x43, 0xE2, 0xA6, 0x86, 0x43, + // Bytes 480 - 4bf + 0xE2, 0xB5, 0xA1, 0x43, 0xE3, 0x80, 0x81, 0x43, + 0xE3, 0x80, 0x82, 0x43, 0xE3, 0x80, 0x88, 0x43, + 0xE3, 0x80, 0x89, 0x43, 0xE3, 0x80, 0x8A, 0x43, + 0xE3, 0x80, 0x8B, 0x43, 0xE3, 0x80, 0x8C, 0x43, + 0xE3, 0x80, 0x8D, 0x43, 0xE3, 0x80, 0x8E, 0x43, + 0xE3, 0x80, 0x8F, 0x43, 0xE3, 0x80, 0x90, 0x43, + 0xE3, 0x80, 0x91, 0x43, 0xE3, 0x80, 0x92, 0x43, + 0xE3, 0x80, 0x94, 0x43, 0xE3, 0x80, 0x95, 0x43, + // Bytes 4c0 - 4ff + 0xE3, 0x80, 0x96, 0x43, 0xE3, 0x80, 0x97, 0x43, + 0xE3, 0x82, 0xA1, 0x43, 0xE3, 0x82, 0xA2, 0x43, + 0xE3, 0x82, 0xA3, 0x43, 0xE3, 0x82, 0xA4, 0x43, + 0xE3, 0x82, 0xA5, 0x43, 0xE3, 0x82, 0xA6, 0x43, + 0xE3, 0x82, 0xA7, 0x43, 0xE3, 0x82, 0xA8, 0x43, + 0xE3, 0x82, 0xA9, 0x43, 0xE3, 0x82, 0xAA, 0x43, + 0xE3, 0x82, 0xAB, 0x43, 0xE3, 0x82, 0xAD, 0x43, + 0xE3, 0x82, 0xAF, 0x43, 0xE3, 0x82, 0xB1, 0x43, + // Bytes 500 - 53f + 0xE3, 0x82, 0xB3, 0x43, 0xE3, 0x82, 0xB5, 0x43, + 0xE3, 0x82, 0xB7, 0x43, 0xE3, 0x82, 0xB9, 0x43, + 0xE3, 0x82, 0xBB, 0x43, 0xE3, 0x82, 0xBD, 0x43, + 0xE3, 0x82, 0xBF, 0x43, 0xE3, 0x83, 0x81, 0x43, + 0xE3, 0x83, 0x83, 0x43, 0xE3, 0x83, 0x84, 0x43, + 0xE3, 0x83, 0x86, 0x43, 0xE3, 0x83, 0x88, 0x43, + 0xE3, 0x83, 0x8A, 0x43, 0xE3, 0x83, 0x8B, 0x43, + 0xE3, 0x83, 0x8C, 0x43, 0xE3, 0x83, 0x8D, 0x43, + // Bytes 540 - 57f + 0xE3, 0x83, 0x8E, 0x43, 0xE3, 0x83, 0x8F, 0x43, + 0xE3, 0x83, 0x92, 0x43, 0xE3, 0x83, 0x95, 0x43, + 0xE3, 0x83, 0x98, 0x43, 0xE3, 0x83, 0x9B, 0x43, + 0xE3, 0x83, 0x9E, 0x43, 0xE3, 0x83, 0x9F, 0x43, + 0xE3, 0x83, 0xA0, 0x43, 0xE3, 0x83, 0xA1, 0x43, + 0xE3, 0x83, 0xA2, 0x43, 0xE3, 0x83, 0xA3, 0x43, + 0xE3, 0x83, 0xA4, 0x43, 0xE3, 0x83, 0xA5, 0x43, + 0xE3, 0x83, 0xA6, 0x43, 0xE3, 0x83, 0xA7, 0x43, + // Bytes 580 - 5bf + 0xE3, 0x83, 0xA8, 0x43, 0xE3, 0x83, 0xA9, 0x43, + 0xE3, 0x83, 0xAA, 0x43, 0xE3, 0x83, 0xAB, 0x43, + 0xE3, 0x83, 0xAC, 0x43, 0xE3, 0x83, 0xAD, 0x43, + 0xE3, 0x83, 0xAF, 0x43, 0xE3, 0x83, 0xB0, 0x43, + 0xE3, 0x83, 0xB1, 0x43, 0xE3, 0x83, 0xB2, 0x43, + 0xE3, 0x83, 0xB3, 0x43, 0xE3, 0x83, 0xBB, 0x43, + 0xE3, 0x83, 0xBC, 0x43, 0xE3, 0x92, 0x9E, 0x43, + 0xE3, 0x92, 0xB9, 0x43, 0xE3, 0x92, 0xBB, 0x43, + // Bytes 5c0 - 5ff + 0xE3, 0x93, 0x9F, 0x43, 0xE3, 0x94, 0x95, 0x43, + 0xE3, 0x9B, 0xAE, 0x43, 0xE3, 0x9B, 0xBC, 0x43, + 0xE3, 0x9E, 0x81, 0x43, 0xE3, 0xA0, 0xAF, 0x43, + 0xE3, 0xA1, 0xA2, 0x43, 0xE3, 0xA1, 0xBC, 0x43, + 0xE3, 0xA3, 0x87, 0x43, 0xE3, 0xA3, 0xA3, 0x43, + 0xE3, 0xA4, 0x9C, 0x43, 0xE3, 0xA4, 0xBA, 0x43, + 0xE3, 0xA8, 0xAE, 0x43, 0xE3, 0xA9, 0xAC, 0x43, + 0xE3, 0xAB, 0xA4, 0x43, 0xE3, 0xAC, 0x88, 0x43, + // Bytes 600 - 63f + 0xE3, 0xAC, 0x99, 0x43, 0xE3, 0xAD, 0x89, 0x43, + 0xE3, 0xAE, 0x9D, 0x43, 0xE3, 0xB0, 0x98, 0x43, + 0xE3, 0xB1, 0x8E, 0x43, 0xE3, 0xB4, 0xB3, 0x43, + 0xE3, 0xB6, 0x96, 0x43, 0xE3, 0xBA, 0xAC, 0x43, + 0xE3, 0xBA, 0xB8, 0x43, 0xE3, 0xBC, 0x9B, 0x43, + 0xE3, 0xBF, 0xBC, 0x43, 0xE4, 0x80, 0x88, 0x43, + 0xE4, 0x80, 0x98, 0x43, 0xE4, 0x80, 0xB9, 0x43, + 0xE4, 0x81, 0x86, 0x43, 0xE4, 0x82, 0x96, 0x43, + // Bytes 640 - 67f + 0xE4, 0x83, 0xA3, 0x43, 0xE4, 0x84, 0xAF, 0x43, + 0xE4, 0x88, 0x82, 0x43, 0xE4, 0x88, 0xA7, 0x43, + 0xE4, 0x8A, 0xA0, 0x43, 0xE4, 0x8C, 0x81, 0x43, + 0xE4, 0x8C, 0xB4, 0x43, 0xE4, 0x8D, 0x99, 0x43, + 0xE4, 0x8F, 0x95, 0x43, 0xE4, 0x8F, 0x99, 0x43, + 0xE4, 0x90, 0x8B, 0x43, 0xE4, 0x91, 0xAB, 0x43, + 0xE4, 0x94, 0xAB, 0x43, 0xE4, 0x95, 0x9D, 0x43, + 0xE4, 0x95, 0xA1, 0x43, 0xE4, 0x95, 0xAB, 0x43, + // Bytes 680 - 6bf + 0xE4, 0x97, 0x97, 0x43, 0xE4, 0x97, 0xB9, 0x43, + 0xE4, 0x98, 0xB5, 0x43, 0xE4, 0x9A, 0xBE, 0x43, + 0xE4, 0x9B, 0x87, 0x43, 0xE4, 0xA6, 0x95, 0x43, + 0xE4, 0xA7, 0xA6, 0x43, 0xE4, 0xA9, 0xAE, 0x43, + 0xE4, 0xA9, 0xB6, 0x43, 0xE4, 0xAA, 0xB2, 0x43, + 0xE4, 0xAC, 0xB3, 0x43, 0xE4, 0xAF, 0x8E, 0x43, + 0xE4, 0xB3, 0x8E, 0x43, 0xE4, 0xB3, 0xAD, 0x43, + 0xE4, 0xB3, 0xB8, 0x43, 0xE4, 0xB5, 0x96, 0x43, + // Bytes 6c0 - 6ff + 0xE4, 0xB8, 0x80, 0x43, 0xE4, 0xB8, 0x81, 0x43, + 0xE4, 0xB8, 0x83, 0x43, 0xE4, 0xB8, 0x89, 0x43, + 0xE4, 0xB8, 0x8A, 0x43, 0xE4, 0xB8, 0x8B, 0x43, + 0xE4, 0xB8, 0x8D, 0x43, 0xE4, 0xB8, 0x99, 0x43, + 0xE4, 0xB8, 0xA6, 0x43, 0xE4, 0xB8, 0xA8, 0x43, + 0xE4, 0xB8, 0xAD, 0x43, 0xE4, 0xB8, 0xB2, 0x43, + 0xE4, 0xB8, 0xB6, 0x43, 0xE4, 0xB8, 0xB8, 0x43, + 0xE4, 0xB8, 0xB9, 0x43, 0xE4, 0xB8, 0xBD, 0x43, + // Bytes 700 - 73f + 0xE4, 0xB8, 0xBF, 0x43, 0xE4, 0xB9, 0x81, 0x43, + 0xE4, 0xB9, 0x99, 0x43, 0xE4, 0xB9, 0x9D, 0x43, + 0xE4, 0xBA, 0x82, 0x43, 0xE4, 0xBA, 0x85, 0x43, + 0xE4, 0xBA, 0x86, 0x43, 0xE4, 0xBA, 0x8C, 0x43, + 0xE4, 0xBA, 0x94, 0x43, 0xE4, 0xBA, 0xA0, 0x43, + 0xE4, 0xBA, 0xA4, 0x43, 0xE4, 0xBA, 0xAE, 0x43, + 0xE4, 0xBA, 0xBA, 0x43, 0xE4, 0xBB, 0x80, 0x43, + 0xE4, 0xBB, 0x8C, 0x43, 0xE4, 0xBB, 0xA4, 0x43, + // Bytes 740 - 77f + 0xE4, 0xBC, 0x81, 0x43, 0xE4, 0xBC, 0x91, 0x43, + 0xE4, 0xBD, 0xA0, 0x43, 0xE4, 0xBE, 0x80, 0x43, + 0xE4, 0xBE, 0x86, 0x43, 0xE4, 0xBE, 0x8B, 0x43, + 0xE4, 0xBE, 0xAE, 0x43, 0xE4, 0xBE, 0xBB, 0x43, + 0xE4, 0xBE, 0xBF, 0x43, 0xE5, 0x80, 0x82, 0x43, + 0xE5, 0x80, 0xAB, 0x43, 0xE5, 0x81, 0xBA, 0x43, + 0xE5, 0x82, 0x99, 0x43, 0xE5, 0x83, 0x8F, 0x43, + 0xE5, 0x83, 0x9A, 0x43, 0xE5, 0x83, 0xA7, 0x43, + // Bytes 780 - 7bf + 0xE5, 0x84, 0xAA, 0x43, 0xE5, 0x84, 0xBF, 0x43, + 0xE5, 0x85, 0x80, 0x43, 0xE5, 0x85, 0x85, 0x43, + 0xE5, 0x85, 0x8D, 0x43, 0xE5, 0x85, 0x94, 0x43, + 0xE5, 0x85, 0xA4, 0x43, 0xE5, 0x85, 0xA5, 0x43, + 0xE5, 0x85, 0xA7, 0x43, 0xE5, 0x85, 0xA8, 0x43, + 0xE5, 0x85, 0xA9, 0x43, 0xE5, 0x85, 0xAB, 0x43, + 0xE5, 0x85, 0xAD, 0x43, 0xE5, 0x85, 0xB7, 0x43, + 0xE5, 0x86, 0x80, 0x43, 0xE5, 0x86, 0x82, 0x43, + // Bytes 7c0 - 7ff + 0xE5, 0x86, 0x8D, 0x43, 0xE5, 0x86, 0x92, 0x43, + 0xE5, 0x86, 0x95, 0x43, 0xE5, 0x86, 0x96, 0x43, + 0xE5, 0x86, 0x97, 0x43, 0xE5, 0x86, 0x99, 0x43, + 0xE5, 0x86, 0xA4, 0x43, 0xE5, 0x86, 0xAB, 0x43, + 0xE5, 0x86, 0xAC, 0x43, 0xE5, 0x86, 0xB5, 0x43, + 0xE5, 0x86, 0xB7, 0x43, 0xE5, 0x87, 0x89, 0x43, + 0xE5, 0x87, 0x8C, 0x43, 0xE5, 0x87, 0x9C, 0x43, + 0xE5, 0x87, 0x9E, 0x43, 0xE5, 0x87, 0xA0, 0x43, + // Bytes 800 - 83f + 0xE5, 0x87, 0xB5, 0x43, 0xE5, 0x88, 0x80, 0x43, + 0xE5, 0x88, 0x83, 0x43, 0xE5, 0x88, 0x87, 0x43, + 0xE5, 0x88, 0x97, 0x43, 0xE5, 0x88, 0x9D, 0x43, + 0xE5, 0x88, 0xA9, 0x43, 0xE5, 0x88, 0xBA, 0x43, + 0xE5, 0x88, 0xBB, 0x43, 0xE5, 0x89, 0x86, 0x43, + 0xE5, 0x89, 0x8D, 0x43, 0xE5, 0x89, 0xB2, 0x43, + 0xE5, 0x89, 0xB7, 0x43, 0xE5, 0x8A, 0x89, 0x43, + 0xE5, 0x8A, 0x9B, 0x43, 0xE5, 0x8A, 0xA3, 0x43, + // Bytes 840 - 87f + 0xE5, 0x8A, 0xB3, 0x43, 0xE5, 0x8A, 0xB4, 0x43, + 0xE5, 0x8B, 0x87, 0x43, 0xE5, 0x8B, 0x89, 0x43, + 0xE5, 0x8B, 0x92, 0x43, 0xE5, 0x8B, 0x9E, 0x43, + 0xE5, 0x8B, 0xA4, 0x43, 0xE5, 0x8B, 0xB5, 0x43, + 0xE5, 0x8B, 0xB9, 0x43, 0xE5, 0x8B, 0xBA, 0x43, + 0xE5, 0x8C, 0x85, 0x43, 0xE5, 0x8C, 0x86, 0x43, + 0xE5, 0x8C, 0x95, 0x43, 0xE5, 0x8C, 0x97, 0x43, + 0xE5, 0x8C, 0x9A, 0x43, 0xE5, 0x8C, 0xB8, 0x43, + // Bytes 880 - 8bf + 0xE5, 0x8C, 0xBB, 0x43, 0xE5, 0x8C, 0xBF, 0x43, + 0xE5, 0x8D, 0x81, 0x43, 0xE5, 0x8D, 0x84, 0x43, + 0xE5, 0x8D, 0x85, 0x43, 0xE5, 0x8D, 0x89, 0x43, + 0xE5, 0x8D, 0x91, 0x43, 0xE5, 0x8D, 0x94, 0x43, + 0xE5, 0x8D, 0x9A, 0x43, 0xE5, 0x8D, 0x9C, 0x43, + 0xE5, 0x8D, 0xA9, 0x43, 0xE5, 0x8D, 0xB0, 0x43, + 0xE5, 0x8D, 0xB3, 0x43, 0xE5, 0x8D, 0xB5, 0x43, + 0xE5, 0x8D, 0xBD, 0x43, 0xE5, 0x8D, 0xBF, 0x43, + // Bytes 8c0 - 8ff + 0xE5, 0x8E, 0x82, 0x43, 0xE5, 0x8E, 0xB6, 0x43, + 0xE5, 0x8F, 0x83, 0x43, 0xE5, 0x8F, 0x88, 0x43, + 0xE5, 0x8F, 0x8A, 0x43, 0xE5, 0x8F, 0x8C, 0x43, + 0xE5, 0x8F, 0x9F, 0x43, 0xE5, 0x8F, 0xA3, 0x43, + 0xE5, 0x8F, 0xA5, 0x43, 0xE5, 0x8F, 0xAB, 0x43, + 0xE5, 0x8F, 0xAF, 0x43, 0xE5, 0x8F, 0xB1, 0x43, + 0xE5, 0x8F, 0xB3, 0x43, 0xE5, 0x90, 0x86, 0x43, + 0xE5, 0x90, 0x88, 0x43, 0xE5, 0x90, 0x8D, 0x43, + // Bytes 900 - 93f + 0xE5, 0x90, 0x8F, 0x43, 0xE5, 0x90, 0x9D, 0x43, + 0xE5, 0x90, 0xB8, 0x43, 0xE5, 0x90, 0xB9, 0x43, + 0xE5, 0x91, 0x82, 0x43, 0xE5, 0x91, 0x88, 0x43, + 0xE5, 0x91, 0xA8, 0x43, 0xE5, 0x92, 0x9E, 0x43, + 0xE5, 0x92, 0xA2, 0x43, 0xE5, 0x92, 0xBD, 0x43, + 0xE5, 0x93, 0xB6, 0x43, 0xE5, 0x94, 0x90, 0x43, + 0xE5, 0x95, 0x8F, 0x43, 0xE5, 0x95, 0x93, 0x43, + 0xE5, 0x95, 0x95, 0x43, 0xE5, 0x95, 0xA3, 0x43, + // Bytes 940 - 97f + 0xE5, 0x96, 0x84, 0x43, 0xE5, 0x96, 0x87, 0x43, + 0xE5, 0x96, 0x99, 0x43, 0xE5, 0x96, 0x9D, 0x43, + 0xE5, 0x96, 0xAB, 0x43, 0xE5, 0x96, 0xB3, 0x43, + 0xE5, 0x96, 0xB6, 0x43, 0xE5, 0x97, 0x80, 0x43, + 0xE5, 0x97, 0x82, 0x43, 0xE5, 0x97, 0xA2, 0x43, + 0xE5, 0x98, 0x86, 0x43, 0xE5, 0x99, 0x91, 0x43, + 0xE5, 0x99, 0xA8, 0x43, 0xE5, 0x99, 0xB4, 0x43, + 0xE5, 0x9B, 0x97, 0x43, 0xE5, 0x9B, 0x9B, 0x43, + // Bytes 980 - 9bf + 0xE5, 0x9B, 0xB9, 0x43, 0xE5, 0x9C, 0x96, 0x43, + 0xE5, 0x9C, 0x97, 0x43, 0xE5, 0x9C, 0x9F, 0x43, + 0xE5, 0x9C, 0xB0, 0x43, 0xE5, 0x9E, 0x8B, 0x43, + 0xE5, 0x9F, 0x8E, 0x43, 0xE5, 0x9F, 0xB4, 0x43, + 0xE5, 0xA0, 0x8D, 0x43, 0xE5, 0xA0, 0xB1, 0x43, + 0xE5, 0xA0, 0xB2, 0x43, 0xE5, 0xA1, 0x80, 0x43, + 0xE5, 0xA1, 0x9A, 0x43, 0xE5, 0xA1, 0x9E, 0x43, + 0xE5, 0xA2, 0xA8, 0x43, 0xE5, 0xA2, 0xAC, 0x43, + // Bytes 9c0 - 9ff + 0xE5, 0xA2, 0xB3, 0x43, 0xE5, 0xA3, 0x98, 0x43, + 0xE5, 0xA3, 0x9F, 0x43, 0xE5, 0xA3, 0xAB, 0x43, + 0xE5, 0xA3, 0xAE, 0x43, 0xE5, 0xA3, 0xB0, 0x43, + 0xE5, 0xA3, 0xB2, 0x43, 0xE5, 0xA3, 0xB7, 0x43, + 0xE5, 0xA4, 0x82, 0x43, 0xE5, 0xA4, 0x86, 0x43, + 0xE5, 0xA4, 0x8A, 0x43, 0xE5, 0xA4, 0x95, 0x43, + 0xE5, 0xA4, 0x9A, 0x43, 0xE5, 0xA4, 0x9C, 0x43, + 0xE5, 0xA4, 0xA2, 0x43, 0xE5, 0xA4, 0xA7, 0x43, + // Bytes a00 - a3f + 0xE5, 0xA4, 0xA9, 0x43, 0xE5, 0xA5, 0x84, 0x43, + 0xE5, 0xA5, 0x88, 0x43, 0xE5, 0xA5, 0x91, 0x43, + 0xE5, 0xA5, 0x94, 0x43, 0xE5, 0xA5, 0xA2, 0x43, + 0xE5, 0xA5, 0xB3, 0x43, 0xE5, 0xA7, 0x98, 0x43, + 0xE5, 0xA7, 0xAC, 0x43, 0xE5, 0xA8, 0x9B, 0x43, + 0xE5, 0xA8, 0xA7, 0x43, 0xE5, 0xA9, 0xA2, 0x43, + 0xE5, 0xA9, 0xA6, 0x43, 0xE5, 0xAA, 0xB5, 0x43, + 0xE5, 0xAC, 0x88, 0x43, 0xE5, 0xAC, 0xA8, 0x43, + // Bytes a40 - a7f + 0xE5, 0xAC, 0xBE, 0x43, 0xE5, 0xAD, 0x90, 0x43, + 0xE5, 0xAD, 0x97, 0x43, 0xE5, 0xAD, 0xA6, 0x43, + 0xE5, 0xAE, 0x80, 0x43, 0xE5, 0xAE, 0x85, 0x43, + 0xE5, 0xAE, 0x97, 0x43, 0xE5, 0xAF, 0x83, 0x43, + 0xE5, 0xAF, 0x98, 0x43, 0xE5, 0xAF, 0xA7, 0x43, + 0xE5, 0xAF, 0xAE, 0x43, 0xE5, 0xAF, 0xB3, 0x43, + 0xE5, 0xAF, 0xB8, 0x43, 0xE5, 0xAF, 0xBF, 0x43, + 0xE5, 0xB0, 0x86, 0x43, 0xE5, 0xB0, 0x8F, 0x43, + // Bytes a80 - abf + 0xE5, 0xB0, 0xA2, 0x43, 0xE5, 0xB0, 0xB8, 0x43, + 0xE5, 0xB0, 0xBF, 0x43, 0xE5, 0xB1, 0xA0, 0x43, + 0xE5, 0xB1, 0xA2, 0x43, 0xE5, 0xB1, 0xA4, 0x43, + 0xE5, 0xB1, 0xA5, 0x43, 0xE5, 0xB1, 0xAE, 0x43, + 0xE5, 0xB1, 0xB1, 0x43, 0xE5, 0xB2, 0x8D, 0x43, + 0xE5, 0xB3, 0x80, 0x43, 0xE5, 0xB4, 0x99, 0x43, + 0xE5, 0xB5, 0x83, 0x43, 0xE5, 0xB5, 0x90, 0x43, + 0xE5, 0xB5, 0xAB, 0x43, 0xE5, 0xB5, 0xAE, 0x43, + // Bytes ac0 - aff + 0xE5, 0xB5, 0xBC, 0x43, 0xE5, 0xB6, 0xB2, 0x43, + 0xE5, 0xB6, 0xBA, 0x43, 0xE5, 0xB7, 0x9B, 0x43, + 0xE5, 0xB7, 0xA1, 0x43, 0xE5, 0xB7, 0xA2, 0x43, + 0xE5, 0xB7, 0xA5, 0x43, 0xE5, 0xB7, 0xA6, 0x43, + 0xE5, 0xB7, 0xB1, 0x43, 0xE5, 0xB7, 0xBD, 0x43, + 0xE5, 0xB7, 0xBE, 0x43, 0xE5, 0xB8, 0xA8, 0x43, + 0xE5, 0xB8, 0xBD, 0x43, 0xE5, 0xB9, 0xA9, 0x43, + 0xE5, 0xB9, 0xB2, 0x43, 0xE5, 0xB9, 0xB4, 0x43, + // Bytes b00 - b3f + 0xE5, 0xB9, 0xBA, 0x43, 0xE5, 0xB9, 0xBC, 0x43, + 0xE5, 0xB9, 0xBF, 0x43, 0xE5, 0xBA, 0xA6, 0x43, + 0xE5, 0xBA, 0xB0, 0x43, 0xE5, 0xBA, 0xB3, 0x43, + 0xE5, 0xBA, 0xB6, 0x43, 0xE5, 0xBB, 0x89, 0x43, + 0xE5, 0xBB, 0x8A, 0x43, 0xE5, 0xBB, 0x92, 0x43, + 0xE5, 0xBB, 0x93, 0x43, 0xE5, 0xBB, 0x99, 0x43, + 0xE5, 0xBB, 0xAC, 0x43, 0xE5, 0xBB, 0xB4, 0x43, + 0xE5, 0xBB, 0xBE, 0x43, 0xE5, 0xBC, 0x84, 0x43, + // Bytes b40 - b7f + 0xE5, 0xBC, 0x8B, 0x43, 0xE5, 0xBC, 0x93, 0x43, + 0xE5, 0xBC, 0xA2, 0x43, 0xE5, 0xBD, 0x90, 0x43, + 0xE5, 0xBD, 0x93, 0x43, 0xE5, 0xBD, 0xA1, 0x43, + 0xE5, 0xBD, 0xA2, 0x43, 0xE5, 0xBD, 0xA9, 0x43, + 0xE5, 0xBD, 0xAB, 0x43, 0xE5, 0xBD, 0xB3, 0x43, + 0xE5, 0xBE, 0x8B, 0x43, 0xE5, 0xBE, 0x8C, 0x43, + 0xE5, 0xBE, 0x97, 0x43, 0xE5, 0xBE, 0x9A, 0x43, + 0xE5, 0xBE, 0xA9, 0x43, 0xE5, 0xBE, 0xAD, 0x43, + // Bytes b80 - bbf + 0xE5, 0xBF, 0x83, 0x43, 0xE5, 0xBF, 0x8D, 0x43, + 0xE5, 0xBF, 0x97, 0x43, 0xE5, 0xBF, 0xB5, 0x43, + 0xE5, 0xBF, 0xB9, 0x43, 0xE6, 0x80, 0x92, 0x43, + 0xE6, 0x80, 0x9C, 0x43, 0xE6, 0x81, 0xB5, 0x43, + 0xE6, 0x82, 0x81, 0x43, 0xE6, 0x82, 0x94, 0x43, + 0xE6, 0x83, 0x87, 0x43, 0xE6, 0x83, 0x98, 0x43, + 0xE6, 0x83, 0xA1, 0x43, 0xE6, 0x84, 0x88, 0x43, + 0xE6, 0x85, 0x84, 0x43, 0xE6, 0x85, 0x88, 0x43, + // Bytes bc0 - bff + 0xE6, 0x85, 0x8C, 0x43, 0xE6, 0x85, 0x8E, 0x43, + 0xE6, 0x85, 0xA0, 0x43, 0xE6, 0x85, 0xA8, 0x43, + 0xE6, 0x85, 0xBA, 0x43, 0xE6, 0x86, 0x8E, 0x43, + 0xE6, 0x86, 0x90, 0x43, 0xE6, 0x86, 0xA4, 0x43, + 0xE6, 0x86, 0xAF, 0x43, 0xE6, 0x86, 0xB2, 0x43, + 0xE6, 0x87, 0x9E, 0x43, 0xE6, 0x87, 0xB2, 0x43, + 0xE6, 0x87, 0xB6, 0x43, 0xE6, 0x88, 0x80, 0x43, + 0xE6, 0x88, 0x88, 0x43, 0xE6, 0x88, 0x90, 0x43, + // Bytes c00 - c3f + 0xE6, 0x88, 0x9B, 0x43, 0xE6, 0x88, 0xAE, 0x43, + 0xE6, 0x88, 0xB4, 0x43, 0xE6, 0x88, 0xB6, 0x43, + 0xE6, 0x89, 0x8B, 0x43, 0xE6, 0x89, 0x93, 0x43, + 0xE6, 0x89, 0x9D, 0x43, 0xE6, 0x8A, 0x95, 0x43, + 0xE6, 0x8A, 0xB1, 0x43, 0xE6, 0x8B, 0x89, 0x43, + 0xE6, 0x8B, 0x8F, 0x43, 0xE6, 0x8B, 0x93, 0x43, + 0xE6, 0x8B, 0x94, 0x43, 0xE6, 0x8B, 0xBC, 0x43, + 0xE6, 0x8B, 0xBE, 0x43, 0xE6, 0x8C, 0x87, 0x43, + // Bytes c40 - c7f + 0xE6, 0x8C, 0xBD, 0x43, 0xE6, 0x8D, 0x90, 0x43, + 0xE6, 0x8D, 0x95, 0x43, 0xE6, 0x8D, 0xA8, 0x43, + 0xE6, 0x8D, 0xBB, 0x43, 0xE6, 0x8E, 0x83, 0x43, + 0xE6, 0x8E, 0xA0, 0x43, 0xE6, 0x8E, 0xA9, 0x43, + 0xE6, 0x8F, 0x84, 0x43, 0xE6, 0x8F, 0x85, 0x43, + 0xE6, 0x8F, 0xA4, 0x43, 0xE6, 0x90, 0x9C, 0x43, + 0xE6, 0x90, 0xA2, 0x43, 0xE6, 0x91, 0x92, 0x43, + 0xE6, 0x91, 0xA9, 0x43, 0xE6, 0x91, 0xB7, 0x43, + // Bytes c80 - cbf + 0xE6, 0x91, 0xBE, 0x43, 0xE6, 0x92, 0x9A, 0x43, + 0xE6, 0x92, 0x9D, 0x43, 0xE6, 0x93, 0x84, 0x43, + 0xE6, 0x94, 0xAF, 0x43, 0xE6, 0x94, 0xB4, 0x43, + 0xE6, 0x95, 0x8F, 0x43, 0xE6, 0x95, 0x96, 0x43, + 0xE6, 0x95, 0xAC, 0x43, 0xE6, 0x95, 0xB8, 0x43, + 0xE6, 0x96, 0x87, 0x43, 0xE6, 0x96, 0x97, 0x43, + 0xE6, 0x96, 0x99, 0x43, 0xE6, 0x96, 0xA4, 0x43, + 0xE6, 0x96, 0xB0, 0x43, 0xE6, 0x96, 0xB9, 0x43, + // Bytes cc0 - cff + 0xE6, 0x97, 0x85, 0x43, 0xE6, 0x97, 0xA0, 0x43, + 0xE6, 0x97, 0xA2, 0x43, 0xE6, 0x97, 0xA3, 0x43, + 0xE6, 0x97, 0xA5, 0x43, 0xE6, 0x98, 0x93, 0x43, + 0xE6, 0x98, 0xA0, 0x43, 0xE6, 0x99, 0x89, 0x43, + 0xE6, 0x99, 0xB4, 0x43, 0xE6, 0x9A, 0x88, 0x43, + 0xE6, 0x9A, 0x91, 0x43, 0xE6, 0x9A, 0x9C, 0x43, + 0xE6, 0x9A, 0xB4, 0x43, 0xE6, 0x9B, 0x86, 0x43, + 0xE6, 0x9B, 0xB0, 0x43, 0xE6, 0x9B, 0xB4, 0x43, + // Bytes d00 - d3f + 0xE6, 0x9B, 0xB8, 0x43, 0xE6, 0x9C, 0x80, 0x43, + 0xE6, 0x9C, 0x88, 0x43, 0xE6, 0x9C, 0x89, 0x43, + 0xE6, 0x9C, 0x97, 0x43, 0xE6, 0x9C, 0x9B, 0x43, + 0xE6, 0x9C, 0xA1, 0x43, 0xE6, 0x9C, 0xA8, 0x43, + 0xE6, 0x9D, 0x8E, 0x43, 0xE6, 0x9D, 0x93, 0x43, + 0xE6, 0x9D, 0x96, 0x43, 0xE6, 0x9D, 0x9E, 0x43, + 0xE6, 0x9D, 0xBB, 0x43, 0xE6, 0x9E, 0x85, 0x43, + 0xE6, 0x9E, 0x97, 0x43, 0xE6, 0x9F, 0xB3, 0x43, + // Bytes d40 - d7f + 0xE6, 0x9F, 0xBA, 0x43, 0xE6, 0xA0, 0x97, 0x43, + 0xE6, 0xA0, 0x9F, 0x43, 0xE6, 0xA0, 0xAA, 0x43, + 0xE6, 0xA1, 0x92, 0x43, 0xE6, 0xA2, 0x81, 0x43, + 0xE6, 0xA2, 0x85, 0x43, 0xE6, 0xA2, 0x8E, 0x43, + 0xE6, 0xA2, 0xA8, 0x43, 0xE6, 0xA4, 0x94, 0x43, + 0xE6, 0xA5, 0x82, 0x43, 0xE6, 0xA6, 0xA3, 0x43, + 0xE6, 0xA7, 0xAA, 0x43, 0xE6, 0xA8, 0x82, 0x43, + 0xE6, 0xA8, 0x93, 0x43, 0xE6, 0xAA, 0xA8, 0x43, + // Bytes d80 - dbf + 0xE6, 0xAB, 0x93, 0x43, 0xE6, 0xAB, 0x9B, 0x43, + 0xE6, 0xAC, 0x84, 0x43, 0xE6, 0xAC, 0xA0, 0x43, + 0xE6, 0xAC, 0xA1, 0x43, 0xE6, 0xAD, 0x94, 0x43, + 0xE6, 0xAD, 0xA2, 0x43, 0xE6, 0xAD, 0xA3, 0x43, + 0xE6, 0xAD, 0xB2, 0x43, 0xE6, 0xAD, 0xB7, 0x43, + 0xE6, 0xAD, 0xB9, 0x43, 0xE6, 0xAE, 0x9F, 0x43, + 0xE6, 0xAE, 0xAE, 0x43, 0xE6, 0xAE, 0xB3, 0x43, + 0xE6, 0xAE, 0xBA, 0x43, 0xE6, 0xAE, 0xBB, 0x43, + // Bytes dc0 - dff + 0xE6, 0xAF, 0x8B, 0x43, 0xE6, 0xAF, 0x8D, 0x43, + 0xE6, 0xAF, 0x94, 0x43, 0xE6, 0xAF, 0x9B, 0x43, + 0xE6, 0xB0, 0x8F, 0x43, 0xE6, 0xB0, 0x94, 0x43, + 0xE6, 0xB0, 0xB4, 0x43, 0xE6, 0xB1, 0x8E, 0x43, + 0xE6, 0xB1, 0xA7, 0x43, 0xE6, 0xB2, 0x88, 0x43, + 0xE6, 0xB2, 0xBF, 0x43, 0xE6, 0xB3, 0x8C, 0x43, + 0xE6, 0xB3, 0x8D, 0x43, 0xE6, 0xB3, 0xA5, 0x43, + 0xE6, 0xB3, 0xA8, 0x43, 0xE6, 0xB4, 0x96, 0x43, + // Bytes e00 - e3f + 0xE6, 0xB4, 0x9B, 0x43, 0xE6, 0xB4, 0x9E, 0x43, + 0xE6, 0xB4, 0xB4, 0x43, 0xE6, 0xB4, 0xBE, 0x43, + 0xE6, 0xB5, 0x81, 0x43, 0xE6, 0xB5, 0xA9, 0x43, + 0xE6, 0xB5, 0xAA, 0x43, 0xE6, 0xB5, 0xB7, 0x43, + 0xE6, 0xB5, 0xB8, 0x43, 0xE6, 0xB6, 0x85, 0x43, + 0xE6, 0xB7, 0x8B, 0x43, 0xE6, 0xB7, 0x9A, 0x43, + 0xE6, 0xB7, 0xAA, 0x43, 0xE6, 0xB7, 0xB9, 0x43, + 0xE6, 0xB8, 0x9A, 0x43, 0xE6, 0xB8, 0xAF, 0x43, + // Bytes e40 - e7f + 0xE6, 0xB9, 0xAE, 0x43, 0xE6, 0xBA, 0x80, 0x43, + 0xE6, 0xBA, 0x9C, 0x43, 0xE6, 0xBA, 0xBA, 0x43, + 0xE6, 0xBB, 0x87, 0x43, 0xE6, 0xBB, 0x8B, 0x43, + 0xE6, 0xBB, 0x91, 0x43, 0xE6, 0xBB, 0x9B, 0x43, + 0xE6, 0xBC, 0x8F, 0x43, 0xE6, 0xBC, 0x94, 0x43, + 0xE6, 0xBC, 0xA2, 0x43, 0xE6, 0xBC, 0xA3, 0x43, + 0xE6, 0xBD, 0xAE, 0x43, 0xE6, 0xBF, 0x86, 0x43, + 0xE6, 0xBF, 0xAB, 0x43, 0xE6, 0xBF, 0xBE, 0x43, + // Bytes e80 - ebf + 0xE7, 0x80, 0x9B, 0x43, 0xE7, 0x80, 0x9E, 0x43, + 0xE7, 0x80, 0xB9, 0x43, 0xE7, 0x81, 0x8A, 0x43, + 0xE7, 0x81, 0xAB, 0x43, 0xE7, 0x81, 0xB0, 0x43, + 0xE7, 0x81, 0xB7, 0x43, 0xE7, 0x81, 0xBD, 0x43, + 0xE7, 0x82, 0x99, 0x43, 0xE7, 0x82, 0xAD, 0x43, + 0xE7, 0x83, 0x88, 0x43, 0xE7, 0x83, 0x99, 0x43, + 0xE7, 0x84, 0xA1, 0x43, 0xE7, 0x85, 0x85, 0x43, + 0xE7, 0x85, 0x89, 0x43, 0xE7, 0x85, 0xAE, 0x43, + // Bytes ec0 - eff + 0xE7, 0x86, 0x9C, 0x43, 0xE7, 0x87, 0x8E, 0x43, + 0xE7, 0x87, 0x90, 0x43, 0xE7, 0x88, 0x90, 0x43, + 0xE7, 0x88, 0x9B, 0x43, 0xE7, 0x88, 0xA8, 0x43, + 0xE7, 0x88, 0xAA, 0x43, 0xE7, 0x88, 0xAB, 0x43, + 0xE7, 0x88, 0xB5, 0x43, 0xE7, 0x88, 0xB6, 0x43, + 0xE7, 0x88, 0xBB, 0x43, 0xE7, 0x88, 0xBF, 0x43, + 0xE7, 0x89, 0x87, 0x43, 0xE7, 0x89, 0x90, 0x43, + 0xE7, 0x89, 0x99, 0x43, 0xE7, 0x89, 0x9B, 0x43, + // Bytes f00 - f3f + 0xE7, 0x89, 0xA2, 0x43, 0xE7, 0x89, 0xB9, 0x43, + 0xE7, 0x8A, 0x80, 0x43, 0xE7, 0x8A, 0x95, 0x43, + 0xE7, 0x8A, 0xAC, 0x43, 0xE7, 0x8A, 0xAF, 0x43, + 0xE7, 0x8B, 0x80, 0x43, 0xE7, 0x8B, 0xBC, 0x43, + 0xE7, 0x8C, 0xAA, 0x43, 0xE7, 0x8D, 0xB5, 0x43, + 0xE7, 0x8D, 0xBA, 0x43, 0xE7, 0x8E, 0x84, 0x43, + 0xE7, 0x8E, 0x87, 0x43, 0xE7, 0x8E, 0x89, 0x43, + 0xE7, 0x8E, 0x8B, 0x43, 0xE7, 0x8E, 0xA5, 0x43, + // Bytes f40 - f7f + 0xE7, 0x8E, 0xB2, 0x43, 0xE7, 0x8F, 0x9E, 0x43, + 0xE7, 0x90, 0x86, 0x43, 0xE7, 0x90, 0x89, 0x43, + 0xE7, 0x90, 0xA2, 0x43, 0xE7, 0x91, 0x87, 0x43, + 0xE7, 0x91, 0x9C, 0x43, 0xE7, 0x91, 0xA9, 0x43, + 0xE7, 0x91, 0xB1, 0x43, 0xE7, 0x92, 0x85, 0x43, + 0xE7, 0x92, 0x89, 0x43, 0xE7, 0x92, 0x98, 0x43, + 0xE7, 0x93, 0x8A, 0x43, 0xE7, 0x93, 0x9C, 0x43, + 0xE7, 0x93, 0xA6, 0x43, 0xE7, 0x94, 0x86, 0x43, + // Bytes f80 - fbf + 0xE7, 0x94, 0x98, 0x43, 0xE7, 0x94, 0x9F, 0x43, + 0xE7, 0x94, 0xA4, 0x43, 0xE7, 0x94, 0xA8, 0x43, + 0xE7, 0x94, 0xB0, 0x43, 0xE7, 0x94, 0xB2, 0x43, + 0xE7, 0x94, 0xB3, 0x43, 0xE7, 0x94, 0xB7, 0x43, + 0xE7, 0x94, 0xBB, 0x43, 0xE7, 0x94, 0xBE, 0x43, + 0xE7, 0x95, 0x99, 0x43, 0xE7, 0x95, 0xA5, 0x43, + 0xE7, 0x95, 0xB0, 0x43, 0xE7, 0x96, 0x8B, 0x43, + 0xE7, 0x96, 0x92, 0x43, 0xE7, 0x97, 0xA2, 0x43, + // Bytes fc0 - fff + 0xE7, 0x98, 0x90, 0x43, 0xE7, 0x98, 0x9D, 0x43, + 0xE7, 0x98, 0x9F, 0x43, 0xE7, 0x99, 0x82, 0x43, + 0xE7, 0x99, 0xA9, 0x43, 0xE7, 0x99, 0xB6, 0x43, + 0xE7, 0x99, 0xBD, 0x43, 0xE7, 0x9A, 0xAE, 0x43, + 0xE7, 0x9A, 0xBF, 0x43, 0xE7, 0x9B, 0x8A, 0x43, + 0xE7, 0x9B, 0x9B, 0x43, 0xE7, 0x9B, 0xA3, 0x43, + 0xE7, 0x9B, 0xA7, 0x43, 0xE7, 0x9B, 0xAE, 0x43, + 0xE7, 0x9B, 0xB4, 0x43, 0xE7, 0x9C, 0x81, 0x43, + // Bytes 1000 - 103f + 0xE7, 0x9C, 0x9E, 0x43, 0xE7, 0x9C, 0x9F, 0x43, + 0xE7, 0x9D, 0x80, 0x43, 0xE7, 0x9D, 0x8A, 0x43, + 0xE7, 0x9E, 0x8B, 0x43, 0xE7, 0x9E, 0xA7, 0x43, + 0xE7, 0x9F, 0x9B, 0x43, 0xE7, 0x9F, 0xA2, 0x43, + 0xE7, 0x9F, 0xB3, 0x43, 0xE7, 0xA1, 0x8E, 0x43, + 0xE7, 0xA1, 0xAB, 0x43, 0xE7, 0xA2, 0x8C, 0x43, + 0xE7, 0xA2, 0x91, 0x43, 0xE7, 0xA3, 0x8A, 0x43, + 0xE7, 0xA3, 0x8C, 0x43, 0xE7, 0xA3, 0xBB, 0x43, + // Bytes 1040 - 107f + 0xE7, 0xA4, 0xAA, 0x43, 0xE7, 0xA4, 0xBA, 0x43, + 0xE7, 0xA4, 0xBC, 0x43, 0xE7, 0xA4, 0xBE, 0x43, + 0xE7, 0xA5, 0x88, 0x43, 0xE7, 0xA5, 0x89, 0x43, + 0xE7, 0xA5, 0x90, 0x43, 0xE7, 0xA5, 0x96, 0x43, + 0xE7, 0xA5, 0x9D, 0x43, 0xE7, 0xA5, 0x9E, 0x43, + 0xE7, 0xA5, 0xA5, 0x43, 0xE7, 0xA5, 0xBF, 0x43, + 0xE7, 0xA6, 0x81, 0x43, 0xE7, 0xA6, 0x8D, 0x43, + 0xE7, 0xA6, 0x8E, 0x43, 0xE7, 0xA6, 0x8F, 0x43, + // Bytes 1080 - 10bf + 0xE7, 0xA6, 0xAE, 0x43, 0xE7, 0xA6, 0xB8, 0x43, + 0xE7, 0xA6, 0xBE, 0x43, 0xE7, 0xA7, 0x8A, 0x43, + 0xE7, 0xA7, 0x98, 0x43, 0xE7, 0xA7, 0xAB, 0x43, + 0xE7, 0xA8, 0x9C, 0x43, 0xE7, 0xA9, 0x80, 0x43, + 0xE7, 0xA9, 0x8A, 0x43, 0xE7, 0xA9, 0x8F, 0x43, + 0xE7, 0xA9, 0xB4, 0x43, 0xE7, 0xA9, 0xBA, 0x43, + 0xE7, 0xAA, 0x81, 0x43, 0xE7, 0xAA, 0xB1, 0x43, + 0xE7, 0xAB, 0x8B, 0x43, 0xE7, 0xAB, 0xAE, 0x43, + // Bytes 10c0 - 10ff + 0xE7, 0xAB, 0xB9, 0x43, 0xE7, 0xAC, 0xA0, 0x43, + 0xE7, 0xAE, 0x8F, 0x43, 0xE7, 0xAF, 0x80, 0x43, + 0xE7, 0xAF, 0x86, 0x43, 0xE7, 0xAF, 0x89, 0x43, + 0xE7, 0xB0, 0xBE, 0x43, 0xE7, 0xB1, 0xA0, 0x43, + 0xE7, 0xB1, 0xB3, 0x43, 0xE7, 0xB1, 0xBB, 0x43, + 0xE7, 0xB2, 0x92, 0x43, 0xE7, 0xB2, 0xBE, 0x43, + 0xE7, 0xB3, 0x92, 0x43, 0xE7, 0xB3, 0x96, 0x43, + 0xE7, 0xB3, 0xA3, 0x43, 0xE7, 0xB3, 0xA7, 0x43, + // Bytes 1100 - 113f + 0xE7, 0xB3, 0xA8, 0x43, 0xE7, 0xB3, 0xB8, 0x43, + 0xE7, 0xB4, 0x80, 0x43, 0xE7, 0xB4, 0x90, 0x43, + 0xE7, 0xB4, 0xA2, 0x43, 0xE7, 0xB4, 0xAF, 0x43, + 0xE7, 0xB5, 0x82, 0x43, 0xE7, 0xB5, 0x9B, 0x43, + 0xE7, 0xB5, 0xA3, 0x43, 0xE7, 0xB6, 0xA0, 0x43, + 0xE7, 0xB6, 0xBE, 0x43, 0xE7, 0xB7, 0x87, 0x43, + 0xE7, 0xB7, 0xB4, 0x43, 0xE7, 0xB8, 0x82, 0x43, + 0xE7, 0xB8, 0x89, 0x43, 0xE7, 0xB8, 0xB7, 0x43, + // Bytes 1140 - 117f + 0xE7, 0xB9, 0x81, 0x43, 0xE7, 0xB9, 0x85, 0x43, + 0xE7, 0xBC, 0xB6, 0x43, 0xE7, 0xBC, 0xBE, 0x43, + 0xE7, 0xBD, 0x91, 0x43, 0xE7, 0xBD, 0xB2, 0x43, + 0xE7, 0xBD, 0xB9, 0x43, 0xE7, 0xBD, 0xBA, 0x43, + 0xE7, 0xBE, 0x85, 0x43, 0xE7, 0xBE, 0x8A, 0x43, + 0xE7, 0xBE, 0x95, 0x43, 0xE7, 0xBE, 0x9A, 0x43, + 0xE7, 0xBE, 0xBD, 0x43, 0xE7, 0xBF, 0xBA, 0x43, + 0xE8, 0x80, 0x81, 0x43, 0xE8, 0x80, 0x85, 0x43, + // Bytes 1180 - 11bf + 0xE8, 0x80, 0x8C, 0x43, 0xE8, 0x80, 0x92, 0x43, + 0xE8, 0x80, 0xB3, 0x43, 0xE8, 0x81, 0x86, 0x43, + 0xE8, 0x81, 0xA0, 0x43, 0xE8, 0x81, 0xAF, 0x43, + 0xE8, 0x81, 0xB0, 0x43, 0xE8, 0x81, 0xBE, 0x43, + 0xE8, 0x81, 0xBF, 0x43, 0xE8, 0x82, 0x89, 0x43, + 0xE8, 0x82, 0x8B, 0x43, 0xE8, 0x82, 0xAD, 0x43, + 0xE8, 0x82, 0xB2, 0x43, 0xE8, 0x84, 0x83, 0x43, + 0xE8, 0x84, 0xBE, 0x43, 0xE8, 0x87, 0x98, 0x43, + // Bytes 11c0 - 11ff + 0xE8, 0x87, 0xA3, 0x43, 0xE8, 0x87, 0xA8, 0x43, + 0xE8, 0x87, 0xAA, 0x43, 0xE8, 0x87, 0xAD, 0x43, + 0xE8, 0x87, 0xB3, 0x43, 0xE8, 0x87, 0xBC, 0x43, + 0xE8, 0x88, 0x81, 0x43, 0xE8, 0x88, 0x84, 0x43, + 0xE8, 0x88, 0x8C, 0x43, 0xE8, 0x88, 0x98, 0x43, + 0xE8, 0x88, 0x9B, 0x43, 0xE8, 0x88, 0x9F, 0x43, + 0xE8, 0x89, 0xAE, 0x43, 0xE8, 0x89, 0xAF, 0x43, + 0xE8, 0x89, 0xB2, 0x43, 0xE8, 0x89, 0xB8, 0x43, + // Bytes 1200 - 123f + 0xE8, 0x89, 0xB9, 0x43, 0xE8, 0x8A, 0x8B, 0x43, + 0xE8, 0x8A, 0x91, 0x43, 0xE8, 0x8A, 0x9D, 0x43, + 0xE8, 0x8A, 0xB1, 0x43, 0xE8, 0x8A, 0xB3, 0x43, + 0xE8, 0x8A, 0xBD, 0x43, 0xE8, 0x8B, 0xA5, 0x43, + 0xE8, 0x8B, 0xA6, 0x43, 0xE8, 0x8C, 0x9D, 0x43, + 0xE8, 0x8C, 0xA3, 0x43, 0xE8, 0x8C, 0xB6, 0x43, + 0xE8, 0x8D, 0x92, 0x43, 0xE8, 0x8D, 0x93, 0x43, + 0xE8, 0x8D, 0xA3, 0x43, 0xE8, 0x8E, 0xAD, 0x43, + // Bytes 1240 - 127f + 0xE8, 0x8E, 0xBD, 0x43, 0xE8, 0x8F, 0x89, 0x43, + 0xE8, 0x8F, 0x8A, 0x43, 0xE8, 0x8F, 0x8C, 0x43, + 0xE8, 0x8F, 0x9C, 0x43, 0xE8, 0x8F, 0xA7, 0x43, + 0xE8, 0x8F, 0xAF, 0x43, 0xE8, 0x8F, 0xB1, 0x43, + 0xE8, 0x90, 0xBD, 0x43, 0xE8, 0x91, 0x89, 0x43, + 0xE8, 0x91, 0x97, 0x43, 0xE8, 0x93, 0xAE, 0x43, + 0xE8, 0x93, 0xB1, 0x43, 0xE8, 0x93, 0xB3, 0x43, + 0xE8, 0x93, 0xBC, 0x43, 0xE8, 0x94, 0x96, 0x43, + // Bytes 1280 - 12bf + 0xE8, 0x95, 0xA4, 0x43, 0xE8, 0x97, 0x8D, 0x43, + 0xE8, 0x97, 0xBA, 0x43, 0xE8, 0x98, 0x86, 0x43, + 0xE8, 0x98, 0x92, 0x43, 0xE8, 0x98, 0xAD, 0x43, + 0xE8, 0x98, 0xBF, 0x43, 0xE8, 0x99, 0x8D, 0x43, + 0xE8, 0x99, 0x90, 0x43, 0xE8, 0x99, 0x9C, 0x43, + 0xE8, 0x99, 0xA7, 0x43, 0xE8, 0x99, 0xA9, 0x43, + 0xE8, 0x99, 0xAB, 0x43, 0xE8, 0x9A, 0x88, 0x43, + 0xE8, 0x9A, 0xA9, 0x43, 0xE8, 0x9B, 0xA2, 0x43, + // Bytes 12c0 - 12ff + 0xE8, 0x9C, 0x8E, 0x43, 0xE8, 0x9C, 0xA8, 0x43, + 0xE8, 0x9D, 0xAB, 0x43, 0xE8, 0x9D, 0xB9, 0x43, + 0xE8, 0x9E, 0x86, 0x43, 0xE8, 0x9E, 0xBA, 0x43, + 0xE8, 0x9F, 0xA1, 0x43, 0xE8, 0xA0, 0x81, 0x43, + 0xE8, 0xA0, 0x9F, 0x43, 0xE8, 0xA1, 0x80, 0x43, + 0xE8, 0xA1, 0x8C, 0x43, 0xE8, 0xA1, 0xA0, 0x43, + 0xE8, 0xA1, 0xA3, 0x43, 0xE8, 0xA3, 0x82, 0x43, + 0xE8, 0xA3, 0x8F, 0x43, 0xE8, 0xA3, 0x97, 0x43, + // Bytes 1300 - 133f + 0xE8, 0xA3, 0x9E, 0x43, 0xE8, 0xA3, 0xA1, 0x43, + 0xE8, 0xA3, 0xB8, 0x43, 0xE8, 0xA3, 0xBA, 0x43, + 0xE8, 0xA4, 0x90, 0x43, 0xE8, 0xA5, 0x81, 0x43, + 0xE8, 0xA5, 0xA4, 0x43, 0xE8, 0xA5, 0xBE, 0x43, + 0xE8, 0xA6, 0x86, 0x43, 0xE8, 0xA6, 0x8B, 0x43, + 0xE8, 0xA6, 0x96, 0x43, 0xE8, 0xA7, 0x92, 0x43, + 0xE8, 0xA7, 0xA3, 0x43, 0xE8, 0xA8, 0x80, 0x43, + 0xE8, 0xAA, 0xA0, 0x43, 0xE8, 0xAA, 0xAA, 0x43, + // Bytes 1340 - 137f + 0xE8, 0xAA, 0xBF, 0x43, 0xE8, 0xAB, 0x8B, 0x43, + 0xE8, 0xAB, 0x92, 0x43, 0xE8, 0xAB, 0x96, 0x43, + 0xE8, 0xAB, 0xAD, 0x43, 0xE8, 0xAB, 0xB8, 0x43, + 0xE8, 0xAB, 0xBE, 0x43, 0xE8, 0xAC, 0x81, 0x43, + 0xE8, 0xAC, 0xB9, 0x43, 0xE8, 0xAD, 0x98, 0x43, + 0xE8, 0xAE, 0x80, 0x43, 0xE8, 0xAE, 0x8A, 0x43, + 0xE8, 0xB0, 0xB7, 0x43, 0xE8, 0xB1, 0x86, 0x43, + 0xE8, 0xB1, 0x88, 0x43, 0xE8, 0xB1, 0x95, 0x43, + // Bytes 1380 - 13bf + 0xE8, 0xB1, 0xB8, 0x43, 0xE8, 0xB2, 0x9D, 0x43, + 0xE8, 0xB2, 0xA1, 0x43, 0xE8, 0xB2, 0xA9, 0x43, + 0xE8, 0xB2, 0xAB, 0x43, 0xE8, 0xB3, 0x81, 0x43, + 0xE8, 0xB3, 0x82, 0x43, 0xE8, 0xB3, 0x87, 0x43, + 0xE8, 0xB3, 0x88, 0x43, 0xE8, 0xB3, 0x93, 0x43, + 0xE8, 0xB4, 0x88, 0x43, 0xE8, 0xB4, 0x9B, 0x43, + 0xE8, 0xB5, 0xA4, 0x43, 0xE8, 0xB5, 0xB0, 0x43, + 0xE8, 0xB5, 0xB7, 0x43, 0xE8, 0xB6, 0xB3, 0x43, + // Bytes 13c0 - 13ff + 0xE8, 0xB6, 0xBC, 0x43, 0xE8, 0xB7, 0x8B, 0x43, + 0xE8, 0xB7, 0xAF, 0x43, 0xE8, 0xB7, 0xB0, 0x43, + 0xE8, 0xBA, 0xAB, 0x43, 0xE8, 0xBB, 0x8A, 0x43, + 0xE8, 0xBB, 0x94, 0x43, 0xE8, 0xBC, 0xA6, 0x43, + 0xE8, 0xBC, 0xAA, 0x43, 0xE8, 0xBC, 0xB8, 0x43, + 0xE8, 0xBC, 0xBB, 0x43, 0xE8, 0xBD, 0xA2, 0x43, + 0xE8, 0xBE, 0x9B, 0x43, 0xE8, 0xBE, 0x9E, 0x43, + 0xE8, 0xBE, 0xB0, 0x43, 0xE8, 0xBE, 0xB5, 0x43, + // Bytes 1400 - 143f + 0xE8, 0xBE, 0xB6, 0x43, 0xE9, 0x80, 0xA3, 0x43, + 0xE9, 0x80, 0xB8, 0x43, 0xE9, 0x81, 0x8A, 0x43, + 0xE9, 0x81, 0xA9, 0x43, 0xE9, 0x81, 0xB2, 0x43, + 0xE9, 0x81, 0xBC, 0x43, 0xE9, 0x82, 0x8F, 0x43, + 0xE9, 0x82, 0x91, 0x43, 0xE9, 0x82, 0x94, 0x43, + 0xE9, 0x83, 0x8E, 0x43, 0xE9, 0x83, 0x9E, 0x43, + 0xE9, 0x83, 0xB1, 0x43, 0xE9, 0x83, 0xBD, 0x43, + 0xE9, 0x84, 0x91, 0x43, 0xE9, 0x84, 0x9B, 0x43, + // Bytes 1440 - 147f + 0xE9, 0x85, 0x89, 0x43, 0xE9, 0x85, 0x8D, 0x43, + 0xE9, 0x85, 0xAA, 0x43, 0xE9, 0x86, 0x99, 0x43, + 0xE9, 0x86, 0xB4, 0x43, 0xE9, 0x87, 0x86, 0x43, + 0xE9, 0x87, 0x8C, 0x43, 0xE9, 0x87, 0x8F, 0x43, + 0xE9, 0x87, 0x91, 0x43, 0xE9, 0x88, 0xB4, 0x43, + 0xE9, 0x88, 0xB8, 0x43, 0xE9, 0x89, 0xB6, 0x43, + 0xE9, 0x89, 0xBC, 0x43, 0xE9, 0x8B, 0x97, 0x43, + 0xE9, 0x8B, 0x98, 0x43, 0xE9, 0x8C, 0x84, 0x43, + // Bytes 1480 - 14bf + 0xE9, 0x8D, 0x8A, 0x43, 0xE9, 0x8F, 0xB9, 0x43, + 0xE9, 0x90, 0x95, 0x43, 0xE9, 0x95, 0xB7, 0x43, + 0xE9, 0x96, 0x80, 0x43, 0xE9, 0x96, 0x8B, 0x43, + 0xE9, 0x96, 0xAD, 0x43, 0xE9, 0x96, 0xB7, 0x43, + 0xE9, 0x98, 0x9C, 0x43, 0xE9, 0x98, 0xAE, 0x43, + 0xE9, 0x99, 0x8B, 0x43, 0xE9, 0x99, 0x8D, 0x43, + 0xE9, 0x99, 0xB5, 0x43, 0xE9, 0x99, 0xB8, 0x43, + 0xE9, 0x99, 0xBC, 0x43, 0xE9, 0x9A, 0x86, 0x43, + // Bytes 14c0 - 14ff + 0xE9, 0x9A, 0xA3, 0x43, 0xE9, 0x9A, 0xB6, 0x43, + 0xE9, 0x9A, 0xB7, 0x43, 0xE9, 0x9A, 0xB8, 0x43, + 0xE9, 0x9A, 0xB9, 0x43, 0xE9, 0x9B, 0x83, 0x43, + 0xE9, 0x9B, 0xA2, 0x43, 0xE9, 0x9B, 0xA3, 0x43, + 0xE9, 0x9B, 0xA8, 0x43, 0xE9, 0x9B, 0xB6, 0x43, + 0xE9, 0x9B, 0xB7, 0x43, 0xE9, 0x9C, 0xA3, 0x43, + 0xE9, 0x9C, 0xB2, 0x43, 0xE9, 0x9D, 0x88, 0x43, + 0xE9, 0x9D, 0x91, 0x43, 0xE9, 0x9D, 0x96, 0x43, + // Bytes 1500 - 153f + 0xE9, 0x9D, 0x9E, 0x43, 0xE9, 0x9D, 0xA2, 0x43, + 0xE9, 0x9D, 0xA9, 0x43, 0xE9, 0x9F, 0x8B, 0x43, + 0xE9, 0x9F, 0x9B, 0x43, 0xE9, 0x9F, 0xA0, 0x43, + 0xE9, 0x9F, 0xAD, 0x43, 0xE9, 0x9F, 0xB3, 0x43, + 0xE9, 0x9F, 0xBF, 0x43, 0xE9, 0xA0, 0x81, 0x43, + 0xE9, 0xA0, 0x85, 0x43, 0xE9, 0xA0, 0x8B, 0x43, + 0xE9, 0xA0, 0x98, 0x43, 0xE9, 0xA0, 0xA9, 0x43, + 0xE9, 0xA0, 0xBB, 0x43, 0xE9, 0xA1, 0x9E, 0x43, + // Bytes 1540 - 157f + 0xE9, 0xA2, 0xA8, 0x43, 0xE9, 0xA3, 0x9B, 0x43, + 0xE9, 0xA3, 0x9F, 0x43, 0xE9, 0xA3, 0xA2, 0x43, + 0xE9, 0xA3, 0xAF, 0x43, 0xE9, 0xA3, 0xBC, 0x43, + 0xE9, 0xA4, 0xA8, 0x43, 0xE9, 0xA4, 0xA9, 0x43, + 0xE9, 0xA6, 0x96, 0x43, 0xE9, 0xA6, 0x99, 0x43, + 0xE9, 0xA6, 0xA7, 0x43, 0xE9, 0xA6, 0xAC, 0x43, + 0xE9, 0xA7, 0x82, 0x43, 0xE9, 0xA7, 0xB1, 0x43, + 0xE9, 0xA7, 0xBE, 0x43, 0xE9, 0xA9, 0xAA, 0x43, + // Bytes 1580 - 15bf + 0xE9, 0xAA, 0xA8, 0x43, 0xE9, 0xAB, 0x98, 0x43, + 0xE9, 0xAB, 0x9F, 0x43, 0xE9, 0xAC, 0x92, 0x43, + 0xE9, 0xAC, 0xA5, 0x43, 0xE9, 0xAC, 0xAF, 0x43, + 0xE9, 0xAC, 0xB2, 0x43, 0xE9, 0xAC, 0xBC, 0x43, + 0xE9, 0xAD, 0x9A, 0x43, 0xE9, 0xAD, 0xAF, 0x43, + 0xE9, 0xB1, 0x80, 0x43, 0xE9, 0xB1, 0x97, 0x43, + 0xE9, 0xB3, 0xA5, 0x43, 0xE9, 0xB3, 0xBD, 0x43, + 0xE9, 0xB5, 0xA7, 0x43, 0xE9, 0xB6, 0xB4, 0x43, + // Bytes 15c0 - 15ff + 0xE9, 0xB7, 0xBA, 0x43, 0xE9, 0xB8, 0x9E, 0x43, + 0xE9, 0xB9, 0xB5, 0x43, 0xE9, 0xB9, 0xBF, 0x43, + 0xE9, 0xBA, 0x97, 0x43, 0xE9, 0xBA, 0x9F, 0x43, + 0xE9, 0xBA, 0xA5, 0x43, 0xE9, 0xBA, 0xBB, 0x43, + 0xE9, 0xBB, 0x83, 0x43, 0xE9, 0xBB, 0x8D, 0x43, + 0xE9, 0xBB, 0x8E, 0x43, 0xE9, 0xBB, 0x91, 0x43, + 0xE9, 0xBB, 0xB9, 0x43, 0xE9, 0xBB, 0xBD, 0x43, + 0xE9, 0xBB, 0xBE, 0x43, 0xE9, 0xBC, 0x85, 0x43, + // Bytes 1600 - 163f + 0xE9, 0xBC, 0x8E, 0x43, 0xE9, 0xBC, 0x8F, 0x43, + 0xE9, 0xBC, 0x93, 0x43, 0xE9, 0xBC, 0x96, 0x43, + 0xE9, 0xBC, 0xA0, 0x43, 0xE9, 0xBC, 0xBB, 0x43, + 0xE9, 0xBD, 0x83, 0x43, 0xE9, 0xBD, 0x8A, 0x43, + 0xE9, 0xBD, 0x92, 0x43, 0xE9, 0xBE, 0x8D, 0x43, + 0xE9, 0xBE, 0x8E, 0x43, 0xE9, 0xBE, 0x9C, 0x43, + 0xE9, 0xBE, 0x9F, 0x43, 0xE9, 0xBE, 0xA0, 0x43, + 0xEA, 0x9C, 0xA7, 0x43, 0xEA, 0x9D, 0xAF, 0x43, + // Bytes 1640 - 167f + 0xEA, 0xAC, 0xB7, 0x43, 0xEA, 0xAD, 0x92, 0x44, + 0xF0, 0xA0, 0x84, 0xA2, 0x44, 0xF0, 0xA0, 0x94, + 0x9C, 0x44, 0xF0, 0xA0, 0x94, 0xA5, 0x44, 0xF0, + 0xA0, 0x95, 0x8B, 0x44, 0xF0, 0xA0, 0x98, 0xBA, + 0x44, 0xF0, 0xA0, 0xA0, 0x84, 0x44, 0xF0, 0xA0, + 0xA3, 0x9E, 0x44, 0xF0, 0xA0, 0xA8, 0xAC, 0x44, + 0xF0, 0xA0, 0xAD, 0xA3, 0x44, 0xF0, 0xA1, 0x93, + 0xA4, 0x44, 0xF0, 0xA1, 0x9A, 0xA8, 0x44, 0xF0, + // Bytes 1680 - 16bf + 0xA1, 0x9B, 0xAA, 0x44, 0xF0, 0xA1, 0xA7, 0x88, + 0x44, 0xF0, 0xA1, 0xAC, 0x98, 0x44, 0xF0, 0xA1, + 0xB4, 0x8B, 0x44, 0xF0, 0xA1, 0xB7, 0xA4, 0x44, + 0xF0, 0xA1, 0xB7, 0xA6, 0x44, 0xF0, 0xA2, 0x86, + 0x83, 0x44, 0xF0, 0xA2, 0x86, 0x9F, 0x44, 0xF0, + 0xA2, 0x8C, 0xB1, 0x44, 0xF0, 0xA2, 0x9B, 0x94, + 0x44, 0xF0, 0xA2, 0xA1, 0x84, 0x44, 0xF0, 0xA2, + 0xA1, 0x8A, 0x44, 0xF0, 0xA2, 0xAC, 0x8C, 0x44, + // Bytes 16c0 - 16ff + 0xF0, 0xA2, 0xAF, 0xB1, 0x44, 0xF0, 0xA3, 0x80, + 0x8A, 0x44, 0xF0, 0xA3, 0x8A, 0xB8, 0x44, 0xF0, + 0xA3, 0x8D, 0x9F, 0x44, 0xF0, 0xA3, 0x8E, 0x93, + 0x44, 0xF0, 0xA3, 0x8E, 0x9C, 0x44, 0xF0, 0xA3, + 0x8F, 0x83, 0x44, 0xF0, 0xA3, 0x8F, 0x95, 0x44, + 0xF0, 0xA3, 0x91, 0xAD, 0x44, 0xF0, 0xA3, 0x9A, + 0xA3, 0x44, 0xF0, 0xA3, 0xA2, 0xA7, 0x44, 0xF0, + 0xA3, 0xAA, 0x8D, 0x44, 0xF0, 0xA3, 0xAB, 0xBA, + // Bytes 1700 - 173f + 0x44, 0xF0, 0xA3, 0xB2, 0xBC, 0x44, 0xF0, 0xA3, + 0xB4, 0x9E, 0x44, 0xF0, 0xA3, 0xBB, 0x91, 0x44, + 0xF0, 0xA3, 0xBD, 0x9E, 0x44, 0xF0, 0xA3, 0xBE, + 0x8E, 0x44, 0xF0, 0xA4, 0x89, 0xA3, 0x44, 0xF0, + 0xA4, 0x8B, 0xAE, 0x44, 0xF0, 0xA4, 0x8E, 0xAB, + 0x44, 0xF0, 0xA4, 0x98, 0x88, 0x44, 0xF0, 0xA4, + 0x9C, 0xB5, 0x44, 0xF0, 0xA4, 0xA0, 0x94, 0x44, + 0xF0, 0xA4, 0xB0, 0xB6, 0x44, 0xF0, 0xA4, 0xB2, + // Bytes 1740 - 177f + 0x92, 0x44, 0xF0, 0xA4, 0xBE, 0xA1, 0x44, 0xF0, + 0xA4, 0xBE, 0xB8, 0x44, 0xF0, 0xA5, 0x81, 0x84, + 0x44, 0xF0, 0xA5, 0x83, 0xB2, 0x44, 0xF0, 0xA5, + 0x83, 0xB3, 0x44, 0xF0, 0xA5, 0x84, 0x99, 0x44, + 0xF0, 0xA5, 0x84, 0xB3, 0x44, 0xF0, 0xA5, 0x89, + 0x89, 0x44, 0xF0, 0xA5, 0x90, 0x9D, 0x44, 0xF0, + 0xA5, 0x98, 0xA6, 0x44, 0xF0, 0xA5, 0x9A, 0x9A, + 0x44, 0xF0, 0xA5, 0x9B, 0x85, 0x44, 0xF0, 0xA5, + // Bytes 1780 - 17bf + 0xA5, 0xBC, 0x44, 0xF0, 0xA5, 0xAA, 0xA7, 0x44, + 0xF0, 0xA5, 0xAE, 0xAB, 0x44, 0xF0, 0xA5, 0xB2, + 0x80, 0x44, 0xF0, 0xA5, 0xB3, 0x90, 0x44, 0xF0, + 0xA5, 0xBE, 0x86, 0x44, 0xF0, 0xA6, 0x87, 0x9A, + 0x44, 0xF0, 0xA6, 0x88, 0xA8, 0x44, 0xF0, 0xA6, + 0x89, 0x87, 0x44, 0xF0, 0xA6, 0x8B, 0x99, 0x44, + 0xF0, 0xA6, 0x8C, 0xBE, 0x44, 0xF0, 0xA6, 0x93, + 0x9A, 0x44, 0xF0, 0xA6, 0x94, 0xA3, 0x44, 0xF0, + // Bytes 17c0 - 17ff + 0xA6, 0x96, 0xA8, 0x44, 0xF0, 0xA6, 0x9E, 0xA7, + 0x44, 0xF0, 0xA6, 0x9E, 0xB5, 0x44, 0xF0, 0xA6, + 0xAC, 0xBC, 0x44, 0xF0, 0xA6, 0xB0, 0xB6, 0x44, + 0xF0, 0xA6, 0xB3, 0x95, 0x44, 0xF0, 0xA6, 0xB5, + 0xAB, 0x44, 0xF0, 0xA6, 0xBC, 0xAC, 0x44, 0xF0, + 0xA6, 0xBE, 0xB1, 0x44, 0xF0, 0xA7, 0x83, 0x92, + 0x44, 0xF0, 0xA7, 0x8F, 0x8A, 0x44, 0xF0, 0xA7, + 0x99, 0xA7, 0x44, 0xF0, 0xA7, 0xA2, 0xAE, 0x44, + // Bytes 1800 - 183f + 0xF0, 0xA7, 0xA5, 0xA6, 0x44, 0xF0, 0xA7, 0xB2, + 0xA8, 0x44, 0xF0, 0xA7, 0xBB, 0x93, 0x44, 0xF0, + 0xA7, 0xBC, 0xAF, 0x44, 0xF0, 0xA8, 0x97, 0x92, + 0x44, 0xF0, 0xA8, 0x97, 0xAD, 0x44, 0xF0, 0xA8, + 0x9C, 0xAE, 0x44, 0xF0, 0xA8, 0xAF, 0xBA, 0x44, + 0xF0, 0xA8, 0xB5, 0xB7, 0x44, 0xF0, 0xA9, 0x85, + 0x85, 0x44, 0xF0, 0xA9, 0x87, 0x9F, 0x44, 0xF0, + 0xA9, 0x88, 0x9A, 0x44, 0xF0, 0xA9, 0x90, 0x8A, + // Bytes 1840 - 187f + 0x44, 0xF0, 0xA9, 0x92, 0x96, 0x44, 0xF0, 0xA9, + 0x96, 0xB6, 0x44, 0xF0, 0xA9, 0xAC, 0xB0, 0x44, + 0xF0, 0xAA, 0x83, 0x8E, 0x44, 0xF0, 0xAA, 0x84, + 0x85, 0x44, 0xF0, 0xAA, 0x88, 0x8E, 0x44, 0xF0, + 0xAA, 0x8A, 0x91, 0x44, 0xF0, 0xAA, 0x8E, 0x92, + 0x44, 0xF0, 0xAA, 0x98, 0x80, 0x42, 0x21, 0x21, + 0x42, 0x21, 0x3F, 0x42, 0x2E, 0x2E, 0x42, 0x30, + 0x2C, 0x42, 0x30, 0x2E, 0x42, 0x31, 0x2C, 0x42, + // Bytes 1880 - 18bf + 0x31, 0x2E, 0x42, 0x31, 0x30, 0x42, 0x31, 0x31, + 0x42, 0x31, 0x32, 0x42, 0x31, 0x33, 0x42, 0x31, + 0x34, 0x42, 0x31, 0x35, 0x42, 0x31, 0x36, 0x42, + 0x31, 0x37, 0x42, 0x31, 0x38, 0x42, 0x31, 0x39, + 0x42, 0x32, 0x2C, 0x42, 0x32, 0x2E, 0x42, 0x32, + 0x30, 0x42, 0x32, 0x31, 0x42, 0x32, 0x32, 0x42, + 0x32, 0x33, 0x42, 0x32, 0x34, 0x42, 0x32, 0x35, + 0x42, 0x32, 0x36, 0x42, 0x32, 0x37, 0x42, 0x32, + // Bytes 18c0 - 18ff + 0x38, 0x42, 0x32, 0x39, 0x42, 0x33, 0x2C, 0x42, + 0x33, 0x2E, 0x42, 0x33, 0x30, 0x42, 0x33, 0x31, + 0x42, 0x33, 0x32, 0x42, 0x33, 0x33, 0x42, 0x33, + 0x34, 0x42, 0x33, 0x35, 0x42, 0x33, 0x36, 0x42, + 0x33, 0x37, 0x42, 0x33, 0x38, 0x42, 0x33, 0x39, + 0x42, 0x34, 0x2C, 0x42, 0x34, 0x2E, 0x42, 0x34, + 0x30, 0x42, 0x34, 0x31, 0x42, 0x34, 0x32, 0x42, + 0x34, 0x33, 0x42, 0x34, 0x34, 0x42, 0x34, 0x35, + // Bytes 1900 - 193f + 0x42, 0x34, 0x36, 0x42, 0x34, 0x37, 0x42, 0x34, + 0x38, 0x42, 0x34, 0x39, 0x42, 0x35, 0x2C, 0x42, + 0x35, 0x2E, 0x42, 0x35, 0x30, 0x42, 0x36, 0x2C, + 0x42, 0x36, 0x2E, 0x42, 0x37, 0x2C, 0x42, 0x37, + 0x2E, 0x42, 0x38, 0x2C, 0x42, 0x38, 0x2E, 0x42, + 0x39, 0x2C, 0x42, 0x39, 0x2E, 0x42, 0x3D, 0x3D, + 0x42, 0x3F, 0x21, 0x42, 0x3F, 0x3F, 0x42, 0x41, + 0x55, 0x42, 0x42, 0x71, 0x42, 0x43, 0x44, 0x42, + // Bytes 1940 - 197f + 0x44, 0x4A, 0x42, 0x44, 0x5A, 0x42, 0x44, 0x7A, + 0x42, 0x47, 0x42, 0x42, 0x47, 0x79, 0x42, 0x48, + 0x50, 0x42, 0x48, 0x56, 0x42, 0x48, 0x67, 0x42, + 0x48, 0x7A, 0x42, 0x49, 0x49, 0x42, 0x49, 0x4A, + 0x42, 0x49, 0x55, 0x42, 0x49, 0x56, 0x42, 0x49, + 0x58, 0x42, 0x4B, 0x42, 0x42, 0x4B, 0x4B, 0x42, + 0x4B, 0x4D, 0x42, 0x4C, 0x4A, 0x42, 0x4C, 0x6A, + 0x42, 0x4D, 0x42, 0x42, 0x4D, 0x43, 0x42, 0x4D, + // Bytes 1980 - 19bf + 0x44, 0x42, 0x4D, 0x56, 0x42, 0x4D, 0x57, 0x42, + 0x4E, 0x4A, 0x42, 0x4E, 0x6A, 0x42, 0x4E, 0x6F, + 0x42, 0x50, 0x48, 0x42, 0x50, 0x52, 0x42, 0x50, + 0x61, 0x42, 0x52, 0x73, 0x42, 0x53, 0x44, 0x42, + 0x53, 0x4D, 0x42, 0x53, 0x53, 0x42, 0x53, 0x76, + 0x42, 0x54, 0x4D, 0x42, 0x56, 0x49, 0x42, 0x57, + 0x43, 0x42, 0x57, 0x5A, 0x42, 0x57, 0x62, 0x42, + 0x58, 0x49, 0x42, 0x63, 0x63, 0x42, 0x63, 0x64, + // Bytes 19c0 - 19ff + 0x42, 0x63, 0x6D, 0x42, 0x64, 0x42, 0x42, 0x64, + 0x61, 0x42, 0x64, 0x6C, 0x42, 0x64, 0x6D, 0x42, + 0x64, 0x7A, 0x42, 0x65, 0x56, 0x42, 0x66, 0x66, + 0x42, 0x66, 0x69, 0x42, 0x66, 0x6C, 0x42, 0x66, + 0x6D, 0x42, 0x68, 0x61, 0x42, 0x69, 0x69, 0x42, + 0x69, 0x6A, 0x42, 0x69, 0x6E, 0x42, 0x69, 0x76, + 0x42, 0x69, 0x78, 0x42, 0x6B, 0x41, 0x42, 0x6B, + 0x56, 0x42, 0x6B, 0x57, 0x42, 0x6B, 0x67, 0x42, + // Bytes 1a00 - 1a3f + 0x6B, 0x6C, 0x42, 0x6B, 0x6D, 0x42, 0x6B, 0x74, + 0x42, 0x6C, 0x6A, 0x42, 0x6C, 0x6D, 0x42, 0x6C, + 0x6E, 0x42, 0x6C, 0x78, 0x42, 0x6D, 0x32, 0x42, + 0x6D, 0x33, 0x42, 0x6D, 0x41, 0x42, 0x6D, 0x56, + 0x42, 0x6D, 0x57, 0x42, 0x6D, 0x62, 0x42, 0x6D, + 0x67, 0x42, 0x6D, 0x6C, 0x42, 0x6D, 0x6D, 0x42, + 0x6D, 0x73, 0x42, 0x6E, 0x41, 0x42, 0x6E, 0x46, + 0x42, 0x6E, 0x56, 0x42, 0x6E, 0x57, 0x42, 0x6E, + // Bytes 1a40 - 1a7f + 0x6A, 0x42, 0x6E, 0x6D, 0x42, 0x6E, 0x73, 0x42, + 0x6F, 0x56, 0x42, 0x70, 0x41, 0x42, 0x70, 0x46, + 0x42, 0x70, 0x56, 0x42, 0x70, 0x57, 0x42, 0x70, + 0x63, 0x42, 0x70, 0x73, 0x42, 0x73, 0x72, 0x42, + 0x73, 0x74, 0x42, 0x76, 0x69, 0x42, 0x78, 0x69, + 0x43, 0x28, 0x31, 0x29, 0x43, 0x28, 0x32, 0x29, + 0x43, 0x28, 0x33, 0x29, 0x43, 0x28, 0x34, 0x29, + 0x43, 0x28, 0x35, 0x29, 0x43, 0x28, 0x36, 0x29, + // Bytes 1a80 - 1abf + 0x43, 0x28, 0x37, 0x29, 0x43, 0x28, 0x38, 0x29, + 0x43, 0x28, 0x39, 0x29, 0x43, 0x28, 0x41, 0x29, + 0x43, 0x28, 0x42, 0x29, 0x43, 0x28, 0x43, 0x29, + 0x43, 0x28, 0x44, 0x29, 0x43, 0x28, 0x45, 0x29, + 0x43, 0x28, 0x46, 0x29, 0x43, 0x28, 0x47, 0x29, + 0x43, 0x28, 0x48, 0x29, 0x43, 0x28, 0x49, 0x29, + 0x43, 0x28, 0x4A, 0x29, 0x43, 0x28, 0x4B, 0x29, + 0x43, 0x28, 0x4C, 0x29, 0x43, 0x28, 0x4D, 0x29, + // Bytes 1ac0 - 1aff + 0x43, 0x28, 0x4E, 0x29, 0x43, 0x28, 0x4F, 0x29, + 0x43, 0x28, 0x50, 0x29, 0x43, 0x28, 0x51, 0x29, + 0x43, 0x28, 0x52, 0x29, 0x43, 0x28, 0x53, 0x29, + 0x43, 0x28, 0x54, 0x29, 0x43, 0x28, 0x55, 0x29, + 0x43, 0x28, 0x56, 0x29, 0x43, 0x28, 0x57, 0x29, + 0x43, 0x28, 0x58, 0x29, 0x43, 0x28, 0x59, 0x29, + 0x43, 0x28, 0x5A, 0x29, 0x43, 0x28, 0x61, 0x29, + 0x43, 0x28, 0x62, 0x29, 0x43, 0x28, 0x63, 0x29, + // Bytes 1b00 - 1b3f + 0x43, 0x28, 0x64, 0x29, 0x43, 0x28, 0x65, 0x29, + 0x43, 0x28, 0x66, 0x29, 0x43, 0x28, 0x67, 0x29, + 0x43, 0x28, 0x68, 0x29, 0x43, 0x28, 0x69, 0x29, + 0x43, 0x28, 0x6A, 0x29, 0x43, 0x28, 0x6B, 0x29, + 0x43, 0x28, 0x6C, 0x29, 0x43, 0x28, 0x6D, 0x29, + 0x43, 0x28, 0x6E, 0x29, 0x43, 0x28, 0x6F, 0x29, + 0x43, 0x28, 0x70, 0x29, 0x43, 0x28, 0x71, 0x29, + 0x43, 0x28, 0x72, 0x29, 0x43, 0x28, 0x73, 0x29, + // Bytes 1b40 - 1b7f + 0x43, 0x28, 0x74, 0x29, 0x43, 0x28, 0x75, 0x29, + 0x43, 0x28, 0x76, 0x29, 0x43, 0x28, 0x77, 0x29, + 0x43, 0x28, 0x78, 0x29, 0x43, 0x28, 0x79, 0x29, + 0x43, 0x28, 0x7A, 0x29, 0x43, 0x2E, 0x2E, 0x2E, + 0x43, 0x31, 0x30, 0x2E, 0x43, 0x31, 0x31, 0x2E, + 0x43, 0x31, 0x32, 0x2E, 0x43, 0x31, 0x33, 0x2E, + 0x43, 0x31, 0x34, 0x2E, 0x43, 0x31, 0x35, 0x2E, + 0x43, 0x31, 0x36, 0x2E, 0x43, 0x31, 0x37, 0x2E, + // Bytes 1b80 - 1bbf + 0x43, 0x31, 0x38, 0x2E, 0x43, 0x31, 0x39, 0x2E, + 0x43, 0x32, 0x30, 0x2E, 0x43, 0x3A, 0x3A, 0x3D, + 0x43, 0x3D, 0x3D, 0x3D, 0x43, 0x43, 0x6F, 0x2E, + 0x43, 0x46, 0x41, 0x58, 0x43, 0x47, 0x48, 0x7A, + 0x43, 0x47, 0x50, 0x61, 0x43, 0x49, 0x49, 0x49, + 0x43, 0x4C, 0x54, 0x44, 0x43, 0x4C, 0xC2, 0xB7, + 0x43, 0x4D, 0x48, 0x7A, 0x43, 0x4D, 0x50, 0x61, + 0x43, 0x4D, 0xCE, 0xA9, 0x43, 0x50, 0x50, 0x4D, + // Bytes 1bc0 - 1bff + 0x43, 0x50, 0x50, 0x56, 0x43, 0x50, 0x54, 0x45, + 0x43, 0x54, 0x45, 0x4C, 0x43, 0x54, 0x48, 0x7A, + 0x43, 0x56, 0x49, 0x49, 0x43, 0x58, 0x49, 0x49, + 0x43, 0x61, 0x2F, 0x63, 0x43, 0x61, 0x2F, 0x73, + 0x43, 0x61, 0xCA, 0xBE, 0x43, 0x62, 0x61, 0x72, + 0x43, 0x63, 0x2F, 0x6F, 0x43, 0x63, 0x2F, 0x75, + 0x43, 0x63, 0x61, 0x6C, 0x43, 0x63, 0x6D, 0x32, + 0x43, 0x63, 0x6D, 0x33, 0x43, 0x64, 0x6D, 0x32, + // Bytes 1c00 - 1c3f + 0x43, 0x64, 0x6D, 0x33, 0x43, 0x65, 0x72, 0x67, + 0x43, 0x66, 0x66, 0x69, 0x43, 0x66, 0x66, 0x6C, + 0x43, 0x67, 0x61, 0x6C, 0x43, 0x68, 0x50, 0x61, + 0x43, 0x69, 0x69, 0x69, 0x43, 0x6B, 0x48, 0x7A, + 0x43, 0x6B, 0x50, 0x61, 0x43, 0x6B, 0x6D, 0x32, + 0x43, 0x6B, 0x6D, 0x33, 0x43, 0x6B, 0xCE, 0xA9, + 0x43, 0x6C, 0x6F, 0x67, 0x43, 0x6C, 0xC2, 0xB7, + 0x43, 0x6D, 0x69, 0x6C, 0x43, 0x6D, 0x6D, 0x32, + // Bytes 1c40 - 1c7f + 0x43, 0x6D, 0x6D, 0x33, 0x43, 0x6D, 0x6F, 0x6C, + 0x43, 0x72, 0x61, 0x64, 0x43, 0x76, 0x69, 0x69, + 0x43, 0x78, 0x69, 0x69, 0x43, 0xC2, 0xB0, 0x43, + 0x43, 0xC2, 0xB0, 0x46, 0x43, 0xCA, 0xBC, 0x6E, + 0x43, 0xCE, 0xBC, 0x41, 0x43, 0xCE, 0xBC, 0x46, + 0x43, 0xCE, 0xBC, 0x56, 0x43, 0xCE, 0xBC, 0x57, + 0x43, 0xCE, 0xBC, 0x67, 0x43, 0xCE, 0xBC, 0x6C, + 0x43, 0xCE, 0xBC, 0x6D, 0x43, 0xCE, 0xBC, 0x73, + // Bytes 1c80 - 1cbf + 0x44, 0x28, 0x31, 0x30, 0x29, 0x44, 0x28, 0x31, + 0x31, 0x29, 0x44, 0x28, 0x31, 0x32, 0x29, 0x44, + 0x28, 0x31, 0x33, 0x29, 0x44, 0x28, 0x31, 0x34, + 0x29, 0x44, 0x28, 0x31, 0x35, 0x29, 0x44, 0x28, + 0x31, 0x36, 0x29, 0x44, 0x28, 0x31, 0x37, 0x29, + 0x44, 0x28, 0x31, 0x38, 0x29, 0x44, 0x28, 0x31, + 0x39, 0x29, 0x44, 0x28, 0x32, 0x30, 0x29, 0x44, + 0x30, 0xE7, 0x82, 0xB9, 0x44, 0x31, 0xE2, 0x81, + // Bytes 1cc0 - 1cff + 0x84, 0x44, 0x31, 0xE6, 0x97, 0xA5, 0x44, 0x31, + 0xE6, 0x9C, 0x88, 0x44, 0x31, 0xE7, 0x82, 0xB9, + 0x44, 0x32, 0xE6, 0x97, 0xA5, 0x44, 0x32, 0xE6, + 0x9C, 0x88, 0x44, 0x32, 0xE7, 0x82, 0xB9, 0x44, + 0x33, 0xE6, 0x97, 0xA5, 0x44, 0x33, 0xE6, 0x9C, + 0x88, 0x44, 0x33, 0xE7, 0x82, 0xB9, 0x44, 0x34, + 0xE6, 0x97, 0xA5, 0x44, 0x34, 0xE6, 0x9C, 0x88, + 0x44, 0x34, 0xE7, 0x82, 0xB9, 0x44, 0x35, 0xE6, + // Bytes 1d00 - 1d3f + 0x97, 0xA5, 0x44, 0x35, 0xE6, 0x9C, 0x88, 0x44, + 0x35, 0xE7, 0x82, 0xB9, 0x44, 0x36, 0xE6, 0x97, + 0xA5, 0x44, 0x36, 0xE6, 0x9C, 0x88, 0x44, 0x36, + 0xE7, 0x82, 0xB9, 0x44, 0x37, 0xE6, 0x97, 0xA5, + 0x44, 0x37, 0xE6, 0x9C, 0x88, 0x44, 0x37, 0xE7, + 0x82, 0xB9, 0x44, 0x38, 0xE6, 0x97, 0xA5, 0x44, + 0x38, 0xE6, 0x9C, 0x88, 0x44, 0x38, 0xE7, 0x82, + 0xB9, 0x44, 0x39, 0xE6, 0x97, 0xA5, 0x44, 0x39, + // Bytes 1d40 - 1d7f + 0xE6, 0x9C, 0x88, 0x44, 0x39, 0xE7, 0x82, 0xB9, + 0x44, 0x56, 0x49, 0x49, 0x49, 0x44, 0x61, 0x2E, + 0x6D, 0x2E, 0x44, 0x6B, 0x63, 0x61, 0x6C, 0x44, + 0x70, 0x2E, 0x6D, 0x2E, 0x44, 0x76, 0x69, 0x69, + 0x69, 0x44, 0xD5, 0xA5, 0xD6, 0x82, 0x44, 0xD5, + 0xB4, 0xD5, 0xA5, 0x44, 0xD5, 0xB4, 0xD5, 0xAB, + 0x44, 0xD5, 0xB4, 0xD5, 0xAD, 0x44, 0xD5, 0xB4, + 0xD5, 0xB6, 0x44, 0xD5, 0xBE, 0xD5, 0xB6, 0x44, + // Bytes 1d80 - 1dbf + 0xD7, 0x90, 0xD7, 0x9C, 0x44, 0xD8, 0xA7, 0xD9, + 0xB4, 0x44, 0xD8, 0xA8, 0xD8, 0xAC, 0x44, 0xD8, + 0xA8, 0xD8, 0xAD, 0x44, 0xD8, 0xA8, 0xD8, 0xAE, + 0x44, 0xD8, 0xA8, 0xD8, 0xB1, 0x44, 0xD8, 0xA8, + 0xD8, 0xB2, 0x44, 0xD8, 0xA8, 0xD9, 0x85, 0x44, + 0xD8, 0xA8, 0xD9, 0x86, 0x44, 0xD8, 0xA8, 0xD9, + 0x87, 0x44, 0xD8, 0xA8, 0xD9, 0x89, 0x44, 0xD8, + 0xA8, 0xD9, 0x8A, 0x44, 0xD8, 0xAA, 0xD8, 0xAC, + // Bytes 1dc0 - 1dff + 0x44, 0xD8, 0xAA, 0xD8, 0xAD, 0x44, 0xD8, 0xAA, + 0xD8, 0xAE, 0x44, 0xD8, 0xAA, 0xD8, 0xB1, 0x44, + 0xD8, 0xAA, 0xD8, 0xB2, 0x44, 0xD8, 0xAA, 0xD9, + 0x85, 0x44, 0xD8, 0xAA, 0xD9, 0x86, 0x44, 0xD8, + 0xAA, 0xD9, 0x87, 0x44, 0xD8, 0xAA, 0xD9, 0x89, + 0x44, 0xD8, 0xAA, 0xD9, 0x8A, 0x44, 0xD8, 0xAB, + 0xD8, 0xAC, 0x44, 0xD8, 0xAB, 0xD8, 0xB1, 0x44, + 0xD8, 0xAB, 0xD8, 0xB2, 0x44, 0xD8, 0xAB, 0xD9, + // Bytes 1e00 - 1e3f + 0x85, 0x44, 0xD8, 0xAB, 0xD9, 0x86, 0x44, 0xD8, + 0xAB, 0xD9, 0x87, 0x44, 0xD8, 0xAB, 0xD9, 0x89, + 0x44, 0xD8, 0xAB, 0xD9, 0x8A, 0x44, 0xD8, 0xAC, + 0xD8, 0xAD, 0x44, 0xD8, 0xAC, 0xD9, 0x85, 0x44, + 0xD8, 0xAC, 0xD9, 0x89, 0x44, 0xD8, 0xAC, 0xD9, + 0x8A, 0x44, 0xD8, 0xAD, 0xD8, 0xAC, 0x44, 0xD8, + 0xAD, 0xD9, 0x85, 0x44, 0xD8, 0xAD, 0xD9, 0x89, + 0x44, 0xD8, 0xAD, 0xD9, 0x8A, 0x44, 0xD8, 0xAE, + // Bytes 1e40 - 1e7f + 0xD8, 0xAC, 0x44, 0xD8, 0xAE, 0xD8, 0xAD, 0x44, + 0xD8, 0xAE, 0xD9, 0x85, 0x44, 0xD8, 0xAE, 0xD9, + 0x89, 0x44, 0xD8, 0xAE, 0xD9, 0x8A, 0x44, 0xD8, + 0xB3, 0xD8, 0xAC, 0x44, 0xD8, 0xB3, 0xD8, 0xAD, + 0x44, 0xD8, 0xB3, 0xD8, 0xAE, 0x44, 0xD8, 0xB3, + 0xD8, 0xB1, 0x44, 0xD8, 0xB3, 0xD9, 0x85, 0x44, + 0xD8, 0xB3, 0xD9, 0x87, 0x44, 0xD8, 0xB3, 0xD9, + 0x89, 0x44, 0xD8, 0xB3, 0xD9, 0x8A, 0x44, 0xD8, + // Bytes 1e80 - 1ebf + 0xB4, 0xD8, 0xAC, 0x44, 0xD8, 0xB4, 0xD8, 0xAD, + 0x44, 0xD8, 0xB4, 0xD8, 0xAE, 0x44, 0xD8, 0xB4, + 0xD8, 0xB1, 0x44, 0xD8, 0xB4, 0xD9, 0x85, 0x44, + 0xD8, 0xB4, 0xD9, 0x87, 0x44, 0xD8, 0xB4, 0xD9, + 0x89, 0x44, 0xD8, 0xB4, 0xD9, 0x8A, 0x44, 0xD8, + 0xB5, 0xD8, 0xAD, 0x44, 0xD8, 0xB5, 0xD8, 0xAE, + 0x44, 0xD8, 0xB5, 0xD8, 0xB1, 0x44, 0xD8, 0xB5, + 0xD9, 0x85, 0x44, 0xD8, 0xB5, 0xD9, 0x89, 0x44, + // Bytes 1ec0 - 1eff + 0xD8, 0xB5, 0xD9, 0x8A, 0x44, 0xD8, 0xB6, 0xD8, + 0xAC, 0x44, 0xD8, 0xB6, 0xD8, 0xAD, 0x44, 0xD8, + 0xB6, 0xD8, 0xAE, 0x44, 0xD8, 0xB6, 0xD8, 0xB1, + 0x44, 0xD8, 0xB6, 0xD9, 0x85, 0x44, 0xD8, 0xB6, + 0xD9, 0x89, 0x44, 0xD8, 0xB6, 0xD9, 0x8A, 0x44, + 0xD8, 0xB7, 0xD8, 0xAD, 0x44, 0xD8, 0xB7, 0xD9, + 0x85, 0x44, 0xD8, 0xB7, 0xD9, 0x89, 0x44, 0xD8, + 0xB7, 0xD9, 0x8A, 0x44, 0xD8, 0xB8, 0xD9, 0x85, + // Bytes 1f00 - 1f3f + 0x44, 0xD8, 0xB9, 0xD8, 0xAC, 0x44, 0xD8, 0xB9, + 0xD9, 0x85, 0x44, 0xD8, 0xB9, 0xD9, 0x89, 0x44, + 0xD8, 0xB9, 0xD9, 0x8A, 0x44, 0xD8, 0xBA, 0xD8, + 0xAC, 0x44, 0xD8, 0xBA, 0xD9, 0x85, 0x44, 0xD8, + 0xBA, 0xD9, 0x89, 0x44, 0xD8, 0xBA, 0xD9, 0x8A, + 0x44, 0xD9, 0x81, 0xD8, 0xAC, 0x44, 0xD9, 0x81, + 0xD8, 0xAD, 0x44, 0xD9, 0x81, 0xD8, 0xAE, 0x44, + 0xD9, 0x81, 0xD9, 0x85, 0x44, 0xD9, 0x81, 0xD9, + // Bytes 1f40 - 1f7f + 0x89, 0x44, 0xD9, 0x81, 0xD9, 0x8A, 0x44, 0xD9, + 0x82, 0xD8, 0xAD, 0x44, 0xD9, 0x82, 0xD9, 0x85, + 0x44, 0xD9, 0x82, 0xD9, 0x89, 0x44, 0xD9, 0x82, + 0xD9, 0x8A, 0x44, 0xD9, 0x83, 0xD8, 0xA7, 0x44, + 0xD9, 0x83, 0xD8, 0xAC, 0x44, 0xD9, 0x83, 0xD8, + 0xAD, 0x44, 0xD9, 0x83, 0xD8, 0xAE, 0x44, 0xD9, + 0x83, 0xD9, 0x84, 0x44, 0xD9, 0x83, 0xD9, 0x85, + 0x44, 0xD9, 0x83, 0xD9, 0x89, 0x44, 0xD9, 0x83, + // Bytes 1f80 - 1fbf + 0xD9, 0x8A, 0x44, 0xD9, 0x84, 0xD8, 0xA7, 0x44, + 0xD9, 0x84, 0xD8, 0xAC, 0x44, 0xD9, 0x84, 0xD8, + 0xAD, 0x44, 0xD9, 0x84, 0xD8, 0xAE, 0x44, 0xD9, + 0x84, 0xD9, 0x85, 0x44, 0xD9, 0x84, 0xD9, 0x87, + 0x44, 0xD9, 0x84, 0xD9, 0x89, 0x44, 0xD9, 0x84, + 0xD9, 0x8A, 0x44, 0xD9, 0x85, 0xD8, 0xA7, 0x44, + 0xD9, 0x85, 0xD8, 0xAC, 0x44, 0xD9, 0x85, 0xD8, + 0xAD, 0x44, 0xD9, 0x85, 0xD8, 0xAE, 0x44, 0xD9, + // Bytes 1fc0 - 1fff + 0x85, 0xD9, 0x85, 0x44, 0xD9, 0x85, 0xD9, 0x89, + 0x44, 0xD9, 0x85, 0xD9, 0x8A, 0x44, 0xD9, 0x86, + 0xD8, 0xAC, 0x44, 0xD9, 0x86, 0xD8, 0xAD, 0x44, + 0xD9, 0x86, 0xD8, 0xAE, 0x44, 0xD9, 0x86, 0xD8, + 0xB1, 0x44, 0xD9, 0x86, 0xD8, 0xB2, 0x44, 0xD9, + 0x86, 0xD9, 0x85, 0x44, 0xD9, 0x86, 0xD9, 0x86, + 0x44, 0xD9, 0x86, 0xD9, 0x87, 0x44, 0xD9, 0x86, + 0xD9, 0x89, 0x44, 0xD9, 0x86, 0xD9, 0x8A, 0x44, + // Bytes 2000 - 203f + 0xD9, 0x87, 0xD8, 0xAC, 0x44, 0xD9, 0x87, 0xD9, + 0x85, 0x44, 0xD9, 0x87, 0xD9, 0x89, 0x44, 0xD9, + 0x87, 0xD9, 0x8A, 0x44, 0xD9, 0x88, 0xD9, 0xB4, + 0x44, 0xD9, 0x8A, 0xD8, 0xAC, 0x44, 0xD9, 0x8A, + 0xD8, 0xAD, 0x44, 0xD9, 0x8A, 0xD8, 0xAE, 0x44, + 0xD9, 0x8A, 0xD8, 0xB1, 0x44, 0xD9, 0x8A, 0xD8, + 0xB2, 0x44, 0xD9, 0x8A, 0xD9, 0x85, 0x44, 0xD9, + 0x8A, 0xD9, 0x86, 0x44, 0xD9, 0x8A, 0xD9, 0x87, + // Bytes 2040 - 207f + 0x44, 0xD9, 0x8A, 0xD9, 0x89, 0x44, 0xD9, 0x8A, + 0xD9, 0x8A, 0x44, 0xD9, 0x8A, 0xD9, 0xB4, 0x44, + 0xDB, 0x87, 0xD9, 0xB4, 0x45, 0x28, 0xE1, 0x84, + 0x80, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x82, 0x29, + 0x45, 0x28, 0xE1, 0x84, 0x83, 0x29, 0x45, 0x28, + 0xE1, 0x84, 0x85, 0x29, 0x45, 0x28, 0xE1, 0x84, + 0x86, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x87, 0x29, + 0x45, 0x28, 0xE1, 0x84, 0x89, 0x29, 0x45, 0x28, + // Bytes 2080 - 20bf + 0xE1, 0x84, 0x8B, 0x29, 0x45, 0x28, 0xE1, 0x84, + 0x8C, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x8E, 0x29, + 0x45, 0x28, 0xE1, 0x84, 0x8F, 0x29, 0x45, 0x28, + 0xE1, 0x84, 0x90, 0x29, 0x45, 0x28, 0xE1, 0x84, + 0x91, 0x29, 0x45, 0x28, 0xE1, 0x84, 0x92, 0x29, + 0x45, 0x28, 0xE4, 0xB8, 0x80, 0x29, 0x45, 0x28, + 0xE4, 0xB8, 0x83, 0x29, 0x45, 0x28, 0xE4, 0xB8, + 0x89, 0x29, 0x45, 0x28, 0xE4, 0xB9, 0x9D, 0x29, + // Bytes 20c0 - 20ff + 0x45, 0x28, 0xE4, 0xBA, 0x8C, 0x29, 0x45, 0x28, + 0xE4, 0xBA, 0x94, 0x29, 0x45, 0x28, 0xE4, 0xBB, + 0xA3, 0x29, 0x45, 0x28, 0xE4, 0xBC, 0x81, 0x29, + 0x45, 0x28, 0xE4, 0xBC, 0x91, 0x29, 0x45, 0x28, + 0xE5, 0x85, 0xAB, 0x29, 0x45, 0x28, 0xE5, 0x85, + 0xAD, 0x29, 0x45, 0x28, 0xE5, 0x8A, 0xB4, 0x29, + 0x45, 0x28, 0xE5, 0x8D, 0x81, 0x29, 0x45, 0x28, + 0xE5, 0x8D, 0x94, 0x29, 0x45, 0x28, 0xE5, 0x90, + // Bytes 2100 - 213f + 0x8D, 0x29, 0x45, 0x28, 0xE5, 0x91, 0xBC, 0x29, + 0x45, 0x28, 0xE5, 0x9B, 0x9B, 0x29, 0x45, 0x28, + 0xE5, 0x9C, 0x9F, 0x29, 0x45, 0x28, 0xE5, 0xAD, + 0xA6, 0x29, 0x45, 0x28, 0xE6, 0x97, 0xA5, 0x29, + 0x45, 0x28, 0xE6, 0x9C, 0x88, 0x29, 0x45, 0x28, + 0xE6, 0x9C, 0x89, 0x29, 0x45, 0x28, 0xE6, 0x9C, + 0xA8, 0x29, 0x45, 0x28, 0xE6, 0xA0, 0xAA, 0x29, + 0x45, 0x28, 0xE6, 0xB0, 0xB4, 0x29, 0x45, 0x28, + // Bytes 2140 - 217f + 0xE7, 0x81, 0xAB, 0x29, 0x45, 0x28, 0xE7, 0x89, + 0xB9, 0x29, 0x45, 0x28, 0xE7, 0x9B, 0xA3, 0x29, + 0x45, 0x28, 0xE7, 0xA4, 0xBE, 0x29, 0x45, 0x28, + 0xE7, 0xA5, 0x9D, 0x29, 0x45, 0x28, 0xE7, 0xA5, + 0xAD, 0x29, 0x45, 0x28, 0xE8, 0x87, 0xAA, 0x29, + 0x45, 0x28, 0xE8, 0x87, 0xB3, 0x29, 0x45, 0x28, + 0xE8, 0xB2, 0xA1, 0x29, 0x45, 0x28, 0xE8, 0xB3, + 0x87, 0x29, 0x45, 0x28, 0xE9, 0x87, 0x91, 0x29, + // Bytes 2180 - 21bf + 0x45, 0x30, 0xE2, 0x81, 0x84, 0x33, 0x45, 0x31, + 0x30, 0xE6, 0x97, 0xA5, 0x45, 0x31, 0x30, 0xE6, + 0x9C, 0x88, 0x45, 0x31, 0x30, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x31, 0xE6, 0x97, 0xA5, 0x45, 0x31, + 0x31, 0xE6, 0x9C, 0x88, 0x45, 0x31, 0x31, 0xE7, + 0x82, 0xB9, 0x45, 0x31, 0x32, 0xE6, 0x97, 0xA5, + 0x45, 0x31, 0x32, 0xE6, 0x9C, 0x88, 0x45, 0x31, + 0x32, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x33, 0xE6, + // Bytes 21c0 - 21ff + 0x97, 0xA5, 0x45, 0x31, 0x33, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x34, 0xE6, 0x97, 0xA5, 0x45, 0x31, + 0x34, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x35, 0xE6, + 0x97, 0xA5, 0x45, 0x31, 0x35, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x36, 0xE6, 0x97, 0xA5, 0x45, 0x31, + 0x36, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x37, 0xE6, + 0x97, 0xA5, 0x45, 0x31, 0x37, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0x38, 0xE6, 0x97, 0xA5, 0x45, 0x31, + // Bytes 2200 - 223f + 0x38, 0xE7, 0x82, 0xB9, 0x45, 0x31, 0x39, 0xE6, + 0x97, 0xA5, 0x45, 0x31, 0x39, 0xE7, 0x82, 0xB9, + 0x45, 0x31, 0xE2, 0x81, 0x84, 0x32, 0x45, 0x31, + 0xE2, 0x81, 0x84, 0x33, 0x45, 0x31, 0xE2, 0x81, + 0x84, 0x34, 0x45, 0x31, 0xE2, 0x81, 0x84, 0x35, + 0x45, 0x31, 0xE2, 0x81, 0x84, 0x36, 0x45, 0x31, + 0xE2, 0x81, 0x84, 0x37, 0x45, 0x31, 0xE2, 0x81, + 0x84, 0x38, 0x45, 0x31, 0xE2, 0x81, 0x84, 0x39, + // Bytes 2240 - 227f + 0x45, 0x32, 0x30, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x30, 0xE7, 0x82, 0xB9, 0x45, 0x32, 0x31, 0xE6, + 0x97, 0xA5, 0x45, 0x32, 0x31, 0xE7, 0x82, 0xB9, + 0x45, 0x32, 0x32, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x32, 0xE7, 0x82, 0xB9, 0x45, 0x32, 0x33, 0xE6, + 0x97, 0xA5, 0x45, 0x32, 0x33, 0xE7, 0x82, 0xB9, + 0x45, 0x32, 0x34, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x34, 0xE7, 0x82, 0xB9, 0x45, 0x32, 0x35, 0xE6, + // Bytes 2280 - 22bf + 0x97, 0xA5, 0x45, 0x32, 0x36, 0xE6, 0x97, 0xA5, + 0x45, 0x32, 0x37, 0xE6, 0x97, 0xA5, 0x45, 0x32, + 0x38, 0xE6, 0x97, 0xA5, 0x45, 0x32, 0x39, 0xE6, + 0x97, 0xA5, 0x45, 0x32, 0xE2, 0x81, 0x84, 0x33, + 0x45, 0x32, 0xE2, 0x81, 0x84, 0x35, 0x45, 0x33, + 0x30, 0xE6, 0x97, 0xA5, 0x45, 0x33, 0x31, 0xE6, + 0x97, 0xA5, 0x45, 0x33, 0xE2, 0x81, 0x84, 0x34, + 0x45, 0x33, 0xE2, 0x81, 0x84, 0x35, 0x45, 0x33, + // Bytes 22c0 - 22ff + 0xE2, 0x81, 0x84, 0x38, 0x45, 0x34, 0xE2, 0x81, + 0x84, 0x35, 0x45, 0x35, 0xE2, 0x81, 0x84, 0x36, + 0x45, 0x35, 0xE2, 0x81, 0x84, 0x38, 0x45, 0x37, + 0xE2, 0x81, 0x84, 0x38, 0x45, 0x41, 0xE2, 0x88, + 0x95, 0x6D, 0x45, 0x56, 0xE2, 0x88, 0x95, 0x6D, + 0x45, 0x6D, 0xE2, 0x88, 0x95, 0x73, 0x46, 0x31, + 0xE2, 0x81, 0x84, 0x31, 0x30, 0x46, 0x43, 0xE2, + 0x88, 0x95, 0x6B, 0x67, 0x46, 0x6D, 0xE2, 0x88, + // Bytes 2300 - 233f + 0x95, 0x73, 0x32, 0x46, 0xD8, 0xA8, 0xD8, 0xAD, + 0xD9, 0x8A, 0x46, 0xD8, 0xA8, 0xD8, 0xAE, 0xD9, + 0x8A, 0x46, 0xD8, 0xAA, 0xD8, 0xAC, 0xD9, 0x85, + 0x46, 0xD8, 0xAA, 0xD8, 0xAC, 0xD9, 0x89, 0x46, + 0xD8, 0xAA, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD8, + 0xAA, 0xD8, 0xAD, 0xD8, 0xAC, 0x46, 0xD8, 0xAA, + 0xD8, 0xAD, 0xD9, 0x85, 0x46, 0xD8, 0xAA, 0xD8, + 0xAE, 0xD9, 0x85, 0x46, 0xD8, 0xAA, 0xD8, 0xAE, + // Bytes 2340 - 237f + 0xD9, 0x89, 0x46, 0xD8, 0xAA, 0xD8, 0xAE, 0xD9, + 0x8A, 0x46, 0xD8, 0xAA, 0xD9, 0x85, 0xD8, 0xAC, + 0x46, 0xD8, 0xAA, 0xD9, 0x85, 0xD8, 0xAD, 0x46, + 0xD8, 0xAA, 0xD9, 0x85, 0xD8, 0xAE, 0x46, 0xD8, + 0xAA, 0xD9, 0x85, 0xD9, 0x89, 0x46, 0xD8, 0xAA, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD8, 0xAC, 0xD8, + 0xAD, 0xD9, 0x89, 0x46, 0xD8, 0xAC, 0xD8, 0xAD, + 0xD9, 0x8A, 0x46, 0xD8, 0xAC, 0xD9, 0x85, 0xD8, + // Bytes 2380 - 23bf + 0xAD, 0x46, 0xD8, 0xAC, 0xD9, 0x85, 0xD9, 0x89, + 0x46, 0xD8, 0xAC, 0xD9, 0x85, 0xD9, 0x8A, 0x46, + 0xD8, 0xAD, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD8, + 0xAD, 0xD9, 0x85, 0xD9, 0x89, 0x46, 0xD8, 0xAD, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD8, 0xB3, 0xD8, + 0xAC, 0xD8, 0xAD, 0x46, 0xD8, 0xB3, 0xD8, 0xAC, + 0xD9, 0x89, 0x46, 0xD8, 0xB3, 0xD8, 0xAD, 0xD8, + 0xAC, 0x46, 0xD8, 0xB3, 0xD8, 0xAE, 0xD9, 0x89, + // Bytes 23c0 - 23ff + 0x46, 0xD8, 0xB3, 0xD8, 0xAE, 0xD9, 0x8A, 0x46, + 0xD8, 0xB3, 0xD9, 0x85, 0xD8, 0xAC, 0x46, 0xD8, + 0xB3, 0xD9, 0x85, 0xD8, 0xAD, 0x46, 0xD8, 0xB3, + 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD8, 0xB4, 0xD8, + 0xAC, 0xD9, 0x8A, 0x46, 0xD8, 0xB4, 0xD8, 0xAD, + 0xD9, 0x85, 0x46, 0xD8, 0xB4, 0xD8, 0xAD, 0xD9, + 0x8A, 0x46, 0xD8, 0xB4, 0xD9, 0x85, 0xD8, 0xAE, + 0x46, 0xD8, 0xB4, 0xD9, 0x85, 0xD9, 0x85, 0x46, + // Bytes 2400 - 243f + 0xD8, 0xB5, 0xD8, 0xAD, 0xD8, 0xAD, 0x46, 0xD8, + 0xB5, 0xD8, 0xAD, 0xD9, 0x8A, 0x46, 0xD8, 0xB5, + 0xD9, 0x84, 0xD9, 0x89, 0x46, 0xD8, 0xB5, 0xD9, + 0x84, 0xDB, 0x92, 0x46, 0xD8, 0xB5, 0xD9, 0x85, + 0xD9, 0x85, 0x46, 0xD8, 0xB6, 0xD8, 0xAD, 0xD9, + 0x89, 0x46, 0xD8, 0xB6, 0xD8, 0xAD, 0xD9, 0x8A, + 0x46, 0xD8, 0xB6, 0xD8, 0xAE, 0xD9, 0x85, 0x46, + 0xD8, 0xB7, 0xD9, 0x85, 0xD8, 0xAD, 0x46, 0xD8, + // Bytes 2440 - 247f + 0xB7, 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD8, 0xB7, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD8, 0xB9, 0xD8, + 0xAC, 0xD9, 0x85, 0x46, 0xD8, 0xB9, 0xD9, 0x85, + 0xD9, 0x85, 0x46, 0xD8, 0xB9, 0xD9, 0x85, 0xD9, + 0x89, 0x46, 0xD8, 0xB9, 0xD9, 0x85, 0xD9, 0x8A, + 0x46, 0xD8, 0xBA, 0xD9, 0x85, 0xD9, 0x85, 0x46, + 0xD8, 0xBA, 0xD9, 0x85, 0xD9, 0x89, 0x46, 0xD8, + 0xBA, 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x81, + // Bytes 2480 - 24bf + 0xD8, 0xAE, 0xD9, 0x85, 0x46, 0xD9, 0x81, 0xD9, + 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x82, 0xD9, 0x84, + 0xDB, 0x92, 0x46, 0xD9, 0x82, 0xD9, 0x85, 0xD8, + 0xAD, 0x46, 0xD9, 0x82, 0xD9, 0x85, 0xD9, 0x85, + 0x46, 0xD9, 0x82, 0xD9, 0x85, 0xD9, 0x8A, 0x46, + 0xD9, 0x83, 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD9, + 0x83, 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x84, + 0xD8, 0xAC, 0xD8, 0xAC, 0x46, 0xD9, 0x84, 0xD8, + // Bytes 24c0 - 24ff + 0xAC, 0xD9, 0x85, 0x46, 0xD9, 0x84, 0xD8, 0xAC, + 0xD9, 0x8A, 0x46, 0xD9, 0x84, 0xD8, 0xAD, 0xD9, + 0x85, 0x46, 0xD9, 0x84, 0xD8, 0xAD, 0xD9, 0x89, + 0x46, 0xD9, 0x84, 0xD8, 0xAD, 0xD9, 0x8A, 0x46, + 0xD9, 0x84, 0xD8, 0xAE, 0xD9, 0x85, 0x46, 0xD9, + 0x84, 0xD9, 0x85, 0xD8, 0xAD, 0x46, 0xD9, 0x84, + 0xD9, 0x85, 0xD9, 0x8A, 0x46, 0xD9, 0x85, 0xD8, + 0xAC, 0xD8, 0xAD, 0x46, 0xD9, 0x85, 0xD8, 0xAC, + // Bytes 2500 - 253f + 0xD8, 0xAE, 0x46, 0xD9, 0x85, 0xD8, 0xAC, 0xD9, + 0x85, 0x46, 0xD9, 0x85, 0xD8, 0xAC, 0xD9, 0x8A, + 0x46, 0xD9, 0x85, 0xD8, 0xAD, 0xD8, 0xAC, 0x46, + 0xD9, 0x85, 0xD8, 0xAD, 0xD9, 0x85, 0x46, 0xD9, + 0x85, 0xD8, 0xAD, 0xD9, 0x8A, 0x46, 0xD9, 0x85, + 0xD8, 0xAE, 0xD8, 0xAC, 0x46, 0xD9, 0x85, 0xD8, + 0xAE, 0xD9, 0x85, 0x46, 0xD9, 0x85, 0xD8, 0xAE, + 0xD9, 0x8A, 0x46, 0xD9, 0x85, 0xD9, 0x85, 0xD9, + // Bytes 2540 - 257f + 0x8A, 0x46, 0xD9, 0x86, 0xD8, 0xAC, 0xD8, 0xAD, + 0x46, 0xD9, 0x86, 0xD8, 0xAC, 0xD9, 0x85, 0x46, + 0xD9, 0x86, 0xD8, 0xAC, 0xD9, 0x89, 0x46, 0xD9, + 0x86, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD9, 0x86, + 0xD8, 0xAD, 0xD9, 0x85, 0x46, 0xD9, 0x86, 0xD8, + 0xAD, 0xD9, 0x89, 0x46, 0xD9, 0x86, 0xD8, 0xAD, + 0xD9, 0x8A, 0x46, 0xD9, 0x86, 0xD9, 0x85, 0xD9, + 0x89, 0x46, 0xD9, 0x86, 0xD9, 0x85, 0xD9, 0x8A, + // Bytes 2580 - 25bf + 0x46, 0xD9, 0x87, 0xD9, 0x85, 0xD8, 0xAC, 0x46, + 0xD9, 0x87, 0xD9, 0x85, 0xD9, 0x85, 0x46, 0xD9, + 0x8A, 0xD8, 0xAC, 0xD9, 0x8A, 0x46, 0xD9, 0x8A, + 0xD8, 0xAD, 0xD9, 0x8A, 0x46, 0xD9, 0x8A, 0xD9, + 0x85, 0xD9, 0x85, 0x46, 0xD9, 0x8A, 0xD9, 0x85, + 0xD9, 0x8A, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD8, + 0xA7, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD8, 0xAC, + 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD8, 0xAD, 0x46, + // Bytes 25c0 - 25ff + 0xD9, 0x8A, 0xD9, 0x94, 0xD8, 0xAE, 0x46, 0xD9, + 0x8A, 0xD9, 0x94, 0xD8, 0xB1, 0x46, 0xD9, 0x8A, + 0xD9, 0x94, 0xD8, 0xB2, 0x46, 0xD9, 0x8A, 0xD9, + 0x94, 0xD9, 0x85, 0x46, 0xD9, 0x8A, 0xD9, 0x94, + 0xD9, 0x86, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD9, + 0x87, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD9, 0x88, + 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xD9, 0x89, 0x46, + 0xD9, 0x8A, 0xD9, 0x94, 0xD9, 0x8A, 0x46, 0xD9, + // Bytes 2600 - 263f + 0x8A, 0xD9, 0x94, 0xDB, 0x86, 0x46, 0xD9, 0x8A, + 0xD9, 0x94, 0xDB, 0x87, 0x46, 0xD9, 0x8A, 0xD9, + 0x94, 0xDB, 0x88, 0x46, 0xD9, 0x8A, 0xD9, 0x94, + 0xDB, 0x90, 0x46, 0xD9, 0x8A, 0xD9, 0x94, 0xDB, + 0x95, 0x46, 0xE0, 0xB9, 0x8D, 0xE0, 0xB8, 0xB2, + 0x46, 0xE0, 0xBA, 0xAB, 0xE0, 0xBA, 0x99, 0x46, + 0xE0, 0xBA, 0xAB, 0xE0, 0xBA, 0xA1, 0x46, 0xE0, + 0xBB, 0x8D, 0xE0, 0xBA, 0xB2, 0x46, 0xE0, 0xBD, + // Bytes 2640 - 267f + 0x80, 0xE0, 0xBE, 0xB5, 0x46, 0xE0, 0xBD, 0x82, + 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBD, 0x8C, 0xE0, + 0xBE, 0xB7, 0x46, 0xE0, 0xBD, 0x91, 0xE0, 0xBE, + 0xB7, 0x46, 0xE0, 0xBD, 0x96, 0xE0, 0xBE, 0xB7, + 0x46, 0xE0, 0xBD, 0x9B, 0xE0, 0xBE, 0xB7, 0x46, + 0xE0, 0xBE, 0x90, 0xE0, 0xBE, 0xB5, 0x46, 0xE0, + 0xBE, 0x92, 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBE, + 0x9C, 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBE, 0xA1, + // Bytes 2680 - 26bf + 0xE0, 0xBE, 0xB7, 0x46, 0xE0, 0xBE, 0xA6, 0xE0, + 0xBE, 0xB7, 0x46, 0xE0, 0xBE, 0xAB, 0xE0, 0xBE, + 0xB7, 0x46, 0xE2, 0x80, 0xB2, 0xE2, 0x80, 0xB2, + 0x46, 0xE2, 0x80, 0xB5, 0xE2, 0x80, 0xB5, 0x46, + 0xE2, 0x88, 0xAB, 0xE2, 0x88, 0xAB, 0x46, 0xE2, + 0x88, 0xAE, 0xE2, 0x88, 0xAE, 0x46, 0xE3, 0x81, + 0xBB, 0xE3, 0x81, 0x8B, 0x46, 0xE3, 0x82, 0x88, + 0xE3, 0x82, 0x8A, 0x46, 0xE3, 0x82, 0xAD, 0xE3, + // Bytes 26c0 - 26ff + 0x83, 0xAD, 0x46, 0xE3, 0x82, 0xB3, 0xE3, 0x82, + 0xB3, 0x46, 0xE3, 0x82, 0xB3, 0xE3, 0x83, 0x88, + 0x46, 0xE3, 0x83, 0x88, 0xE3, 0x83, 0xB3, 0x46, + 0xE3, 0x83, 0x8A, 0xE3, 0x83, 0x8E, 0x46, 0xE3, + 0x83, 0x9B, 0xE3, 0x83, 0xB3, 0x46, 0xE3, 0x83, + 0x9F, 0xE3, 0x83, 0xAA, 0x46, 0xE3, 0x83, 0xAA, + 0xE3, 0x83, 0xA9, 0x46, 0xE3, 0x83, 0xAC, 0xE3, + 0x83, 0xA0, 0x46, 0xE5, 0xA4, 0xA7, 0xE6, 0xAD, + // Bytes 2700 - 273f + 0xA3, 0x46, 0xE5, 0xB9, 0xB3, 0xE6, 0x88, 0x90, + 0x46, 0xE6, 0x98, 0x8E, 0xE6, 0xB2, 0xBB, 0x46, + 0xE6, 0x98, 0xAD, 0xE5, 0x92, 0x8C, 0x47, 0x72, + 0x61, 0x64, 0xE2, 0x88, 0x95, 0x73, 0x47, 0xE3, + 0x80, 0x94, 0x53, 0xE3, 0x80, 0x95, 0x48, 0x28, + 0xE1, 0x84, 0x80, 0xE1, 0x85, 0xA1, 0x29, 0x48, + 0x28, 0xE1, 0x84, 0x82, 0xE1, 0x85, 0xA1, 0x29, + 0x48, 0x28, 0xE1, 0x84, 0x83, 0xE1, 0x85, 0xA1, + // Bytes 2740 - 277f + 0x29, 0x48, 0x28, 0xE1, 0x84, 0x85, 0xE1, 0x85, + 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x86, 0xE1, + 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x87, + 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, + 0x89, 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, + 0x84, 0x8B, 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, + 0xE1, 0x84, 0x8C, 0xE1, 0x85, 0xA1, 0x29, 0x48, + 0x28, 0xE1, 0x84, 0x8C, 0xE1, 0x85, 0xAE, 0x29, + // Bytes 2780 - 27bf + 0x48, 0x28, 0xE1, 0x84, 0x8E, 0xE1, 0x85, 0xA1, + 0x29, 0x48, 0x28, 0xE1, 0x84, 0x8F, 0xE1, 0x85, + 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x90, 0xE1, + 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, 0x91, + 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x28, 0xE1, 0x84, + 0x92, 0xE1, 0x85, 0xA1, 0x29, 0x48, 0x72, 0x61, + 0x64, 0xE2, 0x88, 0x95, 0x73, 0x32, 0x48, 0xD8, + 0xA7, 0xD9, 0x83, 0xD8, 0xA8, 0xD8, 0xB1, 0x48, + // Bytes 27c0 - 27ff + 0xD8, 0xA7, 0xD9, 0x84, 0xD9, 0x84, 0xD9, 0x87, + 0x48, 0xD8, 0xB1, 0xD8, 0xB3, 0xD9, 0x88, 0xD9, + 0x84, 0x48, 0xD8, 0xB1, 0xDB, 0x8C, 0xD8, 0xA7, + 0xD9, 0x84, 0x48, 0xD8, 0xB5, 0xD9, 0x84, 0xD8, + 0xB9, 0xD9, 0x85, 0x48, 0xD8, 0xB9, 0xD9, 0x84, + 0xD9, 0x8A, 0xD9, 0x87, 0x48, 0xD9, 0x85, 0xD8, + 0xAD, 0xD9, 0x85, 0xD8, 0xAF, 0x48, 0xD9, 0x88, + 0xD8, 0xB3, 0xD9, 0x84, 0xD9, 0x85, 0x49, 0xE2, + // Bytes 2800 - 283f + 0x80, 0xB2, 0xE2, 0x80, 0xB2, 0xE2, 0x80, 0xB2, + 0x49, 0xE2, 0x80, 0xB5, 0xE2, 0x80, 0xB5, 0xE2, + 0x80, 0xB5, 0x49, 0xE2, 0x88, 0xAB, 0xE2, 0x88, + 0xAB, 0xE2, 0x88, 0xAB, 0x49, 0xE2, 0x88, 0xAE, + 0xE2, 0x88, 0xAE, 0xE2, 0x88, 0xAE, 0x49, 0xE3, + 0x80, 0x94, 0xE4, 0xB8, 0x89, 0xE3, 0x80, 0x95, + 0x49, 0xE3, 0x80, 0x94, 0xE4, 0xBA, 0x8C, 0xE3, + 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, 0xE5, 0x8B, + // Bytes 2840 - 287f + 0x9D, 0xE3, 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, + 0xE5, 0xAE, 0x89, 0xE3, 0x80, 0x95, 0x49, 0xE3, + 0x80, 0x94, 0xE6, 0x89, 0x93, 0xE3, 0x80, 0x95, + 0x49, 0xE3, 0x80, 0x94, 0xE6, 0x95, 0x97, 0xE3, + 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, 0xE6, 0x9C, + 0xAC, 0xE3, 0x80, 0x95, 0x49, 0xE3, 0x80, 0x94, + 0xE7, 0x82, 0xB9, 0xE3, 0x80, 0x95, 0x49, 0xE3, + 0x80, 0x94, 0xE7, 0x9B, 0x97, 0xE3, 0x80, 0x95, + // Bytes 2880 - 28bf + 0x49, 0xE3, 0x82, 0xA2, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xAB, 0x49, 0xE3, 0x82, 0xA4, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x81, 0x49, 0xE3, 0x82, 0xA6, + 0xE3, 0x82, 0xA9, 0xE3, 0x83, 0xB3, 0x49, 0xE3, + 0x82, 0xAA, 0xE3, 0x83, 0xB3, 0xE3, 0x82, 0xB9, + 0x49, 0xE3, 0x82, 0xAA, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xA0, 0x49, 0xE3, 0x82, 0xAB, 0xE3, 0x82, + 0xA4, 0xE3, 0x83, 0xAA, 0x49, 0xE3, 0x82, 0xB1, + // Bytes 28c0 - 28ff + 0xE3, 0x83, 0xBC, 0xE3, 0x82, 0xB9, 0x49, 0xE3, + 0x82, 0xB3, 0xE3, 0x83, 0xAB, 0xE3, 0x83, 0x8A, + 0x49, 0xE3, 0x82, 0xBB, 0xE3, 0x83, 0xB3, 0xE3, + 0x83, 0x81, 0x49, 0xE3, 0x82, 0xBB, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x88, 0x49, 0xE3, 0x83, 0x86, + 0xE3, 0x82, 0x99, 0xE3, 0x82, 0xB7, 0x49, 0xE3, + 0x83, 0x88, 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xAB, + 0x49, 0xE3, 0x83, 0x8E, 0xE3, 0x83, 0x83, 0xE3, + // Bytes 2900 - 293f + 0x83, 0x88, 0x49, 0xE3, 0x83, 0x8F, 0xE3, 0x82, + 0xA4, 0xE3, 0x83, 0x84, 0x49, 0xE3, 0x83, 0x92, + 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xAB, 0x49, 0xE3, + 0x83, 0x92, 0xE3, 0x82, 0x9A, 0xE3, 0x82, 0xB3, + 0x49, 0xE3, 0x83, 0x95, 0xE3, 0x83, 0xA9, 0xE3, + 0x83, 0xB3, 0x49, 0xE3, 0x83, 0x98, 0xE3, 0x82, + 0x9A, 0xE3, 0x82, 0xBD, 0x49, 0xE3, 0x83, 0x98, + 0xE3, 0x83, 0xAB, 0xE3, 0x83, 0x84, 0x49, 0xE3, + // Bytes 2940 - 297f + 0x83, 0x9B, 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0xAB, + 0x49, 0xE3, 0x83, 0x9B, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xB3, 0x49, 0xE3, 0x83, 0x9E, 0xE3, 0x82, + 0xA4, 0xE3, 0x83, 0xAB, 0x49, 0xE3, 0x83, 0x9E, + 0xE3, 0x83, 0x83, 0xE3, 0x83, 0x8F, 0x49, 0xE3, + 0x83, 0x9E, 0xE3, 0x83, 0xAB, 0xE3, 0x82, 0xAF, + 0x49, 0xE3, 0x83, 0xA4, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0xAB, 0x49, 0xE3, 0x83, 0xA6, 0xE3, 0x82, + // Bytes 2980 - 29bf + 0xA2, 0xE3, 0x83, 0xB3, 0x49, 0xE3, 0x83, 0xAF, + 0xE3, 0x83, 0x83, 0xE3, 0x83, 0x88, 0x4C, 0xE2, + 0x80, 0xB2, 0xE2, 0x80, 0xB2, 0xE2, 0x80, 0xB2, + 0xE2, 0x80, 0xB2, 0x4C, 0xE2, 0x88, 0xAB, 0xE2, + 0x88, 0xAB, 0xE2, 0x88, 0xAB, 0xE2, 0x88, 0xAB, + 0x4C, 0xE3, 0x82, 0xA2, 0xE3, 0x83, 0xAB, 0xE3, + 0x83, 0x95, 0xE3, 0x82, 0xA1, 0x4C, 0xE3, 0x82, + 0xA8, 0xE3, 0x83, 0xBC, 0xE3, 0x82, 0xAB, 0xE3, + // Bytes 29c0 - 29ff + 0x83, 0xBC, 0x4C, 0xE3, 0x82, 0xAB, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xB3, 0x4C, + 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x9E, 0x4C, 0xE3, 0x82, 0xAB, + 0xE3, 0x83, 0xA9, 0xE3, 0x83, 0x83, 0xE3, 0x83, + 0x88, 0x4C, 0xE3, 0x82, 0xAB, 0xE3, 0x83, 0xAD, + 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0xBC, 0x4C, 0xE3, + 0x82, 0xAD, 0xE3, 0x82, 0x99, 0xE3, 0x83, 0x8B, + // Bytes 2a00 - 2a3f + 0xE3, 0x83, 0xBC, 0x4C, 0xE3, 0x82, 0xAD, 0xE3, + 0x83, 0xA5, 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0xBC, + 0x4C, 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0xE3, + 0x83, 0xA9, 0xE3, 0x83, 0xA0, 0x4C, 0xE3, 0x82, + 0xAF, 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xBC, 0xE3, + 0x83, 0x8D, 0x4C, 0xE3, 0x82, 0xB5, 0xE3, 0x82, + 0xA4, 0xE3, 0x82, 0xAF, 0xE3, 0x83, 0xAB, 0x4C, + 0xE3, 0x82, 0xBF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + // Bytes 2a40 - 2a7f + 0xBC, 0xE3, 0x82, 0xB9, 0x4C, 0xE3, 0x83, 0x8F, + 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + 0x84, 0x4C, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x9A, + 0xE3, 0x82, 0xAF, 0xE3, 0x83, 0xAB, 0x4C, 0xE3, + 0x83, 0x95, 0xE3, 0x82, 0xA3, 0xE3, 0x83, 0xBC, + 0xE3, 0x83, 0x88, 0x4C, 0xE3, 0x83, 0x98, 0xE3, + 0x82, 0x99, 0xE3, 0x83, 0xBC, 0xE3, 0x82, 0xBF, + 0x4C, 0xE3, 0x83, 0x98, 0xE3, 0x82, 0x9A, 0xE3, + // Bytes 2a80 - 2abf + 0x83, 0x8B, 0xE3, 0x83, 0x92, 0x4C, 0xE3, 0x83, + 0x98, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xB3, 0xE3, + 0x82, 0xB9, 0x4C, 0xE3, 0x83, 0x9B, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xAB, 0xE3, 0x83, 0x88, 0x4C, + 0xE3, 0x83, 0x9E, 0xE3, 0x82, 0xA4, 0xE3, 0x82, + 0xAF, 0xE3, 0x83, 0xAD, 0x4C, 0xE3, 0x83, 0x9F, + 0xE3, 0x82, 0xAF, 0xE3, 0x83, 0xAD, 0xE3, 0x83, + 0xB3, 0x4C, 0xE3, 0x83, 0xA1, 0xE3, 0x83, 0xBC, + // Bytes 2ac0 - 2aff + 0xE3, 0x83, 0x88, 0xE3, 0x83, 0xAB, 0x4C, 0xE3, + 0x83, 0xAA, 0xE3, 0x83, 0x83, 0xE3, 0x83, 0x88, + 0xE3, 0x83, 0xAB, 0x4C, 0xE3, 0x83, 0xAB, 0xE3, + 0x83, 0x92, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, + 0x4C, 0xE6, 0xA0, 0xAA, 0xE5, 0xBC, 0x8F, 0xE4, + 0xBC, 0x9A, 0xE7, 0xA4, 0xBE, 0x4E, 0x28, 0xE1, + 0x84, 0x8B, 0xE1, 0x85, 0xA9, 0xE1, 0x84, 0x92, + 0xE1, 0x85, 0xAE, 0x29, 0x4F, 0xD8, 0xAC, 0xD9, + // Bytes 2b00 - 2b3f + 0x84, 0x20, 0xD8, 0xAC, 0xD9, 0x84, 0xD8, 0xA7, + 0xD9, 0x84, 0xD9, 0x87, 0x4F, 0xE3, 0x82, 0xA2, + 0xE3, 0x83, 0x8F, 0xE3, 0x82, 0x9A, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0x88, 0x4F, 0xE3, 0x82, 0xA2, + 0xE3, 0x83, 0xB3, 0xE3, 0x83, 0x98, 0xE3, 0x82, + 0x9A, 0xE3, 0x82, 0xA2, 0x4F, 0xE3, 0x82, 0xAD, + 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xAF, 0xE3, 0x83, + 0x83, 0xE3, 0x83, 0x88, 0x4F, 0xE3, 0x82, 0xB5, + // Bytes 2b40 - 2b7f + 0xE3, 0x83, 0xB3, 0xE3, 0x83, 0x81, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0xA0, 0x4F, 0xE3, 0x83, 0x8F, + 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + 0xAC, 0xE3, 0x83, 0xAB, 0x4F, 0xE3, 0x83, 0x98, + 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0xBF, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0xAB, 0x4F, 0xE3, 0x83, 0x9B, + 0xE3, 0x82, 0x9A, 0xE3, 0x82, 0xA4, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x88, 0x4F, 0xE3, 0x83, 0x9E, + // Bytes 2b80 - 2bbf + 0xE3, 0x83, 0xB3, 0xE3, 0x82, 0xB7, 0xE3, 0x83, + 0xA7, 0xE3, 0x83, 0xB3, 0x4F, 0xE3, 0x83, 0xA1, + 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0x88, 0xE3, 0x83, 0xB3, 0x4F, 0xE3, 0x83, 0xAB, + 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0x95, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xAB, 0x51, 0x28, 0xE1, 0x84, + 0x8B, 0xE1, 0x85, 0xA9, 0xE1, 0x84, 0x8C, 0xE1, + 0x85, 0xA5, 0xE1, 0x86, 0xAB, 0x29, 0x52, 0xE3, + // Bytes 2bc0 - 2bff + 0x82, 0xAD, 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xAB, + 0xE3, 0x82, 0xBF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0xBC, 0x52, 0xE3, 0x82, 0xAD, 0xE3, 0x83, 0xAD, + 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + 0xA9, 0xE3, 0x83, 0xA0, 0x52, 0xE3, 0x82, 0xAD, + 0xE3, 0x83, 0xAD, 0xE3, 0x83, 0xA1, 0xE3, 0x83, + 0xBC, 0xE3, 0x83, 0x88, 0xE3, 0x83, 0xAB, 0x52, + 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0xE3, 0x83, + // Bytes 2c00 - 2c3f + 0xA9, 0xE3, 0x83, 0xA0, 0xE3, 0x83, 0x88, 0xE3, + 0x83, 0xB3, 0x52, 0xE3, 0x82, 0xAF, 0xE3, 0x83, + 0xAB, 0xE3, 0x82, 0xBB, 0xE3, 0x82, 0x99, 0xE3, + 0x82, 0xA4, 0xE3, 0x83, 0xAD, 0x52, 0xE3, 0x83, + 0x8F, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, 0xE3, + 0x82, 0xBB, 0xE3, 0x83, 0xB3, 0xE3, 0x83, 0x88, + 0x52, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x9A, 0xE3, + 0x82, 0xA2, 0xE3, 0x82, 0xB9, 0xE3, 0x83, 0x88, + // Bytes 2c40 - 2c7f + 0xE3, 0x83, 0xAB, 0x52, 0xE3, 0x83, 0x95, 0xE3, + 0x82, 0x99, 0xE3, 0x83, 0x83, 0xE3, 0x82, 0xB7, + 0xE3, 0x82, 0xA7, 0xE3, 0x83, 0xAB, 0x52, 0xE3, + 0x83, 0x9F, 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0x8F, + 0xE3, 0x82, 0x99, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + 0xAB, 0x52, 0xE3, 0x83, 0xAC, 0xE3, 0x83, 0xB3, + 0xE3, 0x83, 0x88, 0xE3, 0x82, 0xB1, 0xE3, 0x82, + 0x99, 0xE3, 0x83, 0xB3, 0x61, 0xD8, 0xB5, 0xD9, + // Bytes 2c80 - 2cbf + 0x84, 0xD9, 0x89, 0x20, 0xD8, 0xA7, 0xD9, 0x84, + 0xD9, 0x84, 0xD9, 0x87, 0x20, 0xD8, 0xB9, 0xD9, + 0x84, 0xD9, 0x8A, 0xD9, 0x87, 0x20, 0xD9, 0x88, + 0xD8, 0xB3, 0xD9, 0x84, 0xD9, 0x85, 0x06, 0xE0, + 0xA7, 0x87, 0xE0, 0xA6, 0xBE, 0x01, 0x06, 0xE0, + 0xA7, 0x87, 0xE0, 0xA7, 0x97, 0x01, 0x06, 0xE0, + 0xAD, 0x87, 0xE0, 0xAC, 0xBE, 0x01, 0x06, 0xE0, + 0xAD, 0x87, 0xE0, 0xAD, 0x96, 0x01, 0x06, 0xE0, + // Bytes 2cc0 - 2cff + 0xAD, 0x87, 0xE0, 0xAD, 0x97, 0x01, 0x06, 0xE0, + 0xAE, 0x92, 0xE0, 0xAF, 0x97, 0x01, 0x06, 0xE0, + 0xAF, 0x86, 0xE0, 0xAE, 0xBE, 0x01, 0x06, 0xE0, + 0xAF, 0x86, 0xE0, 0xAF, 0x97, 0x01, 0x06, 0xE0, + 0xAF, 0x87, 0xE0, 0xAE, 0xBE, 0x01, 0x06, 0xE0, + 0xB2, 0xBF, 0xE0, 0xB3, 0x95, 0x01, 0x06, 0xE0, + 0xB3, 0x86, 0xE0, 0xB3, 0x95, 0x01, 0x06, 0xE0, + 0xB3, 0x86, 0xE0, 0xB3, 0x96, 0x01, 0x06, 0xE0, + // Bytes 2d00 - 2d3f + 0xB5, 0x86, 0xE0, 0xB4, 0xBE, 0x01, 0x06, 0xE0, + 0xB5, 0x86, 0xE0, 0xB5, 0x97, 0x01, 0x06, 0xE0, + 0xB5, 0x87, 0xE0, 0xB4, 0xBE, 0x01, 0x06, 0xE0, + 0xB7, 0x99, 0xE0, 0xB7, 0x9F, 0x01, 0x06, 0xE1, + 0x80, 0xA5, 0xE1, 0x80, 0xAE, 0x01, 0x06, 0xE1, + 0xAC, 0x85, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x87, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x89, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + // Bytes 2d40 - 2d7f + 0xAC, 0x8B, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x8D, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0x91, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBA, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBC, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBE, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAC, 0xBF, 0xE1, 0xAC, 0xB5, 0x01, 0x06, 0xE1, + 0xAD, 0x82, 0xE1, 0xAC, 0xB5, 0x01, 0x08, 0xF0, + // Bytes 2d80 - 2dbf + 0x91, 0x84, 0xB1, 0xF0, 0x91, 0x84, 0xA7, 0x01, + 0x08, 0xF0, 0x91, 0x84, 0xB2, 0xF0, 0x91, 0x84, + 0xA7, 0x01, 0x08, 0xF0, 0x91, 0x8D, 0x87, 0xF0, + 0x91, 0x8C, 0xBE, 0x01, 0x08, 0xF0, 0x91, 0x8D, + 0x87, 0xF0, 0x91, 0x8D, 0x97, 0x01, 0x08, 0xF0, + 0x91, 0x92, 0xB9, 0xF0, 0x91, 0x92, 0xB0, 0x01, + 0x08, 0xF0, 0x91, 0x92, 0xB9, 0xF0, 0x91, 0x92, + 0xBA, 0x01, 0x08, 0xF0, 0x91, 0x92, 0xB9, 0xF0, + // Bytes 2dc0 - 2dff + 0x91, 0x92, 0xBD, 0x01, 0x08, 0xF0, 0x91, 0x96, + 0xB8, 0xF0, 0x91, 0x96, 0xAF, 0x01, 0x08, 0xF0, + 0x91, 0x96, 0xB9, 0xF0, 0x91, 0x96, 0xAF, 0x01, + 0x09, 0xE0, 0xB3, 0x86, 0xE0, 0xB3, 0x82, 0xE0, + 0xB3, 0x95, 0x02, 0x09, 0xE0, 0xB7, 0x99, 0xE0, + 0xB7, 0x8F, 0xE0, 0xB7, 0x8A, 0x12, 0x44, 0x44, + 0x5A, 0xCC, 0x8C, 0xC9, 0x44, 0x44, 0x7A, 0xCC, + 0x8C, 0xC9, 0x44, 0x64, 0x7A, 0xCC, 0x8C, 0xC9, + // Bytes 2e00 - 2e3f + 0x46, 0xD9, 0x84, 0xD8, 0xA7, 0xD9, 0x93, 0xC9, + 0x46, 0xD9, 0x84, 0xD8, 0xA7, 0xD9, 0x94, 0xC9, + 0x46, 0xD9, 0x84, 0xD8, 0xA7, 0xD9, 0x95, 0xB5, + 0x46, 0xE1, 0x84, 0x80, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x82, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x83, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x85, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x86, 0xE1, 0x85, 0xA1, 0x01, + // Bytes 2e40 - 2e7f + 0x46, 0xE1, 0x84, 0x87, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x89, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8B, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8B, 0xE1, 0x85, 0xAE, 0x01, + 0x46, 0xE1, 0x84, 0x8C, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8E, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x8F, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x90, 0xE1, 0x85, 0xA1, 0x01, + // Bytes 2e80 - 2ebf + 0x46, 0xE1, 0x84, 0x91, 0xE1, 0x85, 0xA1, 0x01, + 0x46, 0xE1, 0x84, 0x92, 0xE1, 0x85, 0xA1, 0x01, + 0x49, 0xE3, 0x83, 0xA1, 0xE3, 0x82, 0xAB, 0xE3, + 0x82, 0x99, 0x0D, 0x4C, 0xE1, 0x84, 0x8C, 0xE1, + 0x85, 0xAE, 0xE1, 0x84, 0x8B, 0xE1, 0x85, 0xB4, + 0x01, 0x4C, 0xE3, 0x82, 0xAD, 0xE3, 0x82, 0x99, + 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0x0D, 0x4C, + 0xE3, 0x82, 0xB3, 0xE3, 0x83, 0xBC, 0xE3, 0x83, + // Bytes 2ec0 - 2eff + 0x9B, 0xE3, 0x82, 0x9A, 0x0D, 0x4C, 0xE3, 0x83, + 0xA4, 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0x88, 0xE3, + 0x82, 0x99, 0x0D, 0x4F, 0xE1, 0x84, 0x8E, 0xE1, + 0x85, 0xA1, 0xE1, 0x86, 0xB7, 0xE1, 0x84, 0x80, + 0xE1, 0x85, 0xA9, 0x01, 0x4F, 0xE3, 0x82, 0xA4, + 0xE3, 0x83, 0x8B, 0xE3, 0x83, 0xB3, 0xE3, 0x82, + 0xAF, 0xE3, 0x82, 0x99, 0x0D, 0x4F, 0xE3, 0x82, + 0xB7, 0xE3, 0x83, 0xAA, 0xE3, 0x83, 0xB3, 0xE3, + // Bytes 2f00 - 2f3f + 0x82, 0xAF, 0xE3, 0x82, 0x99, 0x0D, 0x4F, 0xE3, + 0x83, 0x98, 0xE3, 0x82, 0x9A, 0xE3, 0x83, 0xBC, + 0xE3, 0x82, 0xB7, 0xE3, 0x82, 0x99, 0x0D, 0x4F, + 0xE3, 0x83, 0x9B, 0xE3, 0x82, 0x9A, 0xE3, 0x83, + 0xB3, 0xE3, 0x83, 0x88, 0xE3, 0x82, 0x99, 0x0D, + 0x52, 0xE3, 0x82, 0xA8, 0xE3, 0x82, 0xB9, 0xE3, + 0x82, 0xAF, 0xE3, 0x83, 0xBC, 0xE3, 0x83, 0x88, + 0xE3, 0x82, 0x99, 0x0D, 0x52, 0xE3, 0x83, 0x95, + // Bytes 2f40 - 2f7f + 0xE3, 0x82, 0xA1, 0xE3, 0x83, 0xA9, 0xE3, 0x83, + 0x83, 0xE3, 0x83, 0x88, 0xE3, 0x82, 0x99, 0x0D, + 0x86, 0xE0, 0xB3, 0x86, 0xE0, 0xB3, 0x82, 0x01, + 0x86, 0xE0, 0xB7, 0x99, 0xE0, 0xB7, 0x8F, 0x01, + 0x03, 0x3C, 0xCC, 0xB8, 0x05, 0x03, 0x3D, 0xCC, + 0xB8, 0x05, 0x03, 0x3E, 0xCC, 0xB8, 0x05, 0x03, + 0x41, 0xCC, 0x80, 0xC9, 0x03, 0x41, 0xCC, 0x81, + 0xC9, 0x03, 0x41, 0xCC, 0x83, 0xC9, 0x03, 0x41, + // Bytes 2f80 - 2fbf + 0xCC, 0x84, 0xC9, 0x03, 0x41, 0xCC, 0x89, 0xC9, + 0x03, 0x41, 0xCC, 0x8C, 0xC9, 0x03, 0x41, 0xCC, + 0x8F, 0xC9, 0x03, 0x41, 0xCC, 0x91, 0xC9, 0x03, + 0x41, 0xCC, 0xA5, 0xB5, 0x03, 0x41, 0xCC, 0xA8, + 0xA5, 0x03, 0x42, 0xCC, 0x87, 0xC9, 0x03, 0x42, + 0xCC, 0xA3, 0xB5, 0x03, 0x42, 0xCC, 0xB1, 0xB5, + 0x03, 0x43, 0xCC, 0x81, 0xC9, 0x03, 0x43, 0xCC, + 0x82, 0xC9, 0x03, 0x43, 0xCC, 0x87, 0xC9, 0x03, + // Bytes 2fc0 - 2fff + 0x43, 0xCC, 0x8C, 0xC9, 0x03, 0x44, 0xCC, 0x87, + 0xC9, 0x03, 0x44, 0xCC, 0x8C, 0xC9, 0x03, 0x44, + 0xCC, 0xA3, 0xB5, 0x03, 0x44, 0xCC, 0xA7, 0xA5, + 0x03, 0x44, 0xCC, 0xAD, 0xB5, 0x03, 0x44, 0xCC, + 0xB1, 0xB5, 0x03, 0x45, 0xCC, 0x80, 0xC9, 0x03, + 0x45, 0xCC, 0x81, 0xC9, 0x03, 0x45, 0xCC, 0x83, + 0xC9, 0x03, 0x45, 0xCC, 0x86, 0xC9, 0x03, 0x45, + 0xCC, 0x87, 0xC9, 0x03, 0x45, 0xCC, 0x88, 0xC9, + // Bytes 3000 - 303f + 0x03, 0x45, 0xCC, 0x89, 0xC9, 0x03, 0x45, 0xCC, + 0x8C, 0xC9, 0x03, 0x45, 0xCC, 0x8F, 0xC9, 0x03, + 0x45, 0xCC, 0x91, 0xC9, 0x03, 0x45, 0xCC, 0xA8, + 0xA5, 0x03, 0x45, 0xCC, 0xAD, 0xB5, 0x03, 0x45, + 0xCC, 0xB0, 0xB5, 0x03, 0x46, 0xCC, 0x87, 0xC9, + 0x03, 0x47, 0xCC, 0x81, 0xC9, 0x03, 0x47, 0xCC, + 0x82, 0xC9, 0x03, 0x47, 0xCC, 0x84, 0xC9, 0x03, + 0x47, 0xCC, 0x86, 0xC9, 0x03, 0x47, 0xCC, 0x87, + // Bytes 3040 - 307f + 0xC9, 0x03, 0x47, 0xCC, 0x8C, 0xC9, 0x03, 0x47, + 0xCC, 0xA7, 0xA5, 0x03, 0x48, 0xCC, 0x82, 0xC9, + 0x03, 0x48, 0xCC, 0x87, 0xC9, 0x03, 0x48, 0xCC, + 0x88, 0xC9, 0x03, 0x48, 0xCC, 0x8C, 0xC9, 0x03, + 0x48, 0xCC, 0xA3, 0xB5, 0x03, 0x48, 0xCC, 0xA7, + 0xA5, 0x03, 0x48, 0xCC, 0xAE, 0xB5, 0x03, 0x49, + 0xCC, 0x80, 0xC9, 0x03, 0x49, 0xCC, 0x81, 0xC9, + 0x03, 0x49, 0xCC, 0x82, 0xC9, 0x03, 0x49, 0xCC, + // Bytes 3080 - 30bf + 0x83, 0xC9, 0x03, 0x49, 0xCC, 0x84, 0xC9, 0x03, + 0x49, 0xCC, 0x86, 0xC9, 0x03, 0x49, 0xCC, 0x87, + 0xC9, 0x03, 0x49, 0xCC, 0x89, 0xC9, 0x03, 0x49, + 0xCC, 0x8C, 0xC9, 0x03, 0x49, 0xCC, 0x8F, 0xC9, + 0x03, 0x49, 0xCC, 0x91, 0xC9, 0x03, 0x49, 0xCC, + 0xA3, 0xB5, 0x03, 0x49, 0xCC, 0xA8, 0xA5, 0x03, + 0x49, 0xCC, 0xB0, 0xB5, 0x03, 0x4A, 0xCC, 0x82, + 0xC9, 0x03, 0x4B, 0xCC, 0x81, 0xC9, 0x03, 0x4B, + // Bytes 30c0 - 30ff + 0xCC, 0x8C, 0xC9, 0x03, 0x4B, 0xCC, 0xA3, 0xB5, + 0x03, 0x4B, 0xCC, 0xA7, 0xA5, 0x03, 0x4B, 0xCC, + 0xB1, 0xB5, 0x03, 0x4C, 0xCC, 0x81, 0xC9, 0x03, + 0x4C, 0xCC, 0x8C, 0xC9, 0x03, 0x4C, 0xCC, 0xA7, + 0xA5, 0x03, 0x4C, 0xCC, 0xAD, 0xB5, 0x03, 0x4C, + 0xCC, 0xB1, 0xB5, 0x03, 0x4D, 0xCC, 0x81, 0xC9, + 0x03, 0x4D, 0xCC, 0x87, 0xC9, 0x03, 0x4D, 0xCC, + 0xA3, 0xB5, 0x03, 0x4E, 0xCC, 0x80, 0xC9, 0x03, + // Bytes 3100 - 313f + 0x4E, 0xCC, 0x81, 0xC9, 0x03, 0x4E, 0xCC, 0x83, + 0xC9, 0x03, 0x4E, 0xCC, 0x87, 0xC9, 0x03, 0x4E, + 0xCC, 0x8C, 0xC9, 0x03, 0x4E, 0xCC, 0xA3, 0xB5, + 0x03, 0x4E, 0xCC, 0xA7, 0xA5, 0x03, 0x4E, 0xCC, + 0xAD, 0xB5, 0x03, 0x4E, 0xCC, 0xB1, 0xB5, 0x03, + 0x4F, 0xCC, 0x80, 0xC9, 0x03, 0x4F, 0xCC, 0x81, + 0xC9, 0x03, 0x4F, 0xCC, 0x86, 0xC9, 0x03, 0x4F, + 0xCC, 0x89, 0xC9, 0x03, 0x4F, 0xCC, 0x8B, 0xC9, + // Bytes 3140 - 317f + 0x03, 0x4F, 0xCC, 0x8C, 0xC9, 0x03, 0x4F, 0xCC, + 0x8F, 0xC9, 0x03, 0x4F, 0xCC, 0x91, 0xC9, 0x03, + 0x50, 0xCC, 0x81, 0xC9, 0x03, 0x50, 0xCC, 0x87, + 0xC9, 0x03, 0x52, 0xCC, 0x81, 0xC9, 0x03, 0x52, + 0xCC, 0x87, 0xC9, 0x03, 0x52, 0xCC, 0x8C, 0xC9, + 0x03, 0x52, 0xCC, 0x8F, 0xC9, 0x03, 0x52, 0xCC, + 0x91, 0xC9, 0x03, 0x52, 0xCC, 0xA7, 0xA5, 0x03, + 0x52, 0xCC, 0xB1, 0xB5, 0x03, 0x53, 0xCC, 0x82, + // Bytes 3180 - 31bf + 0xC9, 0x03, 0x53, 0xCC, 0x87, 0xC9, 0x03, 0x53, + 0xCC, 0xA6, 0xB5, 0x03, 0x53, 0xCC, 0xA7, 0xA5, + 0x03, 0x54, 0xCC, 0x87, 0xC9, 0x03, 0x54, 0xCC, + 0x8C, 0xC9, 0x03, 0x54, 0xCC, 0xA3, 0xB5, 0x03, + 0x54, 0xCC, 0xA6, 0xB5, 0x03, 0x54, 0xCC, 0xA7, + 0xA5, 0x03, 0x54, 0xCC, 0xAD, 0xB5, 0x03, 0x54, + 0xCC, 0xB1, 0xB5, 0x03, 0x55, 0xCC, 0x80, 0xC9, + 0x03, 0x55, 0xCC, 0x81, 0xC9, 0x03, 0x55, 0xCC, + // Bytes 31c0 - 31ff + 0x82, 0xC9, 0x03, 0x55, 0xCC, 0x86, 0xC9, 0x03, + 0x55, 0xCC, 0x89, 0xC9, 0x03, 0x55, 0xCC, 0x8A, + 0xC9, 0x03, 0x55, 0xCC, 0x8B, 0xC9, 0x03, 0x55, + 0xCC, 0x8C, 0xC9, 0x03, 0x55, 0xCC, 0x8F, 0xC9, + 0x03, 0x55, 0xCC, 0x91, 0xC9, 0x03, 0x55, 0xCC, + 0xA3, 0xB5, 0x03, 0x55, 0xCC, 0xA4, 0xB5, 0x03, + 0x55, 0xCC, 0xA8, 0xA5, 0x03, 0x55, 0xCC, 0xAD, + 0xB5, 0x03, 0x55, 0xCC, 0xB0, 0xB5, 0x03, 0x56, + // Bytes 3200 - 323f + 0xCC, 0x83, 0xC9, 0x03, 0x56, 0xCC, 0xA3, 0xB5, + 0x03, 0x57, 0xCC, 0x80, 0xC9, 0x03, 0x57, 0xCC, + 0x81, 0xC9, 0x03, 0x57, 0xCC, 0x82, 0xC9, 0x03, + 0x57, 0xCC, 0x87, 0xC9, 0x03, 0x57, 0xCC, 0x88, + 0xC9, 0x03, 0x57, 0xCC, 0xA3, 0xB5, 0x03, 0x58, + 0xCC, 0x87, 0xC9, 0x03, 0x58, 0xCC, 0x88, 0xC9, + 0x03, 0x59, 0xCC, 0x80, 0xC9, 0x03, 0x59, 0xCC, + 0x81, 0xC9, 0x03, 0x59, 0xCC, 0x82, 0xC9, 0x03, + // Bytes 3240 - 327f + 0x59, 0xCC, 0x83, 0xC9, 0x03, 0x59, 0xCC, 0x84, + 0xC9, 0x03, 0x59, 0xCC, 0x87, 0xC9, 0x03, 0x59, + 0xCC, 0x88, 0xC9, 0x03, 0x59, 0xCC, 0x89, 0xC9, + 0x03, 0x59, 0xCC, 0xA3, 0xB5, 0x03, 0x5A, 0xCC, + 0x81, 0xC9, 0x03, 0x5A, 0xCC, 0x82, 0xC9, 0x03, + 0x5A, 0xCC, 0x87, 0xC9, 0x03, 0x5A, 0xCC, 0x8C, + 0xC9, 0x03, 0x5A, 0xCC, 0xA3, 0xB5, 0x03, 0x5A, + 0xCC, 0xB1, 0xB5, 0x03, 0x61, 0xCC, 0x80, 0xC9, + // Bytes 3280 - 32bf + 0x03, 0x61, 0xCC, 0x81, 0xC9, 0x03, 0x61, 0xCC, + 0x83, 0xC9, 0x03, 0x61, 0xCC, 0x84, 0xC9, 0x03, + 0x61, 0xCC, 0x89, 0xC9, 0x03, 0x61, 0xCC, 0x8C, + 0xC9, 0x03, 0x61, 0xCC, 0x8F, 0xC9, 0x03, 0x61, + 0xCC, 0x91, 0xC9, 0x03, 0x61, 0xCC, 0xA5, 0xB5, + 0x03, 0x61, 0xCC, 0xA8, 0xA5, 0x03, 0x62, 0xCC, + 0x87, 0xC9, 0x03, 0x62, 0xCC, 0xA3, 0xB5, 0x03, + 0x62, 0xCC, 0xB1, 0xB5, 0x03, 0x63, 0xCC, 0x81, + // Bytes 32c0 - 32ff + 0xC9, 0x03, 0x63, 0xCC, 0x82, 0xC9, 0x03, 0x63, + 0xCC, 0x87, 0xC9, 0x03, 0x63, 0xCC, 0x8C, 0xC9, + 0x03, 0x64, 0xCC, 0x87, 0xC9, 0x03, 0x64, 0xCC, + 0x8C, 0xC9, 0x03, 0x64, 0xCC, 0xA3, 0xB5, 0x03, + 0x64, 0xCC, 0xA7, 0xA5, 0x03, 0x64, 0xCC, 0xAD, + 0xB5, 0x03, 0x64, 0xCC, 0xB1, 0xB5, 0x03, 0x65, + 0xCC, 0x80, 0xC9, 0x03, 0x65, 0xCC, 0x81, 0xC9, + 0x03, 0x65, 0xCC, 0x83, 0xC9, 0x03, 0x65, 0xCC, + // Bytes 3300 - 333f + 0x86, 0xC9, 0x03, 0x65, 0xCC, 0x87, 0xC9, 0x03, + 0x65, 0xCC, 0x88, 0xC9, 0x03, 0x65, 0xCC, 0x89, + 0xC9, 0x03, 0x65, 0xCC, 0x8C, 0xC9, 0x03, 0x65, + 0xCC, 0x8F, 0xC9, 0x03, 0x65, 0xCC, 0x91, 0xC9, + 0x03, 0x65, 0xCC, 0xA8, 0xA5, 0x03, 0x65, 0xCC, + 0xAD, 0xB5, 0x03, 0x65, 0xCC, 0xB0, 0xB5, 0x03, + 0x66, 0xCC, 0x87, 0xC9, 0x03, 0x67, 0xCC, 0x81, + 0xC9, 0x03, 0x67, 0xCC, 0x82, 0xC9, 0x03, 0x67, + // Bytes 3340 - 337f + 0xCC, 0x84, 0xC9, 0x03, 0x67, 0xCC, 0x86, 0xC9, + 0x03, 0x67, 0xCC, 0x87, 0xC9, 0x03, 0x67, 0xCC, + 0x8C, 0xC9, 0x03, 0x67, 0xCC, 0xA7, 0xA5, 0x03, + 0x68, 0xCC, 0x82, 0xC9, 0x03, 0x68, 0xCC, 0x87, + 0xC9, 0x03, 0x68, 0xCC, 0x88, 0xC9, 0x03, 0x68, + 0xCC, 0x8C, 0xC9, 0x03, 0x68, 0xCC, 0xA3, 0xB5, + 0x03, 0x68, 0xCC, 0xA7, 0xA5, 0x03, 0x68, 0xCC, + 0xAE, 0xB5, 0x03, 0x68, 0xCC, 0xB1, 0xB5, 0x03, + // Bytes 3380 - 33bf + 0x69, 0xCC, 0x80, 0xC9, 0x03, 0x69, 0xCC, 0x81, + 0xC9, 0x03, 0x69, 0xCC, 0x82, 0xC9, 0x03, 0x69, + 0xCC, 0x83, 0xC9, 0x03, 0x69, 0xCC, 0x84, 0xC9, + 0x03, 0x69, 0xCC, 0x86, 0xC9, 0x03, 0x69, 0xCC, + 0x89, 0xC9, 0x03, 0x69, 0xCC, 0x8C, 0xC9, 0x03, + 0x69, 0xCC, 0x8F, 0xC9, 0x03, 0x69, 0xCC, 0x91, + 0xC9, 0x03, 0x69, 0xCC, 0xA3, 0xB5, 0x03, 0x69, + 0xCC, 0xA8, 0xA5, 0x03, 0x69, 0xCC, 0xB0, 0xB5, + // Bytes 33c0 - 33ff + 0x03, 0x6A, 0xCC, 0x82, 0xC9, 0x03, 0x6A, 0xCC, + 0x8C, 0xC9, 0x03, 0x6B, 0xCC, 0x81, 0xC9, 0x03, + 0x6B, 0xCC, 0x8C, 0xC9, 0x03, 0x6B, 0xCC, 0xA3, + 0xB5, 0x03, 0x6B, 0xCC, 0xA7, 0xA5, 0x03, 0x6B, + 0xCC, 0xB1, 0xB5, 0x03, 0x6C, 0xCC, 0x81, 0xC9, + 0x03, 0x6C, 0xCC, 0x8C, 0xC9, 0x03, 0x6C, 0xCC, + 0xA7, 0xA5, 0x03, 0x6C, 0xCC, 0xAD, 0xB5, 0x03, + 0x6C, 0xCC, 0xB1, 0xB5, 0x03, 0x6D, 0xCC, 0x81, + // Bytes 3400 - 343f + 0xC9, 0x03, 0x6D, 0xCC, 0x87, 0xC9, 0x03, 0x6D, + 0xCC, 0xA3, 0xB5, 0x03, 0x6E, 0xCC, 0x80, 0xC9, + 0x03, 0x6E, 0xCC, 0x81, 0xC9, 0x03, 0x6E, 0xCC, + 0x83, 0xC9, 0x03, 0x6E, 0xCC, 0x87, 0xC9, 0x03, + 0x6E, 0xCC, 0x8C, 0xC9, 0x03, 0x6E, 0xCC, 0xA3, + 0xB5, 0x03, 0x6E, 0xCC, 0xA7, 0xA5, 0x03, 0x6E, + 0xCC, 0xAD, 0xB5, 0x03, 0x6E, 0xCC, 0xB1, 0xB5, + 0x03, 0x6F, 0xCC, 0x80, 0xC9, 0x03, 0x6F, 0xCC, + // Bytes 3440 - 347f + 0x81, 0xC9, 0x03, 0x6F, 0xCC, 0x86, 0xC9, 0x03, + 0x6F, 0xCC, 0x89, 0xC9, 0x03, 0x6F, 0xCC, 0x8B, + 0xC9, 0x03, 0x6F, 0xCC, 0x8C, 0xC9, 0x03, 0x6F, + 0xCC, 0x8F, 0xC9, 0x03, 0x6F, 0xCC, 0x91, 0xC9, + 0x03, 0x70, 0xCC, 0x81, 0xC9, 0x03, 0x70, 0xCC, + 0x87, 0xC9, 0x03, 0x72, 0xCC, 0x81, 0xC9, 0x03, + 0x72, 0xCC, 0x87, 0xC9, 0x03, 0x72, 0xCC, 0x8C, + 0xC9, 0x03, 0x72, 0xCC, 0x8F, 0xC9, 0x03, 0x72, + // Bytes 3480 - 34bf + 0xCC, 0x91, 0xC9, 0x03, 0x72, 0xCC, 0xA7, 0xA5, + 0x03, 0x72, 0xCC, 0xB1, 0xB5, 0x03, 0x73, 0xCC, + 0x82, 0xC9, 0x03, 0x73, 0xCC, 0x87, 0xC9, 0x03, + 0x73, 0xCC, 0xA6, 0xB5, 0x03, 0x73, 0xCC, 0xA7, + 0xA5, 0x03, 0x74, 0xCC, 0x87, 0xC9, 0x03, 0x74, + 0xCC, 0x88, 0xC9, 0x03, 0x74, 0xCC, 0x8C, 0xC9, + 0x03, 0x74, 0xCC, 0xA3, 0xB5, 0x03, 0x74, 0xCC, + 0xA6, 0xB5, 0x03, 0x74, 0xCC, 0xA7, 0xA5, 0x03, + // Bytes 34c0 - 34ff + 0x74, 0xCC, 0xAD, 0xB5, 0x03, 0x74, 0xCC, 0xB1, + 0xB5, 0x03, 0x75, 0xCC, 0x80, 0xC9, 0x03, 0x75, + 0xCC, 0x81, 0xC9, 0x03, 0x75, 0xCC, 0x82, 0xC9, + 0x03, 0x75, 0xCC, 0x86, 0xC9, 0x03, 0x75, 0xCC, + 0x89, 0xC9, 0x03, 0x75, 0xCC, 0x8A, 0xC9, 0x03, + 0x75, 0xCC, 0x8B, 0xC9, 0x03, 0x75, 0xCC, 0x8C, + 0xC9, 0x03, 0x75, 0xCC, 0x8F, 0xC9, 0x03, 0x75, + 0xCC, 0x91, 0xC9, 0x03, 0x75, 0xCC, 0xA3, 0xB5, + // Bytes 3500 - 353f + 0x03, 0x75, 0xCC, 0xA4, 0xB5, 0x03, 0x75, 0xCC, + 0xA8, 0xA5, 0x03, 0x75, 0xCC, 0xAD, 0xB5, 0x03, + 0x75, 0xCC, 0xB0, 0xB5, 0x03, 0x76, 0xCC, 0x83, + 0xC9, 0x03, 0x76, 0xCC, 0xA3, 0xB5, 0x03, 0x77, + 0xCC, 0x80, 0xC9, 0x03, 0x77, 0xCC, 0x81, 0xC9, + 0x03, 0x77, 0xCC, 0x82, 0xC9, 0x03, 0x77, 0xCC, + 0x87, 0xC9, 0x03, 0x77, 0xCC, 0x88, 0xC9, 0x03, + 0x77, 0xCC, 0x8A, 0xC9, 0x03, 0x77, 0xCC, 0xA3, + // Bytes 3540 - 357f + 0xB5, 0x03, 0x78, 0xCC, 0x87, 0xC9, 0x03, 0x78, + 0xCC, 0x88, 0xC9, 0x03, 0x79, 0xCC, 0x80, 0xC9, + 0x03, 0x79, 0xCC, 0x81, 0xC9, 0x03, 0x79, 0xCC, + 0x82, 0xC9, 0x03, 0x79, 0xCC, 0x83, 0xC9, 0x03, + 0x79, 0xCC, 0x84, 0xC9, 0x03, 0x79, 0xCC, 0x87, + 0xC9, 0x03, 0x79, 0xCC, 0x88, 0xC9, 0x03, 0x79, + 0xCC, 0x89, 0xC9, 0x03, 0x79, 0xCC, 0x8A, 0xC9, + 0x03, 0x79, 0xCC, 0xA3, 0xB5, 0x03, 0x7A, 0xCC, + // Bytes 3580 - 35bf + 0x81, 0xC9, 0x03, 0x7A, 0xCC, 0x82, 0xC9, 0x03, + 0x7A, 0xCC, 0x87, 0xC9, 0x03, 0x7A, 0xCC, 0x8C, + 0xC9, 0x03, 0x7A, 0xCC, 0xA3, 0xB5, 0x03, 0x7A, + 0xCC, 0xB1, 0xB5, 0x04, 0xC2, 0xA8, 0xCC, 0x80, + 0xCA, 0x04, 0xC2, 0xA8, 0xCC, 0x81, 0xCA, 0x04, + 0xC2, 0xA8, 0xCD, 0x82, 0xCA, 0x04, 0xC3, 0x86, + 0xCC, 0x81, 0xC9, 0x04, 0xC3, 0x86, 0xCC, 0x84, + 0xC9, 0x04, 0xC3, 0x98, 0xCC, 0x81, 0xC9, 0x04, + // Bytes 35c0 - 35ff + 0xC3, 0xA6, 0xCC, 0x81, 0xC9, 0x04, 0xC3, 0xA6, + 0xCC, 0x84, 0xC9, 0x04, 0xC3, 0xB8, 0xCC, 0x81, + 0xC9, 0x04, 0xC5, 0xBF, 0xCC, 0x87, 0xC9, 0x04, + 0xC6, 0xB7, 0xCC, 0x8C, 0xC9, 0x04, 0xCA, 0x92, + 0xCC, 0x8C, 0xC9, 0x04, 0xCE, 0x91, 0xCC, 0x80, + 0xC9, 0x04, 0xCE, 0x91, 0xCC, 0x81, 0xC9, 0x04, + 0xCE, 0x91, 0xCC, 0x84, 0xC9, 0x04, 0xCE, 0x91, + 0xCC, 0x86, 0xC9, 0x04, 0xCE, 0x91, 0xCD, 0x85, + // Bytes 3600 - 363f + 0xD9, 0x04, 0xCE, 0x95, 0xCC, 0x80, 0xC9, 0x04, + 0xCE, 0x95, 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0x97, + 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0x97, 0xCC, 0x81, + 0xC9, 0x04, 0xCE, 0x97, 0xCD, 0x85, 0xD9, 0x04, + 0xCE, 0x99, 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0x99, + 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0x99, 0xCC, 0x84, + 0xC9, 0x04, 0xCE, 0x99, 0xCC, 0x86, 0xC9, 0x04, + 0xCE, 0x99, 0xCC, 0x88, 0xC9, 0x04, 0xCE, 0x9F, + // Bytes 3640 - 367f + 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0x9F, 0xCC, 0x81, + 0xC9, 0x04, 0xCE, 0xA1, 0xCC, 0x94, 0xC9, 0x04, + 0xCE, 0xA5, 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0xA5, + 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0xA5, 0xCC, 0x84, + 0xC9, 0x04, 0xCE, 0xA5, 0xCC, 0x86, 0xC9, 0x04, + 0xCE, 0xA5, 0xCC, 0x88, 0xC9, 0x04, 0xCE, 0xA9, + 0xCC, 0x80, 0xC9, 0x04, 0xCE, 0xA9, 0xCC, 0x81, + 0xC9, 0x04, 0xCE, 0xA9, 0xCD, 0x85, 0xD9, 0x04, + // Bytes 3680 - 36bf + 0xCE, 0xB1, 0xCC, 0x84, 0xC9, 0x04, 0xCE, 0xB1, + 0xCC, 0x86, 0xC9, 0x04, 0xCE, 0xB1, 0xCD, 0x85, + 0xD9, 0x04, 0xCE, 0xB5, 0xCC, 0x80, 0xC9, 0x04, + 0xCE, 0xB5, 0xCC, 0x81, 0xC9, 0x04, 0xCE, 0xB7, + 0xCD, 0x85, 0xD9, 0x04, 0xCE, 0xB9, 0xCC, 0x80, + 0xC9, 0x04, 0xCE, 0xB9, 0xCC, 0x81, 0xC9, 0x04, + 0xCE, 0xB9, 0xCC, 0x84, 0xC9, 0x04, 0xCE, 0xB9, + 0xCC, 0x86, 0xC9, 0x04, 0xCE, 0xB9, 0xCD, 0x82, + // Bytes 36c0 - 36ff + 0xC9, 0x04, 0xCE, 0xBF, 0xCC, 0x80, 0xC9, 0x04, + 0xCE, 0xBF, 0xCC, 0x81, 0xC9, 0x04, 0xCF, 0x81, + 0xCC, 0x93, 0xC9, 0x04, 0xCF, 0x81, 0xCC, 0x94, + 0xC9, 0x04, 0xCF, 0x85, 0xCC, 0x80, 0xC9, 0x04, + 0xCF, 0x85, 0xCC, 0x81, 0xC9, 0x04, 0xCF, 0x85, + 0xCC, 0x84, 0xC9, 0x04, 0xCF, 0x85, 0xCC, 0x86, + 0xC9, 0x04, 0xCF, 0x85, 0xCD, 0x82, 0xC9, 0x04, + 0xCF, 0x89, 0xCD, 0x85, 0xD9, 0x04, 0xCF, 0x92, + // Bytes 3700 - 373f + 0xCC, 0x81, 0xC9, 0x04, 0xCF, 0x92, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0x86, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0x90, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0x90, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x93, 0xCC, 0x81, + 0xC9, 0x04, 0xD0, 0x95, 0xCC, 0x80, 0xC9, 0x04, + 0xD0, 0x95, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0x95, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x96, 0xCC, 0x86, + 0xC9, 0x04, 0xD0, 0x96, 0xCC, 0x88, 0xC9, 0x04, + // Bytes 3740 - 377f + 0xD0, 0x97, 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x98, + 0xCC, 0x80, 0xC9, 0x04, 0xD0, 0x98, 0xCC, 0x84, + 0xC9, 0x04, 0xD0, 0x98, 0xCC, 0x86, 0xC9, 0x04, + 0xD0, 0x98, 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0x9A, + 0xCC, 0x81, 0xC9, 0x04, 0xD0, 0x9E, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0xA3, 0xCC, 0x84, 0xC9, 0x04, + 0xD0, 0xA3, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0xA3, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xA3, 0xCC, 0x8B, + // Bytes 3780 - 37bf + 0xC9, 0x04, 0xD0, 0xA7, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0xAB, 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xAD, + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xB0, 0xCC, 0x86, + 0xC9, 0x04, 0xD0, 0xB0, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0xB3, 0xCC, 0x81, 0xC9, 0x04, 0xD0, 0xB5, + 0xCC, 0x80, 0xC9, 0x04, 0xD0, 0xB5, 0xCC, 0x86, + 0xC9, 0x04, 0xD0, 0xB5, 0xCC, 0x88, 0xC9, 0x04, + 0xD0, 0xB6, 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0xB6, + // Bytes 37c0 - 37ff + 0xCC, 0x88, 0xC9, 0x04, 0xD0, 0xB7, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0xB8, 0xCC, 0x80, 0xC9, 0x04, + 0xD0, 0xB8, 0xCC, 0x84, 0xC9, 0x04, 0xD0, 0xB8, + 0xCC, 0x86, 0xC9, 0x04, 0xD0, 0xB8, 0xCC, 0x88, + 0xC9, 0x04, 0xD0, 0xBA, 0xCC, 0x81, 0xC9, 0x04, + 0xD0, 0xBE, 0xCC, 0x88, 0xC9, 0x04, 0xD1, 0x83, + 0xCC, 0x84, 0xC9, 0x04, 0xD1, 0x83, 0xCC, 0x86, + 0xC9, 0x04, 0xD1, 0x83, 0xCC, 0x88, 0xC9, 0x04, + // Bytes 3800 - 383f + 0xD1, 0x83, 0xCC, 0x8B, 0xC9, 0x04, 0xD1, 0x87, + 0xCC, 0x88, 0xC9, 0x04, 0xD1, 0x8B, 0xCC, 0x88, + 0xC9, 0x04, 0xD1, 0x8D, 0xCC, 0x88, 0xC9, 0x04, + 0xD1, 0x96, 0xCC, 0x88, 0xC9, 0x04, 0xD1, 0xB4, + 0xCC, 0x8F, 0xC9, 0x04, 0xD1, 0xB5, 0xCC, 0x8F, + 0xC9, 0x04, 0xD3, 0x98, 0xCC, 0x88, 0xC9, 0x04, + 0xD3, 0x99, 0xCC, 0x88, 0xC9, 0x04, 0xD3, 0xA8, + 0xCC, 0x88, 0xC9, 0x04, 0xD3, 0xA9, 0xCC, 0x88, + // Bytes 3840 - 387f + 0xC9, 0x04, 0xD8, 0xA7, 0xD9, 0x93, 0xC9, 0x04, + 0xD8, 0xA7, 0xD9, 0x94, 0xC9, 0x04, 0xD8, 0xA7, + 0xD9, 0x95, 0xB5, 0x04, 0xD9, 0x88, 0xD9, 0x94, + 0xC9, 0x04, 0xD9, 0x8A, 0xD9, 0x94, 0xC9, 0x04, + 0xDB, 0x81, 0xD9, 0x94, 0xC9, 0x04, 0xDB, 0x92, + 0xD9, 0x94, 0xC9, 0x04, 0xDB, 0x95, 0xD9, 0x94, + 0xC9, 0x05, 0x41, 0xCC, 0x82, 0xCC, 0x80, 0xCA, + 0x05, 0x41, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, + // Bytes 3880 - 38bf + 0x41, 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x41, + 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x41, 0xCC, + 0x86, 0xCC, 0x80, 0xCA, 0x05, 0x41, 0xCC, 0x86, + 0xCC, 0x81, 0xCA, 0x05, 0x41, 0xCC, 0x86, 0xCC, + 0x83, 0xCA, 0x05, 0x41, 0xCC, 0x86, 0xCC, 0x89, + 0xCA, 0x05, 0x41, 0xCC, 0x87, 0xCC, 0x84, 0xCA, + 0x05, 0x41, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, + 0x41, 0xCC, 0x8A, 0xCC, 0x81, 0xCA, 0x05, 0x41, + // Bytes 38c0 - 38ff + 0xCC, 0xA3, 0xCC, 0x82, 0xCA, 0x05, 0x41, 0xCC, + 0xA3, 0xCC, 0x86, 0xCA, 0x05, 0x43, 0xCC, 0xA7, + 0xCC, 0x81, 0xCA, 0x05, 0x45, 0xCC, 0x82, 0xCC, + 0x80, 0xCA, 0x05, 0x45, 0xCC, 0x82, 0xCC, 0x81, + 0xCA, 0x05, 0x45, 0xCC, 0x82, 0xCC, 0x83, 0xCA, + 0x05, 0x45, 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, + 0x45, 0xCC, 0x84, 0xCC, 0x80, 0xCA, 0x05, 0x45, + 0xCC, 0x84, 0xCC, 0x81, 0xCA, 0x05, 0x45, 0xCC, + // Bytes 3900 - 393f + 0xA3, 0xCC, 0x82, 0xCA, 0x05, 0x45, 0xCC, 0xA7, + 0xCC, 0x86, 0xCA, 0x05, 0x49, 0xCC, 0x88, 0xCC, + 0x81, 0xCA, 0x05, 0x4C, 0xCC, 0xA3, 0xCC, 0x84, + 0xCA, 0x05, 0x4F, 0xCC, 0x82, 0xCC, 0x80, 0xCA, + 0x05, 0x4F, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, + 0x4F, 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x4F, + 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x4F, 0xCC, + 0x83, 0xCC, 0x81, 0xCA, 0x05, 0x4F, 0xCC, 0x83, + // Bytes 3940 - 397f + 0xCC, 0x84, 0xCA, 0x05, 0x4F, 0xCC, 0x83, 0xCC, + 0x88, 0xCA, 0x05, 0x4F, 0xCC, 0x84, 0xCC, 0x80, + 0xCA, 0x05, 0x4F, 0xCC, 0x84, 0xCC, 0x81, 0xCA, + 0x05, 0x4F, 0xCC, 0x87, 0xCC, 0x84, 0xCA, 0x05, + 0x4F, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x4F, + 0xCC, 0x9B, 0xCC, 0x80, 0xCA, 0x05, 0x4F, 0xCC, + 0x9B, 0xCC, 0x81, 0xCA, 0x05, 0x4F, 0xCC, 0x9B, + 0xCC, 0x83, 0xCA, 0x05, 0x4F, 0xCC, 0x9B, 0xCC, + // Bytes 3980 - 39bf + 0x89, 0xCA, 0x05, 0x4F, 0xCC, 0x9B, 0xCC, 0xA3, + 0xB6, 0x05, 0x4F, 0xCC, 0xA3, 0xCC, 0x82, 0xCA, + 0x05, 0x4F, 0xCC, 0xA8, 0xCC, 0x84, 0xCA, 0x05, + 0x52, 0xCC, 0xA3, 0xCC, 0x84, 0xCA, 0x05, 0x53, + 0xCC, 0x81, 0xCC, 0x87, 0xCA, 0x05, 0x53, 0xCC, + 0x8C, 0xCC, 0x87, 0xCA, 0x05, 0x53, 0xCC, 0xA3, + 0xCC, 0x87, 0xCA, 0x05, 0x55, 0xCC, 0x83, 0xCC, + 0x81, 0xCA, 0x05, 0x55, 0xCC, 0x84, 0xCC, 0x88, + // Bytes 39c0 - 39ff + 0xCA, 0x05, 0x55, 0xCC, 0x88, 0xCC, 0x80, 0xCA, + 0x05, 0x55, 0xCC, 0x88, 0xCC, 0x81, 0xCA, 0x05, + 0x55, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x55, + 0xCC, 0x88, 0xCC, 0x8C, 0xCA, 0x05, 0x55, 0xCC, + 0x9B, 0xCC, 0x80, 0xCA, 0x05, 0x55, 0xCC, 0x9B, + 0xCC, 0x81, 0xCA, 0x05, 0x55, 0xCC, 0x9B, 0xCC, + 0x83, 0xCA, 0x05, 0x55, 0xCC, 0x9B, 0xCC, 0x89, + 0xCA, 0x05, 0x55, 0xCC, 0x9B, 0xCC, 0xA3, 0xB6, + // Bytes 3a00 - 3a3f + 0x05, 0x61, 0xCC, 0x82, 0xCC, 0x80, 0xCA, 0x05, + 0x61, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, 0x61, + 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x61, 0xCC, + 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x61, 0xCC, 0x86, + 0xCC, 0x80, 0xCA, 0x05, 0x61, 0xCC, 0x86, 0xCC, + 0x81, 0xCA, 0x05, 0x61, 0xCC, 0x86, 0xCC, 0x83, + 0xCA, 0x05, 0x61, 0xCC, 0x86, 0xCC, 0x89, 0xCA, + 0x05, 0x61, 0xCC, 0x87, 0xCC, 0x84, 0xCA, 0x05, + // Bytes 3a40 - 3a7f + 0x61, 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x61, + 0xCC, 0x8A, 0xCC, 0x81, 0xCA, 0x05, 0x61, 0xCC, + 0xA3, 0xCC, 0x82, 0xCA, 0x05, 0x61, 0xCC, 0xA3, + 0xCC, 0x86, 0xCA, 0x05, 0x63, 0xCC, 0xA7, 0xCC, + 0x81, 0xCA, 0x05, 0x65, 0xCC, 0x82, 0xCC, 0x80, + 0xCA, 0x05, 0x65, 0xCC, 0x82, 0xCC, 0x81, 0xCA, + 0x05, 0x65, 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, + 0x65, 0xCC, 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x65, + // Bytes 3a80 - 3abf + 0xCC, 0x84, 0xCC, 0x80, 0xCA, 0x05, 0x65, 0xCC, + 0x84, 0xCC, 0x81, 0xCA, 0x05, 0x65, 0xCC, 0xA3, + 0xCC, 0x82, 0xCA, 0x05, 0x65, 0xCC, 0xA7, 0xCC, + 0x86, 0xCA, 0x05, 0x69, 0xCC, 0x88, 0xCC, 0x81, + 0xCA, 0x05, 0x6C, 0xCC, 0xA3, 0xCC, 0x84, 0xCA, + 0x05, 0x6F, 0xCC, 0x82, 0xCC, 0x80, 0xCA, 0x05, + 0x6F, 0xCC, 0x82, 0xCC, 0x81, 0xCA, 0x05, 0x6F, + 0xCC, 0x82, 0xCC, 0x83, 0xCA, 0x05, 0x6F, 0xCC, + // Bytes 3ac0 - 3aff + 0x82, 0xCC, 0x89, 0xCA, 0x05, 0x6F, 0xCC, 0x83, + 0xCC, 0x81, 0xCA, 0x05, 0x6F, 0xCC, 0x83, 0xCC, + 0x84, 0xCA, 0x05, 0x6F, 0xCC, 0x83, 0xCC, 0x88, + 0xCA, 0x05, 0x6F, 0xCC, 0x84, 0xCC, 0x80, 0xCA, + 0x05, 0x6F, 0xCC, 0x84, 0xCC, 0x81, 0xCA, 0x05, + 0x6F, 0xCC, 0x87, 0xCC, 0x84, 0xCA, 0x05, 0x6F, + 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x6F, 0xCC, + 0x9B, 0xCC, 0x80, 0xCA, 0x05, 0x6F, 0xCC, 0x9B, + // Bytes 3b00 - 3b3f + 0xCC, 0x81, 0xCA, 0x05, 0x6F, 0xCC, 0x9B, 0xCC, + 0x83, 0xCA, 0x05, 0x6F, 0xCC, 0x9B, 0xCC, 0x89, + 0xCA, 0x05, 0x6F, 0xCC, 0x9B, 0xCC, 0xA3, 0xB6, + 0x05, 0x6F, 0xCC, 0xA3, 0xCC, 0x82, 0xCA, 0x05, + 0x6F, 0xCC, 0xA8, 0xCC, 0x84, 0xCA, 0x05, 0x72, + 0xCC, 0xA3, 0xCC, 0x84, 0xCA, 0x05, 0x73, 0xCC, + 0x81, 0xCC, 0x87, 0xCA, 0x05, 0x73, 0xCC, 0x8C, + 0xCC, 0x87, 0xCA, 0x05, 0x73, 0xCC, 0xA3, 0xCC, + // Bytes 3b40 - 3b7f + 0x87, 0xCA, 0x05, 0x75, 0xCC, 0x83, 0xCC, 0x81, + 0xCA, 0x05, 0x75, 0xCC, 0x84, 0xCC, 0x88, 0xCA, + 0x05, 0x75, 0xCC, 0x88, 0xCC, 0x80, 0xCA, 0x05, + 0x75, 0xCC, 0x88, 0xCC, 0x81, 0xCA, 0x05, 0x75, + 0xCC, 0x88, 0xCC, 0x84, 0xCA, 0x05, 0x75, 0xCC, + 0x88, 0xCC, 0x8C, 0xCA, 0x05, 0x75, 0xCC, 0x9B, + 0xCC, 0x80, 0xCA, 0x05, 0x75, 0xCC, 0x9B, 0xCC, + 0x81, 0xCA, 0x05, 0x75, 0xCC, 0x9B, 0xCC, 0x83, + // Bytes 3b80 - 3bbf + 0xCA, 0x05, 0x75, 0xCC, 0x9B, 0xCC, 0x89, 0xCA, + 0x05, 0x75, 0xCC, 0x9B, 0xCC, 0xA3, 0xB6, 0x05, + 0xE1, 0xBE, 0xBF, 0xCC, 0x80, 0xCA, 0x05, 0xE1, + 0xBE, 0xBF, 0xCC, 0x81, 0xCA, 0x05, 0xE1, 0xBE, + 0xBF, 0xCD, 0x82, 0xCA, 0x05, 0xE1, 0xBF, 0xBE, + 0xCC, 0x80, 0xCA, 0x05, 0xE1, 0xBF, 0xBE, 0xCC, + 0x81, 0xCA, 0x05, 0xE1, 0xBF, 0xBE, 0xCD, 0x82, + 0xCA, 0x05, 0xE2, 0x86, 0x90, 0xCC, 0xB8, 0x05, + // Bytes 3bc0 - 3bff + 0x05, 0xE2, 0x86, 0x92, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x86, 0x94, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x87, 0x90, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x87, + 0x92, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x87, 0x94, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x88, 0x83, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x88, 0x88, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x88, 0x8B, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x88, 0xA3, 0xCC, 0xB8, 0x05, 0x05, + // Bytes 3c00 - 3c3f + 0xE2, 0x88, 0xA5, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x88, 0xBC, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, + 0x83, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0x85, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0x88, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x89, 0x8D, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x89, 0xA1, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x89, 0xA4, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x89, 0xA5, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + // Bytes 3c40 - 3c7f + 0x89, 0xB2, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, + 0xB3, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0xB6, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x89, 0xB7, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x89, 0xBA, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x89, 0xBB, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x89, 0xBC, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x89, 0xBD, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x8A, 0x82, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, + // Bytes 3c80 - 3cbf + 0x83, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0x86, + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0x87, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0x91, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x8A, 0x92, 0xCC, 0xB8, 0x05, + 0x05, 0xE2, 0x8A, 0xA2, 0xCC, 0xB8, 0x05, 0x05, + 0xE2, 0x8A, 0xA8, 0xCC, 0xB8, 0x05, 0x05, 0xE2, + 0x8A, 0xA9, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, + 0xAB, 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0xB2, + // Bytes 3cc0 - 3cff + 0xCC, 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0xB3, 0xCC, + 0xB8, 0x05, 0x05, 0xE2, 0x8A, 0xB4, 0xCC, 0xB8, + 0x05, 0x05, 0xE2, 0x8A, 0xB5, 0xCC, 0xB8, 0x05, + 0x06, 0xCE, 0x91, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x91, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x95, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x95, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x95, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + // Bytes 3d00 - 3d3f + 0x06, 0xCE, 0x95, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x97, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x97, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0x99, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x93, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x99, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + // Bytes 3d40 - 3d7f + 0x06, 0xCE, 0x99, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0x9F, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xA5, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xA5, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xA5, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + // Bytes 3d80 - 3dbf + 0x06, 0xCE, 0xA9, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xA9, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x80, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x81, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB1, 0xCD, 0x82, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB5, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + // Bytes 3dc0 - 3dff + 0x06, 0xCE, 0xB5, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB5, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB5, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB7, 0xCC, 0x80, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCC, 0x81, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCE, 0xB7, 0xCD, 0x82, 0xCD, 0x85, 0xDA, + // Bytes 3e00 - 3e3f + 0x06, 0xCE, 0xB9, 0xCC, 0x88, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x88, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x88, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x93, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xB9, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + // Bytes 3e40 - 3e7f + 0x06, 0xCE, 0xB9, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCE, 0xBF, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x88, 0xCC, 0x80, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x88, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x88, 0xCD, 0x82, 0xCA, + // Bytes 3e80 - 3ebf + 0x06, 0xCF, 0x85, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x93, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x93, 0xCD, 0x82, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x94, 0xCC, 0x80, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x94, 0xCC, 0x81, 0xCA, + 0x06, 0xCF, 0x85, 0xCC, 0x94, 0xCD, 0x82, 0xCA, + 0x06, 0xCF, 0x89, 0xCC, 0x80, 0xCD, 0x85, 0xDA, + 0x06, 0xCF, 0x89, 0xCC, 0x81, 0xCD, 0x85, 0xDA, + // Bytes 3ec0 - 3eff + 0x06, 0xCF, 0x89, 0xCC, 0x93, 0xCD, 0x85, 0xDA, + 0x06, 0xCF, 0x89, 0xCC, 0x94, 0xCD, 0x85, 0xDA, + 0x06, 0xCF, 0x89, 0xCD, 0x82, 0xCD, 0x85, 0xDA, + 0x06, 0xE0, 0xA4, 0xA8, 0xE0, 0xA4, 0xBC, 0x09, + 0x06, 0xE0, 0xA4, 0xB0, 0xE0, 0xA4, 0xBC, 0x09, + 0x06, 0xE0, 0xA4, 0xB3, 0xE0, 0xA4, 0xBC, 0x09, + 0x06, 0xE0, 0xB1, 0x86, 0xE0, 0xB1, 0x96, 0x85, + 0x06, 0xE0, 0xB7, 0x99, 0xE0, 0xB7, 0x8A, 0x11, + // Bytes 3f00 - 3f3f + 0x06, 0xE3, 0x81, 0x86, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x8B, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x8D, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x8F, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x91, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x93, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x95, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x97, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 3f40 - 3f7f + 0x06, 0xE3, 0x81, 0x99, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x9B, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x9D, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0x9F, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA1, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA4, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA6, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xA8, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 3f80 - 3fbf + 0x06, 0xE3, 0x81, 0xAF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xAF, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x81, 0xB2, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xB2, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x81, 0xB5, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xB5, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x81, 0xB8, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xB8, 0xE3, 0x82, 0x9A, 0x0D, + // Bytes 3fc0 - 3fff + 0x06, 0xE3, 0x81, 0xBB, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x81, 0xBB, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x82, 0x9D, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xA6, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xAB, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xAD, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xAF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB1, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 4000 - 403f + 0x06, 0xE3, 0x82, 0xB3, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB5, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB7, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xB9, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xBB, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xBD, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x82, 0xBF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x81, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 4040 - 407f + 0x06, 0xE3, 0x83, 0x84, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x86, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x88, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x8F, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x8F, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x92, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x95, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 4080 - 40bf + 0x06, 0xE3, 0x83, 0x95, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x98, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x98, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0x9B, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0x9B, 0xE3, 0x82, 0x9A, 0x0D, + 0x06, 0xE3, 0x83, 0xAF, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0xB0, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0xB1, 0xE3, 0x82, 0x99, 0x0D, + // Bytes 40c0 - 40ff + 0x06, 0xE3, 0x83, 0xB2, 0xE3, 0x82, 0x99, 0x0D, + 0x06, 0xE3, 0x83, 0xBD, 0xE3, 0x82, 0x99, 0x0D, + 0x08, 0xCE, 0x91, 0xCC, 0x93, 0xCC, 0x80, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0x91, 0xCC, 0x93, 0xCC, + 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0x91, 0xCC, + 0x93, 0xCD, 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0x91, 0xCC, 0x94, 0xCC, 0x80, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0x91, 0xCC, 0x94, 0xCC, 0x81, 0xCD, + // Bytes 4100 - 413f + 0x85, 0xDB, 0x08, 0xCE, 0x91, 0xCC, 0x94, 0xCD, + 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0x97, 0xCC, + 0x93, 0xCC, 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0x97, 0xCC, 0x93, 0xCC, 0x81, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0x97, 0xCC, 0x93, 0xCD, 0x82, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0x97, 0xCC, 0x94, 0xCC, + 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0x97, 0xCC, + 0x94, 0xCC, 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + // Bytes 4140 - 417f + 0x97, 0xCC, 0x94, 0xCD, 0x82, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xA9, 0xCC, 0x93, 0xCC, 0x80, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xA9, 0xCC, 0x93, 0xCC, + 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xA9, 0xCC, + 0x93, 0xCD, 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xA9, 0xCC, 0x94, 0xCC, 0x80, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xA9, 0xCC, 0x94, 0xCC, 0x81, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xA9, 0xCC, 0x94, 0xCD, + // Bytes 4180 - 41bf + 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xB1, 0xCC, + 0x93, 0xCC, 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xB1, 0xCC, 0x93, 0xCC, 0x81, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xB1, 0xCC, 0x93, 0xCD, 0x82, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xB1, 0xCC, 0x94, 0xCC, + 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xB1, 0xCC, + 0x94, 0xCC, 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xB1, 0xCC, 0x94, 0xCD, 0x82, 0xCD, 0x85, 0xDB, + // Bytes 41c0 - 41ff + 0x08, 0xCE, 0xB7, 0xCC, 0x93, 0xCC, 0x80, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xB7, 0xCC, 0x93, 0xCC, + 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCE, 0xB7, 0xCC, + 0x93, 0xCD, 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCE, + 0xB7, 0xCC, 0x94, 0xCC, 0x80, 0xCD, 0x85, 0xDB, + 0x08, 0xCE, 0xB7, 0xCC, 0x94, 0xCC, 0x81, 0xCD, + 0x85, 0xDB, 0x08, 0xCE, 0xB7, 0xCC, 0x94, 0xCD, + 0x82, 0xCD, 0x85, 0xDB, 0x08, 0xCF, 0x89, 0xCC, + // Bytes 4200 - 423f + 0x93, 0xCC, 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCF, + 0x89, 0xCC, 0x93, 0xCC, 0x81, 0xCD, 0x85, 0xDB, + 0x08, 0xCF, 0x89, 0xCC, 0x93, 0xCD, 0x82, 0xCD, + 0x85, 0xDB, 0x08, 0xCF, 0x89, 0xCC, 0x94, 0xCC, + 0x80, 0xCD, 0x85, 0xDB, 0x08, 0xCF, 0x89, 0xCC, + 0x94, 0xCC, 0x81, 0xCD, 0x85, 0xDB, 0x08, 0xCF, + 0x89, 0xCC, 0x94, 0xCD, 0x82, 0xCD, 0x85, 0xDB, + 0x08, 0xF0, 0x91, 0x82, 0x99, 0xF0, 0x91, 0x82, + // Bytes 4240 - 427f + 0xBA, 0x09, 0x08, 0xF0, 0x91, 0x82, 0x9B, 0xF0, + 0x91, 0x82, 0xBA, 0x09, 0x08, 0xF0, 0x91, 0x82, + 0xA5, 0xF0, 0x91, 0x82, 0xBA, 0x09, 0x42, 0xC2, + 0xB4, 0x01, 0x43, 0x20, 0xCC, 0x81, 0xC9, 0x43, + 0x20, 0xCC, 0x83, 0xC9, 0x43, 0x20, 0xCC, 0x84, + 0xC9, 0x43, 0x20, 0xCC, 0x85, 0xC9, 0x43, 0x20, + 0xCC, 0x86, 0xC9, 0x43, 0x20, 0xCC, 0x87, 0xC9, + 0x43, 0x20, 0xCC, 0x88, 0xC9, 0x43, 0x20, 0xCC, + // Bytes 4280 - 42bf + 0x8A, 0xC9, 0x43, 0x20, 0xCC, 0x8B, 0xC9, 0x43, + 0x20, 0xCC, 0x93, 0xC9, 0x43, 0x20, 0xCC, 0x94, + 0xC9, 0x43, 0x20, 0xCC, 0xA7, 0xA5, 0x43, 0x20, + 0xCC, 0xA8, 0xA5, 0x43, 0x20, 0xCC, 0xB3, 0xB5, + 0x43, 0x20, 0xCD, 0x82, 0xC9, 0x43, 0x20, 0xCD, + 0x85, 0xD9, 0x43, 0x20, 0xD9, 0x8B, 0x59, 0x43, + 0x20, 0xD9, 0x8C, 0x5D, 0x43, 0x20, 0xD9, 0x8D, + 0x61, 0x43, 0x20, 0xD9, 0x8E, 0x65, 0x43, 0x20, + // Bytes 42c0 - 42ff + 0xD9, 0x8F, 0x69, 0x43, 0x20, 0xD9, 0x90, 0x6D, + 0x43, 0x20, 0xD9, 0x91, 0x71, 0x43, 0x20, 0xD9, + 0x92, 0x75, 0x43, 0x41, 0xCC, 0x8A, 0xC9, 0x43, + 0x73, 0xCC, 0x87, 0xC9, 0x44, 0x20, 0xE3, 0x82, + 0x99, 0x0D, 0x44, 0x20, 0xE3, 0x82, 0x9A, 0x0D, + 0x44, 0xC2, 0xA8, 0xCC, 0x81, 0xCA, 0x44, 0xCE, + 0x91, 0xCC, 0x81, 0xC9, 0x44, 0xCE, 0x95, 0xCC, + 0x81, 0xC9, 0x44, 0xCE, 0x97, 0xCC, 0x81, 0xC9, + // Bytes 4300 - 433f + 0x44, 0xCE, 0x99, 0xCC, 0x81, 0xC9, 0x44, 0xCE, + 0x9F, 0xCC, 0x81, 0xC9, 0x44, 0xCE, 0xA5, 0xCC, + 0x81, 0xC9, 0x44, 0xCE, 0xA5, 0xCC, 0x88, 0xC9, + 0x44, 0xCE, 0xA9, 0xCC, 0x81, 0xC9, 0x44, 0xCE, + 0xB1, 0xCC, 0x81, 0xC9, 0x44, 0xCE, 0xB5, 0xCC, + 0x81, 0xC9, 0x44, 0xCE, 0xB7, 0xCC, 0x81, 0xC9, + 0x44, 0xCE, 0xB9, 0xCC, 0x81, 0xC9, 0x44, 0xCE, + 0xBF, 0xCC, 0x81, 0xC9, 0x44, 0xCF, 0x85, 0xCC, + // Bytes 4340 - 437f + 0x81, 0xC9, 0x44, 0xCF, 0x89, 0xCC, 0x81, 0xC9, + 0x44, 0xD7, 0x90, 0xD6, 0xB7, 0x31, 0x44, 0xD7, + 0x90, 0xD6, 0xB8, 0x35, 0x44, 0xD7, 0x90, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x91, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x91, 0xD6, 0xBF, 0x49, 0x44, 0xD7, + 0x92, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x93, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x94, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x95, 0xD6, 0xB9, 0x39, 0x44, 0xD7, + // Bytes 4380 - 43bf + 0x95, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x96, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x98, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x99, 0xD6, 0xB4, 0x25, 0x44, 0xD7, + 0x99, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x9A, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0x9B, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0x9B, 0xD6, 0xBF, 0x49, 0x44, 0xD7, + 0x9C, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0x9E, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0xA0, 0xD6, 0xBC, 0x41, + // Bytes 43c0 - 43ff + 0x44, 0xD7, 0xA1, 0xD6, 0xBC, 0x41, 0x44, 0xD7, + 0xA3, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0xA4, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0xA4, 0xD6, 0xBF, 0x49, + 0x44, 0xD7, 0xA6, 0xD6, 0xBC, 0x41, 0x44, 0xD7, + 0xA7, 0xD6, 0xBC, 0x41, 0x44, 0xD7, 0xA8, 0xD6, + 0xBC, 0x41, 0x44, 0xD7, 0xA9, 0xD6, 0xBC, 0x41, + 0x44, 0xD7, 0xA9, 0xD7, 0x81, 0x4D, 0x44, 0xD7, + 0xA9, 0xD7, 0x82, 0x51, 0x44, 0xD7, 0xAA, 0xD6, + // Bytes 4400 - 443f + 0xBC, 0x41, 0x44, 0xD7, 0xB2, 0xD6, 0xB7, 0x31, + 0x44, 0xD8, 0xA7, 0xD9, 0x8B, 0x59, 0x44, 0xD8, + 0xA7, 0xD9, 0x93, 0xC9, 0x44, 0xD8, 0xA7, 0xD9, + 0x94, 0xC9, 0x44, 0xD8, 0xA7, 0xD9, 0x95, 0xB5, + 0x44, 0xD8, 0xB0, 0xD9, 0xB0, 0x79, 0x44, 0xD8, + 0xB1, 0xD9, 0xB0, 0x79, 0x44, 0xD9, 0x80, 0xD9, + 0x8B, 0x59, 0x44, 0xD9, 0x80, 0xD9, 0x8E, 0x65, + 0x44, 0xD9, 0x80, 0xD9, 0x8F, 0x69, 0x44, 0xD9, + // Bytes 4440 - 447f + 0x80, 0xD9, 0x90, 0x6D, 0x44, 0xD9, 0x80, 0xD9, + 0x91, 0x71, 0x44, 0xD9, 0x80, 0xD9, 0x92, 0x75, + 0x44, 0xD9, 0x87, 0xD9, 0xB0, 0x79, 0x44, 0xD9, + 0x88, 0xD9, 0x94, 0xC9, 0x44, 0xD9, 0x89, 0xD9, + 0xB0, 0x79, 0x44, 0xD9, 0x8A, 0xD9, 0x94, 0xC9, + 0x44, 0xDB, 0x92, 0xD9, 0x94, 0xC9, 0x44, 0xDB, + 0x95, 0xD9, 0x94, 0xC9, 0x45, 0x20, 0xCC, 0x88, + 0xCC, 0x80, 0xCA, 0x45, 0x20, 0xCC, 0x88, 0xCC, + // Bytes 4480 - 44bf + 0x81, 0xCA, 0x45, 0x20, 0xCC, 0x88, 0xCD, 0x82, + 0xCA, 0x45, 0x20, 0xCC, 0x93, 0xCC, 0x80, 0xCA, + 0x45, 0x20, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x45, + 0x20, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x45, 0x20, + 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x45, 0x20, 0xCC, + 0x94, 0xCC, 0x81, 0xCA, 0x45, 0x20, 0xCC, 0x94, + 0xCD, 0x82, 0xCA, 0x45, 0x20, 0xD9, 0x8C, 0xD9, + 0x91, 0x72, 0x45, 0x20, 0xD9, 0x8D, 0xD9, 0x91, + // Bytes 44c0 - 44ff + 0x72, 0x45, 0x20, 0xD9, 0x8E, 0xD9, 0x91, 0x72, + 0x45, 0x20, 0xD9, 0x8F, 0xD9, 0x91, 0x72, 0x45, + 0x20, 0xD9, 0x90, 0xD9, 0x91, 0x72, 0x45, 0x20, + 0xD9, 0x91, 0xD9, 0xB0, 0x7A, 0x45, 0xE2, 0xAB, + 0x9D, 0xCC, 0xB8, 0x05, 0x46, 0xCE, 0xB9, 0xCC, + 0x88, 0xCC, 0x81, 0xCA, 0x46, 0xCF, 0x85, 0xCC, + 0x88, 0xCC, 0x81, 0xCA, 0x46, 0xD7, 0xA9, 0xD6, + 0xBC, 0xD7, 0x81, 0x4E, 0x46, 0xD7, 0xA9, 0xD6, + // Bytes 4500 - 453f + 0xBC, 0xD7, 0x82, 0x52, 0x46, 0xD9, 0x80, 0xD9, + 0x8E, 0xD9, 0x91, 0x72, 0x46, 0xD9, 0x80, 0xD9, + 0x8F, 0xD9, 0x91, 0x72, 0x46, 0xD9, 0x80, 0xD9, + 0x90, 0xD9, 0x91, 0x72, 0x46, 0xE0, 0xA4, 0x95, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0x96, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0x97, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0x9C, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xA1, + // Bytes 4540 - 457f + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xA2, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xAB, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA4, 0xAF, + 0xE0, 0xA4, 0xBC, 0x09, 0x46, 0xE0, 0xA6, 0xA1, + 0xE0, 0xA6, 0xBC, 0x09, 0x46, 0xE0, 0xA6, 0xA2, + 0xE0, 0xA6, 0xBC, 0x09, 0x46, 0xE0, 0xA6, 0xAF, + 0xE0, 0xA6, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0x96, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0x97, + // Bytes 4580 - 45bf + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0x9C, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0xAB, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0xB2, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xA8, 0xB8, + 0xE0, 0xA8, 0xBC, 0x09, 0x46, 0xE0, 0xAC, 0xA1, + 0xE0, 0xAC, 0xBC, 0x09, 0x46, 0xE0, 0xAC, 0xA2, + 0xE0, 0xAC, 0xBC, 0x09, 0x46, 0xE0, 0xBE, 0xB2, + 0xE0, 0xBE, 0x80, 0x9D, 0x46, 0xE0, 0xBE, 0xB3, + // Bytes 45c0 - 45ff + 0xE0, 0xBE, 0x80, 0x9D, 0x46, 0xE3, 0x83, 0x86, + 0xE3, 0x82, 0x99, 0x0D, 0x48, 0xF0, 0x9D, 0x85, + 0x97, 0xF0, 0x9D, 0x85, 0xA5, 0xAD, 0x48, 0xF0, + 0x9D, 0x85, 0x98, 0xF0, 0x9D, 0x85, 0xA5, 0xAD, + 0x48, 0xF0, 0x9D, 0x86, 0xB9, 0xF0, 0x9D, 0x85, + 0xA5, 0xAD, 0x48, 0xF0, 0x9D, 0x86, 0xBA, 0xF0, + 0x9D, 0x85, 0xA5, 0xAD, 0x49, 0xE0, 0xBE, 0xB2, + 0xE0, 0xBD, 0xB1, 0xE0, 0xBE, 0x80, 0x9E, 0x49, + // Bytes 4600 - 463f + 0xE0, 0xBE, 0xB3, 0xE0, 0xBD, 0xB1, 0xE0, 0xBE, + 0x80, 0x9E, 0x4C, 0xF0, 0x9D, 0x85, 0x98, 0xF0, + 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, 0xAE, 0xAE, + 0x4C, 0xF0, 0x9D, 0x85, 0x98, 0xF0, 0x9D, 0x85, + 0xA5, 0xF0, 0x9D, 0x85, 0xAF, 0xAE, 0x4C, 0xF0, + 0x9D, 0x85, 0x98, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, + 0x9D, 0x85, 0xB0, 0xAE, 0x4C, 0xF0, 0x9D, 0x85, + 0x98, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, + // Bytes 4640 - 467f + 0xB1, 0xAE, 0x4C, 0xF0, 0x9D, 0x85, 0x98, 0xF0, + 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, 0xB2, 0xAE, + 0x4C, 0xF0, 0x9D, 0x86, 0xB9, 0xF0, 0x9D, 0x85, + 0xA5, 0xF0, 0x9D, 0x85, 0xAE, 0xAE, 0x4C, 0xF0, + 0x9D, 0x86, 0xB9, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, + 0x9D, 0x85, 0xAF, 0xAE, 0x4C, 0xF0, 0x9D, 0x86, + 0xBA, 0xF0, 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, + 0xAE, 0xAE, 0x4C, 0xF0, 0x9D, 0x86, 0xBA, 0xF0, + // Bytes 4680 - 46bf + 0x9D, 0x85, 0xA5, 0xF0, 0x9D, 0x85, 0xAF, 0xAE, + 0x83, 0x41, 0xCC, 0x82, 0xC9, 0x83, 0x41, 0xCC, + 0x86, 0xC9, 0x83, 0x41, 0xCC, 0x87, 0xC9, 0x83, + 0x41, 0xCC, 0x88, 0xC9, 0x83, 0x41, 0xCC, 0x8A, + 0xC9, 0x83, 0x41, 0xCC, 0xA3, 0xB5, 0x83, 0x43, + 0xCC, 0xA7, 0xA5, 0x83, 0x45, 0xCC, 0x82, 0xC9, + 0x83, 0x45, 0xCC, 0x84, 0xC9, 0x83, 0x45, 0xCC, + 0xA3, 0xB5, 0x83, 0x45, 0xCC, 0xA7, 0xA5, 0x83, + // Bytes 46c0 - 46ff + 0x49, 0xCC, 0x88, 0xC9, 0x83, 0x4C, 0xCC, 0xA3, + 0xB5, 0x83, 0x4F, 0xCC, 0x82, 0xC9, 0x83, 0x4F, + 0xCC, 0x83, 0xC9, 0x83, 0x4F, 0xCC, 0x84, 0xC9, + 0x83, 0x4F, 0xCC, 0x87, 0xC9, 0x83, 0x4F, 0xCC, + 0x88, 0xC9, 0x83, 0x4F, 0xCC, 0x9B, 0xAD, 0x83, + 0x4F, 0xCC, 0xA3, 0xB5, 0x83, 0x4F, 0xCC, 0xA8, + 0xA5, 0x83, 0x52, 0xCC, 0xA3, 0xB5, 0x83, 0x53, + 0xCC, 0x81, 0xC9, 0x83, 0x53, 0xCC, 0x8C, 0xC9, + // Bytes 4700 - 473f + 0x83, 0x53, 0xCC, 0xA3, 0xB5, 0x83, 0x55, 0xCC, + 0x83, 0xC9, 0x83, 0x55, 0xCC, 0x84, 0xC9, 0x83, + 0x55, 0xCC, 0x88, 0xC9, 0x83, 0x55, 0xCC, 0x9B, + 0xAD, 0x83, 0x61, 0xCC, 0x82, 0xC9, 0x83, 0x61, + 0xCC, 0x86, 0xC9, 0x83, 0x61, 0xCC, 0x87, 0xC9, + 0x83, 0x61, 0xCC, 0x88, 0xC9, 0x83, 0x61, 0xCC, + 0x8A, 0xC9, 0x83, 0x61, 0xCC, 0xA3, 0xB5, 0x83, + 0x63, 0xCC, 0xA7, 0xA5, 0x83, 0x65, 0xCC, 0x82, + // Bytes 4740 - 477f + 0xC9, 0x83, 0x65, 0xCC, 0x84, 0xC9, 0x83, 0x65, + 0xCC, 0xA3, 0xB5, 0x83, 0x65, 0xCC, 0xA7, 0xA5, + 0x83, 0x69, 0xCC, 0x88, 0xC9, 0x83, 0x6C, 0xCC, + 0xA3, 0xB5, 0x83, 0x6F, 0xCC, 0x82, 0xC9, 0x83, + 0x6F, 0xCC, 0x83, 0xC9, 0x83, 0x6F, 0xCC, 0x84, + 0xC9, 0x83, 0x6F, 0xCC, 0x87, 0xC9, 0x83, 0x6F, + 0xCC, 0x88, 0xC9, 0x83, 0x6F, 0xCC, 0x9B, 0xAD, + 0x83, 0x6F, 0xCC, 0xA3, 0xB5, 0x83, 0x6F, 0xCC, + // Bytes 4780 - 47bf + 0xA8, 0xA5, 0x83, 0x72, 0xCC, 0xA3, 0xB5, 0x83, + 0x73, 0xCC, 0x81, 0xC9, 0x83, 0x73, 0xCC, 0x8C, + 0xC9, 0x83, 0x73, 0xCC, 0xA3, 0xB5, 0x83, 0x75, + 0xCC, 0x83, 0xC9, 0x83, 0x75, 0xCC, 0x84, 0xC9, + 0x83, 0x75, 0xCC, 0x88, 0xC9, 0x83, 0x75, 0xCC, + 0x9B, 0xAD, 0x84, 0xCE, 0x91, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0x91, 0xCC, 0x94, 0xC9, 0x84, 0xCE, + 0x95, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0x95, 0xCC, + // Bytes 47c0 - 47ff + 0x94, 0xC9, 0x84, 0xCE, 0x97, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0x97, 0xCC, 0x94, 0xC9, 0x84, 0xCE, + 0x99, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0x99, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0x9F, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0x9F, 0xCC, 0x94, 0xC9, 0x84, 0xCE, + 0xA5, 0xCC, 0x94, 0xC9, 0x84, 0xCE, 0xA9, 0xCC, + 0x93, 0xC9, 0x84, 0xCE, 0xA9, 0xCC, 0x94, 0xC9, + 0x84, 0xCE, 0xB1, 0xCC, 0x80, 0xC9, 0x84, 0xCE, + // Bytes 4800 - 483f + 0xB1, 0xCC, 0x81, 0xC9, 0x84, 0xCE, 0xB1, 0xCC, + 0x93, 0xC9, 0x84, 0xCE, 0xB1, 0xCC, 0x94, 0xC9, + 0x84, 0xCE, 0xB1, 0xCD, 0x82, 0xC9, 0x84, 0xCE, + 0xB5, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0xB5, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0xB7, 0xCC, 0x80, 0xC9, + 0x84, 0xCE, 0xB7, 0xCC, 0x81, 0xC9, 0x84, 0xCE, + 0xB7, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0xB7, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0xB7, 0xCD, 0x82, 0xC9, + // Bytes 4840 - 487f + 0x84, 0xCE, 0xB9, 0xCC, 0x88, 0xC9, 0x84, 0xCE, + 0xB9, 0xCC, 0x93, 0xC9, 0x84, 0xCE, 0xB9, 0xCC, + 0x94, 0xC9, 0x84, 0xCE, 0xBF, 0xCC, 0x93, 0xC9, + 0x84, 0xCE, 0xBF, 0xCC, 0x94, 0xC9, 0x84, 0xCF, + 0x85, 0xCC, 0x88, 0xC9, 0x84, 0xCF, 0x85, 0xCC, + 0x93, 0xC9, 0x84, 0xCF, 0x85, 0xCC, 0x94, 0xC9, + 0x84, 0xCF, 0x89, 0xCC, 0x80, 0xC9, 0x84, 0xCF, + 0x89, 0xCC, 0x81, 0xC9, 0x84, 0xCF, 0x89, 0xCC, + // Bytes 4880 - 48bf + 0x93, 0xC9, 0x84, 0xCF, 0x89, 0xCC, 0x94, 0xC9, + 0x84, 0xCF, 0x89, 0xCD, 0x82, 0xC9, 0x86, 0xCE, + 0x91, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x91, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + // Bytes 48c0 - 48ff + 0x97, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0x97, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + // Bytes 4900 - 493f + 0xA9, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xA9, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + // Bytes 4940 - 497f + 0xB1, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB1, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCE, + 0xB7, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x86, 0xCF, + // Bytes 4980 - 49bf + 0x89, 0xCC, 0x93, 0xCC, 0x80, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x93, 0xCC, 0x81, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x93, 0xCD, 0x82, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x94, 0xCC, 0x80, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x94, 0xCC, 0x81, 0xCA, 0x86, 0xCF, + 0x89, 0xCC, 0x94, 0xCD, 0x82, 0xCA, 0x42, 0xCC, + 0x80, 0xC9, 0x32, 0x42, 0xCC, 0x81, 0xC9, 0x32, + 0x42, 0xCC, 0x93, 0xC9, 0x32, 0x43, 0xE1, 0x85, + // Bytes 49c0 - 49ff + 0xA1, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xA2, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xA3, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xA4, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xA5, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xA6, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xA7, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xA8, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xA9, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xAA, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xAB, 0x01, 0x00, 0x43, + // Bytes 4a00 - 4a3f + 0xE1, 0x85, 0xAC, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xAD, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xAE, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xAF, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xB0, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xB1, 0x01, 0x00, 0x43, 0xE1, 0x85, 0xB2, 0x01, + 0x00, 0x43, 0xE1, 0x85, 0xB3, 0x01, 0x00, 0x43, + 0xE1, 0x85, 0xB4, 0x01, 0x00, 0x43, 0xE1, 0x85, + 0xB5, 0x01, 0x00, 0x43, 0xE1, 0x86, 0xAA, 0x01, + // Bytes 4a40 - 4a7f + 0x00, 0x43, 0xE1, 0x86, 0xAC, 0x01, 0x00, 0x43, + 0xE1, 0x86, 0xAD, 0x01, 0x00, 0x43, 0xE1, 0x86, + 0xB0, 0x01, 0x00, 0x43, 0xE1, 0x86, 0xB1, 0x01, + 0x00, 0x43, 0xE1, 0x86, 0xB2, 0x01, 0x00, 0x43, + 0xE1, 0x86, 0xB3, 0x01, 0x00, 0x43, 0xE1, 0x86, + 0xB4, 0x01, 0x00, 0x43, 0xE1, 0x86, 0xB5, 0x01, + 0x00, 0x44, 0xCC, 0x88, 0xCC, 0x81, 0xCA, 0x32, + 0x43, 0xE3, 0x82, 0x99, 0x0D, 0x03, 0x43, 0xE3, + // Bytes 4a80 - 4abf + 0x82, 0x9A, 0x0D, 0x03, 0x46, 0xE0, 0xBD, 0xB1, + 0xE0, 0xBD, 0xB2, 0x9E, 0x26, 0x46, 0xE0, 0xBD, + 0xB1, 0xE0, 0xBD, 0xB4, 0xA2, 0x26, 0x46, 0xE0, + 0xBD, 0xB1, 0xE0, 0xBE, 0x80, 0x9E, 0x26, 0x00, + 0x01, +} + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfcTrie) lookup(s []byte) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfcTrie) lookupUnsafe(s []byte) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfcValues[c0] + } + i := nfcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfcTrie) lookupString(s string) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfcTrie) lookupStringUnsafe(s string) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfcValues[c0] + } + i := nfcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// nfcTrie. Total size: 10332 bytes (10.09 KiB). Checksum: 51cc525b297fc970. +type nfcTrie struct{} + +func newNfcTrie(i int) *nfcTrie { + return &nfcTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *nfcTrie) lookupValue(n uint32, b byte) uint16 { + switch { + case n < 44: + return uint16(nfcValues[n<<6+uint32(b)]) + default: + n -= 44 + return uint16(nfcSparse.lookup(n, b)) + } +} + +// nfcValues: 46 blocks, 2944 entries, 5888 bytes +// The third block is the zero block. +var nfcValues = [2944]uint16{ + // Block 0x0, offset 0x0 + 0x3c: 0xa000, 0x3d: 0xa000, 0x3e: 0xa000, + // Block 0x1, offset 0x40 + 0x41: 0xa000, 0x42: 0xa000, 0x43: 0xa000, 0x44: 0xa000, 0x45: 0xa000, + 0x46: 0xa000, 0x47: 0xa000, 0x48: 0xa000, 0x49: 0xa000, 0x4a: 0xa000, 0x4b: 0xa000, + 0x4c: 0xa000, 0x4d: 0xa000, 0x4e: 0xa000, 0x4f: 0xa000, 0x50: 0xa000, + 0x52: 0xa000, 0x53: 0xa000, 0x54: 0xa000, 0x55: 0xa000, 0x56: 0xa000, 0x57: 0xa000, + 0x58: 0xa000, 0x59: 0xa000, 0x5a: 0xa000, + 0x61: 0xa000, 0x62: 0xa000, 0x63: 0xa000, + 0x64: 0xa000, 0x65: 0xa000, 0x66: 0xa000, 0x67: 0xa000, 0x68: 0xa000, 0x69: 0xa000, + 0x6a: 0xa000, 0x6b: 0xa000, 0x6c: 0xa000, 0x6d: 0xa000, 0x6e: 0xa000, 0x6f: 0xa000, + 0x70: 0xa000, 0x72: 0xa000, 0x73: 0xa000, 0x74: 0xa000, 0x75: 0xa000, + 0x76: 0xa000, 0x77: 0xa000, 0x78: 0xa000, 0x79: 0xa000, 0x7a: 0xa000, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x2f6f, 0xc1: 0x2f74, 0xc2: 0x4688, 0xc3: 0x2f79, 0xc4: 0x4697, 0xc5: 0x469c, + 0xc6: 0xa000, 0xc7: 0x46a6, 0xc8: 0x2fe2, 0xc9: 0x2fe7, 0xca: 0x46ab, 0xcb: 0x2ffb, + 0xcc: 0x306e, 0xcd: 0x3073, 0xce: 0x3078, 0xcf: 0x46bf, 0xd1: 0x3104, + 0xd2: 0x3127, 0xd3: 0x312c, 0xd4: 0x46c9, 0xd5: 0x46ce, 0xd6: 0x46dd, + 0xd8: 0xa000, 0xd9: 0x31b3, 0xda: 0x31b8, 0xdb: 0x31bd, 0xdc: 0x470f, 0xdd: 0x3235, + 0xe0: 0x327b, 0xe1: 0x3280, 0xe2: 0x4719, 0xe3: 0x3285, + 0xe4: 0x4728, 0xe5: 0x472d, 0xe6: 0xa000, 0xe7: 0x4737, 0xe8: 0x32ee, 0xe9: 0x32f3, + 0xea: 0x473c, 0xeb: 0x3307, 0xec: 0x337f, 0xed: 0x3384, 0xee: 0x3389, 0xef: 0x4750, + 0xf1: 0x3415, 0xf2: 0x3438, 0xf3: 0x343d, 0xf4: 0x475a, 0xf5: 0x475f, + 0xf6: 0x476e, 0xf8: 0xa000, 0xf9: 0x34c9, 0xfa: 0x34ce, 0xfb: 0x34d3, + 0xfc: 0x47a0, 0xfd: 0x3550, 0xff: 0x3569, + // Block 0x4, offset 0x100 + 0x100: 0x2f7e, 0x101: 0x328a, 0x102: 0x468d, 0x103: 0x471e, 0x104: 0x2f9c, 0x105: 0x32a8, + 0x106: 0x2fb0, 0x107: 0x32bc, 0x108: 0x2fb5, 0x109: 0x32c1, 0x10a: 0x2fba, 0x10b: 0x32c6, + 0x10c: 0x2fbf, 0x10d: 0x32cb, 0x10e: 0x2fc9, 0x10f: 0x32d5, + 0x112: 0x46b0, 0x113: 0x4741, 0x114: 0x2ff1, 0x115: 0x32fd, 0x116: 0x2ff6, 0x117: 0x3302, + 0x118: 0x3014, 0x119: 0x3320, 0x11a: 0x3005, 0x11b: 0x3311, 0x11c: 0x302d, 0x11d: 0x3339, + 0x11e: 0x3037, 0x11f: 0x3343, 0x120: 0x303c, 0x121: 0x3348, 0x122: 0x3046, 0x123: 0x3352, + 0x124: 0x304b, 0x125: 0x3357, 0x128: 0x307d, 0x129: 0x338e, + 0x12a: 0x3082, 0x12b: 0x3393, 0x12c: 0x3087, 0x12d: 0x3398, 0x12e: 0x30aa, 0x12f: 0x33b6, + 0x130: 0x308c, 0x134: 0x30b4, 0x135: 0x33c0, + 0x136: 0x30c8, 0x137: 0x33d9, 0x139: 0x30d2, 0x13a: 0x33e3, 0x13b: 0x30dc, + 0x13c: 0x33ed, 0x13d: 0x30d7, 0x13e: 0x33e8, + // Block 0x5, offset 0x140 + 0x143: 0x30ff, 0x144: 0x3410, 0x145: 0x3118, + 0x146: 0x3429, 0x147: 0x310e, 0x148: 0x341f, + 0x14c: 0x46d3, 0x14d: 0x4764, 0x14e: 0x3131, 0x14f: 0x3442, 0x150: 0x313b, 0x151: 0x344c, + 0x154: 0x3159, 0x155: 0x346a, 0x156: 0x3172, 0x157: 0x3483, + 0x158: 0x3163, 0x159: 0x3474, 0x15a: 0x46f6, 0x15b: 0x4787, 0x15c: 0x317c, 0x15d: 0x348d, + 0x15e: 0x318b, 0x15f: 0x349c, 0x160: 0x46fb, 0x161: 0x478c, 0x162: 0x31a4, 0x163: 0x34ba, + 0x164: 0x3195, 0x165: 0x34ab, 0x168: 0x4705, 0x169: 0x4796, + 0x16a: 0x470a, 0x16b: 0x479b, 0x16c: 0x31c2, 0x16d: 0x34d8, 0x16e: 0x31cc, 0x16f: 0x34e2, + 0x170: 0x31d1, 0x171: 0x34e7, 0x172: 0x31ef, 0x173: 0x3505, 0x174: 0x3212, 0x175: 0x3528, + 0x176: 0x323a, 0x177: 0x3555, 0x178: 0x324e, 0x179: 0x325d, 0x17a: 0x357d, 0x17b: 0x3267, + 0x17c: 0x3587, 0x17d: 0x326c, 0x17e: 0x358c, 0x17f: 0xa000, + // Block 0x6, offset 0x180 + 0x184: 0x8100, 0x185: 0x8100, + 0x186: 0x8100, + 0x18d: 0x2f88, 0x18e: 0x3294, 0x18f: 0x3096, 0x190: 0x33a2, 0x191: 0x3140, + 0x192: 0x3451, 0x193: 0x31d6, 0x194: 0x34ec, 0x195: 0x39cf, 0x196: 0x3b5e, 0x197: 0x39c8, + 0x198: 0x3b57, 0x199: 0x39d6, 0x19a: 0x3b65, 0x19b: 0x39c1, 0x19c: 0x3b50, + 0x19e: 0x38b0, 0x19f: 0x3a3f, 0x1a0: 0x38a9, 0x1a1: 0x3a38, 0x1a2: 0x35b3, 0x1a3: 0x35c5, + 0x1a6: 0x3041, 0x1a7: 0x334d, 0x1a8: 0x30be, 0x1a9: 0x33cf, + 0x1aa: 0x46ec, 0x1ab: 0x477d, 0x1ac: 0x3990, 0x1ad: 0x3b1f, 0x1ae: 0x35d7, 0x1af: 0x35dd, + 0x1b0: 0x33c5, 0x1b4: 0x3028, 0x1b5: 0x3334, + 0x1b8: 0x30fa, 0x1b9: 0x340b, 0x1ba: 0x38b7, 0x1bb: 0x3a46, + 0x1bc: 0x35ad, 0x1bd: 0x35bf, 0x1be: 0x35b9, 0x1bf: 0x35cb, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x2f8d, 0x1c1: 0x3299, 0x1c2: 0x2f92, 0x1c3: 0x329e, 0x1c4: 0x300a, 0x1c5: 0x3316, + 0x1c6: 0x300f, 0x1c7: 0x331b, 0x1c8: 0x309b, 0x1c9: 0x33a7, 0x1ca: 0x30a0, 0x1cb: 0x33ac, + 0x1cc: 0x3145, 0x1cd: 0x3456, 0x1ce: 0x314a, 0x1cf: 0x345b, 0x1d0: 0x3168, 0x1d1: 0x3479, + 0x1d2: 0x316d, 0x1d3: 0x347e, 0x1d4: 0x31db, 0x1d5: 0x34f1, 0x1d6: 0x31e0, 0x1d7: 0x34f6, + 0x1d8: 0x3186, 0x1d9: 0x3497, 0x1da: 0x319f, 0x1db: 0x34b5, + 0x1de: 0x305a, 0x1df: 0x3366, + 0x1e6: 0x4692, 0x1e7: 0x4723, 0x1e8: 0x46ba, 0x1e9: 0x474b, + 0x1ea: 0x395f, 0x1eb: 0x3aee, 0x1ec: 0x393c, 0x1ed: 0x3acb, 0x1ee: 0x46d8, 0x1ef: 0x4769, + 0x1f0: 0x3958, 0x1f1: 0x3ae7, 0x1f2: 0x3244, 0x1f3: 0x355f, + // Block 0x8, offset 0x200 + 0x200: 0x9932, 0x201: 0x9932, 0x202: 0x9932, 0x203: 0x9932, 0x204: 0x9932, 0x205: 0x8132, + 0x206: 0x9932, 0x207: 0x9932, 0x208: 0x9932, 0x209: 0x9932, 0x20a: 0x9932, 0x20b: 0x9932, + 0x20c: 0x9932, 0x20d: 0x8132, 0x20e: 0x8132, 0x20f: 0x9932, 0x210: 0x8132, 0x211: 0x9932, + 0x212: 0x8132, 0x213: 0x9932, 0x214: 0x9932, 0x215: 0x8133, 0x216: 0x812d, 0x217: 0x812d, + 0x218: 0x812d, 0x219: 0x812d, 0x21a: 0x8133, 0x21b: 0x992b, 0x21c: 0x812d, 0x21d: 0x812d, + 0x21e: 0x812d, 0x21f: 0x812d, 0x220: 0x812d, 0x221: 0x8129, 0x222: 0x8129, 0x223: 0x992d, + 0x224: 0x992d, 0x225: 0x992d, 0x226: 0x992d, 0x227: 0x9929, 0x228: 0x9929, 0x229: 0x812d, + 0x22a: 0x812d, 0x22b: 0x812d, 0x22c: 0x812d, 0x22d: 0x992d, 0x22e: 0x992d, 0x22f: 0x812d, + 0x230: 0x992d, 0x231: 0x992d, 0x232: 0x812d, 0x233: 0x812d, 0x234: 0x8101, 0x235: 0x8101, + 0x236: 0x8101, 0x237: 0x8101, 0x238: 0x9901, 0x239: 0x812d, 0x23a: 0x812d, 0x23b: 0x812d, + 0x23c: 0x812d, 0x23d: 0x8132, 0x23e: 0x8132, 0x23f: 0x8132, + // Block 0x9, offset 0x240 + 0x240: 0x49ae, 0x241: 0x49b3, 0x242: 0x9932, 0x243: 0x49b8, 0x244: 0x4a71, 0x245: 0x9936, + 0x246: 0x8132, 0x247: 0x812d, 0x248: 0x812d, 0x249: 0x812d, 0x24a: 0x8132, 0x24b: 0x8132, + 0x24c: 0x8132, 0x24d: 0x812d, 0x24e: 0x812d, 0x250: 0x8132, 0x251: 0x8132, + 0x252: 0x8132, 0x253: 0x812d, 0x254: 0x812d, 0x255: 0x812d, 0x256: 0x812d, 0x257: 0x8132, + 0x258: 0x8133, 0x259: 0x812d, 0x25a: 0x812d, 0x25b: 0x8132, 0x25c: 0x8134, 0x25d: 0x8135, + 0x25e: 0x8135, 0x25f: 0x8134, 0x260: 0x8135, 0x261: 0x8135, 0x262: 0x8134, 0x263: 0x8132, + 0x264: 0x8132, 0x265: 0x8132, 0x266: 0x8132, 0x267: 0x8132, 0x268: 0x8132, 0x269: 0x8132, + 0x26a: 0x8132, 0x26b: 0x8132, 0x26c: 0x8132, 0x26d: 0x8132, 0x26e: 0x8132, 0x26f: 0x8132, + 0x274: 0x0170, + 0x27a: 0x8100, + 0x27e: 0x0037, + // Block 0xa, offset 0x280 + 0x284: 0x8100, 0x285: 0x35a1, + 0x286: 0x35e9, 0x287: 0x00ce, 0x288: 0x3607, 0x289: 0x3613, 0x28a: 0x3625, + 0x28c: 0x3643, 0x28e: 0x3655, 0x28f: 0x3673, 0x290: 0x3e08, 0x291: 0xa000, + 0x295: 0xa000, 0x297: 0xa000, + 0x299: 0xa000, + 0x29f: 0xa000, 0x2a1: 0xa000, + 0x2a5: 0xa000, 0x2a9: 0xa000, + 0x2aa: 0x3637, 0x2ab: 0x3667, 0x2ac: 0x47fe, 0x2ad: 0x3697, 0x2ae: 0x4828, 0x2af: 0x36a9, + 0x2b0: 0x3e70, 0x2b1: 0xa000, 0x2b5: 0xa000, + 0x2b7: 0xa000, 0x2b9: 0xa000, + 0x2bf: 0xa000, + // Block 0xb, offset 0x2c0 + 0x2c0: 0x3721, 0x2c1: 0x372d, 0x2c3: 0x371b, + 0x2c6: 0xa000, 0x2c7: 0x3709, + 0x2cc: 0x375d, 0x2cd: 0x3745, 0x2ce: 0x376f, 0x2d0: 0xa000, + 0x2d3: 0xa000, 0x2d5: 0xa000, 0x2d6: 0xa000, 0x2d7: 0xa000, + 0x2d8: 0xa000, 0x2d9: 0x3751, 0x2da: 0xa000, + 0x2de: 0xa000, 0x2e3: 0xa000, + 0x2e7: 0xa000, + 0x2eb: 0xa000, 0x2ed: 0xa000, + 0x2f0: 0xa000, 0x2f3: 0xa000, 0x2f5: 0xa000, + 0x2f6: 0xa000, 0x2f7: 0xa000, 0x2f8: 0xa000, 0x2f9: 0x37d5, 0x2fa: 0xa000, + 0x2fe: 0xa000, + // Block 0xc, offset 0x300 + 0x301: 0x3733, 0x302: 0x37b7, + 0x310: 0x370f, 0x311: 0x3793, + 0x312: 0x3715, 0x313: 0x3799, 0x316: 0x3727, 0x317: 0x37ab, + 0x318: 0xa000, 0x319: 0xa000, 0x31a: 0x3829, 0x31b: 0x382f, 0x31c: 0x3739, 0x31d: 0x37bd, + 0x31e: 0x373f, 0x31f: 0x37c3, 0x322: 0x374b, 0x323: 0x37cf, + 0x324: 0x3757, 0x325: 0x37db, 0x326: 0x3763, 0x327: 0x37e7, 0x328: 0xa000, 0x329: 0xa000, + 0x32a: 0x3835, 0x32b: 0x383b, 0x32c: 0x378d, 0x32d: 0x3811, 0x32e: 0x3769, 0x32f: 0x37ed, + 0x330: 0x3775, 0x331: 0x37f9, 0x332: 0x377b, 0x333: 0x37ff, 0x334: 0x3781, 0x335: 0x3805, + 0x338: 0x3787, 0x339: 0x380b, + // Block 0xd, offset 0x340 + 0x351: 0x812d, + 0x352: 0x8132, 0x353: 0x8132, 0x354: 0x8132, 0x355: 0x8132, 0x356: 0x812d, 0x357: 0x8132, + 0x358: 0x8132, 0x359: 0x8132, 0x35a: 0x812e, 0x35b: 0x812d, 0x35c: 0x8132, 0x35d: 0x8132, + 0x35e: 0x8132, 0x35f: 0x8132, 0x360: 0x8132, 0x361: 0x8132, 0x362: 0x812d, 0x363: 0x812d, + 0x364: 0x812d, 0x365: 0x812d, 0x366: 0x812d, 0x367: 0x812d, 0x368: 0x8132, 0x369: 0x8132, + 0x36a: 0x812d, 0x36b: 0x8132, 0x36c: 0x8132, 0x36d: 0x812e, 0x36e: 0x8131, 0x36f: 0x8132, + 0x370: 0x8105, 0x371: 0x8106, 0x372: 0x8107, 0x373: 0x8108, 0x374: 0x8109, 0x375: 0x810a, + 0x376: 0x810b, 0x377: 0x810c, 0x378: 0x810d, 0x379: 0x810e, 0x37a: 0x810e, 0x37b: 0x810f, + 0x37c: 0x8110, 0x37d: 0x8111, 0x37f: 0x8112, + // Block 0xe, offset 0x380 + 0x388: 0xa000, 0x38a: 0xa000, 0x38b: 0x8116, + 0x38c: 0x8117, 0x38d: 0x8118, 0x38e: 0x8119, 0x38f: 0x811a, 0x390: 0x811b, 0x391: 0x811c, + 0x392: 0x811d, 0x393: 0x9932, 0x394: 0x9932, 0x395: 0x992d, 0x396: 0x812d, 0x397: 0x8132, + 0x398: 0x8132, 0x399: 0x8132, 0x39a: 0x8132, 0x39b: 0x8132, 0x39c: 0x812d, 0x39d: 0x8132, + 0x39e: 0x8132, 0x39f: 0x812d, + 0x3b0: 0x811e, + // Block 0xf, offset 0x3c0 + 0x3c5: 0xa000, + 0x3c6: 0x2d26, 0x3c7: 0xa000, 0x3c8: 0x2d2e, 0x3c9: 0xa000, 0x3ca: 0x2d36, 0x3cb: 0xa000, + 0x3cc: 0x2d3e, 0x3cd: 0xa000, 0x3ce: 0x2d46, 0x3d1: 0xa000, + 0x3d2: 0x2d4e, + 0x3f4: 0x8102, 0x3f5: 0x9900, + 0x3fa: 0xa000, 0x3fb: 0x2d56, + 0x3fc: 0xa000, 0x3fd: 0x2d5e, 0x3fe: 0xa000, 0x3ff: 0xa000, + // Block 0x10, offset 0x400 + 0x400: 0x2f97, 0x401: 0x32a3, 0x402: 0x2fa1, 0x403: 0x32ad, 0x404: 0x2fa6, 0x405: 0x32b2, + 0x406: 0x2fab, 0x407: 0x32b7, 0x408: 0x38cc, 0x409: 0x3a5b, 0x40a: 0x2fc4, 0x40b: 0x32d0, + 0x40c: 0x2fce, 0x40d: 0x32da, 0x40e: 0x2fdd, 0x40f: 0x32e9, 0x410: 0x2fd3, 0x411: 0x32df, + 0x412: 0x2fd8, 0x413: 0x32e4, 0x414: 0x38ef, 0x415: 0x3a7e, 0x416: 0x38f6, 0x417: 0x3a85, + 0x418: 0x3019, 0x419: 0x3325, 0x41a: 0x301e, 0x41b: 0x332a, 0x41c: 0x3904, 0x41d: 0x3a93, + 0x41e: 0x3023, 0x41f: 0x332f, 0x420: 0x3032, 0x421: 0x333e, 0x422: 0x3050, 0x423: 0x335c, + 0x424: 0x305f, 0x425: 0x336b, 0x426: 0x3055, 0x427: 0x3361, 0x428: 0x3064, 0x429: 0x3370, + 0x42a: 0x3069, 0x42b: 0x3375, 0x42c: 0x30af, 0x42d: 0x33bb, 0x42e: 0x390b, 0x42f: 0x3a9a, + 0x430: 0x30b9, 0x431: 0x33ca, 0x432: 0x30c3, 0x433: 0x33d4, 0x434: 0x30cd, 0x435: 0x33de, + 0x436: 0x46c4, 0x437: 0x4755, 0x438: 0x3912, 0x439: 0x3aa1, 0x43a: 0x30e6, 0x43b: 0x33f7, + 0x43c: 0x30e1, 0x43d: 0x33f2, 0x43e: 0x30eb, 0x43f: 0x33fc, + // Block 0x11, offset 0x440 + 0x440: 0x30f0, 0x441: 0x3401, 0x442: 0x30f5, 0x443: 0x3406, 0x444: 0x3109, 0x445: 0x341a, + 0x446: 0x3113, 0x447: 0x3424, 0x448: 0x3122, 0x449: 0x3433, 0x44a: 0x311d, 0x44b: 0x342e, + 0x44c: 0x3935, 0x44d: 0x3ac4, 0x44e: 0x3943, 0x44f: 0x3ad2, 0x450: 0x394a, 0x451: 0x3ad9, + 0x452: 0x3951, 0x453: 0x3ae0, 0x454: 0x314f, 0x455: 0x3460, 0x456: 0x3154, 0x457: 0x3465, + 0x458: 0x315e, 0x459: 0x346f, 0x45a: 0x46f1, 0x45b: 0x4782, 0x45c: 0x3997, 0x45d: 0x3b26, + 0x45e: 0x3177, 0x45f: 0x3488, 0x460: 0x3181, 0x461: 0x3492, 0x462: 0x4700, 0x463: 0x4791, + 0x464: 0x399e, 0x465: 0x3b2d, 0x466: 0x39a5, 0x467: 0x3b34, 0x468: 0x39ac, 0x469: 0x3b3b, + 0x46a: 0x3190, 0x46b: 0x34a1, 0x46c: 0x319a, 0x46d: 0x34b0, 0x46e: 0x31ae, 0x46f: 0x34c4, + 0x470: 0x31a9, 0x471: 0x34bf, 0x472: 0x31ea, 0x473: 0x3500, 0x474: 0x31f9, 0x475: 0x350f, + 0x476: 0x31f4, 0x477: 0x350a, 0x478: 0x39b3, 0x479: 0x3b42, 0x47a: 0x39ba, 0x47b: 0x3b49, + 0x47c: 0x31fe, 0x47d: 0x3514, 0x47e: 0x3203, 0x47f: 0x3519, + // Block 0x12, offset 0x480 + 0x480: 0x3208, 0x481: 0x351e, 0x482: 0x320d, 0x483: 0x3523, 0x484: 0x321c, 0x485: 0x3532, + 0x486: 0x3217, 0x487: 0x352d, 0x488: 0x3221, 0x489: 0x353c, 0x48a: 0x3226, 0x48b: 0x3541, + 0x48c: 0x322b, 0x48d: 0x3546, 0x48e: 0x3249, 0x48f: 0x3564, 0x490: 0x3262, 0x491: 0x3582, + 0x492: 0x3271, 0x493: 0x3591, 0x494: 0x3276, 0x495: 0x3596, 0x496: 0x337a, 0x497: 0x34a6, + 0x498: 0x3537, 0x499: 0x3573, 0x49b: 0x35d1, + 0x4a0: 0x46a1, 0x4a1: 0x4732, 0x4a2: 0x2f83, 0x4a3: 0x328f, + 0x4a4: 0x3878, 0x4a5: 0x3a07, 0x4a6: 0x3871, 0x4a7: 0x3a00, 0x4a8: 0x3886, 0x4a9: 0x3a15, + 0x4aa: 0x387f, 0x4ab: 0x3a0e, 0x4ac: 0x38be, 0x4ad: 0x3a4d, 0x4ae: 0x3894, 0x4af: 0x3a23, + 0x4b0: 0x388d, 0x4b1: 0x3a1c, 0x4b2: 0x38a2, 0x4b3: 0x3a31, 0x4b4: 0x389b, 0x4b5: 0x3a2a, + 0x4b6: 0x38c5, 0x4b7: 0x3a54, 0x4b8: 0x46b5, 0x4b9: 0x4746, 0x4ba: 0x3000, 0x4bb: 0x330c, + 0x4bc: 0x2fec, 0x4bd: 0x32f8, 0x4be: 0x38da, 0x4bf: 0x3a69, + // Block 0x13, offset 0x4c0 + 0x4c0: 0x38d3, 0x4c1: 0x3a62, 0x4c2: 0x38e8, 0x4c3: 0x3a77, 0x4c4: 0x38e1, 0x4c5: 0x3a70, + 0x4c6: 0x38fd, 0x4c7: 0x3a8c, 0x4c8: 0x3091, 0x4c9: 0x339d, 0x4ca: 0x30a5, 0x4cb: 0x33b1, + 0x4cc: 0x46e7, 0x4cd: 0x4778, 0x4ce: 0x3136, 0x4cf: 0x3447, 0x4d0: 0x3920, 0x4d1: 0x3aaf, + 0x4d2: 0x3919, 0x4d3: 0x3aa8, 0x4d4: 0x392e, 0x4d5: 0x3abd, 0x4d6: 0x3927, 0x4d7: 0x3ab6, + 0x4d8: 0x3989, 0x4d9: 0x3b18, 0x4da: 0x396d, 0x4db: 0x3afc, 0x4dc: 0x3966, 0x4dd: 0x3af5, + 0x4de: 0x397b, 0x4df: 0x3b0a, 0x4e0: 0x3974, 0x4e1: 0x3b03, 0x4e2: 0x3982, 0x4e3: 0x3b11, + 0x4e4: 0x31e5, 0x4e5: 0x34fb, 0x4e6: 0x31c7, 0x4e7: 0x34dd, 0x4e8: 0x39e4, 0x4e9: 0x3b73, + 0x4ea: 0x39dd, 0x4eb: 0x3b6c, 0x4ec: 0x39f2, 0x4ed: 0x3b81, 0x4ee: 0x39eb, 0x4ef: 0x3b7a, + 0x4f0: 0x39f9, 0x4f1: 0x3b88, 0x4f2: 0x3230, 0x4f3: 0x354b, 0x4f4: 0x3258, 0x4f5: 0x3578, + 0x4f6: 0x3253, 0x4f7: 0x356e, 0x4f8: 0x323f, 0x4f9: 0x355a, + // Block 0x14, offset 0x500 + 0x500: 0x4804, 0x501: 0x480a, 0x502: 0x491e, 0x503: 0x4936, 0x504: 0x4926, 0x505: 0x493e, + 0x506: 0x492e, 0x507: 0x4946, 0x508: 0x47aa, 0x509: 0x47b0, 0x50a: 0x488e, 0x50b: 0x48a6, + 0x50c: 0x4896, 0x50d: 0x48ae, 0x50e: 0x489e, 0x50f: 0x48b6, 0x510: 0x4816, 0x511: 0x481c, + 0x512: 0x3db8, 0x513: 0x3dc8, 0x514: 0x3dc0, 0x515: 0x3dd0, + 0x518: 0x47b6, 0x519: 0x47bc, 0x51a: 0x3ce8, 0x51b: 0x3cf8, 0x51c: 0x3cf0, 0x51d: 0x3d00, + 0x520: 0x482e, 0x521: 0x4834, 0x522: 0x494e, 0x523: 0x4966, + 0x524: 0x4956, 0x525: 0x496e, 0x526: 0x495e, 0x527: 0x4976, 0x528: 0x47c2, 0x529: 0x47c8, + 0x52a: 0x48be, 0x52b: 0x48d6, 0x52c: 0x48c6, 0x52d: 0x48de, 0x52e: 0x48ce, 0x52f: 0x48e6, + 0x530: 0x4846, 0x531: 0x484c, 0x532: 0x3e18, 0x533: 0x3e30, 0x534: 0x3e20, 0x535: 0x3e38, + 0x536: 0x3e28, 0x537: 0x3e40, 0x538: 0x47ce, 0x539: 0x47d4, 0x53a: 0x3d18, 0x53b: 0x3d30, + 0x53c: 0x3d20, 0x53d: 0x3d38, 0x53e: 0x3d28, 0x53f: 0x3d40, + // Block 0x15, offset 0x540 + 0x540: 0x4852, 0x541: 0x4858, 0x542: 0x3e48, 0x543: 0x3e58, 0x544: 0x3e50, 0x545: 0x3e60, + 0x548: 0x47da, 0x549: 0x47e0, 0x54a: 0x3d48, 0x54b: 0x3d58, + 0x54c: 0x3d50, 0x54d: 0x3d60, 0x550: 0x4864, 0x551: 0x486a, + 0x552: 0x3e80, 0x553: 0x3e98, 0x554: 0x3e88, 0x555: 0x3ea0, 0x556: 0x3e90, 0x557: 0x3ea8, + 0x559: 0x47e6, 0x55b: 0x3d68, 0x55d: 0x3d70, + 0x55f: 0x3d78, 0x560: 0x487c, 0x561: 0x4882, 0x562: 0x497e, 0x563: 0x4996, + 0x564: 0x4986, 0x565: 0x499e, 0x566: 0x498e, 0x567: 0x49a6, 0x568: 0x47ec, 0x569: 0x47f2, + 0x56a: 0x48ee, 0x56b: 0x4906, 0x56c: 0x48f6, 0x56d: 0x490e, 0x56e: 0x48fe, 0x56f: 0x4916, + 0x570: 0x47f8, 0x571: 0x431e, 0x572: 0x3691, 0x573: 0x4324, 0x574: 0x4822, 0x575: 0x432a, + 0x576: 0x36a3, 0x577: 0x4330, 0x578: 0x36c1, 0x579: 0x4336, 0x57a: 0x36d9, 0x57b: 0x433c, + 0x57c: 0x4870, 0x57d: 0x4342, + // Block 0x16, offset 0x580 + 0x580: 0x3da0, 0x581: 0x3da8, 0x582: 0x4184, 0x583: 0x41a2, 0x584: 0x418e, 0x585: 0x41ac, + 0x586: 0x4198, 0x587: 0x41b6, 0x588: 0x3cd8, 0x589: 0x3ce0, 0x58a: 0x40d0, 0x58b: 0x40ee, + 0x58c: 0x40da, 0x58d: 0x40f8, 0x58e: 0x40e4, 0x58f: 0x4102, 0x590: 0x3de8, 0x591: 0x3df0, + 0x592: 0x41c0, 0x593: 0x41de, 0x594: 0x41ca, 0x595: 0x41e8, 0x596: 0x41d4, 0x597: 0x41f2, + 0x598: 0x3d08, 0x599: 0x3d10, 0x59a: 0x410c, 0x59b: 0x412a, 0x59c: 0x4116, 0x59d: 0x4134, + 0x59e: 0x4120, 0x59f: 0x413e, 0x5a0: 0x3ec0, 0x5a1: 0x3ec8, 0x5a2: 0x41fc, 0x5a3: 0x421a, + 0x5a4: 0x4206, 0x5a5: 0x4224, 0x5a6: 0x4210, 0x5a7: 0x422e, 0x5a8: 0x3d80, 0x5a9: 0x3d88, + 0x5aa: 0x4148, 0x5ab: 0x4166, 0x5ac: 0x4152, 0x5ad: 0x4170, 0x5ae: 0x415c, 0x5af: 0x417a, + 0x5b0: 0x3685, 0x5b1: 0x367f, 0x5b2: 0x3d90, 0x5b3: 0x368b, 0x5b4: 0x3d98, + 0x5b6: 0x4810, 0x5b7: 0x3db0, 0x5b8: 0x35f5, 0x5b9: 0x35ef, 0x5ba: 0x35e3, 0x5bb: 0x42ee, + 0x5bc: 0x35fb, 0x5bd: 0x8100, 0x5be: 0x01d3, 0x5bf: 0xa100, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x8100, 0x5c1: 0x35a7, 0x5c2: 0x3dd8, 0x5c3: 0x369d, 0x5c4: 0x3de0, + 0x5c6: 0x483a, 0x5c7: 0x3df8, 0x5c8: 0x3601, 0x5c9: 0x42f4, 0x5ca: 0x360d, 0x5cb: 0x42fa, + 0x5cc: 0x3619, 0x5cd: 0x3b8f, 0x5ce: 0x3b96, 0x5cf: 0x3b9d, 0x5d0: 0x36b5, 0x5d1: 0x36af, + 0x5d2: 0x3e00, 0x5d3: 0x44e4, 0x5d6: 0x36bb, 0x5d7: 0x3e10, + 0x5d8: 0x3631, 0x5d9: 0x362b, 0x5da: 0x361f, 0x5db: 0x4300, 0x5dd: 0x3ba4, + 0x5de: 0x3bab, 0x5df: 0x3bb2, 0x5e0: 0x36eb, 0x5e1: 0x36e5, 0x5e2: 0x3e68, 0x5e3: 0x44ec, + 0x5e4: 0x36cd, 0x5e5: 0x36d3, 0x5e6: 0x36f1, 0x5e7: 0x3e78, 0x5e8: 0x3661, 0x5e9: 0x365b, + 0x5ea: 0x364f, 0x5eb: 0x430c, 0x5ec: 0x3649, 0x5ed: 0x359b, 0x5ee: 0x42e8, 0x5ef: 0x0081, + 0x5f2: 0x3eb0, 0x5f3: 0x36f7, 0x5f4: 0x3eb8, + 0x5f6: 0x4888, 0x5f7: 0x3ed0, 0x5f8: 0x363d, 0x5f9: 0x4306, 0x5fa: 0x366d, 0x5fb: 0x4318, + 0x5fc: 0x3679, 0x5fd: 0x4256, 0x5fe: 0xa100, + // Block 0x18, offset 0x600 + 0x601: 0x3c06, 0x603: 0xa000, 0x604: 0x3c0d, 0x605: 0xa000, + 0x607: 0x3c14, 0x608: 0xa000, 0x609: 0x3c1b, + 0x60d: 0xa000, + 0x620: 0x2f65, 0x621: 0xa000, 0x622: 0x3c29, + 0x624: 0xa000, 0x625: 0xa000, + 0x62d: 0x3c22, 0x62e: 0x2f60, 0x62f: 0x2f6a, + 0x630: 0x3c30, 0x631: 0x3c37, 0x632: 0xa000, 0x633: 0xa000, 0x634: 0x3c3e, 0x635: 0x3c45, + 0x636: 0xa000, 0x637: 0xa000, 0x638: 0x3c4c, 0x639: 0x3c53, 0x63a: 0xa000, 0x63b: 0xa000, + 0x63c: 0xa000, 0x63d: 0xa000, + // Block 0x19, offset 0x640 + 0x640: 0x3c5a, 0x641: 0x3c61, 0x642: 0xa000, 0x643: 0xa000, 0x644: 0x3c76, 0x645: 0x3c7d, + 0x646: 0xa000, 0x647: 0xa000, 0x648: 0x3c84, 0x649: 0x3c8b, + 0x651: 0xa000, + 0x652: 0xa000, + 0x662: 0xa000, + 0x668: 0xa000, 0x669: 0xa000, + 0x66b: 0xa000, 0x66c: 0x3ca0, 0x66d: 0x3ca7, 0x66e: 0x3cae, 0x66f: 0x3cb5, + 0x672: 0xa000, 0x673: 0xa000, 0x674: 0xa000, 0x675: 0xa000, + // Block 0x1a, offset 0x680 + 0x686: 0xa000, 0x68b: 0xa000, + 0x68c: 0x3f08, 0x68d: 0xa000, 0x68e: 0x3f10, 0x68f: 0xa000, 0x690: 0x3f18, 0x691: 0xa000, + 0x692: 0x3f20, 0x693: 0xa000, 0x694: 0x3f28, 0x695: 0xa000, 0x696: 0x3f30, 0x697: 0xa000, + 0x698: 0x3f38, 0x699: 0xa000, 0x69a: 0x3f40, 0x69b: 0xa000, 0x69c: 0x3f48, 0x69d: 0xa000, + 0x69e: 0x3f50, 0x69f: 0xa000, 0x6a0: 0x3f58, 0x6a1: 0xa000, 0x6a2: 0x3f60, + 0x6a4: 0xa000, 0x6a5: 0x3f68, 0x6a6: 0xa000, 0x6a7: 0x3f70, 0x6a8: 0xa000, 0x6a9: 0x3f78, + 0x6af: 0xa000, + 0x6b0: 0x3f80, 0x6b1: 0x3f88, 0x6b2: 0xa000, 0x6b3: 0x3f90, 0x6b4: 0x3f98, 0x6b5: 0xa000, + 0x6b6: 0x3fa0, 0x6b7: 0x3fa8, 0x6b8: 0xa000, 0x6b9: 0x3fb0, 0x6ba: 0x3fb8, 0x6bb: 0xa000, + 0x6bc: 0x3fc0, 0x6bd: 0x3fc8, + // Block 0x1b, offset 0x6c0 + 0x6d4: 0x3f00, + 0x6d9: 0x9903, 0x6da: 0x9903, 0x6db: 0x8100, 0x6dc: 0x8100, 0x6dd: 0xa000, + 0x6de: 0x3fd0, + 0x6e6: 0xa000, + 0x6eb: 0xa000, 0x6ec: 0x3fe0, 0x6ed: 0xa000, 0x6ee: 0x3fe8, 0x6ef: 0xa000, + 0x6f0: 0x3ff0, 0x6f1: 0xa000, 0x6f2: 0x3ff8, 0x6f3: 0xa000, 0x6f4: 0x4000, 0x6f5: 0xa000, + 0x6f6: 0x4008, 0x6f7: 0xa000, 0x6f8: 0x4010, 0x6f9: 0xa000, 0x6fa: 0x4018, 0x6fb: 0xa000, + 0x6fc: 0x4020, 0x6fd: 0xa000, 0x6fe: 0x4028, 0x6ff: 0xa000, + // Block 0x1c, offset 0x700 + 0x700: 0x4030, 0x701: 0xa000, 0x702: 0x4038, 0x704: 0xa000, 0x705: 0x4040, + 0x706: 0xa000, 0x707: 0x4048, 0x708: 0xa000, 0x709: 0x4050, + 0x70f: 0xa000, 0x710: 0x4058, 0x711: 0x4060, + 0x712: 0xa000, 0x713: 0x4068, 0x714: 0x4070, 0x715: 0xa000, 0x716: 0x4078, 0x717: 0x4080, + 0x718: 0xa000, 0x719: 0x4088, 0x71a: 0x4090, 0x71b: 0xa000, 0x71c: 0x4098, 0x71d: 0x40a0, + 0x72f: 0xa000, + 0x730: 0xa000, 0x731: 0xa000, 0x732: 0xa000, 0x734: 0x3fd8, + 0x737: 0x40a8, 0x738: 0x40b0, 0x739: 0x40b8, 0x73a: 0x40c0, + 0x73d: 0xa000, 0x73e: 0x40c8, + // Block 0x1d, offset 0x740 + 0x740: 0x1377, 0x741: 0x0cfb, 0x742: 0x13d3, 0x743: 0x139f, 0x744: 0x0e57, 0x745: 0x06eb, + 0x746: 0x08df, 0x747: 0x162b, 0x748: 0x162b, 0x749: 0x0a0b, 0x74a: 0x145f, 0x74b: 0x0943, + 0x74c: 0x0a07, 0x74d: 0x0bef, 0x74e: 0x0fcf, 0x74f: 0x115f, 0x750: 0x1297, 0x751: 0x12d3, + 0x752: 0x1307, 0x753: 0x141b, 0x754: 0x0d73, 0x755: 0x0dff, 0x756: 0x0eab, 0x757: 0x0f43, + 0x758: 0x125f, 0x759: 0x1447, 0x75a: 0x1573, 0x75b: 0x070f, 0x75c: 0x08b3, 0x75d: 0x0d87, + 0x75e: 0x0ecf, 0x75f: 0x1293, 0x760: 0x15c3, 0x761: 0x0ab3, 0x762: 0x0e77, 0x763: 0x1283, + 0x764: 0x1317, 0x765: 0x0c23, 0x766: 0x11bb, 0x767: 0x12df, 0x768: 0x0b1f, 0x769: 0x0d0f, + 0x76a: 0x0e17, 0x76b: 0x0f1b, 0x76c: 0x1427, 0x76d: 0x074f, 0x76e: 0x07e7, 0x76f: 0x0853, + 0x770: 0x0c8b, 0x771: 0x0d7f, 0x772: 0x0ecb, 0x773: 0x0fef, 0x774: 0x1177, 0x775: 0x128b, + 0x776: 0x12a3, 0x777: 0x13c7, 0x778: 0x14ef, 0x779: 0x15a3, 0x77a: 0x15bf, 0x77b: 0x102b, + 0x77c: 0x106b, 0x77d: 0x1123, 0x77e: 0x1243, 0x77f: 0x147b, + // Block 0x1e, offset 0x780 + 0x780: 0x15cb, 0x781: 0x134b, 0x782: 0x09c7, 0x783: 0x0b3b, 0x784: 0x10db, 0x785: 0x119b, + 0x786: 0x0eff, 0x787: 0x1033, 0x788: 0x1397, 0x789: 0x14e7, 0x78a: 0x09c3, 0x78b: 0x0a8f, + 0x78c: 0x0d77, 0x78d: 0x0e2b, 0x78e: 0x0e5f, 0x78f: 0x1113, 0x790: 0x113b, 0x791: 0x14a7, + 0x792: 0x084f, 0x793: 0x11a7, 0x794: 0x07f3, 0x795: 0x07ef, 0x796: 0x1097, 0x797: 0x1127, + 0x798: 0x125b, 0x799: 0x14af, 0x79a: 0x1367, 0x79b: 0x0c27, 0x79c: 0x0d73, 0x79d: 0x1357, + 0x79e: 0x06f7, 0x79f: 0x0a63, 0x7a0: 0x0b93, 0x7a1: 0x0f2f, 0x7a2: 0x0faf, 0x7a3: 0x0873, + 0x7a4: 0x103b, 0x7a5: 0x075f, 0x7a6: 0x0b77, 0x7a7: 0x06d7, 0x7a8: 0x0deb, 0x7a9: 0x0ca3, + 0x7aa: 0x110f, 0x7ab: 0x08c7, 0x7ac: 0x09b3, 0x7ad: 0x0ffb, 0x7ae: 0x1263, 0x7af: 0x133b, + 0x7b0: 0x0db7, 0x7b1: 0x13f7, 0x7b2: 0x0de3, 0x7b3: 0x0c37, 0x7b4: 0x121b, 0x7b5: 0x0c57, + 0x7b6: 0x0fab, 0x7b7: 0x072b, 0x7b8: 0x07a7, 0x7b9: 0x07eb, 0x7ba: 0x0d53, 0x7bb: 0x10fb, + 0x7bc: 0x11f3, 0x7bd: 0x1347, 0x7be: 0x145b, 0x7bf: 0x085b, + // Block 0x1f, offset 0x7c0 + 0x7c0: 0x090f, 0x7c1: 0x0a17, 0x7c2: 0x0b2f, 0x7c3: 0x0cbf, 0x7c4: 0x0e7b, 0x7c5: 0x103f, + 0x7c6: 0x1497, 0x7c7: 0x157b, 0x7c8: 0x15cf, 0x7c9: 0x15e7, 0x7ca: 0x0837, 0x7cb: 0x0cf3, + 0x7cc: 0x0da3, 0x7cd: 0x13eb, 0x7ce: 0x0afb, 0x7cf: 0x0bd7, 0x7d0: 0x0bf3, 0x7d1: 0x0c83, + 0x7d2: 0x0e6b, 0x7d3: 0x0eb7, 0x7d4: 0x0f67, 0x7d5: 0x108b, 0x7d6: 0x112f, 0x7d7: 0x1193, + 0x7d8: 0x13db, 0x7d9: 0x126b, 0x7da: 0x1403, 0x7db: 0x147f, 0x7dc: 0x080f, 0x7dd: 0x083b, + 0x7de: 0x0923, 0x7df: 0x0ea7, 0x7e0: 0x12f3, 0x7e1: 0x133b, 0x7e2: 0x0b1b, 0x7e3: 0x0b8b, + 0x7e4: 0x0c4f, 0x7e5: 0x0daf, 0x7e6: 0x10d7, 0x7e7: 0x0f23, 0x7e8: 0x073b, 0x7e9: 0x097f, + 0x7ea: 0x0a63, 0x7eb: 0x0ac7, 0x7ec: 0x0b97, 0x7ed: 0x0f3f, 0x7ee: 0x0f5b, 0x7ef: 0x116b, + 0x7f0: 0x118b, 0x7f1: 0x1463, 0x7f2: 0x14e3, 0x7f3: 0x14f3, 0x7f4: 0x152f, 0x7f5: 0x0753, + 0x7f6: 0x107f, 0x7f7: 0x144f, 0x7f8: 0x14cb, 0x7f9: 0x0baf, 0x7fa: 0x0717, 0x7fb: 0x0777, + 0x7fc: 0x0a67, 0x7fd: 0x0a87, 0x7fe: 0x0caf, 0x7ff: 0x0d73, + // Block 0x20, offset 0x800 + 0x800: 0x0ec3, 0x801: 0x0fcb, 0x802: 0x1277, 0x803: 0x1417, 0x804: 0x1623, 0x805: 0x0ce3, + 0x806: 0x14a3, 0x807: 0x0833, 0x808: 0x0d2f, 0x809: 0x0d3b, 0x80a: 0x0e0f, 0x80b: 0x0e47, + 0x80c: 0x0f4b, 0x80d: 0x0fa7, 0x80e: 0x1027, 0x80f: 0x110b, 0x810: 0x153b, 0x811: 0x07af, + 0x812: 0x0c03, 0x813: 0x14b3, 0x814: 0x0767, 0x815: 0x0aab, 0x816: 0x0e2f, 0x817: 0x13df, + 0x818: 0x0b67, 0x819: 0x0bb7, 0x81a: 0x0d43, 0x81b: 0x0f2f, 0x81c: 0x14bb, 0x81d: 0x0817, + 0x81e: 0x08ff, 0x81f: 0x0a97, 0x820: 0x0cd3, 0x821: 0x0d1f, 0x822: 0x0d5f, 0x823: 0x0df3, + 0x824: 0x0f47, 0x825: 0x0fbb, 0x826: 0x1157, 0x827: 0x12f7, 0x828: 0x1303, 0x829: 0x1457, + 0x82a: 0x14d7, 0x82b: 0x0883, 0x82c: 0x0e4b, 0x82d: 0x0903, 0x82e: 0x0ec7, 0x82f: 0x0f6b, + 0x830: 0x1287, 0x831: 0x14bf, 0x832: 0x15ab, 0x833: 0x15d3, 0x834: 0x0d37, 0x835: 0x0e27, + 0x836: 0x11c3, 0x837: 0x10b7, 0x838: 0x10c3, 0x839: 0x10e7, 0x83a: 0x0f17, 0x83b: 0x0e9f, + 0x83c: 0x1363, 0x83d: 0x0733, 0x83e: 0x122b, 0x83f: 0x081b, + // Block 0x21, offset 0x840 + 0x840: 0x080b, 0x841: 0x0b0b, 0x842: 0x0c2b, 0x843: 0x10f3, 0x844: 0x0a53, 0x845: 0x0e03, + 0x846: 0x0cef, 0x847: 0x13e7, 0x848: 0x12e7, 0x849: 0x14ab, 0x84a: 0x1323, 0x84b: 0x0b27, + 0x84c: 0x0787, 0x84d: 0x095b, 0x850: 0x09af, + 0x852: 0x0cdf, 0x855: 0x07f7, 0x856: 0x0f1f, 0x857: 0x0fe3, + 0x858: 0x1047, 0x859: 0x1063, 0x85a: 0x1067, 0x85b: 0x107b, 0x85c: 0x14fb, 0x85d: 0x10eb, + 0x85e: 0x116f, 0x860: 0x128f, 0x862: 0x1353, + 0x865: 0x1407, 0x866: 0x1433, + 0x86a: 0x154f, 0x86b: 0x1553, 0x86c: 0x1557, 0x86d: 0x15bb, 0x86e: 0x142b, 0x86f: 0x14c7, + 0x870: 0x0757, 0x871: 0x077b, 0x872: 0x078f, 0x873: 0x084b, 0x874: 0x0857, 0x875: 0x0897, + 0x876: 0x094b, 0x877: 0x0967, 0x878: 0x096f, 0x879: 0x09ab, 0x87a: 0x09b7, 0x87b: 0x0a93, + 0x87c: 0x0a9b, 0x87d: 0x0ba3, 0x87e: 0x0bcb, 0x87f: 0x0bd3, + // Block 0x22, offset 0x880 + 0x880: 0x0beb, 0x881: 0x0c97, 0x882: 0x0cc7, 0x883: 0x0ce7, 0x884: 0x0d57, 0x885: 0x0e1b, + 0x886: 0x0e37, 0x887: 0x0e67, 0x888: 0x0ebb, 0x889: 0x0edb, 0x88a: 0x0f4f, 0x88b: 0x102f, + 0x88c: 0x104b, 0x88d: 0x1053, 0x88e: 0x104f, 0x88f: 0x1057, 0x890: 0x105b, 0x891: 0x105f, + 0x892: 0x1073, 0x893: 0x1077, 0x894: 0x109b, 0x895: 0x10af, 0x896: 0x10cb, 0x897: 0x112f, + 0x898: 0x1137, 0x899: 0x113f, 0x89a: 0x1153, 0x89b: 0x117b, 0x89c: 0x11cb, 0x89d: 0x11ff, + 0x89e: 0x11ff, 0x89f: 0x1267, 0x8a0: 0x130f, 0x8a1: 0x1327, 0x8a2: 0x135b, 0x8a3: 0x135f, + 0x8a4: 0x13a3, 0x8a5: 0x13a7, 0x8a6: 0x13ff, 0x8a7: 0x1407, 0x8a8: 0x14db, 0x8a9: 0x151f, + 0x8aa: 0x1537, 0x8ab: 0x0b9b, 0x8ac: 0x171e, 0x8ad: 0x11e3, + 0x8b0: 0x06df, 0x8b1: 0x07e3, 0x8b2: 0x07a3, 0x8b3: 0x074b, 0x8b4: 0x078b, 0x8b5: 0x07b7, + 0x8b6: 0x0847, 0x8b7: 0x0863, 0x8b8: 0x094b, 0x8b9: 0x0937, 0x8ba: 0x0947, 0x8bb: 0x0963, + 0x8bc: 0x09af, 0x8bd: 0x09bf, 0x8be: 0x0a03, 0x8bf: 0x0a0f, + // Block 0x23, offset 0x8c0 + 0x8c0: 0x0a2b, 0x8c1: 0x0a3b, 0x8c2: 0x0b23, 0x8c3: 0x0b2b, 0x8c4: 0x0b5b, 0x8c5: 0x0b7b, + 0x8c6: 0x0bab, 0x8c7: 0x0bc3, 0x8c8: 0x0bb3, 0x8c9: 0x0bd3, 0x8ca: 0x0bc7, 0x8cb: 0x0beb, + 0x8cc: 0x0c07, 0x8cd: 0x0c5f, 0x8ce: 0x0c6b, 0x8cf: 0x0c73, 0x8d0: 0x0c9b, 0x8d1: 0x0cdf, + 0x8d2: 0x0d0f, 0x8d3: 0x0d13, 0x8d4: 0x0d27, 0x8d5: 0x0da7, 0x8d6: 0x0db7, 0x8d7: 0x0e0f, + 0x8d8: 0x0e5b, 0x8d9: 0x0e53, 0x8da: 0x0e67, 0x8db: 0x0e83, 0x8dc: 0x0ebb, 0x8dd: 0x1013, + 0x8de: 0x0edf, 0x8df: 0x0f13, 0x8e0: 0x0f1f, 0x8e1: 0x0f5f, 0x8e2: 0x0f7b, 0x8e3: 0x0f9f, + 0x8e4: 0x0fc3, 0x8e5: 0x0fc7, 0x8e6: 0x0fe3, 0x8e7: 0x0fe7, 0x8e8: 0x0ff7, 0x8e9: 0x100b, + 0x8ea: 0x1007, 0x8eb: 0x1037, 0x8ec: 0x10b3, 0x8ed: 0x10cb, 0x8ee: 0x10e3, 0x8ef: 0x111b, + 0x8f0: 0x112f, 0x8f1: 0x114b, 0x8f2: 0x117b, 0x8f3: 0x122f, 0x8f4: 0x1257, 0x8f5: 0x12cb, + 0x8f6: 0x1313, 0x8f7: 0x131f, 0x8f8: 0x1327, 0x8f9: 0x133f, 0x8fa: 0x1353, 0x8fb: 0x1343, + 0x8fc: 0x135b, 0x8fd: 0x1357, 0x8fe: 0x134f, 0x8ff: 0x135f, + // Block 0x24, offset 0x900 + 0x900: 0x136b, 0x901: 0x13a7, 0x902: 0x13e3, 0x903: 0x1413, 0x904: 0x144b, 0x905: 0x146b, + 0x906: 0x14b7, 0x907: 0x14db, 0x908: 0x14fb, 0x909: 0x150f, 0x90a: 0x151f, 0x90b: 0x152b, + 0x90c: 0x1537, 0x90d: 0x158b, 0x90e: 0x162b, 0x90f: 0x16b5, 0x910: 0x16b0, 0x911: 0x16e2, + 0x912: 0x0607, 0x913: 0x062f, 0x914: 0x0633, 0x915: 0x1764, 0x916: 0x1791, 0x917: 0x1809, + 0x918: 0x1617, 0x919: 0x1627, + // Block 0x25, offset 0x940 + 0x940: 0x06fb, 0x941: 0x06f3, 0x942: 0x0703, 0x943: 0x1647, 0x944: 0x0747, 0x945: 0x0757, + 0x946: 0x075b, 0x947: 0x0763, 0x948: 0x076b, 0x949: 0x076f, 0x94a: 0x077b, 0x94b: 0x0773, + 0x94c: 0x05b3, 0x94d: 0x165b, 0x94e: 0x078f, 0x94f: 0x0793, 0x950: 0x0797, 0x951: 0x07b3, + 0x952: 0x164c, 0x953: 0x05b7, 0x954: 0x079f, 0x955: 0x07bf, 0x956: 0x1656, 0x957: 0x07cf, + 0x958: 0x07d7, 0x959: 0x0737, 0x95a: 0x07df, 0x95b: 0x07e3, 0x95c: 0x1831, 0x95d: 0x07ff, + 0x95e: 0x0807, 0x95f: 0x05bf, 0x960: 0x081f, 0x961: 0x0823, 0x962: 0x082b, 0x963: 0x082f, + 0x964: 0x05c3, 0x965: 0x0847, 0x966: 0x084b, 0x967: 0x0857, 0x968: 0x0863, 0x969: 0x0867, + 0x96a: 0x086b, 0x96b: 0x0873, 0x96c: 0x0893, 0x96d: 0x0897, 0x96e: 0x089f, 0x96f: 0x08af, + 0x970: 0x08b7, 0x971: 0x08bb, 0x972: 0x08bb, 0x973: 0x08bb, 0x974: 0x166a, 0x975: 0x0e93, + 0x976: 0x08cf, 0x977: 0x08d7, 0x978: 0x166f, 0x979: 0x08e3, 0x97a: 0x08eb, 0x97b: 0x08f3, + 0x97c: 0x091b, 0x97d: 0x0907, 0x97e: 0x0913, 0x97f: 0x0917, + // Block 0x26, offset 0x980 + 0x980: 0x091f, 0x981: 0x0927, 0x982: 0x092b, 0x983: 0x0933, 0x984: 0x093b, 0x985: 0x093f, + 0x986: 0x093f, 0x987: 0x0947, 0x988: 0x094f, 0x989: 0x0953, 0x98a: 0x095f, 0x98b: 0x0983, + 0x98c: 0x0967, 0x98d: 0x0987, 0x98e: 0x096b, 0x98f: 0x0973, 0x990: 0x080b, 0x991: 0x09cf, + 0x992: 0x0997, 0x993: 0x099b, 0x994: 0x099f, 0x995: 0x0993, 0x996: 0x09a7, 0x997: 0x09a3, + 0x998: 0x09bb, 0x999: 0x1674, 0x99a: 0x09d7, 0x99b: 0x09db, 0x99c: 0x09e3, 0x99d: 0x09ef, + 0x99e: 0x09f7, 0x99f: 0x0a13, 0x9a0: 0x1679, 0x9a1: 0x167e, 0x9a2: 0x0a1f, 0x9a3: 0x0a23, + 0x9a4: 0x0a27, 0x9a5: 0x0a1b, 0x9a6: 0x0a2f, 0x9a7: 0x05c7, 0x9a8: 0x05cb, 0x9a9: 0x0a37, + 0x9aa: 0x0a3f, 0x9ab: 0x0a3f, 0x9ac: 0x1683, 0x9ad: 0x0a5b, 0x9ae: 0x0a5f, 0x9af: 0x0a63, + 0x9b0: 0x0a6b, 0x9b1: 0x1688, 0x9b2: 0x0a73, 0x9b3: 0x0a77, 0x9b4: 0x0b4f, 0x9b5: 0x0a7f, + 0x9b6: 0x05cf, 0x9b7: 0x0a8b, 0x9b8: 0x0a9b, 0x9b9: 0x0aa7, 0x9ba: 0x0aa3, 0x9bb: 0x1692, + 0x9bc: 0x0aaf, 0x9bd: 0x1697, 0x9be: 0x0abb, 0x9bf: 0x0ab7, + // Block 0x27, offset 0x9c0 + 0x9c0: 0x0abf, 0x9c1: 0x0acf, 0x9c2: 0x0ad3, 0x9c3: 0x05d3, 0x9c4: 0x0ae3, 0x9c5: 0x0aeb, + 0x9c6: 0x0aef, 0x9c7: 0x0af3, 0x9c8: 0x05d7, 0x9c9: 0x169c, 0x9ca: 0x05db, 0x9cb: 0x0b0f, + 0x9cc: 0x0b13, 0x9cd: 0x0b17, 0x9ce: 0x0b1f, 0x9cf: 0x1863, 0x9d0: 0x0b37, 0x9d1: 0x16a6, + 0x9d2: 0x16a6, 0x9d3: 0x11d7, 0x9d4: 0x0b47, 0x9d5: 0x0b47, 0x9d6: 0x05df, 0x9d7: 0x16c9, + 0x9d8: 0x179b, 0x9d9: 0x0b57, 0x9da: 0x0b5f, 0x9db: 0x05e3, 0x9dc: 0x0b73, 0x9dd: 0x0b83, + 0x9de: 0x0b87, 0x9df: 0x0b8f, 0x9e0: 0x0b9f, 0x9e1: 0x05eb, 0x9e2: 0x05e7, 0x9e3: 0x0ba3, + 0x9e4: 0x16ab, 0x9e5: 0x0ba7, 0x9e6: 0x0bbb, 0x9e7: 0x0bbf, 0x9e8: 0x0bc3, 0x9e9: 0x0bbf, + 0x9ea: 0x0bcf, 0x9eb: 0x0bd3, 0x9ec: 0x0be3, 0x9ed: 0x0bdb, 0x9ee: 0x0bdf, 0x9ef: 0x0be7, + 0x9f0: 0x0beb, 0x9f1: 0x0bef, 0x9f2: 0x0bfb, 0x9f3: 0x0bff, 0x9f4: 0x0c17, 0x9f5: 0x0c1f, + 0x9f6: 0x0c2f, 0x9f7: 0x0c43, 0x9f8: 0x16ba, 0x9f9: 0x0c3f, 0x9fa: 0x0c33, 0x9fb: 0x0c4b, + 0x9fc: 0x0c53, 0x9fd: 0x0c67, 0x9fe: 0x16bf, 0x9ff: 0x0c6f, + // Block 0x28, offset 0xa00 + 0xa00: 0x0c63, 0xa01: 0x0c5b, 0xa02: 0x05ef, 0xa03: 0x0c77, 0xa04: 0x0c7f, 0xa05: 0x0c87, + 0xa06: 0x0c7b, 0xa07: 0x05f3, 0xa08: 0x0c97, 0xa09: 0x0c9f, 0xa0a: 0x16c4, 0xa0b: 0x0ccb, + 0xa0c: 0x0cff, 0xa0d: 0x0cdb, 0xa0e: 0x05ff, 0xa0f: 0x0ce7, 0xa10: 0x05fb, 0xa11: 0x05f7, + 0xa12: 0x07c3, 0xa13: 0x07c7, 0xa14: 0x0d03, 0xa15: 0x0ceb, 0xa16: 0x11ab, 0xa17: 0x0663, + 0xa18: 0x0d0f, 0xa19: 0x0d13, 0xa1a: 0x0d17, 0xa1b: 0x0d2b, 0xa1c: 0x0d23, 0xa1d: 0x16dd, + 0xa1e: 0x0603, 0xa1f: 0x0d3f, 0xa20: 0x0d33, 0xa21: 0x0d4f, 0xa22: 0x0d57, 0xa23: 0x16e7, + 0xa24: 0x0d5b, 0xa25: 0x0d47, 0xa26: 0x0d63, 0xa27: 0x0607, 0xa28: 0x0d67, 0xa29: 0x0d6b, + 0xa2a: 0x0d6f, 0xa2b: 0x0d7b, 0xa2c: 0x16ec, 0xa2d: 0x0d83, 0xa2e: 0x060b, 0xa2f: 0x0d8f, + 0xa30: 0x16f1, 0xa31: 0x0d93, 0xa32: 0x060f, 0xa33: 0x0d9f, 0xa34: 0x0dab, 0xa35: 0x0db7, + 0xa36: 0x0dbb, 0xa37: 0x16f6, 0xa38: 0x168d, 0xa39: 0x16fb, 0xa3a: 0x0ddb, 0xa3b: 0x1700, + 0xa3c: 0x0de7, 0xa3d: 0x0def, 0xa3e: 0x0ddf, 0xa3f: 0x0dfb, + // Block 0x29, offset 0xa40 + 0xa40: 0x0e0b, 0xa41: 0x0e1b, 0xa42: 0x0e0f, 0xa43: 0x0e13, 0xa44: 0x0e1f, 0xa45: 0x0e23, + 0xa46: 0x1705, 0xa47: 0x0e07, 0xa48: 0x0e3b, 0xa49: 0x0e3f, 0xa4a: 0x0613, 0xa4b: 0x0e53, + 0xa4c: 0x0e4f, 0xa4d: 0x170a, 0xa4e: 0x0e33, 0xa4f: 0x0e6f, 0xa50: 0x170f, 0xa51: 0x1714, + 0xa52: 0x0e73, 0xa53: 0x0e87, 0xa54: 0x0e83, 0xa55: 0x0e7f, 0xa56: 0x0617, 0xa57: 0x0e8b, + 0xa58: 0x0e9b, 0xa59: 0x0e97, 0xa5a: 0x0ea3, 0xa5b: 0x1651, 0xa5c: 0x0eb3, 0xa5d: 0x1719, + 0xa5e: 0x0ebf, 0xa5f: 0x1723, 0xa60: 0x0ed3, 0xa61: 0x0edf, 0xa62: 0x0ef3, 0xa63: 0x1728, + 0xa64: 0x0f07, 0xa65: 0x0f0b, 0xa66: 0x172d, 0xa67: 0x1732, 0xa68: 0x0f27, 0xa69: 0x0f37, + 0xa6a: 0x061b, 0xa6b: 0x0f3b, 0xa6c: 0x061f, 0xa6d: 0x061f, 0xa6e: 0x0f53, 0xa6f: 0x0f57, + 0xa70: 0x0f5f, 0xa71: 0x0f63, 0xa72: 0x0f6f, 0xa73: 0x0623, 0xa74: 0x0f87, 0xa75: 0x1737, + 0xa76: 0x0fa3, 0xa77: 0x173c, 0xa78: 0x0faf, 0xa79: 0x16a1, 0xa7a: 0x0fbf, 0xa7b: 0x1741, + 0xa7c: 0x1746, 0xa7d: 0x174b, 0xa7e: 0x0627, 0xa7f: 0x062b, + // Block 0x2a, offset 0xa80 + 0xa80: 0x0ff7, 0xa81: 0x1755, 0xa82: 0x1750, 0xa83: 0x175a, 0xa84: 0x175f, 0xa85: 0x0fff, + 0xa86: 0x1003, 0xa87: 0x1003, 0xa88: 0x100b, 0xa89: 0x0633, 0xa8a: 0x100f, 0xa8b: 0x0637, + 0xa8c: 0x063b, 0xa8d: 0x1769, 0xa8e: 0x1023, 0xa8f: 0x102b, 0xa90: 0x1037, 0xa91: 0x063f, + 0xa92: 0x176e, 0xa93: 0x105b, 0xa94: 0x1773, 0xa95: 0x1778, 0xa96: 0x107b, 0xa97: 0x1093, + 0xa98: 0x0643, 0xa99: 0x109b, 0xa9a: 0x109f, 0xa9b: 0x10a3, 0xa9c: 0x177d, 0xa9d: 0x1782, + 0xa9e: 0x1782, 0xa9f: 0x10bb, 0xaa0: 0x0647, 0xaa1: 0x1787, 0xaa2: 0x10cf, 0xaa3: 0x10d3, + 0xaa4: 0x064b, 0xaa5: 0x178c, 0xaa6: 0x10ef, 0xaa7: 0x064f, 0xaa8: 0x10ff, 0xaa9: 0x10f7, + 0xaaa: 0x1107, 0xaab: 0x1796, 0xaac: 0x111f, 0xaad: 0x0653, 0xaae: 0x112b, 0xaaf: 0x1133, + 0xab0: 0x1143, 0xab1: 0x0657, 0xab2: 0x17a0, 0xab3: 0x17a5, 0xab4: 0x065b, 0xab5: 0x17aa, + 0xab6: 0x115b, 0xab7: 0x17af, 0xab8: 0x1167, 0xab9: 0x1173, 0xaba: 0x117b, 0xabb: 0x17b4, + 0xabc: 0x17b9, 0xabd: 0x118f, 0xabe: 0x17be, 0xabf: 0x1197, + // Block 0x2b, offset 0xac0 + 0xac0: 0x16ce, 0xac1: 0x065f, 0xac2: 0x11af, 0xac3: 0x11b3, 0xac4: 0x0667, 0xac5: 0x11b7, + 0xac6: 0x0a33, 0xac7: 0x17c3, 0xac8: 0x17c8, 0xac9: 0x16d3, 0xaca: 0x16d8, 0xacb: 0x11d7, + 0xacc: 0x11db, 0xacd: 0x13f3, 0xace: 0x066b, 0xacf: 0x1207, 0xad0: 0x1203, 0xad1: 0x120b, + 0xad2: 0x083f, 0xad3: 0x120f, 0xad4: 0x1213, 0xad5: 0x1217, 0xad6: 0x121f, 0xad7: 0x17cd, + 0xad8: 0x121b, 0xad9: 0x1223, 0xada: 0x1237, 0xadb: 0x123b, 0xadc: 0x1227, 0xadd: 0x123f, + 0xade: 0x1253, 0xadf: 0x1267, 0xae0: 0x1233, 0xae1: 0x1247, 0xae2: 0x124b, 0xae3: 0x124f, + 0xae4: 0x17d2, 0xae5: 0x17dc, 0xae6: 0x17d7, 0xae7: 0x066f, 0xae8: 0x126f, 0xae9: 0x1273, + 0xaea: 0x127b, 0xaeb: 0x17f0, 0xaec: 0x127f, 0xaed: 0x17e1, 0xaee: 0x0673, 0xaef: 0x0677, + 0xaf0: 0x17e6, 0xaf1: 0x17eb, 0xaf2: 0x067b, 0xaf3: 0x129f, 0xaf4: 0x12a3, 0xaf5: 0x12a7, + 0xaf6: 0x12ab, 0xaf7: 0x12b7, 0xaf8: 0x12b3, 0xaf9: 0x12bf, 0xafa: 0x12bb, 0xafb: 0x12cb, + 0xafc: 0x12c3, 0xafd: 0x12c7, 0xafe: 0x12cf, 0xaff: 0x067f, + // Block 0x2c, offset 0xb00 + 0xb00: 0x12d7, 0xb01: 0x12db, 0xb02: 0x0683, 0xb03: 0x12eb, 0xb04: 0x12ef, 0xb05: 0x17f5, + 0xb06: 0x12fb, 0xb07: 0x12ff, 0xb08: 0x0687, 0xb09: 0x130b, 0xb0a: 0x05bb, 0xb0b: 0x17fa, + 0xb0c: 0x17ff, 0xb0d: 0x068b, 0xb0e: 0x068f, 0xb0f: 0x1337, 0xb10: 0x134f, 0xb11: 0x136b, + 0xb12: 0x137b, 0xb13: 0x1804, 0xb14: 0x138f, 0xb15: 0x1393, 0xb16: 0x13ab, 0xb17: 0x13b7, + 0xb18: 0x180e, 0xb19: 0x1660, 0xb1a: 0x13c3, 0xb1b: 0x13bf, 0xb1c: 0x13cb, 0xb1d: 0x1665, + 0xb1e: 0x13d7, 0xb1f: 0x13e3, 0xb20: 0x1813, 0xb21: 0x1818, 0xb22: 0x1423, 0xb23: 0x142f, + 0xb24: 0x1437, 0xb25: 0x181d, 0xb26: 0x143b, 0xb27: 0x1467, 0xb28: 0x1473, 0xb29: 0x1477, + 0xb2a: 0x146f, 0xb2b: 0x1483, 0xb2c: 0x1487, 0xb2d: 0x1822, 0xb2e: 0x1493, 0xb2f: 0x0693, + 0xb30: 0x149b, 0xb31: 0x1827, 0xb32: 0x0697, 0xb33: 0x14d3, 0xb34: 0x0ac3, 0xb35: 0x14eb, + 0xb36: 0x182c, 0xb37: 0x1836, 0xb38: 0x069b, 0xb39: 0x069f, 0xb3a: 0x1513, 0xb3b: 0x183b, + 0xb3c: 0x06a3, 0xb3d: 0x1840, 0xb3e: 0x152b, 0xb3f: 0x152b, + // Block 0x2d, offset 0xb40 + 0xb40: 0x1533, 0xb41: 0x1845, 0xb42: 0x154b, 0xb43: 0x06a7, 0xb44: 0x155b, 0xb45: 0x1567, + 0xb46: 0x156f, 0xb47: 0x1577, 0xb48: 0x06ab, 0xb49: 0x184a, 0xb4a: 0x158b, 0xb4b: 0x15a7, + 0xb4c: 0x15b3, 0xb4d: 0x06af, 0xb4e: 0x06b3, 0xb4f: 0x15b7, 0xb50: 0x184f, 0xb51: 0x06b7, + 0xb52: 0x1854, 0xb53: 0x1859, 0xb54: 0x185e, 0xb55: 0x15db, 0xb56: 0x06bb, 0xb57: 0x15ef, + 0xb58: 0x15f7, 0xb59: 0x15fb, 0xb5a: 0x1603, 0xb5b: 0x160b, 0xb5c: 0x1613, 0xb5d: 0x1868, +} + +// nfcIndex: 22 blocks, 1408 entries, 1408 bytes +// Block 0 is the zero block. +var nfcIndex = [1408]uint8{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x2c, 0xc3: 0x01, 0xc4: 0x02, 0xc5: 0x03, 0xc6: 0x2d, 0xc7: 0x04, + 0xc8: 0x05, 0xca: 0x2e, 0xcb: 0x2f, 0xcc: 0x06, 0xcd: 0x07, 0xce: 0x08, 0xcf: 0x30, + 0xd0: 0x09, 0xd1: 0x31, 0xd2: 0x32, 0xd3: 0x0a, 0xd6: 0x0b, 0xd7: 0x33, + 0xd8: 0x34, 0xd9: 0x0c, 0xdb: 0x35, 0xdc: 0x36, 0xdd: 0x37, 0xdf: 0x38, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, + 0xea: 0x06, 0xeb: 0x07, 0xec: 0x08, 0xed: 0x09, 0xef: 0x0a, + 0xf0: 0x13, + // Block 0x4, offset 0x100 + 0x120: 0x39, 0x121: 0x3a, 0x123: 0x3b, 0x124: 0x3c, 0x125: 0x3d, 0x126: 0x3e, 0x127: 0x3f, + 0x128: 0x40, 0x129: 0x41, 0x12a: 0x42, 0x12b: 0x43, 0x12c: 0x3e, 0x12d: 0x44, 0x12e: 0x45, 0x12f: 0x46, + 0x131: 0x47, 0x132: 0x48, 0x133: 0x49, 0x134: 0x4a, 0x135: 0x4b, 0x137: 0x4c, + 0x138: 0x4d, 0x139: 0x4e, 0x13a: 0x4f, 0x13b: 0x50, 0x13c: 0x51, 0x13d: 0x52, 0x13e: 0x53, 0x13f: 0x54, + // Block 0x5, offset 0x140 + 0x140: 0x55, 0x142: 0x56, 0x144: 0x57, 0x145: 0x58, 0x146: 0x59, 0x147: 0x5a, + 0x14d: 0x5b, + 0x15c: 0x5c, 0x15f: 0x5d, + 0x162: 0x5e, 0x164: 0x5f, + 0x168: 0x60, 0x169: 0x61, 0x16a: 0x62, 0x16c: 0x0d, 0x16d: 0x63, 0x16e: 0x64, 0x16f: 0x65, + 0x170: 0x66, 0x173: 0x67, 0x177: 0x68, + 0x178: 0x0e, 0x179: 0x0f, 0x17a: 0x10, 0x17b: 0x11, 0x17c: 0x12, 0x17d: 0x13, 0x17e: 0x14, 0x17f: 0x15, + // Block 0x6, offset 0x180 + 0x180: 0x69, 0x183: 0x6a, 0x184: 0x6b, 0x186: 0x6c, 0x187: 0x6d, + 0x188: 0x6e, 0x189: 0x16, 0x18a: 0x17, 0x18b: 0x6f, 0x18c: 0x70, + 0x1ab: 0x71, + 0x1b3: 0x72, 0x1b5: 0x73, 0x1b7: 0x74, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x75, 0x1c1: 0x18, 0x1c2: 0x19, 0x1c3: 0x1a, 0x1c4: 0x76, 0x1c5: 0x77, + 0x1c9: 0x78, 0x1cc: 0x79, 0x1cd: 0x7a, + // Block 0x8, offset 0x200 + 0x219: 0x7b, 0x21a: 0x7c, 0x21b: 0x7d, + 0x220: 0x7e, 0x223: 0x7f, 0x224: 0x80, 0x225: 0x81, 0x226: 0x82, 0x227: 0x83, + 0x22a: 0x84, 0x22b: 0x85, 0x22f: 0x86, + 0x230: 0x87, 0x231: 0x88, 0x232: 0x89, 0x233: 0x8a, 0x234: 0x8b, 0x235: 0x8c, 0x236: 0x8d, 0x237: 0x87, + 0x238: 0x88, 0x239: 0x89, 0x23a: 0x8a, 0x23b: 0x8b, 0x23c: 0x8c, 0x23d: 0x8d, 0x23e: 0x87, 0x23f: 0x88, + // Block 0x9, offset 0x240 + 0x240: 0x89, 0x241: 0x8a, 0x242: 0x8b, 0x243: 0x8c, 0x244: 0x8d, 0x245: 0x87, 0x246: 0x88, 0x247: 0x89, + 0x248: 0x8a, 0x249: 0x8b, 0x24a: 0x8c, 0x24b: 0x8d, 0x24c: 0x87, 0x24d: 0x88, 0x24e: 0x89, 0x24f: 0x8a, + 0x250: 0x8b, 0x251: 0x8c, 0x252: 0x8d, 0x253: 0x87, 0x254: 0x88, 0x255: 0x89, 0x256: 0x8a, 0x257: 0x8b, + 0x258: 0x8c, 0x259: 0x8d, 0x25a: 0x87, 0x25b: 0x88, 0x25c: 0x89, 0x25d: 0x8a, 0x25e: 0x8b, 0x25f: 0x8c, + 0x260: 0x8d, 0x261: 0x87, 0x262: 0x88, 0x263: 0x89, 0x264: 0x8a, 0x265: 0x8b, 0x266: 0x8c, 0x267: 0x8d, + 0x268: 0x87, 0x269: 0x88, 0x26a: 0x89, 0x26b: 0x8a, 0x26c: 0x8b, 0x26d: 0x8c, 0x26e: 0x8d, 0x26f: 0x87, + 0x270: 0x88, 0x271: 0x89, 0x272: 0x8a, 0x273: 0x8b, 0x274: 0x8c, 0x275: 0x8d, 0x276: 0x87, 0x277: 0x88, + 0x278: 0x89, 0x279: 0x8a, 0x27a: 0x8b, 0x27b: 0x8c, 0x27c: 0x8d, 0x27d: 0x87, 0x27e: 0x88, 0x27f: 0x89, + // Block 0xa, offset 0x280 + 0x280: 0x8a, 0x281: 0x8b, 0x282: 0x8c, 0x283: 0x8d, 0x284: 0x87, 0x285: 0x88, 0x286: 0x89, 0x287: 0x8a, + 0x288: 0x8b, 0x289: 0x8c, 0x28a: 0x8d, 0x28b: 0x87, 0x28c: 0x88, 0x28d: 0x89, 0x28e: 0x8a, 0x28f: 0x8b, + 0x290: 0x8c, 0x291: 0x8d, 0x292: 0x87, 0x293: 0x88, 0x294: 0x89, 0x295: 0x8a, 0x296: 0x8b, 0x297: 0x8c, + 0x298: 0x8d, 0x299: 0x87, 0x29a: 0x88, 0x29b: 0x89, 0x29c: 0x8a, 0x29d: 0x8b, 0x29e: 0x8c, 0x29f: 0x8d, + 0x2a0: 0x87, 0x2a1: 0x88, 0x2a2: 0x89, 0x2a3: 0x8a, 0x2a4: 0x8b, 0x2a5: 0x8c, 0x2a6: 0x8d, 0x2a7: 0x87, + 0x2a8: 0x88, 0x2a9: 0x89, 0x2aa: 0x8a, 0x2ab: 0x8b, 0x2ac: 0x8c, 0x2ad: 0x8d, 0x2ae: 0x87, 0x2af: 0x88, + 0x2b0: 0x89, 0x2b1: 0x8a, 0x2b2: 0x8b, 0x2b3: 0x8c, 0x2b4: 0x8d, 0x2b5: 0x87, 0x2b6: 0x88, 0x2b7: 0x89, + 0x2b8: 0x8a, 0x2b9: 0x8b, 0x2ba: 0x8c, 0x2bb: 0x8d, 0x2bc: 0x87, 0x2bd: 0x88, 0x2be: 0x89, 0x2bf: 0x8a, + // Block 0xb, offset 0x2c0 + 0x2c0: 0x8b, 0x2c1: 0x8c, 0x2c2: 0x8d, 0x2c3: 0x87, 0x2c4: 0x88, 0x2c5: 0x89, 0x2c6: 0x8a, 0x2c7: 0x8b, + 0x2c8: 0x8c, 0x2c9: 0x8d, 0x2ca: 0x87, 0x2cb: 0x88, 0x2cc: 0x89, 0x2cd: 0x8a, 0x2ce: 0x8b, 0x2cf: 0x8c, + 0x2d0: 0x8d, 0x2d1: 0x87, 0x2d2: 0x88, 0x2d3: 0x89, 0x2d4: 0x8a, 0x2d5: 0x8b, 0x2d6: 0x8c, 0x2d7: 0x8d, + 0x2d8: 0x87, 0x2d9: 0x88, 0x2da: 0x89, 0x2db: 0x8a, 0x2dc: 0x8b, 0x2dd: 0x8c, 0x2de: 0x8e, + // Block 0xc, offset 0x300 + 0x324: 0x1b, 0x325: 0x1c, 0x326: 0x1d, 0x327: 0x1e, + 0x328: 0x1f, 0x329: 0x20, 0x32a: 0x21, 0x32b: 0x22, 0x32c: 0x8f, 0x32d: 0x90, 0x32e: 0x91, + 0x331: 0x92, 0x332: 0x93, 0x333: 0x94, 0x334: 0x95, + 0x338: 0x96, 0x339: 0x97, 0x33a: 0x98, 0x33b: 0x99, 0x33e: 0x9a, 0x33f: 0x9b, + // Block 0xd, offset 0x340 + 0x347: 0x9c, + 0x34b: 0x9d, 0x34d: 0x9e, + 0x368: 0x9f, 0x36b: 0xa0, + // Block 0xe, offset 0x380 + 0x381: 0xa1, 0x382: 0xa2, 0x384: 0xa3, 0x385: 0x82, 0x387: 0xa4, + 0x388: 0xa5, 0x38b: 0xa6, 0x38c: 0x3e, 0x38d: 0xa7, + 0x391: 0xa8, 0x392: 0xa9, 0x393: 0xaa, 0x396: 0xab, 0x397: 0xac, + 0x398: 0x73, 0x39a: 0xad, 0x39c: 0xae, + 0x3b0: 0x73, + // Block 0xf, offset 0x3c0 + 0x3eb: 0xaf, 0x3ec: 0xb0, + // Block 0x10, offset 0x400 + 0x432: 0xb1, + // Block 0x11, offset 0x440 + 0x445: 0xb2, 0x446: 0xb3, 0x447: 0xb4, + 0x449: 0xb5, + // Block 0x12, offset 0x480 + 0x480: 0xb6, + 0x4a3: 0xb7, 0x4a5: 0xb8, + // Block 0x13, offset 0x4c0 + 0x4c8: 0xb9, + // Block 0x14, offset 0x500 + 0x520: 0x23, 0x521: 0x24, 0x522: 0x25, 0x523: 0x26, 0x524: 0x27, 0x525: 0x28, 0x526: 0x29, 0x527: 0x2a, + 0x528: 0x2b, + // Block 0x15, offset 0x540 + 0x550: 0x0b, 0x551: 0x0c, 0x556: 0x0d, + 0x55b: 0x0e, 0x55d: 0x0f, 0x55e: 0x10, 0x55f: 0x11, + 0x56f: 0x12, +} + +// nfcSparseOffset: 142 entries, 284 bytes +var nfcSparseOffset = []uint16{0x0, 0x5, 0x9, 0xb, 0xd, 0x18, 0x28, 0x2a, 0x2f, 0x3a, 0x49, 0x56, 0x5e, 0x62, 0x67, 0x69, 0x7a, 0x82, 0x89, 0x8c, 0x93, 0x97, 0x9b, 0x9d, 0x9f, 0xa8, 0xac, 0xb3, 0xb8, 0xbb, 0xc5, 0xc7, 0xce, 0xd6, 0xd9, 0xdb, 0xdd, 0xdf, 0xe4, 0xf5, 0x101, 0x103, 0x109, 0x10b, 0x10d, 0x10f, 0x111, 0x113, 0x115, 0x118, 0x11b, 0x11d, 0x120, 0x123, 0x127, 0x12c, 0x135, 0x137, 0x13a, 0x13c, 0x147, 0x157, 0x15b, 0x169, 0x16c, 0x172, 0x178, 0x183, 0x187, 0x189, 0x18b, 0x18d, 0x18f, 0x191, 0x197, 0x19b, 0x19d, 0x19f, 0x1a7, 0x1ab, 0x1ae, 0x1b0, 0x1b2, 0x1b4, 0x1b7, 0x1b9, 0x1bb, 0x1bd, 0x1bf, 0x1c5, 0x1c8, 0x1ca, 0x1d1, 0x1d7, 0x1dd, 0x1e5, 0x1eb, 0x1f1, 0x1f7, 0x1fb, 0x209, 0x212, 0x215, 0x218, 0x21a, 0x21d, 0x21f, 0x223, 0x228, 0x22a, 0x22c, 0x231, 0x237, 0x239, 0x23b, 0x23d, 0x243, 0x246, 0x249, 0x251, 0x258, 0x25b, 0x25e, 0x260, 0x268, 0x26b, 0x272, 0x275, 0x27b, 0x27d, 0x280, 0x282, 0x284, 0x286, 0x288, 0x295, 0x29f, 0x2a1, 0x2a3, 0x2a9, 0x2ab, 0x2ae} + +// nfcSparseValues: 688 entries, 2752 bytes +var nfcSparseValues = [688]valueRange{ + // Block 0x0, offset 0x0 + {value: 0x0000, lo: 0x04}, + {value: 0xa100, lo: 0xa8, hi: 0xa8}, + {value: 0x8100, lo: 0xaf, hi: 0xaf}, + {value: 0x8100, lo: 0xb4, hi: 0xb4}, + {value: 0x8100, lo: 0xb8, hi: 0xb8}, + // Block 0x1, offset 0x5 + {value: 0x0091, lo: 0x03}, + {value: 0x46e2, lo: 0xa0, hi: 0xa1}, + {value: 0x4714, lo: 0xaf, hi: 0xb0}, + {value: 0xa000, lo: 0xb7, hi: 0xb7}, + // Block 0x2, offset 0x9 + {value: 0x0000, lo: 0x01}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + // Block 0x3, offset 0xb + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x98, hi: 0x9d}, + // Block 0x4, offset 0xd + {value: 0x0006, lo: 0x0a}, + {value: 0xa000, lo: 0x81, hi: 0x81}, + {value: 0xa000, lo: 0x85, hi: 0x85}, + {value: 0xa000, lo: 0x89, hi: 0x89}, + {value: 0x4840, lo: 0x8a, hi: 0x8a}, + {value: 0x485e, lo: 0x8b, hi: 0x8b}, + {value: 0x36c7, lo: 0x8c, hi: 0x8c}, + {value: 0x36df, lo: 0x8d, hi: 0x8d}, + {value: 0x4876, lo: 0x8e, hi: 0x8e}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x36fd, lo: 0x93, hi: 0x94}, + // Block 0x5, offset 0x18 + {value: 0x0000, lo: 0x0f}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0xa000, lo: 0x8d, hi: 0x8d}, + {value: 0x37a5, lo: 0x90, hi: 0x90}, + {value: 0x37b1, lo: 0x91, hi: 0x91}, + {value: 0x379f, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x96, hi: 0x96}, + {value: 0x3817, lo: 0x97, hi: 0x97}, + {value: 0x37e1, lo: 0x9c, hi: 0x9c}, + {value: 0x37c9, lo: 0x9d, hi: 0x9d}, + {value: 0x37f3, lo: 0x9e, hi: 0x9e}, + {value: 0xa000, lo: 0xb4, hi: 0xb5}, + {value: 0x381d, lo: 0xb6, hi: 0xb6}, + {value: 0x3823, lo: 0xb7, hi: 0xb7}, + // Block 0x6, offset 0x28 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x83, hi: 0x87}, + // Block 0x7, offset 0x2a + {value: 0x0001, lo: 0x04}, + {value: 0x8113, lo: 0x81, hi: 0x82}, + {value: 0x8132, lo: 0x84, hi: 0x84}, + {value: 0x812d, lo: 0x85, hi: 0x85}, + {value: 0x810d, lo: 0x87, hi: 0x87}, + // Block 0x8, offset 0x2f + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x97}, + {value: 0x8119, lo: 0x98, hi: 0x98}, + {value: 0x811a, lo: 0x99, hi: 0x99}, + {value: 0x811b, lo: 0x9a, hi: 0x9a}, + {value: 0x3841, lo: 0xa2, hi: 0xa2}, + {value: 0x3847, lo: 0xa3, hi: 0xa3}, + {value: 0x3853, lo: 0xa4, hi: 0xa4}, + {value: 0x384d, lo: 0xa5, hi: 0xa5}, + {value: 0x3859, lo: 0xa6, hi: 0xa6}, + {value: 0xa000, lo: 0xa7, hi: 0xa7}, + // Block 0x9, offset 0x3a + {value: 0x0000, lo: 0x0e}, + {value: 0x386b, lo: 0x80, hi: 0x80}, + {value: 0xa000, lo: 0x81, hi: 0x81}, + {value: 0x385f, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x3865, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x95, hi: 0x95}, + {value: 0x8132, lo: 0x96, hi: 0x9c}, + {value: 0x8132, lo: 0x9f, hi: 0xa2}, + {value: 0x812d, lo: 0xa3, hi: 0xa3}, + {value: 0x8132, lo: 0xa4, hi: 0xa4}, + {value: 0x8132, lo: 0xa7, hi: 0xa8}, + {value: 0x812d, lo: 0xaa, hi: 0xaa}, + {value: 0x8132, lo: 0xab, hi: 0xac}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + // Block 0xa, offset 0x49 + {value: 0x0000, lo: 0x0c}, + {value: 0x811f, lo: 0x91, hi: 0x91}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x812d, lo: 0xb1, hi: 0xb1}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb5, hi: 0xb6}, + {value: 0x812d, lo: 0xb7, hi: 0xb9}, + {value: 0x8132, lo: 0xba, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbc}, + {value: 0x8132, lo: 0xbd, hi: 0xbd}, + {value: 0x812d, lo: 0xbe, hi: 0xbe}, + {value: 0x8132, lo: 0xbf, hi: 0xbf}, + // Block 0xb, offset 0x56 + {value: 0x0005, lo: 0x07}, + {value: 0x8132, lo: 0x80, hi: 0x80}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x812d, lo: 0x82, hi: 0x83}, + {value: 0x812d, lo: 0x84, hi: 0x85}, + {value: 0x812d, lo: 0x86, hi: 0x87}, + {value: 0x812d, lo: 0x88, hi: 0x89}, + {value: 0x8132, lo: 0x8a, hi: 0x8a}, + // Block 0xc, offset 0x5e + {value: 0x0000, lo: 0x03}, + {value: 0x8132, lo: 0xab, hi: 0xb1}, + {value: 0x812d, lo: 0xb2, hi: 0xb2}, + {value: 0x8132, lo: 0xb3, hi: 0xb3}, + // Block 0xd, offset 0x62 + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0x96, hi: 0x99}, + {value: 0x8132, lo: 0x9b, hi: 0xa3}, + {value: 0x8132, lo: 0xa5, hi: 0xa7}, + {value: 0x8132, lo: 0xa9, hi: 0xad}, + // Block 0xe, offset 0x67 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x99, hi: 0x9b}, + // Block 0xf, offset 0x69 + {value: 0x0000, lo: 0x10}, + {value: 0x8132, lo: 0x94, hi: 0xa1}, + {value: 0x812d, lo: 0xa3, hi: 0xa3}, + {value: 0x8132, lo: 0xa4, hi: 0xa5}, + {value: 0x812d, lo: 0xa6, hi: 0xa6}, + {value: 0x8132, lo: 0xa7, hi: 0xa8}, + {value: 0x812d, lo: 0xa9, hi: 0xa9}, + {value: 0x8132, lo: 0xaa, hi: 0xac}, + {value: 0x812d, lo: 0xad, hi: 0xaf}, + {value: 0x8116, lo: 0xb0, hi: 0xb0}, + {value: 0x8117, lo: 0xb1, hi: 0xb1}, + {value: 0x8118, lo: 0xb2, hi: 0xb2}, + {value: 0x8132, lo: 0xb3, hi: 0xb5}, + {value: 0x812d, lo: 0xb6, hi: 0xb6}, + {value: 0x8132, lo: 0xb7, hi: 0xb8}, + {value: 0x812d, lo: 0xb9, hi: 0xba}, + {value: 0x8132, lo: 0xbb, hi: 0xbf}, + // Block 0x10, offset 0x7a + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0xa8, hi: 0xa8}, + {value: 0x3ed8, lo: 0xa9, hi: 0xa9}, + {value: 0xa000, lo: 0xb0, hi: 0xb0}, + {value: 0x3ee0, lo: 0xb1, hi: 0xb1}, + {value: 0xa000, lo: 0xb3, hi: 0xb3}, + {value: 0x3ee8, lo: 0xb4, hi: 0xb4}, + {value: 0x9902, lo: 0xbc, hi: 0xbc}, + // Block 0x11, offset 0x82 + {value: 0x0008, lo: 0x06}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x91, hi: 0x91}, + {value: 0x812d, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x93, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x94}, + {value: 0x451c, lo: 0x98, hi: 0x9f}, + // Block 0x12, offset 0x89 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x13, offset 0x8c + {value: 0x0008, lo: 0x06}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2c9e, lo: 0x8b, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x455c, lo: 0x9c, hi: 0x9d}, + {value: 0x456c, lo: 0x9f, hi: 0x9f}, + // Block 0x14, offset 0x93 + {value: 0x0000, lo: 0x03}, + {value: 0x4594, lo: 0xb3, hi: 0xb3}, + {value: 0x459c, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x15, offset 0x97 + {value: 0x0008, lo: 0x03}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x4574, lo: 0x99, hi: 0x9b}, + {value: 0x458c, lo: 0x9e, hi: 0x9e}, + // Block 0x16, offset 0x9b + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x17, offset 0x9d + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + // Block 0x18, offset 0x9f + {value: 0x0000, lo: 0x08}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2cb6, lo: 0x88, hi: 0x88}, + {value: 0x2cae, lo: 0x8b, hi: 0x8b}, + {value: 0x2cbe, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x96, hi: 0x97}, + {value: 0x45a4, lo: 0x9c, hi: 0x9c}, + {value: 0x45ac, lo: 0x9d, hi: 0x9d}, + // Block 0x19, offset 0xa8 + {value: 0x0000, lo: 0x03}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x2cc6, lo: 0x94, hi: 0x94}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x1a, offset 0xac + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cce, lo: 0x8a, hi: 0x8a}, + {value: 0x2cde, lo: 0x8b, hi: 0x8b}, + {value: 0x2cd6, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x1b, offset 0xb3 + {value: 0x1801, lo: 0x04}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x3ef0, lo: 0x88, hi: 0x88}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8120, lo: 0x95, hi: 0x96}, + // Block 0x1c, offset 0xb8 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0xa000, lo: 0xbf, hi: 0xbf}, + // Block 0x1d, offset 0xbb + {value: 0x0000, lo: 0x09}, + {value: 0x2ce6, lo: 0x80, hi: 0x80}, + {value: 0x9900, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x2cee, lo: 0x87, hi: 0x87}, + {value: 0x2cf6, lo: 0x88, hi: 0x88}, + {value: 0x2f50, lo: 0x8a, hi: 0x8a}, + {value: 0x2dd8, lo: 0x8b, hi: 0x8b}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x95, hi: 0x96}, + // Block 0x1e, offset 0xc5 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x1f, offset 0xc7 + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cfe, lo: 0x8a, hi: 0x8a}, + {value: 0x2d0e, lo: 0x8b, hi: 0x8b}, + {value: 0x2d06, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x20, offset 0xce + {value: 0x6bea, lo: 0x07}, + {value: 0x9904, lo: 0x8a, hi: 0x8a}, + {value: 0x9900, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x3ef8, lo: 0x9a, hi: 0x9a}, + {value: 0x2f58, lo: 0x9c, hi: 0x9c}, + {value: 0x2de3, lo: 0x9d, hi: 0x9d}, + {value: 0x2d16, lo: 0x9e, hi: 0x9f}, + // Block 0x21, offset 0xd6 + {value: 0x0000, lo: 0x02}, + {value: 0x8122, lo: 0xb8, hi: 0xb9}, + {value: 0x8104, lo: 0xba, hi: 0xba}, + // Block 0x22, offset 0xd9 + {value: 0x0000, lo: 0x01}, + {value: 0x8123, lo: 0x88, hi: 0x8b}, + // Block 0x23, offset 0xdb + {value: 0x0000, lo: 0x01}, + {value: 0x8124, lo: 0xb8, hi: 0xb9}, + // Block 0x24, offset 0xdd + {value: 0x0000, lo: 0x01}, + {value: 0x8125, lo: 0x88, hi: 0x8b}, + // Block 0x25, offset 0xdf + {value: 0x0000, lo: 0x04}, + {value: 0x812d, lo: 0x98, hi: 0x99}, + {value: 0x812d, lo: 0xb5, hi: 0xb5}, + {value: 0x812d, lo: 0xb7, hi: 0xb7}, + {value: 0x812b, lo: 0xb9, hi: 0xb9}, + // Block 0x26, offset 0xe4 + {value: 0x0000, lo: 0x10}, + {value: 0x2644, lo: 0x83, hi: 0x83}, + {value: 0x264b, lo: 0x8d, hi: 0x8d}, + {value: 0x2652, lo: 0x92, hi: 0x92}, + {value: 0x2659, lo: 0x97, hi: 0x97}, + {value: 0x2660, lo: 0x9c, hi: 0x9c}, + {value: 0x263d, lo: 0xa9, hi: 0xa9}, + {value: 0x8126, lo: 0xb1, hi: 0xb1}, + {value: 0x8127, lo: 0xb2, hi: 0xb2}, + {value: 0x4a84, lo: 0xb3, hi: 0xb3}, + {value: 0x8128, lo: 0xb4, hi: 0xb4}, + {value: 0x4a8d, lo: 0xb5, hi: 0xb5}, + {value: 0x45b4, lo: 0xb6, hi: 0xb6}, + {value: 0x8200, lo: 0xb7, hi: 0xb7}, + {value: 0x45bc, lo: 0xb8, hi: 0xb8}, + {value: 0x8200, lo: 0xb9, hi: 0xb9}, + {value: 0x8127, lo: 0xba, hi: 0xbd}, + // Block 0x27, offset 0xf5 + {value: 0x0000, lo: 0x0b}, + {value: 0x8127, lo: 0x80, hi: 0x80}, + {value: 0x4a96, lo: 0x81, hi: 0x81}, + {value: 0x8132, lo: 0x82, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0x86, hi: 0x87}, + {value: 0x266e, lo: 0x93, hi: 0x93}, + {value: 0x2675, lo: 0x9d, hi: 0x9d}, + {value: 0x267c, lo: 0xa2, hi: 0xa2}, + {value: 0x2683, lo: 0xa7, hi: 0xa7}, + {value: 0x268a, lo: 0xac, hi: 0xac}, + {value: 0x2667, lo: 0xb9, hi: 0xb9}, + // Block 0x28, offset 0x101 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x86, hi: 0x86}, + // Block 0x29, offset 0x103 + {value: 0x0000, lo: 0x05}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x2d1e, lo: 0xa6, hi: 0xa6}, + {value: 0x9900, lo: 0xae, hi: 0xae}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x2a, offset 0x109 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + // Block 0x2b, offset 0x10b + {value: 0x0000, lo: 0x01}, + {value: 0xa000, lo: 0x80, hi: 0x92}, + // Block 0x2c, offset 0x10d + {value: 0x0000, lo: 0x01}, + {value: 0xb900, lo: 0xa1, hi: 0xb5}, + // Block 0x2d, offset 0x10f + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0xa8, hi: 0xbf}, + // Block 0x2e, offset 0x111 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0x80, hi: 0x82}, + // Block 0x2f, offset 0x113 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x9d, hi: 0x9f}, + // Block 0x30, offset 0x115 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x94, hi: 0x94}, + {value: 0x8104, lo: 0xb4, hi: 0xb4}, + // Block 0x31, offset 0x118 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x9d, hi: 0x9d}, + // Block 0x32, offset 0x11b + {value: 0x0000, lo: 0x01}, + {value: 0x8131, lo: 0xa9, hi: 0xa9}, + // Block 0x33, offset 0x11d + {value: 0x0004, lo: 0x02}, + {value: 0x812e, lo: 0xb9, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbb}, + // Block 0x34, offset 0x120 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x97, hi: 0x97}, + {value: 0x812d, lo: 0x98, hi: 0x98}, + // Block 0x35, offset 0x123 + {value: 0x0000, lo: 0x03}, + {value: 0x8104, lo: 0xa0, hi: 0xa0}, + {value: 0x8132, lo: 0xb5, hi: 0xbc}, + {value: 0x812d, lo: 0xbf, hi: 0xbf}, + // Block 0x36, offset 0x127 + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + {value: 0x812d, lo: 0xb5, hi: 0xba}, + {value: 0x8132, lo: 0xbb, hi: 0xbc}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x37, offset 0x12c + {value: 0x0000, lo: 0x08}, + {value: 0x2d66, lo: 0x80, hi: 0x80}, + {value: 0x2d6e, lo: 0x81, hi: 0x81}, + {value: 0xa000, lo: 0x82, hi: 0x82}, + {value: 0x2d76, lo: 0x83, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xab, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xac}, + {value: 0x8132, lo: 0xad, hi: 0xb3}, + // Block 0x38, offset 0x135 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xaa, hi: 0xab}, + // Block 0x39, offset 0x137 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xa6, hi: 0xa6}, + {value: 0x8104, lo: 0xb2, hi: 0xb3}, + // Block 0x3a, offset 0x13a + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x3b, offset 0x13c + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x92}, + {value: 0x8101, lo: 0x94, hi: 0x94}, + {value: 0x812d, lo: 0x95, hi: 0x99}, + {value: 0x8132, lo: 0x9a, hi: 0x9b}, + {value: 0x812d, lo: 0x9c, hi: 0x9f}, + {value: 0x8132, lo: 0xa0, hi: 0xa0}, + {value: 0x8101, lo: 0xa2, hi: 0xa8}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + {value: 0x8132, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb8, hi: 0xb9}, + // Block 0x3c, offset 0x147 + {value: 0x0000, lo: 0x0f}, + {value: 0x8132, lo: 0x80, hi: 0x81}, + {value: 0x812d, lo: 0x82, hi: 0x82}, + {value: 0x8132, lo: 0x83, hi: 0x89}, + {value: 0x812d, lo: 0x8a, hi: 0x8a}, + {value: 0x8132, lo: 0x8b, hi: 0x8c}, + {value: 0x8135, lo: 0x8d, hi: 0x8d}, + {value: 0x812a, lo: 0x8e, hi: 0x8e}, + {value: 0x812d, lo: 0x8f, hi: 0x8f}, + {value: 0x8129, lo: 0x90, hi: 0x90}, + {value: 0x8132, lo: 0x91, hi: 0xb5}, + {value: 0x8132, lo: 0xbb, hi: 0xbb}, + {value: 0x8134, lo: 0xbc, hi: 0xbc}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + {value: 0x8132, lo: 0xbe, hi: 0xbe}, + {value: 0x812d, lo: 0xbf, hi: 0xbf}, + // Block 0x3d, offset 0x157 + {value: 0x0004, lo: 0x03}, + {value: 0x0433, lo: 0x80, hi: 0x81}, + {value: 0x8100, lo: 0x97, hi: 0x97}, + {value: 0x8100, lo: 0xbe, hi: 0xbe}, + // Block 0x3e, offset 0x15b + {value: 0x0000, lo: 0x0d}, + {value: 0x8132, lo: 0x90, hi: 0x91}, + {value: 0x8101, lo: 0x92, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x97}, + {value: 0x8101, lo: 0x98, hi: 0x9a}, + {value: 0x8132, lo: 0x9b, hi: 0x9c}, + {value: 0x8132, lo: 0xa1, hi: 0xa1}, + {value: 0x8101, lo: 0xa5, hi: 0xa6}, + {value: 0x8132, lo: 0xa7, hi: 0xa7}, + {value: 0x812d, lo: 0xa8, hi: 0xa8}, + {value: 0x8132, lo: 0xa9, hi: 0xa9}, + {value: 0x8101, lo: 0xaa, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xaf}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + // Block 0x3f, offset 0x169 + {value: 0x427b, lo: 0x02}, + {value: 0x01b8, lo: 0xa6, hi: 0xa6}, + {value: 0x0057, lo: 0xaa, hi: 0xab}, + // Block 0x40, offset 0x16c + {value: 0x0007, lo: 0x05}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + {value: 0x3bb9, lo: 0x9a, hi: 0x9b}, + {value: 0x3bc7, lo: 0xae, hi: 0xae}, + // Block 0x41, offset 0x172 + {value: 0x000e, lo: 0x05}, + {value: 0x3bce, lo: 0x8d, hi: 0x8e}, + {value: 0x3bd5, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + // Block 0x42, offset 0x178 + {value: 0x6408, lo: 0x0a}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0x3be3, lo: 0x84, hi: 0x84}, + {value: 0xa000, lo: 0x88, hi: 0x88}, + {value: 0x3bea, lo: 0x89, hi: 0x89}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0x3bf1, lo: 0x8c, hi: 0x8c}, + {value: 0xa000, lo: 0xa3, hi: 0xa3}, + {value: 0x3bf8, lo: 0xa4, hi: 0xa5}, + {value: 0x3bff, lo: 0xa6, hi: 0xa6}, + {value: 0xa000, lo: 0xbc, hi: 0xbc}, + // Block 0x43, offset 0x183 + {value: 0x0007, lo: 0x03}, + {value: 0x3c68, lo: 0xa0, hi: 0xa1}, + {value: 0x3c92, lo: 0xa2, hi: 0xa3}, + {value: 0x3cbc, lo: 0xaa, hi: 0xad}, + // Block 0x44, offset 0x187 + {value: 0x0004, lo: 0x01}, + {value: 0x048b, lo: 0xa9, hi: 0xaa}, + // Block 0x45, offset 0x189 + {value: 0x0000, lo: 0x01}, + {value: 0x44dd, lo: 0x9c, hi: 0x9c}, + // Block 0x46, offset 0x18b + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xaf, hi: 0xb1}, + // Block 0x47, offset 0x18d + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x48, offset 0x18f + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xa0, hi: 0xbf}, + // Block 0x49, offset 0x191 + {value: 0x0000, lo: 0x05}, + {value: 0x812c, lo: 0xaa, hi: 0xaa}, + {value: 0x8131, lo: 0xab, hi: 0xab}, + {value: 0x8133, lo: 0xac, hi: 0xac}, + {value: 0x812e, lo: 0xad, hi: 0xad}, + {value: 0x812f, lo: 0xae, hi: 0xaf}, + // Block 0x4a, offset 0x197 + {value: 0x0000, lo: 0x03}, + {value: 0x4a9f, lo: 0xb3, hi: 0xb3}, + {value: 0x4a9f, lo: 0xb5, hi: 0xb6}, + {value: 0x4a9f, lo: 0xba, hi: 0xbf}, + // Block 0x4b, offset 0x19b + {value: 0x0000, lo: 0x01}, + {value: 0x4a9f, lo: 0x8f, hi: 0xa3}, + // Block 0x4c, offset 0x19d + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0xae, hi: 0xbe}, + // Block 0x4d, offset 0x19f + {value: 0x0000, lo: 0x07}, + {value: 0x8100, lo: 0x84, hi: 0x84}, + {value: 0x8100, lo: 0x87, hi: 0x87}, + {value: 0x8100, lo: 0x90, hi: 0x90}, + {value: 0x8100, lo: 0x9e, hi: 0x9e}, + {value: 0x8100, lo: 0xa1, hi: 0xa1}, + {value: 0x8100, lo: 0xb2, hi: 0xb2}, + {value: 0x8100, lo: 0xbb, hi: 0xbb}, + // Block 0x4e, offset 0x1a7 + {value: 0x0000, lo: 0x03}, + {value: 0x8100, lo: 0x80, hi: 0x80}, + {value: 0x8100, lo: 0x8b, hi: 0x8b}, + {value: 0x8100, lo: 0x8e, hi: 0x8e}, + // Block 0x4f, offset 0x1ab + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xaf, hi: 0xaf}, + {value: 0x8132, lo: 0xb4, hi: 0xbd}, + // Block 0x50, offset 0x1ae + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x9e, hi: 0x9f}, + // Block 0x51, offset 0x1b0 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb1}, + // Block 0x52, offset 0x1b2 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + // Block 0x53, offset 0x1b4 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xa0, hi: 0xb1}, + // Block 0x54, offset 0x1b7 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xab, hi: 0xad}, + // Block 0x55, offset 0x1b9 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x93, hi: 0x93}, + // Block 0x56, offset 0x1bb + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb3, hi: 0xb3}, + // Block 0x57, offset 0x1bd + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + // Block 0x58, offset 0x1bf + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb7, hi: 0xb8}, + {value: 0x8132, lo: 0xbe, hi: 0xbf}, + // Block 0x59, offset 0x1c5 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + // Block 0x5a, offset 0x1c8 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xad, hi: 0xad}, + // Block 0x5b, offset 0x1ca + {value: 0x0000, lo: 0x06}, + {value: 0xe500, lo: 0x80, hi: 0x80}, + {value: 0xc600, lo: 0x81, hi: 0x9b}, + {value: 0xe500, lo: 0x9c, hi: 0x9c}, + {value: 0xc600, lo: 0x9d, hi: 0xb7}, + {value: 0xe500, lo: 0xb8, hi: 0xb8}, + {value: 0xc600, lo: 0xb9, hi: 0xbf}, + // Block 0x5c, offset 0x1d1 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x93}, + {value: 0xe500, lo: 0x94, hi: 0x94}, + {value: 0xc600, lo: 0x95, hi: 0xaf}, + {value: 0xe500, lo: 0xb0, hi: 0xb0}, + {value: 0xc600, lo: 0xb1, hi: 0xbf}, + // Block 0x5d, offset 0x1d7 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8b}, + {value: 0xe500, lo: 0x8c, hi: 0x8c}, + {value: 0xc600, lo: 0x8d, hi: 0xa7}, + {value: 0xe500, lo: 0xa8, hi: 0xa8}, + {value: 0xc600, lo: 0xa9, hi: 0xbf}, + // Block 0x5e, offset 0x1dd + {value: 0x0000, lo: 0x07}, + {value: 0xc600, lo: 0x80, hi: 0x83}, + {value: 0xe500, lo: 0x84, hi: 0x84}, + {value: 0xc600, lo: 0x85, hi: 0x9f}, + {value: 0xe500, lo: 0xa0, hi: 0xa0}, + {value: 0xc600, lo: 0xa1, hi: 0xbb}, + {value: 0xe500, lo: 0xbc, hi: 0xbc}, + {value: 0xc600, lo: 0xbd, hi: 0xbf}, + // Block 0x5f, offset 0x1e5 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x97}, + {value: 0xe500, lo: 0x98, hi: 0x98}, + {value: 0xc600, lo: 0x99, hi: 0xb3}, + {value: 0xe500, lo: 0xb4, hi: 0xb4}, + {value: 0xc600, lo: 0xb5, hi: 0xbf}, + // Block 0x60, offset 0x1eb + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8f}, + {value: 0xe500, lo: 0x90, hi: 0x90}, + {value: 0xc600, lo: 0x91, hi: 0xab}, + {value: 0xe500, lo: 0xac, hi: 0xac}, + {value: 0xc600, lo: 0xad, hi: 0xbf}, + // Block 0x61, offset 0x1f1 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + {value: 0xe500, lo: 0xa4, hi: 0xa4}, + {value: 0xc600, lo: 0xa5, hi: 0xbf}, + // Block 0x62, offset 0x1f7 + {value: 0x0000, lo: 0x03}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + // Block 0x63, offset 0x1fb + {value: 0x0006, lo: 0x0d}, + {value: 0x4390, lo: 0x9d, hi: 0x9d}, + {value: 0x8115, lo: 0x9e, hi: 0x9e}, + {value: 0x4402, lo: 0x9f, hi: 0x9f}, + {value: 0x43f0, lo: 0xaa, hi: 0xab}, + {value: 0x44f4, lo: 0xac, hi: 0xac}, + {value: 0x44fc, lo: 0xad, hi: 0xad}, + {value: 0x4348, lo: 0xae, hi: 0xb1}, + {value: 0x4366, lo: 0xb2, hi: 0xb4}, + {value: 0x437e, lo: 0xb5, hi: 0xb6}, + {value: 0x438a, lo: 0xb8, hi: 0xb8}, + {value: 0x4396, lo: 0xb9, hi: 0xbb}, + {value: 0x43ae, lo: 0xbc, hi: 0xbc}, + {value: 0x43b4, lo: 0xbe, hi: 0xbe}, + // Block 0x64, offset 0x209 + {value: 0x0006, lo: 0x08}, + {value: 0x43ba, lo: 0x80, hi: 0x81}, + {value: 0x43c6, lo: 0x83, hi: 0x84}, + {value: 0x43d8, lo: 0x86, hi: 0x89}, + {value: 0x43fc, lo: 0x8a, hi: 0x8a}, + {value: 0x4378, lo: 0x8b, hi: 0x8b}, + {value: 0x4360, lo: 0x8c, hi: 0x8c}, + {value: 0x43a8, lo: 0x8d, hi: 0x8d}, + {value: 0x43d2, lo: 0x8e, hi: 0x8e}, + // Block 0x65, offset 0x212 + {value: 0x0000, lo: 0x02}, + {value: 0x8100, lo: 0xa4, hi: 0xa5}, + {value: 0x8100, lo: 0xb0, hi: 0xb1}, + // Block 0x66, offset 0x215 + {value: 0x0000, lo: 0x02}, + {value: 0x8100, lo: 0x9b, hi: 0x9d}, + {value: 0x8200, lo: 0x9e, hi: 0xa3}, + // Block 0x67, offset 0x218 + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x90, hi: 0x90}, + // Block 0x68, offset 0x21a + {value: 0x0000, lo: 0x02}, + {value: 0x8100, lo: 0x99, hi: 0x99}, + {value: 0x8200, lo: 0xb2, hi: 0xb4}, + // Block 0x69, offset 0x21d + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0xbc, hi: 0xbd}, + // Block 0x6a, offset 0x21f + {value: 0x0000, lo: 0x03}, + {value: 0x8132, lo: 0xa0, hi: 0xa6}, + {value: 0x812d, lo: 0xa7, hi: 0xad}, + {value: 0x8132, lo: 0xae, hi: 0xaf}, + // Block 0x6b, offset 0x223 + {value: 0x0000, lo: 0x04}, + {value: 0x8100, lo: 0x89, hi: 0x8c}, + {value: 0x8100, lo: 0xb0, hi: 0xb2}, + {value: 0x8100, lo: 0xb4, hi: 0xb4}, + {value: 0x8100, lo: 0xb6, hi: 0xbf}, + // Block 0x6c, offset 0x228 + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x81, hi: 0x8c}, + // Block 0x6d, offset 0x22a + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0xb5, hi: 0xba}, + // Block 0x6e, offset 0x22c + {value: 0x0000, lo: 0x04}, + {value: 0x4a9f, lo: 0x9e, hi: 0x9f}, + {value: 0x4a9f, lo: 0xa3, hi: 0xa3}, + {value: 0x4a9f, lo: 0xa5, hi: 0xa6}, + {value: 0x4a9f, lo: 0xaa, hi: 0xaf}, + // Block 0x6f, offset 0x231 + {value: 0x0000, lo: 0x05}, + {value: 0x4a9f, lo: 0x82, hi: 0x87}, + {value: 0x4a9f, lo: 0x8a, hi: 0x8f}, + {value: 0x4a9f, lo: 0x92, hi: 0x97}, + {value: 0x4a9f, lo: 0x9a, hi: 0x9c}, + {value: 0x8100, lo: 0xa3, hi: 0xa3}, + // Block 0x70, offset 0x237 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x71, offset 0x239 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xa0, hi: 0xa0}, + // Block 0x72, offset 0x23b + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb6, hi: 0xba}, + // Block 0x73, offset 0x23d + {value: 0x002c, lo: 0x05}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x8f, hi: 0x8f}, + {value: 0x8132, lo: 0xb8, hi: 0xb8}, + {value: 0x8101, lo: 0xb9, hi: 0xba}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x74, offset 0x243 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xa5, hi: 0xa5}, + {value: 0x812d, lo: 0xa6, hi: 0xa6}, + // Block 0x75, offset 0x246 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x76, offset 0x249 + {value: 0x17fe, lo: 0x07}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x4238, lo: 0x9a, hi: 0x9a}, + {value: 0xa000, lo: 0x9b, hi: 0x9b}, + {value: 0x4242, lo: 0x9c, hi: 0x9c}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x424c, lo: 0xab, hi: 0xab}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x77, offset 0x251 + {value: 0x0000, lo: 0x06}, + {value: 0x8132, lo: 0x80, hi: 0x82}, + {value: 0x9900, lo: 0xa7, hi: 0xa7}, + {value: 0x2d7e, lo: 0xae, hi: 0xae}, + {value: 0x2d88, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb1, hi: 0xb2}, + {value: 0x8104, lo: 0xb3, hi: 0xb4}, + // Block 0x78, offset 0x258 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x79, offset 0x25b + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb5, hi: 0xb5}, + {value: 0x8102, lo: 0xb6, hi: 0xb6}, + // Block 0x7a, offset 0x25e + {value: 0x0002, lo: 0x01}, + {value: 0x8102, lo: 0xa9, hi: 0xaa}, + // Block 0x7b, offset 0x260 + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2d92, lo: 0x8b, hi: 0x8b}, + {value: 0x2d9c, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x8132, lo: 0xa6, hi: 0xac}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + // Block 0x7c, offset 0x268 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x86, hi: 0x86}, + // Block 0x7d, offset 0x26b + {value: 0x6b5a, lo: 0x06}, + {value: 0x9900, lo: 0xb0, hi: 0xb0}, + {value: 0xa000, lo: 0xb9, hi: 0xb9}, + {value: 0x9900, lo: 0xba, hi: 0xba}, + {value: 0x2db0, lo: 0xbb, hi: 0xbb}, + {value: 0x2da6, lo: 0xbc, hi: 0xbd}, + {value: 0x2dba, lo: 0xbe, hi: 0xbe}, + // Block 0x7e, offset 0x272 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x83, hi: 0x83}, + // Block 0x7f, offset 0x275 + {value: 0x0000, lo: 0x05}, + {value: 0x9900, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb8, hi: 0xb9}, + {value: 0x2dc4, lo: 0xba, hi: 0xba}, + {value: 0x2dce, lo: 0xbb, hi: 0xbb}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x80, offset 0x27b + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0x80, hi: 0x80}, + // Block 0x81, offset 0x27d + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x82, offset 0x280 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xab, hi: 0xab}, + // Block 0x83, offset 0x282 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0xb0, hi: 0xb4}, + // Block 0x84, offset 0x284 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb6}, + // Block 0x85, offset 0x286 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0x9e, hi: 0x9e}, + // Block 0x86, offset 0x288 + {value: 0x0000, lo: 0x0c}, + {value: 0x45cc, lo: 0x9e, hi: 0x9e}, + {value: 0x45d6, lo: 0x9f, hi: 0x9f}, + {value: 0x460a, lo: 0xa0, hi: 0xa0}, + {value: 0x4618, lo: 0xa1, hi: 0xa1}, + {value: 0x4626, lo: 0xa2, hi: 0xa2}, + {value: 0x4634, lo: 0xa3, hi: 0xa3}, + {value: 0x4642, lo: 0xa4, hi: 0xa4}, + {value: 0x812b, lo: 0xa5, hi: 0xa6}, + {value: 0x8101, lo: 0xa7, hi: 0xa9}, + {value: 0x8130, lo: 0xad, hi: 0xad}, + {value: 0x812b, lo: 0xae, hi: 0xb2}, + {value: 0x812d, lo: 0xbb, hi: 0xbf}, + // Block 0x87, offset 0x295 + {value: 0x0000, lo: 0x09}, + {value: 0x812d, lo: 0x80, hi: 0x82}, + {value: 0x8132, lo: 0x85, hi: 0x89}, + {value: 0x812d, lo: 0x8a, hi: 0x8b}, + {value: 0x8132, lo: 0xaa, hi: 0xad}, + {value: 0x45e0, lo: 0xbb, hi: 0xbb}, + {value: 0x45ea, lo: 0xbc, hi: 0xbc}, + {value: 0x4650, lo: 0xbd, hi: 0xbd}, + {value: 0x466c, lo: 0xbe, hi: 0xbe}, + {value: 0x465e, lo: 0xbf, hi: 0xbf}, + // Block 0x88, offset 0x29f + {value: 0x0000, lo: 0x01}, + {value: 0x467a, lo: 0x80, hi: 0x80}, + // Block 0x89, offset 0x2a1 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x82, hi: 0x84}, + // Block 0x8a, offset 0x2a3 + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0x80, hi: 0x86}, + {value: 0x8132, lo: 0x88, hi: 0x98}, + {value: 0x8132, lo: 0x9b, hi: 0xa1}, + {value: 0x8132, lo: 0xa3, hi: 0xa4}, + {value: 0x8132, lo: 0xa6, hi: 0xaa}, + // Block 0x8b, offset 0x2a9 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x90, hi: 0x96}, + // Block 0x8c, offset 0x2ab + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x84, hi: 0x89}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x8d, offset 0x2ae + {value: 0x0000, lo: 0x01}, + {value: 0x8100, lo: 0x93, hi: 0x93}, +} + +// lookup returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfkcTrie) lookup(s []byte) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfkcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfkcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfkcTrie) lookupUnsafe(s []byte) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfkcValues[c0] + } + i := nfkcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// lookupString returns the trie value for the first UTF-8 encoding in s and +// the width in bytes of this encoding. The size will be 0 if s does not +// hold enough bytes to complete the encoding. len(s) must be greater than 0. +func (t *nfkcTrie) lookupString(s string) (v uint16, sz int) { + c0 := s[0] + switch { + case c0 < 0x80: // is ASCII + return nfkcValues[c0], 1 + case c0 < 0xC2: + return 0, 1 // Illegal UTF-8: not a starter, not ASCII. + case c0 < 0xE0: // 2-byte UTF-8 + if len(s) < 2 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c1), 2 + case c0 < 0xF0: // 3-byte UTF-8 + if len(s) < 3 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c2), 3 + case c0 < 0xF8: // 4-byte UTF-8 + if len(s) < 4 { + return 0, 0 + } + i := nfkcIndex[c0] + c1 := s[1] + if c1 < 0x80 || 0xC0 <= c1 { + return 0, 1 // Illegal UTF-8: not a continuation byte. + } + o := uint32(i)<<6 + uint32(c1) + i = nfkcIndex[o] + c2 := s[2] + if c2 < 0x80 || 0xC0 <= c2 { + return 0, 2 // Illegal UTF-8: not a continuation byte. + } + o = uint32(i)<<6 + uint32(c2) + i = nfkcIndex[o] + c3 := s[3] + if c3 < 0x80 || 0xC0 <= c3 { + return 0, 3 // Illegal UTF-8: not a continuation byte. + } + return t.lookupValue(uint32(i), c3), 4 + } + // Illegal rune + return 0, 1 +} + +// lookupStringUnsafe returns the trie value for the first UTF-8 encoding in s. +// s must start with a full and valid UTF-8 encoded rune. +func (t *nfkcTrie) lookupStringUnsafe(s string) uint16 { + c0 := s[0] + if c0 < 0x80 { // is ASCII + return nfkcValues[c0] + } + i := nfkcIndex[c0] + if c0 < 0xE0 { // 2-byte UTF-8 + return t.lookupValue(uint32(i), s[1]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[1])] + if c0 < 0xF0 { // 3-byte UTF-8 + return t.lookupValue(uint32(i), s[2]) + } + i = nfkcIndex[uint32(i)<<6+uint32(s[2])] + if c0 < 0xF8 { // 4-byte UTF-8 + return t.lookupValue(uint32(i), s[3]) + } + return 0 +} + +// nfkcTrie. Total size: 16994 bytes (16.60 KiB). Checksum: c3ed54ee046f3c46. +type nfkcTrie struct{} + +func newNfkcTrie(i int) *nfkcTrie { + return &nfkcTrie{} +} + +// lookupValue determines the type of block n and looks up the value for b. +func (t *nfkcTrie) lookupValue(n uint32, b byte) uint16 { + switch { + case n < 90: + return uint16(nfkcValues[n<<6+uint32(b)]) + default: + n -= 90 + return uint16(nfkcSparse.lookup(n, b)) + } +} + +// nfkcValues: 92 blocks, 5888 entries, 11776 bytes +// The third block is the zero block. +var nfkcValues = [5888]uint16{ + // Block 0x0, offset 0x0 + 0x3c: 0xa000, 0x3d: 0xa000, 0x3e: 0xa000, + // Block 0x1, offset 0x40 + 0x41: 0xa000, 0x42: 0xa000, 0x43: 0xa000, 0x44: 0xa000, 0x45: 0xa000, + 0x46: 0xa000, 0x47: 0xa000, 0x48: 0xa000, 0x49: 0xa000, 0x4a: 0xa000, 0x4b: 0xa000, + 0x4c: 0xa000, 0x4d: 0xa000, 0x4e: 0xa000, 0x4f: 0xa000, 0x50: 0xa000, + 0x52: 0xa000, 0x53: 0xa000, 0x54: 0xa000, 0x55: 0xa000, 0x56: 0xa000, 0x57: 0xa000, + 0x58: 0xa000, 0x59: 0xa000, 0x5a: 0xa000, + 0x61: 0xa000, 0x62: 0xa000, 0x63: 0xa000, + 0x64: 0xa000, 0x65: 0xa000, 0x66: 0xa000, 0x67: 0xa000, 0x68: 0xa000, 0x69: 0xa000, + 0x6a: 0xa000, 0x6b: 0xa000, 0x6c: 0xa000, 0x6d: 0xa000, 0x6e: 0xa000, 0x6f: 0xa000, + 0x70: 0xa000, 0x72: 0xa000, 0x73: 0xa000, 0x74: 0xa000, 0x75: 0xa000, + 0x76: 0xa000, 0x77: 0xa000, 0x78: 0xa000, 0x79: 0xa000, 0x7a: 0xa000, + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc0: 0x2f6f, 0xc1: 0x2f74, 0xc2: 0x4688, 0xc3: 0x2f79, 0xc4: 0x4697, 0xc5: 0x469c, + 0xc6: 0xa000, 0xc7: 0x46a6, 0xc8: 0x2fe2, 0xc9: 0x2fe7, 0xca: 0x46ab, 0xcb: 0x2ffb, + 0xcc: 0x306e, 0xcd: 0x3073, 0xce: 0x3078, 0xcf: 0x46bf, 0xd1: 0x3104, + 0xd2: 0x3127, 0xd3: 0x312c, 0xd4: 0x46c9, 0xd5: 0x46ce, 0xd6: 0x46dd, + 0xd8: 0xa000, 0xd9: 0x31b3, 0xda: 0x31b8, 0xdb: 0x31bd, 0xdc: 0x470f, 0xdd: 0x3235, + 0xe0: 0x327b, 0xe1: 0x3280, 0xe2: 0x4719, 0xe3: 0x3285, + 0xe4: 0x4728, 0xe5: 0x472d, 0xe6: 0xa000, 0xe7: 0x4737, 0xe8: 0x32ee, 0xe9: 0x32f3, + 0xea: 0x473c, 0xeb: 0x3307, 0xec: 0x337f, 0xed: 0x3384, 0xee: 0x3389, 0xef: 0x4750, + 0xf1: 0x3415, 0xf2: 0x3438, 0xf3: 0x343d, 0xf4: 0x475a, 0xf5: 0x475f, + 0xf6: 0x476e, 0xf8: 0xa000, 0xf9: 0x34c9, 0xfa: 0x34ce, 0xfb: 0x34d3, + 0xfc: 0x47a0, 0xfd: 0x3550, 0xff: 0x3569, + // Block 0x4, offset 0x100 + 0x100: 0x2f7e, 0x101: 0x328a, 0x102: 0x468d, 0x103: 0x471e, 0x104: 0x2f9c, 0x105: 0x32a8, + 0x106: 0x2fb0, 0x107: 0x32bc, 0x108: 0x2fb5, 0x109: 0x32c1, 0x10a: 0x2fba, 0x10b: 0x32c6, + 0x10c: 0x2fbf, 0x10d: 0x32cb, 0x10e: 0x2fc9, 0x10f: 0x32d5, + 0x112: 0x46b0, 0x113: 0x4741, 0x114: 0x2ff1, 0x115: 0x32fd, 0x116: 0x2ff6, 0x117: 0x3302, + 0x118: 0x3014, 0x119: 0x3320, 0x11a: 0x3005, 0x11b: 0x3311, 0x11c: 0x302d, 0x11d: 0x3339, + 0x11e: 0x3037, 0x11f: 0x3343, 0x120: 0x303c, 0x121: 0x3348, 0x122: 0x3046, 0x123: 0x3352, + 0x124: 0x304b, 0x125: 0x3357, 0x128: 0x307d, 0x129: 0x338e, + 0x12a: 0x3082, 0x12b: 0x3393, 0x12c: 0x3087, 0x12d: 0x3398, 0x12e: 0x30aa, 0x12f: 0x33b6, + 0x130: 0x308c, 0x132: 0x195d, 0x133: 0x19e7, 0x134: 0x30b4, 0x135: 0x33c0, + 0x136: 0x30c8, 0x137: 0x33d9, 0x139: 0x30d2, 0x13a: 0x33e3, 0x13b: 0x30dc, + 0x13c: 0x33ed, 0x13d: 0x30d7, 0x13e: 0x33e8, 0x13f: 0x1bac, + // Block 0x5, offset 0x140 + 0x140: 0x1c34, 0x143: 0x30ff, 0x144: 0x3410, 0x145: 0x3118, + 0x146: 0x3429, 0x147: 0x310e, 0x148: 0x341f, 0x149: 0x1c5c, + 0x14c: 0x46d3, 0x14d: 0x4764, 0x14e: 0x3131, 0x14f: 0x3442, 0x150: 0x313b, 0x151: 0x344c, + 0x154: 0x3159, 0x155: 0x346a, 0x156: 0x3172, 0x157: 0x3483, + 0x158: 0x3163, 0x159: 0x3474, 0x15a: 0x46f6, 0x15b: 0x4787, 0x15c: 0x317c, 0x15d: 0x348d, + 0x15e: 0x318b, 0x15f: 0x349c, 0x160: 0x46fb, 0x161: 0x478c, 0x162: 0x31a4, 0x163: 0x34ba, + 0x164: 0x3195, 0x165: 0x34ab, 0x168: 0x4705, 0x169: 0x4796, + 0x16a: 0x470a, 0x16b: 0x479b, 0x16c: 0x31c2, 0x16d: 0x34d8, 0x16e: 0x31cc, 0x16f: 0x34e2, + 0x170: 0x31d1, 0x171: 0x34e7, 0x172: 0x31ef, 0x173: 0x3505, 0x174: 0x3212, 0x175: 0x3528, + 0x176: 0x323a, 0x177: 0x3555, 0x178: 0x324e, 0x179: 0x325d, 0x17a: 0x357d, 0x17b: 0x3267, + 0x17c: 0x3587, 0x17d: 0x326c, 0x17e: 0x358c, 0x17f: 0x00a7, + // Block 0x6, offset 0x180 + 0x184: 0x2dee, 0x185: 0x2df4, + 0x186: 0x2dfa, 0x187: 0x1972, 0x188: 0x1975, 0x189: 0x1a08, 0x18a: 0x1987, 0x18b: 0x198a, + 0x18c: 0x1a3e, 0x18d: 0x2f88, 0x18e: 0x3294, 0x18f: 0x3096, 0x190: 0x33a2, 0x191: 0x3140, + 0x192: 0x3451, 0x193: 0x31d6, 0x194: 0x34ec, 0x195: 0x39cf, 0x196: 0x3b5e, 0x197: 0x39c8, + 0x198: 0x3b57, 0x199: 0x39d6, 0x19a: 0x3b65, 0x19b: 0x39c1, 0x19c: 0x3b50, + 0x19e: 0x38b0, 0x19f: 0x3a3f, 0x1a0: 0x38a9, 0x1a1: 0x3a38, 0x1a2: 0x35b3, 0x1a3: 0x35c5, + 0x1a6: 0x3041, 0x1a7: 0x334d, 0x1a8: 0x30be, 0x1a9: 0x33cf, + 0x1aa: 0x46ec, 0x1ab: 0x477d, 0x1ac: 0x3990, 0x1ad: 0x3b1f, 0x1ae: 0x35d7, 0x1af: 0x35dd, + 0x1b0: 0x33c5, 0x1b1: 0x1942, 0x1b2: 0x1945, 0x1b3: 0x19cf, 0x1b4: 0x3028, 0x1b5: 0x3334, + 0x1b8: 0x30fa, 0x1b9: 0x340b, 0x1ba: 0x38b7, 0x1bb: 0x3a46, + 0x1bc: 0x35ad, 0x1bd: 0x35bf, 0x1be: 0x35b9, 0x1bf: 0x35cb, + // Block 0x7, offset 0x1c0 + 0x1c0: 0x2f8d, 0x1c1: 0x3299, 0x1c2: 0x2f92, 0x1c3: 0x329e, 0x1c4: 0x300a, 0x1c5: 0x3316, + 0x1c6: 0x300f, 0x1c7: 0x331b, 0x1c8: 0x309b, 0x1c9: 0x33a7, 0x1ca: 0x30a0, 0x1cb: 0x33ac, + 0x1cc: 0x3145, 0x1cd: 0x3456, 0x1ce: 0x314a, 0x1cf: 0x345b, 0x1d0: 0x3168, 0x1d1: 0x3479, + 0x1d2: 0x316d, 0x1d3: 0x347e, 0x1d4: 0x31db, 0x1d5: 0x34f1, 0x1d6: 0x31e0, 0x1d7: 0x34f6, + 0x1d8: 0x3186, 0x1d9: 0x3497, 0x1da: 0x319f, 0x1db: 0x34b5, + 0x1de: 0x305a, 0x1df: 0x3366, + 0x1e6: 0x4692, 0x1e7: 0x4723, 0x1e8: 0x46ba, 0x1e9: 0x474b, + 0x1ea: 0x395f, 0x1eb: 0x3aee, 0x1ec: 0x393c, 0x1ed: 0x3acb, 0x1ee: 0x46d8, 0x1ef: 0x4769, + 0x1f0: 0x3958, 0x1f1: 0x3ae7, 0x1f2: 0x3244, 0x1f3: 0x355f, + // Block 0x8, offset 0x200 + 0x200: 0x9932, 0x201: 0x9932, 0x202: 0x9932, 0x203: 0x9932, 0x204: 0x9932, 0x205: 0x8132, + 0x206: 0x9932, 0x207: 0x9932, 0x208: 0x9932, 0x209: 0x9932, 0x20a: 0x9932, 0x20b: 0x9932, + 0x20c: 0x9932, 0x20d: 0x8132, 0x20e: 0x8132, 0x20f: 0x9932, 0x210: 0x8132, 0x211: 0x9932, + 0x212: 0x8132, 0x213: 0x9932, 0x214: 0x9932, 0x215: 0x8133, 0x216: 0x812d, 0x217: 0x812d, + 0x218: 0x812d, 0x219: 0x812d, 0x21a: 0x8133, 0x21b: 0x992b, 0x21c: 0x812d, 0x21d: 0x812d, + 0x21e: 0x812d, 0x21f: 0x812d, 0x220: 0x812d, 0x221: 0x8129, 0x222: 0x8129, 0x223: 0x992d, + 0x224: 0x992d, 0x225: 0x992d, 0x226: 0x992d, 0x227: 0x9929, 0x228: 0x9929, 0x229: 0x812d, + 0x22a: 0x812d, 0x22b: 0x812d, 0x22c: 0x812d, 0x22d: 0x992d, 0x22e: 0x992d, 0x22f: 0x812d, + 0x230: 0x992d, 0x231: 0x992d, 0x232: 0x812d, 0x233: 0x812d, 0x234: 0x8101, 0x235: 0x8101, + 0x236: 0x8101, 0x237: 0x8101, 0x238: 0x9901, 0x239: 0x812d, 0x23a: 0x812d, 0x23b: 0x812d, + 0x23c: 0x812d, 0x23d: 0x8132, 0x23e: 0x8132, 0x23f: 0x8132, + // Block 0x9, offset 0x240 + 0x240: 0x49ae, 0x241: 0x49b3, 0x242: 0x9932, 0x243: 0x49b8, 0x244: 0x4a71, 0x245: 0x9936, + 0x246: 0x8132, 0x247: 0x812d, 0x248: 0x812d, 0x249: 0x812d, 0x24a: 0x8132, 0x24b: 0x8132, + 0x24c: 0x8132, 0x24d: 0x812d, 0x24e: 0x812d, 0x250: 0x8132, 0x251: 0x8132, + 0x252: 0x8132, 0x253: 0x812d, 0x254: 0x812d, 0x255: 0x812d, 0x256: 0x812d, 0x257: 0x8132, + 0x258: 0x8133, 0x259: 0x812d, 0x25a: 0x812d, 0x25b: 0x8132, 0x25c: 0x8134, 0x25d: 0x8135, + 0x25e: 0x8135, 0x25f: 0x8134, 0x260: 0x8135, 0x261: 0x8135, 0x262: 0x8134, 0x263: 0x8132, + 0x264: 0x8132, 0x265: 0x8132, 0x266: 0x8132, 0x267: 0x8132, 0x268: 0x8132, 0x269: 0x8132, + 0x26a: 0x8132, 0x26b: 0x8132, 0x26c: 0x8132, 0x26d: 0x8132, 0x26e: 0x8132, 0x26f: 0x8132, + 0x274: 0x0170, + 0x27a: 0x42a5, + 0x27e: 0x0037, + // Block 0xa, offset 0x280 + 0x284: 0x425a, 0x285: 0x447b, + 0x286: 0x35e9, 0x287: 0x00ce, 0x288: 0x3607, 0x289: 0x3613, 0x28a: 0x3625, + 0x28c: 0x3643, 0x28e: 0x3655, 0x28f: 0x3673, 0x290: 0x3e08, 0x291: 0xa000, + 0x295: 0xa000, 0x297: 0xa000, + 0x299: 0xa000, + 0x29f: 0xa000, 0x2a1: 0xa000, + 0x2a5: 0xa000, 0x2a9: 0xa000, + 0x2aa: 0x3637, 0x2ab: 0x3667, 0x2ac: 0x47fe, 0x2ad: 0x3697, 0x2ae: 0x4828, 0x2af: 0x36a9, + 0x2b0: 0x3e70, 0x2b1: 0xa000, 0x2b5: 0xa000, + 0x2b7: 0xa000, 0x2b9: 0xa000, + 0x2bf: 0xa000, + // Block 0xb, offset 0x2c0 + 0x2c1: 0xa000, 0x2c5: 0xa000, + 0x2c9: 0xa000, 0x2ca: 0x4840, 0x2cb: 0x485e, + 0x2cc: 0x36c7, 0x2cd: 0x36df, 0x2ce: 0x4876, 0x2d0: 0x01be, 0x2d1: 0x01d0, + 0x2d2: 0x01ac, 0x2d3: 0x430c, 0x2d4: 0x4312, 0x2d5: 0x01fa, 0x2d6: 0x01e8, + 0x2f0: 0x01d6, 0x2f1: 0x01eb, 0x2f2: 0x01ee, 0x2f4: 0x0188, 0x2f5: 0x01c7, + 0x2f9: 0x01a6, + // Block 0xc, offset 0x300 + 0x300: 0x3721, 0x301: 0x372d, 0x303: 0x371b, + 0x306: 0xa000, 0x307: 0x3709, + 0x30c: 0x375d, 0x30d: 0x3745, 0x30e: 0x376f, 0x310: 0xa000, + 0x313: 0xa000, 0x315: 0xa000, 0x316: 0xa000, 0x317: 0xa000, + 0x318: 0xa000, 0x319: 0x3751, 0x31a: 0xa000, + 0x31e: 0xa000, 0x323: 0xa000, + 0x327: 0xa000, + 0x32b: 0xa000, 0x32d: 0xa000, + 0x330: 0xa000, 0x333: 0xa000, 0x335: 0xa000, + 0x336: 0xa000, 0x337: 0xa000, 0x338: 0xa000, 0x339: 0x37d5, 0x33a: 0xa000, + 0x33e: 0xa000, + // Block 0xd, offset 0x340 + 0x341: 0x3733, 0x342: 0x37b7, + 0x350: 0x370f, 0x351: 0x3793, + 0x352: 0x3715, 0x353: 0x3799, 0x356: 0x3727, 0x357: 0x37ab, + 0x358: 0xa000, 0x359: 0xa000, 0x35a: 0x3829, 0x35b: 0x382f, 0x35c: 0x3739, 0x35d: 0x37bd, + 0x35e: 0x373f, 0x35f: 0x37c3, 0x362: 0x374b, 0x363: 0x37cf, + 0x364: 0x3757, 0x365: 0x37db, 0x366: 0x3763, 0x367: 0x37e7, 0x368: 0xa000, 0x369: 0xa000, + 0x36a: 0x3835, 0x36b: 0x383b, 0x36c: 0x378d, 0x36d: 0x3811, 0x36e: 0x3769, 0x36f: 0x37ed, + 0x370: 0x3775, 0x371: 0x37f9, 0x372: 0x377b, 0x373: 0x37ff, 0x374: 0x3781, 0x375: 0x3805, + 0x378: 0x3787, 0x379: 0x380b, + // Block 0xe, offset 0x380 + 0x387: 0x1d61, + 0x391: 0x812d, + 0x392: 0x8132, 0x393: 0x8132, 0x394: 0x8132, 0x395: 0x8132, 0x396: 0x812d, 0x397: 0x8132, + 0x398: 0x8132, 0x399: 0x8132, 0x39a: 0x812e, 0x39b: 0x812d, 0x39c: 0x8132, 0x39d: 0x8132, + 0x39e: 0x8132, 0x39f: 0x8132, 0x3a0: 0x8132, 0x3a1: 0x8132, 0x3a2: 0x812d, 0x3a3: 0x812d, + 0x3a4: 0x812d, 0x3a5: 0x812d, 0x3a6: 0x812d, 0x3a7: 0x812d, 0x3a8: 0x8132, 0x3a9: 0x8132, + 0x3aa: 0x812d, 0x3ab: 0x8132, 0x3ac: 0x8132, 0x3ad: 0x812e, 0x3ae: 0x8131, 0x3af: 0x8132, + 0x3b0: 0x8105, 0x3b1: 0x8106, 0x3b2: 0x8107, 0x3b3: 0x8108, 0x3b4: 0x8109, 0x3b5: 0x810a, + 0x3b6: 0x810b, 0x3b7: 0x810c, 0x3b8: 0x810d, 0x3b9: 0x810e, 0x3ba: 0x810e, 0x3bb: 0x810f, + 0x3bc: 0x8110, 0x3bd: 0x8111, 0x3bf: 0x8112, + // Block 0xf, offset 0x3c0 + 0x3c8: 0xa000, 0x3ca: 0xa000, 0x3cb: 0x8116, + 0x3cc: 0x8117, 0x3cd: 0x8118, 0x3ce: 0x8119, 0x3cf: 0x811a, 0x3d0: 0x811b, 0x3d1: 0x811c, + 0x3d2: 0x811d, 0x3d3: 0x9932, 0x3d4: 0x9932, 0x3d5: 0x992d, 0x3d6: 0x812d, 0x3d7: 0x8132, + 0x3d8: 0x8132, 0x3d9: 0x8132, 0x3da: 0x8132, 0x3db: 0x8132, 0x3dc: 0x812d, 0x3dd: 0x8132, + 0x3de: 0x8132, 0x3df: 0x812d, + 0x3f0: 0x811e, 0x3f5: 0x1d84, + 0x3f6: 0x2013, 0x3f7: 0x204f, 0x3f8: 0x204a, + // Block 0x10, offset 0x400 + 0x405: 0xa000, + 0x406: 0x2d26, 0x407: 0xa000, 0x408: 0x2d2e, 0x409: 0xa000, 0x40a: 0x2d36, 0x40b: 0xa000, + 0x40c: 0x2d3e, 0x40d: 0xa000, 0x40e: 0x2d46, 0x411: 0xa000, + 0x412: 0x2d4e, + 0x434: 0x8102, 0x435: 0x9900, + 0x43a: 0xa000, 0x43b: 0x2d56, + 0x43c: 0xa000, 0x43d: 0x2d5e, 0x43e: 0xa000, 0x43f: 0xa000, + // Block 0x11, offset 0x440 + 0x440: 0x0069, 0x441: 0x006b, 0x442: 0x006f, 0x443: 0x0083, 0x444: 0x00f5, 0x445: 0x00f8, + 0x446: 0x0413, 0x447: 0x0085, 0x448: 0x0089, 0x449: 0x008b, 0x44a: 0x0104, 0x44b: 0x0107, + 0x44c: 0x010a, 0x44d: 0x008f, 0x44f: 0x0097, 0x450: 0x009b, 0x451: 0x00e0, + 0x452: 0x009f, 0x453: 0x00fe, 0x454: 0x0417, 0x455: 0x041b, 0x456: 0x00a1, 0x457: 0x00a9, + 0x458: 0x00ab, 0x459: 0x0423, 0x45a: 0x012b, 0x45b: 0x00ad, 0x45c: 0x0427, 0x45d: 0x01be, + 0x45e: 0x01c1, 0x45f: 0x01c4, 0x460: 0x01fa, 0x461: 0x01fd, 0x462: 0x0093, 0x463: 0x00a5, + 0x464: 0x00ab, 0x465: 0x00ad, 0x466: 0x01be, 0x467: 0x01c1, 0x468: 0x01eb, 0x469: 0x01fa, + 0x46a: 0x01fd, + 0x478: 0x020c, + // Block 0x12, offset 0x480 + 0x49b: 0x00fb, 0x49c: 0x0087, 0x49d: 0x0101, + 0x49e: 0x00d4, 0x49f: 0x010a, 0x4a0: 0x008d, 0x4a1: 0x010d, 0x4a2: 0x0110, 0x4a3: 0x0116, + 0x4a4: 0x011c, 0x4a5: 0x011f, 0x4a6: 0x0122, 0x4a7: 0x042b, 0x4a8: 0x016a, 0x4a9: 0x0128, + 0x4aa: 0x042f, 0x4ab: 0x016d, 0x4ac: 0x0131, 0x4ad: 0x012e, 0x4ae: 0x0134, 0x4af: 0x0137, + 0x4b0: 0x013a, 0x4b1: 0x013d, 0x4b2: 0x0140, 0x4b3: 0x014c, 0x4b4: 0x014f, 0x4b5: 0x00ec, + 0x4b6: 0x0152, 0x4b7: 0x0155, 0x4b8: 0x041f, 0x4b9: 0x0158, 0x4ba: 0x015b, 0x4bb: 0x00b5, + 0x4bc: 0x015e, 0x4bd: 0x0161, 0x4be: 0x0164, 0x4bf: 0x01d0, + // Block 0x13, offset 0x4c0 + 0x4c0: 0x2f97, 0x4c1: 0x32a3, 0x4c2: 0x2fa1, 0x4c3: 0x32ad, 0x4c4: 0x2fa6, 0x4c5: 0x32b2, + 0x4c6: 0x2fab, 0x4c7: 0x32b7, 0x4c8: 0x38cc, 0x4c9: 0x3a5b, 0x4ca: 0x2fc4, 0x4cb: 0x32d0, + 0x4cc: 0x2fce, 0x4cd: 0x32da, 0x4ce: 0x2fdd, 0x4cf: 0x32e9, 0x4d0: 0x2fd3, 0x4d1: 0x32df, + 0x4d2: 0x2fd8, 0x4d3: 0x32e4, 0x4d4: 0x38ef, 0x4d5: 0x3a7e, 0x4d6: 0x38f6, 0x4d7: 0x3a85, + 0x4d8: 0x3019, 0x4d9: 0x3325, 0x4da: 0x301e, 0x4db: 0x332a, 0x4dc: 0x3904, 0x4dd: 0x3a93, + 0x4de: 0x3023, 0x4df: 0x332f, 0x4e0: 0x3032, 0x4e1: 0x333e, 0x4e2: 0x3050, 0x4e3: 0x335c, + 0x4e4: 0x305f, 0x4e5: 0x336b, 0x4e6: 0x3055, 0x4e7: 0x3361, 0x4e8: 0x3064, 0x4e9: 0x3370, + 0x4ea: 0x3069, 0x4eb: 0x3375, 0x4ec: 0x30af, 0x4ed: 0x33bb, 0x4ee: 0x390b, 0x4ef: 0x3a9a, + 0x4f0: 0x30b9, 0x4f1: 0x33ca, 0x4f2: 0x30c3, 0x4f3: 0x33d4, 0x4f4: 0x30cd, 0x4f5: 0x33de, + 0x4f6: 0x46c4, 0x4f7: 0x4755, 0x4f8: 0x3912, 0x4f9: 0x3aa1, 0x4fa: 0x30e6, 0x4fb: 0x33f7, + 0x4fc: 0x30e1, 0x4fd: 0x33f2, 0x4fe: 0x30eb, 0x4ff: 0x33fc, + // Block 0x14, offset 0x500 + 0x500: 0x30f0, 0x501: 0x3401, 0x502: 0x30f5, 0x503: 0x3406, 0x504: 0x3109, 0x505: 0x341a, + 0x506: 0x3113, 0x507: 0x3424, 0x508: 0x3122, 0x509: 0x3433, 0x50a: 0x311d, 0x50b: 0x342e, + 0x50c: 0x3935, 0x50d: 0x3ac4, 0x50e: 0x3943, 0x50f: 0x3ad2, 0x510: 0x394a, 0x511: 0x3ad9, + 0x512: 0x3951, 0x513: 0x3ae0, 0x514: 0x314f, 0x515: 0x3460, 0x516: 0x3154, 0x517: 0x3465, + 0x518: 0x315e, 0x519: 0x346f, 0x51a: 0x46f1, 0x51b: 0x4782, 0x51c: 0x3997, 0x51d: 0x3b26, + 0x51e: 0x3177, 0x51f: 0x3488, 0x520: 0x3181, 0x521: 0x3492, 0x522: 0x4700, 0x523: 0x4791, + 0x524: 0x399e, 0x525: 0x3b2d, 0x526: 0x39a5, 0x527: 0x3b34, 0x528: 0x39ac, 0x529: 0x3b3b, + 0x52a: 0x3190, 0x52b: 0x34a1, 0x52c: 0x319a, 0x52d: 0x34b0, 0x52e: 0x31ae, 0x52f: 0x34c4, + 0x530: 0x31a9, 0x531: 0x34bf, 0x532: 0x31ea, 0x533: 0x3500, 0x534: 0x31f9, 0x535: 0x350f, + 0x536: 0x31f4, 0x537: 0x350a, 0x538: 0x39b3, 0x539: 0x3b42, 0x53a: 0x39ba, 0x53b: 0x3b49, + 0x53c: 0x31fe, 0x53d: 0x3514, 0x53e: 0x3203, 0x53f: 0x3519, + // Block 0x15, offset 0x540 + 0x540: 0x3208, 0x541: 0x351e, 0x542: 0x320d, 0x543: 0x3523, 0x544: 0x321c, 0x545: 0x3532, + 0x546: 0x3217, 0x547: 0x352d, 0x548: 0x3221, 0x549: 0x353c, 0x54a: 0x3226, 0x54b: 0x3541, + 0x54c: 0x322b, 0x54d: 0x3546, 0x54e: 0x3249, 0x54f: 0x3564, 0x550: 0x3262, 0x551: 0x3582, + 0x552: 0x3271, 0x553: 0x3591, 0x554: 0x3276, 0x555: 0x3596, 0x556: 0x337a, 0x557: 0x34a6, + 0x558: 0x3537, 0x559: 0x3573, 0x55a: 0x1be0, 0x55b: 0x42d7, + 0x560: 0x46a1, 0x561: 0x4732, 0x562: 0x2f83, 0x563: 0x328f, + 0x564: 0x3878, 0x565: 0x3a07, 0x566: 0x3871, 0x567: 0x3a00, 0x568: 0x3886, 0x569: 0x3a15, + 0x56a: 0x387f, 0x56b: 0x3a0e, 0x56c: 0x38be, 0x56d: 0x3a4d, 0x56e: 0x3894, 0x56f: 0x3a23, + 0x570: 0x388d, 0x571: 0x3a1c, 0x572: 0x38a2, 0x573: 0x3a31, 0x574: 0x389b, 0x575: 0x3a2a, + 0x576: 0x38c5, 0x577: 0x3a54, 0x578: 0x46b5, 0x579: 0x4746, 0x57a: 0x3000, 0x57b: 0x330c, + 0x57c: 0x2fec, 0x57d: 0x32f8, 0x57e: 0x38da, 0x57f: 0x3a69, + // Block 0x16, offset 0x580 + 0x580: 0x38d3, 0x581: 0x3a62, 0x582: 0x38e8, 0x583: 0x3a77, 0x584: 0x38e1, 0x585: 0x3a70, + 0x586: 0x38fd, 0x587: 0x3a8c, 0x588: 0x3091, 0x589: 0x339d, 0x58a: 0x30a5, 0x58b: 0x33b1, + 0x58c: 0x46e7, 0x58d: 0x4778, 0x58e: 0x3136, 0x58f: 0x3447, 0x590: 0x3920, 0x591: 0x3aaf, + 0x592: 0x3919, 0x593: 0x3aa8, 0x594: 0x392e, 0x595: 0x3abd, 0x596: 0x3927, 0x597: 0x3ab6, + 0x598: 0x3989, 0x599: 0x3b18, 0x59a: 0x396d, 0x59b: 0x3afc, 0x59c: 0x3966, 0x59d: 0x3af5, + 0x59e: 0x397b, 0x59f: 0x3b0a, 0x5a0: 0x3974, 0x5a1: 0x3b03, 0x5a2: 0x3982, 0x5a3: 0x3b11, + 0x5a4: 0x31e5, 0x5a5: 0x34fb, 0x5a6: 0x31c7, 0x5a7: 0x34dd, 0x5a8: 0x39e4, 0x5a9: 0x3b73, + 0x5aa: 0x39dd, 0x5ab: 0x3b6c, 0x5ac: 0x39f2, 0x5ad: 0x3b81, 0x5ae: 0x39eb, 0x5af: 0x3b7a, + 0x5b0: 0x39f9, 0x5b1: 0x3b88, 0x5b2: 0x3230, 0x5b3: 0x354b, 0x5b4: 0x3258, 0x5b5: 0x3578, + 0x5b6: 0x3253, 0x5b7: 0x356e, 0x5b8: 0x323f, 0x5b9: 0x355a, + // Block 0x17, offset 0x5c0 + 0x5c0: 0x4804, 0x5c1: 0x480a, 0x5c2: 0x491e, 0x5c3: 0x4936, 0x5c4: 0x4926, 0x5c5: 0x493e, + 0x5c6: 0x492e, 0x5c7: 0x4946, 0x5c8: 0x47aa, 0x5c9: 0x47b0, 0x5ca: 0x488e, 0x5cb: 0x48a6, + 0x5cc: 0x4896, 0x5cd: 0x48ae, 0x5ce: 0x489e, 0x5cf: 0x48b6, 0x5d0: 0x4816, 0x5d1: 0x481c, + 0x5d2: 0x3db8, 0x5d3: 0x3dc8, 0x5d4: 0x3dc0, 0x5d5: 0x3dd0, + 0x5d8: 0x47b6, 0x5d9: 0x47bc, 0x5da: 0x3ce8, 0x5db: 0x3cf8, 0x5dc: 0x3cf0, 0x5dd: 0x3d00, + 0x5e0: 0x482e, 0x5e1: 0x4834, 0x5e2: 0x494e, 0x5e3: 0x4966, + 0x5e4: 0x4956, 0x5e5: 0x496e, 0x5e6: 0x495e, 0x5e7: 0x4976, 0x5e8: 0x47c2, 0x5e9: 0x47c8, + 0x5ea: 0x48be, 0x5eb: 0x48d6, 0x5ec: 0x48c6, 0x5ed: 0x48de, 0x5ee: 0x48ce, 0x5ef: 0x48e6, + 0x5f0: 0x4846, 0x5f1: 0x484c, 0x5f2: 0x3e18, 0x5f3: 0x3e30, 0x5f4: 0x3e20, 0x5f5: 0x3e38, + 0x5f6: 0x3e28, 0x5f7: 0x3e40, 0x5f8: 0x47ce, 0x5f9: 0x47d4, 0x5fa: 0x3d18, 0x5fb: 0x3d30, + 0x5fc: 0x3d20, 0x5fd: 0x3d38, 0x5fe: 0x3d28, 0x5ff: 0x3d40, + // Block 0x18, offset 0x600 + 0x600: 0x4852, 0x601: 0x4858, 0x602: 0x3e48, 0x603: 0x3e58, 0x604: 0x3e50, 0x605: 0x3e60, + 0x608: 0x47da, 0x609: 0x47e0, 0x60a: 0x3d48, 0x60b: 0x3d58, + 0x60c: 0x3d50, 0x60d: 0x3d60, 0x610: 0x4864, 0x611: 0x486a, + 0x612: 0x3e80, 0x613: 0x3e98, 0x614: 0x3e88, 0x615: 0x3ea0, 0x616: 0x3e90, 0x617: 0x3ea8, + 0x619: 0x47e6, 0x61b: 0x3d68, 0x61d: 0x3d70, + 0x61f: 0x3d78, 0x620: 0x487c, 0x621: 0x4882, 0x622: 0x497e, 0x623: 0x4996, + 0x624: 0x4986, 0x625: 0x499e, 0x626: 0x498e, 0x627: 0x49a6, 0x628: 0x47ec, 0x629: 0x47f2, + 0x62a: 0x48ee, 0x62b: 0x4906, 0x62c: 0x48f6, 0x62d: 0x490e, 0x62e: 0x48fe, 0x62f: 0x4916, + 0x630: 0x47f8, 0x631: 0x431e, 0x632: 0x3691, 0x633: 0x4324, 0x634: 0x4822, 0x635: 0x432a, + 0x636: 0x36a3, 0x637: 0x4330, 0x638: 0x36c1, 0x639: 0x4336, 0x63a: 0x36d9, 0x63b: 0x433c, + 0x63c: 0x4870, 0x63d: 0x4342, + // Block 0x19, offset 0x640 + 0x640: 0x3da0, 0x641: 0x3da8, 0x642: 0x4184, 0x643: 0x41a2, 0x644: 0x418e, 0x645: 0x41ac, + 0x646: 0x4198, 0x647: 0x41b6, 0x648: 0x3cd8, 0x649: 0x3ce0, 0x64a: 0x40d0, 0x64b: 0x40ee, + 0x64c: 0x40da, 0x64d: 0x40f8, 0x64e: 0x40e4, 0x64f: 0x4102, 0x650: 0x3de8, 0x651: 0x3df0, + 0x652: 0x41c0, 0x653: 0x41de, 0x654: 0x41ca, 0x655: 0x41e8, 0x656: 0x41d4, 0x657: 0x41f2, + 0x658: 0x3d08, 0x659: 0x3d10, 0x65a: 0x410c, 0x65b: 0x412a, 0x65c: 0x4116, 0x65d: 0x4134, + 0x65e: 0x4120, 0x65f: 0x413e, 0x660: 0x3ec0, 0x661: 0x3ec8, 0x662: 0x41fc, 0x663: 0x421a, + 0x664: 0x4206, 0x665: 0x4224, 0x666: 0x4210, 0x667: 0x422e, 0x668: 0x3d80, 0x669: 0x3d88, + 0x66a: 0x4148, 0x66b: 0x4166, 0x66c: 0x4152, 0x66d: 0x4170, 0x66e: 0x415c, 0x66f: 0x417a, + 0x670: 0x3685, 0x671: 0x367f, 0x672: 0x3d90, 0x673: 0x368b, 0x674: 0x3d98, + 0x676: 0x4810, 0x677: 0x3db0, 0x678: 0x35f5, 0x679: 0x35ef, 0x67a: 0x35e3, 0x67b: 0x42ee, + 0x67c: 0x35fb, 0x67d: 0x4287, 0x67e: 0x01d3, 0x67f: 0x4287, + // Block 0x1a, offset 0x680 + 0x680: 0x42a0, 0x681: 0x4482, 0x682: 0x3dd8, 0x683: 0x369d, 0x684: 0x3de0, + 0x686: 0x483a, 0x687: 0x3df8, 0x688: 0x3601, 0x689: 0x42f4, 0x68a: 0x360d, 0x68b: 0x42fa, + 0x68c: 0x3619, 0x68d: 0x4489, 0x68e: 0x4490, 0x68f: 0x4497, 0x690: 0x36b5, 0x691: 0x36af, + 0x692: 0x3e00, 0x693: 0x44e4, 0x696: 0x36bb, 0x697: 0x3e10, + 0x698: 0x3631, 0x699: 0x362b, 0x69a: 0x361f, 0x69b: 0x4300, 0x69d: 0x449e, + 0x69e: 0x44a5, 0x69f: 0x44ac, 0x6a0: 0x36eb, 0x6a1: 0x36e5, 0x6a2: 0x3e68, 0x6a3: 0x44ec, + 0x6a4: 0x36cd, 0x6a5: 0x36d3, 0x6a6: 0x36f1, 0x6a7: 0x3e78, 0x6a8: 0x3661, 0x6a9: 0x365b, + 0x6aa: 0x364f, 0x6ab: 0x430c, 0x6ac: 0x3649, 0x6ad: 0x4474, 0x6ae: 0x447b, 0x6af: 0x0081, + 0x6b2: 0x3eb0, 0x6b3: 0x36f7, 0x6b4: 0x3eb8, + 0x6b6: 0x4888, 0x6b7: 0x3ed0, 0x6b8: 0x363d, 0x6b9: 0x4306, 0x6ba: 0x366d, 0x6bb: 0x4318, + 0x6bc: 0x3679, 0x6bd: 0x425a, 0x6be: 0x428c, + // Block 0x1b, offset 0x6c0 + 0x6c0: 0x1bd8, 0x6c1: 0x1bdc, 0x6c2: 0x0047, 0x6c3: 0x1c54, 0x6c5: 0x1be8, + 0x6c6: 0x1bec, 0x6c7: 0x00e9, 0x6c9: 0x1c58, 0x6ca: 0x008f, 0x6cb: 0x0051, + 0x6cc: 0x0051, 0x6cd: 0x0051, 0x6ce: 0x0091, 0x6cf: 0x00da, 0x6d0: 0x0053, 0x6d1: 0x0053, + 0x6d2: 0x0059, 0x6d3: 0x0099, 0x6d5: 0x005d, 0x6d6: 0x198d, + 0x6d9: 0x0061, 0x6da: 0x0063, 0x6db: 0x0065, 0x6dc: 0x0065, 0x6dd: 0x0065, + 0x6e0: 0x199f, 0x6e1: 0x1bc8, 0x6e2: 0x19a8, + 0x6e4: 0x0075, 0x6e6: 0x01b8, 0x6e8: 0x0075, + 0x6ea: 0x0057, 0x6eb: 0x42d2, 0x6ec: 0x0045, 0x6ed: 0x0047, 0x6ef: 0x008b, + 0x6f0: 0x004b, 0x6f1: 0x004d, 0x6f3: 0x005b, 0x6f4: 0x009f, 0x6f5: 0x0215, + 0x6f6: 0x0218, 0x6f7: 0x021b, 0x6f8: 0x021e, 0x6f9: 0x0093, 0x6fb: 0x1b98, + 0x6fc: 0x01e8, 0x6fd: 0x01c1, 0x6fe: 0x0179, 0x6ff: 0x01a0, + // Block 0x1c, offset 0x700 + 0x700: 0x0463, 0x705: 0x0049, + 0x706: 0x0089, 0x707: 0x008b, 0x708: 0x0093, 0x709: 0x0095, + 0x710: 0x222e, 0x711: 0x223a, + 0x712: 0x22ee, 0x713: 0x2216, 0x714: 0x229a, 0x715: 0x2222, 0x716: 0x22a0, 0x717: 0x22b8, + 0x718: 0x22c4, 0x719: 0x2228, 0x71a: 0x22ca, 0x71b: 0x2234, 0x71c: 0x22be, 0x71d: 0x22d0, + 0x71e: 0x22d6, 0x71f: 0x1cbc, 0x720: 0x0053, 0x721: 0x195a, 0x722: 0x1ba4, 0x723: 0x1963, + 0x724: 0x006d, 0x725: 0x19ab, 0x726: 0x1bd0, 0x727: 0x1d48, 0x728: 0x1966, 0x729: 0x0071, + 0x72a: 0x19b7, 0x72b: 0x1bd4, 0x72c: 0x0059, 0x72d: 0x0047, 0x72e: 0x0049, 0x72f: 0x005b, + 0x730: 0x0093, 0x731: 0x19e4, 0x732: 0x1c18, 0x733: 0x19ed, 0x734: 0x00ad, 0x735: 0x1a62, + 0x736: 0x1c4c, 0x737: 0x1d5c, 0x738: 0x19f0, 0x739: 0x00b1, 0x73a: 0x1a65, 0x73b: 0x1c50, + 0x73c: 0x0099, 0x73d: 0x0087, 0x73e: 0x0089, 0x73f: 0x009b, + // Block 0x1d, offset 0x740 + 0x741: 0x3c06, 0x743: 0xa000, 0x744: 0x3c0d, 0x745: 0xa000, + 0x747: 0x3c14, 0x748: 0xa000, 0x749: 0x3c1b, + 0x74d: 0xa000, + 0x760: 0x2f65, 0x761: 0xa000, 0x762: 0x3c29, + 0x764: 0xa000, 0x765: 0xa000, + 0x76d: 0x3c22, 0x76e: 0x2f60, 0x76f: 0x2f6a, + 0x770: 0x3c30, 0x771: 0x3c37, 0x772: 0xa000, 0x773: 0xa000, 0x774: 0x3c3e, 0x775: 0x3c45, + 0x776: 0xa000, 0x777: 0xa000, 0x778: 0x3c4c, 0x779: 0x3c53, 0x77a: 0xa000, 0x77b: 0xa000, + 0x77c: 0xa000, 0x77d: 0xa000, + // Block 0x1e, offset 0x780 + 0x780: 0x3c5a, 0x781: 0x3c61, 0x782: 0xa000, 0x783: 0xa000, 0x784: 0x3c76, 0x785: 0x3c7d, + 0x786: 0xa000, 0x787: 0xa000, 0x788: 0x3c84, 0x789: 0x3c8b, + 0x791: 0xa000, + 0x792: 0xa000, + 0x7a2: 0xa000, + 0x7a8: 0xa000, 0x7a9: 0xa000, + 0x7ab: 0xa000, 0x7ac: 0x3ca0, 0x7ad: 0x3ca7, 0x7ae: 0x3cae, 0x7af: 0x3cb5, + 0x7b2: 0xa000, 0x7b3: 0xa000, 0x7b4: 0xa000, 0x7b5: 0xa000, + // Block 0x1f, offset 0x7c0 + 0x7e0: 0x0023, 0x7e1: 0x0025, 0x7e2: 0x0027, 0x7e3: 0x0029, + 0x7e4: 0x002b, 0x7e5: 0x002d, 0x7e6: 0x002f, 0x7e7: 0x0031, 0x7e8: 0x0033, 0x7e9: 0x1882, + 0x7ea: 0x1885, 0x7eb: 0x1888, 0x7ec: 0x188b, 0x7ed: 0x188e, 0x7ee: 0x1891, 0x7ef: 0x1894, + 0x7f0: 0x1897, 0x7f1: 0x189a, 0x7f2: 0x189d, 0x7f3: 0x18a6, 0x7f4: 0x1a68, 0x7f5: 0x1a6c, + 0x7f6: 0x1a70, 0x7f7: 0x1a74, 0x7f8: 0x1a78, 0x7f9: 0x1a7c, 0x7fa: 0x1a80, 0x7fb: 0x1a84, + 0x7fc: 0x1a88, 0x7fd: 0x1c80, 0x7fe: 0x1c85, 0x7ff: 0x1c8a, + // Block 0x20, offset 0x800 + 0x800: 0x1c8f, 0x801: 0x1c94, 0x802: 0x1c99, 0x803: 0x1c9e, 0x804: 0x1ca3, 0x805: 0x1ca8, + 0x806: 0x1cad, 0x807: 0x1cb2, 0x808: 0x187f, 0x809: 0x18a3, 0x80a: 0x18c7, 0x80b: 0x18eb, + 0x80c: 0x190f, 0x80d: 0x1918, 0x80e: 0x191e, 0x80f: 0x1924, 0x810: 0x192a, 0x811: 0x1b60, + 0x812: 0x1b64, 0x813: 0x1b68, 0x814: 0x1b6c, 0x815: 0x1b70, 0x816: 0x1b74, 0x817: 0x1b78, + 0x818: 0x1b7c, 0x819: 0x1b80, 0x81a: 0x1b84, 0x81b: 0x1b88, 0x81c: 0x1af4, 0x81d: 0x1af8, + 0x81e: 0x1afc, 0x81f: 0x1b00, 0x820: 0x1b04, 0x821: 0x1b08, 0x822: 0x1b0c, 0x823: 0x1b10, + 0x824: 0x1b14, 0x825: 0x1b18, 0x826: 0x1b1c, 0x827: 0x1b20, 0x828: 0x1b24, 0x829: 0x1b28, + 0x82a: 0x1b2c, 0x82b: 0x1b30, 0x82c: 0x1b34, 0x82d: 0x1b38, 0x82e: 0x1b3c, 0x82f: 0x1b40, + 0x830: 0x1b44, 0x831: 0x1b48, 0x832: 0x1b4c, 0x833: 0x1b50, 0x834: 0x1b54, 0x835: 0x1b58, + 0x836: 0x0043, 0x837: 0x0045, 0x838: 0x0047, 0x839: 0x0049, 0x83a: 0x004b, 0x83b: 0x004d, + 0x83c: 0x004f, 0x83d: 0x0051, 0x83e: 0x0053, 0x83f: 0x0055, + // Block 0x21, offset 0x840 + 0x840: 0x06bf, 0x841: 0x06e3, 0x842: 0x06ef, 0x843: 0x06ff, 0x844: 0x0707, 0x845: 0x0713, + 0x846: 0x071b, 0x847: 0x0723, 0x848: 0x072f, 0x849: 0x0783, 0x84a: 0x079b, 0x84b: 0x07ab, + 0x84c: 0x07bb, 0x84d: 0x07cb, 0x84e: 0x07db, 0x84f: 0x07fb, 0x850: 0x07ff, 0x851: 0x0803, + 0x852: 0x0837, 0x853: 0x085f, 0x854: 0x086f, 0x855: 0x0877, 0x856: 0x087b, 0x857: 0x0887, + 0x858: 0x08a3, 0x859: 0x08a7, 0x85a: 0x08bf, 0x85b: 0x08c3, 0x85c: 0x08cb, 0x85d: 0x08db, + 0x85e: 0x0977, 0x85f: 0x098b, 0x860: 0x09cb, 0x861: 0x09df, 0x862: 0x09e7, 0x863: 0x09eb, + 0x864: 0x09fb, 0x865: 0x0a17, 0x866: 0x0a43, 0x867: 0x0a4f, 0x868: 0x0a6f, 0x869: 0x0a7b, + 0x86a: 0x0a7f, 0x86b: 0x0a83, 0x86c: 0x0a9b, 0x86d: 0x0a9f, 0x86e: 0x0acb, 0x86f: 0x0ad7, + 0x870: 0x0adf, 0x871: 0x0ae7, 0x872: 0x0af7, 0x873: 0x0aff, 0x874: 0x0b07, 0x875: 0x0b33, + 0x876: 0x0b37, 0x877: 0x0b3f, 0x878: 0x0b43, 0x879: 0x0b4b, 0x87a: 0x0b53, 0x87b: 0x0b63, + 0x87c: 0x0b7f, 0x87d: 0x0bf7, 0x87e: 0x0c0b, 0x87f: 0x0c0f, + // Block 0x22, offset 0x880 + 0x880: 0x0c8f, 0x881: 0x0c93, 0x882: 0x0ca7, 0x883: 0x0cab, 0x884: 0x0cb3, 0x885: 0x0cbb, + 0x886: 0x0cc3, 0x887: 0x0ccf, 0x888: 0x0cf7, 0x889: 0x0d07, 0x88a: 0x0d1b, 0x88b: 0x0d8b, + 0x88c: 0x0d97, 0x88d: 0x0da7, 0x88e: 0x0db3, 0x88f: 0x0dbf, 0x890: 0x0dc7, 0x891: 0x0dcb, + 0x892: 0x0dcf, 0x893: 0x0dd3, 0x894: 0x0dd7, 0x895: 0x0e8f, 0x896: 0x0ed7, 0x897: 0x0ee3, + 0x898: 0x0ee7, 0x899: 0x0eeb, 0x89a: 0x0eef, 0x89b: 0x0ef7, 0x89c: 0x0efb, 0x89d: 0x0f0f, + 0x89e: 0x0f2b, 0x89f: 0x0f33, 0x8a0: 0x0f73, 0x8a1: 0x0f77, 0x8a2: 0x0f7f, 0x8a3: 0x0f83, + 0x8a4: 0x0f8b, 0x8a5: 0x0f8f, 0x8a6: 0x0fb3, 0x8a7: 0x0fb7, 0x8a8: 0x0fd3, 0x8a9: 0x0fd7, + 0x8aa: 0x0fdb, 0x8ab: 0x0fdf, 0x8ac: 0x0ff3, 0x8ad: 0x1017, 0x8ae: 0x101b, 0x8af: 0x101f, + 0x8b0: 0x1043, 0x8b1: 0x1083, 0x8b2: 0x1087, 0x8b3: 0x10a7, 0x8b4: 0x10b7, 0x8b5: 0x10bf, + 0x8b6: 0x10df, 0x8b7: 0x1103, 0x8b8: 0x1147, 0x8b9: 0x114f, 0x8ba: 0x1163, 0x8bb: 0x116f, + 0x8bc: 0x1177, 0x8bd: 0x117f, 0x8be: 0x1183, 0x8bf: 0x1187, + // Block 0x23, offset 0x8c0 + 0x8c0: 0x119f, 0x8c1: 0x11a3, 0x8c2: 0x11bf, 0x8c3: 0x11c7, 0x8c4: 0x11cf, 0x8c5: 0x11d3, + 0x8c6: 0x11df, 0x8c7: 0x11e7, 0x8c8: 0x11eb, 0x8c9: 0x11ef, 0x8ca: 0x11f7, 0x8cb: 0x11fb, + 0x8cc: 0x129b, 0x8cd: 0x12af, 0x8ce: 0x12e3, 0x8cf: 0x12e7, 0x8d0: 0x12ef, 0x8d1: 0x131b, + 0x8d2: 0x1323, 0x8d3: 0x132b, 0x8d4: 0x1333, 0x8d5: 0x136f, 0x8d6: 0x1373, 0x8d7: 0x137b, + 0x8d8: 0x137f, 0x8d9: 0x1383, 0x8da: 0x13af, 0x8db: 0x13b3, 0x8dc: 0x13bb, 0x8dd: 0x13cf, + 0x8de: 0x13d3, 0x8df: 0x13ef, 0x8e0: 0x13f7, 0x8e1: 0x13fb, 0x8e2: 0x141f, 0x8e3: 0x143f, + 0x8e4: 0x1453, 0x8e5: 0x1457, 0x8e6: 0x145f, 0x8e7: 0x148b, 0x8e8: 0x148f, 0x8e9: 0x149f, + 0x8ea: 0x14c3, 0x8eb: 0x14cf, 0x8ec: 0x14df, 0x8ed: 0x14f7, 0x8ee: 0x14ff, 0x8ef: 0x1503, + 0x8f0: 0x1507, 0x8f1: 0x150b, 0x8f2: 0x1517, 0x8f3: 0x151b, 0x8f4: 0x1523, 0x8f5: 0x153f, + 0x8f6: 0x1543, 0x8f7: 0x1547, 0x8f8: 0x155f, 0x8f9: 0x1563, 0x8fa: 0x156b, 0x8fb: 0x157f, + 0x8fc: 0x1583, 0x8fd: 0x1587, 0x8fe: 0x158f, 0x8ff: 0x1593, + // Block 0x24, offset 0x900 + 0x906: 0xa000, 0x90b: 0xa000, + 0x90c: 0x3f08, 0x90d: 0xa000, 0x90e: 0x3f10, 0x90f: 0xa000, 0x910: 0x3f18, 0x911: 0xa000, + 0x912: 0x3f20, 0x913: 0xa000, 0x914: 0x3f28, 0x915: 0xa000, 0x916: 0x3f30, 0x917: 0xa000, + 0x918: 0x3f38, 0x919: 0xa000, 0x91a: 0x3f40, 0x91b: 0xa000, 0x91c: 0x3f48, 0x91d: 0xa000, + 0x91e: 0x3f50, 0x91f: 0xa000, 0x920: 0x3f58, 0x921: 0xa000, 0x922: 0x3f60, + 0x924: 0xa000, 0x925: 0x3f68, 0x926: 0xa000, 0x927: 0x3f70, 0x928: 0xa000, 0x929: 0x3f78, + 0x92f: 0xa000, + 0x930: 0x3f80, 0x931: 0x3f88, 0x932: 0xa000, 0x933: 0x3f90, 0x934: 0x3f98, 0x935: 0xa000, + 0x936: 0x3fa0, 0x937: 0x3fa8, 0x938: 0xa000, 0x939: 0x3fb0, 0x93a: 0x3fb8, 0x93b: 0xa000, + 0x93c: 0x3fc0, 0x93d: 0x3fc8, + // Block 0x25, offset 0x940 + 0x954: 0x3f00, + 0x959: 0x9903, 0x95a: 0x9903, 0x95b: 0x42dc, 0x95c: 0x42e2, 0x95d: 0xa000, + 0x95e: 0x3fd0, 0x95f: 0x26b4, + 0x966: 0xa000, + 0x96b: 0xa000, 0x96c: 0x3fe0, 0x96d: 0xa000, 0x96e: 0x3fe8, 0x96f: 0xa000, + 0x970: 0x3ff0, 0x971: 0xa000, 0x972: 0x3ff8, 0x973: 0xa000, 0x974: 0x4000, 0x975: 0xa000, + 0x976: 0x4008, 0x977: 0xa000, 0x978: 0x4010, 0x979: 0xa000, 0x97a: 0x4018, 0x97b: 0xa000, + 0x97c: 0x4020, 0x97d: 0xa000, 0x97e: 0x4028, 0x97f: 0xa000, + // Block 0x26, offset 0x980 + 0x980: 0x4030, 0x981: 0xa000, 0x982: 0x4038, 0x984: 0xa000, 0x985: 0x4040, + 0x986: 0xa000, 0x987: 0x4048, 0x988: 0xa000, 0x989: 0x4050, + 0x98f: 0xa000, 0x990: 0x4058, 0x991: 0x4060, + 0x992: 0xa000, 0x993: 0x4068, 0x994: 0x4070, 0x995: 0xa000, 0x996: 0x4078, 0x997: 0x4080, + 0x998: 0xa000, 0x999: 0x4088, 0x99a: 0x4090, 0x99b: 0xa000, 0x99c: 0x4098, 0x99d: 0x40a0, + 0x9af: 0xa000, + 0x9b0: 0xa000, 0x9b1: 0xa000, 0x9b2: 0xa000, 0x9b4: 0x3fd8, + 0x9b7: 0x40a8, 0x9b8: 0x40b0, 0x9b9: 0x40b8, 0x9ba: 0x40c0, + 0x9bd: 0xa000, 0x9be: 0x40c8, 0x9bf: 0x26c9, + // Block 0x27, offset 0x9c0 + 0x9c0: 0x0367, 0x9c1: 0x032b, 0x9c2: 0x032f, 0x9c3: 0x0333, 0x9c4: 0x037b, 0x9c5: 0x0337, + 0x9c6: 0x033b, 0x9c7: 0x033f, 0x9c8: 0x0343, 0x9c9: 0x0347, 0x9ca: 0x034b, 0x9cb: 0x034f, + 0x9cc: 0x0353, 0x9cd: 0x0357, 0x9ce: 0x035b, 0x9cf: 0x49bd, 0x9d0: 0x49c3, 0x9d1: 0x49c9, + 0x9d2: 0x49cf, 0x9d3: 0x49d5, 0x9d4: 0x49db, 0x9d5: 0x49e1, 0x9d6: 0x49e7, 0x9d7: 0x49ed, + 0x9d8: 0x49f3, 0x9d9: 0x49f9, 0x9da: 0x49ff, 0x9db: 0x4a05, 0x9dc: 0x4a0b, 0x9dd: 0x4a11, + 0x9de: 0x4a17, 0x9df: 0x4a1d, 0x9e0: 0x4a23, 0x9e1: 0x4a29, 0x9e2: 0x4a2f, 0x9e3: 0x4a35, + 0x9e4: 0x03c3, 0x9e5: 0x035f, 0x9e6: 0x0363, 0x9e7: 0x03e7, 0x9e8: 0x03eb, 0x9e9: 0x03ef, + 0x9ea: 0x03f3, 0x9eb: 0x03f7, 0x9ec: 0x03fb, 0x9ed: 0x03ff, 0x9ee: 0x036b, 0x9ef: 0x0403, + 0x9f0: 0x0407, 0x9f1: 0x036f, 0x9f2: 0x0373, 0x9f3: 0x0377, 0x9f4: 0x037f, 0x9f5: 0x0383, + 0x9f6: 0x0387, 0x9f7: 0x038b, 0x9f8: 0x038f, 0x9f9: 0x0393, 0x9fa: 0x0397, 0x9fb: 0x039b, + 0x9fc: 0x039f, 0x9fd: 0x03a3, 0x9fe: 0x03a7, 0x9ff: 0x03ab, + // Block 0x28, offset 0xa00 + 0xa00: 0x03af, 0xa01: 0x03b3, 0xa02: 0x040b, 0xa03: 0x040f, 0xa04: 0x03b7, 0xa05: 0x03bb, + 0xa06: 0x03bf, 0xa07: 0x03c7, 0xa08: 0x03cb, 0xa09: 0x03cf, 0xa0a: 0x03d3, 0xa0b: 0x03d7, + 0xa0c: 0x03db, 0xa0d: 0x03df, 0xa0e: 0x03e3, + 0xa12: 0x06bf, 0xa13: 0x071b, 0xa14: 0x06cb, 0xa15: 0x097b, 0xa16: 0x06cf, 0xa17: 0x06e7, + 0xa18: 0x06d3, 0xa19: 0x0f93, 0xa1a: 0x0707, 0xa1b: 0x06db, 0xa1c: 0x06c3, 0xa1d: 0x09ff, + 0xa1e: 0x098f, 0xa1f: 0x072f, + // Block 0x29, offset 0xa40 + 0xa40: 0x2054, 0xa41: 0x205a, 0xa42: 0x2060, 0xa43: 0x2066, 0xa44: 0x206c, 0xa45: 0x2072, + 0xa46: 0x2078, 0xa47: 0x207e, 0xa48: 0x2084, 0xa49: 0x208a, 0xa4a: 0x2090, 0xa4b: 0x2096, + 0xa4c: 0x209c, 0xa4d: 0x20a2, 0xa4e: 0x2726, 0xa4f: 0x272f, 0xa50: 0x2738, 0xa51: 0x2741, + 0xa52: 0x274a, 0xa53: 0x2753, 0xa54: 0x275c, 0xa55: 0x2765, 0xa56: 0x276e, 0xa57: 0x2780, + 0xa58: 0x2789, 0xa59: 0x2792, 0xa5a: 0x279b, 0xa5b: 0x27a4, 0xa5c: 0x2777, 0xa5d: 0x2bac, + 0xa5e: 0x2aed, 0xa60: 0x20a8, 0xa61: 0x20c0, 0xa62: 0x20b4, 0xa63: 0x2108, + 0xa64: 0x20c6, 0xa65: 0x20e4, 0xa66: 0x20ae, 0xa67: 0x20de, 0xa68: 0x20ba, 0xa69: 0x20f0, + 0xa6a: 0x2120, 0xa6b: 0x213e, 0xa6c: 0x2138, 0xa6d: 0x212c, 0xa6e: 0x217a, 0xa6f: 0x210e, + 0xa70: 0x211a, 0xa71: 0x2132, 0xa72: 0x2126, 0xa73: 0x2150, 0xa74: 0x20fc, 0xa75: 0x2144, + 0xa76: 0x216e, 0xa77: 0x2156, 0xa78: 0x20ea, 0xa79: 0x20cc, 0xa7a: 0x2102, 0xa7b: 0x2114, + 0xa7c: 0x214a, 0xa7d: 0x20d2, 0xa7e: 0x2174, 0xa7f: 0x20f6, + // Block 0x2a, offset 0xa80 + 0xa80: 0x215c, 0xa81: 0x20d8, 0xa82: 0x2162, 0xa83: 0x2168, 0xa84: 0x092f, 0xa85: 0x0b03, + 0xa86: 0x0ca7, 0xa87: 0x10c7, + 0xa90: 0x1bc4, 0xa91: 0x18a9, + 0xa92: 0x18ac, 0xa93: 0x18af, 0xa94: 0x18b2, 0xa95: 0x18b5, 0xa96: 0x18b8, 0xa97: 0x18bb, + 0xa98: 0x18be, 0xa99: 0x18c1, 0xa9a: 0x18ca, 0xa9b: 0x18cd, 0xa9c: 0x18d0, 0xa9d: 0x18d3, + 0xa9e: 0x18d6, 0xa9f: 0x18d9, 0xaa0: 0x0313, 0xaa1: 0x031b, 0xaa2: 0x031f, 0xaa3: 0x0327, + 0xaa4: 0x032b, 0xaa5: 0x032f, 0xaa6: 0x0337, 0xaa7: 0x033f, 0xaa8: 0x0343, 0xaa9: 0x034b, + 0xaaa: 0x034f, 0xaab: 0x0353, 0xaac: 0x0357, 0xaad: 0x035b, 0xaae: 0x2e18, 0xaaf: 0x2e20, + 0xab0: 0x2e28, 0xab1: 0x2e30, 0xab2: 0x2e38, 0xab3: 0x2e40, 0xab4: 0x2e48, 0xab5: 0x2e50, + 0xab6: 0x2e60, 0xab7: 0x2e68, 0xab8: 0x2e70, 0xab9: 0x2e78, 0xaba: 0x2e80, 0xabb: 0x2e88, + 0xabc: 0x2ed3, 0xabd: 0x2e9b, 0xabe: 0x2e58, + // Block 0x2b, offset 0xac0 + 0xac0: 0x06bf, 0xac1: 0x071b, 0xac2: 0x06cb, 0xac3: 0x097b, 0xac4: 0x071f, 0xac5: 0x07af, + 0xac6: 0x06c7, 0xac7: 0x07ab, 0xac8: 0x070b, 0xac9: 0x0887, 0xaca: 0x0d07, 0xacb: 0x0e8f, + 0xacc: 0x0dd7, 0xacd: 0x0d1b, 0xace: 0x145f, 0xacf: 0x098b, 0xad0: 0x0ccf, 0xad1: 0x0d4b, + 0xad2: 0x0d0b, 0xad3: 0x104b, 0xad4: 0x08fb, 0xad5: 0x0f03, 0xad6: 0x1387, 0xad7: 0x105f, + 0xad8: 0x0843, 0xad9: 0x108f, 0xada: 0x0f9b, 0xadb: 0x0a17, 0xadc: 0x140f, 0xadd: 0x077f, + 0xade: 0x08ab, 0xadf: 0x0df7, 0xae0: 0x1527, 0xae1: 0x0743, 0xae2: 0x07d3, 0xae3: 0x0d9b, + 0xae4: 0x06cf, 0xae5: 0x06e7, 0xae6: 0x06d3, 0xae7: 0x0adb, 0xae8: 0x08ef, 0xae9: 0x087f, + 0xaea: 0x0a57, 0xaeb: 0x0a4b, 0xaec: 0x0feb, 0xaed: 0x073f, 0xaee: 0x139b, 0xaef: 0x089b, + 0xaf0: 0x09f3, 0xaf1: 0x18dc, 0xaf2: 0x18df, 0xaf3: 0x18e2, 0xaf4: 0x18e5, 0xaf5: 0x18ee, + 0xaf6: 0x18f1, 0xaf7: 0x18f4, 0xaf8: 0x18f7, 0xaf9: 0x18fa, 0xafa: 0x18fd, 0xafb: 0x1900, + 0xafc: 0x1903, 0xafd: 0x1906, 0xafe: 0x1909, 0xaff: 0x1912, + // Block 0x2c, offset 0xb00 + 0xb00: 0x1cc6, 0xb01: 0x1cd5, 0xb02: 0x1ce4, 0xb03: 0x1cf3, 0xb04: 0x1d02, 0xb05: 0x1d11, + 0xb06: 0x1d20, 0xb07: 0x1d2f, 0xb08: 0x1d3e, 0xb09: 0x218c, 0xb0a: 0x219e, 0xb0b: 0x21b0, + 0xb0c: 0x1954, 0xb0d: 0x1c04, 0xb0e: 0x19d2, 0xb0f: 0x1ba8, 0xb10: 0x04cb, 0xb11: 0x04d3, + 0xb12: 0x04db, 0xb13: 0x04e3, 0xb14: 0x04eb, 0xb15: 0x04ef, 0xb16: 0x04f3, 0xb17: 0x04f7, + 0xb18: 0x04fb, 0xb19: 0x04ff, 0xb1a: 0x0503, 0xb1b: 0x0507, 0xb1c: 0x050b, 0xb1d: 0x050f, + 0xb1e: 0x0513, 0xb1f: 0x0517, 0xb20: 0x051b, 0xb21: 0x0523, 0xb22: 0x0527, 0xb23: 0x052b, + 0xb24: 0x052f, 0xb25: 0x0533, 0xb26: 0x0537, 0xb27: 0x053b, 0xb28: 0x053f, 0xb29: 0x0543, + 0xb2a: 0x0547, 0xb2b: 0x054b, 0xb2c: 0x054f, 0xb2d: 0x0553, 0xb2e: 0x0557, 0xb2f: 0x055b, + 0xb30: 0x055f, 0xb31: 0x0563, 0xb32: 0x0567, 0xb33: 0x056f, 0xb34: 0x0577, 0xb35: 0x057f, + 0xb36: 0x0583, 0xb37: 0x0587, 0xb38: 0x058b, 0xb39: 0x058f, 0xb3a: 0x0593, 0xb3b: 0x0597, + 0xb3c: 0x059b, 0xb3d: 0x059f, 0xb3e: 0x05a3, + // Block 0x2d, offset 0xb40 + 0xb40: 0x2b0c, 0xb41: 0x29a8, 0xb42: 0x2b1c, 0xb43: 0x2880, 0xb44: 0x2ee4, 0xb45: 0x288a, + 0xb46: 0x2894, 0xb47: 0x2f28, 0xb48: 0x29b5, 0xb49: 0x289e, 0xb4a: 0x28a8, 0xb4b: 0x28b2, + 0xb4c: 0x29dc, 0xb4d: 0x29e9, 0xb4e: 0x29c2, 0xb4f: 0x29cf, 0xb50: 0x2ea9, 0xb51: 0x29f6, + 0xb52: 0x2a03, 0xb53: 0x2bbe, 0xb54: 0x26bb, 0xb55: 0x2bd1, 0xb56: 0x2be4, 0xb57: 0x2b2c, + 0xb58: 0x2a10, 0xb59: 0x2bf7, 0xb5a: 0x2c0a, 0xb5b: 0x2a1d, 0xb5c: 0x28bc, 0xb5d: 0x28c6, + 0xb5e: 0x2eb7, 0xb5f: 0x2a2a, 0xb60: 0x2b3c, 0xb61: 0x2ef5, 0xb62: 0x28d0, 0xb63: 0x28da, + 0xb64: 0x2a37, 0xb65: 0x28e4, 0xb66: 0x28ee, 0xb67: 0x26d0, 0xb68: 0x26d7, 0xb69: 0x28f8, + 0xb6a: 0x2902, 0xb6b: 0x2c1d, 0xb6c: 0x2a44, 0xb6d: 0x2b4c, 0xb6e: 0x2c30, 0xb6f: 0x2a51, + 0xb70: 0x2916, 0xb71: 0x290c, 0xb72: 0x2f3c, 0xb73: 0x2a5e, 0xb74: 0x2c43, 0xb75: 0x2920, + 0xb76: 0x2b5c, 0xb77: 0x292a, 0xb78: 0x2a78, 0xb79: 0x2934, 0xb7a: 0x2a85, 0xb7b: 0x2f06, + 0xb7c: 0x2a6b, 0xb7d: 0x2b6c, 0xb7e: 0x2a92, 0xb7f: 0x26de, + // Block 0x2e, offset 0xb80 + 0xb80: 0x2f17, 0xb81: 0x293e, 0xb82: 0x2948, 0xb83: 0x2a9f, 0xb84: 0x2952, 0xb85: 0x295c, + 0xb86: 0x2966, 0xb87: 0x2b7c, 0xb88: 0x2aac, 0xb89: 0x26e5, 0xb8a: 0x2c56, 0xb8b: 0x2e90, + 0xb8c: 0x2b8c, 0xb8d: 0x2ab9, 0xb8e: 0x2ec5, 0xb8f: 0x2970, 0xb90: 0x297a, 0xb91: 0x2ac6, + 0xb92: 0x26ec, 0xb93: 0x2ad3, 0xb94: 0x2b9c, 0xb95: 0x26f3, 0xb96: 0x2c69, 0xb97: 0x2984, + 0xb98: 0x1cb7, 0xb99: 0x1ccb, 0xb9a: 0x1cda, 0xb9b: 0x1ce9, 0xb9c: 0x1cf8, 0xb9d: 0x1d07, + 0xb9e: 0x1d16, 0xb9f: 0x1d25, 0xba0: 0x1d34, 0xba1: 0x1d43, 0xba2: 0x2192, 0xba3: 0x21a4, + 0xba4: 0x21b6, 0xba5: 0x21c2, 0xba6: 0x21ce, 0xba7: 0x21da, 0xba8: 0x21e6, 0xba9: 0x21f2, + 0xbaa: 0x21fe, 0xbab: 0x220a, 0xbac: 0x2246, 0xbad: 0x2252, 0xbae: 0x225e, 0xbaf: 0x226a, + 0xbb0: 0x2276, 0xbb1: 0x1c14, 0xbb2: 0x19c6, 0xbb3: 0x1936, 0xbb4: 0x1be4, 0xbb5: 0x1a47, + 0xbb6: 0x1a56, 0xbb7: 0x19cc, 0xbb8: 0x1bfc, 0xbb9: 0x1c00, 0xbba: 0x1960, 0xbbb: 0x2701, + 0xbbc: 0x270f, 0xbbd: 0x26fa, 0xbbe: 0x2708, 0xbbf: 0x2ae0, + // Block 0x2f, offset 0xbc0 + 0xbc0: 0x1a4a, 0xbc1: 0x1a32, 0xbc2: 0x1c60, 0xbc3: 0x1a1a, 0xbc4: 0x19f3, 0xbc5: 0x1969, + 0xbc6: 0x1978, 0xbc7: 0x1948, 0xbc8: 0x1bf0, 0xbc9: 0x1d52, 0xbca: 0x1a4d, 0xbcb: 0x1a35, + 0xbcc: 0x1c64, 0xbcd: 0x1c70, 0xbce: 0x1a26, 0xbcf: 0x19fc, 0xbd0: 0x1957, 0xbd1: 0x1c1c, + 0xbd2: 0x1bb0, 0xbd3: 0x1b9c, 0xbd4: 0x1bcc, 0xbd5: 0x1c74, 0xbd6: 0x1a29, 0xbd7: 0x19c9, + 0xbd8: 0x19ff, 0xbd9: 0x19de, 0xbda: 0x1a41, 0xbdb: 0x1c78, 0xbdc: 0x1a2c, 0xbdd: 0x19c0, + 0xbde: 0x1a02, 0xbdf: 0x1c3c, 0xbe0: 0x1bf4, 0xbe1: 0x1a14, 0xbe2: 0x1c24, 0xbe3: 0x1c40, + 0xbe4: 0x1bf8, 0xbe5: 0x1a17, 0xbe6: 0x1c28, 0xbe7: 0x22e8, 0xbe8: 0x22fc, 0xbe9: 0x1996, + 0xbea: 0x1c20, 0xbeb: 0x1bb4, 0xbec: 0x1ba0, 0xbed: 0x1c48, 0xbee: 0x2716, 0xbef: 0x27ad, + 0xbf0: 0x1a59, 0xbf1: 0x1a44, 0xbf2: 0x1c7c, 0xbf3: 0x1a2f, 0xbf4: 0x1a50, 0xbf5: 0x1a38, + 0xbf6: 0x1c68, 0xbf7: 0x1a1d, 0xbf8: 0x19f6, 0xbf9: 0x1981, 0xbfa: 0x1a53, 0xbfb: 0x1a3b, + 0xbfc: 0x1c6c, 0xbfd: 0x1a20, 0xbfe: 0x19f9, 0xbff: 0x1984, + // Block 0x30, offset 0xc00 + 0xc00: 0x1c2c, 0xc01: 0x1bb8, 0xc02: 0x1d4d, 0xc03: 0x1939, 0xc04: 0x19ba, 0xc05: 0x19bd, + 0xc06: 0x22f5, 0xc07: 0x1b94, 0xc08: 0x19c3, 0xc09: 0x194b, 0xc0a: 0x19e1, 0xc0b: 0x194e, + 0xc0c: 0x19ea, 0xc0d: 0x196c, 0xc0e: 0x196f, 0xc0f: 0x1a05, 0xc10: 0x1a0b, 0xc11: 0x1a0e, + 0xc12: 0x1c30, 0xc13: 0x1a11, 0xc14: 0x1a23, 0xc15: 0x1c38, 0xc16: 0x1c44, 0xc17: 0x1990, + 0xc18: 0x1d57, 0xc19: 0x1bbc, 0xc1a: 0x1993, 0xc1b: 0x1a5c, 0xc1c: 0x19a5, 0xc1d: 0x19b4, + 0xc1e: 0x22e2, 0xc1f: 0x22dc, 0xc20: 0x1cc1, 0xc21: 0x1cd0, 0xc22: 0x1cdf, 0xc23: 0x1cee, + 0xc24: 0x1cfd, 0xc25: 0x1d0c, 0xc26: 0x1d1b, 0xc27: 0x1d2a, 0xc28: 0x1d39, 0xc29: 0x2186, + 0xc2a: 0x2198, 0xc2b: 0x21aa, 0xc2c: 0x21bc, 0xc2d: 0x21c8, 0xc2e: 0x21d4, 0xc2f: 0x21e0, + 0xc30: 0x21ec, 0xc31: 0x21f8, 0xc32: 0x2204, 0xc33: 0x2240, 0xc34: 0x224c, 0xc35: 0x2258, + 0xc36: 0x2264, 0xc37: 0x2270, 0xc38: 0x227c, 0xc39: 0x2282, 0xc3a: 0x2288, 0xc3b: 0x228e, + 0xc3c: 0x2294, 0xc3d: 0x22a6, 0xc3e: 0x22ac, 0xc3f: 0x1c10, + // Block 0x31, offset 0xc40 + 0xc40: 0x1377, 0xc41: 0x0cfb, 0xc42: 0x13d3, 0xc43: 0x139f, 0xc44: 0x0e57, 0xc45: 0x06eb, + 0xc46: 0x08df, 0xc47: 0x162b, 0xc48: 0x162b, 0xc49: 0x0a0b, 0xc4a: 0x145f, 0xc4b: 0x0943, + 0xc4c: 0x0a07, 0xc4d: 0x0bef, 0xc4e: 0x0fcf, 0xc4f: 0x115f, 0xc50: 0x1297, 0xc51: 0x12d3, + 0xc52: 0x1307, 0xc53: 0x141b, 0xc54: 0x0d73, 0xc55: 0x0dff, 0xc56: 0x0eab, 0xc57: 0x0f43, + 0xc58: 0x125f, 0xc59: 0x1447, 0xc5a: 0x1573, 0xc5b: 0x070f, 0xc5c: 0x08b3, 0xc5d: 0x0d87, + 0xc5e: 0x0ecf, 0xc5f: 0x1293, 0xc60: 0x15c3, 0xc61: 0x0ab3, 0xc62: 0x0e77, 0xc63: 0x1283, + 0xc64: 0x1317, 0xc65: 0x0c23, 0xc66: 0x11bb, 0xc67: 0x12df, 0xc68: 0x0b1f, 0xc69: 0x0d0f, + 0xc6a: 0x0e17, 0xc6b: 0x0f1b, 0xc6c: 0x1427, 0xc6d: 0x074f, 0xc6e: 0x07e7, 0xc6f: 0x0853, + 0xc70: 0x0c8b, 0xc71: 0x0d7f, 0xc72: 0x0ecb, 0xc73: 0x0fef, 0xc74: 0x1177, 0xc75: 0x128b, + 0xc76: 0x12a3, 0xc77: 0x13c7, 0xc78: 0x14ef, 0xc79: 0x15a3, 0xc7a: 0x15bf, 0xc7b: 0x102b, + 0xc7c: 0x106b, 0xc7d: 0x1123, 0xc7e: 0x1243, 0xc7f: 0x147b, + // Block 0x32, offset 0xc80 + 0xc80: 0x15cb, 0xc81: 0x134b, 0xc82: 0x09c7, 0xc83: 0x0b3b, 0xc84: 0x10db, 0xc85: 0x119b, + 0xc86: 0x0eff, 0xc87: 0x1033, 0xc88: 0x1397, 0xc89: 0x14e7, 0xc8a: 0x09c3, 0xc8b: 0x0a8f, + 0xc8c: 0x0d77, 0xc8d: 0x0e2b, 0xc8e: 0x0e5f, 0xc8f: 0x1113, 0xc90: 0x113b, 0xc91: 0x14a7, + 0xc92: 0x084f, 0xc93: 0x11a7, 0xc94: 0x07f3, 0xc95: 0x07ef, 0xc96: 0x1097, 0xc97: 0x1127, + 0xc98: 0x125b, 0xc99: 0x14af, 0xc9a: 0x1367, 0xc9b: 0x0c27, 0xc9c: 0x0d73, 0xc9d: 0x1357, + 0xc9e: 0x06f7, 0xc9f: 0x0a63, 0xca0: 0x0b93, 0xca1: 0x0f2f, 0xca2: 0x0faf, 0xca3: 0x0873, + 0xca4: 0x103b, 0xca5: 0x075f, 0xca6: 0x0b77, 0xca7: 0x06d7, 0xca8: 0x0deb, 0xca9: 0x0ca3, + 0xcaa: 0x110f, 0xcab: 0x08c7, 0xcac: 0x09b3, 0xcad: 0x0ffb, 0xcae: 0x1263, 0xcaf: 0x133b, + 0xcb0: 0x0db7, 0xcb1: 0x13f7, 0xcb2: 0x0de3, 0xcb3: 0x0c37, 0xcb4: 0x121b, 0xcb5: 0x0c57, + 0xcb6: 0x0fab, 0xcb7: 0x072b, 0xcb8: 0x07a7, 0xcb9: 0x07eb, 0xcba: 0x0d53, 0xcbb: 0x10fb, + 0xcbc: 0x11f3, 0xcbd: 0x1347, 0xcbe: 0x145b, 0xcbf: 0x085b, + // Block 0x33, offset 0xcc0 + 0xcc0: 0x090f, 0xcc1: 0x0a17, 0xcc2: 0x0b2f, 0xcc3: 0x0cbf, 0xcc4: 0x0e7b, 0xcc5: 0x103f, + 0xcc6: 0x1497, 0xcc7: 0x157b, 0xcc8: 0x15cf, 0xcc9: 0x15e7, 0xcca: 0x0837, 0xccb: 0x0cf3, + 0xccc: 0x0da3, 0xccd: 0x13eb, 0xcce: 0x0afb, 0xccf: 0x0bd7, 0xcd0: 0x0bf3, 0xcd1: 0x0c83, + 0xcd2: 0x0e6b, 0xcd3: 0x0eb7, 0xcd4: 0x0f67, 0xcd5: 0x108b, 0xcd6: 0x112f, 0xcd7: 0x1193, + 0xcd8: 0x13db, 0xcd9: 0x126b, 0xcda: 0x1403, 0xcdb: 0x147f, 0xcdc: 0x080f, 0xcdd: 0x083b, + 0xcde: 0x0923, 0xcdf: 0x0ea7, 0xce0: 0x12f3, 0xce1: 0x133b, 0xce2: 0x0b1b, 0xce3: 0x0b8b, + 0xce4: 0x0c4f, 0xce5: 0x0daf, 0xce6: 0x10d7, 0xce7: 0x0f23, 0xce8: 0x073b, 0xce9: 0x097f, + 0xcea: 0x0a63, 0xceb: 0x0ac7, 0xcec: 0x0b97, 0xced: 0x0f3f, 0xcee: 0x0f5b, 0xcef: 0x116b, + 0xcf0: 0x118b, 0xcf1: 0x1463, 0xcf2: 0x14e3, 0xcf3: 0x14f3, 0xcf4: 0x152f, 0xcf5: 0x0753, + 0xcf6: 0x107f, 0xcf7: 0x144f, 0xcf8: 0x14cb, 0xcf9: 0x0baf, 0xcfa: 0x0717, 0xcfb: 0x0777, + 0xcfc: 0x0a67, 0xcfd: 0x0a87, 0xcfe: 0x0caf, 0xcff: 0x0d73, + // Block 0x34, offset 0xd00 + 0xd00: 0x0ec3, 0xd01: 0x0fcb, 0xd02: 0x1277, 0xd03: 0x1417, 0xd04: 0x1623, 0xd05: 0x0ce3, + 0xd06: 0x14a3, 0xd07: 0x0833, 0xd08: 0x0d2f, 0xd09: 0x0d3b, 0xd0a: 0x0e0f, 0xd0b: 0x0e47, + 0xd0c: 0x0f4b, 0xd0d: 0x0fa7, 0xd0e: 0x1027, 0xd0f: 0x110b, 0xd10: 0x153b, 0xd11: 0x07af, + 0xd12: 0x0c03, 0xd13: 0x14b3, 0xd14: 0x0767, 0xd15: 0x0aab, 0xd16: 0x0e2f, 0xd17: 0x13df, + 0xd18: 0x0b67, 0xd19: 0x0bb7, 0xd1a: 0x0d43, 0xd1b: 0x0f2f, 0xd1c: 0x14bb, 0xd1d: 0x0817, + 0xd1e: 0x08ff, 0xd1f: 0x0a97, 0xd20: 0x0cd3, 0xd21: 0x0d1f, 0xd22: 0x0d5f, 0xd23: 0x0df3, + 0xd24: 0x0f47, 0xd25: 0x0fbb, 0xd26: 0x1157, 0xd27: 0x12f7, 0xd28: 0x1303, 0xd29: 0x1457, + 0xd2a: 0x14d7, 0xd2b: 0x0883, 0xd2c: 0x0e4b, 0xd2d: 0x0903, 0xd2e: 0x0ec7, 0xd2f: 0x0f6b, + 0xd30: 0x1287, 0xd31: 0x14bf, 0xd32: 0x15ab, 0xd33: 0x15d3, 0xd34: 0x0d37, 0xd35: 0x0e27, + 0xd36: 0x11c3, 0xd37: 0x10b7, 0xd38: 0x10c3, 0xd39: 0x10e7, 0xd3a: 0x0f17, 0xd3b: 0x0e9f, + 0xd3c: 0x1363, 0xd3d: 0x0733, 0xd3e: 0x122b, 0xd3f: 0x081b, + // Block 0x35, offset 0xd40 + 0xd40: 0x080b, 0xd41: 0x0b0b, 0xd42: 0x0c2b, 0xd43: 0x10f3, 0xd44: 0x0a53, 0xd45: 0x0e03, + 0xd46: 0x0cef, 0xd47: 0x13e7, 0xd48: 0x12e7, 0xd49: 0x14ab, 0xd4a: 0x1323, 0xd4b: 0x0b27, + 0xd4c: 0x0787, 0xd4d: 0x095b, 0xd50: 0x09af, + 0xd52: 0x0cdf, 0xd55: 0x07f7, 0xd56: 0x0f1f, 0xd57: 0x0fe3, + 0xd58: 0x1047, 0xd59: 0x1063, 0xd5a: 0x1067, 0xd5b: 0x107b, 0xd5c: 0x14fb, 0xd5d: 0x10eb, + 0xd5e: 0x116f, 0xd60: 0x128f, 0xd62: 0x1353, + 0xd65: 0x1407, 0xd66: 0x1433, + 0xd6a: 0x154f, 0xd6b: 0x1553, 0xd6c: 0x1557, 0xd6d: 0x15bb, 0xd6e: 0x142b, 0xd6f: 0x14c7, + 0xd70: 0x0757, 0xd71: 0x077b, 0xd72: 0x078f, 0xd73: 0x084b, 0xd74: 0x0857, 0xd75: 0x0897, + 0xd76: 0x094b, 0xd77: 0x0967, 0xd78: 0x096f, 0xd79: 0x09ab, 0xd7a: 0x09b7, 0xd7b: 0x0a93, + 0xd7c: 0x0a9b, 0xd7d: 0x0ba3, 0xd7e: 0x0bcb, 0xd7f: 0x0bd3, + // Block 0x36, offset 0xd80 + 0xd80: 0x0beb, 0xd81: 0x0c97, 0xd82: 0x0cc7, 0xd83: 0x0ce7, 0xd84: 0x0d57, 0xd85: 0x0e1b, + 0xd86: 0x0e37, 0xd87: 0x0e67, 0xd88: 0x0ebb, 0xd89: 0x0edb, 0xd8a: 0x0f4f, 0xd8b: 0x102f, + 0xd8c: 0x104b, 0xd8d: 0x1053, 0xd8e: 0x104f, 0xd8f: 0x1057, 0xd90: 0x105b, 0xd91: 0x105f, + 0xd92: 0x1073, 0xd93: 0x1077, 0xd94: 0x109b, 0xd95: 0x10af, 0xd96: 0x10cb, 0xd97: 0x112f, + 0xd98: 0x1137, 0xd99: 0x113f, 0xd9a: 0x1153, 0xd9b: 0x117b, 0xd9c: 0x11cb, 0xd9d: 0x11ff, + 0xd9e: 0x11ff, 0xd9f: 0x1267, 0xda0: 0x130f, 0xda1: 0x1327, 0xda2: 0x135b, 0xda3: 0x135f, + 0xda4: 0x13a3, 0xda5: 0x13a7, 0xda6: 0x13ff, 0xda7: 0x1407, 0xda8: 0x14db, 0xda9: 0x151f, + 0xdaa: 0x1537, 0xdab: 0x0b9b, 0xdac: 0x171e, 0xdad: 0x11e3, + 0xdb0: 0x06df, 0xdb1: 0x07e3, 0xdb2: 0x07a3, 0xdb3: 0x074b, 0xdb4: 0x078b, 0xdb5: 0x07b7, + 0xdb6: 0x0847, 0xdb7: 0x0863, 0xdb8: 0x094b, 0xdb9: 0x0937, 0xdba: 0x0947, 0xdbb: 0x0963, + 0xdbc: 0x09af, 0xdbd: 0x09bf, 0xdbe: 0x0a03, 0xdbf: 0x0a0f, + // Block 0x37, offset 0xdc0 + 0xdc0: 0x0a2b, 0xdc1: 0x0a3b, 0xdc2: 0x0b23, 0xdc3: 0x0b2b, 0xdc4: 0x0b5b, 0xdc5: 0x0b7b, + 0xdc6: 0x0bab, 0xdc7: 0x0bc3, 0xdc8: 0x0bb3, 0xdc9: 0x0bd3, 0xdca: 0x0bc7, 0xdcb: 0x0beb, + 0xdcc: 0x0c07, 0xdcd: 0x0c5f, 0xdce: 0x0c6b, 0xdcf: 0x0c73, 0xdd0: 0x0c9b, 0xdd1: 0x0cdf, + 0xdd2: 0x0d0f, 0xdd3: 0x0d13, 0xdd4: 0x0d27, 0xdd5: 0x0da7, 0xdd6: 0x0db7, 0xdd7: 0x0e0f, + 0xdd8: 0x0e5b, 0xdd9: 0x0e53, 0xdda: 0x0e67, 0xddb: 0x0e83, 0xddc: 0x0ebb, 0xddd: 0x1013, + 0xdde: 0x0edf, 0xddf: 0x0f13, 0xde0: 0x0f1f, 0xde1: 0x0f5f, 0xde2: 0x0f7b, 0xde3: 0x0f9f, + 0xde4: 0x0fc3, 0xde5: 0x0fc7, 0xde6: 0x0fe3, 0xde7: 0x0fe7, 0xde8: 0x0ff7, 0xde9: 0x100b, + 0xdea: 0x1007, 0xdeb: 0x1037, 0xdec: 0x10b3, 0xded: 0x10cb, 0xdee: 0x10e3, 0xdef: 0x111b, + 0xdf0: 0x112f, 0xdf1: 0x114b, 0xdf2: 0x117b, 0xdf3: 0x122f, 0xdf4: 0x1257, 0xdf5: 0x12cb, + 0xdf6: 0x1313, 0xdf7: 0x131f, 0xdf8: 0x1327, 0xdf9: 0x133f, 0xdfa: 0x1353, 0xdfb: 0x1343, + 0xdfc: 0x135b, 0xdfd: 0x1357, 0xdfe: 0x134f, 0xdff: 0x135f, + // Block 0x38, offset 0xe00 + 0xe00: 0x136b, 0xe01: 0x13a7, 0xe02: 0x13e3, 0xe03: 0x1413, 0xe04: 0x144b, 0xe05: 0x146b, + 0xe06: 0x14b7, 0xe07: 0x14db, 0xe08: 0x14fb, 0xe09: 0x150f, 0xe0a: 0x151f, 0xe0b: 0x152b, + 0xe0c: 0x1537, 0xe0d: 0x158b, 0xe0e: 0x162b, 0xe0f: 0x16b5, 0xe10: 0x16b0, 0xe11: 0x16e2, + 0xe12: 0x0607, 0xe13: 0x062f, 0xe14: 0x0633, 0xe15: 0x1764, 0xe16: 0x1791, 0xe17: 0x1809, + 0xe18: 0x1617, 0xe19: 0x1627, + // Block 0x39, offset 0xe40 + 0xe40: 0x19d5, 0xe41: 0x19d8, 0xe42: 0x19db, 0xe43: 0x1c08, 0xe44: 0x1c0c, 0xe45: 0x1a5f, + 0xe46: 0x1a5f, + 0xe53: 0x1d75, 0xe54: 0x1d66, 0xe55: 0x1d6b, 0xe56: 0x1d7a, 0xe57: 0x1d70, + 0xe5d: 0x4390, + 0xe5e: 0x8115, 0xe5f: 0x4402, 0xe60: 0x022d, 0xe61: 0x0215, 0xe62: 0x021e, 0xe63: 0x0221, + 0xe64: 0x0224, 0xe65: 0x0227, 0xe66: 0x022a, 0xe67: 0x0230, 0xe68: 0x0233, 0xe69: 0x0017, + 0xe6a: 0x43f0, 0xe6b: 0x43f6, 0xe6c: 0x44f4, 0xe6d: 0x44fc, 0xe6e: 0x4348, 0xe6f: 0x434e, + 0xe70: 0x4354, 0xe71: 0x435a, 0xe72: 0x4366, 0xe73: 0x436c, 0xe74: 0x4372, 0xe75: 0x437e, + 0xe76: 0x4384, 0xe78: 0x438a, 0xe79: 0x4396, 0xe7a: 0x439c, 0xe7b: 0x43a2, + 0xe7c: 0x43ae, 0xe7e: 0x43b4, + // Block 0x3a, offset 0xe80 + 0xe80: 0x43ba, 0xe81: 0x43c0, 0xe83: 0x43c6, 0xe84: 0x43cc, + 0xe86: 0x43d8, 0xe87: 0x43de, 0xe88: 0x43e4, 0xe89: 0x43ea, 0xe8a: 0x43fc, 0xe8b: 0x4378, + 0xe8c: 0x4360, 0xe8d: 0x43a8, 0xe8e: 0x43d2, 0xe8f: 0x1d7f, 0xe90: 0x0299, 0xe91: 0x0299, + 0xe92: 0x02a2, 0xe93: 0x02a2, 0xe94: 0x02a2, 0xe95: 0x02a2, 0xe96: 0x02a5, 0xe97: 0x02a5, + 0xe98: 0x02a5, 0xe99: 0x02a5, 0xe9a: 0x02ab, 0xe9b: 0x02ab, 0xe9c: 0x02ab, 0xe9d: 0x02ab, + 0xe9e: 0x029f, 0xe9f: 0x029f, 0xea0: 0x029f, 0xea1: 0x029f, 0xea2: 0x02a8, 0xea3: 0x02a8, + 0xea4: 0x02a8, 0xea5: 0x02a8, 0xea6: 0x029c, 0xea7: 0x029c, 0xea8: 0x029c, 0xea9: 0x029c, + 0xeaa: 0x02cf, 0xeab: 0x02cf, 0xeac: 0x02cf, 0xead: 0x02cf, 0xeae: 0x02d2, 0xeaf: 0x02d2, + 0xeb0: 0x02d2, 0xeb1: 0x02d2, 0xeb2: 0x02b1, 0xeb3: 0x02b1, 0xeb4: 0x02b1, 0xeb5: 0x02b1, + 0xeb6: 0x02ae, 0xeb7: 0x02ae, 0xeb8: 0x02ae, 0xeb9: 0x02ae, 0xeba: 0x02b4, 0xebb: 0x02b4, + 0xebc: 0x02b4, 0xebd: 0x02b4, 0xebe: 0x02b7, 0xebf: 0x02b7, + // Block 0x3b, offset 0xec0 + 0xec0: 0x02b7, 0xec1: 0x02b7, 0xec2: 0x02c0, 0xec3: 0x02c0, 0xec4: 0x02bd, 0xec5: 0x02bd, + 0xec6: 0x02c3, 0xec7: 0x02c3, 0xec8: 0x02ba, 0xec9: 0x02ba, 0xeca: 0x02c9, 0xecb: 0x02c9, + 0xecc: 0x02c6, 0xecd: 0x02c6, 0xece: 0x02d5, 0xecf: 0x02d5, 0xed0: 0x02d5, 0xed1: 0x02d5, + 0xed2: 0x02db, 0xed3: 0x02db, 0xed4: 0x02db, 0xed5: 0x02db, 0xed6: 0x02e1, 0xed7: 0x02e1, + 0xed8: 0x02e1, 0xed9: 0x02e1, 0xeda: 0x02de, 0xedb: 0x02de, 0xedc: 0x02de, 0xedd: 0x02de, + 0xede: 0x02e4, 0xedf: 0x02e4, 0xee0: 0x02e7, 0xee1: 0x02e7, 0xee2: 0x02e7, 0xee3: 0x02e7, + 0xee4: 0x446e, 0xee5: 0x446e, 0xee6: 0x02ed, 0xee7: 0x02ed, 0xee8: 0x02ed, 0xee9: 0x02ed, + 0xeea: 0x02ea, 0xeeb: 0x02ea, 0xeec: 0x02ea, 0xeed: 0x02ea, 0xeee: 0x0308, 0xeef: 0x0308, + 0xef0: 0x4468, 0xef1: 0x4468, + // Block 0x3c, offset 0xf00 + 0xf13: 0x02d8, 0xf14: 0x02d8, 0xf15: 0x02d8, 0xf16: 0x02d8, 0xf17: 0x02f6, + 0xf18: 0x02f6, 0xf19: 0x02f3, 0xf1a: 0x02f3, 0xf1b: 0x02f9, 0xf1c: 0x02f9, 0xf1d: 0x204f, + 0xf1e: 0x02ff, 0xf1f: 0x02ff, 0xf20: 0x02f0, 0xf21: 0x02f0, 0xf22: 0x02fc, 0xf23: 0x02fc, + 0xf24: 0x0305, 0xf25: 0x0305, 0xf26: 0x0305, 0xf27: 0x0305, 0xf28: 0x028d, 0xf29: 0x028d, + 0xf2a: 0x25aa, 0xf2b: 0x25aa, 0xf2c: 0x261a, 0xf2d: 0x261a, 0xf2e: 0x25e9, 0xf2f: 0x25e9, + 0xf30: 0x2605, 0xf31: 0x2605, 0xf32: 0x25fe, 0xf33: 0x25fe, 0xf34: 0x260c, 0xf35: 0x260c, + 0xf36: 0x2613, 0xf37: 0x2613, 0xf38: 0x2613, 0xf39: 0x25f0, 0xf3a: 0x25f0, 0xf3b: 0x25f0, + 0xf3c: 0x0302, 0xf3d: 0x0302, 0xf3e: 0x0302, 0xf3f: 0x0302, + // Block 0x3d, offset 0xf40 + 0xf40: 0x25b1, 0xf41: 0x25b8, 0xf42: 0x25d4, 0xf43: 0x25f0, 0xf44: 0x25f7, 0xf45: 0x1d89, + 0xf46: 0x1d8e, 0xf47: 0x1d93, 0xf48: 0x1da2, 0xf49: 0x1db1, 0xf4a: 0x1db6, 0xf4b: 0x1dbb, + 0xf4c: 0x1dc0, 0xf4d: 0x1dc5, 0xf4e: 0x1dd4, 0xf4f: 0x1de3, 0xf50: 0x1de8, 0xf51: 0x1ded, + 0xf52: 0x1dfc, 0xf53: 0x1e0b, 0xf54: 0x1e10, 0xf55: 0x1e15, 0xf56: 0x1e1a, 0xf57: 0x1e29, + 0xf58: 0x1e2e, 0xf59: 0x1e3d, 0xf5a: 0x1e42, 0xf5b: 0x1e47, 0xf5c: 0x1e56, 0xf5d: 0x1e5b, + 0xf5e: 0x1e60, 0xf5f: 0x1e6a, 0xf60: 0x1ea6, 0xf61: 0x1eb5, 0xf62: 0x1ec4, 0xf63: 0x1ec9, + 0xf64: 0x1ece, 0xf65: 0x1ed8, 0xf66: 0x1ee7, 0xf67: 0x1eec, 0xf68: 0x1efb, 0xf69: 0x1f00, + 0xf6a: 0x1f05, 0xf6b: 0x1f14, 0xf6c: 0x1f19, 0xf6d: 0x1f28, 0xf6e: 0x1f2d, 0xf6f: 0x1f32, + 0xf70: 0x1f37, 0xf71: 0x1f3c, 0xf72: 0x1f41, 0xf73: 0x1f46, 0xf74: 0x1f4b, 0xf75: 0x1f50, + 0xf76: 0x1f55, 0xf77: 0x1f5a, 0xf78: 0x1f5f, 0xf79: 0x1f64, 0xf7a: 0x1f69, 0xf7b: 0x1f6e, + 0xf7c: 0x1f73, 0xf7d: 0x1f78, 0xf7e: 0x1f7d, 0xf7f: 0x1f87, + // Block 0x3e, offset 0xf80 + 0xf80: 0x1f8c, 0xf81: 0x1f91, 0xf82: 0x1f96, 0xf83: 0x1fa0, 0xf84: 0x1fa5, 0xf85: 0x1faf, + 0xf86: 0x1fb4, 0xf87: 0x1fb9, 0xf88: 0x1fbe, 0xf89: 0x1fc3, 0xf8a: 0x1fc8, 0xf8b: 0x1fcd, + 0xf8c: 0x1fd2, 0xf8d: 0x1fd7, 0xf8e: 0x1fe6, 0xf8f: 0x1ff5, 0xf90: 0x1ffa, 0xf91: 0x1fff, + 0xf92: 0x2004, 0xf93: 0x2009, 0xf94: 0x200e, 0xf95: 0x2018, 0xf96: 0x201d, 0xf97: 0x2022, + 0xf98: 0x2031, 0xf99: 0x2040, 0xf9a: 0x2045, 0xf9b: 0x4420, 0xf9c: 0x4426, 0xf9d: 0x445c, + 0xf9e: 0x44b3, 0xf9f: 0x44ba, 0xfa0: 0x44c1, 0xfa1: 0x44c8, 0xfa2: 0x44cf, 0xfa3: 0x44d6, + 0xfa4: 0x25c6, 0xfa5: 0x25cd, 0xfa6: 0x25d4, 0xfa7: 0x25db, 0xfa8: 0x25f0, 0xfa9: 0x25f7, + 0xfaa: 0x1d98, 0xfab: 0x1d9d, 0xfac: 0x1da2, 0xfad: 0x1da7, 0xfae: 0x1db1, 0xfaf: 0x1db6, + 0xfb0: 0x1dca, 0xfb1: 0x1dcf, 0xfb2: 0x1dd4, 0xfb3: 0x1dd9, 0xfb4: 0x1de3, 0xfb5: 0x1de8, + 0xfb6: 0x1df2, 0xfb7: 0x1df7, 0xfb8: 0x1dfc, 0xfb9: 0x1e01, 0xfba: 0x1e0b, 0xfbb: 0x1e10, + 0xfbc: 0x1f3c, 0xfbd: 0x1f41, 0xfbe: 0x1f50, 0xfbf: 0x1f55, + // Block 0x3f, offset 0xfc0 + 0xfc0: 0x1f5a, 0xfc1: 0x1f6e, 0xfc2: 0x1f73, 0xfc3: 0x1f78, 0xfc4: 0x1f7d, 0xfc5: 0x1f96, + 0xfc6: 0x1fa0, 0xfc7: 0x1fa5, 0xfc8: 0x1faa, 0xfc9: 0x1fbe, 0xfca: 0x1fdc, 0xfcb: 0x1fe1, + 0xfcc: 0x1fe6, 0xfcd: 0x1feb, 0xfce: 0x1ff5, 0xfcf: 0x1ffa, 0xfd0: 0x445c, 0xfd1: 0x2027, + 0xfd2: 0x202c, 0xfd3: 0x2031, 0xfd4: 0x2036, 0xfd5: 0x2040, 0xfd6: 0x2045, 0xfd7: 0x25b1, + 0xfd8: 0x25b8, 0xfd9: 0x25bf, 0xfda: 0x25d4, 0xfdb: 0x25e2, 0xfdc: 0x1d89, 0xfdd: 0x1d8e, + 0xfde: 0x1d93, 0xfdf: 0x1da2, 0xfe0: 0x1dac, 0xfe1: 0x1dbb, 0xfe2: 0x1dc0, 0xfe3: 0x1dc5, + 0xfe4: 0x1dd4, 0xfe5: 0x1dde, 0xfe6: 0x1dfc, 0xfe7: 0x1e15, 0xfe8: 0x1e1a, 0xfe9: 0x1e29, + 0xfea: 0x1e2e, 0xfeb: 0x1e3d, 0xfec: 0x1e47, 0xfed: 0x1e56, 0xfee: 0x1e5b, 0xfef: 0x1e60, + 0xff0: 0x1e6a, 0xff1: 0x1ea6, 0xff2: 0x1eab, 0xff3: 0x1eb5, 0xff4: 0x1ec4, 0xff5: 0x1ec9, + 0xff6: 0x1ece, 0xff7: 0x1ed8, 0xff8: 0x1ee7, 0xff9: 0x1efb, 0xffa: 0x1f00, 0xffb: 0x1f05, + 0xffc: 0x1f14, 0xffd: 0x1f19, 0xffe: 0x1f28, 0xfff: 0x1f2d, + // Block 0x40, offset 0x1000 + 0x1000: 0x1f32, 0x1001: 0x1f37, 0x1002: 0x1f46, 0x1003: 0x1f4b, 0x1004: 0x1f5f, 0x1005: 0x1f64, + 0x1006: 0x1f69, 0x1007: 0x1f6e, 0x1008: 0x1f73, 0x1009: 0x1f87, 0x100a: 0x1f8c, 0x100b: 0x1f91, + 0x100c: 0x1f96, 0x100d: 0x1f9b, 0x100e: 0x1faf, 0x100f: 0x1fb4, 0x1010: 0x1fb9, 0x1011: 0x1fbe, + 0x1012: 0x1fcd, 0x1013: 0x1fd2, 0x1014: 0x1fd7, 0x1015: 0x1fe6, 0x1016: 0x1ff0, 0x1017: 0x1fff, + 0x1018: 0x2004, 0x1019: 0x4450, 0x101a: 0x2018, 0x101b: 0x201d, 0x101c: 0x2022, 0x101d: 0x2031, + 0x101e: 0x203b, 0x101f: 0x25d4, 0x1020: 0x25e2, 0x1021: 0x1da2, 0x1022: 0x1dac, 0x1023: 0x1dd4, + 0x1024: 0x1dde, 0x1025: 0x1dfc, 0x1026: 0x1e06, 0x1027: 0x1e6a, 0x1028: 0x1e6f, 0x1029: 0x1e92, + 0x102a: 0x1e97, 0x102b: 0x1f6e, 0x102c: 0x1f73, 0x102d: 0x1f96, 0x102e: 0x1fe6, 0x102f: 0x1ff0, + 0x1030: 0x2031, 0x1031: 0x203b, 0x1032: 0x4504, 0x1033: 0x450c, 0x1034: 0x4514, 0x1035: 0x1ef1, + 0x1036: 0x1ef6, 0x1037: 0x1f0a, 0x1038: 0x1f0f, 0x1039: 0x1f1e, 0x103a: 0x1f23, 0x103b: 0x1e74, + 0x103c: 0x1e79, 0x103d: 0x1e9c, 0x103e: 0x1ea1, 0x103f: 0x1e33, + // Block 0x41, offset 0x1040 + 0x1040: 0x1e38, 0x1041: 0x1e1f, 0x1042: 0x1e24, 0x1043: 0x1e4c, 0x1044: 0x1e51, 0x1045: 0x1eba, + 0x1046: 0x1ebf, 0x1047: 0x1edd, 0x1048: 0x1ee2, 0x1049: 0x1e7e, 0x104a: 0x1e83, 0x104b: 0x1e88, + 0x104c: 0x1e92, 0x104d: 0x1e8d, 0x104e: 0x1e65, 0x104f: 0x1eb0, 0x1050: 0x1ed3, 0x1051: 0x1ef1, + 0x1052: 0x1ef6, 0x1053: 0x1f0a, 0x1054: 0x1f0f, 0x1055: 0x1f1e, 0x1056: 0x1f23, 0x1057: 0x1e74, + 0x1058: 0x1e79, 0x1059: 0x1e9c, 0x105a: 0x1ea1, 0x105b: 0x1e33, 0x105c: 0x1e38, 0x105d: 0x1e1f, + 0x105e: 0x1e24, 0x105f: 0x1e4c, 0x1060: 0x1e51, 0x1061: 0x1eba, 0x1062: 0x1ebf, 0x1063: 0x1edd, + 0x1064: 0x1ee2, 0x1065: 0x1e7e, 0x1066: 0x1e83, 0x1067: 0x1e88, 0x1068: 0x1e92, 0x1069: 0x1e8d, + 0x106a: 0x1e65, 0x106b: 0x1eb0, 0x106c: 0x1ed3, 0x106d: 0x1e7e, 0x106e: 0x1e83, 0x106f: 0x1e88, + 0x1070: 0x1e92, 0x1071: 0x1e6f, 0x1072: 0x1e97, 0x1073: 0x1eec, 0x1074: 0x1e56, 0x1075: 0x1e5b, + 0x1076: 0x1e60, 0x1077: 0x1e7e, 0x1078: 0x1e83, 0x1079: 0x1e88, 0x107a: 0x1eec, 0x107b: 0x1efb, + 0x107c: 0x4408, 0x107d: 0x4408, + // Block 0x42, offset 0x1080 + 0x1090: 0x2311, 0x1091: 0x2326, + 0x1092: 0x2326, 0x1093: 0x232d, 0x1094: 0x2334, 0x1095: 0x2349, 0x1096: 0x2350, 0x1097: 0x2357, + 0x1098: 0x237a, 0x1099: 0x237a, 0x109a: 0x239d, 0x109b: 0x2396, 0x109c: 0x23b2, 0x109d: 0x23a4, + 0x109e: 0x23ab, 0x109f: 0x23ce, 0x10a0: 0x23ce, 0x10a1: 0x23c7, 0x10a2: 0x23d5, 0x10a3: 0x23d5, + 0x10a4: 0x23ff, 0x10a5: 0x23ff, 0x10a6: 0x241b, 0x10a7: 0x23e3, 0x10a8: 0x23e3, 0x10a9: 0x23dc, + 0x10aa: 0x23f1, 0x10ab: 0x23f1, 0x10ac: 0x23f8, 0x10ad: 0x23f8, 0x10ae: 0x2422, 0x10af: 0x2430, + 0x10b0: 0x2430, 0x10b1: 0x2437, 0x10b2: 0x2437, 0x10b3: 0x243e, 0x10b4: 0x2445, 0x10b5: 0x244c, + 0x10b6: 0x2453, 0x10b7: 0x2453, 0x10b8: 0x245a, 0x10b9: 0x2468, 0x10ba: 0x2476, 0x10bb: 0x246f, + 0x10bc: 0x247d, 0x10bd: 0x247d, 0x10be: 0x2492, 0x10bf: 0x2499, + // Block 0x43, offset 0x10c0 + 0x10c0: 0x24ca, 0x10c1: 0x24d8, 0x10c2: 0x24d1, 0x10c3: 0x24b5, 0x10c4: 0x24b5, 0x10c5: 0x24df, + 0x10c6: 0x24df, 0x10c7: 0x24e6, 0x10c8: 0x24e6, 0x10c9: 0x2510, 0x10ca: 0x2517, 0x10cb: 0x251e, + 0x10cc: 0x24f4, 0x10cd: 0x2502, 0x10ce: 0x2525, 0x10cf: 0x252c, + 0x10d2: 0x24fb, 0x10d3: 0x2580, 0x10d4: 0x2587, 0x10d5: 0x255d, 0x10d6: 0x2564, 0x10d7: 0x2548, + 0x10d8: 0x2548, 0x10d9: 0x254f, 0x10da: 0x2579, 0x10db: 0x2572, 0x10dc: 0x259c, 0x10dd: 0x259c, + 0x10de: 0x230a, 0x10df: 0x231f, 0x10e0: 0x2318, 0x10e1: 0x2342, 0x10e2: 0x233b, 0x10e3: 0x2365, + 0x10e4: 0x235e, 0x10e5: 0x2388, 0x10e6: 0x236c, 0x10e7: 0x2381, 0x10e8: 0x23b9, 0x10e9: 0x2406, + 0x10ea: 0x23ea, 0x10eb: 0x2429, 0x10ec: 0x24c3, 0x10ed: 0x24ed, 0x10ee: 0x2595, 0x10ef: 0x258e, + 0x10f0: 0x25a3, 0x10f1: 0x253a, 0x10f2: 0x24a0, 0x10f3: 0x256b, 0x10f4: 0x2492, 0x10f5: 0x24ca, + 0x10f6: 0x2461, 0x10f7: 0x24ae, 0x10f8: 0x2541, 0x10f9: 0x2533, 0x10fa: 0x24bc, 0x10fb: 0x24a7, + 0x10fc: 0x24bc, 0x10fd: 0x2541, 0x10fe: 0x2373, 0x10ff: 0x238f, + // Block 0x44, offset 0x1100 + 0x1100: 0x2509, 0x1101: 0x2484, 0x1102: 0x2303, 0x1103: 0x24a7, 0x1104: 0x244c, 0x1105: 0x241b, + 0x1106: 0x23c0, 0x1107: 0x2556, + 0x1130: 0x2414, 0x1131: 0x248b, 0x1132: 0x27bf, 0x1133: 0x27b6, 0x1134: 0x27ec, 0x1135: 0x27da, + 0x1136: 0x27c8, 0x1137: 0x27e3, 0x1138: 0x27f5, 0x1139: 0x240d, 0x113a: 0x2c7c, 0x113b: 0x2afc, + 0x113c: 0x27d1, + // Block 0x45, offset 0x1140 + 0x1150: 0x0019, 0x1151: 0x0483, + 0x1152: 0x0487, 0x1153: 0x0035, 0x1154: 0x0037, 0x1155: 0x0003, 0x1156: 0x003f, 0x1157: 0x04bf, + 0x1158: 0x04c3, 0x1159: 0x1b5c, + 0x1160: 0x8132, 0x1161: 0x8132, 0x1162: 0x8132, 0x1163: 0x8132, + 0x1164: 0x8132, 0x1165: 0x8132, 0x1166: 0x8132, 0x1167: 0x812d, 0x1168: 0x812d, 0x1169: 0x812d, + 0x116a: 0x812d, 0x116b: 0x812d, 0x116c: 0x812d, 0x116d: 0x812d, 0x116e: 0x8132, 0x116f: 0x8132, + 0x1170: 0x1873, 0x1171: 0x0443, 0x1172: 0x043f, 0x1173: 0x007f, 0x1174: 0x007f, 0x1175: 0x0011, + 0x1176: 0x0013, 0x1177: 0x00b7, 0x1178: 0x00bb, 0x1179: 0x04b7, 0x117a: 0x04bb, 0x117b: 0x04ab, + 0x117c: 0x04af, 0x117d: 0x0493, 0x117e: 0x0497, 0x117f: 0x048b, + // Block 0x46, offset 0x1180 + 0x1180: 0x048f, 0x1181: 0x049b, 0x1182: 0x049f, 0x1183: 0x04a3, 0x1184: 0x04a7, + 0x1187: 0x0077, 0x1188: 0x007b, 0x1189: 0x4269, 0x118a: 0x4269, 0x118b: 0x4269, + 0x118c: 0x4269, 0x118d: 0x007f, 0x118e: 0x007f, 0x118f: 0x007f, 0x1190: 0x0019, 0x1191: 0x0483, + 0x1192: 0x001d, 0x1194: 0x0037, 0x1195: 0x0035, 0x1196: 0x003f, 0x1197: 0x0003, + 0x1198: 0x0443, 0x1199: 0x0011, 0x119a: 0x0013, 0x119b: 0x00b7, 0x119c: 0x00bb, 0x119d: 0x04b7, + 0x119e: 0x04bb, 0x119f: 0x0007, 0x11a0: 0x000d, 0x11a1: 0x0015, 0x11a2: 0x0017, 0x11a3: 0x001b, + 0x11a4: 0x0039, 0x11a5: 0x003d, 0x11a6: 0x003b, 0x11a8: 0x0079, 0x11a9: 0x0009, + 0x11aa: 0x000b, 0x11ab: 0x0041, + 0x11b0: 0x42aa, 0x11b1: 0x442c, 0x11b2: 0x42af, 0x11b4: 0x42b4, + 0x11b6: 0x42b9, 0x11b7: 0x4432, 0x11b8: 0x42be, 0x11b9: 0x4438, 0x11ba: 0x42c3, 0x11bb: 0x443e, + 0x11bc: 0x42c8, 0x11bd: 0x4444, 0x11be: 0x42cd, 0x11bf: 0x444a, + // Block 0x47, offset 0x11c0 + 0x11c0: 0x0236, 0x11c1: 0x440e, 0x11c2: 0x440e, 0x11c3: 0x4414, 0x11c4: 0x4414, 0x11c5: 0x4456, + 0x11c6: 0x4456, 0x11c7: 0x441a, 0x11c8: 0x441a, 0x11c9: 0x4462, 0x11ca: 0x4462, 0x11cb: 0x4462, + 0x11cc: 0x4462, 0x11cd: 0x0239, 0x11ce: 0x0239, 0x11cf: 0x023c, 0x11d0: 0x023c, 0x11d1: 0x023c, + 0x11d2: 0x023c, 0x11d3: 0x023f, 0x11d4: 0x023f, 0x11d5: 0x0242, 0x11d6: 0x0242, 0x11d7: 0x0242, + 0x11d8: 0x0242, 0x11d9: 0x0245, 0x11da: 0x0245, 0x11db: 0x0245, 0x11dc: 0x0245, 0x11dd: 0x0248, + 0x11de: 0x0248, 0x11df: 0x0248, 0x11e0: 0x0248, 0x11e1: 0x024b, 0x11e2: 0x024b, 0x11e3: 0x024b, + 0x11e4: 0x024b, 0x11e5: 0x024e, 0x11e6: 0x024e, 0x11e7: 0x024e, 0x11e8: 0x024e, 0x11e9: 0x0251, + 0x11ea: 0x0251, 0x11eb: 0x0254, 0x11ec: 0x0254, 0x11ed: 0x0257, 0x11ee: 0x0257, 0x11ef: 0x025a, + 0x11f0: 0x025a, 0x11f1: 0x025d, 0x11f2: 0x025d, 0x11f3: 0x025d, 0x11f4: 0x025d, 0x11f5: 0x0260, + 0x11f6: 0x0260, 0x11f7: 0x0260, 0x11f8: 0x0260, 0x11f9: 0x0263, 0x11fa: 0x0263, 0x11fb: 0x0263, + 0x11fc: 0x0263, 0x11fd: 0x0266, 0x11fe: 0x0266, 0x11ff: 0x0266, + // Block 0x48, offset 0x1200 + 0x1200: 0x0266, 0x1201: 0x0269, 0x1202: 0x0269, 0x1203: 0x0269, 0x1204: 0x0269, 0x1205: 0x026c, + 0x1206: 0x026c, 0x1207: 0x026c, 0x1208: 0x026c, 0x1209: 0x026f, 0x120a: 0x026f, 0x120b: 0x026f, + 0x120c: 0x026f, 0x120d: 0x0272, 0x120e: 0x0272, 0x120f: 0x0272, 0x1210: 0x0272, 0x1211: 0x0275, + 0x1212: 0x0275, 0x1213: 0x0275, 0x1214: 0x0275, 0x1215: 0x0278, 0x1216: 0x0278, 0x1217: 0x0278, + 0x1218: 0x0278, 0x1219: 0x027b, 0x121a: 0x027b, 0x121b: 0x027b, 0x121c: 0x027b, 0x121d: 0x027e, + 0x121e: 0x027e, 0x121f: 0x027e, 0x1220: 0x027e, 0x1221: 0x0281, 0x1222: 0x0281, 0x1223: 0x0281, + 0x1224: 0x0281, 0x1225: 0x0284, 0x1226: 0x0284, 0x1227: 0x0284, 0x1228: 0x0284, 0x1229: 0x0287, + 0x122a: 0x0287, 0x122b: 0x0287, 0x122c: 0x0287, 0x122d: 0x028a, 0x122e: 0x028a, 0x122f: 0x028d, + 0x1230: 0x028d, 0x1231: 0x0290, 0x1232: 0x0290, 0x1233: 0x0290, 0x1234: 0x0290, 0x1235: 0x2e00, + 0x1236: 0x2e00, 0x1237: 0x2e08, 0x1238: 0x2e08, 0x1239: 0x2e10, 0x123a: 0x2e10, 0x123b: 0x1f82, + 0x123c: 0x1f82, + // Block 0x49, offset 0x1240 + 0x1240: 0x0081, 0x1241: 0x0083, 0x1242: 0x0085, 0x1243: 0x0087, 0x1244: 0x0089, 0x1245: 0x008b, + 0x1246: 0x008d, 0x1247: 0x008f, 0x1248: 0x0091, 0x1249: 0x0093, 0x124a: 0x0095, 0x124b: 0x0097, + 0x124c: 0x0099, 0x124d: 0x009b, 0x124e: 0x009d, 0x124f: 0x009f, 0x1250: 0x00a1, 0x1251: 0x00a3, + 0x1252: 0x00a5, 0x1253: 0x00a7, 0x1254: 0x00a9, 0x1255: 0x00ab, 0x1256: 0x00ad, 0x1257: 0x00af, + 0x1258: 0x00b1, 0x1259: 0x00b3, 0x125a: 0x00b5, 0x125b: 0x00b7, 0x125c: 0x00b9, 0x125d: 0x00bb, + 0x125e: 0x00bd, 0x125f: 0x0477, 0x1260: 0x047b, 0x1261: 0x0487, 0x1262: 0x049b, 0x1263: 0x049f, + 0x1264: 0x0483, 0x1265: 0x05ab, 0x1266: 0x05a3, 0x1267: 0x04c7, 0x1268: 0x04cf, 0x1269: 0x04d7, + 0x126a: 0x04df, 0x126b: 0x04e7, 0x126c: 0x056b, 0x126d: 0x0573, 0x126e: 0x057b, 0x126f: 0x051f, + 0x1270: 0x05af, 0x1271: 0x04cb, 0x1272: 0x04d3, 0x1273: 0x04db, 0x1274: 0x04e3, 0x1275: 0x04eb, + 0x1276: 0x04ef, 0x1277: 0x04f3, 0x1278: 0x04f7, 0x1279: 0x04fb, 0x127a: 0x04ff, 0x127b: 0x0503, + 0x127c: 0x0507, 0x127d: 0x050b, 0x127e: 0x050f, 0x127f: 0x0513, + // Block 0x4a, offset 0x1280 + 0x1280: 0x0517, 0x1281: 0x051b, 0x1282: 0x0523, 0x1283: 0x0527, 0x1284: 0x052b, 0x1285: 0x052f, + 0x1286: 0x0533, 0x1287: 0x0537, 0x1288: 0x053b, 0x1289: 0x053f, 0x128a: 0x0543, 0x128b: 0x0547, + 0x128c: 0x054b, 0x128d: 0x054f, 0x128e: 0x0553, 0x128f: 0x0557, 0x1290: 0x055b, 0x1291: 0x055f, + 0x1292: 0x0563, 0x1293: 0x0567, 0x1294: 0x056f, 0x1295: 0x0577, 0x1296: 0x057f, 0x1297: 0x0583, + 0x1298: 0x0587, 0x1299: 0x058b, 0x129a: 0x058f, 0x129b: 0x0593, 0x129c: 0x0597, 0x129d: 0x05a7, + 0x129e: 0x4a78, 0x129f: 0x4a7e, 0x12a0: 0x03c3, 0x12a1: 0x0313, 0x12a2: 0x0317, 0x12a3: 0x4a3b, + 0x12a4: 0x031b, 0x12a5: 0x4a41, 0x12a6: 0x4a47, 0x12a7: 0x031f, 0x12a8: 0x0323, 0x12a9: 0x0327, + 0x12aa: 0x4a4d, 0x12ab: 0x4a53, 0x12ac: 0x4a59, 0x12ad: 0x4a5f, 0x12ae: 0x4a65, 0x12af: 0x4a6b, + 0x12b0: 0x0367, 0x12b1: 0x032b, 0x12b2: 0x032f, 0x12b3: 0x0333, 0x12b4: 0x037b, 0x12b5: 0x0337, + 0x12b6: 0x033b, 0x12b7: 0x033f, 0x12b8: 0x0343, 0x12b9: 0x0347, 0x12ba: 0x034b, 0x12bb: 0x034f, + 0x12bc: 0x0353, 0x12bd: 0x0357, 0x12be: 0x035b, + // Block 0x4b, offset 0x12c0 + 0x12c2: 0x49bd, 0x12c3: 0x49c3, 0x12c4: 0x49c9, 0x12c5: 0x49cf, + 0x12c6: 0x49d5, 0x12c7: 0x49db, 0x12ca: 0x49e1, 0x12cb: 0x49e7, + 0x12cc: 0x49ed, 0x12cd: 0x49f3, 0x12ce: 0x49f9, 0x12cf: 0x49ff, + 0x12d2: 0x4a05, 0x12d3: 0x4a0b, 0x12d4: 0x4a11, 0x12d5: 0x4a17, 0x12d6: 0x4a1d, 0x12d7: 0x4a23, + 0x12da: 0x4a29, 0x12db: 0x4a2f, 0x12dc: 0x4a35, + 0x12e0: 0x00bf, 0x12e1: 0x00c2, 0x12e2: 0x00cb, 0x12e3: 0x4264, + 0x12e4: 0x00c8, 0x12e5: 0x00c5, 0x12e6: 0x0447, 0x12e8: 0x046b, 0x12e9: 0x044b, + 0x12ea: 0x044f, 0x12eb: 0x0453, 0x12ec: 0x0457, 0x12ed: 0x046f, 0x12ee: 0x0473, + // Block 0x4c, offset 0x1300 + 0x1300: 0x0063, 0x1301: 0x0065, 0x1302: 0x0067, 0x1303: 0x0069, 0x1304: 0x006b, 0x1305: 0x006d, + 0x1306: 0x006f, 0x1307: 0x0071, 0x1308: 0x0073, 0x1309: 0x0075, 0x130a: 0x0083, 0x130b: 0x0085, + 0x130c: 0x0087, 0x130d: 0x0089, 0x130e: 0x008b, 0x130f: 0x008d, 0x1310: 0x008f, 0x1311: 0x0091, + 0x1312: 0x0093, 0x1313: 0x0095, 0x1314: 0x0097, 0x1315: 0x0099, 0x1316: 0x009b, 0x1317: 0x009d, + 0x1318: 0x009f, 0x1319: 0x00a1, 0x131a: 0x00a3, 0x131b: 0x00a5, 0x131c: 0x00a7, 0x131d: 0x00a9, + 0x131e: 0x00ab, 0x131f: 0x00ad, 0x1320: 0x00af, 0x1321: 0x00b1, 0x1322: 0x00b3, 0x1323: 0x00b5, + 0x1324: 0x00dd, 0x1325: 0x00f2, 0x1328: 0x0173, 0x1329: 0x0176, + 0x132a: 0x0179, 0x132b: 0x017c, 0x132c: 0x017f, 0x132d: 0x0182, 0x132e: 0x0185, 0x132f: 0x0188, + 0x1330: 0x018b, 0x1331: 0x018e, 0x1332: 0x0191, 0x1333: 0x0194, 0x1334: 0x0197, 0x1335: 0x019a, + 0x1336: 0x019d, 0x1337: 0x01a0, 0x1338: 0x01a3, 0x1339: 0x0188, 0x133a: 0x01a6, 0x133b: 0x01a9, + 0x133c: 0x01ac, 0x133d: 0x01af, 0x133e: 0x01b2, 0x133f: 0x01b5, + // Block 0x4d, offset 0x1340 + 0x1340: 0x01fd, 0x1341: 0x0200, 0x1342: 0x0203, 0x1343: 0x045b, 0x1344: 0x01c7, 0x1345: 0x01d0, + 0x1346: 0x01d6, 0x1347: 0x01fa, 0x1348: 0x01eb, 0x1349: 0x01e8, 0x134a: 0x0206, 0x134b: 0x0209, + 0x134e: 0x0021, 0x134f: 0x0023, 0x1350: 0x0025, 0x1351: 0x0027, + 0x1352: 0x0029, 0x1353: 0x002b, 0x1354: 0x002d, 0x1355: 0x002f, 0x1356: 0x0031, 0x1357: 0x0033, + 0x1358: 0x0021, 0x1359: 0x0023, 0x135a: 0x0025, 0x135b: 0x0027, 0x135c: 0x0029, 0x135d: 0x002b, + 0x135e: 0x002d, 0x135f: 0x002f, 0x1360: 0x0031, 0x1361: 0x0033, 0x1362: 0x0021, 0x1363: 0x0023, + 0x1364: 0x0025, 0x1365: 0x0027, 0x1366: 0x0029, 0x1367: 0x002b, 0x1368: 0x002d, 0x1369: 0x002f, + 0x136a: 0x0031, 0x136b: 0x0033, 0x136c: 0x0021, 0x136d: 0x0023, 0x136e: 0x0025, 0x136f: 0x0027, + 0x1370: 0x0029, 0x1371: 0x002b, 0x1372: 0x002d, 0x1373: 0x002f, 0x1374: 0x0031, 0x1375: 0x0033, + 0x1376: 0x0021, 0x1377: 0x0023, 0x1378: 0x0025, 0x1379: 0x0027, 0x137a: 0x0029, 0x137b: 0x002b, + 0x137c: 0x002d, 0x137d: 0x002f, 0x137e: 0x0031, 0x137f: 0x0033, + // Block 0x4e, offset 0x1380 + 0x1380: 0x0239, 0x1381: 0x023c, 0x1382: 0x0248, 0x1383: 0x0251, 0x1385: 0x028a, + 0x1386: 0x025a, 0x1387: 0x024b, 0x1388: 0x0269, 0x1389: 0x0290, 0x138a: 0x027b, 0x138b: 0x027e, + 0x138c: 0x0281, 0x138d: 0x0284, 0x138e: 0x025d, 0x138f: 0x026f, 0x1390: 0x0275, 0x1391: 0x0263, + 0x1392: 0x0278, 0x1393: 0x0257, 0x1394: 0x0260, 0x1395: 0x0242, 0x1396: 0x0245, 0x1397: 0x024e, + 0x1398: 0x0254, 0x1399: 0x0266, 0x139a: 0x026c, 0x139b: 0x0272, 0x139c: 0x0293, 0x139d: 0x02e4, + 0x139e: 0x02cc, 0x139f: 0x0296, 0x13a1: 0x023c, 0x13a2: 0x0248, + 0x13a4: 0x0287, 0x13a7: 0x024b, 0x13a9: 0x0290, + 0x13aa: 0x027b, 0x13ab: 0x027e, 0x13ac: 0x0281, 0x13ad: 0x0284, 0x13ae: 0x025d, 0x13af: 0x026f, + 0x13b0: 0x0275, 0x13b1: 0x0263, 0x13b2: 0x0278, 0x13b4: 0x0260, 0x13b5: 0x0242, + 0x13b6: 0x0245, 0x13b7: 0x024e, 0x13b9: 0x0266, 0x13bb: 0x0272, + // Block 0x4f, offset 0x13c0 + 0x13c2: 0x0248, + 0x13c7: 0x024b, 0x13c9: 0x0290, 0x13cb: 0x027e, + 0x13cd: 0x0284, 0x13ce: 0x025d, 0x13cf: 0x026f, 0x13d1: 0x0263, + 0x13d2: 0x0278, 0x13d4: 0x0260, 0x13d7: 0x024e, + 0x13d9: 0x0266, 0x13db: 0x0272, 0x13dd: 0x02e4, + 0x13df: 0x0296, 0x13e1: 0x023c, 0x13e2: 0x0248, + 0x13e4: 0x0287, 0x13e7: 0x024b, 0x13e8: 0x0269, 0x13e9: 0x0290, + 0x13ea: 0x027b, 0x13ec: 0x0281, 0x13ed: 0x0284, 0x13ee: 0x025d, 0x13ef: 0x026f, + 0x13f0: 0x0275, 0x13f1: 0x0263, 0x13f2: 0x0278, 0x13f4: 0x0260, 0x13f5: 0x0242, + 0x13f6: 0x0245, 0x13f7: 0x024e, 0x13f9: 0x0266, 0x13fa: 0x026c, 0x13fb: 0x0272, + 0x13fc: 0x0293, 0x13fe: 0x02cc, + // Block 0x50, offset 0x1400 + 0x1400: 0x0239, 0x1401: 0x023c, 0x1402: 0x0248, 0x1403: 0x0251, 0x1404: 0x0287, 0x1405: 0x028a, + 0x1406: 0x025a, 0x1407: 0x024b, 0x1408: 0x0269, 0x1409: 0x0290, 0x140b: 0x027e, + 0x140c: 0x0281, 0x140d: 0x0284, 0x140e: 0x025d, 0x140f: 0x026f, 0x1410: 0x0275, 0x1411: 0x0263, + 0x1412: 0x0278, 0x1413: 0x0257, 0x1414: 0x0260, 0x1415: 0x0242, 0x1416: 0x0245, 0x1417: 0x024e, + 0x1418: 0x0254, 0x1419: 0x0266, 0x141a: 0x026c, 0x141b: 0x0272, + 0x1421: 0x023c, 0x1422: 0x0248, 0x1423: 0x0251, + 0x1425: 0x028a, 0x1426: 0x025a, 0x1427: 0x024b, 0x1428: 0x0269, 0x1429: 0x0290, + 0x142b: 0x027e, 0x142c: 0x0281, 0x142d: 0x0284, 0x142e: 0x025d, 0x142f: 0x026f, + 0x1430: 0x0275, 0x1431: 0x0263, 0x1432: 0x0278, 0x1433: 0x0257, 0x1434: 0x0260, 0x1435: 0x0242, + 0x1436: 0x0245, 0x1437: 0x024e, 0x1438: 0x0254, 0x1439: 0x0266, 0x143a: 0x026c, 0x143b: 0x0272, + // Block 0x51, offset 0x1440 + 0x1440: 0x1879, 0x1441: 0x1876, 0x1442: 0x187c, 0x1443: 0x18a0, 0x1444: 0x18c4, 0x1445: 0x18e8, + 0x1446: 0x190c, 0x1447: 0x1915, 0x1448: 0x191b, 0x1449: 0x1921, 0x144a: 0x1927, + 0x1450: 0x1a8c, 0x1451: 0x1a90, + 0x1452: 0x1a94, 0x1453: 0x1a98, 0x1454: 0x1a9c, 0x1455: 0x1aa0, 0x1456: 0x1aa4, 0x1457: 0x1aa8, + 0x1458: 0x1aac, 0x1459: 0x1ab0, 0x145a: 0x1ab4, 0x145b: 0x1ab8, 0x145c: 0x1abc, 0x145d: 0x1ac0, + 0x145e: 0x1ac4, 0x145f: 0x1ac8, 0x1460: 0x1acc, 0x1461: 0x1ad0, 0x1462: 0x1ad4, 0x1463: 0x1ad8, + 0x1464: 0x1adc, 0x1465: 0x1ae0, 0x1466: 0x1ae4, 0x1467: 0x1ae8, 0x1468: 0x1aec, 0x1469: 0x1af0, + 0x146a: 0x271e, 0x146b: 0x0047, 0x146c: 0x0065, 0x146d: 0x193c, 0x146e: 0x19b1, + 0x1470: 0x0043, 0x1471: 0x0045, 0x1472: 0x0047, 0x1473: 0x0049, 0x1474: 0x004b, 0x1475: 0x004d, + 0x1476: 0x004f, 0x1477: 0x0051, 0x1478: 0x0053, 0x1479: 0x0055, 0x147a: 0x0057, 0x147b: 0x0059, + 0x147c: 0x005b, 0x147d: 0x005d, 0x147e: 0x005f, 0x147f: 0x0061, + // Block 0x52, offset 0x1480 + 0x1480: 0x26ad, 0x1481: 0x26c2, 0x1482: 0x0503, + 0x1490: 0x0c0f, 0x1491: 0x0a47, + 0x1492: 0x08d3, 0x1493: 0x45c4, 0x1494: 0x071b, 0x1495: 0x09ef, 0x1496: 0x132f, 0x1497: 0x09ff, + 0x1498: 0x0727, 0x1499: 0x0cd7, 0x149a: 0x0eaf, 0x149b: 0x0caf, 0x149c: 0x0827, 0x149d: 0x0b6b, + 0x149e: 0x07bf, 0x149f: 0x0cb7, 0x14a0: 0x0813, 0x14a1: 0x1117, 0x14a2: 0x0f83, 0x14a3: 0x138b, + 0x14a4: 0x09d3, 0x14a5: 0x090b, 0x14a6: 0x0e63, 0x14a7: 0x0c1b, 0x14a8: 0x0c47, 0x14a9: 0x06bf, + 0x14aa: 0x06cb, 0x14ab: 0x140b, 0x14ac: 0x0adb, 0x14ad: 0x06e7, 0x14ae: 0x08ef, 0x14af: 0x0c3b, + 0x14b0: 0x13b3, 0x14b1: 0x0c13, 0x14b2: 0x106f, 0x14b3: 0x10ab, 0x14b4: 0x08f7, 0x14b5: 0x0e43, + 0x14b6: 0x0d0b, 0x14b7: 0x0d07, 0x14b8: 0x0f97, 0x14b9: 0x082b, 0x14ba: 0x0957, 0x14bb: 0x1443, + // Block 0x53, offset 0x14c0 + 0x14c0: 0x06fb, 0x14c1: 0x06f3, 0x14c2: 0x0703, 0x14c3: 0x1647, 0x14c4: 0x0747, 0x14c5: 0x0757, + 0x14c6: 0x075b, 0x14c7: 0x0763, 0x14c8: 0x076b, 0x14c9: 0x076f, 0x14ca: 0x077b, 0x14cb: 0x0773, + 0x14cc: 0x05b3, 0x14cd: 0x165b, 0x14ce: 0x078f, 0x14cf: 0x0793, 0x14d0: 0x0797, 0x14d1: 0x07b3, + 0x14d2: 0x164c, 0x14d3: 0x05b7, 0x14d4: 0x079f, 0x14d5: 0x07bf, 0x14d6: 0x1656, 0x14d7: 0x07cf, + 0x14d8: 0x07d7, 0x14d9: 0x0737, 0x14da: 0x07df, 0x14db: 0x07e3, 0x14dc: 0x1831, 0x14dd: 0x07ff, + 0x14de: 0x0807, 0x14df: 0x05bf, 0x14e0: 0x081f, 0x14e1: 0x0823, 0x14e2: 0x082b, 0x14e3: 0x082f, + 0x14e4: 0x05c3, 0x14e5: 0x0847, 0x14e6: 0x084b, 0x14e7: 0x0857, 0x14e8: 0x0863, 0x14e9: 0x0867, + 0x14ea: 0x086b, 0x14eb: 0x0873, 0x14ec: 0x0893, 0x14ed: 0x0897, 0x14ee: 0x089f, 0x14ef: 0x08af, + 0x14f0: 0x08b7, 0x14f1: 0x08bb, 0x14f2: 0x08bb, 0x14f3: 0x08bb, 0x14f4: 0x166a, 0x14f5: 0x0e93, + 0x14f6: 0x08cf, 0x14f7: 0x08d7, 0x14f8: 0x166f, 0x14f9: 0x08e3, 0x14fa: 0x08eb, 0x14fb: 0x08f3, + 0x14fc: 0x091b, 0x14fd: 0x0907, 0x14fe: 0x0913, 0x14ff: 0x0917, + // Block 0x54, offset 0x1500 + 0x1500: 0x091f, 0x1501: 0x0927, 0x1502: 0x092b, 0x1503: 0x0933, 0x1504: 0x093b, 0x1505: 0x093f, + 0x1506: 0x093f, 0x1507: 0x0947, 0x1508: 0x094f, 0x1509: 0x0953, 0x150a: 0x095f, 0x150b: 0x0983, + 0x150c: 0x0967, 0x150d: 0x0987, 0x150e: 0x096b, 0x150f: 0x0973, 0x1510: 0x080b, 0x1511: 0x09cf, + 0x1512: 0x0997, 0x1513: 0x099b, 0x1514: 0x099f, 0x1515: 0x0993, 0x1516: 0x09a7, 0x1517: 0x09a3, + 0x1518: 0x09bb, 0x1519: 0x1674, 0x151a: 0x09d7, 0x151b: 0x09db, 0x151c: 0x09e3, 0x151d: 0x09ef, + 0x151e: 0x09f7, 0x151f: 0x0a13, 0x1520: 0x1679, 0x1521: 0x167e, 0x1522: 0x0a1f, 0x1523: 0x0a23, + 0x1524: 0x0a27, 0x1525: 0x0a1b, 0x1526: 0x0a2f, 0x1527: 0x05c7, 0x1528: 0x05cb, 0x1529: 0x0a37, + 0x152a: 0x0a3f, 0x152b: 0x0a3f, 0x152c: 0x1683, 0x152d: 0x0a5b, 0x152e: 0x0a5f, 0x152f: 0x0a63, + 0x1530: 0x0a6b, 0x1531: 0x1688, 0x1532: 0x0a73, 0x1533: 0x0a77, 0x1534: 0x0b4f, 0x1535: 0x0a7f, + 0x1536: 0x05cf, 0x1537: 0x0a8b, 0x1538: 0x0a9b, 0x1539: 0x0aa7, 0x153a: 0x0aa3, 0x153b: 0x1692, + 0x153c: 0x0aaf, 0x153d: 0x1697, 0x153e: 0x0abb, 0x153f: 0x0ab7, + // Block 0x55, offset 0x1540 + 0x1540: 0x0abf, 0x1541: 0x0acf, 0x1542: 0x0ad3, 0x1543: 0x05d3, 0x1544: 0x0ae3, 0x1545: 0x0aeb, + 0x1546: 0x0aef, 0x1547: 0x0af3, 0x1548: 0x05d7, 0x1549: 0x169c, 0x154a: 0x05db, 0x154b: 0x0b0f, + 0x154c: 0x0b13, 0x154d: 0x0b17, 0x154e: 0x0b1f, 0x154f: 0x1863, 0x1550: 0x0b37, 0x1551: 0x16a6, + 0x1552: 0x16a6, 0x1553: 0x11d7, 0x1554: 0x0b47, 0x1555: 0x0b47, 0x1556: 0x05df, 0x1557: 0x16c9, + 0x1558: 0x179b, 0x1559: 0x0b57, 0x155a: 0x0b5f, 0x155b: 0x05e3, 0x155c: 0x0b73, 0x155d: 0x0b83, + 0x155e: 0x0b87, 0x155f: 0x0b8f, 0x1560: 0x0b9f, 0x1561: 0x05eb, 0x1562: 0x05e7, 0x1563: 0x0ba3, + 0x1564: 0x16ab, 0x1565: 0x0ba7, 0x1566: 0x0bbb, 0x1567: 0x0bbf, 0x1568: 0x0bc3, 0x1569: 0x0bbf, + 0x156a: 0x0bcf, 0x156b: 0x0bd3, 0x156c: 0x0be3, 0x156d: 0x0bdb, 0x156e: 0x0bdf, 0x156f: 0x0be7, + 0x1570: 0x0beb, 0x1571: 0x0bef, 0x1572: 0x0bfb, 0x1573: 0x0bff, 0x1574: 0x0c17, 0x1575: 0x0c1f, + 0x1576: 0x0c2f, 0x1577: 0x0c43, 0x1578: 0x16ba, 0x1579: 0x0c3f, 0x157a: 0x0c33, 0x157b: 0x0c4b, + 0x157c: 0x0c53, 0x157d: 0x0c67, 0x157e: 0x16bf, 0x157f: 0x0c6f, + // Block 0x56, offset 0x1580 + 0x1580: 0x0c63, 0x1581: 0x0c5b, 0x1582: 0x05ef, 0x1583: 0x0c77, 0x1584: 0x0c7f, 0x1585: 0x0c87, + 0x1586: 0x0c7b, 0x1587: 0x05f3, 0x1588: 0x0c97, 0x1589: 0x0c9f, 0x158a: 0x16c4, 0x158b: 0x0ccb, + 0x158c: 0x0cff, 0x158d: 0x0cdb, 0x158e: 0x05ff, 0x158f: 0x0ce7, 0x1590: 0x05fb, 0x1591: 0x05f7, + 0x1592: 0x07c3, 0x1593: 0x07c7, 0x1594: 0x0d03, 0x1595: 0x0ceb, 0x1596: 0x11ab, 0x1597: 0x0663, + 0x1598: 0x0d0f, 0x1599: 0x0d13, 0x159a: 0x0d17, 0x159b: 0x0d2b, 0x159c: 0x0d23, 0x159d: 0x16dd, + 0x159e: 0x0603, 0x159f: 0x0d3f, 0x15a0: 0x0d33, 0x15a1: 0x0d4f, 0x15a2: 0x0d57, 0x15a3: 0x16e7, + 0x15a4: 0x0d5b, 0x15a5: 0x0d47, 0x15a6: 0x0d63, 0x15a7: 0x0607, 0x15a8: 0x0d67, 0x15a9: 0x0d6b, + 0x15aa: 0x0d6f, 0x15ab: 0x0d7b, 0x15ac: 0x16ec, 0x15ad: 0x0d83, 0x15ae: 0x060b, 0x15af: 0x0d8f, + 0x15b0: 0x16f1, 0x15b1: 0x0d93, 0x15b2: 0x060f, 0x15b3: 0x0d9f, 0x15b4: 0x0dab, 0x15b5: 0x0db7, + 0x15b6: 0x0dbb, 0x15b7: 0x16f6, 0x15b8: 0x168d, 0x15b9: 0x16fb, 0x15ba: 0x0ddb, 0x15bb: 0x1700, + 0x15bc: 0x0de7, 0x15bd: 0x0def, 0x15be: 0x0ddf, 0x15bf: 0x0dfb, + // Block 0x57, offset 0x15c0 + 0x15c0: 0x0e0b, 0x15c1: 0x0e1b, 0x15c2: 0x0e0f, 0x15c3: 0x0e13, 0x15c4: 0x0e1f, 0x15c5: 0x0e23, + 0x15c6: 0x1705, 0x15c7: 0x0e07, 0x15c8: 0x0e3b, 0x15c9: 0x0e3f, 0x15ca: 0x0613, 0x15cb: 0x0e53, + 0x15cc: 0x0e4f, 0x15cd: 0x170a, 0x15ce: 0x0e33, 0x15cf: 0x0e6f, 0x15d0: 0x170f, 0x15d1: 0x1714, + 0x15d2: 0x0e73, 0x15d3: 0x0e87, 0x15d4: 0x0e83, 0x15d5: 0x0e7f, 0x15d6: 0x0617, 0x15d7: 0x0e8b, + 0x15d8: 0x0e9b, 0x15d9: 0x0e97, 0x15da: 0x0ea3, 0x15db: 0x1651, 0x15dc: 0x0eb3, 0x15dd: 0x1719, + 0x15de: 0x0ebf, 0x15df: 0x1723, 0x15e0: 0x0ed3, 0x15e1: 0x0edf, 0x15e2: 0x0ef3, 0x15e3: 0x1728, + 0x15e4: 0x0f07, 0x15e5: 0x0f0b, 0x15e6: 0x172d, 0x15e7: 0x1732, 0x15e8: 0x0f27, 0x15e9: 0x0f37, + 0x15ea: 0x061b, 0x15eb: 0x0f3b, 0x15ec: 0x061f, 0x15ed: 0x061f, 0x15ee: 0x0f53, 0x15ef: 0x0f57, + 0x15f0: 0x0f5f, 0x15f1: 0x0f63, 0x15f2: 0x0f6f, 0x15f3: 0x0623, 0x15f4: 0x0f87, 0x15f5: 0x1737, + 0x15f6: 0x0fa3, 0x15f7: 0x173c, 0x15f8: 0x0faf, 0x15f9: 0x16a1, 0x15fa: 0x0fbf, 0x15fb: 0x1741, + 0x15fc: 0x1746, 0x15fd: 0x174b, 0x15fe: 0x0627, 0x15ff: 0x062b, + // Block 0x58, offset 0x1600 + 0x1600: 0x0ff7, 0x1601: 0x1755, 0x1602: 0x1750, 0x1603: 0x175a, 0x1604: 0x175f, 0x1605: 0x0fff, + 0x1606: 0x1003, 0x1607: 0x1003, 0x1608: 0x100b, 0x1609: 0x0633, 0x160a: 0x100f, 0x160b: 0x0637, + 0x160c: 0x063b, 0x160d: 0x1769, 0x160e: 0x1023, 0x160f: 0x102b, 0x1610: 0x1037, 0x1611: 0x063f, + 0x1612: 0x176e, 0x1613: 0x105b, 0x1614: 0x1773, 0x1615: 0x1778, 0x1616: 0x107b, 0x1617: 0x1093, + 0x1618: 0x0643, 0x1619: 0x109b, 0x161a: 0x109f, 0x161b: 0x10a3, 0x161c: 0x177d, 0x161d: 0x1782, + 0x161e: 0x1782, 0x161f: 0x10bb, 0x1620: 0x0647, 0x1621: 0x1787, 0x1622: 0x10cf, 0x1623: 0x10d3, + 0x1624: 0x064b, 0x1625: 0x178c, 0x1626: 0x10ef, 0x1627: 0x064f, 0x1628: 0x10ff, 0x1629: 0x10f7, + 0x162a: 0x1107, 0x162b: 0x1796, 0x162c: 0x111f, 0x162d: 0x0653, 0x162e: 0x112b, 0x162f: 0x1133, + 0x1630: 0x1143, 0x1631: 0x0657, 0x1632: 0x17a0, 0x1633: 0x17a5, 0x1634: 0x065b, 0x1635: 0x17aa, + 0x1636: 0x115b, 0x1637: 0x17af, 0x1638: 0x1167, 0x1639: 0x1173, 0x163a: 0x117b, 0x163b: 0x17b4, + 0x163c: 0x17b9, 0x163d: 0x118f, 0x163e: 0x17be, 0x163f: 0x1197, + // Block 0x59, offset 0x1640 + 0x1640: 0x16ce, 0x1641: 0x065f, 0x1642: 0x11af, 0x1643: 0x11b3, 0x1644: 0x0667, 0x1645: 0x11b7, + 0x1646: 0x0a33, 0x1647: 0x17c3, 0x1648: 0x17c8, 0x1649: 0x16d3, 0x164a: 0x16d8, 0x164b: 0x11d7, + 0x164c: 0x11db, 0x164d: 0x13f3, 0x164e: 0x066b, 0x164f: 0x1207, 0x1650: 0x1203, 0x1651: 0x120b, + 0x1652: 0x083f, 0x1653: 0x120f, 0x1654: 0x1213, 0x1655: 0x1217, 0x1656: 0x121f, 0x1657: 0x17cd, + 0x1658: 0x121b, 0x1659: 0x1223, 0x165a: 0x1237, 0x165b: 0x123b, 0x165c: 0x1227, 0x165d: 0x123f, + 0x165e: 0x1253, 0x165f: 0x1267, 0x1660: 0x1233, 0x1661: 0x1247, 0x1662: 0x124b, 0x1663: 0x124f, + 0x1664: 0x17d2, 0x1665: 0x17dc, 0x1666: 0x17d7, 0x1667: 0x066f, 0x1668: 0x126f, 0x1669: 0x1273, + 0x166a: 0x127b, 0x166b: 0x17f0, 0x166c: 0x127f, 0x166d: 0x17e1, 0x166e: 0x0673, 0x166f: 0x0677, + 0x1670: 0x17e6, 0x1671: 0x17eb, 0x1672: 0x067b, 0x1673: 0x129f, 0x1674: 0x12a3, 0x1675: 0x12a7, + 0x1676: 0x12ab, 0x1677: 0x12b7, 0x1678: 0x12b3, 0x1679: 0x12bf, 0x167a: 0x12bb, 0x167b: 0x12cb, + 0x167c: 0x12c3, 0x167d: 0x12c7, 0x167e: 0x12cf, 0x167f: 0x067f, + // Block 0x5a, offset 0x1680 + 0x1680: 0x12d7, 0x1681: 0x12db, 0x1682: 0x0683, 0x1683: 0x12eb, 0x1684: 0x12ef, 0x1685: 0x17f5, + 0x1686: 0x12fb, 0x1687: 0x12ff, 0x1688: 0x0687, 0x1689: 0x130b, 0x168a: 0x05bb, 0x168b: 0x17fa, + 0x168c: 0x17ff, 0x168d: 0x068b, 0x168e: 0x068f, 0x168f: 0x1337, 0x1690: 0x134f, 0x1691: 0x136b, + 0x1692: 0x137b, 0x1693: 0x1804, 0x1694: 0x138f, 0x1695: 0x1393, 0x1696: 0x13ab, 0x1697: 0x13b7, + 0x1698: 0x180e, 0x1699: 0x1660, 0x169a: 0x13c3, 0x169b: 0x13bf, 0x169c: 0x13cb, 0x169d: 0x1665, + 0x169e: 0x13d7, 0x169f: 0x13e3, 0x16a0: 0x1813, 0x16a1: 0x1818, 0x16a2: 0x1423, 0x16a3: 0x142f, + 0x16a4: 0x1437, 0x16a5: 0x181d, 0x16a6: 0x143b, 0x16a7: 0x1467, 0x16a8: 0x1473, 0x16a9: 0x1477, + 0x16aa: 0x146f, 0x16ab: 0x1483, 0x16ac: 0x1487, 0x16ad: 0x1822, 0x16ae: 0x1493, 0x16af: 0x0693, + 0x16b0: 0x149b, 0x16b1: 0x1827, 0x16b2: 0x0697, 0x16b3: 0x14d3, 0x16b4: 0x0ac3, 0x16b5: 0x14eb, + 0x16b6: 0x182c, 0x16b7: 0x1836, 0x16b8: 0x069b, 0x16b9: 0x069f, 0x16ba: 0x1513, 0x16bb: 0x183b, + 0x16bc: 0x06a3, 0x16bd: 0x1840, 0x16be: 0x152b, 0x16bf: 0x152b, + // Block 0x5b, offset 0x16c0 + 0x16c0: 0x1533, 0x16c1: 0x1845, 0x16c2: 0x154b, 0x16c3: 0x06a7, 0x16c4: 0x155b, 0x16c5: 0x1567, + 0x16c6: 0x156f, 0x16c7: 0x1577, 0x16c8: 0x06ab, 0x16c9: 0x184a, 0x16ca: 0x158b, 0x16cb: 0x15a7, + 0x16cc: 0x15b3, 0x16cd: 0x06af, 0x16ce: 0x06b3, 0x16cf: 0x15b7, 0x16d0: 0x184f, 0x16d1: 0x06b7, + 0x16d2: 0x1854, 0x16d3: 0x1859, 0x16d4: 0x185e, 0x16d5: 0x15db, 0x16d6: 0x06bb, 0x16d7: 0x15ef, + 0x16d8: 0x15f7, 0x16d9: 0x15fb, 0x16da: 0x1603, 0x16db: 0x160b, 0x16dc: 0x1613, 0x16dd: 0x1868, +} + +// nfkcIndex: 22 blocks, 1408 entries, 1408 bytes +// Block 0 is the zero block. +var nfkcIndex = [1408]uint8{ + // Block 0x0, offset 0x0 + // Block 0x1, offset 0x40 + // Block 0x2, offset 0x80 + // Block 0x3, offset 0xc0 + 0xc2: 0x5a, 0xc3: 0x01, 0xc4: 0x02, 0xc5: 0x03, 0xc6: 0x5b, 0xc7: 0x04, + 0xc8: 0x05, 0xca: 0x5c, 0xcb: 0x5d, 0xcc: 0x06, 0xcd: 0x07, 0xce: 0x08, 0xcf: 0x09, + 0xd0: 0x0a, 0xd1: 0x5e, 0xd2: 0x5f, 0xd3: 0x0b, 0xd6: 0x0c, 0xd7: 0x60, + 0xd8: 0x61, 0xd9: 0x0d, 0xdb: 0x62, 0xdc: 0x63, 0xdd: 0x64, 0xdf: 0x65, + 0xe0: 0x02, 0xe1: 0x03, 0xe2: 0x04, 0xe3: 0x05, + 0xea: 0x06, 0xeb: 0x07, 0xec: 0x08, 0xed: 0x09, 0xef: 0x0a, + 0xf0: 0x13, + // Block 0x4, offset 0x100 + 0x120: 0x66, 0x121: 0x67, 0x123: 0x68, 0x124: 0x69, 0x125: 0x6a, 0x126: 0x6b, 0x127: 0x6c, + 0x128: 0x6d, 0x129: 0x6e, 0x12a: 0x6f, 0x12b: 0x70, 0x12c: 0x6b, 0x12d: 0x71, 0x12e: 0x72, 0x12f: 0x73, + 0x131: 0x74, 0x132: 0x75, 0x133: 0x76, 0x134: 0x77, 0x135: 0x78, 0x137: 0x79, + 0x138: 0x7a, 0x139: 0x7b, 0x13a: 0x7c, 0x13b: 0x7d, 0x13c: 0x7e, 0x13d: 0x7f, 0x13e: 0x80, 0x13f: 0x81, + // Block 0x5, offset 0x140 + 0x140: 0x82, 0x142: 0x83, 0x143: 0x84, 0x144: 0x85, 0x145: 0x86, 0x146: 0x87, 0x147: 0x88, + 0x14d: 0x89, + 0x15c: 0x8a, 0x15f: 0x8b, + 0x162: 0x8c, 0x164: 0x8d, + 0x168: 0x8e, 0x169: 0x8f, 0x16a: 0x90, 0x16c: 0x0e, 0x16d: 0x91, 0x16e: 0x92, 0x16f: 0x93, + 0x170: 0x94, 0x173: 0x95, 0x174: 0x96, 0x175: 0x0f, 0x176: 0x10, 0x177: 0x97, + 0x178: 0x11, 0x179: 0x12, 0x17a: 0x13, 0x17b: 0x14, 0x17c: 0x15, 0x17d: 0x16, 0x17e: 0x17, 0x17f: 0x18, + // Block 0x6, offset 0x180 + 0x180: 0x98, 0x181: 0x99, 0x182: 0x9a, 0x183: 0x9b, 0x184: 0x19, 0x185: 0x1a, 0x186: 0x9c, 0x187: 0x9d, + 0x188: 0x9e, 0x189: 0x1b, 0x18a: 0x1c, 0x18b: 0x9f, 0x18c: 0xa0, + 0x191: 0x1d, 0x192: 0x1e, 0x193: 0xa1, + 0x1a8: 0xa2, 0x1a9: 0xa3, 0x1ab: 0xa4, + 0x1b1: 0xa5, 0x1b3: 0xa6, 0x1b5: 0xa7, 0x1b7: 0xa8, + 0x1ba: 0xa9, 0x1bb: 0xaa, 0x1bc: 0x1f, 0x1bd: 0x20, 0x1be: 0x21, 0x1bf: 0xab, + // Block 0x7, offset 0x1c0 + 0x1c0: 0xac, 0x1c1: 0x22, 0x1c2: 0x23, 0x1c3: 0x24, 0x1c4: 0xad, 0x1c5: 0x25, 0x1c6: 0x26, + 0x1c8: 0x27, 0x1c9: 0x28, 0x1ca: 0x29, 0x1cb: 0x2a, 0x1cc: 0x2b, 0x1cd: 0x2c, 0x1ce: 0x2d, 0x1cf: 0x2e, + // Block 0x8, offset 0x200 + 0x219: 0xae, 0x21a: 0xaf, 0x21b: 0xb0, 0x21d: 0xb1, 0x21f: 0xb2, + 0x220: 0xb3, 0x223: 0xb4, 0x224: 0xb5, 0x225: 0xb6, 0x226: 0xb7, 0x227: 0xb8, + 0x22a: 0xb9, 0x22b: 0xba, 0x22d: 0xbb, 0x22f: 0xbc, + 0x230: 0xbd, 0x231: 0xbe, 0x232: 0xbf, 0x233: 0xc0, 0x234: 0xc1, 0x235: 0xc2, 0x236: 0xc3, 0x237: 0xbd, + 0x238: 0xbe, 0x239: 0xbf, 0x23a: 0xc0, 0x23b: 0xc1, 0x23c: 0xc2, 0x23d: 0xc3, 0x23e: 0xbd, 0x23f: 0xbe, + // Block 0x9, offset 0x240 + 0x240: 0xbf, 0x241: 0xc0, 0x242: 0xc1, 0x243: 0xc2, 0x244: 0xc3, 0x245: 0xbd, 0x246: 0xbe, 0x247: 0xbf, + 0x248: 0xc0, 0x249: 0xc1, 0x24a: 0xc2, 0x24b: 0xc3, 0x24c: 0xbd, 0x24d: 0xbe, 0x24e: 0xbf, 0x24f: 0xc0, + 0x250: 0xc1, 0x251: 0xc2, 0x252: 0xc3, 0x253: 0xbd, 0x254: 0xbe, 0x255: 0xbf, 0x256: 0xc0, 0x257: 0xc1, + 0x258: 0xc2, 0x259: 0xc3, 0x25a: 0xbd, 0x25b: 0xbe, 0x25c: 0xbf, 0x25d: 0xc0, 0x25e: 0xc1, 0x25f: 0xc2, + 0x260: 0xc3, 0x261: 0xbd, 0x262: 0xbe, 0x263: 0xbf, 0x264: 0xc0, 0x265: 0xc1, 0x266: 0xc2, 0x267: 0xc3, + 0x268: 0xbd, 0x269: 0xbe, 0x26a: 0xbf, 0x26b: 0xc0, 0x26c: 0xc1, 0x26d: 0xc2, 0x26e: 0xc3, 0x26f: 0xbd, + 0x270: 0xbe, 0x271: 0xbf, 0x272: 0xc0, 0x273: 0xc1, 0x274: 0xc2, 0x275: 0xc3, 0x276: 0xbd, 0x277: 0xbe, + 0x278: 0xbf, 0x279: 0xc0, 0x27a: 0xc1, 0x27b: 0xc2, 0x27c: 0xc3, 0x27d: 0xbd, 0x27e: 0xbe, 0x27f: 0xbf, + // Block 0xa, offset 0x280 + 0x280: 0xc0, 0x281: 0xc1, 0x282: 0xc2, 0x283: 0xc3, 0x284: 0xbd, 0x285: 0xbe, 0x286: 0xbf, 0x287: 0xc0, + 0x288: 0xc1, 0x289: 0xc2, 0x28a: 0xc3, 0x28b: 0xbd, 0x28c: 0xbe, 0x28d: 0xbf, 0x28e: 0xc0, 0x28f: 0xc1, + 0x290: 0xc2, 0x291: 0xc3, 0x292: 0xbd, 0x293: 0xbe, 0x294: 0xbf, 0x295: 0xc0, 0x296: 0xc1, 0x297: 0xc2, + 0x298: 0xc3, 0x299: 0xbd, 0x29a: 0xbe, 0x29b: 0xbf, 0x29c: 0xc0, 0x29d: 0xc1, 0x29e: 0xc2, 0x29f: 0xc3, + 0x2a0: 0xbd, 0x2a1: 0xbe, 0x2a2: 0xbf, 0x2a3: 0xc0, 0x2a4: 0xc1, 0x2a5: 0xc2, 0x2a6: 0xc3, 0x2a7: 0xbd, + 0x2a8: 0xbe, 0x2a9: 0xbf, 0x2aa: 0xc0, 0x2ab: 0xc1, 0x2ac: 0xc2, 0x2ad: 0xc3, 0x2ae: 0xbd, 0x2af: 0xbe, + 0x2b0: 0xbf, 0x2b1: 0xc0, 0x2b2: 0xc1, 0x2b3: 0xc2, 0x2b4: 0xc3, 0x2b5: 0xbd, 0x2b6: 0xbe, 0x2b7: 0xbf, + 0x2b8: 0xc0, 0x2b9: 0xc1, 0x2ba: 0xc2, 0x2bb: 0xc3, 0x2bc: 0xbd, 0x2bd: 0xbe, 0x2be: 0xbf, 0x2bf: 0xc0, + // Block 0xb, offset 0x2c0 + 0x2c0: 0xc1, 0x2c1: 0xc2, 0x2c2: 0xc3, 0x2c3: 0xbd, 0x2c4: 0xbe, 0x2c5: 0xbf, 0x2c6: 0xc0, 0x2c7: 0xc1, + 0x2c8: 0xc2, 0x2c9: 0xc3, 0x2ca: 0xbd, 0x2cb: 0xbe, 0x2cc: 0xbf, 0x2cd: 0xc0, 0x2ce: 0xc1, 0x2cf: 0xc2, + 0x2d0: 0xc3, 0x2d1: 0xbd, 0x2d2: 0xbe, 0x2d3: 0xbf, 0x2d4: 0xc0, 0x2d5: 0xc1, 0x2d6: 0xc2, 0x2d7: 0xc3, + 0x2d8: 0xbd, 0x2d9: 0xbe, 0x2da: 0xbf, 0x2db: 0xc0, 0x2dc: 0xc1, 0x2dd: 0xc2, 0x2de: 0xc4, + // Block 0xc, offset 0x300 + 0x324: 0x2f, 0x325: 0x30, 0x326: 0x31, 0x327: 0x32, + 0x328: 0x33, 0x329: 0x34, 0x32a: 0x35, 0x32b: 0x36, 0x32c: 0x37, 0x32d: 0x38, 0x32e: 0x39, 0x32f: 0x3a, + 0x330: 0x3b, 0x331: 0x3c, 0x332: 0x3d, 0x333: 0x3e, 0x334: 0x3f, 0x335: 0x40, 0x336: 0x41, 0x337: 0x42, + 0x338: 0x43, 0x339: 0x44, 0x33a: 0x45, 0x33b: 0x46, 0x33c: 0xc5, 0x33d: 0x47, 0x33e: 0x48, 0x33f: 0x49, + // Block 0xd, offset 0x340 + 0x347: 0xc6, + 0x34b: 0xc7, 0x34d: 0xc8, + 0x368: 0xc9, 0x36b: 0xca, + // Block 0xe, offset 0x380 + 0x381: 0xcb, 0x382: 0xcc, 0x384: 0xcd, 0x385: 0xb7, 0x387: 0xce, + 0x388: 0xcf, 0x38b: 0xd0, 0x38c: 0x6b, 0x38d: 0xd1, + 0x391: 0xd2, 0x392: 0xd3, 0x393: 0xd4, 0x396: 0xd5, 0x397: 0xd6, + 0x398: 0xd7, 0x39a: 0xd8, 0x39c: 0xd9, + 0x3b0: 0xd7, + // Block 0xf, offset 0x3c0 + 0x3eb: 0xda, 0x3ec: 0xdb, + // Block 0x10, offset 0x400 + 0x432: 0xdc, + // Block 0x11, offset 0x440 + 0x445: 0xdd, 0x446: 0xde, 0x447: 0xdf, + 0x449: 0xe0, + 0x450: 0xe1, 0x451: 0xe2, 0x452: 0xe3, 0x453: 0xe4, 0x454: 0xe5, 0x455: 0xe6, 0x456: 0xe7, 0x457: 0xe8, + 0x458: 0xe9, 0x459: 0xea, 0x45a: 0x4a, 0x45b: 0xeb, 0x45c: 0xec, 0x45d: 0xed, 0x45e: 0xee, 0x45f: 0x4b, + // Block 0x12, offset 0x480 + 0x480: 0xef, + 0x4a3: 0xf0, 0x4a5: 0xf1, + 0x4b8: 0x4c, 0x4b9: 0x4d, 0x4ba: 0x4e, + // Block 0x13, offset 0x4c0 + 0x4c4: 0x4f, 0x4c5: 0xf2, 0x4c6: 0xf3, + 0x4c8: 0x50, 0x4c9: 0xf4, + // Block 0x14, offset 0x500 + 0x520: 0x51, 0x521: 0x52, 0x522: 0x53, 0x523: 0x54, 0x524: 0x55, 0x525: 0x56, 0x526: 0x57, 0x527: 0x58, + 0x528: 0x59, + // Block 0x15, offset 0x540 + 0x550: 0x0b, 0x551: 0x0c, 0x556: 0x0d, + 0x55b: 0x0e, 0x55d: 0x0f, 0x55e: 0x10, 0x55f: 0x11, + 0x56f: 0x12, +} + +// nfkcSparseOffset: 155 entries, 310 bytes +var nfkcSparseOffset = []uint16{0x0, 0xe, 0x12, 0x1b, 0x25, 0x35, 0x37, 0x3c, 0x47, 0x56, 0x63, 0x6b, 0x6f, 0x74, 0x76, 0x87, 0x8f, 0x96, 0x99, 0xa0, 0xa4, 0xa8, 0xaa, 0xac, 0xb5, 0xb9, 0xc0, 0xc5, 0xc8, 0xd2, 0xd4, 0xdb, 0xe3, 0xe7, 0xe9, 0xec, 0xf0, 0xf6, 0x107, 0x113, 0x115, 0x11b, 0x11d, 0x11f, 0x121, 0x123, 0x125, 0x127, 0x129, 0x12c, 0x12f, 0x131, 0x134, 0x137, 0x13b, 0x140, 0x149, 0x14b, 0x14e, 0x150, 0x15b, 0x166, 0x176, 0x184, 0x192, 0x1a2, 0x1b0, 0x1b7, 0x1bd, 0x1cc, 0x1d0, 0x1d2, 0x1d6, 0x1d8, 0x1db, 0x1dd, 0x1e0, 0x1e2, 0x1e5, 0x1e7, 0x1e9, 0x1eb, 0x1f7, 0x201, 0x20b, 0x20e, 0x212, 0x214, 0x216, 0x218, 0x21a, 0x21d, 0x21f, 0x221, 0x223, 0x225, 0x22b, 0x22e, 0x232, 0x234, 0x23b, 0x241, 0x247, 0x24f, 0x255, 0x25b, 0x261, 0x265, 0x267, 0x269, 0x26b, 0x26d, 0x273, 0x276, 0x279, 0x281, 0x288, 0x28b, 0x28e, 0x290, 0x298, 0x29b, 0x2a2, 0x2a5, 0x2ab, 0x2ad, 0x2af, 0x2b2, 0x2b4, 0x2b6, 0x2b8, 0x2ba, 0x2c7, 0x2d1, 0x2d3, 0x2d5, 0x2d9, 0x2de, 0x2ea, 0x2ef, 0x2f8, 0x2fe, 0x303, 0x307, 0x30c, 0x310, 0x320, 0x32e, 0x33c, 0x34a, 0x350, 0x352, 0x355, 0x35f, 0x361} + +// nfkcSparseValues: 875 entries, 3500 bytes +var nfkcSparseValues = [875]valueRange{ + // Block 0x0, offset 0x0 + {value: 0x0002, lo: 0x0d}, + {value: 0x0001, lo: 0xa0, hi: 0xa0}, + {value: 0x4278, lo: 0xa8, hi: 0xa8}, + {value: 0x0083, lo: 0xaa, hi: 0xaa}, + {value: 0x4264, lo: 0xaf, hi: 0xaf}, + {value: 0x0025, lo: 0xb2, hi: 0xb3}, + {value: 0x425a, lo: 0xb4, hi: 0xb4}, + {value: 0x01dc, lo: 0xb5, hi: 0xb5}, + {value: 0x4291, lo: 0xb8, hi: 0xb8}, + {value: 0x0023, lo: 0xb9, hi: 0xb9}, + {value: 0x009f, lo: 0xba, hi: 0xba}, + {value: 0x221c, lo: 0xbc, hi: 0xbc}, + {value: 0x2210, lo: 0xbd, hi: 0xbd}, + {value: 0x22b2, lo: 0xbe, hi: 0xbe}, + // Block 0x1, offset 0xe + {value: 0x0091, lo: 0x03}, + {value: 0x46e2, lo: 0xa0, hi: 0xa1}, + {value: 0x4714, lo: 0xaf, hi: 0xb0}, + {value: 0xa000, lo: 0xb7, hi: 0xb7}, + // Block 0x2, offset 0x12 + {value: 0x0003, lo: 0x08}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x0091, lo: 0xb0, hi: 0xb0}, + {value: 0x0119, lo: 0xb1, hi: 0xb1}, + {value: 0x0095, lo: 0xb2, hi: 0xb2}, + {value: 0x00a5, lo: 0xb3, hi: 0xb3}, + {value: 0x0143, lo: 0xb4, hi: 0xb6}, + {value: 0x00af, lo: 0xb7, hi: 0xb7}, + {value: 0x00b3, lo: 0xb8, hi: 0xb8}, + // Block 0x3, offset 0x1b + {value: 0x000a, lo: 0x09}, + {value: 0x426e, lo: 0x98, hi: 0x98}, + {value: 0x4273, lo: 0x99, hi: 0x9a}, + {value: 0x4296, lo: 0x9b, hi: 0x9b}, + {value: 0x425f, lo: 0x9c, hi: 0x9c}, + {value: 0x4282, lo: 0x9d, hi: 0x9d}, + {value: 0x0113, lo: 0xa0, hi: 0xa0}, + {value: 0x0099, lo: 0xa1, hi: 0xa1}, + {value: 0x00a7, lo: 0xa2, hi: 0xa3}, + {value: 0x0167, lo: 0xa4, hi: 0xa4}, + // Block 0x4, offset 0x25 + {value: 0x0000, lo: 0x0f}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0xa000, lo: 0x8d, hi: 0x8d}, + {value: 0x37a5, lo: 0x90, hi: 0x90}, + {value: 0x37b1, lo: 0x91, hi: 0x91}, + {value: 0x379f, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x96, hi: 0x96}, + {value: 0x3817, lo: 0x97, hi: 0x97}, + {value: 0x37e1, lo: 0x9c, hi: 0x9c}, + {value: 0x37c9, lo: 0x9d, hi: 0x9d}, + {value: 0x37f3, lo: 0x9e, hi: 0x9e}, + {value: 0xa000, lo: 0xb4, hi: 0xb5}, + {value: 0x381d, lo: 0xb6, hi: 0xb6}, + {value: 0x3823, lo: 0xb7, hi: 0xb7}, + // Block 0x5, offset 0x35 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x83, hi: 0x87}, + // Block 0x6, offset 0x37 + {value: 0x0001, lo: 0x04}, + {value: 0x8113, lo: 0x81, hi: 0x82}, + {value: 0x8132, lo: 0x84, hi: 0x84}, + {value: 0x812d, lo: 0x85, hi: 0x85}, + {value: 0x810d, lo: 0x87, hi: 0x87}, + // Block 0x7, offset 0x3c + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x97}, + {value: 0x8119, lo: 0x98, hi: 0x98}, + {value: 0x811a, lo: 0x99, hi: 0x99}, + {value: 0x811b, lo: 0x9a, hi: 0x9a}, + {value: 0x3841, lo: 0xa2, hi: 0xa2}, + {value: 0x3847, lo: 0xa3, hi: 0xa3}, + {value: 0x3853, lo: 0xa4, hi: 0xa4}, + {value: 0x384d, lo: 0xa5, hi: 0xa5}, + {value: 0x3859, lo: 0xa6, hi: 0xa6}, + {value: 0xa000, lo: 0xa7, hi: 0xa7}, + // Block 0x8, offset 0x47 + {value: 0x0000, lo: 0x0e}, + {value: 0x386b, lo: 0x80, hi: 0x80}, + {value: 0xa000, lo: 0x81, hi: 0x81}, + {value: 0x385f, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x3865, lo: 0x93, hi: 0x93}, + {value: 0xa000, lo: 0x95, hi: 0x95}, + {value: 0x8132, lo: 0x96, hi: 0x9c}, + {value: 0x8132, lo: 0x9f, hi: 0xa2}, + {value: 0x812d, lo: 0xa3, hi: 0xa3}, + {value: 0x8132, lo: 0xa4, hi: 0xa4}, + {value: 0x8132, lo: 0xa7, hi: 0xa8}, + {value: 0x812d, lo: 0xaa, hi: 0xaa}, + {value: 0x8132, lo: 0xab, hi: 0xac}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + // Block 0x9, offset 0x56 + {value: 0x0000, lo: 0x0c}, + {value: 0x811f, lo: 0x91, hi: 0x91}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x812d, lo: 0xb1, hi: 0xb1}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb5, hi: 0xb6}, + {value: 0x812d, lo: 0xb7, hi: 0xb9}, + {value: 0x8132, lo: 0xba, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbc}, + {value: 0x8132, lo: 0xbd, hi: 0xbd}, + {value: 0x812d, lo: 0xbe, hi: 0xbe}, + {value: 0x8132, lo: 0xbf, hi: 0xbf}, + // Block 0xa, offset 0x63 + {value: 0x0005, lo: 0x07}, + {value: 0x8132, lo: 0x80, hi: 0x80}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x812d, lo: 0x82, hi: 0x83}, + {value: 0x812d, lo: 0x84, hi: 0x85}, + {value: 0x812d, lo: 0x86, hi: 0x87}, + {value: 0x812d, lo: 0x88, hi: 0x89}, + {value: 0x8132, lo: 0x8a, hi: 0x8a}, + // Block 0xb, offset 0x6b + {value: 0x0000, lo: 0x03}, + {value: 0x8132, lo: 0xab, hi: 0xb1}, + {value: 0x812d, lo: 0xb2, hi: 0xb2}, + {value: 0x8132, lo: 0xb3, hi: 0xb3}, + // Block 0xc, offset 0x6f + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0x96, hi: 0x99}, + {value: 0x8132, lo: 0x9b, hi: 0xa3}, + {value: 0x8132, lo: 0xa5, hi: 0xa7}, + {value: 0x8132, lo: 0xa9, hi: 0xad}, + // Block 0xd, offset 0x74 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x99, hi: 0x9b}, + // Block 0xe, offset 0x76 + {value: 0x0000, lo: 0x10}, + {value: 0x8132, lo: 0x94, hi: 0xa1}, + {value: 0x812d, lo: 0xa3, hi: 0xa3}, + {value: 0x8132, lo: 0xa4, hi: 0xa5}, + {value: 0x812d, lo: 0xa6, hi: 0xa6}, + {value: 0x8132, lo: 0xa7, hi: 0xa8}, + {value: 0x812d, lo: 0xa9, hi: 0xa9}, + {value: 0x8132, lo: 0xaa, hi: 0xac}, + {value: 0x812d, lo: 0xad, hi: 0xaf}, + {value: 0x8116, lo: 0xb0, hi: 0xb0}, + {value: 0x8117, lo: 0xb1, hi: 0xb1}, + {value: 0x8118, lo: 0xb2, hi: 0xb2}, + {value: 0x8132, lo: 0xb3, hi: 0xb5}, + {value: 0x812d, lo: 0xb6, hi: 0xb6}, + {value: 0x8132, lo: 0xb7, hi: 0xb8}, + {value: 0x812d, lo: 0xb9, hi: 0xba}, + {value: 0x8132, lo: 0xbb, hi: 0xbf}, + // Block 0xf, offset 0x87 + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0xa8, hi: 0xa8}, + {value: 0x3ed8, lo: 0xa9, hi: 0xa9}, + {value: 0xa000, lo: 0xb0, hi: 0xb0}, + {value: 0x3ee0, lo: 0xb1, hi: 0xb1}, + {value: 0xa000, lo: 0xb3, hi: 0xb3}, + {value: 0x3ee8, lo: 0xb4, hi: 0xb4}, + {value: 0x9902, lo: 0xbc, hi: 0xbc}, + // Block 0x10, offset 0x8f + {value: 0x0008, lo: 0x06}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x91, hi: 0x91}, + {value: 0x812d, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x93, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x94}, + {value: 0x451c, lo: 0x98, hi: 0x9f}, + // Block 0x11, offset 0x96 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x12, offset 0x99 + {value: 0x0008, lo: 0x06}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2c9e, lo: 0x8b, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x455c, lo: 0x9c, hi: 0x9d}, + {value: 0x456c, lo: 0x9f, hi: 0x9f}, + // Block 0x13, offset 0xa0 + {value: 0x0000, lo: 0x03}, + {value: 0x4594, lo: 0xb3, hi: 0xb3}, + {value: 0x459c, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x14, offset 0xa4 + {value: 0x0008, lo: 0x03}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x4574, lo: 0x99, hi: 0x9b}, + {value: 0x458c, lo: 0x9e, hi: 0x9e}, + // Block 0x15, offset 0xa8 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + // Block 0x16, offset 0xaa + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + // Block 0x17, offset 0xac + {value: 0x0000, lo: 0x08}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2cb6, lo: 0x88, hi: 0x88}, + {value: 0x2cae, lo: 0x8b, hi: 0x8b}, + {value: 0x2cbe, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x96, hi: 0x97}, + {value: 0x45a4, lo: 0x9c, hi: 0x9c}, + {value: 0x45ac, lo: 0x9d, hi: 0x9d}, + // Block 0x18, offset 0xb5 + {value: 0x0000, lo: 0x03}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0x2cc6, lo: 0x94, hi: 0x94}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x19, offset 0xb9 + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cce, lo: 0x8a, hi: 0x8a}, + {value: 0x2cde, lo: 0x8b, hi: 0x8b}, + {value: 0x2cd6, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x1a, offset 0xc0 + {value: 0x1801, lo: 0x04}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x3ef0, lo: 0x88, hi: 0x88}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x8120, lo: 0x95, hi: 0x96}, + // Block 0x1b, offset 0xc5 + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xbc, hi: 0xbc}, + {value: 0xa000, lo: 0xbf, hi: 0xbf}, + // Block 0x1c, offset 0xc8 + {value: 0x0000, lo: 0x09}, + {value: 0x2ce6, lo: 0x80, hi: 0x80}, + {value: 0x9900, lo: 0x82, hi: 0x82}, + {value: 0xa000, lo: 0x86, hi: 0x86}, + {value: 0x2cee, lo: 0x87, hi: 0x87}, + {value: 0x2cf6, lo: 0x88, hi: 0x88}, + {value: 0x2f50, lo: 0x8a, hi: 0x8a}, + {value: 0x2dd8, lo: 0x8b, hi: 0x8b}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x95, hi: 0x96}, + // Block 0x1d, offset 0xd2 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0xbe, hi: 0xbe}, + // Block 0x1e, offset 0xd4 + {value: 0x0000, lo: 0x06}, + {value: 0xa000, lo: 0x86, hi: 0x87}, + {value: 0x2cfe, lo: 0x8a, hi: 0x8a}, + {value: 0x2d0e, lo: 0x8b, hi: 0x8b}, + {value: 0x2d06, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + // Block 0x1f, offset 0xdb + {value: 0x6bea, lo: 0x07}, + {value: 0x9904, lo: 0x8a, hi: 0x8a}, + {value: 0x9900, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x3ef8, lo: 0x9a, hi: 0x9a}, + {value: 0x2f58, lo: 0x9c, hi: 0x9c}, + {value: 0x2de3, lo: 0x9d, hi: 0x9d}, + {value: 0x2d16, lo: 0x9e, hi: 0x9f}, + // Block 0x20, offset 0xe3 + {value: 0x0000, lo: 0x03}, + {value: 0x2621, lo: 0xb3, hi: 0xb3}, + {value: 0x8122, lo: 0xb8, hi: 0xb9}, + {value: 0x8104, lo: 0xba, hi: 0xba}, + // Block 0x21, offset 0xe7 + {value: 0x0000, lo: 0x01}, + {value: 0x8123, lo: 0x88, hi: 0x8b}, + // Block 0x22, offset 0xe9 + {value: 0x0000, lo: 0x02}, + {value: 0x2636, lo: 0xb3, hi: 0xb3}, + {value: 0x8124, lo: 0xb8, hi: 0xb9}, + // Block 0x23, offset 0xec + {value: 0x0000, lo: 0x03}, + {value: 0x8125, lo: 0x88, hi: 0x8b}, + {value: 0x2628, lo: 0x9c, hi: 0x9c}, + {value: 0x262f, lo: 0x9d, hi: 0x9d}, + // Block 0x24, offset 0xf0 + {value: 0x0000, lo: 0x05}, + {value: 0x030b, lo: 0x8c, hi: 0x8c}, + {value: 0x812d, lo: 0x98, hi: 0x99}, + {value: 0x812d, lo: 0xb5, hi: 0xb5}, + {value: 0x812d, lo: 0xb7, hi: 0xb7}, + {value: 0x812b, lo: 0xb9, hi: 0xb9}, + // Block 0x25, offset 0xf6 + {value: 0x0000, lo: 0x10}, + {value: 0x2644, lo: 0x83, hi: 0x83}, + {value: 0x264b, lo: 0x8d, hi: 0x8d}, + {value: 0x2652, lo: 0x92, hi: 0x92}, + {value: 0x2659, lo: 0x97, hi: 0x97}, + {value: 0x2660, lo: 0x9c, hi: 0x9c}, + {value: 0x263d, lo: 0xa9, hi: 0xa9}, + {value: 0x8126, lo: 0xb1, hi: 0xb1}, + {value: 0x8127, lo: 0xb2, hi: 0xb2}, + {value: 0x4a84, lo: 0xb3, hi: 0xb3}, + {value: 0x8128, lo: 0xb4, hi: 0xb4}, + {value: 0x4a8d, lo: 0xb5, hi: 0xb5}, + {value: 0x45b4, lo: 0xb6, hi: 0xb6}, + {value: 0x45f4, lo: 0xb7, hi: 0xb7}, + {value: 0x45bc, lo: 0xb8, hi: 0xb8}, + {value: 0x45ff, lo: 0xb9, hi: 0xb9}, + {value: 0x8127, lo: 0xba, hi: 0xbd}, + // Block 0x26, offset 0x107 + {value: 0x0000, lo: 0x0b}, + {value: 0x8127, lo: 0x80, hi: 0x80}, + {value: 0x4a96, lo: 0x81, hi: 0x81}, + {value: 0x8132, lo: 0x82, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0x86, hi: 0x87}, + {value: 0x266e, lo: 0x93, hi: 0x93}, + {value: 0x2675, lo: 0x9d, hi: 0x9d}, + {value: 0x267c, lo: 0xa2, hi: 0xa2}, + {value: 0x2683, lo: 0xa7, hi: 0xa7}, + {value: 0x268a, lo: 0xac, hi: 0xac}, + {value: 0x2667, lo: 0xb9, hi: 0xb9}, + // Block 0x27, offset 0x113 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x86, hi: 0x86}, + // Block 0x28, offset 0x115 + {value: 0x0000, lo: 0x05}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x2d1e, lo: 0xa6, hi: 0xa6}, + {value: 0x9900, lo: 0xae, hi: 0xae}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x29, offset 0x11b + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + // Block 0x2a, offset 0x11d + {value: 0x0000, lo: 0x01}, + {value: 0x030f, lo: 0xbc, hi: 0xbc}, + // Block 0x2b, offset 0x11f + {value: 0x0000, lo: 0x01}, + {value: 0xa000, lo: 0x80, hi: 0x92}, + // Block 0x2c, offset 0x121 + {value: 0x0000, lo: 0x01}, + {value: 0xb900, lo: 0xa1, hi: 0xb5}, + // Block 0x2d, offset 0x123 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0xa8, hi: 0xbf}, + // Block 0x2e, offset 0x125 + {value: 0x0000, lo: 0x01}, + {value: 0x9900, lo: 0x80, hi: 0x82}, + // Block 0x2f, offset 0x127 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x9d, hi: 0x9f}, + // Block 0x30, offset 0x129 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x94, hi: 0x94}, + {value: 0x8104, lo: 0xb4, hi: 0xb4}, + // Block 0x31, offset 0x12c + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x92, hi: 0x92}, + {value: 0x8132, lo: 0x9d, hi: 0x9d}, + // Block 0x32, offset 0x12f + {value: 0x0000, lo: 0x01}, + {value: 0x8131, lo: 0xa9, hi: 0xa9}, + // Block 0x33, offset 0x131 + {value: 0x0004, lo: 0x02}, + {value: 0x812e, lo: 0xb9, hi: 0xba}, + {value: 0x812d, lo: 0xbb, hi: 0xbb}, + // Block 0x34, offset 0x134 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x97, hi: 0x97}, + {value: 0x812d, lo: 0x98, hi: 0x98}, + // Block 0x35, offset 0x137 + {value: 0x0000, lo: 0x03}, + {value: 0x8104, lo: 0xa0, hi: 0xa0}, + {value: 0x8132, lo: 0xb5, hi: 0xbc}, + {value: 0x812d, lo: 0xbf, hi: 0xbf}, + // Block 0x36, offset 0x13b + {value: 0x0000, lo: 0x04}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + {value: 0x812d, lo: 0xb5, hi: 0xba}, + {value: 0x8132, lo: 0xbb, hi: 0xbc}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x37, offset 0x140 + {value: 0x0000, lo: 0x08}, + {value: 0x2d66, lo: 0x80, hi: 0x80}, + {value: 0x2d6e, lo: 0x81, hi: 0x81}, + {value: 0xa000, lo: 0x82, hi: 0x82}, + {value: 0x2d76, lo: 0x83, hi: 0x83}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xab, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xac}, + {value: 0x8132, lo: 0xad, hi: 0xb3}, + // Block 0x38, offset 0x149 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xaa, hi: 0xab}, + // Block 0x39, offset 0x14b + {value: 0x0000, lo: 0x02}, + {value: 0x8102, lo: 0xa6, hi: 0xa6}, + {value: 0x8104, lo: 0xb2, hi: 0xb3}, + // Block 0x3a, offset 0x14e + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x3b, offset 0x150 + {value: 0x0000, lo: 0x0a}, + {value: 0x8132, lo: 0x90, hi: 0x92}, + {value: 0x8101, lo: 0x94, hi: 0x94}, + {value: 0x812d, lo: 0x95, hi: 0x99}, + {value: 0x8132, lo: 0x9a, hi: 0x9b}, + {value: 0x812d, lo: 0x9c, hi: 0x9f}, + {value: 0x8132, lo: 0xa0, hi: 0xa0}, + {value: 0x8101, lo: 0xa2, hi: 0xa8}, + {value: 0x812d, lo: 0xad, hi: 0xad}, + {value: 0x8132, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb8, hi: 0xb9}, + // Block 0x3c, offset 0x15b + {value: 0x0002, lo: 0x0a}, + {value: 0x0043, lo: 0xac, hi: 0xac}, + {value: 0x00d1, lo: 0xad, hi: 0xad}, + {value: 0x0045, lo: 0xae, hi: 0xae}, + {value: 0x0049, lo: 0xb0, hi: 0xb1}, + {value: 0x00e6, lo: 0xb2, hi: 0xb2}, + {value: 0x004f, lo: 0xb3, hi: 0xba}, + {value: 0x005f, lo: 0xbc, hi: 0xbc}, + {value: 0x00ef, lo: 0xbd, hi: 0xbd}, + {value: 0x0061, lo: 0xbe, hi: 0xbe}, + {value: 0x0065, lo: 0xbf, hi: 0xbf}, + // Block 0x3d, offset 0x166 + {value: 0x0000, lo: 0x0f}, + {value: 0x8132, lo: 0x80, hi: 0x81}, + {value: 0x812d, lo: 0x82, hi: 0x82}, + {value: 0x8132, lo: 0x83, hi: 0x89}, + {value: 0x812d, lo: 0x8a, hi: 0x8a}, + {value: 0x8132, lo: 0x8b, hi: 0x8c}, + {value: 0x8135, lo: 0x8d, hi: 0x8d}, + {value: 0x812a, lo: 0x8e, hi: 0x8e}, + {value: 0x812d, lo: 0x8f, hi: 0x8f}, + {value: 0x8129, lo: 0x90, hi: 0x90}, + {value: 0x8132, lo: 0x91, hi: 0xb5}, + {value: 0x8132, lo: 0xbb, hi: 0xbb}, + {value: 0x8134, lo: 0xbc, hi: 0xbc}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + {value: 0x8132, lo: 0xbe, hi: 0xbe}, + {value: 0x812d, lo: 0xbf, hi: 0xbf}, + // Block 0x3e, offset 0x176 + {value: 0x0000, lo: 0x0d}, + {value: 0x0001, lo: 0x80, hi: 0x8a}, + {value: 0x043b, lo: 0x91, hi: 0x91}, + {value: 0x429b, lo: 0x97, hi: 0x97}, + {value: 0x001d, lo: 0xa4, hi: 0xa4}, + {value: 0x1873, lo: 0xa5, hi: 0xa5}, + {value: 0x1b5c, lo: 0xa6, hi: 0xa6}, + {value: 0x0001, lo: 0xaf, hi: 0xaf}, + {value: 0x2691, lo: 0xb3, hi: 0xb3}, + {value: 0x27fe, lo: 0xb4, hi: 0xb4}, + {value: 0x2698, lo: 0xb6, hi: 0xb6}, + {value: 0x2808, lo: 0xb7, hi: 0xb7}, + {value: 0x186d, lo: 0xbc, hi: 0xbc}, + {value: 0x4269, lo: 0xbe, hi: 0xbe}, + // Block 0x3f, offset 0x184 + {value: 0x0002, lo: 0x0d}, + {value: 0x1933, lo: 0x87, hi: 0x87}, + {value: 0x1930, lo: 0x88, hi: 0x88}, + {value: 0x1870, lo: 0x89, hi: 0x89}, + {value: 0x298e, lo: 0x97, hi: 0x97}, + {value: 0x0001, lo: 0x9f, hi: 0x9f}, + {value: 0x0021, lo: 0xb0, hi: 0xb0}, + {value: 0x0093, lo: 0xb1, hi: 0xb1}, + {value: 0x0029, lo: 0xb4, hi: 0xb9}, + {value: 0x0017, lo: 0xba, hi: 0xba}, + {value: 0x0467, lo: 0xbb, hi: 0xbb}, + {value: 0x003b, lo: 0xbc, hi: 0xbc}, + {value: 0x0011, lo: 0xbd, hi: 0xbe}, + {value: 0x009d, lo: 0xbf, hi: 0xbf}, + // Block 0x40, offset 0x192 + {value: 0x0002, lo: 0x0f}, + {value: 0x0021, lo: 0x80, hi: 0x89}, + {value: 0x0017, lo: 0x8a, hi: 0x8a}, + {value: 0x0467, lo: 0x8b, hi: 0x8b}, + {value: 0x003b, lo: 0x8c, hi: 0x8c}, + {value: 0x0011, lo: 0x8d, hi: 0x8e}, + {value: 0x0083, lo: 0x90, hi: 0x90}, + {value: 0x008b, lo: 0x91, hi: 0x91}, + {value: 0x009f, lo: 0x92, hi: 0x92}, + {value: 0x00b1, lo: 0x93, hi: 0x93}, + {value: 0x0104, lo: 0x94, hi: 0x94}, + {value: 0x0091, lo: 0x95, hi: 0x95}, + {value: 0x0097, lo: 0x96, hi: 0x99}, + {value: 0x00a1, lo: 0x9a, hi: 0x9a}, + {value: 0x00a7, lo: 0x9b, hi: 0x9c}, + {value: 0x1999, lo: 0xa8, hi: 0xa8}, + // Block 0x41, offset 0x1a2 + {value: 0x0000, lo: 0x0d}, + {value: 0x8132, lo: 0x90, hi: 0x91}, + {value: 0x8101, lo: 0x92, hi: 0x93}, + {value: 0x8132, lo: 0x94, hi: 0x97}, + {value: 0x8101, lo: 0x98, hi: 0x9a}, + {value: 0x8132, lo: 0x9b, hi: 0x9c}, + {value: 0x8132, lo: 0xa1, hi: 0xa1}, + {value: 0x8101, lo: 0xa5, hi: 0xa6}, + {value: 0x8132, lo: 0xa7, hi: 0xa7}, + {value: 0x812d, lo: 0xa8, hi: 0xa8}, + {value: 0x8132, lo: 0xa9, hi: 0xa9}, + {value: 0x8101, lo: 0xaa, hi: 0xab}, + {value: 0x812d, lo: 0xac, hi: 0xaf}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + // Block 0x42, offset 0x1b0 + {value: 0x0007, lo: 0x06}, + {value: 0x2180, lo: 0x89, hi: 0x89}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + {value: 0x3bb9, lo: 0x9a, hi: 0x9b}, + {value: 0x3bc7, lo: 0xae, hi: 0xae}, + // Block 0x43, offset 0x1b7 + {value: 0x000e, lo: 0x05}, + {value: 0x3bce, lo: 0x8d, hi: 0x8e}, + {value: 0x3bd5, lo: 0x8f, hi: 0x8f}, + {value: 0xa000, lo: 0x90, hi: 0x90}, + {value: 0xa000, lo: 0x92, hi: 0x92}, + {value: 0xa000, lo: 0x94, hi: 0x94}, + // Block 0x44, offset 0x1bd + {value: 0x0173, lo: 0x0e}, + {value: 0xa000, lo: 0x83, hi: 0x83}, + {value: 0x3be3, lo: 0x84, hi: 0x84}, + {value: 0xa000, lo: 0x88, hi: 0x88}, + {value: 0x3bea, lo: 0x89, hi: 0x89}, + {value: 0xa000, lo: 0x8b, hi: 0x8b}, + {value: 0x3bf1, lo: 0x8c, hi: 0x8c}, + {value: 0xa000, lo: 0xa3, hi: 0xa3}, + {value: 0x3bf8, lo: 0xa4, hi: 0xa4}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x3bff, lo: 0xa6, hi: 0xa6}, + {value: 0x269f, lo: 0xac, hi: 0xad}, + {value: 0x26a6, lo: 0xaf, hi: 0xaf}, + {value: 0x281c, lo: 0xb0, hi: 0xb0}, + {value: 0xa000, lo: 0xbc, hi: 0xbc}, + // Block 0x45, offset 0x1cc + {value: 0x0007, lo: 0x03}, + {value: 0x3c68, lo: 0xa0, hi: 0xa1}, + {value: 0x3c92, lo: 0xa2, hi: 0xa3}, + {value: 0x3cbc, lo: 0xaa, hi: 0xad}, + // Block 0x46, offset 0x1d0 + {value: 0x0004, lo: 0x01}, + {value: 0x048b, lo: 0xa9, hi: 0xaa}, + // Block 0x47, offset 0x1d2 + {value: 0x0002, lo: 0x03}, + {value: 0x0057, lo: 0x80, hi: 0x8f}, + {value: 0x0083, lo: 0x90, hi: 0xa9}, + {value: 0x0021, lo: 0xaa, hi: 0xaa}, + // Block 0x48, offset 0x1d6 + {value: 0x0000, lo: 0x01}, + {value: 0x299b, lo: 0x8c, hi: 0x8c}, + // Block 0x49, offset 0x1d8 + {value: 0x0263, lo: 0x02}, + {value: 0x1b8c, lo: 0xb4, hi: 0xb4}, + {value: 0x192d, lo: 0xb5, hi: 0xb6}, + // Block 0x4a, offset 0x1db + {value: 0x0000, lo: 0x01}, + {value: 0x44dd, lo: 0x9c, hi: 0x9c}, + // Block 0x4b, offset 0x1dd + {value: 0x0000, lo: 0x02}, + {value: 0x0095, lo: 0xbc, hi: 0xbc}, + {value: 0x006d, lo: 0xbd, hi: 0xbd}, + // Block 0x4c, offset 0x1e0 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xaf, hi: 0xb1}, + // Block 0x4d, offset 0x1e2 + {value: 0x0000, lo: 0x02}, + {value: 0x047f, lo: 0xaf, hi: 0xaf}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x4e, offset 0x1e5 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xa0, hi: 0xbf}, + // Block 0x4f, offset 0x1e7 + {value: 0x0000, lo: 0x01}, + {value: 0x0dc3, lo: 0x9f, hi: 0x9f}, + // Block 0x50, offset 0x1e9 + {value: 0x0000, lo: 0x01}, + {value: 0x162f, lo: 0xb3, hi: 0xb3}, + // Block 0x51, offset 0x1eb + {value: 0x0004, lo: 0x0b}, + {value: 0x1597, lo: 0x80, hi: 0x82}, + {value: 0x15af, lo: 0x83, hi: 0x83}, + {value: 0x15c7, lo: 0x84, hi: 0x85}, + {value: 0x15d7, lo: 0x86, hi: 0x89}, + {value: 0x15eb, lo: 0x8a, hi: 0x8c}, + {value: 0x15ff, lo: 0x8d, hi: 0x8d}, + {value: 0x1607, lo: 0x8e, hi: 0x8e}, + {value: 0x160f, lo: 0x8f, hi: 0x90}, + {value: 0x161b, lo: 0x91, hi: 0x93}, + {value: 0x162b, lo: 0x94, hi: 0x94}, + {value: 0x1633, lo: 0x95, hi: 0x95}, + // Block 0x52, offset 0x1f7 + {value: 0x0004, lo: 0x09}, + {value: 0x0001, lo: 0x80, hi: 0x80}, + {value: 0x812c, lo: 0xaa, hi: 0xaa}, + {value: 0x8131, lo: 0xab, hi: 0xab}, + {value: 0x8133, lo: 0xac, hi: 0xac}, + {value: 0x812e, lo: 0xad, hi: 0xad}, + {value: 0x812f, lo: 0xae, hi: 0xae}, + {value: 0x812f, lo: 0xaf, hi: 0xaf}, + {value: 0x04b3, lo: 0xb6, hi: 0xb6}, + {value: 0x0887, lo: 0xb8, hi: 0xba}, + // Block 0x53, offset 0x201 + {value: 0x0006, lo: 0x09}, + {value: 0x0313, lo: 0xb1, hi: 0xb1}, + {value: 0x0317, lo: 0xb2, hi: 0xb2}, + {value: 0x4a3b, lo: 0xb3, hi: 0xb3}, + {value: 0x031b, lo: 0xb4, hi: 0xb4}, + {value: 0x4a41, lo: 0xb5, hi: 0xb6}, + {value: 0x031f, lo: 0xb7, hi: 0xb7}, + {value: 0x0323, lo: 0xb8, hi: 0xb8}, + {value: 0x0327, lo: 0xb9, hi: 0xb9}, + {value: 0x4a4d, lo: 0xba, hi: 0xbf}, + // Block 0x54, offset 0x20b + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xaf, hi: 0xaf}, + {value: 0x8132, lo: 0xb4, hi: 0xbd}, + // Block 0x55, offset 0x20e + {value: 0x0000, lo: 0x03}, + {value: 0x020f, lo: 0x9c, hi: 0x9c}, + {value: 0x0212, lo: 0x9d, hi: 0x9d}, + {value: 0x8132, lo: 0x9e, hi: 0x9f}, + // Block 0x56, offset 0x212 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb1}, + // Block 0x57, offset 0x214 + {value: 0x0000, lo: 0x01}, + {value: 0x163b, lo: 0xb0, hi: 0xb0}, + // Block 0x58, offset 0x216 + {value: 0x000c, lo: 0x01}, + {value: 0x00d7, lo: 0xb8, hi: 0xb9}, + // Block 0x59, offset 0x218 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + // Block 0x5a, offset 0x21a + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x84, hi: 0x84}, + {value: 0x8132, lo: 0xa0, hi: 0xb1}, + // Block 0x5b, offset 0x21d + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xab, hi: 0xad}, + // Block 0x5c, offset 0x21f + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x93, hi: 0x93}, + // Block 0x5d, offset 0x221 + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0xb3, hi: 0xb3}, + // Block 0x5e, offset 0x223 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + // Block 0x5f, offset 0x225 + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0xb0, hi: 0xb0}, + {value: 0x8132, lo: 0xb2, hi: 0xb3}, + {value: 0x812d, lo: 0xb4, hi: 0xb4}, + {value: 0x8132, lo: 0xb7, hi: 0xb8}, + {value: 0x8132, lo: 0xbe, hi: 0xbf}, + // Block 0x60, offset 0x22b + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x81, hi: 0x81}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + // Block 0x61, offset 0x22e + {value: 0x0008, lo: 0x03}, + {value: 0x1637, lo: 0x9c, hi: 0x9d}, + {value: 0x0125, lo: 0x9e, hi: 0x9e}, + {value: 0x1643, lo: 0x9f, hi: 0x9f}, + // Block 0x62, offset 0x232 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xad, hi: 0xad}, + // Block 0x63, offset 0x234 + {value: 0x0000, lo: 0x06}, + {value: 0xe500, lo: 0x80, hi: 0x80}, + {value: 0xc600, lo: 0x81, hi: 0x9b}, + {value: 0xe500, lo: 0x9c, hi: 0x9c}, + {value: 0xc600, lo: 0x9d, hi: 0xb7}, + {value: 0xe500, lo: 0xb8, hi: 0xb8}, + {value: 0xc600, lo: 0xb9, hi: 0xbf}, + // Block 0x64, offset 0x23b + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x93}, + {value: 0xe500, lo: 0x94, hi: 0x94}, + {value: 0xc600, lo: 0x95, hi: 0xaf}, + {value: 0xe500, lo: 0xb0, hi: 0xb0}, + {value: 0xc600, lo: 0xb1, hi: 0xbf}, + // Block 0x65, offset 0x241 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8b}, + {value: 0xe500, lo: 0x8c, hi: 0x8c}, + {value: 0xc600, lo: 0x8d, hi: 0xa7}, + {value: 0xe500, lo: 0xa8, hi: 0xa8}, + {value: 0xc600, lo: 0xa9, hi: 0xbf}, + // Block 0x66, offset 0x247 + {value: 0x0000, lo: 0x07}, + {value: 0xc600, lo: 0x80, hi: 0x83}, + {value: 0xe500, lo: 0x84, hi: 0x84}, + {value: 0xc600, lo: 0x85, hi: 0x9f}, + {value: 0xe500, lo: 0xa0, hi: 0xa0}, + {value: 0xc600, lo: 0xa1, hi: 0xbb}, + {value: 0xe500, lo: 0xbc, hi: 0xbc}, + {value: 0xc600, lo: 0xbd, hi: 0xbf}, + // Block 0x67, offset 0x24f + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x97}, + {value: 0xe500, lo: 0x98, hi: 0x98}, + {value: 0xc600, lo: 0x99, hi: 0xb3}, + {value: 0xe500, lo: 0xb4, hi: 0xb4}, + {value: 0xc600, lo: 0xb5, hi: 0xbf}, + // Block 0x68, offset 0x255 + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x8f}, + {value: 0xe500, lo: 0x90, hi: 0x90}, + {value: 0xc600, lo: 0x91, hi: 0xab}, + {value: 0xe500, lo: 0xac, hi: 0xac}, + {value: 0xc600, lo: 0xad, hi: 0xbf}, + // Block 0x69, offset 0x25b + {value: 0x0000, lo: 0x05}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + {value: 0xe500, lo: 0xa4, hi: 0xa4}, + {value: 0xc600, lo: 0xa5, hi: 0xbf}, + // Block 0x6a, offset 0x261 + {value: 0x0000, lo: 0x03}, + {value: 0xc600, lo: 0x80, hi: 0x87}, + {value: 0xe500, lo: 0x88, hi: 0x88}, + {value: 0xc600, lo: 0x89, hi: 0xa3}, + // Block 0x6b, offset 0x265 + {value: 0x0002, lo: 0x01}, + {value: 0x0003, lo: 0x81, hi: 0xbf}, + // Block 0x6c, offset 0x267 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xbd, hi: 0xbd}, + // Block 0x6d, offset 0x269 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0xa0, hi: 0xa0}, + // Block 0x6e, offset 0x26b + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb6, hi: 0xba}, + // Block 0x6f, offset 0x26d + {value: 0x002c, lo: 0x05}, + {value: 0x812d, lo: 0x8d, hi: 0x8d}, + {value: 0x8132, lo: 0x8f, hi: 0x8f}, + {value: 0x8132, lo: 0xb8, hi: 0xb8}, + {value: 0x8101, lo: 0xb9, hi: 0xba}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x70, offset 0x273 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0xa5, hi: 0xa5}, + {value: 0x812d, lo: 0xa6, hi: 0xa6}, + // Block 0x71, offset 0x276 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x86, hi: 0x86}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x72, offset 0x279 + {value: 0x17fe, lo: 0x07}, + {value: 0xa000, lo: 0x99, hi: 0x99}, + {value: 0x4238, lo: 0x9a, hi: 0x9a}, + {value: 0xa000, lo: 0x9b, hi: 0x9b}, + {value: 0x4242, lo: 0x9c, hi: 0x9c}, + {value: 0xa000, lo: 0xa5, hi: 0xa5}, + {value: 0x424c, lo: 0xab, hi: 0xab}, + {value: 0x8104, lo: 0xb9, hi: 0xba}, + // Block 0x73, offset 0x281 + {value: 0x0000, lo: 0x06}, + {value: 0x8132, lo: 0x80, hi: 0x82}, + {value: 0x9900, lo: 0xa7, hi: 0xa7}, + {value: 0x2d7e, lo: 0xae, hi: 0xae}, + {value: 0x2d88, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb1, hi: 0xb2}, + {value: 0x8104, lo: 0xb3, hi: 0xb4}, + // Block 0x74, offset 0x288 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x80, hi: 0x80}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x75, offset 0x28b + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb5, hi: 0xb5}, + {value: 0x8102, lo: 0xb6, hi: 0xb6}, + // Block 0x76, offset 0x28e + {value: 0x0002, lo: 0x01}, + {value: 0x8102, lo: 0xa9, hi: 0xaa}, + // Block 0x77, offset 0x290 + {value: 0x0000, lo: 0x07}, + {value: 0xa000, lo: 0x87, hi: 0x87}, + {value: 0x2d92, lo: 0x8b, hi: 0x8b}, + {value: 0x2d9c, lo: 0x8c, hi: 0x8c}, + {value: 0x8104, lo: 0x8d, hi: 0x8d}, + {value: 0x9900, lo: 0x97, hi: 0x97}, + {value: 0x8132, lo: 0xa6, hi: 0xac}, + {value: 0x8132, lo: 0xb0, hi: 0xb4}, + // Block 0x78, offset 0x298 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x86, hi: 0x86}, + // Block 0x79, offset 0x29b + {value: 0x6b5a, lo: 0x06}, + {value: 0x9900, lo: 0xb0, hi: 0xb0}, + {value: 0xa000, lo: 0xb9, hi: 0xb9}, + {value: 0x9900, lo: 0xba, hi: 0xba}, + {value: 0x2db0, lo: 0xbb, hi: 0xbb}, + {value: 0x2da6, lo: 0xbc, hi: 0xbd}, + {value: 0x2dba, lo: 0xbe, hi: 0xbe}, + // Block 0x7a, offset 0x2a2 + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0x82, hi: 0x82}, + {value: 0x8102, lo: 0x83, hi: 0x83}, + // Block 0x7b, offset 0x2a5 + {value: 0x0000, lo: 0x05}, + {value: 0x9900, lo: 0xaf, hi: 0xaf}, + {value: 0xa000, lo: 0xb8, hi: 0xb9}, + {value: 0x2dc4, lo: 0xba, hi: 0xba}, + {value: 0x2dce, lo: 0xbb, hi: 0xbb}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x7c, offset 0x2ab + {value: 0x0000, lo: 0x01}, + {value: 0x8102, lo: 0x80, hi: 0x80}, + // Block 0x7d, offset 0x2ad + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xbf, hi: 0xbf}, + // Block 0x7e, offset 0x2af + {value: 0x0000, lo: 0x02}, + {value: 0x8104, lo: 0xb6, hi: 0xb6}, + {value: 0x8102, lo: 0xb7, hi: 0xb7}, + // Block 0x7f, offset 0x2b2 + {value: 0x0000, lo: 0x01}, + {value: 0x8104, lo: 0xab, hi: 0xab}, + // Block 0x80, offset 0x2b4 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0xb0, hi: 0xb4}, + // Block 0x81, offset 0x2b6 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0xb0, hi: 0xb6}, + // Block 0x82, offset 0x2b8 + {value: 0x0000, lo: 0x01}, + {value: 0x8101, lo: 0x9e, hi: 0x9e}, + // Block 0x83, offset 0x2ba + {value: 0x0000, lo: 0x0c}, + {value: 0x45cc, lo: 0x9e, hi: 0x9e}, + {value: 0x45d6, lo: 0x9f, hi: 0x9f}, + {value: 0x460a, lo: 0xa0, hi: 0xa0}, + {value: 0x4618, lo: 0xa1, hi: 0xa1}, + {value: 0x4626, lo: 0xa2, hi: 0xa2}, + {value: 0x4634, lo: 0xa3, hi: 0xa3}, + {value: 0x4642, lo: 0xa4, hi: 0xa4}, + {value: 0x812b, lo: 0xa5, hi: 0xa6}, + {value: 0x8101, lo: 0xa7, hi: 0xa9}, + {value: 0x8130, lo: 0xad, hi: 0xad}, + {value: 0x812b, lo: 0xae, hi: 0xb2}, + {value: 0x812d, lo: 0xbb, hi: 0xbf}, + // Block 0x84, offset 0x2c7 + {value: 0x0000, lo: 0x09}, + {value: 0x812d, lo: 0x80, hi: 0x82}, + {value: 0x8132, lo: 0x85, hi: 0x89}, + {value: 0x812d, lo: 0x8a, hi: 0x8b}, + {value: 0x8132, lo: 0xaa, hi: 0xad}, + {value: 0x45e0, lo: 0xbb, hi: 0xbb}, + {value: 0x45ea, lo: 0xbc, hi: 0xbc}, + {value: 0x4650, lo: 0xbd, hi: 0xbd}, + {value: 0x466c, lo: 0xbe, hi: 0xbe}, + {value: 0x465e, lo: 0xbf, hi: 0xbf}, + // Block 0x85, offset 0x2d1 + {value: 0x0000, lo: 0x01}, + {value: 0x467a, lo: 0x80, hi: 0x80}, + // Block 0x86, offset 0x2d3 + {value: 0x0000, lo: 0x01}, + {value: 0x8132, lo: 0x82, hi: 0x84}, + // Block 0x87, offset 0x2d5 + {value: 0x0002, lo: 0x03}, + {value: 0x0043, lo: 0x80, hi: 0x99}, + {value: 0x0083, lo: 0x9a, hi: 0xb3}, + {value: 0x0043, lo: 0xb4, hi: 0xbf}, + // Block 0x88, offset 0x2d9 + {value: 0x0002, lo: 0x04}, + {value: 0x005b, lo: 0x80, hi: 0x8d}, + {value: 0x0083, lo: 0x8e, hi: 0x94}, + {value: 0x0093, lo: 0x96, hi: 0xa7}, + {value: 0x0043, lo: 0xa8, hi: 0xbf}, + // Block 0x89, offset 0x2de + {value: 0x0002, lo: 0x0b}, + {value: 0x0073, lo: 0x80, hi: 0x81}, + {value: 0x0083, lo: 0x82, hi: 0x9b}, + {value: 0x0043, lo: 0x9c, hi: 0x9c}, + {value: 0x0047, lo: 0x9e, hi: 0x9f}, + {value: 0x004f, lo: 0xa2, hi: 0xa2}, + {value: 0x0055, lo: 0xa5, hi: 0xa6}, + {value: 0x005d, lo: 0xa9, hi: 0xac}, + {value: 0x0067, lo: 0xae, hi: 0xb5}, + {value: 0x0083, lo: 0xb6, hi: 0xb9}, + {value: 0x008d, lo: 0xbb, hi: 0xbb}, + {value: 0x0091, lo: 0xbd, hi: 0xbf}, + // Block 0x8a, offset 0x2ea + {value: 0x0002, lo: 0x04}, + {value: 0x0097, lo: 0x80, hi: 0x83}, + {value: 0x00a1, lo: 0x85, hi: 0x8f}, + {value: 0x0043, lo: 0x90, hi: 0xa9}, + {value: 0x0083, lo: 0xaa, hi: 0xbf}, + // Block 0x8b, offset 0x2ef + {value: 0x0002, lo: 0x08}, + {value: 0x00af, lo: 0x80, hi: 0x83}, + {value: 0x0043, lo: 0x84, hi: 0x85}, + {value: 0x0049, lo: 0x87, hi: 0x8a}, + {value: 0x0055, lo: 0x8d, hi: 0x94}, + {value: 0x0067, lo: 0x96, hi: 0x9c}, + {value: 0x0083, lo: 0x9e, hi: 0xb7}, + {value: 0x0043, lo: 0xb8, hi: 0xb9}, + {value: 0x0049, lo: 0xbb, hi: 0xbe}, + // Block 0x8c, offset 0x2f8 + {value: 0x0002, lo: 0x05}, + {value: 0x0053, lo: 0x80, hi: 0x84}, + {value: 0x005f, lo: 0x86, hi: 0x86}, + {value: 0x0067, lo: 0x8a, hi: 0x90}, + {value: 0x0083, lo: 0x92, hi: 0xab}, + {value: 0x0043, lo: 0xac, hi: 0xbf}, + // Block 0x8d, offset 0x2fe + {value: 0x0002, lo: 0x04}, + {value: 0x006b, lo: 0x80, hi: 0x85}, + {value: 0x0083, lo: 0x86, hi: 0x9f}, + {value: 0x0043, lo: 0xa0, hi: 0xb9}, + {value: 0x0083, lo: 0xba, hi: 0xbf}, + // Block 0x8e, offset 0x303 + {value: 0x0002, lo: 0x03}, + {value: 0x008f, lo: 0x80, hi: 0x93}, + {value: 0x0043, lo: 0x94, hi: 0xad}, + {value: 0x0083, lo: 0xae, hi: 0xbf}, + // Block 0x8f, offset 0x307 + {value: 0x0002, lo: 0x04}, + {value: 0x00a7, lo: 0x80, hi: 0x87}, + {value: 0x0043, lo: 0x88, hi: 0xa1}, + {value: 0x0083, lo: 0xa2, hi: 0xbb}, + {value: 0x0043, lo: 0xbc, hi: 0xbf}, + // Block 0x90, offset 0x30c + {value: 0x0002, lo: 0x03}, + {value: 0x004b, lo: 0x80, hi: 0x95}, + {value: 0x0083, lo: 0x96, hi: 0xaf}, + {value: 0x0043, lo: 0xb0, hi: 0xbf}, + // Block 0x91, offset 0x310 + {value: 0x0003, lo: 0x0f}, + {value: 0x01b8, lo: 0x80, hi: 0x80}, + {value: 0x045f, lo: 0x81, hi: 0x81}, + {value: 0x01bb, lo: 0x82, hi: 0x9a}, + {value: 0x045b, lo: 0x9b, hi: 0x9b}, + {value: 0x01c7, lo: 0x9c, hi: 0x9c}, + {value: 0x01d0, lo: 0x9d, hi: 0x9d}, + {value: 0x01d6, lo: 0x9e, hi: 0x9e}, + {value: 0x01fa, lo: 0x9f, hi: 0x9f}, + {value: 0x01eb, lo: 0xa0, hi: 0xa0}, + {value: 0x01e8, lo: 0xa1, hi: 0xa1}, + {value: 0x0173, lo: 0xa2, hi: 0xb2}, + {value: 0x0188, lo: 0xb3, hi: 0xb3}, + {value: 0x01a6, lo: 0xb4, hi: 0xba}, + {value: 0x045f, lo: 0xbb, hi: 0xbb}, + {value: 0x01bb, lo: 0xbc, hi: 0xbf}, + // Block 0x92, offset 0x320 + {value: 0x0003, lo: 0x0d}, + {value: 0x01c7, lo: 0x80, hi: 0x94}, + {value: 0x045b, lo: 0x95, hi: 0x95}, + {value: 0x01c7, lo: 0x96, hi: 0x96}, + {value: 0x01d0, lo: 0x97, hi: 0x97}, + {value: 0x01d6, lo: 0x98, hi: 0x98}, + {value: 0x01fa, lo: 0x99, hi: 0x99}, + {value: 0x01eb, lo: 0x9a, hi: 0x9a}, + {value: 0x01e8, lo: 0x9b, hi: 0x9b}, + {value: 0x0173, lo: 0x9c, hi: 0xac}, + {value: 0x0188, lo: 0xad, hi: 0xad}, + {value: 0x01a6, lo: 0xae, hi: 0xb4}, + {value: 0x045f, lo: 0xb5, hi: 0xb5}, + {value: 0x01bb, lo: 0xb6, hi: 0xbf}, + // Block 0x93, offset 0x32e + {value: 0x0003, lo: 0x0d}, + {value: 0x01d9, lo: 0x80, hi: 0x8e}, + {value: 0x045b, lo: 0x8f, hi: 0x8f}, + {value: 0x01c7, lo: 0x90, hi: 0x90}, + {value: 0x01d0, lo: 0x91, hi: 0x91}, + {value: 0x01d6, lo: 0x92, hi: 0x92}, + {value: 0x01fa, lo: 0x93, hi: 0x93}, + {value: 0x01eb, lo: 0x94, hi: 0x94}, + {value: 0x01e8, lo: 0x95, hi: 0x95}, + {value: 0x0173, lo: 0x96, hi: 0xa6}, + {value: 0x0188, lo: 0xa7, hi: 0xa7}, + {value: 0x01a6, lo: 0xa8, hi: 0xae}, + {value: 0x045f, lo: 0xaf, hi: 0xaf}, + {value: 0x01bb, lo: 0xb0, hi: 0xbf}, + // Block 0x94, offset 0x33c + {value: 0x0003, lo: 0x0d}, + {value: 0x01eb, lo: 0x80, hi: 0x88}, + {value: 0x045b, lo: 0x89, hi: 0x89}, + {value: 0x01c7, lo: 0x8a, hi: 0x8a}, + {value: 0x01d0, lo: 0x8b, hi: 0x8b}, + {value: 0x01d6, lo: 0x8c, hi: 0x8c}, + {value: 0x01fa, lo: 0x8d, hi: 0x8d}, + {value: 0x01eb, lo: 0x8e, hi: 0x8e}, + {value: 0x01e8, lo: 0x8f, hi: 0x8f}, + {value: 0x0173, lo: 0x90, hi: 0xa0}, + {value: 0x0188, lo: 0xa1, hi: 0xa1}, + {value: 0x01a6, lo: 0xa2, hi: 0xa8}, + {value: 0x045f, lo: 0xa9, hi: 0xa9}, + {value: 0x01bb, lo: 0xaa, hi: 0xbf}, + // Block 0x95, offset 0x34a + {value: 0x0000, lo: 0x05}, + {value: 0x8132, lo: 0x80, hi: 0x86}, + {value: 0x8132, lo: 0x88, hi: 0x98}, + {value: 0x8132, lo: 0x9b, hi: 0xa1}, + {value: 0x8132, lo: 0xa3, hi: 0xa4}, + {value: 0x8132, lo: 0xa6, hi: 0xaa}, + // Block 0x96, offset 0x350 + {value: 0x0000, lo: 0x01}, + {value: 0x812d, lo: 0x90, hi: 0x96}, + // Block 0x97, offset 0x352 + {value: 0x0000, lo: 0x02}, + {value: 0x8132, lo: 0x84, hi: 0x89}, + {value: 0x8102, lo: 0x8a, hi: 0x8a}, + // Block 0x98, offset 0x355 + {value: 0x0002, lo: 0x09}, + {value: 0x0063, lo: 0x80, hi: 0x89}, + {value: 0x1951, lo: 0x8a, hi: 0x8a}, + {value: 0x1981, lo: 0x8b, hi: 0x8b}, + {value: 0x199c, lo: 0x8c, hi: 0x8c}, + {value: 0x19a2, lo: 0x8d, hi: 0x8d}, + {value: 0x1bc0, lo: 0x8e, hi: 0x8e}, + {value: 0x19ae, lo: 0x8f, hi: 0x8f}, + {value: 0x197b, lo: 0xaa, hi: 0xaa}, + {value: 0x197e, lo: 0xab, hi: 0xab}, + // Block 0x99, offset 0x35f + {value: 0x0000, lo: 0x01}, + {value: 0x193f, lo: 0x90, hi: 0x90}, + // Block 0x9a, offset 0x361 + {value: 0x0028, lo: 0x09}, + {value: 0x2862, lo: 0x80, hi: 0x80}, + {value: 0x2826, lo: 0x81, hi: 0x81}, + {value: 0x2830, lo: 0x82, hi: 0x82}, + {value: 0x2844, lo: 0x83, hi: 0x84}, + {value: 0x284e, lo: 0x85, hi: 0x86}, + {value: 0x283a, lo: 0x87, hi: 0x87}, + {value: 0x2858, lo: 0x88, hi: 0x88}, + {value: 0x0b6f, lo: 0x90, hi: 0x90}, + {value: 0x08e7, lo: 0x91, hi: 0x91}, +} + +// recompMap: 7520 bytes (entries only) +var recompMap = map[uint32]rune{ + 0x00410300: 0x00C0, + 0x00410301: 0x00C1, + 0x00410302: 0x00C2, + 0x00410303: 0x00C3, + 0x00410308: 0x00C4, + 0x0041030A: 0x00C5, + 0x00430327: 0x00C7, + 0x00450300: 0x00C8, + 0x00450301: 0x00C9, + 0x00450302: 0x00CA, + 0x00450308: 0x00CB, + 0x00490300: 0x00CC, + 0x00490301: 0x00CD, + 0x00490302: 0x00CE, + 0x00490308: 0x00CF, + 0x004E0303: 0x00D1, + 0x004F0300: 0x00D2, + 0x004F0301: 0x00D3, + 0x004F0302: 0x00D4, + 0x004F0303: 0x00D5, + 0x004F0308: 0x00D6, + 0x00550300: 0x00D9, + 0x00550301: 0x00DA, + 0x00550302: 0x00DB, + 0x00550308: 0x00DC, + 0x00590301: 0x00DD, + 0x00610300: 0x00E0, + 0x00610301: 0x00E1, + 0x00610302: 0x00E2, + 0x00610303: 0x00E3, + 0x00610308: 0x00E4, + 0x0061030A: 0x00E5, + 0x00630327: 0x00E7, + 0x00650300: 0x00E8, + 0x00650301: 0x00E9, + 0x00650302: 0x00EA, + 0x00650308: 0x00EB, + 0x00690300: 0x00EC, + 0x00690301: 0x00ED, + 0x00690302: 0x00EE, + 0x00690308: 0x00EF, + 0x006E0303: 0x00F1, + 0x006F0300: 0x00F2, + 0x006F0301: 0x00F3, + 0x006F0302: 0x00F4, + 0x006F0303: 0x00F5, + 0x006F0308: 0x00F6, + 0x00750300: 0x00F9, + 0x00750301: 0x00FA, + 0x00750302: 0x00FB, + 0x00750308: 0x00FC, + 0x00790301: 0x00FD, + 0x00790308: 0x00FF, + 0x00410304: 0x0100, + 0x00610304: 0x0101, + 0x00410306: 0x0102, + 0x00610306: 0x0103, + 0x00410328: 0x0104, + 0x00610328: 0x0105, + 0x00430301: 0x0106, + 0x00630301: 0x0107, + 0x00430302: 0x0108, + 0x00630302: 0x0109, + 0x00430307: 0x010A, + 0x00630307: 0x010B, + 0x0043030C: 0x010C, + 0x0063030C: 0x010D, + 0x0044030C: 0x010E, + 0x0064030C: 0x010F, + 0x00450304: 0x0112, + 0x00650304: 0x0113, + 0x00450306: 0x0114, + 0x00650306: 0x0115, + 0x00450307: 0x0116, + 0x00650307: 0x0117, + 0x00450328: 0x0118, + 0x00650328: 0x0119, + 0x0045030C: 0x011A, + 0x0065030C: 0x011B, + 0x00470302: 0x011C, + 0x00670302: 0x011D, + 0x00470306: 0x011E, + 0x00670306: 0x011F, + 0x00470307: 0x0120, + 0x00670307: 0x0121, + 0x00470327: 0x0122, + 0x00670327: 0x0123, + 0x00480302: 0x0124, + 0x00680302: 0x0125, + 0x00490303: 0x0128, + 0x00690303: 0x0129, + 0x00490304: 0x012A, + 0x00690304: 0x012B, + 0x00490306: 0x012C, + 0x00690306: 0x012D, + 0x00490328: 0x012E, + 0x00690328: 0x012F, + 0x00490307: 0x0130, + 0x004A0302: 0x0134, + 0x006A0302: 0x0135, + 0x004B0327: 0x0136, + 0x006B0327: 0x0137, + 0x004C0301: 0x0139, + 0x006C0301: 0x013A, + 0x004C0327: 0x013B, + 0x006C0327: 0x013C, + 0x004C030C: 0x013D, + 0x006C030C: 0x013E, + 0x004E0301: 0x0143, + 0x006E0301: 0x0144, + 0x004E0327: 0x0145, + 0x006E0327: 0x0146, + 0x004E030C: 0x0147, + 0x006E030C: 0x0148, + 0x004F0304: 0x014C, + 0x006F0304: 0x014D, + 0x004F0306: 0x014E, + 0x006F0306: 0x014F, + 0x004F030B: 0x0150, + 0x006F030B: 0x0151, + 0x00520301: 0x0154, + 0x00720301: 0x0155, + 0x00520327: 0x0156, + 0x00720327: 0x0157, + 0x0052030C: 0x0158, + 0x0072030C: 0x0159, + 0x00530301: 0x015A, + 0x00730301: 0x015B, + 0x00530302: 0x015C, + 0x00730302: 0x015D, + 0x00530327: 0x015E, + 0x00730327: 0x015F, + 0x0053030C: 0x0160, + 0x0073030C: 0x0161, + 0x00540327: 0x0162, + 0x00740327: 0x0163, + 0x0054030C: 0x0164, + 0x0074030C: 0x0165, + 0x00550303: 0x0168, + 0x00750303: 0x0169, + 0x00550304: 0x016A, + 0x00750304: 0x016B, + 0x00550306: 0x016C, + 0x00750306: 0x016D, + 0x0055030A: 0x016E, + 0x0075030A: 0x016F, + 0x0055030B: 0x0170, + 0x0075030B: 0x0171, + 0x00550328: 0x0172, + 0x00750328: 0x0173, + 0x00570302: 0x0174, + 0x00770302: 0x0175, + 0x00590302: 0x0176, + 0x00790302: 0x0177, + 0x00590308: 0x0178, + 0x005A0301: 0x0179, + 0x007A0301: 0x017A, + 0x005A0307: 0x017B, + 0x007A0307: 0x017C, + 0x005A030C: 0x017D, + 0x007A030C: 0x017E, + 0x004F031B: 0x01A0, + 0x006F031B: 0x01A1, + 0x0055031B: 0x01AF, + 0x0075031B: 0x01B0, + 0x0041030C: 0x01CD, + 0x0061030C: 0x01CE, + 0x0049030C: 0x01CF, + 0x0069030C: 0x01D0, + 0x004F030C: 0x01D1, + 0x006F030C: 0x01D2, + 0x0055030C: 0x01D3, + 0x0075030C: 0x01D4, + 0x00DC0304: 0x01D5, + 0x00FC0304: 0x01D6, + 0x00DC0301: 0x01D7, + 0x00FC0301: 0x01D8, + 0x00DC030C: 0x01D9, + 0x00FC030C: 0x01DA, + 0x00DC0300: 0x01DB, + 0x00FC0300: 0x01DC, + 0x00C40304: 0x01DE, + 0x00E40304: 0x01DF, + 0x02260304: 0x01E0, + 0x02270304: 0x01E1, + 0x00C60304: 0x01E2, + 0x00E60304: 0x01E3, + 0x0047030C: 0x01E6, + 0x0067030C: 0x01E7, + 0x004B030C: 0x01E8, + 0x006B030C: 0x01E9, + 0x004F0328: 0x01EA, + 0x006F0328: 0x01EB, + 0x01EA0304: 0x01EC, + 0x01EB0304: 0x01ED, + 0x01B7030C: 0x01EE, + 0x0292030C: 0x01EF, + 0x006A030C: 0x01F0, + 0x00470301: 0x01F4, + 0x00670301: 0x01F5, + 0x004E0300: 0x01F8, + 0x006E0300: 0x01F9, + 0x00C50301: 0x01FA, + 0x00E50301: 0x01FB, + 0x00C60301: 0x01FC, + 0x00E60301: 0x01FD, + 0x00D80301: 0x01FE, + 0x00F80301: 0x01FF, + 0x0041030F: 0x0200, + 0x0061030F: 0x0201, + 0x00410311: 0x0202, + 0x00610311: 0x0203, + 0x0045030F: 0x0204, + 0x0065030F: 0x0205, + 0x00450311: 0x0206, + 0x00650311: 0x0207, + 0x0049030F: 0x0208, + 0x0069030F: 0x0209, + 0x00490311: 0x020A, + 0x00690311: 0x020B, + 0x004F030F: 0x020C, + 0x006F030F: 0x020D, + 0x004F0311: 0x020E, + 0x006F0311: 0x020F, + 0x0052030F: 0x0210, + 0x0072030F: 0x0211, + 0x00520311: 0x0212, + 0x00720311: 0x0213, + 0x0055030F: 0x0214, + 0x0075030F: 0x0215, + 0x00550311: 0x0216, + 0x00750311: 0x0217, + 0x00530326: 0x0218, + 0x00730326: 0x0219, + 0x00540326: 0x021A, + 0x00740326: 0x021B, + 0x0048030C: 0x021E, + 0x0068030C: 0x021F, + 0x00410307: 0x0226, + 0x00610307: 0x0227, + 0x00450327: 0x0228, + 0x00650327: 0x0229, + 0x00D60304: 0x022A, + 0x00F60304: 0x022B, + 0x00D50304: 0x022C, + 0x00F50304: 0x022D, + 0x004F0307: 0x022E, + 0x006F0307: 0x022F, + 0x022E0304: 0x0230, + 0x022F0304: 0x0231, + 0x00590304: 0x0232, + 0x00790304: 0x0233, + 0x00A80301: 0x0385, + 0x03910301: 0x0386, + 0x03950301: 0x0388, + 0x03970301: 0x0389, + 0x03990301: 0x038A, + 0x039F0301: 0x038C, + 0x03A50301: 0x038E, + 0x03A90301: 0x038F, + 0x03CA0301: 0x0390, + 0x03990308: 0x03AA, + 0x03A50308: 0x03AB, + 0x03B10301: 0x03AC, + 0x03B50301: 0x03AD, + 0x03B70301: 0x03AE, + 0x03B90301: 0x03AF, + 0x03CB0301: 0x03B0, + 0x03B90308: 0x03CA, + 0x03C50308: 0x03CB, + 0x03BF0301: 0x03CC, + 0x03C50301: 0x03CD, + 0x03C90301: 0x03CE, + 0x03D20301: 0x03D3, + 0x03D20308: 0x03D4, + 0x04150300: 0x0400, + 0x04150308: 0x0401, + 0x04130301: 0x0403, + 0x04060308: 0x0407, + 0x041A0301: 0x040C, + 0x04180300: 0x040D, + 0x04230306: 0x040E, + 0x04180306: 0x0419, + 0x04380306: 0x0439, + 0x04350300: 0x0450, + 0x04350308: 0x0451, + 0x04330301: 0x0453, + 0x04560308: 0x0457, + 0x043A0301: 0x045C, + 0x04380300: 0x045D, + 0x04430306: 0x045E, + 0x0474030F: 0x0476, + 0x0475030F: 0x0477, + 0x04160306: 0x04C1, + 0x04360306: 0x04C2, + 0x04100306: 0x04D0, + 0x04300306: 0x04D1, + 0x04100308: 0x04D2, + 0x04300308: 0x04D3, + 0x04150306: 0x04D6, + 0x04350306: 0x04D7, + 0x04D80308: 0x04DA, + 0x04D90308: 0x04DB, + 0x04160308: 0x04DC, + 0x04360308: 0x04DD, + 0x04170308: 0x04DE, + 0x04370308: 0x04DF, + 0x04180304: 0x04E2, + 0x04380304: 0x04E3, + 0x04180308: 0x04E4, + 0x04380308: 0x04E5, + 0x041E0308: 0x04E6, + 0x043E0308: 0x04E7, + 0x04E80308: 0x04EA, + 0x04E90308: 0x04EB, + 0x042D0308: 0x04EC, + 0x044D0308: 0x04ED, + 0x04230304: 0x04EE, + 0x04430304: 0x04EF, + 0x04230308: 0x04F0, + 0x04430308: 0x04F1, + 0x0423030B: 0x04F2, + 0x0443030B: 0x04F3, + 0x04270308: 0x04F4, + 0x04470308: 0x04F5, + 0x042B0308: 0x04F8, + 0x044B0308: 0x04F9, + 0x06270653: 0x0622, + 0x06270654: 0x0623, + 0x06480654: 0x0624, + 0x06270655: 0x0625, + 0x064A0654: 0x0626, + 0x06D50654: 0x06C0, + 0x06C10654: 0x06C2, + 0x06D20654: 0x06D3, + 0x0928093C: 0x0929, + 0x0930093C: 0x0931, + 0x0933093C: 0x0934, + 0x09C709BE: 0x09CB, + 0x09C709D7: 0x09CC, + 0x0B470B56: 0x0B48, + 0x0B470B3E: 0x0B4B, + 0x0B470B57: 0x0B4C, + 0x0B920BD7: 0x0B94, + 0x0BC60BBE: 0x0BCA, + 0x0BC70BBE: 0x0BCB, + 0x0BC60BD7: 0x0BCC, + 0x0C460C56: 0x0C48, + 0x0CBF0CD5: 0x0CC0, + 0x0CC60CD5: 0x0CC7, + 0x0CC60CD6: 0x0CC8, + 0x0CC60CC2: 0x0CCA, + 0x0CCA0CD5: 0x0CCB, + 0x0D460D3E: 0x0D4A, + 0x0D470D3E: 0x0D4B, + 0x0D460D57: 0x0D4C, + 0x0DD90DCA: 0x0DDA, + 0x0DD90DCF: 0x0DDC, + 0x0DDC0DCA: 0x0DDD, + 0x0DD90DDF: 0x0DDE, + 0x1025102E: 0x1026, + 0x1B051B35: 0x1B06, + 0x1B071B35: 0x1B08, + 0x1B091B35: 0x1B0A, + 0x1B0B1B35: 0x1B0C, + 0x1B0D1B35: 0x1B0E, + 0x1B111B35: 0x1B12, + 0x1B3A1B35: 0x1B3B, + 0x1B3C1B35: 0x1B3D, + 0x1B3E1B35: 0x1B40, + 0x1B3F1B35: 0x1B41, + 0x1B421B35: 0x1B43, + 0x00410325: 0x1E00, + 0x00610325: 0x1E01, + 0x00420307: 0x1E02, + 0x00620307: 0x1E03, + 0x00420323: 0x1E04, + 0x00620323: 0x1E05, + 0x00420331: 0x1E06, + 0x00620331: 0x1E07, + 0x00C70301: 0x1E08, + 0x00E70301: 0x1E09, + 0x00440307: 0x1E0A, + 0x00640307: 0x1E0B, + 0x00440323: 0x1E0C, + 0x00640323: 0x1E0D, + 0x00440331: 0x1E0E, + 0x00640331: 0x1E0F, + 0x00440327: 0x1E10, + 0x00640327: 0x1E11, + 0x0044032D: 0x1E12, + 0x0064032D: 0x1E13, + 0x01120300: 0x1E14, + 0x01130300: 0x1E15, + 0x01120301: 0x1E16, + 0x01130301: 0x1E17, + 0x0045032D: 0x1E18, + 0x0065032D: 0x1E19, + 0x00450330: 0x1E1A, + 0x00650330: 0x1E1B, + 0x02280306: 0x1E1C, + 0x02290306: 0x1E1D, + 0x00460307: 0x1E1E, + 0x00660307: 0x1E1F, + 0x00470304: 0x1E20, + 0x00670304: 0x1E21, + 0x00480307: 0x1E22, + 0x00680307: 0x1E23, + 0x00480323: 0x1E24, + 0x00680323: 0x1E25, + 0x00480308: 0x1E26, + 0x00680308: 0x1E27, + 0x00480327: 0x1E28, + 0x00680327: 0x1E29, + 0x0048032E: 0x1E2A, + 0x0068032E: 0x1E2B, + 0x00490330: 0x1E2C, + 0x00690330: 0x1E2D, + 0x00CF0301: 0x1E2E, + 0x00EF0301: 0x1E2F, + 0x004B0301: 0x1E30, + 0x006B0301: 0x1E31, + 0x004B0323: 0x1E32, + 0x006B0323: 0x1E33, + 0x004B0331: 0x1E34, + 0x006B0331: 0x1E35, + 0x004C0323: 0x1E36, + 0x006C0323: 0x1E37, + 0x1E360304: 0x1E38, + 0x1E370304: 0x1E39, + 0x004C0331: 0x1E3A, + 0x006C0331: 0x1E3B, + 0x004C032D: 0x1E3C, + 0x006C032D: 0x1E3D, + 0x004D0301: 0x1E3E, + 0x006D0301: 0x1E3F, + 0x004D0307: 0x1E40, + 0x006D0307: 0x1E41, + 0x004D0323: 0x1E42, + 0x006D0323: 0x1E43, + 0x004E0307: 0x1E44, + 0x006E0307: 0x1E45, + 0x004E0323: 0x1E46, + 0x006E0323: 0x1E47, + 0x004E0331: 0x1E48, + 0x006E0331: 0x1E49, + 0x004E032D: 0x1E4A, + 0x006E032D: 0x1E4B, + 0x00D50301: 0x1E4C, + 0x00F50301: 0x1E4D, + 0x00D50308: 0x1E4E, + 0x00F50308: 0x1E4F, + 0x014C0300: 0x1E50, + 0x014D0300: 0x1E51, + 0x014C0301: 0x1E52, + 0x014D0301: 0x1E53, + 0x00500301: 0x1E54, + 0x00700301: 0x1E55, + 0x00500307: 0x1E56, + 0x00700307: 0x1E57, + 0x00520307: 0x1E58, + 0x00720307: 0x1E59, + 0x00520323: 0x1E5A, + 0x00720323: 0x1E5B, + 0x1E5A0304: 0x1E5C, + 0x1E5B0304: 0x1E5D, + 0x00520331: 0x1E5E, + 0x00720331: 0x1E5F, + 0x00530307: 0x1E60, + 0x00730307: 0x1E61, + 0x00530323: 0x1E62, + 0x00730323: 0x1E63, + 0x015A0307: 0x1E64, + 0x015B0307: 0x1E65, + 0x01600307: 0x1E66, + 0x01610307: 0x1E67, + 0x1E620307: 0x1E68, + 0x1E630307: 0x1E69, + 0x00540307: 0x1E6A, + 0x00740307: 0x1E6B, + 0x00540323: 0x1E6C, + 0x00740323: 0x1E6D, + 0x00540331: 0x1E6E, + 0x00740331: 0x1E6F, + 0x0054032D: 0x1E70, + 0x0074032D: 0x1E71, + 0x00550324: 0x1E72, + 0x00750324: 0x1E73, + 0x00550330: 0x1E74, + 0x00750330: 0x1E75, + 0x0055032D: 0x1E76, + 0x0075032D: 0x1E77, + 0x01680301: 0x1E78, + 0x01690301: 0x1E79, + 0x016A0308: 0x1E7A, + 0x016B0308: 0x1E7B, + 0x00560303: 0x1E7C, + 0x00760303: 0x1E7D, + 0x00560323: 0x1E7E, + 0x00760323: 0x1E7F, + 0x00570300: 0x1E80, + 0x00770300: 0x1E81, + 0x00570301: 0x1E82, + 0x00770301: 0x1E83, + 0x00570308: 0x1E84, + 0x00770308: 0x1E85, + 0x00570307: 0x1E86, + 0x00770307: 0x1E87, + 0x00570323: 0x1E88, + 0x00770323: 0x1E89, + 0x00580307: 0x1E8A, + 0x00780307: 0x1E8B, + 0x00580308: 0x1E8C, + 0x00780308: 0x1E8D, + 0x00590307: 0x1E8E, + 0x00790307: 0x1E8F, + 0x005A0302: 0x1E90, + 0x007A0302: 0x1E91, + 0x005A0323: 0x1E92, + 0x007A0323: 0x1E93, + 0x005A0331: 0x1E94, + 0x007A0331: 0x1E95, + 0x00680331: 0x1E96, + 0x00740308: 0x1E97, + 0x0077030A: 0x1E98, + 0x0079030A: 0x1E99, + 0x017F0307: 0x1E9B, + 0x00410323: 0x1EA0, + 0x00610323: 0x1EA1, + 0x00410309: 0x1EA2, + 0x00610309: 0x1EA3, + 0x00C20301: 0x1EA4, + 0x00E20301: 0x1EA5, + 0x00C20300: 0x1EA6, + 0x00E20300: 0x1EA7, + 0x00C20309: 0x1EA8, + 0x00E20309: 0x1EA9, + 0x00C20303: 0x1EAA, + 0x00E20303: 0x1EAB, + 0x1EA00302: 0x1EAC, + 0x1EA10302: 0x1EAD, + 0x01020301: 0x1EAE, + 0x01030301: 0x1EAF, + 0x01020300: 0x1EB0, + 0x01030300: 0x1EB1, + 0x01020309: 0x1EB2, + 0x01030309: 0x1EB3, + 0x01020303: 0x1EB4, + 0x01030303: 0x1EB5, + 0x1EA00306: 0x1EB6, + 0x1EA10306: 0x1EB7, + 0x00450323: 0x1EB8, + 0x00650323: 0x1EB9, + 0x00450309: 0x1EBA, + 0x00650309: 0x1EBB, + 0x00450303: 0x1EBC, + 0x00650303: 0x1EBD, + 0x00CA0301: 0x1EBE, + 0x00EA0301: 0x1EBF, + 0x00CA0300: 0x1EC0, + 0x00EA0300: 0x1EC1, + 0x00CA0309: 0x1EC2, + 0x00EA0309: 0x1EC3, + 0x00CA0303: 0x1EC4, + 0x00EA0303: 0x1EC5, + 0x1EB80302: 0x1EC6, + 0x1EB90302: 0x1EC7, + 0x00490309: 0x1EC8, + 0x00690309: 0x1EC9, + 0x00490323: 0x1ECA, + 0x00690323: 0x1ECB, + 0x004F0323: 0x1ECC, + 0x006F0323: 0x1ECD, + 0x004F0309: 0x1ECE, + 0x006F0309: 0x1ECF, + 0x00D40301: 0x1ED0, + 0x00F40301: 0x1ED1, + 0x00D40300: 0x1ED2, + 0x00F40300: 0x1ED3, + 0x00D40309: 0x1ED4, + 0x00F40309: 0x1ED5, + 0x00D40303: 0x1ED6, + 0x00F40303: 0x1ED7, + 0x1ECC0302: 0x1ED8, + 0x1ECD0302: 0x1ED9, + 0x01A00301: 0x1EDA, + 0x01A10301: 0x1EDB, + 0x01A00300: 0x1EDC, + 0x01A10300: 0x1EDD, + 0x01A00309: 0x1EDE, + 0x01A10309: 0x1EDF, + 0x01A00303: 0x1EE0, + 0x01A10303: 0x1EE1, + 0x01A00323: 0x1EE2, + 0x01A10323: 0x1EE3, + 0x00550323: 0x1EE4, + 0x00750323: 0x1EE5, + 0x00550309: 0x1EE6, + 0x00750309: 0x1EE7, + 0x01AF0301: 0x1EE8, + 0x01B00301: 0x1EE9, + 0x01AF0300: 0x1EEA, + 0x01B00300: 0x1EEB, + 0x01AF0309: 0x1EEC, + 0x01B00309: 0x1EED, + 0x01AF0303: 0x1EEE, + 0x01B00303: 0x1EEF, + 0x01AF0323: 0x1EF0, + 0x01B00323: 0x1EF1, + 0x00590300: 0x1EF2, + 0x00790300: 0x1EF3, + 0x00590323: 0x1EF4, + 0x00790323: 0x1EF5, + 0x00590309: 0x1EF6, + 0x00790309: 0x1EF7, + 0x00590303: 0x1EF8, + 0x00790303: 0x1EF9, + 0x03B10313: 0x1F00, + 0x03B10314: 0x1F01, + 0x1F000300: 0x1F02, + 0x1F010300: 0x1F03, + 0x1F000301: 0x1F04, + 0x1F010301: 0x1F05, + 0x1F000342: 0x1F06, + 0x1F010342: 0x1F07, + 0x03910313: 0x1F08, + 0x03910314: 0x1F09, + 0x1F080300: 0x1F0A, + 0x1F090300: 0x1F0B, + 0x1F080301: 0x1F0C, + 0x1F090301: 0x1F0D, + 0x1F080342: 0x1F0E, + 0x1F090342: 0x1F0F, + 0x03B50313: 0x1F10, + 0x03B50314: 0x1F11, + 0x1F100300: 0x1F12, + 0x1F110300: 0x1F13, + 0x1F100301: 0x1F14, + 0x1F110301: 0x1F15, + 0x03950313: 0x1F18, + 0x03950314: 0x1F19, + 0x1F180300: 0x1F1A, + 0x1F190300: 0x1F1B, + 0x1F180301: 0x1F1C, + 0x1F190301: 0x1F1D, + 0x03B70313: 0x1F20, + 0x03B70314: 0x1F21, + 0x1F200300: 0x1F22, + 0x1F210300: 0x1F23, + 0x1F200301: 0x1F24, + 0x1F210301: 0x1F25, + 0x1F200342: 0x1F26, + 0x1F210342: 0x1F27, + 0x03970313: 0x1F28, + 0x03970314: 0x1F29, + 0x1F280300: 0x1F2A, + 0x1F290300: 0x1F2B, + 0x1F280301: 0x1F2C, + 0x1F290301: 0x1F2D, + 0x1F280342: 0x1F2E, + 0x1F290342: 0x1F2F, + 0x03B90313: 0x1F30, + 0x03B90314: 0x1F31, + 0x1F300300: 0x1F32, + 0x1F310300: 0x1F33, + 0x1F300301: 0x1F34, + 0x1F310301: 0x1F35, + 0x1F300342: 0x1F36, + 0x1F310342: 0x1F37, + 0x03990313: 0x1F38, + 0x03990314: 0x1F39, + 0x1F380300: 0x1F3A, + 0x1F390300: 0x1F3B, + 0x1F380301: 0x1F3C, + 0x1F390301: 0x1F3D, + 0x1F380342: 0x1F3E, + 0x1F390342: 0x1F3F, + 0x03BF0313: 0x1F40, + 0x03BF0314: 0x1F41, + 0x1F400300: 0x1F42, + 0x1F410300: 0x1F43, + 0x1F400301: 0x1F44, + 0x1F410301: 0x1F45, + 0x039F0313: 0x1F48, + 0x039F0314: 0x1F49, + 0x1F480300: 0x1F4A, + 0x1F490300: 0x1F4B, + 0x1F480301: 0x1F4C, + 0x1F490301: 0x1F4D, + 0x03C50313: 0x1F50, + 0x03C50314: 0x1F51, + 0x1F500300: 0x1F52, + 0x1F510300: 0x1F53, + 0x1F500301: 0x1F54, + 0x1F510301: 0x1F55, + 0x1F500342: 0x1F56, + 0x1F510342: 0x1F57, + 0x03A50314: 0x1F59, + 0x1F590300: 0x1F5B, + 0x1F590301: 0x1F5D, + 0x1F590342: 0x1F5F, + 0x03C90313: 0x1F60, + 0x03C90314: 0x1F61, + 0x1F600300: 0x1F62, + 0x1F610300: 0x1F63, + 0x1F600301: 0x1F64, + 0x1F610301: 0x1F65, + 0x1F600342: 0x1F66, + 0x1F610342: 0x1F67, + 0x03A90313: 0x1F68, + 0x03A90314: 0x1F69, + 0x1F680300: 0x1F6A, + 0x1F690300: 0x1F6B, + 0x1F680301: 0x1F6C, + 0x1F690301: 0x1F6D, + 0x1F680342: 0x1F6E, + 0x1F690342: 0x1F6F, + 0x03B10300: 0x1F70, + 0x03B50300: 0x1F72, + 0x03B70300: 0x1F74, + 0x03B90300: 0x1F76, + 0x03BF0300: 0x1F78, + 0x03C50300: 0x1F7A, + 0x03C90300: 0x1F7C, + 0x1F000345: 0x1F80, + 0x1F010345: 0x1F81, + 0x1F020345: 0x1F82, + 0x1F030345: 0x1F83, + 0x1F040345: 0x1F84, + 0x1F050345: 0x1F85, + 0x1F060345: 0x1F86, + 0x1F070345: 0x1F87, + 0x1F080345: 0x1F88, + 0x1F090345: 0x1F89, + 0x1F0A0345: 0x1F8A, + 0x1F0B0345: 0x1F8B, + 0x1F0C0345: 0x1F8C, + 0x1F0D0345: 0x1F8D, + 0x1F0E0345: 0x1F8E, + 0x1F0F0345: 0x1F8F, + 0x1F200345: 0x1F90, + 0x1F210345: 0x1F91, + 0x1F220345: 0x1F92, + 0x1F230345: 0x1F93, + 0x1F240345: 0x1F94, + 0x1F250345: 0x1F95, + 0x1F260345: 0x1F96, + 0x1F270345: 0x1F97, + 0x1F280345: 0x1F98, + 0x1F290345: 0x1F99, + 0x1F2A0345: 0x1F9A, + 0x1F2B0345: 0x1F9B, + 0x1F2C0345: 0x1F9C, + 0x1F2D0345: 0x1F9D, + 0x1F2E0345: 0x1F9E, + 0x1F2F0345: 0x1F9F, + 0x1F600345: 0x1FA0, + 0x1F610345: 0x1FA1, + 0x1F620345: 0x1FA2, + 0x1F630345: 0x1FA3, + 0x1F640345: 0x1FA4, + 0x1F650345: 0x1FA5, + 0x1F660345: 0x1FA6, + 0x1F670345: 0x1FA7, + 0x1F680345: 0x1FA8, + 0x1F690345: 0x1FA9, + 0x1F6A0345: 0x1FAA, + 0x1F6B0345: 0x1FAB, + 0x1F6C0345: 0x1FAC, + 0x1F6D0345: 0x1FAD, + 0x1F6E0345: 0x1FAE, + 0x1F6F0345: 0x1FAF, + 0x03B10306: 0x1FB0, + 0x03B10304: 0x1FB1, + 0x1F700345: 0x1FB2, + 0x03B10345: 0x1FB3, + 0x03AC0345: 0x1FB4, + 0x03B10342: 0x1FB6, + 0x1FB60345: 0x1FB7, + 0x03910306: 0x1FB8, + 0x03910304: 0x1FB9, + 0x03910300: 0x1FBA, + 0x03910345: 0x1FBC, + 0x00A80342: 0x1FC1, + 0x1F740345: 0x1FC2, + 0x03B70345: 0x1FC3, + 0x03AE0345: 0x1FC4, + 0x03B70342: 0x1FC6, + 0x1FC60345: 0x1FC7, + 0x03950300: 0x1FC8, + 0x03970300: 0x1FCA, + 0x03970345: 0x1FCC, + 0x1FBF0300: 0x1FCD, + 0x1FBF0301: 0x1FCE, + 0x1FBF0342: 0x1FCF, + 0x03B90306: 0x1FD0, + 0x03B90304: 0x1FD1, + 0x03CA0300: 0x1FD2, + 0x03B90342: 0x1FD6, + 0x03CA0342: 0x1FD7, + 0x03990306: 0x1FD8, + 0x03990304: 0x1FD9, + 0x03990300: 0x1FDA, + 0x1FFE0300: 0x1FDD, + 0x1FFE0301: 0x1FDE, + 0x1FFE0342: 0x1FDF, + 0x03C50306: 0x1FE0, + 0x03C50304: 0x1FE1, + 0x03CB0300: 0x1FE2, + 0x03C10313: 0x1FE4, + 0x03C10314: 0x1FE5, + 0x03C50342: 0x1FE6, + 0x03CB0342: 0x1FE7, + 0x03A50306: 0x1FE8, + 0x03A50304: 0x1FE9, + 0x03A50300: 0x1FEA, + 0x03A10314: 0x1FEC, + 0x00A80300: 0x1FED, + 0x1F7C0345: 0x1FF2, + 0x03C90345: 0x1FF3, + 0x03CE0345: 0x1FF4, + 0x03C90342: 0x1FF6, + 0x1FF60345: 0x1FF7, + 0x039F0300: 0x1FF8, + 0x03A90300: 0x1FFA, + 0x03A90345: 0x1FFC, + 0x21900338: 0x219A, + 0x21920338: 0x219B, + 0x21940338: 0x21AE, + 0x21D00338: 0x21CD, + 0x21D40338: 0x21CE, + 0x21D20338: 0x21CF, + 0x22030338: 0x2204, + 0x22080338: 0x2209, + 0x220B0338: 0x220C, + 0x22230338: 0x2224, + 0x22250338: 0x2226, + 0x223C0338: 0x2241, + 0x22430338: 0x2244, + 0x22450338: 0x2247, + 0x22480338: 0x2249, + 0x003D0338: 0x2260, + 0x22610338: 0x2262, + 0x224D0338: 0x226D, + 0x003C0338: 0x226E, + 0x003E0338: 0x226F, + 0x22640338: 0x2270, + 0x22650338: 0x2271, + 0x22720338: 0x2274, + 0x22730338: 0x2275, + 0x22760338: 0x2278, + 0x22770338: 0x2279, + 0x227A0338: 0x2280, + 0x227B0338: 0x2281, + 0x22820338: 0x2284, + 0x22830338: 0x2285, + 0x22860338: 0x2288, + 0x22870338: 0x2289, + 0x22A20338: 0x22AC, + 0x22A80338: 0x22AD, + 0x22A90338: 0x22AE, + 0x22AB0338: 0x22AF, + 0x227C0338: 0x22E0, + 0x227D0338: 0x22E1, + 0x22910338: 0x22E2, + 0x22920338: 0x22E3, + 0x22B20338: 0x22EA, + 0x22B30338: 0x22EB, + 0x22B40338: 0x22EC, + 0x22B50338: 0x22ED, + 0x304B3099: 0x304C, + 0x304D3099: 0x304E, + 0x304F3099: 0x3050, + 0x30513099: 0x3052, + 0x30533099: 0x3054, + 0x30553099: 0x3056, + 0x30573099: 0x3058, + 0x30593099: 0x305A, + 0x305B3099: 0x305C, + 0x305D3099: 0x305E, + 0x305F3099: 0x3060, + 0x30613099: 0x3062, + 0x30643099: 0x3065, + 0x30663099: 0x3067, + 0x30683099: 0x3069, + 0x306F3099: 0x3070, + 0x306F309A: 0x3071, + 0x30723099: 0x3073, + 0x3072309A: 0x3074, + 0x30753099: 0x3076, + 0x3075309A: 0x3077, + 0x30783099: 0x3079, + 0x3078309A: 0x307A, + 0x307B3099: 0x307C, + 0x307B309A: 0x307D, + 0x30463099: 0x3094, + 0x309D3099: 0x309E, + 0x30AB3099: 0x30AC, + 0x30AD3099: 0x30AE, + 0x30AF3099: 0x30B0, + 0x30B13099: 0x30B2, + 0x30B33099: 0x30B4, + 0x30B53099: 0x30B6, + 0x30B73099: 0x30B8, + 0x30B93099: 0x30BA, + 0x30BB3099: 0x30BC, + 0x30BD3099: 0x30BE, + 0x30BF3099: 0x30C0, + 0x30C13099: 0x30C2, + 0x30C43099: 0x30C5, + 0x30C63099: 0x30C7, + 0x30C83099: 0x30C9, + 0x30CF3099: 0x30D0, + 0x30CF309A: 0x30D1, + 0x30D23099: 0x30D3, + 0x30D2309A: 0x30D4, + 0x30D53099: 0x30D6, + 0x30D5309A: 0x30D7, + 0x30D83099: 0x30D9, + 0x30D8309A: 0x30DA, + 0x30DB3099: 0x30DC, + 0x30DB309A: 0x30DD, + 0x30A63099: 0x30F4, + 0x30EF3099: 0x30F7, + 0x30F03099: 0x30F8, + 0x30F13099: 0x30F9, + 0x30F23099: 0x30FA, + 0x30FD3099: 0x30FE, + 0x109910BA: 0x1109A, + 0x109B10BA: 0x1109C, + 0x10A510BA: 0x110AB, + 0x11311127: 0x1112E, + 0x11321127: 0x1112F, + 0x1347133E: 0x1134B, + 0x13471357: 0x1134C, + 0x14B914BA: 0x114BB, + 0x14B914B0: 0x114BC, + 0x14B914BD: 0x114BE, + 0x15B815AF: 0x115BA, + 0x15B915AF: 0x115BB, +} + +// Total size of tables: 53KB (54006 bytes) diff --git a/vendor/golang.org/x/text/unicode/norm/transform.go b/vendor/golang.org/x/text/unicode/norm/transform.go new file mode 100644 index 0000000..8589067 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/transform.go @@ -0,0 +1,88 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +import ( + "unicode/utf8" + + "golang.org/x/text/transform" +) + +// Reset implements the Reset method of the transform.Transformer interface. +func (Form) Reset() {} + +// Transform implements the Transform method of the transform.Transformer +// interface. It may need to write segments of up to MaxSegmentSize at once. +// Users should either catch ErrShortDst and allow dst to grow or have dst be at +// least of size MaxTransformChunkSize to be guaranteed of progress. +func (f Form) Transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { + n := 0 + // Cap the maximum number of src bytes to check. + b := src + eof := atEOF + if ns := len(dst); ns < len(b) { + err = transform.ErrShortDst + eof = false + b = b[:ns] + } + i, ok := formTable[f].quickSpan(inputBytes(b), n, len(b), eof) + n += copy(dst[n:], b[n:i]) + if !ok { + nDst, nSrc, err = f.transform(dst[n:], src[n:], atEOF) + return nDst + n, nSrc + n, err + } + if n < len(src) && !atEOF { + err = transform.ErrShortSrc + } + return n, n, err +} + +func flushTransform(rb *reorderBuffer) bool { + // Write out (must fully fit in dst, or else it is a ErrShortDst). + if len(rb.out) < rb.nrune*utf8.UTFMax { + return false + } + rb.out = rb.out[rb.flushCopy(rb.out):] + return true +} + +var errs = []error{nil, transform.ErrShortDst, transform.ErrShortSrc} + +// transform implements the transform.Transformer interface. It is only called +// when quickSpan does not pass for a given string. +func (f Form) transform(dst, src []byte, atEOF bool) (nDst, nSrc int, err error) { + // TODO: get rid of reorderBuffer. See CL 23460044. + rb := reorderBuffer{} + rb.init(f, src) + for { + // Load segment into reorder buffer. + rb.setFlusher(dst[nDst:], flushTransform) + end := decomposeSegment(&rb, nSrc, atEOF) + if end < 0 { + return nDst, nSrc, errs[-end] + } + nDst = len(dst) - len(rb.out) + nSrc = end + + // Next quickSpan. + end = rb.nsrc + eof := atEOF + if n := nSrc + len(dst) - nDst; n < end { + err = transform.ErrShortDst + end = n + eof = false + } + end, ok := rb.f.quickSpan(rb.src, nSrc, end, eof) + n := copy(dst[nDst:], rb.src.bytes[nSrc:end]) + nSrc += n + nDst += n + if ok { + if n < rb.nsrc && !atEOF { + err = transform.ErrShortSrc + } + return nDst, nSrc, err + } + } +} diff --git a/vendor/golang.org/x/text/unicode/norm/trie.go b/vendor/golang.org/x/text/unicode/norm/trie.go new file mode 100644 index 0000000..423386b --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/trie.go @@ -0,0 +1,54 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package norm + +type valueRange struct { + value uint16 // header: value:stride + lo, hi byte // header: lo:n +} + +type sparseBlocks struct { + values []valueRange + offset []uint16 +} + +var nfcSparse = sparseBlocks{ + values: nfcSparseValues[:], + offset: nfcSparseOffset[:], +} + +var nfkcSparse = sparseBlocks{ + values: nfkcSparseValues[:], + offset: nfkcSparseOffset[:], +} + +var ( + nfcData = newNfcTrie(0) + nfkcData = newNfkcTrie(0) +) + +// lookupValue determines the type of block n and looks up the value for b. +// For n < t.cutoff, the block is a simple lookup table. Otherwise, the block +// is a list of ranges with an accompanying value. Given a matching range r, +// the value for b is by r.value + (b - r.lo) * stride. +func (t *sparseBlocks) lookup(n uint32, b byte) uint16 { + offset := t.offset[n] + header := t.values[offset] + lo := offset + 1 + hi := lo + uint16(header.lo) + for lo < hi { + m := lo + (hi-lo)/2 + r := t.values[m] + if r.lo <= b && b <= r.hi { + return r.value + uint16(b-r.lo)*header.value + } + if b < r.lo { + hi = m + } else { + lo = m + 1 + } + } + return 0 +} diff --git a/vendor/golang.org/x/text/unicode/norm/triegen.go b/vendor/golang.org/x/text/unicode/norm/triegen.go new file mode 100644 index 0000000..45d7119 --- /dev/null +++ b/vendor/golang.org/x/text/unicode/norm/triegen.go @@ -0,0 +1,117 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ignore + +// Trie table generator. +// Used by make*tables tools to generate a go file with trie data structures +// for mapping UTF-8 to a 16-bit value. All but the last byte in a UTF-8 byte +// sequence are used to lookup offsets in the index table to be used for the +// next byte. The last byte is used to index into a table with 16-bit values. + +package main + +import ( + "fmt" + "io" +) + +const maxSparseEntries = 16 + +type normCompacter struct { + sparseBlocks [][]uint64 + sparseOffset []uint16 + sparseCount int + name string +} + +func mostFrequentStride(a []uint64) int { + counts := make(map[int]int) + var v int + for _, x := range a { + if stride := int(x) - v; v != 0 && stride >= 0 { + counts[stride]++ + } + v = int(x) + } + var maxs, maxc int + for stride, cnt := range counts { + if cnt > maxc || (cnt == maxc && stride < maxs) { + maxs, maxc = stride, cnt + } + } + return maxs +} + +func countSparseEntries(a []uint64) int { + stride := mostFrequentStride(a) + var v, count int + for _, tv := range a { + if int(tv)-v != stride { + if tv != 0 { + count++ + } + } + v = int(tv) + } + return count +} + +func (c *normCompacter) Size(v []uint64) (sz int, ok bool) { + if n := countSparseEntries(v); n <= maxSparseEntries { + return (n+1)*4 + 2, true + } + return 0, false +} + +func (c *normCompacter) Store(v []uint64) uint32 { + h := uint32(len(c.sparseOffset)) + c.sparseBlocks = append(c.sparseBlocks, v) + c.sparseOffset = append(c.sparseOffset, uint16(c.sparseCount)) + c.sparseCount += countSparseEntries(v) + 1 + return h +} + +func (c *normCompacter) Handler() string { + return c.name + "Sparse.lookup" +} + +func (c *normCompacter) Print(w io.Writer) (retErr error) { + p := func(f string, x ...interface{}) { + if _, err := fmt.Fprintf(w, f, x...); retErr == nil && err != nil { + retErr = err + } + } + + ls := len(c.sparseBlocks) + p("// %sSparseOffset: %d entries, %d bytes\n", c.name, ls, ls*2) + p("var %sSparseOffset = %#v\n\n", c.name, c.sparseOffset) + + ns := c.sparseCount + p("// %sSparseValues: %d entries, %d bytes\n", c.name, ns, ns*4) + p("var %sSparseValues = [%d]valueRange {", c.name, ns) + for i, b := range c.sparseBlocks { + p("\n// Block %#x, offset %#x", i, c.sparseOffset[i]) + var v int + stride := mostFrequentStride(b) + n := countSparseEntries(b) + p("\n{value:%#04x,lo:%#02x},", stride, uint8(n)) + for i, nv := range b { + if int(nv)-v != stride { + if v != 0 { + p(",hi:%#02x},", 0x80+i-1) + } + if nv != 0 { + p("\n{value:%#04x,lo:%#02x", nv, 0x80+i) + } + } + v = int(nv) + } + if v != 0 { + p(",hi:%#02x},", 0x80+len(b)-1) + } + } + p("\n}\n\n") + return +} diff --git a/vendor/vendor.json b/vendor/vendor.json index 1bd7db6..5b1d3af 100644 --- a/vendor/vendor.json +++ b/vendor/vendor.json @@ -8,13 +8,6 @@ "revision": "c91e78db502ff629614837aacb7aa4efa61c651a", "revisionTime": "2016-04-30T09:49:23Z" }, - { - "checksumSHA1": "OFu4xJEIjiI8Suu+j/gabfp+y6Q=", - "origin": "github.com/stretchr/testify/vendor/github.com/davecgh/go-spew/spew", - "path": "github.com/davecgh/go-spew/spew", - "revision": "f6abca593680b2315d2075e0f5e2a9751e3f431a", - "revisionTime": "2017-06-01T20:57:54Z" - }, { "checksumSHA1": "aIhLeVAIrsjs63CwqmU3+GU8yT4=", "path": "github.com/ginuerzh/gosocks4", @@ -28,10 +21,10 @@ "revisionTime": "2017-01-19T05:34:58Z" }, { - "checksumSHA1": "+XIOnTW0rv8Kr/amkXgMraNeUr4=", + "checksumSHA1": "9e9tjPDTESeCEdUMElph250lurs=", "path": "github.com/ginuerzh/pht", - "revision": "f90acb425616767b84789d10e50a6fb652cd1e9a", - "revisionTime": "2017-02-05T06:05:58Z" + "revision": "8acf34a91f436364fadb82a630ab3c7e938e1d0f", + "revisionTime": "2017-02-05T06:52:49Z" }, { "checksumSHA1": "fBx0fqiyrl26gkGo14J9pJ8zB2Y=", @@ -40,10 +33,10 @@ "revisionTime": "2017-05-15T17:08:25Z" }, { - "checksumSHA1": "URsJa4y/sUUw/STmbeYx9EKqaYE=", + "checksumSHA1": "HmbftipkadrLlCfzzVQ+iFHbl6g=", "path": "github.com/golang/glog", - "revision": "44145f04b68cf362d9c4df2182967c2275eaefed", - "revisionTime": "2014-09-23T20:47:00Z" + "revision": "23def4e6c14b4da8ac2ed8007337bc5eb5007998", + "revisionTime": "2016-01-25T20:49:56Z" }, { "checksumSHA1": "d9PxF1XQGLMJZRct2R8qVM/eYlE=", @@ -88,10 +81,10 @@ "revisionTime": "2016-05-04T15:23:51Z" }, { - "checksumSHA1": "KF0chHPN90e/Ct/WJJYsuHKdiEM=", + "checksumSHA1": "Z/PMIFIZ3o0/HabtyLwTHKKdvb4=", "path": "github.com/lucas-clemente/quic-go", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { "checksumSHA1": "OA9E+y7g05x/mWJJHmA7oPxWKQo=", @@ -100,83 +93,76 @@ "revisionTime": "2016-08-23T09:51:56Z" }, { - "checksumSHA1": "NtA/2oLQBR72S8l43PNUug2TCog=", + "checksumSHA1": "quVHUmzDMdxO14W2xY1PizK1GME=", "path": "github.com/lucas-clemente/quic-go/ackhandler", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "8zoU6uLKP2Czs96VgmNMubNcWKk=", + "checksumSHA1": "bHgFCrGrrdQLBrDN/iwhWnTY5c8=", "path": "github.com/lucas-clemente/quic-go/congestion", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "FvtYBMKar0eNDWauCofafpJ+z7w=", + "checksumSHA1": "mOdxhLhYusZpEUM4XYweq6/e7wc=", "path": "github.com/lucas-clemente/quic-go/crypto", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "qeA/SEEEJISmxMiT7wVH87x8bYs=", + "checksumSHA1": "IjJn3XeLM+MZ0vWkl2RxK+8y7ac=", "path": "github.com/lucas-clemente/quic-go/flowcontrol", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "Uj2jJdb2wytCw/DJqmVD7wvq4BU=", + "checksumSHA1": "BvjNmqw285B/O0u9CapEiOG6nNU=", "path": "github.com/lucas-clemente/quic-go/frames", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "Q+A6dMo3fn7olbOo64BocN5Iun8=", + "checksumSHA1": "T6xXdLavEsHmF+yhvMOjKn/1RJU=", "path": "github.com/lucas-clemente/quic-go/h2quic", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "ItcGJhHoCWJVDtJagkdbtFkqIMo=", + "checksumSHA1": "dnDC7JMEhC/8UtQnkExChY+zIeY=", "path": "github.com/lucas-clemente/quic-go/handshake", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "5qERDU1QlAgmMVbyY/zkWTzG7Po=", + "checksumSHA1": "I106jIrBkNesQcoPrgUJ8e2JUNY=", + "path": "github.com/lucas-clemente/quic-go/internal/utils", + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" + }, + { + "checksumSHA1": "UoLAi6qeJrVxnEWxEyRs7VKLp78=", "path": "github.com/lucas-clemente/quic-go/protocol", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { - "checksumSHA1": "ss57bkTclCnmt9fVosYie/ehkoo=", + "checksumSHA1": "RaG0jfP+lFzgedW98Bfp0Uri7EY=", "path": "github.com/lucas-clemente/quic-go/qerr", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" - }, - { - "checksumSHA1": "LUpOEK8o7qCBWHt5DdPd+3QG6Y4=", - "path": "github.com/lucas-clemente/quic-go/utils", - "revision": "268841f0cc2962070a8bd662551b150acbee369b", - "revisionTime": "2017-02-04T02:12:35Z" + "revision": "811315e31a0c190e7a9e86c84102e86c9ed2a072", + "revisionTime": "2017-07-29T00:10:52Z" }, { "checksumSHA1": "ynJSWoF6v+3zMnh9R0QmmG6iGV8=", "path": "github.com/pkg/errors", - "revision": "839d9e913e063e28dfd0e6c7b7512793e0a48be9", - "revisionTime": "2016-10-02T05:25:12Z" + "revision": "248dadf4e9068a0b3e79f02ed0a610d935de5302", + "revisionTime": "2016-10-29T09:36:37Z" }, { - "checksumSHA1": "zKKp5SZ3d3ycKe4EKMNT0BqAWBw=", - "origin": "github.com/stretchr/testify/vendor/github.com/pmezard/go-difflib/difflib", - "path": "github.com/pmezard/go-difflib/difflib", - "revision": "f6abca593680b2315d2075e0f5e2a9751e3f431a", - "revisionTime": "2017-06-01T20:57:54Z" - }, - { - "checksumSHA1": "9JoAHfGuIBHqCaJSoy4LPIhcA1k=", + "checksumSHA1": "6JP37UqrI0H80Gpk0Y2P+KXgn5M=", "path": "github.com/ryanuber/go-glob", - "revision": "0067a9abd927e50aed5190662702f81231413ae0", - "revisionTime": "2014-06-17T17:15:57Z" + "revision": "256dc444b735e061061cf46c809487313d5b0065", + "revisionTime": "2017-01-28T01:21:29Z" }, { "checksumSHA1": "MRsfMrdZwnnCTfIzT3czcj0lb0s=", @@ -185,136 +171,154 @@ "revisionTime": "2017-01-21T20:35:16Z" }, { - "checksumSHA1": "5NBHAe3S15q3L9hOLThnMZjIZRE=", - "path": "github.com/stretchr/testify/assert", - "revision": "f6abca593680b2315d2075e0f5e2a9751e3f431a", - "revisionTime": "2017-06-01T20:57:54Z" - }, - { - "checksumSHA1": "JsJdKXhz87gWenMwBeejTOeNE7k=", + "checksumSHA1": "oVPHWesOmZ02vLq2fglGvf+AMgk=", "path": "golang.org/x/crypto/blowfish", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { "checksumSHA1": "TT1rac6kpQp2vz24m5yDGUNQ/QQ=", "path": "golang.org/x/crypto/cast5", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "C1KKOxFoW7/W/NFNpiXK+boguNo=", + "checksumSHA1": "MlEHIE/60sB86Lmf0MPTIXHzKzE=", "path": "golang.org/x/crypto/curve25519", - "revision": "453249f01cfeb54c3d549ddb75ff152ca243f9d8", - "revisionTime": "2017-02-08T20:51:15Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "wGb//LjBPNxYHqk+dcLo7BjPXK8=", + "checksumSHA1": "i3dNaI+oCYeDGIsNj7LwecTsIAs=", "path": "golang.org/x/crypto/ed25519", - "revision": "453249f01cfeb54c3d549ddb75ff152ca243f9d8", - "revisionTime": "2017-02-08T20:51:15Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { "checksumSHA1": "LXFcVx8I587SnWmKycSDEq9yvK8=", "path": "golang.org/x/crypto/ed25519/internal/edwards25519", - "revision": "453249f01cfeb54c3d549ddb75ff152ca243f9d8", - "revisionTime": "2017-02-08T20:51:15Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { "checksumSHA1": "4D8hxMIaSDEW5pCQk22Xj4DcDh4=", "path": "golang.org/x/crypto/hkdf", - "revision": "453249f01cfeb54c3d549ddb75ff152ca243f9d8", - "revisionTime": "2017-02-08T20:51:15Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { "checksumSHA1": "1MGpGDQqnUoRpv7VEcQrXOBydXE=", "path": "golang.org/x/crypto/pbkdf2", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "o5QDZYQhyiEt2jg1Fot34mR1rBg=", + "checksumSHA1": "qsacnnq6zmaoRpDJeTX2YDpIo6U=", "path": "golang.org/x/crypto/salsa20", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "w8PESKJweP+BCAxCYPU1QC08qUU=", + "checksumSHA1": "RUr1Owi1/hTpuAqKeeus6YuEyz8=", "path": "golang.org/x/crypto/salsa20/salsa", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "fsrFs762jlaILyqqQImS1GfvIvw=", + "checksumSHA1": "+cJ5DMdWg6q//21EKgxcaQ5vZaI=", "path": "golang.org/x/crypto/ssh", - "revision": "453249f01cfeb54c3d549ddb75ff152ca243f9d8", - "revisionTime": "2017-02-08T20:51:15Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { "checksumSHA1": "Iwv89z1aXYKaB936lnsmE2NcfqA=", "path": "golang.org/x/crypto/tea", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "/qXTeb4Dp6W5qlttwaN+Yur36+A=", + "checksumSHA1": "fgKd/+IO854XgYSrwOQJ5jG8WdI=", "path": "golang.org/x/crypto/twofish", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { "checksumSHA1": "d37eTFvbbuPQcKt5vkgsx+6C4c0=", "path": "golang.org/x/crypto/xtea", - "revision": "1150b8bd09e53aea1d415621adae9bad665061a1", - "revisionTime": "2016-10-21T22:59:10Z" + "revision": "558b6879de74bc843225cde5686419267ff707ca", + "revisionTime": "2017-07-28T12:36:07Z" }, { - "checksumSHA1": "tK8eFmQ0JeKpR3P0TjiGobzlIh0=", + "checksumSHA1": "9Pcc1IiRqPxEcxU2KMpkrcEGb3k=", "path": "golang.org/x/net/bpf", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { - "checksumSHA1": "N1akwAdrHVfPPrsFOhG2ouP21VA=", + "checksumSHA1": "Wl71V4Lh2iajiRnVAMPtd276vTg=", "path": "golang.org/x/net/http2", - "revision": "60c41d1de8da134c05b7b40154a9a82bf5b7edb9", - "revisionTime": "2017-01-10T03:16:11Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { - "checksumSHA1": "HzuGD7AwgC0p1az1WAQnEFnEk98=", + "checksumSHA1": "4n0osCZJbirWKtbcyAg+Mb5PQ0k=", "path": "golang.org/x/net/http2/hpack", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { - "checksumSHA1": "GIGmSrYACByf5JDIP9ByBZksY80=", + "checksumSHA1": "VrzPJyWI6disCgYuVEQzkjqUsJk=", "path": "golang.org/x/net/idna", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { - "checksumSHA1": "yRuyntx9a59ugMi5NlN4ST0XRcI=", + "checksumSHA1": "ph4zMZHCWvSjVOZwoxbks+nG0/M=", "path": "golang.org/x/net/internal/iana", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { - "checksumSHA1": "LVY0kRV5iwxDS3XQaBWxdzPemyc=", + "checksumSHA1": "5IbL5aAZfu+FMhrkv1soqQejTr4=", "path": "golang.org/x/net/internal/netreflect", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { - "checksumSHA1": "yzxKtJnG6O34n0gsbnoceGhASdQ=", + "checksumSHA1": "DVuL0YTpk4E8bRxkr2KXgzoCxw8=", "path": "golang.org/x/net/ipv4", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" }, { "checksumSHA1": "3xyuaSNmClqG4YWC7g0isQIbUTc=", "path": "golang.org/x/net/lex/httplex", - "revision": "65dfc08770ce66f74becfdff5f8ab01caef4e946", - "revisionTime": "2016-10-24T22:38:16Z" + "revision": "84f0e6f92b10139f986b1756e149a7d9de270cdc", + "revisionTime": "2017-05-12T21:27:43Z" + }, + { + "checksumSHA1": "faFDXp++cLjLBlvsr+izZ+go1WU=", + "path": "golang.org/x/text/secure/bidirule", + "revision": "19e51611da83d6be54ddafce4a4af510cb3e9ea4", + "revisionTime": "2017-04-21T08:09:44Z" + }, + { + "checksumSHA1": "ziMb9+ANGRJSSIuxYdRbA+cDRBQ=", + "path": "golang.org/x/text/transform", + "revision": "19e51611da83d6be54ddafce4a4af510cb3e9ea4", + "revisionTime": "2017-04-21T08:09:44Z" + }, + { + "checksumSHA1": "KG+XZAbxdkpBm3Fa3bJ3Ylq8CKI=", + "path": "golang.org/x/text/unicode/bidi", + "revision": "19e51611da83d6be54ddafce4a4af510cb3e9ea4", + "revisionTime": "2017-04-21T08:09:44Z" + }, + { + "checksumSHA1": "Anof4bt0AU+Sa3R8Rq0KBnlpbaQ=", + "path": "golang.org/x/text/unicode/norm", + "revision": "19e51611da83d6be54ddafce4a4af510cb3e9ea4", + "revisionTime": "2017-04-21T08:09:44Z" }, { "checksumSHA1": "G/v7O8ukxRnqPUrKYmf+niQ+JNU=", @@ -323,10 +327,10 @@ "revisionTime": "2016-12-15T22:53:35Z" }, { - "checksumSHA1": "SbBORpjEg3VfPfdSrW82pa3f9Io=", + "checksumSHA1": "FJUY4FAPSimDxXpnlZM8ou26ztE=", "path": "gopkg.in/xtaci/kcp-go.v2", - "revision": "6da5044c742f24f05b00db9214b57b2ac943c9ab", - "revisionTime": "2017-01-20T08:43:10Z" + "revision": "bf95749e1be2a3f152ba0004eae0c4f47fbf1251", + "revisionTime": "2017-03-04T10:43:02Z" }, { "checksumSHA1": "EutBuLS2elfcDCMifXNMGj9farQ=",